summaryrefslogtreecommitdiff
diff options
context:
space:
mode:
authorDimitry Andric <dim@FreeBSD.org>2017-01-14 15:38:35 +0000
committerDimitry Andric <dim@FreeBSD.org>2017-01-14 15:38:35 +0000
commitd2e0a8dd949ab874c6d66f97106bd5c270e2fa7d (patch)
treee8a99a0386e8f6bece630700da5915c8a312c2d9
parentfdc82ccb3f2b23a89e7002fe8238e1422b00f96a (diff)
Notes
-rw-r--r--CMakeLists.txt5
-rw-r--r--bindings/python/clang/cindex.py145
-rw-r--r--bindings/python/tests/cindex/test_translation_unit.py8
-rw-r--r--docs/AttributeReference.rst3117
-rw-r--r--docs/ReleaseNotes.rst7
-rw-r--r--docs/UsersManual.rst579
-rw-r--r--include/clang-c/Index.h6
-rw-r--r--include/clang/AST/Decl.h4
-rw-r--r--include/clang/AST/DeclTemplate.h3
-rw-r--r--include/clang/AST/RecursiveASTVisitor.h3
-rw-r--r--include/clang/AST/StmtOpenMP.h69
-rw-r--r--include/clang/AST/TypeLoc.h28
-rw-r--r--include/clang/Basic/AttrDocs.td1
-rw-r--r--include/clang/Basic/DiagnosticSemaKinds.td4
-rw-r--r--include/clang/Basic/OpenMPKinds.def35
-rw-r--r--include/clang/Basic/StmtNodes.td1
-rw-r--r--include/clang/Driver/CLCompatOptions.td7
-rw-r--r--include/clang/Driver/Options.td1
-rw-r--r--include/clang/Index/IndexSymbol.h8
-rw-r--r--include/clang/Lex/HeaderSearch.h3
-rw-r--r--include/clang/Lex/ModuleMap.h8
-rw-r--r--include/clang/Parse/Parser.h7
-rw-r--r--include/clang/Sema/Sema.h20
-rw-r--r--include/clang/Serialization/ASTBitCodes.h1
-rw-r--r--lib/AST/ASTImporter.cpp3
-rw-r--r--lib/AST/Decl.cpp12
-rw-r--r--lib/AST/DeclTemplate.cpp4
-rw-r--r--lib/AST/Expr.cpp8
-rw-r--r--lib/AST/ExprConstant.cpp13
-rw-r--r--lib/AST/StmtOpenMP.cpp56
-rw-r--r--lib/AST/StmtPrinter.cpp6
-rw-r--r--lib/AST/StmtProfile.cpp5
-rw-r--r--lib/Analysis/BodyFarm.cpp2
-rw-r--r--lib/Analysis/CFG.cpp77
-rw-r--r--lib/Analysis/ReachableCode.cpp20
-rw-r--r--lib/Basic/OpenMPKinds.cpp28
-rw-r--r--lib/Basic/Targets.cpp38
-rw-r--r--lib/Basic/Version.cpp2
-rw-r--r--lib/CodeGen/CGBuiltin.cpp10
-rw-r--r--lib/CodeGen/CGDecl.cpp4
-rw-r--r--lib/CodeGen/CGDeclCXX.cpp3
-rw-r--r--lib/CodeGen/CGOpenMPRuntime.cpp16
-rw-r--r--lib/CodeGen/CGOpenMPRuntime.h42
-rw-r--r--lib/CodeGen/CGOpenMPRuntimeNVPTX.cpp223
-rw-r--r--lib/CodeGen/CGOpenMPRuntimeNVPTX.h40
-rw-r--r--lib/CodeGen/CGStmt.cpp4
-rw-r--r--lib/CodeGen/CGStmtOpenMP.cpp10
-rw-r--r--lib/CodeGen/CodeGenFunction.h2
-rw-r--r--lib/CodeGen/CodeGenModule.cpp8
-rw-r--r--lib/CodeGen/ItaniumCXXABI.cpp42
-rw-r--r--lib/Driver/ToolChains.cpp2
-rw-r--r--lib/Driver/Tools.cpp10
-rw-r--r--lib/Format/ContinuationIndenter.cpp5
-rw-r--r--lib/Frontend/InitPreprocessor.cpp10
-rw-r--r--lib/Headers/altivec.h6
-rw-r--r--lib/Index/IndexDecl.cpp28
-rw-r--r--lib/Index/IndexSymbol.cpp18
-rw-r--r--lib/Index/IndexTypeSourceInfo.cpp20
-rw-r--r--lib/Index/IndexingContext.cpp15
-rw-r--r--lib/Index/IndexingContext.h6
-rw-r--r--lib/Lex/HeaderSearch.cpp47
-rw-r--r--lib/Lex/ModuleMap.cpp20
-rw-r--r--lib/Lex/PPDirectives.cpp1
-rw-r--r--lib/Parse/ParseDecl.cpp13
-rw-r--r--lib/Parse/ParseDeclCXX.cpp11
-rw-r--r--lib/Parse/ParseExpr.cpp2
-rw-r--r--lib/Parse/ParseExprCXX.cpp5
-rw-r--r--lib/Parse/ParseOpenMP.cpp8
-rw-r--r--lib/Parse/Parser.cpp42
-rw-r--r--lib/Sema/AnalysisBasedWarnings.cpp10
-rw-r--r--lib/Sema/SemaCoroutine.cpp13
-rw-r--r--lib/Sema/SemaDecl.cpp96
-rw-r--r--lib/Sema/SemaDeclObjC.cpp6
-rw-r--r--lib/Sema/SemaExprCXX.cpp14
-rw-r--r--lib/Sema/SemaOpenMP.cpp97
-rw-r--r--lib/Sema/SemaOverload.cpp60
-rw-r--r--lib/Sema/SemaStmt.cpp9
-rw-r--r--lib/Sema/SemaTemplate.cpp72
-rw-r--r--lib/Sema/SemaTemplateInstantiate.cpp3
-rw-r--r--lib/Sema/SemaTemplateInstantiateDecl.cpp13
-rw-r--r--lib/Sema/SemaType.cpp2
-rw-r--r--lib/Sema/TreeTransform.h13
-rw-r--r--lib/Serialization/ASTReader.cpp2
-rw-r--r--lib/Serialization/ASTReaderDecl.cpp1
-rw-r--r--lib/Serialization/ASTReaderStmt.cpp13
-rw-r--r--lib/Serialization/ASTWriter.cpp1
-rw-r--r--lib/Serialization/ASTWriterDecl.cpp2
-rw-r--r--lib/Serialization/ASTWriterStmt.cpp6
-rw-r--r--lib/StaticAnalyzer/Core/ExprEngine.cpp6
-rw-r--r--lib/StaticAnalyzer/Core/SValBuilder.cpp12
-rw-r--r--test/Analysis/initializer.cpp7
-rw-r--r--test/Analysis/pointer-to-member.cpp18
-rw-r--r--test/Analysis/properties.m26
-rw-r--r--test/CXX/basic/basic.start/basic.start.init/p2.cpp21
-rw-r--r--test/CXX/drs/dr0xx.cpp2
-rw-r--r--test/CXX/drs/dr12xx.cpp4
-rw-r--r--test/CXX/drs/dr13xx.cpp4
-rw-r--r--test/CXX/drs/dr14xx.cpp2
-rw-r--r--test/CXX/drs/dr15xx.cpp4
-rw-r--r--test/CXX/drs/dr16xx.cpp2
-rw-r--r--test/CXX/drs/dr18xx.cpp2
-rw-r--r--test/CXX/drs/dr2xx.cpp2
-rw-r--r--test/CXX/drs/dr5xx.cpp2
-rw-r--r--test/CXX/drs/dr6xx.cpp2
-rw-r--r--test/CodeGen/always_inline.c2
-rw-r--r--test/CodeGen/arm_acle.c14
-rw-r--r--test/CodeGen/builtins-arm.c2
-rw-r--r--test/CodeGen/builtins-arm64.c4
-rw-r--r--test/CodeGen/builtins-ppc-p9vector.c12
-rw-r--r--test/CodeGen/integer-overflow.c30
-rw-r--r--test/CodeGenCXX/cxx11-thread-local.cpp167
-rw-r--r--test/CodeGenCXX/dllexport.cpp20
-rw-r--r--test/CodeGenCXX/funcsig.cpp32
-rw-r--r--test/CodeGenCXX/global-array-destruction.cpp6
-rw-r--r--test/CodeGenCXX/pr31054.cpp12
-rw-r--r--test/Driver/Inputs/opensuse_42.2_aarch64_tree/usr/lib64/crt1.o0
-rw-r--r--test/Driver/Inputs/opensuse_42.2_aarch64_tree/usr/lib64/crti.o0
-rw-r--r--test/Driver/Inputs/opensuse_42.2_aarch64_tree/usr/lib64/crtn.o0
-rw-r--r--test/Driver/Inputs/opensuse_42.2_aarch64_tree/usr/lib64/gcc/aarch64-suse-linux/4.8/crtbegin.o0
-rw-r--r--test/Driver/Inputs/opensuse_42.2_aarch64_tree/usr/lib64/gcc/aarch64-suse-linux/4.8/crtend.o0
-rw-r--r--test/Driver/cl-options.c2
-rw-r--r--test/Driver/disable-llvm.c22
-rw-r--r--test/Driver/linux-ld.c20
-rw-r--r--test/Driver/x86-march.c28
-rw-r--r--test/Frontend/x86-target-cpu.c6
-rw-r--r--test/Index/Core/designated-inits.c4
-rw-r--r--test/Index/Core/index-source.cpp8
-rw-r--r--test/Index/Core/index-source.m105
-rw-r--r--test/Index/Core/index-subkinds.m8
-rw-r--r--test/Index/Core/index-with-module.m2
-rw-r--r--test/Index/index-templates.cpp6
-rw-r--r--test/Misc/ast-dump-decl.cpp1
-rw-r--r--test/Modules/Inputs/FooFramework.framework/Modules/module.modulemap12
-rw-r--r--test/Modules/Inputs/FooFramework.framework/PrivateHeaders/Bar.h2
-rw-r--r--test/Modules/Inputs/FooFramework.framework/PrivateHeaders/Baz_Private.h3
-rw-r--r--test/Modules/Inputs/FooFramework.framework/PrivateHeaders/Foo.h10
-rw-r--r--test/Modules/Inputs/FooFramework.framework/PrivateHeaders/FooUmbrella.h3
-rw-r--r--test/Modules/Inputs/PR31469/empty.h1
-rw-r--r--test/Modules/Inputs/PR31469/module.modulemap5
-rw-r--r--test/Modules/Inputs/PR31469/textual.h17
-rw-r--r--test/Modules/Inputs/PR31469/textual_file_shadow.h2
-rw-r--r--test/Modules/Inputs/import-textual/M/A/A.h4
-rw-r--r--test/Modules/Inputs/import-textual/M/B/B.h4
-rw-r--r--test/Modules/Inputs/import-textual/M/module.modulemap17
-rw-r--r--test/Modules/Inputs/import-textual/M/someheader.h6
-rw-r--r--test/Modules/Inputs/import-textual/M2/A/A.h4
-rw-r--r--test/Modules/Inputs/import-textual/M2/B/B.h4
-rw-r--r--test/Modules/Inputs/import-textual/M2/module.modulemap17
-rw-r--r--test/Modules/Inputs/import-textual/M2/someheader.h1
-rw-r--r--test/Modules/Inputs/libc-libcxx/sysroot/usr/include/c++/v1/cstddef9
-rw-r--r--test/Modules/Inputs/libc-libcxx/sysroot/usr/include/c++/v1/math.h2
-rw-r--r--test/Modules/Inputs/libc-libcxx/sysroot/usr/include/c++/v1/module.modulemap2
-rw-r--r--test/Modules/Inputs/libc-libcxx/sysroot/usr/include/c++/v1/stddef.h1
-rw-r--r--test/Modules/Inputs/libc-libcxx/sysroot/usr/include/c++/v1/type_traits6
-rw-r--r--test/Modules/Inputs/libc-libcxx/sysroot/usr/include/module.modulemap8
-rw-r--r--test/Modules/Inputs/libc-libcxx/sysroot/usr/include/stddef.h7
-rw-r--r--test/Modules/Inputs/libc-libcxx/sysroot/usr/include/sys/_types/_ptrdiff_t.h4
-rw-r--r--test/Modules/Inputs/libc-libcxx/sysroot/usr/include/sys/_types/_types.h6
-rw-r--r--test/Modules/Inputs/module-impl-with-link/foo.h1
-rw-r--r--test/Modules/Inputs/module-impl-with-link/module.modulemap4
-rw-r--r--test/Modules/builtin-import.mm12
-rw-r--r--test/Modules/cxx-templates.cpp10
-rw-r--r--test/Modules/import-textual-noguard.mm8
-rw-r--r--test/Modules/import-textual.mm10
-rw-r--r--test/Modules/module-impl-with-link.c7
-rw-r--r--test/Modules/pr31469.cpp15
-rw-r--r--test/Modules/textual-hdr-in-umbrella-hdr.m10
-rw-r--r--test/OpenMP/nesting_of_regions.cpp909
-rw-r--r--test/OpenMP/nvptx_parallel_codegen.cpp317
-rw-r--r--test/OpenMP/target_parallel_for_is_device_ptr_ast_print.cpp315
-rw-r--r--test/OpenMP/target_parallel_for_is_device_ptr_messages.cpp311
-rw-r--r--test/OpenMP/target_parallel_for_simd_is_device_ptr_ast_print.cpp318
-rw-r--r--test/OpenMP/target_parallel_for_simd_is_device_ptr_messages.cpp337
-rw-r--r--test/OpenMP/target_teams_distribute_collapse_messages.cpp29
-rw-r--r--test/OpenMP/target_teams_distribute_simd_aligned_messages.cpp231
-rw-r--r--test/OpenMP/target_teams_distribute_simd_ast_print.cpp198
-rw-r--r--test/OpenMP/target_teams_distribute_simd_collapse_messages.cpp149
-rw-r--r--test/OpenMP/target_teams_distribute_simd_defaultmap_messages.cpp58
-rw-r--r--test/OpenMP/target_teams_distribute_simd_depend_messages.cpp90
-rw-r--r--test/OpenMP/target_teams_distribute_simd_device_messages.cpp40
-rw-r--r--test/OpenMP/target_teams_distribute_simd_dist_schedule_messages.cpp84
-rw-r--r--test/OpenMP/target_teams_distribute_simd_firstprivate_messages.cpp134
-rw-r--r--test/OpenMP/target_teams_distribute_simd_if_messages.cpp101
-rw-r--r--test/OpenMP/target_teams_distribute_simd_is_device_ptr_ast_print.cpp318
-rw-r--r--test/OpenMP/target_teams_distribute_simd_is_device_ptr_messages.cpp337
-rw-r--r--test/OpenMP/target_teams_distribute_simd_lastprivate_messages.cpp233
-rw-r--r--test/OpenMP/target_teams_distribute_simd_linear_messages.cpp248
-rw-r--r--test/OpenMP/target_teams_distribute_simd_loop_messages.cpp627
-rw-r--r--test/OpenMP/target_teams_distribute_simd_map_messages.cpp281
-rw-r--r--test/OpenMP/target_teams_distribute_simd_messages.cpp93
-rw-r--r--test/OpenMP/target_teams_distribute_simd_misc_messages.c312
-rw-r--r--test/OpenMP/target_teams_distribute_simd_nowait_messages.cpp18
-rw-r--r--test/OpenMP/target_teams_distribute_simd_num_teams_messages.cpp85
-rw-r--r--test/OpenMP/target_teams_distribute_simd_private_messages.cpp127
-rw-r--r--test/OpenMP/target_teams_distribute_simd_reduction_messages.cpp241
-rw-r--r--test/OpenMP/target_teams_distribute_simd_safelen_messages.cpp133
-rw-r--r--test/OpenMP/target_teams_distribute_simd_shared_messages.cpp106
-rw-r--r--test/OpenMP/target_teams_distribute_simd_simdlen_messages.cpp133
-rw-r--r--test/OpenMP/target_teams_distribute_simd_thread_limit_messages.cpp85
-rw-r--r--test/OpenMP/threadprivate_codegen.cpp14
-rw-r--r--test/PCH/uses-seh.cpp29
-rw-r--r--test/Preprocessor/predefined-arch-macros.c82
-rw-r--r--test/Profile/gcc-flag-compatibility.c4
-rw-r--r--test/Sema/atomic-ops.c4
-rw-r--r--test/Sema/warn-unreachable.c55
-rw-r--r--test/SemaCXX/coroutines.cpp3
-rw-r--r--test/SemaCXX/cxx0x-class.cpp8
-rw-r--r--test/SemaCXX/cxx1y-variable-templates_top_level.cpp5
-rw-r--r--test/SemaCXX/diagnose_if-ext.cpp8
-rw-r--r--test/SemaCXX/uninitialized.cpp12
-rw-r--r--test/SemaCXX/warn-shadow-in-lambdas.cpp8
-rw-r--r--test/SemaCXX/warn-shadow.cpp10
-rw-r--r--test/SemaTemplate/deduction.cpp17
-rw-r--r--test/SemaTemplate/temp_arg_template.cpp6
-rw-r--r--test/SemaTemplate/temp_arg_template_cxx1z.cpp29
-rw-r--r--tools/clang-fuzzer/ClangFuzzer.cpp2
-rw-r--r--tools/libclang/CIndex.cpp9
-rw-r--r--tools/libclang/CXCursor.cpp3
-rw-r--r--unittests/AST/SourceLocationTest.cpp67
-rw-r--r--unittests/Format/FormatTest.cpp8
-rw-r--r--www/cxx_dr_status.html28
-rw-r--r--www/cxx_status.html30
-rw-r--r--www/index.html8
-rwxr-xr-xwww/make_cxx_dr_status7
224 files changed, 12944 insertions, 823 deletions
diff --git a/CMakeLists.txt b/CMakeLists.txt
index c09b75f990e5f..c56707e7fb57b 100644
--- a/CMakeLists.txt
+++ b/CMakeLists.txt
@@ -16,7 +16,8 @@ if( CMAKE_SOURCE_DIR STREQUAL CMAKE_CURRENT_SOURCE_DIR )
"--libdir"
"--includedir"
"--prefix"
- "--src-root")
+ "--src-root"
+ "--cmakedir")
execute_process(
COMMAND ${CONFIG_COMMAND}
RESULT_VARIABLE HAD_ERROR
@@ -41,6 +42,7 @@ if( CMAKE_SOURCE_DIR STREQUAL CMAKE_CURRENT_SOURCE_DIR )
list(GET CONFIG_OUTPUT 3 INCLUDE_DIR)
list(GET CONFIG_OUTPUT 4 LLVM_OBJ_ROOT)
list(GET CONFIG_OUTPUT 5 MAIN_SRC_DIR)
+ list(GET CONFIG_OUTPUT 6 LLVM_CMAKE_PATH)
if(NOT MSVC_IDE)
set(LLVM_ENABLE_ASSERTIONS ${ENABLE_ASSERTIONS}
@@ -58,7 +60,6 @@ if( CMAKE_SOURCE_DIR STREQUAL CMAKE_CURRENT_SOURCE_DIR )
find_program(LLVM_TABLEGEN_EXE "llvm-tblgen" ${LLVM_TOOLS_BINARY_DIR}
NO_DEFAULT_PATH)
- set(LLVM_CMAKE_PATH "${LLVM_BINARY_DIR}/lib${LLVM_LIBDIR_SUFFIX}/cmake/llvm")
set(LLVMCONFIG_FILE "${LLVM_CMAKE_PATH}/LLVMConfig.cmake")
if(EXISTS ${LLVMCONFIG_FILE})
list(APPEND CMAKE_MODULE_PATH "${LLVM_CMAKE_PATH}")
diff --git a/bindings/python/clang/cindex.py b/bindings/python/clang/cindex.py
index c22d2510c62cd..c1c7590fe9f32 100644
--- a/bindings/python/clang/cindex.py
+++ b/bindings/python/clang/cindex.py
@@ -64,7 +64,6 @@ call is efficient.
from ctypes import *
import collections
-import sys
import clang.enumerations
@@ -74,33 +73,6 @@ import clang.enumerations
# this by marshalling object arguments as void**.
c_object_p = POINTER(c_void_p)
-if sys.version_info[0] > 2:
-# Python 3 strings are unicode, translate them to/from utf8 for C-interop
-# Python 3 replaces xrange with range, we want xrange behaviour
- xrange = range
-
- class c_string_p(c_char_p):
- def __init__(self, p=None):
- if type(p) == str:
- p = p.encode("utf8")
- super(c_char_p, self).__init__(p)
-
- def __str__(self):
- return str(self.value)
-
- @property
- def value(self):
- if super(c_char_p, self).value is None:
- return None
- return super(c_char_p, self).value.decode("utf8")
-
- @classmethod
- def from_param(cls, param):
- return cls(param)
-else:
- c_string_p = c_char_p
-
-
callbacks = {}
### Exception Classes ###
@@ -175,7 +147,7 @@ class CachedProperty(object):
class _CXString(Structure):
"""Helper for transforming CXString results."""
- _fields_ = [("spelling", c_string_p), ("free", c_int)]
+ _fields_ = [("spelling", c_char_p), ("free", c_int)]
def __del__(self):
conf.lib.clang_disposeString(self)
@@ -357,7 +329,7 @@ class Diagnostic(object):
@property
def spelling(self):
- return str(conf.lib.clang_getDiagnosticSpelling(self))
+ return conf.lib.clang_getDiagnosticSpelling(self)
@property
def ranges(self):
@@ -386,8 +358,8 @@ class Diagnostic(object):
def __getitem__(self, key):
range = SourceRange()
- value = str(conf.lib.clang_getDiagnosticFixIt(self.diag, key,
- byref(range)))
+ value = conf.lib.clang_getDiagnosticFixIt(self.diag, key,
+ byref(range))
if len(value) == 0:
raise IndexError
@@ -420,12 +392,12 @@ class Diagnostic(object):
@property
def category_name(self):
"""The string name of the category for this diagnostic."""
- return str(conf.lib.clang_getDiagnosticCategoryText(self))
+ return conf.lib.clang_getDiagnosticCategoryText(self)
@property
def option(self):
"""The command-line option that enables this diagnostic."""
- return str(conf.lib.clang_getDiagnosticOption(self, None))
+ return conf.lib.clang_getDiagnosticOption(self, None)
@property
def disable_option(self):
@@ -433,7 +405,7 @@ class Diagnostic(object):
disable = _CXString()
conf.lib.clang_getDiagnosticOption(self, byref(disable))
- return str(conf.lib.clang_getCString(disable))
+ return conf.lib.clang_getCString(disable)
def format(self, options=None):
"""
@@ -582,8 +554,8 @@ class BaseEnumeration(object):
if value >= len(self.__class__._kinds):
self.__class__._kinds += [None] * (value - len(self.__class__._kinds) + 1)
if self.__class__._kinds[value] is not None:
- raise ValueError('{0} value {1} already loaded'.format(
- str(self.__class__), value))
+ raise ValueError,'{0} value {1} already loaded'.format(
+ str(self.__class__), value)
self.value = value
self.__class__._kinds[value] = self
self.__class__._name_map = None
@@ -600,12 +572,12 @@ class BaseEnumeration(object):
for key, value in self.__class__.__dict__.items():
if isinstance(value, self.__class__):
self._name_map[value] = key
- return str(self._name_map[self])
+ return self._name_map[self]
@classmethod
def from_id(cls, id):
if id >= len(cls._kinds) or cls._kinds[id] is None:
- raise ValueError('Unknown template argument kind %d' % id)
+ raise ValueError,'Unknown template argument kind %d' % id
return cls._kinds[id]
def __repr__(self):
@@ -624,7 +596,7 @@ class CursorKind(BaseEnumeration):
@staticmethod
def get_all_kinds():
"""Return all CursorKind enumeration instances."""
- return [x for x in CursorKind._kinds if x]
+ return filter(None, CursorKind._kinds)
def is_declaration(self):
"""Test if this is a declaration kind."""
@@ -1457,9 +1429,9 @@ class Cursor(Structure):
def spelling(self):
"""Return the spelling of the entity pointed at by the cursor."""
if not hasattr(self, '_spelling'):
- self._spelling = str(conf.lib.clang_getCursorSpelling(self))
+ self._spelling = conf.lib.clang_getCursorSpelling(self)
- return str(self._spelling)
+ return self._spelling
@property
def displayname(self):
@@ -1471,7 +1443,7 @@ class Cursor(Structure):
arguments of a class template specialization.
"""
if not hasattr(self, '_displayname'):
- self._displayname = str(conf.lib.clang_getCursorDisplayName(self))
+ self._displayname = conf.lib.clang_getCursorDisplayName(self)
return self._displayname
@@ -1479,7 +1451,7 @@ class Cursor(Structure):
def mangled_name(self):
"""Return the mangled name for the entity referenced by this cursor."""
if not hasattr(self, '_mangled_name'):
- self._mangled_name = str(conf.lib.clang_Cursor_getMangling(self))
+ self._mangled_name = conf.lib.clang_Cursor_getMangling(self)
return self._mangled_name
@@ -1618,7 +1590,7 @@ class Cursor(Structure):
self._objc_type_encoding = \
conf.lib.clang_getDeclObjCTypeEncoding(self)
- return str(self._objc_type_encoding)
+ return self._objc_type_encoding
@property
def hash(self):
@@ -1665,23 +1637,17 @@ class Cursor(Structure):
@property
def brief_comment(self):
"""Returns the brief comment text associated with that Cursor"""
- r = conf.lib.clang_Cursor_getBriefCommentText(self)
- if not r:
- return None
- return str(r)
+ return conf.lib.clang_Cursor_getBriefCommentText(self)
@property
def raw_comment(self):
"""Returns the raw comment text associated with that Cursor"""
- r = conf.lib.clang_Cursor_getRawCommentText(self)
- if not r:
- return None
- return str(r)
+ return conf.lib.clang_Cursor_getRawCommentText(self)
def get_arguments(self):
"""Return an iterator for accessing the arguments of this cursor."""
num_args = conf.lib.clang_Cursor_getNumArguments(self)
- for i in xrange(0, num_args):
+ for i in range(0, num_args):
yield conf.lib.clang_Cursor_getArgument(self, i)
def get_num_template_arguments(self):
@@ -1811,7 +1777,7 @@ class StorageClass(object):
if value >= len(StorageClass._kinds):
StorageClass._kinds += [None] * (value - len(StorageClass._kinds) + 1)
if StorageClass._kinds[value] is not None:
- raise ValueError('StorageClass already loaded')
+ raise ValueError,'StorageClass already loaded'
self.value = value
StorageClass._kinds[value] = self
StorageClass._name_map = None
@@ -1832,7 +1798,7 @@ class StorageClass(object):
@staticmethod
def from_id(id):
if id >= len(StorageClass._kinds) or not StorageClass._kinds[id]:
- raise ValueError('Unknown storage class %d' % id)
+ raise ValueError,'Unknown storage class %d' % id
return StorageClass._kinds[id]
def __repr__(self):
@@ -1885,7 +1851,7 @@ class TypeKind(BaseEnumeration):
@property
def spelling(self):
"""Retrieve the spelling of this TypeKind."""
- return str(conf.lib.clang_getTypeKindSpelling(self.value))
+ return conf.lib.clang_getTypeKindSpelling(self.value)
def __repr__(self):
return 'TypeKind.%s' % (self.name,)
@@ -2161,7 +2127,7 @@ class Type(Structure):
"""
Retrieve the offset of a field in the record.
"""
- return conf.lib.clang_Type_getOffsetOf(self, fieldname)
+ return conf.lib.clang_Type_getOffsetOf(self, c_char_p(fieldname))
def get_ref_qualifier(self):
"""
@@ -2188,7 +2154,7 @@ class Type(Structure):
@property
def spelling(self):
"""Retrieve the spelling of this Type."""
- return str(conf.lib.clang_getTypeSpelling(self))
+ return conf.lib.clang_getTypeSpelling(self)
def __eq__(self, other):
if type(other) != type(self):
@@ -2220,7 +2186,7 @@ class ClangObject(object):
class _CXUnsavedFile(Structure):
"""Helper for passing unsaved file arguments."""
- _fields_ = [("name", c_string_p), ("contents", c_string_p), ('length', c_ulong)]
+ _fields_ = [("name", c_char_p), ("contents", c_char_p), ('length', c_ulong)]
# Functions calls through the python interface are rather slow. Fortunately,
# for most symboles, we do not need to perform a function call. Their spelling
@@ -2266,7 +2232,7 @@ class CompletionChunk:
self.__kindNumberCache = -1
def __repr__(self):
- return "{'" + str(self.spelling) + "', " + str(self.kind) + "}"
+ return "{'" + self.spelling + "', " + str(self.kind) + "}"
@CachedProperty
def spelling(self):
@@ -2575,9 +2541,7 @@ class TranslationUnit(ClangObject):
args_array = None
if len(args) > 0:
- args_array = (c_string_p * len(args))()
- for i,a in enumerate(args):
- args_array[i] = c_string_p(a)
+ args_array = (c_char_p * len(args))(* args)
unsaved_array = None
if len(unsaved_files) > 0:
@@ -2586,8 +2550,8 @@ class TranslationUnit(ClangObject):
if hasattr(contents, "read"):
contents = contents.read()
- unsaved_array[i].name = c_string_p(name)
- unsaved_array[i].contents = c_string_p(contents)
+ unsaved_array[i].name = name
+ unsaved_array[i].contents = contents
unsaved_array[i].length = len(contents)
ptr = conf.lib.clang_parseTranslationUnit(index, filename, args_array,
@@ -2642,7 +2606,7 @@ class TranslationUnit(ClangObject):
@property
def spelling(self):
"""Get the original translation unit source file name."""
- return str(conf.lib.clang_getTranslationUnitSpelling(self))
+ return conf.lib.clang_getTranslationUnitSpelling(self)
def get_includes(self):
"""
@@ -2765,9 +2729,9 @@ class TranslationUnit(ClangObject):
# FIXME: It would be great to support an efficient version
# of this, one day.
value = value.read()
- print(value)
+ print value
if not isinstance(value, str):
- raise TypeError('Unexpected unsaved file contents.')
+ raise TypeError,'Unexpected unsaved file contents.'
unsaved_files_array[i].name = name
unsaved_files_array[i].contents = value
unsaved_files_array[i].length = len(value)
@@ -2829,11 +2793,11 @@ class TranslationUnit(ClangObject):
# FIXME: It would be great to support an efficient version
# of this, one day.
value = value.read()
- print(value)
+ print value
if not isinstance(value, str):
- raise TypeError('Unexpected unsaved file contents.')
- unsaved_files_array[i].name = c_string_p(name)
- unsaved_files_array[i].contents = c_string_p(value)
+ raise TypeError,'Unexpected unsaved file contents.'
+ unsaved_files_array[i].name = name
+ unsaved_files_array[i].contents = value
unsaved_files_array[i].length = len(value)
ptr = conf.lib.clang_codeCompleteAt(self, path, line, column,
unsaved_files_array, len(unsaved_files), options)
@@ -2868,7 +2832,7 @@ class File(ClangObject):
@property
def name(self):
"""Return the complete file and path name of the file."""
- return str(conf.lib.clang_getCString(conf.lib.clang_getFileName(self)))
+ return conf.lib.clang_getCString(conf.lib.clang_getFileName(self))
@property
def time(self):
@@ -2876,7 +2840,7 @@ class File(ClangObject):
return conf.lib.clang_getFileTime(self)
def __str__(self):
- return str(self.name)
+ return self.name
def __repr__(self):
return "<File: %s>" % (self.name)
@@ -2945,12 +2909,12 @@ class CompileCommand(object):
@property
def directory(self):
"""Get the working directory for this CompileCommand"""
- return str(conf.lib.clang_CompileCommand_getDirectory(self.cmd))
+ return conf.lib.clang_CompileCommand_getDirectory(self.cmd)
@property
def filename(self):
"""Get the working filename for this CompileCommand"""
- return str(conf.lib.clang_CompileCommand_getFilename(self.cmd))
+ return conf.lib.clang_CompileCommand_getFilename(self.cmd)
@property
def arguments(self):
@@ -2962,7 +2926,7 @@ class CompileCommand(object):
"""
length = conf.lib.clang_CompileCommand_getNumArgs(self.cmd)
for i in xrange(length):
- yield str(conf.lib.clang_CompileCommand_getArg(self.cmd, i))
+ yield conf.lib.clang_CompileCommand_getArg(self.cmd, i)
class CompileCommands(object):
"""
@@ -3056,7 +3020,7 @@ class Token(Structure):
This is the textual representation of the token in source.
"""
- return str(conf.lib.clang_getTokenSpelling(self._tu, self))
+ return conf.lib.clang_getTokenSpelling(self._tu, self)
@property
def kind(self):
@@ -3099,7 +3063,7 @@ functionList = [
[c_object_p]),
("clang_CompilationDatabase_fromDirectory",
- [c_string_p, POINTER(c_uint)],
+ [c_char_p, POINTER(c_uint)],
c_object_p,
CompilationDatabase.from_result),
@@ -3109,7 +3073,7 @@ functionList = [
CompileCommands.from_result),
("clang_CompilationDatabase_getCompileCommands",
- [c_object_p, c_string_p],
+ [c_object_p, c_char_p],
c_object_p,
CompileCommands.from_result),
@@ -3144,7 +3108,7 @@ functionList = [
c_uint),
("clang_codeCompleteAt",
- [TranslationUnit, c_string_p, c_int, c_int, c_void_p, c_int, c_int],
+ [TranslationUnit, c_char_p, c_int, c_int, c_void_p, c_int, c_int],
POINTER(CCRStructure)),
("clang_codeCompleteGetDiagnostic",
@@ -3160,7 +3124,7 @@ functionList = [
c_object_p),
("clang_createTranslationUnit",
- [Index, c_string_p],
+ [Index, c_char_p],
c_object_p),
("clang_CXXConstructor_isConvertingConstructor",
@@ -3310,7 +3274,7 @@ functionList = [
("clang_getCString",
[_CXString],
- c_string_p),
+ c_char_p),
("clang_getCursor",
[TranslationUnit, SourceLocation],
@@ -3457,7 +3421,7 @@ functionList = [
Type.from_result),
("clang_getFile",
- [TranslationUnit, c_string_p],
+ [TranslationUnit, c_char_p],
c_object_p),
("clang_getFileName",
@@ -3586,7 +3550,7 @@ functionList = [
("clang_getTUResourceUsageName",
[c_uint],
- c_string_p),
+ c_char_p),
("clang_getTypeDeclaration",
[Type],
@@ -3681,7 +3645,7 @@ functionList = [
bool),
("clang_parseTranslationUnit",
- [Index, c_string_p, c_void_p, c_int, c_void_p, c_int, c_int],
+ [Index, c_char_p, c_void_p, c_int, c_void_p, c_int, c_int],
c_object_p),
("clang_reparseTranslationUnit",
@@ -3689,7 +3653,7 @@ functionList = [
c_int),
("clang_saveTranslationUnit",
- [TranslationUnit, c_string_p, c_uint],
+ [TranslationUnit, c_char_p, c_uint],
c_int),
("clang_tokenize",
@@ -3761,7 +3725,7 @@ functionList = [
Type.from_result),
("clang_Type_getOffsetOf",
- [Type, c_string_p],
+ [Type, c_char_p],
c_longlong),
("clang_Type_getSizeOf",
@@ -3820,8 +3784,7 @@ def register_functions(lib, ignore_errors):
def register(item):
return register_function(lib, item, ignore_errors)
- for f in functionList:
- register(f)
+ map(register, functionList)
class Config:
library_path = None
diff --git a/bindings/python/tests/cindex/test_translation_unit.py b/bindings/python/tests/cindex/test_translation_unit.py
index f959cf4aafcc5..be6cd671ae0c0 100644
--- a/bindings/python/tests/cindex/test_translation_unit.py
+++ b/bindings/python/tests/cindex/test_translation_unit.py
@@ -59,13 +59,9 @@ int SOME_DEFINE;
assert spellings[-1] == 'y'
def test_unsaved_files_2():
- try:
- from StringIO import StringIO
- except:
- from io import StringIO
-
+ import StringIO
tu = TranslationUnit.from_source('fake.c', unsaved_files = [
- ('fake.c', StringIO('int x;'))])
+ ('fake.c', StringIO.StringIO('int x;'))])
spellings = [c.spelling for c in tu.cursor.get_children()]
assert spellings[-1] == 'x'
diff --git a/docs/AttributeReference.rst b/docs/AttributeReference.rst
index a763ddeaeb106..d7a3f74f83fbe 100644
--- a/docs/AttributeReference.rst
+++ b/docs/AttributeReference.rst
@@ -1,13 +1,3118 @@
..
-------------------------------------------------------------------
NOTE: This file is automatically generated by running clang-tblgen
- -gen-attr-docs. Do not edit this file by hand!! The contents for
- this file are automatically generated by a server-side process.
-
- Please do not commit this file. The file exists for local testing
- purposes only.
+ -gen-attr-docs. Do not edit this file by hand!!
-------------------------------------------------------------------
===================
Attributes in Clang
-=================== \ No newline at end of file
+===================
+.. contents::
+ :local:
+
+Introduction
+============
+
+This page lists the attributes currently supported by Clang.
+
+Function Attributes
+===================
+
+
+interrupt
+---------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+Clang supports the GNU style ``__attribute__((interrupt("TYPE")))`` attribute on
+ARM targets. This attribute may be attached to a function definition and
+instructs the backend to generate appropriate function entry/exit code so that
+it can be used directly as an interrupt service routine.
+
+The parameter passed to the interrupt attribute is optional, but if
+provided it must be a string literal with one of the following values: "IRQ",
+"FIQ", "SWI", "ABORT", "UNDEF".
+
+The semantics are as follows:
+
+- If the function is AAPCS, Clang instructs the backend to realign the stack to
+ 8 bytes on entry. This is a general requirement of the AAPCS at public
+ interfaces, but may not hold when an exception is taken. Doing this allows
+ other AAPCS functions to be called.
+- If the CPU is M-class this is all that needs to be done since the architecture
+ itself is designed in such a way that functions obeying the normal AAPCS ABI
+ constraints are valid exception handlers.
+- If the CPU is not M-class, the prologue and epilogue are modified to save all
+ non-banked registers that are used, so that upon return the user-mode state
+ will not be corrupted. Note that to avoid unnecessary overhead, only
+ general-purpose (integer) registers are saved in this way. If VFP operations
+ are needed, that state must be saved manually.
+
+ Specifically, interrupt kinds other than "FIQ" will save all core registers
+ except "lr" and "sp". "FIQ" interrupts will save r0-r7.
+- If the CPU is not M-class, the return instruction is changed to one of the
+ canonical sequences permitted by the architecture for exception return. Where
+ possible the function itself will make the necessary "lr" adjustments so that
+ the "preferred return address" is selected.
+
+ Unfortunately the compiler is unable to make this guarantee for an "UNDEF"
+ handler, where the offset from "lr" to the preferred return address depends on
+ the execution state of the code which generated the exception. In this case
+ a sequence equivalent to "movs pc, lr" will be used.
+
+
+abi_tag (gnu::abi_tag)
+----------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+The ``abi_tag`` attribute can be applied to a function, variable, class or
+inline namespace declaration to modify the mangled name of the entity. It gives
+the ability to distinguish between different versions of the same entity but
+with different ABI versions supported. For example, a newer version of a class
+could have a different set of data members and thus have a different size. Using
+the ``abi_tag`` attribute, it is possible to have different mangled names for
+a global variable of the class type. Therefor, the old code could keep using
+the old manged name and the new code will use the new mangled name with tags.
+
+
+acquire_capability (acquire_shared_capability, clang::acquire_capability, clang::acquire_shared_capability)
+-----------------------------------------------------------------------------------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+Marks a function as acquiring a capability.
+
+
+alloc_size (gnu::alloc_size)
+----------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+The ``alloc_size`` attribute can be placed on functions that return pointers in
+order to hint to the compiler how many bytes of memory will be available at the
+returned poiner. ``alloc_size`` takes one or two arguments.
+
+- ``alloc_size(N)`` implies that argument number N equals the number of
+ available bytes at the returned pointer.
+- ``alloc_size(N, M)`` implies that the product of argument number N and
+ argument number M equals the number of available bytes at the returned
+ pointer.
+
+Argument numbers are 1-based.
+
+An example of how to use ``alloc_size``
+
+.. code-block:: c
+
+ void *my_malloc(int a) __attribute__((alloc_size(1)));
+ void *my_calloc(int a, int b) __attribute__((alloc_size(1, 2)));
+
+ int main() {
+ void *const p = my_malloc(100);
+ assert(__builtin_object_size(p, 0) == 100);
+ void *const a = my_calloc(20, 5);
+ assert(__builtin_object_size(a, 0) == 100);
+ }
+
+.. Note:: This attribute works differently in clang than it does in GCC.
+ Specifically, clang will only trace ``const`` pointers (as above); we give up
+ on pointers that are not marked as ``const``. In the vast majority of cases,
+ this is unimportant, because LLVM has support for the ``alloc_size``
+ attribute. However, this may cause mildly unintuitive behavior when used with
+ other attributes, such as ``enable_if``.
+
+
+interrupt
+---------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+Clang supports the GNU style ``__attribute__((interrupt))`` attribute on
+x86/x86-64 targets.The compiler generates function entry and exit sequences
+suitable for use in an interrupt handler when this attribute is present.
+The 'IRET' instruction, instead of the 'RET' instruction, is used to return
+from interrupt or exception handlers. All registers, except for the EFLAGS
+register which is restored by the 'IRET' instruction, are preserved by the
+compiler.
+
+Any interruptible-without-stack-switch code must be compiled with
+-mno-red-zone since interrupt handlers can and will, because of the
+hardware design, touch the red zone.
+
+1. interrupt handler must be declared with a mandatory pointer argument:
+
+ .. code-block:: c
+
+ struct interrupt_frame
+ {
+ uword_t ip;
+ uword_t cs;
+ uword_t flags;
+ uword_t sp;
+ uword_t ss;
+ };
+
+ __attribute__ ((interrupt))
+ void f (struct interrupt_frame *frame) {
+ ...
+ }
+
+2. exception handler:
+
+ The exception handler is very similar to the interrupt handler with
+ a different mandatory function signature:
+
+ .. code-block:: c
+
+ __attribute__ ((interrupt))
+ void f (struct interrupt_frame *frame, uword_t error_code) {
+ ...
+ }
+
+ and compiler pops 'ERROR_CODE' off stack before the 'IRET' instruction.
+
+ The exception handler should only be used for exceptions which push an
+ error code and all other exceptions must use the interrupt handler.
+ The system will crash if the wrong handler is used.
+
+
+assert_capability (assert_shared_capability, clang::assert_capability, clang::assert_shared_capability)
+-------------------------------------------------------------------------------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+Marks a function that dynamically tests whether a capability is held, and halts
+the program if it is not held.
+
+
+assume_aligned (gnu::assume_aligned)
+------------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+Use ``__attribute__((assume_aligned(<alignment>[,<offset>]))`` on a function
+declaration to specify that the return value of the function (which must be a
+pointer type) has the specified offset, in bytes, from an address with the
+specified alignment. The offset is taken to be zero if omitted.
+
+.. code-block:: c++
+
+ // The returned pointer value has 32-byte alignment.
+ void *a() __attribute__((assume_aligned (32)));
+
+ // The returned pointer value is 4 bytes greater than an address having
+ // 32-byte alignment.
+ void *b() __attribute__((assume_aligned (32, 4)));
+
+Note that this attribute provides information to the compiler regarding a
+condition that the code already ensures is true. It does not cause the compiler
+to enforce the provided alignment assumption.
+
+
+availability
+------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+The ``availability`` attribute can be placed on declarations to describe the
+lifecycle of that declaration relative to operating system versions. Consider
+the function declaration for a hypothetical function ``f``:
+
+.. code-block:: c++
+
+ void f(void) __attribute__((availability(macos,introduced=10.4,deprecated=10.6,obsoleted=10.7)));
+
+The availability attribute states that ``f`` was introduced in Mac OS X 10.4,
+deprecated in Mac OS X 10.6, and obsoleted in Mac OS X 10.7. This information
+is used by Clang to determine when it is safe to use ``f``: for example, if
+Clang is instructed to compile code for Mac OS X 10.5, a call to ``f()``
+succeeds. If Clang is instructed to compile code for Mac OS X 10.6, the call
+succeeds but Clang emits a warning specifying that the function is deprecated.
+Finally, if Clang is instructed to compile code for Mac OS X 10.7, the call
+fails because ``f()`` is no longer available.
+
+The availability attribute is a comma-separated list starting with the
+platform name and then including clauses specifying important milestones in the
+declaration's lifetime (in any order) along with additional information. Those
+clauses can be:
+
+introduced=\ *version*
+ The first version in which this declaration was introduced.
+
+deprecated=\ *version*
+ The first version in which this declaration was deprecated, meaning that
+ users should migrate away from this API.
+
+obsoleted=\ *version*
+ The first version in which this declaration was obsoleted, meaning that it
+ was removed completely and can no longer be used.
+
+unavailable
+ This declaration is never available on this platform.
+
+message=\ *string-literal*
+ Additional message text that Clang will provide when emitting a warning or
+ error about use of a deprecated or obsoleted declaration. Useful to direct
+ users to replacement APIs.
+
+replacement=\ *string-literal*
+ Additional message text that Clang will use to provide Fix-It when emitting
+ a warning about use of a deprecated declaration. The Fix-It will replace
+ the deprecated declaration with the new declaration specified.
+
+Multiple availability attributes can be placed on a declaration, which may
+correspond to different platforms. Only the availability attribute with the
+platform corresponding to the target platform will be used; any others will be
+ignored. If no availability attribute specifies availability for the current
+target platform, the availability attributes are ignored. Supported platforms
+are:
+
+``ios``
+ Apple's iOS operating system. The minimum deployment target is specified by
+ the ``-mios-version-min=*version*`` or ``-miphoneos-version-min=*version*``
+ command-line arguments.
+
+``macos``
+ Apple's Mac OS X operating system. The minimum deployment target is
+ specified by the ``-mmacosx-version-min=*version*`` command-line argument.
+ ``macosx`` is supported for backward-compatibility reasons, but it is
+ deprecated.
+
+``tvos``
+ Apple's tvOS operating system. The minimum deployment target is specified by
+ the ``-mtvos-version-min=*version*`` command-line argument.
+
+``watchos``
+ Apple's watchOS operating system. The minimum deployment target is specified by
+ the ``-mwatchos-version-min=*version*`` command-line argument.
+
+A declaration can typically be used even when deploying back to a platform
+version prior to when the declaration was introduced. When this happens, the
+declaration is `weakly linked
+<https://developer.apple.com/library/mac/#documentation/MacOSX/Conceptual/BPFrameworks/Concepts/WeakLinking.html>`_,
+as if the ``weak_import`` attribute were added to the declaration. A
+weakly-linked declaration may or may not be present a run-time, and a program
+can determine whether the declaration is present by checking whether the
+address of that declaration is non-NULL.
+
+The flag ``strict`` disallows using API when deploying back to a
+platform version prior to when the declaration was introduced. An
+attempt to use such API before its introduction causes a hard error.
+Weakly-linking is almost always a better API choice, since it allows
+users to query availability at runtime.
+
+If there are multiple declarations of the same entity, the availability
+attributes must either match on a per-platform basis or later
+declarations must not have availability attributes for that
+platform. For example:
+
+.. code-block:: c
+
+ void g(void) __attribute__((availability(macos,introduced=10.4)));
+ void g(void) __attribute__((availability(macos,introduced=10.4))); // okay, matches
+ void g(void) __attribute__((availability(ios,introduced=4.0))); // okay, adds a new platform
+ void g(void); // okay, inherits both macos and ios availability from above.
+ void g(void) __attribute__((availability(macos,introduced=10.5))); // error: mismatch
+
+When one method overrides another, the overriding method can be more widely available than the overridden method, e.g.,:
+
+.. code-block:: objc
+
+ @interface A
+ - (id)method __attribute__((availability(macos,introduced=10.4)));
+ - (id)method2 __attribute__((availability(macos,introduced=10.4)));
+ @end
+
+ @interface B : A
+ - (id)method __attribute__((availability(macos,introduced=10.3))); // okay: method moved into base class later
+ - (id)method __attribute__((availability(macos,introduced=10.5))); // error: this method was available via the base class in 10.4
+ @end
+
+
+_Noreturn
+---------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "","","","X", ""
+
+A function declared as ``_Noreturn`` shall not return to its caller. The
+compiler will generate a diagnostic for a function declared as ``_Noreturn``
+that appears to be capable of returning to its caller.
+
+
+noreturn
+--------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "","X","","", ""
+
+A function declared as ``[[noreturn]]`` shall not return to its caller. The
+compiler will generate a diagnostic for a function declared as ``[[noreturn]]``
+that appears to be capable of returning to its caller.
+
+
+carries_dependency
+------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+The ``carries_dependency`` attribute specifies dependency propagation into and
+out of functions.
+
+When specified on a function or Objective-C method, the ``carries_dependency``
+attribute means that the return value carries a dependency out of the function,
+so that the implementation need not constrain ordering upon return from that
+function. Implementations of the function and its caller may choose to preserve
+dependencies instead of emitting memory ordering instructions such as fences.
+
+Note, this attribute does not change the meaning of the program, but may result
+in generation of more efficient code.
+
+
+convergent (clang::convergent)
+------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+The ``convergent`` attribute can be placed on a function declaration. It is
+translated into the LLVM ``convergent`` attribute, which indicates that the call
+instructions of a function with this attribute cannot be made control-dependent
+on any additional values.
+
+In languages designed for SPMD/SIMT programming model, e.g. OpenCL or CUDA,
+the call instructions of a function with this attribute must be executed by
+all work items or threads in a work group or sub group.
+
+This attribute is different from ``noduplicate`` because it allows duplicating
+function calls if it can be proved that the duplicated function calls are
+not made control-dependent on any additional values, e.g., unrolling a loop
+executed by all work items.
+
+Sample usage:
+.. code-block:: c
+
+ void convfunc(void) __attribute__((convergent));
+ // Setting it as a C++11 attribute is also valid in a C++ program.
+ // void convfunc(void) [[clang::convergent]];
+
+
+deprecated (gnu::deprecated)
+----------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","X","", ""
+
+The ``deprecated`` attribute can be applied to a function, a variable, or a
+type. This is useful when identifying functions, variables, or types that are
+expected to be removed in a future version of a program.
+
+Consider the function declaration for a hypothetical function ``f``:
+
+.. code-block:: c++
+
+ void f(void) __attribute__((deprecated("message", "replacement")));
+
+When spelled as `__attribute__((deprecated))`, the deprecated attribute can have
+two optional string arguments. The first one is the message to display when
+emitting the warning; the second one enables the compiler to provide a Fix-It
+to replace the deprecated name with a new name. Otherwise, when spelled as
+`[[gnu::deprecated]] or [[deprecated]]`, the attribute can have one optional
+string argument which is the message to display when emitting the warning.
+
+
+diagnose_if
+-----------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+The ``diagnose_if`` attribute can be placed on function declarations to emit
+warnings or errors at compile-time if calls to the attributed function meet
+certain user-defined criteria. For example:
+
+.. code-block:: c
+ void abs(int a)
+ __attribute__((diagnose_if(a >= 0, "Redundant abs call", "warning")));
+ void must_abs(int a)
+ __attribute__((diagnose_if(a >= 0, "Redundant abs call", "error")));
+
+ int val = abs(1); // warning: Redundant abs call
+ int val2 = must_abs(1); // error: Redundant abs call
+ int val3 = abs(val);
+ int val4 = must_abs(val); // Because run-time checks are not emitted for
+ // diagnose_if attributes, this executes without
+ // issue.
+
+
+``diagnose_if`` is closely related to ``enable_if``, with a few key differences:
+
+* Overload resolution is not aware of ``diagnose_if`` attributes: they're
+ considered only after we select the best candidate from a given candidate set.
+* Function declarations that differ only in their ``diagnose_if`` attributes are
+ considered to be redeclarations of the same function (not overloads).
+* If the condition provided to ``diagnose_if`` cannot be evaluated, no
+ diagnostic will be emitted.
+
+Otherwise, ``diagnose_if`` is essentially the logical negation of ``enable_if``.
+
+As a result of bullet number two, ``diagnose_if`` attributes will stack on the
+same function. For example:
+
+.. code-block:: c
+
+ int foo() __attribute__((diagnose_if(1, "diag1", "warning")));
+ int foo() __attribute__((diagnose_if(1, "diag2", "warning")));
+
+ int bar = foo(); // warning: diag1
+ // warning: diag2
+ int (*fooptr)(void) = foo; // warning: diag1
+ // warning: diag2
+
+ constexpr int supportsAPILevel(int N) { return N < 5; }
+ int baz(int a)
+ __attribute__((diagnose_if(!supportsAPILevel(10),
+ "Upgrade to API level 10 to use baz", "error")));
+ int baz(int a)
+ __attribute__((diagnose_if(!a, "0 is not recommended.", "warning")));
+
+ int (*bazptr)(int) = baz; // error: Upgrade to API level 10 to use baz
+ int v = baz(0); // error: Upgrade to API level 10 to use baz
+
+Query for this feature with ``__has_attribute(diagnose_if)``.
+
+
+disable_tail_calls (clang::disable_tail_calls)
+----------------------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+The ``disable_tail_calls`` attribute instructs the backend to not perform tail call optimization inside the marked function.
+
+For example:
+
+ .. code-block:: c
+
+ int callee(int);
+
+ int foo(int a) __attribute__((disable_tail_calls)) {
+ return callee(a); // This call is not tail-call optimized.
+ }
+
+Marking virtual functions as ``disable_tail_calls`` is legal.
+
+ .. code-block:: c++
+
+ int callee(int);
+
+ class Base {
+ public:
+ [[clang::disable_tail_calls]] virtual int foo1() {
+ return callee(); // This call is not tail-call optimized.
+ }
+ };
+
+ class Derived1 : public Base {
+ public:
+ int foo1() override {
+ return callee(); // This call is tail-call optimized.
+ }
+ };
+
+
+enable_if
+---------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+.. Note:: Some features of this attribute are experimental. The meaning of
+ multiple enable_if attributes on a single declaration is subject to change in
+ a future version of clang. Also, the ABI is not standardized and the name
+ mangling may change in future versions. To avoid that, use asm labels.
+
+The ``enable_if`` attribute can be placed on function declarations to control
+which overload is selected based on the values of the function's arguments.
+When combined with the ``overloadable`` attribute, this feature is also
+available in C.
+
+.. code-block:: c++
+
+ int isdigit(int c);
+ int isdigit(int c) __attribute__((enable_if(c <= -1 || c > 255, "chosen when 'c' is out of range"))) __attribute__((unavailable("'c' must have the value of an unsigned char or EOF")));
+
+ void foo(char c) {
+ isdigit(c);
+ isdigit(10);
+ isdigit(-10); // results in a compile-time error.
+ }
+
+The enable_if attribute takes two arguments, the first is an expression written
+in terms of the function parameters, the second is a string explaining why this
+overload candidate could not be selected to be displayed in diagnostics. The
+expression is part of the function signature for the purposes of determining
+whether it is a redeclaration (following the rules used when determining
+whether a C++ template specialization is ODR-equivalent), but is not part of
+the type.
+
+The enable_if expression is evaluated as if it were the body of a
+bool-returning constexpr function declared with the arguments of the function
+it is being applied to, then called with the parameters at the call site. If the
+result is false or could not be determined through constant expression
+evaluation, then this overload will not be chosen and the provided string may
+be used in a diagnostic if the compile fails as a result.
+
+Because the enable_if expression is an unevaluated context, there are no global
+state changes, nor the ability to pass information from the enable_if
+expression to the function body. For example, suppose we want calls to
+strnlen(strbuf, maxlen) to resolve to strnlen_chk(strbuf, maxlen, size of
+strbuf) only if the size of strbuf can be determined:
+
+.. code-block:: c++
+
+ __attribute__((always_inline))
+ static inline size_t strnlen(const char *s, size_t maxlen)
+ __attribute__((overloadable))
+ __attribute__((enable_if(__builtin_object_size(s, 0) != -1))),
+ "chosen when the buffer size is known but 'maxlen' is not")))
+ {
+ return strnlen_chk(s, maxlen, __builtin_object_size(s, 0));
+ }
+
+Multiple enable_if attributes may be applied to a single declaration. In this
+case, the enable_if expressions are evaluated from left to right in the
+following manner. First, the candidates whose enable_if expressions evaluate to
+false or cannot be evaluated are discarded. If the remaining candidates do not
+share ODR-equivalent enable_if expressions, the overload resolution is
+ambiguous. Otherwise, enable_if overload resolution continues with the next
+enable_if attribute on the candidates that have not been discarded and have
+remaining enable_if attributes. In this way, we pick the most specific
+overload out of a number of viable overloads using enable_if.
+
+.. code-block:: c++
+
+ void f() __attribute__((enable_if(true, ""))); // #1
+ void f() __attribute__((enable_if(true, ""))) __attribute__((enable_if(true, ""))); // #2
+
+ void g(int i, int j) __attribute__((enable_if(i, ""))); // #1
+ void g(int i, int j) __attribute__((enable_if(j, ""))) __attribute__((enable_if(true))); // #2
+
+In this example, a call to f() is always resolved to #2, as the first enable_if
+expression is ODR-equivalent for both declarations, but #1 does not have another
+enable_if expression to continue evaluating, so the next round of evaluation has
+only a single candidate. In a call to g(1, 1), the call is ambiguous even though
+#2 has more enable_if attributes, because the first enable_if expressions are
+not ODR-equivalent.
+
+Query for this feature with ``__has_attribute(enable_if)``.
+
+Note that functions with one or more ``enable_if`` attributes may not have
+their address taken, unless all of the conditions specified by said
+``enable_if`` are constants that evaluate to ``true``. For example:
+
+.. code-block:: c
+
+ const int TrueConstant = 1;
+ const int FalseConstant = 0;
+ int f(int a) __attribute__((enable_if(a > 0, "")));
+ int g(int a) __attribute__((enable_if(a == 0 || a != 0, "")));
+ int h(int a) __attribute__((enable_if(1, "")));
+ int i(int a) __attribute__((enable_if(TrueConstant, "")));
+ int j(int a) __attribute__((enable_if(FalseConstant, "")));
+
+ void fn() {
+ int (*ptr)(int);
+ ptr = &f; // error: 'a > 0' is not always true
+ ptr = &g; // error: 'a == 0 || a != 0' is not a truthy constant
+ ptr = &h; // OK: 1 is a truthy constant
+ ptr = &i; // OK: 'TrueConstant' is a truthy constant
+ ptr = &j; // error: 'FalseConstant' is a constant, but not truthy
+ }
+
+Because ``enable_if`` evaluation happens during overload resolution,
+``enable_if`` may give unintuitive results when used with templates, depending
+on when overloads are resolved. In the example below, clang will emit a
+diagnostic about no viable overloads for ``foo`` in ``bar``, but not in ``baz``:
+
+.. code-block:: c++
+
+ double foo(int i) __attribute__((enable_if(i > 0, "")));
+ void *foo(int i) __attribute__((enable_if(i <= 0, "")));
+ template <int I>
+ auto bar() { return foo(I); }
+
+ template <typename T>
+ auto baz() { return foo(T::number); }
+
+ struct WithNumber { constexpr static int number = 1; };
+ void callThem() {
+ bar<sizeof(WithNumber)>();
+ baz<WithNumber>();
+ }
+
+This is because, in ``bar``, ``foo`` is resolved prior to template
+instantiation, so the value for ``I`` isn't known (thus, both ``enable_if``
+conditions for ``foo`` fail). However, in ``baz``, ``foo`` is resolved during
+template instantiation, so the value for ``T::number`` is known.
+
+
+flatten (gnu::flatten)
+----------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+The ``flatten`` attribute causes calls within the attributed function to
+be inlined unless it is impossible to do so, for example if the body of the
+callee is unavailable or if the callee has the ``noinline`` attribute.
+
+
+format (gnu::format)
+--------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+Clang supports the ``format`` attribute, which indicates that the function
+accepts a ``printf`` or ``scanf``-like format string and corresponding
+arguments or a ``va_list`` that contains these arguments.
+
+Please see `GCC documentation about format attribute
+<http://gcc.gnu.org/onlinedocs/gcc/Function-Attributes.html>`_ to find details
+about attribute syntax.
+
+Clang implements two kinds of checks with this attribute.
+
+#. Clang checks that the function with the ``format`` attribute is called with
+ a format string that uses format specifiers that are allowed, and that
+ arguments match the format string. This is the ``-Wformat`` warning, it is
+ on by default.
+
+#. Clang checks that the format string argument is a literal string. This is
+ the ``-Wformat-nonliteral`` warning, it is off by default.
+
+ Clang implements this mostly the same way as GCC, but there is a difference
+ for functions that accept a ``va_list`` argument (for example, ``vprintf``).
+ GCC does not emit ``-Wformat-nonliteral`` warning for calls to such
+ functions. Clang does not warn if the format string comes from a function
+ parameter, where the function is annotated with a compatible attribute,
+ otherwise it warns. For example:
+
+ .. code-block:: c
+
+ __attribute__((__format__ (__scanf__, 1, 3)))
+ void foo(const char* s, char *buf, ...) {
+ va_list ap;
+ va_start(ap, buf);
+
+ vprintf(s, ap); // warning: format string is not a string literal
+ }
+
+ In this case we warn because ``s`` contains a format string for a
+ ``scanf``-like function, but it is passed to a ``printf``-like function.
+
+ If the attribute is removed, clang still warns, because the format string is
+ not a string literal.
+
+ Another example:
+
+ .. code-block:: c
+
+ __attribute__((__format__ (__printf__, 1, 3)))
+ void foo(const char* s, char *buf, ...) {
+ va_list ap;
+ va_start(ap, buf);
+
+ vprintf(s, ap); // warning
+ }
+
+ In this case Clang does not warn because the format string ``s`` and
+ the corresponding arguments are annotated. If the arguments are
+ incorrect, the caller of ``foo`` will receive a warning.
+
+
+ifunc (gnu::ifunc)
+------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+``__attribute__((ifunc("resolver")))`` is used to mark that the address of a declaration should be resolved at runtime by calling a resolver function.
+
+The symbol name of the resolver function is given in quotes. A function with this name (after mangling) must be defined in the current translation unit; it may be ``static``. The resolver function should take no arguments and return a pointer.
+
+The ``ifunc`` attribute may only be used on a function declaration. A function declaration with an ``ifunc`` attribute is considered to be a definition of the declared entity. The entity must not have weak linkage; for example, in C++, it cannot be applied to a declaration if a definition at that location would be considered inline.
+
+Not all targets support this attribute. ELF targets support this attribute when using binutils v2.20.1 or higher and glibc v2.11.1 or higher. Non-ELF targets currently do not support this attribute.
+
+
+internal_linkage (clang::internal_linkage)
+------------------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+The ``internal_linkage`` attribute changes the linkage type of the declaration to internal.
+This is similar to C-style ``static``, but can be used on classes and class methods. When applied to a class definition,
+this attribute affects all methods and static data members of that class.
+This can be used to contain the ABI of a C++ library by excluding unwanted class methods from the export tables.
+
+
+interrupt
+---------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+Clang supports the GNU style ``__attribute__((interrupt("ARGUMENT")))`` attribute on
+MIPS targets. This attribute may be attached to a function definition and instructs
+the backend to generate appropriate function entry/exit code so that it can be used
+directly as an interrupt service routine.
+
+By default, the compiler will produce a function prologue and epilogue suitable for
+an interrupt service routine that handles an External Interrupt Controller (eic)
+generated interrupt. This behaviour can be explicitly requested with the "eic"
+argument.
+
+Otherwise, for use with vectored interrupt mode, the argument passed should be
+of the form "vector=LEVEL" where LEVEL is one of the following values:
+"sw0", "sw1", "hw0", "hw1", "hw2", "hw3", "hw4", "hw5". The compiler will
+then set the interrupt mask to the corresponding level which will mask all
+interrupts up to and including the argument.
+
+The semantics are as follows:
+
+- The prologue is modified so that the Exception Program Counter (EPC) and
+ Status coprocessor registers are saved to the stack. The interrupt mask is
+ set so that the function can only be interrupted by a higher priority
+ interrupt. The epilogue will restore the previous values of EPC and Status.
+
+- The prologue and epilogue are modified to save and restore all non-kernel
+ registers as necessary.
+
+- The FPU is disabled in the prologue, as the floating pointer registers are not
+ spilled to the stack.
+
+- The function return sequence is changed to use an exception return instruction.
+
+- The parameter sets the interrupt mask for the function corresponding to the
+ interrupt level specified. If no mask is specified the interrupt mask
+ defaults to "eic".
+
+
+noalias
+-------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "","","X","", ""
+
+The ``noalias`` attribute indicates that the only memory accesses inside
+function are loads and stores from objects pointed to by its pointer-typed
+arguments, with arbitrary offsets.
+
+
+noduplicate (clang::noduplicate)
+--------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+The ``noduplicate`` attribute can be placed on function declarations to control
+whether function calls to this function can be duplicated or not as a result of
+optimizations. This is required for the implementation of functions with
+certain special requirements, like the OpenCL "barrier" function, that might
+need to be run concurrently by all the threads that are executing in lockstep
+on the hardware. For example this attribute applied on the function
+"nodupfunc" in the code below avoids that:
+
+.. code-block:: c
+
+ void nodupfunc() __attribute__((noduplicate));
+ // Setting it as a C++11 attribute is also valid
+ // void nodupfunc() [[clang::noduplicate]];
+ void foo();
+ void bar();
+
+ nodupfunc();
+ if (a > n) {
+ foo();
+ } else {
+ bar();
+ }
+
+gets possibly modified by some optimizations into code similar to this:
+
+.. code-block:: c
+
+ if (a > n) {
+ nodupfunc();
+ foo();
+ } else {
+ nodupfunc();
+ bar();
+ }
+
+where the call to "nodupfunc" is duplicated and sunk into the two branches
+of the condition.
+
+
+no_sanitize (clang::no_sanitize)
+--------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+Use the ``no_sanitize`` attribute on a function declaration to specify
+that a particular instrumentation or set of instrumentations should not be
+applied to that function. The attribute takes a list of string literals,
+which have the same meaning as values accepted by the ``-fno-sanitize=``
+flag. For example, ``__attribute__((no_sanitize("address", "thread")))``
+specifies that AddressSanitizer and ThreadSanitizer should not be applied
+to the function.
+
+See :ref:`Controlling Code Generation <controlling-code-generation>` for a
+full list of supported sanitizer flags.
+
+
+no_sanitize_address (no_address_safety_analysis, gnu::no_address_safety_analysis, gnu::no_sanitize_address)
+-----------------------------------------------------------------------------------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+.. _langext-address_sanitizer:
+
+Use ``__attribute__((no_sanitize_address))`` on a function declaration to
+specify that address safety instrumentation (e.g. AddressSanitizer) should
+not be applied to that function.
+
+
+no_sanitize_thread
+------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+.. _langext-thread_sanitizer:
+
+Use ``__attribute__((no_sanitize_thread))`` on a function declaration to
+specify that checks for data races on plain (non-atomic) memory accesses should
+not be inserted by ThreadSanitizer. The function is still instrumented by the
+tool to avoid false positives and provide meaningful stack traces.
+
+
+no_sanitize_memory
+------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+.. _langext-memory_sanitizer:
+
+Use ``__attribute__((no_sanitize_memory))`` on a function declaration to
+specify that checks for uninitialized memory should not be inserted
+(e.g. by MemorySanitizer). The function may still be instrumented by the tool
+to avoid false positives in other places.
+
+
+no_split_stack (gnu::no_split_stack)
+------------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+The ``no_split_stack`` attribute disables the emission of the split stack
+preamble for a particular function. It has no effect if ``-fsplit-stack``
+is not specified.
+
+
+not_tail_called (clang::not_tail_called)
+----------------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+The ``not_tail_called`` attribute prevents tail-call optimization on statically bound calls. It has no effect on indirect calls. Virtual functions, objective-c methods, and functions marked as ``always_inline`` cannot be marked as ``not_tail_called``.
+
+For example, it prevents tail-call optimization in the following case:
+
+ .. code-block:: c
+
+ int __attribute__((not_tail_called)) foo1(int);
+
+ int foo2(int a) {
+ return foo1(a); // No tail-call optimization on direct calls.
+ }
+
+However, it doesn't prevent tail-call optimization in this case:
+
+ .. code-block:: c
+
+ int __attribute__((not_tail_called)) foo1(int);
+
+ int foo2(int a) {
+ int (*fn)(int) = &foo1;
+
+ // not_tail_called has no effect on an indirect call even if the call can be
+ // resolved at compile time.
+ return (*fn)(a);
+ }
+
+Marking virtual functions as ``not_tail_called`` is an error:
+
+ .. code-block:: c++
+
+ class Base {
+ public:
+ // not_tail_called on a virtual function is an error.
+ [[clang::not_tail_called]] virtual int foo1();
+
+ virtual int foo2();
+
+ // Non-virtual functions can be marked ``not_tail_called``.
+ [[clang::not_tail_called]] int foo3();
+ };
+
+ class Derived1 : public Base {
+ public:
+ int foo1() override;
+
+ // not_tail_called on a virtual function is an error.
+ [[clang::not_tail_called]] int foo2() override;
+ };
+
+
+#pragma omp declare simd
+------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "","","","", "X"
+
+The `declare simd` construct can be applied to a function to enable the creation
+of one or more versions that can process multiple arguments using SIMD
+instructions from a single invocation in a SIMD loop. The `declare simd`
+directive is a declarative directive. There may be multiple `declare simd`
+directives for a function. The use of a `declare simd` construct on a function
+enables the creation of SIMD versions of the associated function that can be
+used to process multiple arguments from a single invocation from a SIMD loop
+concurrently.
+The syntax of the `declare simd` construct is as follows:
+
+ .. code-block:: c
+
+ #pragma omp declare simd [clause[[,] clause] ...] new-line
+ [#pragma omp declare simd [clause[[,] clause] ...] new-line]
+ [...]
+ function definition or declaration
+
+where clause is one of the following:
+
+ .. code-block:: c
+
+ simdlen(length)
+ linear(argument-list[:constant-linear-step])
+ aligned(argument-list[:alignment])
+ uniform(argument-list)
+ inbranch
+ notinbranch
+
+
+#pragma omp declare target
+--------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "","","","", "X"
+
+The `declare target` directive specifies that variables and functions are mapped
+to a device for OpenMP offload mechanism.
+
+The syntax of the declare target directive is as follows:
+
+ .. code-block:: c
+
+ #pragma omp declare target new-line
+ declarations-definition-seq
+ #pragma omp end declare target new-line
+
+
+objc_boxable
+------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+Structs and unions marked with the ``objc_boxable`` attribute can be used
+with the Objective-C boxed expression syntax, ``@(...)``.
+
+**Usage**: ``__attribute__((objc_boxable))``. This attribute
+can only be placed on a declaration of a trivially-copyable struct or union:
+
+.. code-block:: objc
+
+ struct __attribute__((objc_boxable)) some_struct {
+ int i;
+ };
+ union __attribute__((objc_boxable)) some_union {
+ int i;
+ float f;
+ };
+ typedef struct __attribute__((objc_boxable)) _some_struct some_struct;
+
+ // ...
+
+ some_struct ss;
+ NSValue *boxed = @(ss);
+
+
+objc_method_family
+------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+Many methods in Objective-C have conventional meanings determined by their
+selectors. It is sometimes useful to be able to mark a method as having a
+particular conventional meaning despite not having the right selector, or as
+not having the conventional meaning that its selector would suggest. For these
+use cases, we provide an attribute to specifically describe the "method family"
+that a method belongs to.
+
+**Usage**: ``__attribute__((objc_method_family(X)))``, where ``X`` is one of
+``none``, ``alloc``, ``copy``, ``init``, ``mutableCopy``, or ``new``. This
+attribute can only be placed at the end of a method declaration:
+
+.. code-block:: objc
+
+ - (NSString *)initMyStringValue __attribute__((objc_method_family(none)));
+
+Users who do not wish to change the conventional meaning of a method, and who
+merely want to document its non-standard retain and release semantics, should
+use the retaining behavior attributes (``ns_returns_retained``,
+``ns_returns_not_retained``, etc).
+
+Query for this feature with ``__has_attribute(objc_method_family)``.
+
+
+objc_requires_super
+-------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+Some Objective-C classes allow a subclass to override a particular method in a
+parent class but expect that the overriding method also calls the overridden
+method in the parent class. For these cases, we provide an attribute to
+designate that a method requires a "call to ``super``" in the overriding
+method in the subclass.
+
+**Usage**: ``__attribute__((objc_requires_super))``. This attribute can only
+be placed at the end of a method declaration:
+
+.. code-block:: objc
+
+ - (void)foo __attribute__((objc_requires_super));
+
+This attribute can only be applied the method declarations within a class, and
+not a protocol. Currently this attribute does not enforce any placement of
+where the call occurs in the overriding method (such as in the case of
+``-dealloc`` where the call must appear at the end). It checks only that it
+exists.
+
+Note that on both OS X and iOS that the Foundation framework provides a
+convenience macro ``NS_REQUIRES_SUPER`` that provides syntactic sugar for this
+attribute:
+
+.. code-block:: objc
+
+ - (void)foo NS_REQUIRES_SUPER;
+
+This macro is conditionally defined depending on the compiler's support for
+this attribute. If the compiler does not support the attribute the macro
+expands to nothing.
+
+Operationally, when a method has this annotation the compiler will warn if the
+implementation of an override in a subclass does not call super. For example:
+
+.. code-block:: objc
+
+ warning: method possibly missing a [super AnnotMeth] call
+ - (void) AnnotMeth{};
+ ^
+
+
+objc_runtime_name
+-----------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+By default, the Objective-C interface or protocol identifier is used
+in the metadata name for that object. The `objc_runtime_name`
+attribute allows annotated interfaces or protocols to use the
+specified string argument in the object's metadata name instead of the
+default name.
+
+**Usage**: ``__attribute__((objc_runtime_name("MyLocalName")))``. This attribute
+can only be placed before an @protocol or @interface declaration:
+
+.. code-block:: objc
+
+ __attribute__((objc_runtime_name("MyLocalName")))
+ @interface Message
+ @end
+
+
+objc_runtime_visible
+--------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+This attribute specifies that the Objective-C class to which it applies is visible to the Objective-C runtime but not to the linker. Classes annotated with this attribute cannot be subclassed and cannot have categories defined for them.
+
+
+optnone (clang::optnone)
+------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+The ``optnone`` attribute suppresses essentially all optimizations
+on a function or method, regardless of the optimization level applied to
+the compilation unit as a whole. This is particularly useful when you
+need to debug a particular function, but it is infeasible to build the
+entire application without optimization. Avoiding optimization on the
+specified function can improve the quality of the debugging information
+for that function.
+
+This attribute is incompatible with the ``always_inline`` and ``minsize``
+attributes.
+
+
+overloadable
+------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+Clang provides support for C++ function overloading in C. Function overloading
+in C is introduced using the ``overloadable`` attribute. For example, one
+might provide several overloaded versions of a ``tgsin`` function that invokes
+the appropriate standard function computing the sine of a value with ``float``,
+``double``, or ``long double`` precision:
+
+.. code-block:: c
+
+ #include <math.h>
+ float __attribute__((overloadable)) tgsin(float x) { return sinf(x); }
+ double __attribute__((overloadable)) tgsin(double x) { return sin(x); }
+ long double __attribute__((overloadable)) tgsin(long double x) { return sinl(x); }
+
+Given these declarations, one can call ``tgsin`` with a ``float`` value to
+receive a ``float`` result, with a ``double`` to receive a ``double`` result,
+etc. Function overloading in C follows the rules of C++ function overloading
+to pick the best overload given the call arguments, with a few C-specific
+semantics:
+
+* Conversion from ``float`` or ``double`` to ``long double`` is ranked as a
+ floating-point promotion (per C99) rather than as a floating-point conversion
+ (as in C++).
+
+* A conversion from a pointer of type ``T*`` to a pointer of type ``U*`` is
+ considered a pointer conversion (with conversion rank) if ``T`` and ``U`` are
+ compatible types.
+
+* A conversion from type ``T`` to a value of type ``U`` is permitted if ``T``
+ and ``U`` are compatible types. This conversion is given "conversion" rank.
+
+* If no viable candidates are otherwise available, we allow a conversion from a
+ pointer of type ``T*`` to a pointer of type ``U*``, where ``T`` and ``U`` are
+ incompatible. This conversion is ranked below all other types of conversions.
+ Please note: ``U`` lacking qualifiers that are present on ``T`` is sufficient
+ for ``T`` and ``U`` to be incompatible.
+
+The declaration of ``overloadable`` functions is restricted to function
+declarations and definitions. Most importantly, if any function with a given
+name is given the ``overloadable`` attribute, then all function declarations
+and definitions with that name (and in that scope) must have the
+``overloadable`` attribute. This rule even applies to redeclarations of
+functions whose original declaration had the ``overloadable`` attribute, e.g.,
+
+.. code-block:: c
+
+ int f(int) __attribute__((overloadable));
+ float f(float); // error: declaration of "f" must have the "overloadable" attribute
+
+ int g(int) __attribute__((overloadable));
+ int g(int) { } // error: redeclaration of "g" must also have the "overloadable" attribute
+
+Functions marked ``overloadable`` must have prototypes. Therefore, the
+following code is ill-formed:
+
+.. code-block:: c
+
+ int h() __attribute__((overloadable)); // error: h does not have a prototype
+
+However, ``overloadable`` functions are allowed to use a ellipsis even if there
+are no named parameters (as is permitted in C++). This feature is particularly
+useful when combined with the ``unavailable`` attribute:
+
+.. code-block:: c++
+
+ void honeypot(...) __attribute__((overloadable, unavailable)); // calling me is an error
+
+Functions declared with the ``overloadable`` attribute have their names mangled
+according to the same rules as C++ function names. For example, the three
+``tgsin`` functions in our motivating example get the mangled names
+``_Z5tgsinf``, ``_Z5tgsind``, and ``_Z5tgsine``, respectively. There are two
+caveats to this use of name mangling:
+
+* Future versions of Clang may change the name mangling of functions overloaded
+ in C, so you should not depend on an specific mangling. To be completely
+ safe, we strongly urge the use of ``static inline`` with ``overloadable``
+ functions.
+
+* The ``overloadable`` attribute has almost no meaning when used in C++,
+ because names will already be mangled and functions are already overloadable.
+ However, when an ``overloadable`` function occurs within an ``extern "C"``
+ linkage specification, it's name *will* be mangled in the same way as it
+ would in C.
+
+Query for this feature with ``__has_extension(attribute_overloadable)``.
+
+
+release_capability (release_shared_capability, clang::release_capability, clang::release_shared_capability)
+-----------------------------------------------------------------------------------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+Marks a function as releasing a capability.
+
+
+kernel
+------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+``__attribute__((kernel))`` is used to mark a ``kernel`` function in
+RenderScript.
+
+In RenderScript, ``kernel`` functions are used to express data-parallel
+computations. The RenderScript runtime efficiently parallelizes ``kernel``
+functions to run on computational resources such as multi-core CPUs and GPUs.
+See the RenderScript_ documentation for more information.
+
+.. _RenderScript: https://developer.android.com/guide/topics/renderscript/compute.html
+
+
+target (gnu::target)
+--------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+Clang supports the GNU style ``__attribute__((target("OPTIONS")))`` attribute.
+This attribute may be attached to a function definition and instructs
+the backend to use different code generation options than were passed on the
+command line.
+
+The current set of options correspond to the existing "subtarget features" for
+the target with or without a "-mno-" in front corresponding to the absence
+of the feature, as well as ``arch="CPU"`` which will change the default "CPU"
+for the function.
+
+Example "subtarget features" from the x86 backend include: "mmx", "sse", "sse4.2",
+"avx", "xop" and largely correspond to the machine specific options handled by
+the front end.
+
+
+try_acquire_capability (try_acquire_shared_capability, clang::try_acquire_capability, clang::try_acquire_shared_capability)
+---------------------------------------------------------------------------------------------------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+Marks a function that attempts to acquire a capability. This function may fail to
+actually acquire the capability; they accept a Boolean value determining
+whether acquiring the capability means success (true), or failing to acquire
+the capability means success (false).
+
+
+nodiscard, warn_unused_result, clang::warn_unused_result, gnu::warn_unused_result
+---------------------------------------------------------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+Clang supports the ability to diagnose when the results of a function call
+expression are discarded under suspicious circumstances. A diagnostic is
+generated when a function or its return type is marked with ``[[nodiscard]]``
+(or ``__attribute__((warn_unused_result))``) and the function call appears as a
+potentially-evaluated discarded-value expression that is not explicitly cast to
+`void`.
+
+.. code-block: c++
+ struct [[nodiscard]] error_info { /*...*/ };
+ error_info enable_missile_safety_mode();
+
+ void launch_missiles();
+ void test_missiles() {
+ enable_missile_safety_mode(); // diagnoses
+ launch_missiles();
+ }
+ error_info &foo();
+ void f() { foo(); } // Does not diagnose, error_info is a reference.
+
+
+xray_always_instrument (clang::xray_always_instrument), xray_never_instrument (clang::xray_never_instrument)
+------------------------------------------------------------------------------------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+``__attribute__((xray_always_instrument))`` or ``[[clang::xray_always_instrument]]`` is used to mark member functions (in C++), methods (in Objective C), and free functions (in C, C++, and Objective C) to be instrumented with XRay. This will cause the function to always have space at the beginning and exit points to allow for runtime patching.
+
+Conversely, ``__attribute__((xray_never_instrument))`` or ``[[clang::xray_never_instrument]]`` will inhibit the insertion of these instrumentation points.
+
+If a function has neither of these attributes, they become subject to the XRay heuristics used to determine whether a function should be instrumented or otherwise.
+
+
+Variable Attributes
+===================
+
+
+dllexport (gnu::dllexport)
+--------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","X","", ""
+
+The ``__declspec(dllexport)`` attribute declares a variable, function, or
+Objective-C interface to be exported from the module. It is available under the
+``-fdeclspec`` flag for compatibility with various compilers. The primary use
+is for COFF object files which explicitly specify what interfaces are available
+for external use. See the dllexport_ documentation on MSDN for more
+information.
+
+.. _dllexport: https://msdn.microsoft.com/en-us/library/3y1sfaz2.aspx
+
+
+dllimport (gnu::dllimport)
+--------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","X","", ""
+
+The ``__declspec(dllimport)`` attribute declares a variable, function, or
+Objective-C interface to be imported from an external module. It is available
+under the ``-fdeclspec`` flag for compatibility with various compilers. The
+primary use is for COFF object files which explicitly specify what interfaces
+are imported from external modules. See the dllimport_ documentation on MSDN
+for more information.
+
+.. _dllimport: https://msdn.microsoft.com/en-us/library/3y1sfaz2.aspx
+
+
+init_seg
+--------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "","","","", "X"
+
+The attribute applied by ``pragma init_seg()`` controls the section into
+which global initialization function pointers are emitted. It is only
+available with ``-fms-extensions``. Typically, this function pointer is
+emitted into ``.CRT$XCU`` on Windows. The user can change the order of
+initialization by using a different section name with the same
+``.CRT$XC`` prefix and a suffix that sorts lexicographically before or
+after the standard ``.CRT$XCU`` sections. See the init_seg_
+documentation on MSDN for more information.
+
+.. _init_seg: http://msdn.microsoft.com/en-us/library/7977wcck(v=vs.110).aspx
+
+
+nodebug (gnu::nodebug)
+----------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+The ``nodebug`` attribute allows you to suppress debugging information for a
+function or method, or for a variable that is not a parameter or a non-static
+data member.
+
+
+nosvm
+-----
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+OpenCL 2.0 supports the optional ``__attribute__((nosvm))`` qualifier for
+pointer variable. It informs the compiler that the pointer does not refer
+to a shared virtual memory region. See OpenCL v2.0 s6.7.2 for details.
+
+Since it is not widely used and has been removed from OpenCL 2.1, it is ignored
+by Clang.
+
+
+pass_object_size
+----------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+.. Note:: The mangling of functions with parameters that are annotated with
+ ``pass_object_size`` is subject to change. You can get around this by
+ using ``__asm__("foo")`` to explicitly name your functions, thus preserving
+ your ABI; also, non-overloadable C functions with ``pass_object_size`` are
+ not mangled.
+
+The ``pass_object_size(Type)`` attribute can be placed on function parameters to
+instruct clang to call ``__builtin_object_size(param, Type)`` at each callsite
+of said function, and implicitly pass the result of this call in as an invisible
+argument of type ``size_t`` directly after the parameter annotated with
+``pass_object_size``. Clang will also replace any calls to
+``__builtin_object_size(param, Type)`` in the function by said implicit
+parameter.
+
+Example usage:
+
+.. code-block:: c
+
+ int bzero1(char *const p __attribute__((pass_object_size(0))))
+ __attribute__((noinline)) {
+ int i = 0;
+ for (/**/; i < (int)__builtin_object_size(p, 0); ++i) {
+ p[i] = 0;
+ }
+ return i;
+ }
+
+ int main() {
+ char chars[100];
+ int n = bzero1(&chars[0]);
+ assert(n == sizeof(chars));
+ return 0;
+ }
+
+If successfully evaluating ``__builtin_object_size(param, Type)`` at the
+callsite is not possible, then the "failed" value is passed in. So, using the
+definition of ``bzero1`` from above, the following code would exit cleanly:
+
+.. code-block:: c
+
+ int main2(int argc, char *argv[]) {
+ int n = bzero1(argv);
+ assert(n == -1);
+ return 0;
+ }
+
+``pass_object_size`` plays a part in overload resolution. If two overload
+candidates are otherwise equally good, then the overload with one or more
+parameters with ``pass_object_size`` is preferred. This implies that the choice
+between two identical overloads both with ``pass_object_size`` on one or more
+parameters will always be ambiguous; for this reason, having two such overloads
+is illegal. For example:
+
+.. code-block:: c++
+
+ #define PS(N) __attribute__((pass_object_size(N)))
+ // OK
+ void Foo(char *a, char *b); // Overload A
+ // OK -- overload A has no parameters with pass_object_size.
+ void Foo(char *a PS(0), char *b PS(0)); // Overload B
+ // Error -- Same signature (sans pass_object_size) as overload B, and both
+ // overloads have one or more parameters with the pass_object_size attribute.
+ void Foo(void *a PS(0), void *b);
+
+ // OK
+ void Bar(void *a PS(0)); // Overload C
+ // OK
+ void Bar(char *c PS(1)); // Overload D
+
+ void main() {
+ char known[10], *unknown;
+ Foo(unknown, unknown); // Calls overload B
+ Foo(known, unknown); // Calls overload B
+ Foo(unknown, known); // Calls overload B
+ Foo(known, known); // Calls overload B
+
+ Bar(known); // Calls overload D
+ Bar(unknown); // Calls overload D
+ }
+
+Currently, ``pass_object_size`` is a bit restricted in terms of its usage:
+
+* Only one use of ``pass_object_size`` is allowed per parameter.
+
+* It is an error to take the address of a function with ``pass_object_size`` on
+ any of its parameters. If you wish to do this, you can create an overload
+ without ``pass_object_size`` on any parameters.
+
+* It is an error to apply the ``pass_object_size`` attribute to parameters that
+ are not pointers. Additionally, any parameter that ``pass_object_size`` is
+ applied to must be marked ``const`` at its function's definition.
+
+
+require_constant_initialization (clang::require_constant_initialization)
+------------------------------------------------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+This attribute specifies that the variable to which it is attached is intended
+to have a `constant initializer <http://en.cppreference.com/w/cpp/language/constant_initialization>`_
+according to the rules of [basic.start.static]. The variable is required to
+have static or thread storage duration. If the initialization of the variable
+is not a constant initializer an error will be produced. This attribute may
+only be used in C++.
+
+Note that in C++03 strict constant expression checking is not done. Instead
+the attribute reports if Clang can emit the variable as a constant, even if it's
+not technically a 'constant initializer'. This behavior is non-portable.
+
+Static storage duration variables with constant initializers avoid hard-to-find
+bugs caused by the indeterminate order of dynamic initialization. They can also
+be safely used during dynamic initialization across translation units.
+
+This attribute acts as a compile time assertion that the requirements
+for constant initialization have been met. Since these requirements change
+between dialects and have subtle pitfalls it's important to fail fast instead
+of silently falling back on dynamic initialization.
+
+.. code-block:: c++
+
+ // -std=c++14
+ #define SAFE_STATIC [[clang::require_constant_initialization]]
+ struct T {
+ constexpr T(int) {}
+ ~T(); // non-trivial
+ };
+ SAFE_STATIC T x = {42}; // Initialization OK. Doesn't check destructor.
+ SAFE_STATIC T y = 42; // error: variable does not have a constant initializer
+ // copy initialization is not a constant expression on a non-literal type.
+
+
+section (gnu::section, __declspec(allocate))
+--------------------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","X","", ""
+
+The ``section`` attribute allows you to specify a specific section a
+global variable or function should be in after translation.
+
+
+swiftcall (gnu::swiftcall)
+--------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+The ``swiftcall`` attribute indicates that a function should be called
+using the Swift calling convention for a function or function pointer.
+
+The lowering for the Swift calling convention, as described by the Swift
+ABI documentation, occurs in multiple phases. The first, "high-level"
+phase breaks down the formal parameters and results into innately direct
+and indirect components, adds implicit paraameters for the generic
+signature, and assigns the context and error ABI treatments to parameters
+where applicable. The second phase breaks down the direct parameters
+and results from the first phase and assigns them to registers or the
+stack. The ``swiftcall`` convention only handles this second phase of
+lowering; the C function type must accurately reflect the results
+of the first phase, as follows:
+
+- Results classified as indirect by high-level lowering should be
+ represented as parameters with the ``swift_indirect_result`` attribute.
+
+- Results classified as direct by high-level lowering should be represented
+ as follows:
+
+ - First, remove any empty direct results.
+
+ - If there are no direct results, the C result type should be ``void``.
+
+ - If there is one direct result, the C result type should be a type with
+ the exact layout of that result type.
+
+ - If there are a multiple direct results, the C result type should be
+ a struct type with the exact layout of a tuple of those results.
+
+- Parameters classified as indirect by high-level lowering should be
+ represented as parameters of pointer type.
+
+- Parameters classified as direct by high-level lowering should be
+ omitted if they are empty types; otherwise, they should be represented
+ as a parameter type with a layout exactly matching the layout of the
+ Swift parameter type.
+
+- The context parameter, if present, should be represented as a trailing
+ parameter with the ``swift_context`` attribute.
+
+- The error result parameter, if present, should be represented as a
+ trailing parameter (always following a context parameter) with the
+ ``swift_error_result`` attribute.
+
+``swiftcall`` does not support variadic arguments or unprototyped functions.
+
+The parameter ABI treatment attributes are aspects of the function type.
+A function type which which applies an ABI treatment attribute to a
+parameter is a different type from an otherwise-identical function type
+that does not. A single parameter may not have multiple ABI treatment
+attributes.
+
+Support for this feature is target-dependent, although it should be
+supported on every target that Swift supports. Query for this support
+with ``__has_attribute(swiftcall)``. This implies support for the
+``swift_context``, ``swift_error_result``, and ``swift_indirect_result``
+attributes.
+
+
+swift_context (gnu::swift_context)
+----------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+The ``swift_context`` attribute marks a parameter of a ``swiftcall``
+function as having the special context-parameter ABI treatment.
+
+This treatment generally passes the context value in a special register
+which is normally callee-preserved.
+
+A ``swift_context`` parameter must either be the last parameter or must be
+followed by a ``swift_error_result`` parameter (which itself must always be
+the last parameter).
+
+A context parameter must have pointer or reference type.
+
+
+swift_error_result (gnu::swift_error_result)
+--------------------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+The ``swift_error_result`` attribute marks a parameter of a ``swiftcall``
+function as having the special error-result ABI treatment.
+
+This treatment generally passes the underlying error value in and out of
+the function through a special register which is normally callee-preserved.
+This is modeled in C by pretending that the register is addressable memory:
+
+- The caller appears to pass the address of a variable of pointer type.
+ The current value of this variable is copied into the register before
+ the call; if the call returns normally, the value is copied back into the
+ variable.
+
+- The callee appears to receive the address of a variable. This address
+ is actually a hidden location in its own stack, initialized with the
+ value of the register upon entry. When the function returns normally,
+ the value in that hidden location is written back to the register.
+
+A ``swift_error_result`` parameter must be the last parameter, and it must be
+preceded by a ``swift_context`` parameter.
+
+A ``swift_error_result`` parameter must have type ``T**`` or ``T*&`` for some
+type T. Note that no qualifiers are permitted on the intermediate level.
+
+It is undefined behavior if the caller does not pass a pointer or
+reference to a valid object.
+
+The standard convention is that the error value itself (that is, the
+value stored in the apparent argument) will be null upon function entry,
+but this is not enforced by the ABI.
+
+
+swift_indirect_result (gnu::swift_indirect_result)
+--------------------------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+The ``swift_indirect_result`` attribute marks a parameter of a ``swiftcall``
+function as having the special indirect-result ABI treatment.
+
+This treatment gives the parameter the target's normal indirect-result
+ABI treatment, which may involve passing it differently from an ordinary
+parameter. However, only the first indirect result will receive this
+treatment. Furthermore, low-level lowering may decide that a direct result
+must be returned indirectly; if so, this will take priority over the
+``swift_indirect_result`` parameters.
+
+A ``swift_indirect_result`` parameter must either be the first parameter or
+follow another ``swift_indirect_result`` parameter.
+
+A ``swift_indirect_result`` parameter must have type ``T*`` or ``T&`` for
+some object type ``T``. If ``T`` is a complete type at the point of
+definition of a function, it is undefined behavior if the argument
+value does not point to storage of adequate size and alignment for a
+value of type ``T``.
+
+Making indirect results explicit in the signature allows C functions to
+directly construct objects into them without relying on language
+optimizations like C++'s named return value optimization (NRVO).
+
+
+tls_model (gnu::tls_model)
+--------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+The ``tls_model`` attribute allows you to specify which thread-local storage
+model to use. It accepts the following strings:
+
+* global-dynamic
+* local-dynamic
+* initial-exec
+* local-exec
+
+TLS models are mutually exclusive.
+
+
+thread
+------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "","","X","", ""
+
+The ``__declspec(thread)`` attribute declares a variable with thread local
+storage. It is available under the ``-fms-extensions`` flag for MSVC
+compatibility. See the documentation for `__declspec(thread)`_ on MSDN.
+
+.. _`__declspec(thread)`: http://msdn.microsoft.com/en-us/library/9w1sdazb.aspx
+
+In Clang, ``__declspec(thread)`` is generally equivalent in functionality to the
+GNU ``__thread`` keyword. The variable must not have a destructor and must have
+a constant initializer, if any. The attribute only applies to variables
+declared with static storage duration, such as globals, class static data
+members, and static locals.
+
+
+maybe_unused, unused, gnu::unused
+---------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+When passing the ``-Wunused`` flag to Clang, entities that are unused by the
+program may be diagnosed. The ``[[maybe_unused]]`` (or
+``__attribute__((unused))``) attribute can be used to silence such diagnostics
+when the entity cannot be removed. For instance, a local variable may exist
+solely for use in an ``assert()`` statement, which makes the local variable
+unused when ``NDEBUG`` is defined.
+
+The attribute may be applied to the declaration of a class, a typedef, a
+variable, a function or method, a function parameter, an enumeration, an
+enumerator, a non-static data member, or a label.
+
+.. code-block: c++
+ #include <cassert>
+
+ [[maybe_unused]] void f([[maybe_unused]] bool thing1,
+ [[maybe_unused]] bool thing2) {
+ [[maybe_unused]] bool b = thing1 && thing2;
+ assert(b);
+ }
+
+
+Type Attributes
+===============
+
+
+align_value
+-----------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+The align_value attribute can be added to the typedef of a pointer type or the
+declaration of a variable of pointer or reference type. It specifies that the
+pointer will point to, or the reference will bind to, only objects with at
+least the provided alignment. This alignment value must be some positive power
+of 2.
+
+ .. code-block:: c
+
+ typedef double * aligned_double_ptr __attribute__((align_value(64)));
+ void foo(double & x __attribute__((align_value(128)),
+ aligned_double_ptr y) { ... }
+
+If the pointer value does not have the specified alignment at runtime, the
+behavior of the program is undefined.
+
+
+empty_bases
+-----------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "","","X","", ""
+
+The empty_bases attribute permits the compiler to utilize the
+empty-base-optimization more frequently.
+This attribute only applies to struct, class, and union types.
+It is only supported when using the Microsoft C++ ABI.
+
+
+flag_enum
+---------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+This attribute can be added to an enumerator to signal to the compiler that it
+is intended to be used as a flag type. This will cause the compiler to assume
+that the range of the type includes all of the values that you can get by
+manipulating bits of the enumerator when issuing warnings.
+
+
+lto_visibility_public (clang::lto_visibility_public)
+----------------------------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "","X","","", ""
+
+See :doc:`LTOVisibility`.
+
+
+layout_version
+--------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "","","X","", ""
+
+The layout_version attribute requests that the compiler utilize the class
+layout rules of a particular compiler version.
+This attribute only applies to struct, class, and union types.
+It is only supported when using the Microsoft C++ ABI.
+
+
+__single_inhertiance, __multiple_inheritance, __virtual_inheritance
+-------------------------------------------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "","","","X", ""
+
+This collection of keywords is enabled under ``-fms-extensions`` and controls
+the pointer-to-member representation used on ``*-*-win32`` targets.
+
+The ``*-*-win32`` targets utilize a pointer-to-member representation which
+varies in size and alignment depending on the definition of the underlying
+class.
+
+However, this is problematic when a forward declaration is only available and
+no definition has been made yet. In such cases, Clang is forced to utilize the
+most general representation that is available to it.
+
+These keywords make it possible to use a pointer-to-member representation other
+than the most general one regardless of whether or not the definition will ever
+be present in the current translation unit.
+
+This family of keywords belong between the ``class-key`` and ``class-name``:
+
+.. code-block:: c++
+
+ struct __single_inheritance S;
+ int S::*i;
+ struct S {};
+
+This keyword can be applied to class templates but only has an effect when used
+on full specializations:
+
+.. code-block:: c++
+
+ template <typename T, typename U> struct __single_inheritance A; // warning: inheritance model ignored on primary template
+ template <typename T> struct __multiple_inheritance A<T, T>; // warning: inheritance model ignored on partial specialization
+ template <> struct __single_inheritance A<int, float>;
+
+Note that choosing an inheritance model less general than strictly necessary is
+an error:
+
+.. code-block:: c++
+
+ struct __multiple_inheritance S; // error: inheritance model does not match definition
+ int S::*i;
+ struct S {};
+
+
+novtable
+--------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "","","X","", ""
+
+This attribute can be added to a class declaration or definition to signal to
+the compiler that constructors and destructors will not reference the virtual
+function table. It is only supported when using the Microsoft C++ ABI.
+
+
+objc_subclassing_restricted
+---------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+This attribute can be added to an Objective-C ``@interface`` declaration to
+ensure that this class cannot be subclassed.
+
+
+transparent_union (gnu::transparent_union)
+------------------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+This attribute can be applied to a union to change the behaviour of calls to
+functions that have an argument with a transparent union type. The compiler
+behaviour is changed in the following manner:
+
+- A value whose type is any member of the transparent union can be passed as an
+ argument without the need to cast that value.
+
+- The argument is passed to the function using the calling convention of the
+ first member of the transparent union. Consequently, all the members of the
+ transparent union should have the same calling convention as its first member.
+
+Transparent unions are not supported in C++.
+
+
+Statement Attributes
+====================
+
+
+fallthrough, clang::fallthrough
+-------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "","X","","", ""
+
+The ``fallthrough`` (or ``clang::fallthrough``) attribute is used
+to annotate intentional fall-through
+between switch labels. It can only be applied to a null statement placed at a
+point of execution between any statement and the next switch label. It is
+common to mark these places with a specific comment, but this attribute is
+meant to replace comments with a more strict annotation, which can be checked
+by the compiler. This attribute doesn't change semantics of the code and can
+be used wherever an intended fall-through occurs. It is designed to mimic
+control-flow statements like ``break;``, so it can be placed in most places
+where ``break;`` can, but only if there are no statements on the execution path
+between it and the next switch label.
+
+By default, Clang does not warn on unannotated fallthrough from one ``switch``
+case to another. Diagnostics on fallthrough without a corresponding annotation
+can be enabled with the ``-Wimplicit-fallthrough`` argument.
+
+Here is an example:
+
+.. code-block:: c++
+
+ // compile with -Wimplicit-fallthrough
+ switch (n) {
+ case 22:
+ case 33: // no warning: no statements between case labels
+ f();
+ case 44: // warning: unannotated fall-through
+ g();
+ [[clang::fallthrough]];
+ case 55: // no warning
+ if (x) {
+ h();
+ break;
+ }
+ else {
+ i();
+ [[clang::fallthrough]];
+ }
+ case 66: // no warning
+ p();
+ [[clang::fallthrough]]; // warning: fallthrough annotation does not
+ // directly precede case label
+ q();
+ case 77: // warning: unannotated fall-through
+ r();
+ }
+
+
+#pragma clang loop
+------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "","","","", "X"
+
+The ``#pragma clang loop`` directive allows loop optimization hints to be
+specified for the subsequent loop. The directive allows vectorization,
+interleaving, and unrolling to be enabled or disabled. Vector width as well
+as interleave and unrolling count can be manually specified. See
+`language extensions
+<http://clang.llvm.org/docs/LanguageExtensions.html#extensions-for-loop-hint-optimizations>`_
+for details.
+
+
+#pragma unroll, #pragma nounroll
+--------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "","","","", "X"
+
+Loop unrolling optimization hints can be specified with ``#pragma unroll`` and
+``#pragma nounroll``. The pragma is placed immediately before a for, while,
+do-while, or c++11 range-based for loop.
+
+Specifying ``#pragma unroll`` without a parameter directs the loop unroller to
+attempt to fully unroll the loop if the trip count is known at compile time and
+attempt to partially unroll the loop if the trip count is not known at compile
+time:
+
+.. code-block:: c++
+
+ #pragma unroll
+ for (...) {
+ ...
+ }
+
+Specifying the optional parameter, ``#pragma unroll _value_``, directs the
+unroller to unroll the loop ``_value_`` times. The parameter may optionally be
+enclosed in parentheses:
+
+.. code-block:: c++
+
+ #pragma unroll 16
+ for (...) {
+ ...
+ }
+
+ #pragma unroll(16)
+ for (...) {
+ ...
+ }
+
+Specifying ``#pragma nounroll`` indicates that the loop should not be unrolled:
+
+.. code-block:: c++
+
+ #pragma nounroll
+ for (...) {
+ ...
+ }
+
+``#pragma unroll`` and ``#pragma unroll _value_`` have identical semantics to
+``#pragma clang loop unroll(full)`` and
+``#pragma clang loop unroll_count(_value_)`` respectively. ``#pragma nounroll``
+is equivalent to ``#pragma clang loop unroll(disable)``. See
+`language extensions
+<http://clang.llvm.org/docs/LanguageExtensions.html#extensions-for-loop-hint-optimizations>`_
+for further details including limitations of the unroll hints.
+
+
+__read_only, __write_only, __read_write (read_only, write_only, read_write)
+---------------------------------------------------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "","","","X", ""
+
+The access qualifiers must be used with image object arguments or pipe arguments
+to declare if they are being read or written by a kernel or function.
+
+The read_only/__read_only, write_only/__write_only and read_write/__read_write
+names are reserved for use as access qualifiers and shall not be used otherwise.
+
+.. code-block:: c
+
+ kernel void
+ foo (read_only image2d_t imageA,
+ write_only image2d_t imageB) {
+ ...
+ }
+
+In the above example imageA is a read-only 2D image object, and imageB is a
+write-only 2D image object.
+
+The read_write (or __read_write) qualifier can not be used with pipe.
+
+More details can be found in the OpenCL C language Spec v2.0, Section 6.6.
+
+
+__attribute__((opencl_unroll_hint))
+-----------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+The opencl_unroll_hint attribute qualifier can be used to specify that a loop
+(for, while and do loops) can be unrolled. This attribute qualifier can be
+used to specify full unrolling or partial unrolling by a specified amount.
+This is a compiler hint and the compiler may ignore this directive. See
+`OpenCL v2.0 <https://www.khronos.org/registry/cl/specs/opencl-2.0.pdf>`_
+s6.11.5 for details.
+
+
+Type Safety Checking
+====================
+Clang supports additional attributes to enable checking type safety properties
+that can't be enforced by the C type system. To see warnings produced by these
+checks, ensure that -Wtype-safety is enabled. Use cases include:
+
+* MPI library implementations, where these attributes enable checking that
+ the buffer type matches the passed ``MPI_Datatype``;
+* for HDF5 library there is a similar use case to MPI;
+* checking types of variadic functions' arguments for functions like
+ ``fcntl()`` and ``ioctl()``.
+
+You can detect support for these attributes with ``__has_attribute()``. For
+example:
+
+.. code-block:: c++
+
+ #if defined(__has_attribute)
+ # if __has_attribute(argument_with_type_tag) && \
+ __has_attribute(pointer_with_type_tag) && \
+ __has_attribute(type_tag_for_datatype)
+ # define ATTR_MPI_PWT(buffer_idx, type_idx) __attribute__((pointer_with_type_tag(mpi,buffer_idx,type_idx)))
+ /* ... other macros ... */
+ # endif
+ #endif
+
+ #if !defined(ATTR_MPI_PWT)
+ # define ATTR_MPI_PWT(buffer_idx, type_idx)
+ #endif
+
+ int MPI_Send(void *buf, int count, MPI_Datatype datatype /*, other args omitted */)
+ ATTR_MPI_PWT(1,3);
+
+argument_with_type_tag
+----------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+Use ``__attribute__((argument_with_type_tag(arg_kind, arg_idx,
+type_tag_idx)))`` on a function declaration to specify that the function
+accepts a type tag that determines the type of some other argument.
+
+This attribute is primarily useful for checking arguments of variadic functions
+(``pointer_with_type_tag`` can be used in most non-variadic cases).
+
+In the attribute prototype above:
+ * ``arg_kind`` is an identifier that should be used when annotating all
+ applicable type tags.
+ * ``arg_idx`` provides the position of a function argument. The expected type of
+ this function argument will be determined by the function argument specified
+ by ``type_tag_idx``. In the code example below, "3" means that the type of the
+ function's third argument will be determined by ``type_tag_idx``.
+ * ``type_tag_idx`` provides the position of a function argument. This function
+ argument will be a type tag. The type tag will determine the expected type of
+ the argument specified by ``arg_idx``. In the code example below, "2" means
+ that the type tag associated with the function's second argument should agree
+ with the type of the argument specified by ``arg_idx``.
+
+For example:
+
+.. code-block:: c++
+
+ int fcntl(int fd, int cmd, ...)
+ __attribute__(( argument_with_type_tag(fcntl,3,2) ));
+ // The function's second argument will be a type tag; this type tag will
+ // determine the expected type of the function's third argument.
+
+
+pointer_with_type_tag
+---------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+Use ``__attribute__((pointer_with_type_tag(ptr_kind, ptr_idx, type_tag_idx)))``
+on a function declaration to specify that the function accepts a type tag that
+determines the pointee type of some other pointer argument.
+
+In the attribute prototype above:
+ * ``ptr_kind`` is an identifier that should be used when annotating all
+ applicable type tags.
+ * ``ptr_idx`` provides the position of a function argument; this function
+ argument will have a pointer type. The expected pointee type of this pointer
+ type will be determined by the function argument specified by
+ ``type_tag_idx``. In the code example below, "1" means that the pointee type
+ of the function's first argument will be determined by ``type_tag_idx``.
+ * ``type_tag_idx`` provides the position of a function argument; this function
+ argument will be a type tag. The type tag will determine the expected pointee
+ type of the pointer argument specified by ``ptr_idx``. In the code example
+ below, "3" means that the type tag associated with the function's third
+ argument should agree with the pointee type of the pointer argument specified
+ by ``ptr_idx``.
+
+For example:
+
+.. code-block:: c++
+
+ typedef int MPI_Datatype;
+ int MPI_Send(void *buf, int count, MPI_Datatype datatype /*, other args omitted */)
+ __attribute__(( pointer_with_type_tag(mpi,1,3) ));
+ // The function's 3rd argument will be a type tag; this type tag will
+ // determine the expected pointee type of the function's 1st argument.
+
+
+type_tag_for_datatype
+---------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+When declaring a variable, use
+``__attribute__((type_tag_for_datatype(kind, type)))`` to create a type tag that
+is tied to the ``type`` argument given to the attribute.
+
+In the attribute prototype above:
+ * ``kind`` is an identifier that should be used when annotating all applicable
+ type tags.
+ * ``type`` indicates the name of the type.
+
+Clang supports annotating type tags of two forms.
+
+ * **Type tag that is a reference to a declared identifier.**
+ Use ``__attribute__((type_tag_for_datatype(kind, type)))`` when declaring that
+ identifier:
+
+ .. code-block:: c++
+
+ typedef int MPI_Datatype;
+ extern struct mpi_datatype mpi_datatype_int
+ __attribute__(( type_tag_for_datatype(mpi,int) ));
+ #define MPI_INT ((MPI_Datatype) &mpi_datatype_int)
+ // &mpi_datatype_int is a type tag. It is tied to type "int".
+
+ * **Type tag that is an integral literal.**
+ Declare a ``static const`` variable with an initializer value and attach
+ ``__attribute__((type_tag_for_datatype(kind, type)))`` on that declaration:
+
+ .. code-block:: c++
+
+ typedef int MPI_Datatype;
+ static const MPI_Datatype mpi_datatype_int
+ __attribute__(( type_tag_for_datatype(mpi,int) )) = 42;
+ #define MPI_INT ((MPI_Datatype) 42)
+ // The number 42 is a type tag. It is tied to type "int".
+
+
+The ``type_tag_for_datatype`` attribute also accepts an optional third argument
+that determines how the type of the function argument specified by either
+``arg_idx`` or ``ptr_idx`` is compared against the type associated with the type
+tag. (Recall that for the ``argument_with_type_tag`` attribute, the type of the
+function argument specified by ``arg_idx`` is compared against the type
+associated with the type tag. Also recall that for the ``pointer_with_type_tag``
+attribute, the pointee type of the function argument specified by ``ptr_idx`` is
+compared against the type associated with the type tag.) There are two supported
+values for this optional third argument:
+
+ * ``layout_compatible`` will cause types to be compared according to
+ layout-compatibility rules (In C++11 [class.mem] p 17, 18, see the
+ layout-compatibility rules for two standard-layout struct types and for two
+ standard-layout union types). This is useful when creating a type tag
+ associated with a struct or union type. For example:
+
+ .. code-block:: c++
+
+ /* In mpi.h */
+ typedef int MPI_Datatype;
+ struct internal_mpi_double_int { double d; int i; };
+ extern struct mpi_datatype mpi_datatype_double_int
+ __attribute__(( type_tag_for_datatype(mpi,
+ struct internal_mpi_double_int, layout_compatible) ));
+
+ #define MPI_DOUBLE_INT ((MPI_Datatype) &mpi_datatype_double_int)
+
+ int MPI_Send(void *buf, int count, MPI_Datatype datatype, ...)
+ __attribute__(( pointer_with_type_tag(mpi,1,3) ));
+
+ /* In user code */
+ struct my_pair { double a; int b; };
+ struct my_pair *buffer;
+ MPI_Send(buffer, 1, MPI_DOUBLE_INT /*, ... */); // no warning because the
+ // layout of my_pair is
+ // compatible with that of
+ // internal_mpi_double_int
+
+ struct my_int_pair { int a; int b; }
+ struct my_int_pair *buffer2;
+ MPI_Send(buffer2, 1, MPI_DOUBLE_INT /*, ... */); // warning because the
+ // layout of my_int_pair
+ // does not match that of
+ // internal_mpi_double_int
+
+ * ``must_be_null`` specifies that the function argument specified by either
+ ``arg_idx`` (for the ``argument_with_type_tag`` attribute) or ``ptr_idx`` (for
+ the ``pointer_with_type_tag`` attribute) should be a null pointer constant.
+ The second argument to the ``type_tag_for_datatype`` attribute is ignored. For
+ example:
+
+ .. code-block:: c++
+
+ /* In mpi.h */
+ typedef int MPI_Datatype;
+ extern struct mpi_datatype mpi_datatype_null
+ __attribute__(( type_tag_for_datatype(mpi, void, must_be_null) ));
+
+ #define MPI_DATATYPE_NULL ((MPI_Datatype) &mpi_datatype_null)
+ int MPI_Send(void *buf, int count, MPI_Datatype datatype, ...)
+ __attribute__(( pointer_with_type_tag(mpi,1,3) ));
+
+ /* In user code */
+ struct my_pair { double a; int b; };
+ struct my_pair *buffer;
+ MPI_Send(buffer, 1, MPI_DATATYPE_NULL /*, ... */); // warning: MPI_DATATYPE_NULL
+ // was specified but buffer
+ // is not a null pointer
+
+
+AMD GPU Attributes
+==================
+
+
+amdgpu_flat_work_group_size
+---------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+The flat work-group size is the number of work-items in the work-group size
+specified when the kernel is dispatched. It is the product of the sizes of the
+x, y, and z dimension of the work-group.
+
+Clang supports the
+``__attribute__((amdgpu_flat_work_group_size(<min>, <max>)))`` attribute for the
+AMDGPU target. This attribute may be attached to a kernel function definition
+and is an optimization hint.
+
+``<min>`` parameter specifies the minimum flat work-group size, and ``<max>``
+parameter specifies the maximum flat work-group size (must be greater than
+``<min>``) to which all dispatches of the kernel will conform. Passing ``0, 0``
+as ``<min>, <max>`` implies the default behavior (``128, 256``).
+
+If specified, the AMDGPU target backend might be able to produce better machine
+code for barriers and perform scratch promotion by estimating available group
+segment size.
+
+An error will be given if:
+ - Specified values violate subtarget specifications;
+ - Specified values are not compatible with values provided through other
+ attributes.
+
+
+amdgpu_num_sgpr
+---------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+Clang supports the ``__attribute__((amdgpu_num_sgpr(<num_sgpr>)))`` and
+``__attribute__((amdgpu_num_vgpr(<num_vgpr>)))`` attributes for the AMDGPU
+target. These attributes may be attached to a kernel function definition and are
+an optimization hint.
+
+If these attributes are specified, then the AMDGPU target backend will attempt
+to limit the number of SGPRs and/or VGPRs used to the specified value(s). The
+number of used SGPRs and/or VGPRs may further be rounded up to satisfy the
+allocation requirements or constraints of the subtarget. Passing ``0`` as
+``num_sgpr`` and/or ``num_vgpr`` implies the default behavior (no limits).
+
+These attributes can be used to test the AMDGPU target backend. It is
+recommended that the ``amdgpu_waves_per_eu`` attribute be used to control
+resources such as SGPRs and VGPRs since it is aware of the limits for different
+subtargets.
+
+An error will be given if:
+ - Specified values violate subtarget specifications;
+ - Specified values are not compatible with values provided through other
+ attributes;
+ - The AMDGPU target backend is unable to create machine code that can meet the
+ request.
+
+
+amdgpu_num_vgpr
+---------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+Clang supports the ``__attribute__((amdgpu_num_sgpr(<num_sgpr>)))`` and
+``__attribute__((amdgpu_num_vgpr(<num_vgpr>)))`` attributes for the AMDGPU
+target. These attributes may be attached to a kernel function definition and are
+an optimization hint.
+
+If these attributes are specified, then the AMDGPU target backend will attempt
+to limit the number of SGPRs and/or VGPRs used to the specified value(s). The
+number of used SGPRs and/or VGPRs may further be rounded up to satisfy the
+allocation requirements or constraints of the subtarget. Passing ``0`` as
+``num_sgpr`` and/or ``num_vgpr`` implies the default behavior (no limits).
+
+These attributes can be used to test the AMDGPU target backend. It is
+recommended that the ``amdgpu_waves_per_eu`` attribute be used to control
+resources such as SGPRs and VGPRs since it is aware of the limits for different
+subtargets.
+
+An error will be given if:
+ - Specified values violate subtarget specifications;
+ - Specified values are not compatible with values provided through other
+ attributes;
+ - The AMDGPU target backend is unable to create machine code that can meet the
+ request.
+
+
+amdgpu_waves_per_eu
+-------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+A compute unit (CU) is responsible for executing the wavefronts of a work-group.
+It is composed of one or more execution units (EU), which are responsible for
+executing the wavefronts. An EU can have enough resources to maintain the state
+of more than one executing wavefront. This allows an EU to hide latency by
+switching between wavefronts in a similar way to symmetric multithreading on a
+CPU. In order to allow the state for multiple wavefronts to fit on an EU, the
+resources used by a single wavefront have to be limited. For example, the number
+of SGPRs and VGPRs. Limiting such resources can allow greater latency hiding,
+but can result in having to spill some register state to memory.
+
+Clang supports the ``__attribute__((amdgpu_waves_per_eu(<min>[, <max>])))``
+attribute for the AMDGPU target. This attribute may be attached to a kernel
+function definition and is an optimization hint.
+
+``<min>`` parameter specifies the requested minimum number of waves per EU, and
+*optional* ``<max>`` parameter specifies the requested maximum number of waves
+per EU (must be greater than ``<min>`` if specified). If ``<max>`` is omitted,
+then there is no restriction on the maximum number of waves per EU other than
+the one dictated by the hardware for which the kernel is compiled. Passing
+``0, 0`` as ``<min>, <max>`` implies the default behavior (no limits).
+
+If specified, this attribute allows an advanced developer to tune the number of
+wavefronts that are capable of fitting within the resources of an EU. The AMDGPU
+target backend can use this information to limit resources, such as number of
+SGPRs, number of VGPRs, size of available group and private memory segments, in
+such a way that guarantees that at least ``<min>`` wavefronts and at most
+``<max>`` wavefronts are able to fit within the resources of an EU. Requesting
+more wavefronts can hide memory latency but limits available registers which
+can result in spilling. Requesting fewer wavefronts can help reduce cache
+thrashing, but can reduce memory latency hiding.
+
+This attribute controls the machine code generated by the AMDGPU target backend
+to ensure it is capable of meeting the requested values. However, when the
+kernel is executed, there may be other reasons that prevent meeting the request,
+for example, there may be wavefronts from other kernels executing on the EU.
+
+An error will be given if:
+ - Specified values violate subtarget specifications;
+ - Specified values are not compatible with values provided through other
+ attributes;
+ - The AMDGPU target backend is unable to create machine code that can meet the
+ request.
+
+
+Calling Conventions
+===================
+Clang supports several different calling conventions, depending on the target
+platform and architecture. The calling convention used for a function determines
+how parameters are passed, how results are returned to the caller, and other
+low-level details of calling a function.
+
+fastcall (gnu::fastcall, __fastcall, _fastcall)
+-----------------------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","X", ""
+
+On 32-bit x86 targets, this attribute changes the calling convention of a
+function to use ECX and EDX as register parameters and clear parameters off of
+the stack on return. This convention does not support variadic calls or
+unprototyped functions in C, and has no effect on x86_64 targets. This calling
+convention is supported primarily for compatibility with existing code. Users
+seeking register parameters should use the ``regparm`` attribute, which does
+not require callee-cleanup. See the documentation for `__fastcall`_ on MSDN.
+
+.. _`__fastcall`: http://msdn.microsoft.com/en-us/library/6xa169sk.aspx
+
+
+ms_abi (gnu::ms_abi)
+--------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+On non-Windows x86_64 targets, this attribute changes the calling convention of
+a function to match the default convention used on Windows x86_64. This
+attribute has no effect on Windows targets or non-x86_64 targets.
+
+
+pcs (gnu::pcs)
+--------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+On ARM targets, this attribute can be used to select calling conventions
+similar to ``stdcall`` on x86. Valid parameter values are "aapcs" and
+"aapcs-vfp".
+
+
+preserve_all
+------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+On X86-64 and AArch64 targets, this attribute changes the calling convention of
+a function. The ``preserve_all`` calling convention attempts to make the code
+in the caller even less intrusive than the ``preserve_most`` calling convention.
+This calling convention also behaves identical to the ``C`` calling convention
+on how arguments and return values are passed, but it uses a different set of
+caller/callee-saved registers. This removes the burden of saving and
+recovering a large register set before and after the call in the caller. If
+the arguments are passed in callee-saved registers, then they will be
+preserved by the callee across the call. This doesn't apply for values
+returned in callee-saved registers.
+
+- On X86-64 the callee preserves all general purpose registers, except for
+ R11. R11 can be used as a scratch register. Furthermore it also preserves
+ all floating-point registers (XMMs/YMMs).
+
+The idea behind this convention is to support calls to runtime functions
+that don't need to call out to any other functions.
+
+This calling convention, like the ``preserve_most`` calling convention, will be
+used by a future version of the Objective-C runtime and should be considered
+experimental at this time.
+
+
+preserve_most
+-------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+On X86-64 and AArch64 targets, this attribute changes the calling convention of
+a function. The ``preserve_most`` calling convention attempts to make the code
+in the caller as unintrusive as possible. This convention behaves identically
+to the ``C`` calling convention on how arguments and return values are passed,
+but it uses a different set of caller/callee-saved registers. This alleviates
+the burden of saving and recovering a large register set before and after the
+call in the caller. If the arguments are passed in callee-saved registers,
+then they will be preserved by the callee across the call. This doesn't
+apply for values returned in callee-saved registers.
+
+- On X86-64 the callee preserves all general purpose registers, except for
+ R11. R11 can be used as a scratch register. Floating-point registers
+ (XMMs/YMMs) are not preserved and need to be saved by the caller.
+
+The idea behind this convention is to support calls to runtime functions
+that have a hot path and a cold path. The hot path is usually a small piece
+of code that doesn't use many registers. The cold path might need to call out to
+another function and therefore only needs to preserve the caller-saved
+registers, which haven't already been saved by the caller. The
+`preserve_most` calling convention is very similar to the ``cold`` calling
+convention in terms of caller/callee-saved registers, but they are used for
+different types of function calls. ``coldcc`` is for function calls that are
+rarely executed, whereas `preserve_most` function calls are intended to be
+on the hot path and definitely executed a lot. Furthermore ``preserve_most``
+doesn't prevent the inliner from inlining the function call.
+
+This calling convention will be used by a future version of the Objective-C
+runtime and should therefore still be considered experimental at this time.
+Although this convention was created to optimize certain runtime calls to
+the Objective-C runtime, it is not limited to this runtime and might be used
+by other runtimes in the future too. The current implementation only
+supports X86-64 and AArch64, but the intention is to support more architectures
+in the future.
+
+
+regcall (gnu::regcall, __regcall)
+---------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","X", ""
+
+On x86 targets, this attribute changes the calling convention to
+`__regcall`_ convention. This convention aims to pass as many arguments
+as possible in registers. It also tries to utilize registers for the
+return value whenever it is possible.
+
+.. _`__regcall`: https://software.intel.com/en-us/node/693069
+
+
+regparm (gnu::regparm)
+----------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+On 32-bit x86 targets, the regparm attribute causes the compiler to pass
+the first three integer parameters in EAX, EDX, and ECX instead of on the
+stack. This attribute has no effect on variadic functions, and all parameters
+are passed via the stack as normal.
+
+
+stdcall (gnu::stdcall, __stdcall, _stdcall)
+-------------------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","X", ""
+
+On 32-bit x86 targets, this attribute changes the calling convention of a
+function to clear parameters off of the stack on return. This convention does
+not support variadic calls or unprototyped functions in C, and has no effect on
+x86_64 targets. This calling convention is used widely by the Windows API and
+COM applications. See the documentation for `__stdcall`_ on MSDN.
+
+.. _`__stdcall`: http://msdn.microsoft.com/en-us/library/zxk0tw93.aspx
+
+
+thiscall (gnu::thiscall, __thiscall, _thiscall)
+-----------------------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","X", ""
+
+On 32-bit x86 targets, this attribute changes the calling convention of a
+function to use ECX for the first parameter (typically the implicit ``this``
+parameter of C++ methods) and clear parameters off of the stack on return. This
+convention does not support variadic calls or unprototyped functions in C, and
+has no effect on x86_64 targets. See the documentation for `__thiscall`_ on
+MSDN.
+
+.. _`__thiscall`: http://msdn.microsoft.com/en-us/library/ek8tkfbw.aspx
+
+
+vectorcall (__vectorcall, _vectorcall)
+--------------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","X", ""
+
+On 32-bit x86 *and* x86_64 targets, this attribute changes the calling
+convention of a function to pass vector parameters in SSE registers.
+
+On 32-bit x86 targets, this calling convention is similar to ``__fastcall``.
+The first two integer parameters are passed in ECX and EDX. Subsequent integer
+parameters are passed in memory, and callee clears the stack. On x86_64
+targets, the callee does *not* clear the stack, and integer parameters are
+passed in RCX, RDX, R8, and R9 as is done for the default Windows x64 calling
+convention.
+
+On both 32-bit x86 and x86_64 targets, vector and floating point arguments are
+passed in XMM0-XMM5. Homogeneous vector aggregates of up to four elements are
+passed in sequential SSE registers if enough are available. If AVX is enabled,
+256 bit vectors are passed in YMM0-YMM5. Any vector or aggregate type that
+cannot be passed in registers for any reason is passed by reference, which
+allows the caller to align the parameter memory.
+
+See the documentation for `__vectorcall`_ on MSDN for more details.
+
+.. _`__vectorcall`: http://msdn.microsoft.com/en-us/library/dn375768.aspx
+
+
+Consumed Annotation Checking
+============================
+Clang supports additional attributes for checking basic resource management
+properties, specifically for unique objects that have a single owning reference.
+The following attributes are currently supported, although **the implementation
+for these annotations is currently in development and are subject to change.**
+
+callable_when
+-------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+Use ``__attribute__((callable_when(...)))`` to indicate what states a method
+may be called in. Valid states are unconsumed, consumed, or unknown. Each
+argument to this attribute must be a quoted string. E.g.:
+
+``__attribute__((callable_when("unconsumed", "unknown")))``
+
+
+consumable
+----------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+Each ``class`` that uses any of the typestate annotations must first be marked
+using the ``consumable`` attribute. Failure to do so will result in a warning.
+
+This attribute accepts a single parameter that must be one of the following:
+``unknown``, ``consumed``, or ``unconsumed``.
+
+
+param_typestate
+---------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+This attribute specifies expectations about function parameters. Calls to an
+function with annotated parameters will issue a warning if the corresponding
+argument isn't in the expected state. The attribute is also used to set the
+initial state of the parameter when analyzing the function's body.
+
+
+return_typestate
+----------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+The ``return_typestate`` attribute can be applied to functions or parameters.
+When applied to a function the attribute specifies the state of the returned
+value. The function's body is checked to ensure that it always returns a value
+in the specified state. On the caller side, values returned by the annotated
+function are initialized to the given state.
+
+When applied to a function parameter it modifies the state of an argument after
+a call to the function returns. The function's body is checked to ensure that
+the parameter is in the expected state before returning.
+
+
+set_typestate
+-------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+Annotate methods that transition an object into a new state with
+``__attribute__((set_typestate(new_state)))``. The new state must be
+unconsumed, consumed, or unknown.
+
+
+test_typestate
+--------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","","","", ""
+
+Use ``__attribute__((test_typestate(tested_state)))`` to indicate that a method
+returns true if the object is in the specified state..
+
+
+OpenCL Address Spaces
+=====================
+The address space qualifier may be used to specify the region of memory that is
+used to allocate the object. OpenCL supports the following address spaces:
+__generic(generic), __global(global), __local(local), __private(private),
+__constant(constant).
+
+ .. code-block:: c
+
+ __constant int c = ...;
+
+ __generic int* foo(global int* g) {
+ __local int* l;
+ private int p;
+ ...
+ return l;
+ }
+
+More details can be found in the OpenCL C language Spec v2.0, Section 6.5.
+
+constant (__constant)
+---------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "","","","X", ""
+
+The constant address space attribute signals that an object is located in
+a constant (non-modifiable) memory region. It is available to all work items.
+Any type can be annotated with the constant address space attribute. Objects
+with the constant address space qualifier can be declared in any scope and must
+have an initializer.
+
+
+generic (__generic)
+-------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "","","","X", ""
+
+The generic address space attribute is only available with OpenCL v2.0 and later.
+It can be used with pointer types. Variables in global and local scope and
+function parameters in non-kernel functions can have the generic address space
+type attribute. It is intended to be a placeholder for any other address space
+except for '__constant' in OpenCL code which can be used with multiple address
+spaces.
+
+
+global (__global)
+-----------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "","","","X", ""
+
+The global address space attribute specifies that an object is allocated in
+global memory, which is accessible by all work items. The content stored in this
+memory area persists between kernel executions. Pointer types to the global
+address space are allowed as function parameters or local variables. Starting
+with OpenCL v2.0, the global address space can be used with global (program
+scope) variables and static local variable as well.
+
+
+local (__local)
+---------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "","","","X", ""
+
+The local address space specifies that an object is allocated in the local (work
+group) memory area, which is accessible to all work items in the same work
+group. The content stored in this memory region is not accessible after
+the kernel execution ends. In a kernel function scope, any variable can be in
+the local address space. In other scopes, only pointer types to the local address
+space are allowed. Local address space variables cannot have an initializer.
+
+
+private (__private)
+-------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "","","","X", ""
+
+The private address space specifies that an object is allocated in the private
+(work item) memory. Other work items cannot access the same memory area and its
+content is destroyed after work item execution ends. Local variables can be
+declared in the private address space. Function arguments are always in the
+private address space. Kernel function arguments of a pointer or an array type
+cannot point to the private address space.
+
+
+Nullability Attributes
+======================
+Whether a particular pointer may be "null" is an important concern when working with pointers in the C family of languages. The various nullability attributes indicate whether a particular pointer can be null or not, which makes APIs more expressive and can help static analysis tools identify bugs involving null pointers. Clang supports several kinds of nullability attributes: the ``nonnull`` and ``returns_nonnull`` attributes indicate which function or method parameters and result types can never be null, while nullability type qualifiers indicate which pointer types can be null (``_Nullable``) or cannot be null (``_Nonnull``).
+
+The nullability (type) qualifiers express whether a value of a given pointer type can be null (the ``_Nullable`` qualifier), doesn't have a defined meaning for null (the ``_Nonnull`` qualifier), or for which the purpose of null is unclear (the ``_Null_unspecified`` qualifier). Because nullability qualifiers are expressed within the type system, they are more general than the ``nonnull`` and ``returns_nonnull`` attributes, allowing one to express (for example) a nullable pointer to an array of nonnull pointers. Nullability qualifiers are written to the right of the pointer to which they apply. For example:
+
+ .. code-block:: c
+
+ // No meaningful result when 'ptr' is null (here, it happens to be undefined behavior).
+ int fetch(int * _Nonnull ptr) { return *ptr; }
+
+ // 'ptr' may be null.
+ int fetch_or_zero(int * _Nullable ptr) {
+ return ptr ? *ptr : 0;
+ }
+
+ // A nullable pointer to non-null pointers to const characters.
+ const char *join_strings(const char * _Nonnull * _Nullable strings, unsigned n);
+
+In Objective-C, there is an alternate spelling for the nullability qualifiers that can be used in Objective-C methods and properties using context-sensitive, non-underscored keywords. For example:
+
+ .. code-block:: objective-c
+
+ @interface NSView : NSResponder
+ - (nullable NSView *)ancestorSharedWithView:(nonnull NSView *)aView;
+ @property (assign, nullable) NSView *superview;
+ @property (readonly, nonnull) NSArray *subviews;
+ @end
+
+nonnull (gnu::nonnull)
+----------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+The ``nonnull`` attribute indicates that some function parameters must not be null, and can be used in several different ways. It's original usage (`from GCC <https://gcc.gnu.org/onlinedocs/gcc/Common-Function-Attributes.html#Common-Function-Attributes>`_) is as a function (or Objective-C method) attribute that specifies which parameters of the function are nonnull in a comma-separated list. For example:
+
+ .. code-block:: c
+
+ extern void * my_memcpy (void *dest, const void *src, size_t len)
+ __attribute__((nonnull (1, 2)));
+
+Here, the ``nonnull`` attribute indicates that parameters 1 and 2
+cannot have a null value. Omitting the parenthesized list of parameter indices means that all parameters of pointer type cannot be null:
+
+ .. code-block:: c
+
+ extern void * my_memcpy (void *dest, const void *src, size_t len)
+ __attribute__((nonnull));
+
+Clang also allows the ``nonnull`` attribute to be placed directly on a function (or Objective-C method) parameter, eliminating the need to specify the parameter index ahead of type. For example:
+
+ .. code-block:: c
+
+ extern void * my_memcpy (void *dest __attribute__((nonnull)),
+ const void *src __attribute__((nonnull)), size_t len);
+
+Note that the ``nonnull`` attribute indicates that passing null to a non-null parameter is undefined behavior, which the optimizer may take advantage of to, e.g., remove null checks. The ``_Nonnull`` type qualifier indicates that a pointer cannot be null in a more general manner (because it is part of the type system) and does not imply undefined behavior, making it more widely applicable.
+
+
+returns_nonnull (gnu::returns_nonnull)
+--------------------------------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "X","X","","", ""
+
+The ``returns_nonnull`` attribute indicates that a particular function (or Objective-C method) always returns a non-null pointer. For example, a particular system ``malloc`` might be defined to terminate a process when memory is not available rather than returning a null pointer:
+
+ .. code-block:: c
+
+ extern void * malloc (size_t size) __attribute__((returns_nonnull));
+
+The ``returns_nonnull`` attribute implies that returning a null pointer is undefined behavior, which the optimizer may take advantage of. The ``_Nonnull`` type qualifier indicates that a pointer cannot be null in a more general manner (because it is part of the type system) and does not imply undefined behavior, making it more widely applicable
+
+
+_Nonnull
+--------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "","","","X", ""
+
+The ``_Nonnull`` nullability qualifier indicates that null is not a meaningful value for a value of the ``_Nonnull`` pointer type. For example, given a declaration such as:
+
+ .. code-block:: c
+
+ int fetch(int * _Nonnull ptr);
+
+a caller of ``fetch`` should not provide a null value, and the compiler will produce a warning if it sees a literal null value passed to ``fetch``. Note that, unlike the declaration attribute ``nonnull``, the presence of ``_Nonnull`` does not imply that passing null is undefined behavior: ``fetch`` is free to consider null undefined behavior or (perhaps for backward-compatibility reasons) defensively handle null.
+
+
+_Null_unspecified
+-----------------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "","","","X", ""
+
+The ``_Null_unspecified`` nullability qualifier indicates that neither the ``_Nonnull`` nor ``_Nullable`` qualifiers make sense for a particular pointer type. It is used primarily to indicate that the role of null with specific pointers in a nullability-annotated header is unclear, e.g., due to overly-complex implementations or historical factors with a long-lived API.
+
+
+_Nullable
+---------
+.. csv-table:: Supported Syntaxes
+ :header: "GNU", "C++11", "__declspec", "Keyword", "Pragma"
+
+ "","","","X", ""
+
+The ``_Nullable`` nullability qualifier indicates that a value of the ``_Nullable`` pointer type can be null. For example, given:
+
+ .. code-block:: c
+
+ int fetch_or_zero(int * _Nullable ptr);
+
+a caller of ``fetch_or_zero`` can provide null.
+
+
diff --git a/docs/ReleaseNotes.rst b/docs/ReleaseNotes.rst
index b15d9a5a147cb..5b035cd3320f8 100644
--- a/docs/ReleaseNotes.rst
+++ b/docs/ReleaseNotes.rst
@@ -31,11 +31,6 @@ the latest release, please check out the main please see the `Clang Web
Site <http://clang.llvm.org>`_ or the `LLVM Web
Site <http://llvm.org>`_.
-Note that if you are reading this file from a Subversion checkout or the
-main Clang web page, this document applies to the *next* release, not
-the current one. To see the release notes for a specific release, please
-see the `releases page <http://llvm.org/releases/>`_.
-
What's New in Clang 4.0.0?
==========================
@@ -65,6 +60,8 @@ The option -Og has been added to optimize the debugging experience.
For now, this option is exactly the same as -O1. However, in the future,
some other optimizations might be enabled or disabled.
+The option -MJ has been added to simplify adding JSON compilation
+database output into existing build systems.
The option ....
diff --git a/docs/UsersManual.rst b/docs/UsersManual.rst
index 96b7ac95cb5d6..3adbfe059f89a 100644
--- a/docs/UsersManual.rst
+++ b/docs/UsersManual.rst
@@ -41,6 +41,7 @@ specific section:
variants depending on base language.
- :ref:`C++ Language <cxx>`
- :ref:`Objective C++ Language <objcxx>`
+- :ref:`OpenCL C Language <opencl>`: v1.0, v1.1, v1.2, v2.0.
In addition to these base languages and their dialects, Clang supports a
broad variety of language extensions, which are documented in the
@@ -1973,6 +1974,365 @@ Controlling implementation limits
is provided or target does not support TLS, code generation for threadprivate
variables relies on OpenMP runtime library.
+.. _opencl:
+
+OpenCL Features
+===============
+
+Clang can be used to compile OpenCL kernels for execution on a device
+(e.g. GPU). It is possible to compile the kernel into a binary (e.g. for AMD or
+Nvidia targets) that can be uploaded to run directly on a device (e.g. using
+`clCreateProgramWithBinary
+<https://www.khronos.org/registry/OpenCL/specs/opencl-1.1.pdf#111>`_) or
+into generic bitcode files loadable into other toolchains.
+
+Compiling to a binary using the default target from the installation can be done
+as follows:
+
+ .. code-block:: console
+
+ $ echo "kernel void k(){}" > test.cl
+ $ clang test.cl
+
+Compiling for a specific target can be done by specifying the triple corresponding
+to the target, for example:
+
+ .. code-block:: console
+
+ $ clang -target nvptx64-unknown-unknown test.cl
+ $ clang -target amdgcn-amd-amdhsa-opencl test.cl
+
+Compiling to bitcode can be done as follows:
+
+ .. code-block:: console
+
+ $ clang -c -emit-llvm test.cl
+
+This will produce a generic test.bc file that can be used in vendor toolchains
+to perform machine code generation.
+
+Clang currently supports OpenCL C language standards up to v2.0.
+
+OpenCL Specific Options
+-----------------------
+
+Most of the OpenCL build options from `the specification v2.0 section 5.8.4
+<https://www.khronos.org/registry/cl/specs/opencl-2.0.pdf#200>`_ are available.
+
+Examples:
+
+ .. code-block:: console
+
+ $ clang -cl-std=CL2.0 -cl-single-precision-constant test.cl
+
+Some extra options are available to support special OpenCL features.
+
+.. option:: -finclude-default-header
+
+Loads standard includes during compilations. By default OpenCL headers are not
+loaded and therefore standard library includes are not available. To load them
+automatically a flag has been added to the frontend (see also :ref:`the section
+on the OpenCL Header <opencl_header>`):
+
+ .. code-block:: console
+
+ $ clang -Xclang -finclude-default-header test.cl
+
+Alternatively ``-include`` or ``-I`` followed by the path to the header location
+can be given manually.
+
+ .. code-block:: console
+
+ $ clang -I<path to clang>/lib/Headers/opencl-c.h test.cl
+
+In this case the kernel code should contain ``#include <opencl-c.h>`` just as a
+regular C include.
+
+.. option:: -cl-ext
+
+Disables support of OpenCL extensions. All OpenCL targets provide a list
+of extensions that they support. Clang allows to amend this using the ``-cl-ext``
+flag with a comma-separated list of extensions prefixed with ``'+'`` or ``'-'``.
+The syntax: ``-cl-ext=<(['-'|'+']<extension>[,])+>``, where extensions
+can be either one of `the OpenCL specification extensions
+<https://www.khronos.org/registry/cl/sdk/2.0/docs/man/xhtml/EXTENSION.html>`_
+or any known vendor extension. Alternatively, ``'all'`` can be used to enable
+or disable all known extensions.
+Example disabling double support for the 64-bit SPIR target:
+
+ .. code-block:: console
+
+ $ clang -cc1 -triple spir64-unknown-unknown -cl-ext=-cl_khr_fp64 test.cl
+
+Enabling all extensions except double support in R600 AMD GPU can be done using:
+
+ .. code-block:: console
+
+ $ clang -cc1 -triple r600-unknown-unknown -cl-ext=-all,+cl_khr_fp16 test.cl
+
+.. _opencl_fake_address_space_map:
+
+.. option:: -ffake-address-space-map
+
+Overrides the target address space map with a fake map.
+This allows adding explicit address space IDs to the bitcode for non-segmented
+memory architectures that don't have separate IDs for each of the OpenCL
+logical address spaces by default. Passing ``-ffake-address-space-map`` will
+add/override address spaces of the target compiled for with the following values:
+``1-global``, ``2-constant``, ``3-local``, ``4-generic``. The private address
+space is represented by the absence of an address space attribute in the IR (see
+also :ref:`the section on the address space attribute <opencl_addrsp>`).
+
+ .. code-block:: console
+
+ $ clang -ffake-address-space-map test.cl
+
+Some other flags used for the compilation for C can also be passed while
+compiling for OpenCL, examples: ``-c``, ``-O<1-4|s>``, ``-o``, ``-emit-llvm``, etc.
+
+OpenCL Targets
+--------------
+
+OpenCL targets are derived from the regular Clang target classes. The OpenCL
+specific parts of the target representation provide address space mapping as
+well as a set of supported extensions.
+
+Specific Targets
+^^^^^^^^^^^^^^^^
+
+There is a set of concrete HW architectures that OpenCL can be compiled for.
+
+- For AMD target:
+
+ .. code-block:: console
+
+ $ clang -target amdgcn-amd-amdhsa-opencl test.cl
+
+- For Nvidia architectures:
+
+ .. code-block:: console
+
+ $ clang -target nvptx64-unknown-unknown test.cl
+
+
+Generic Targets
+^^^^^^^^^^^^^^^
+
+- SPIR is available as a generic target to allow portable bitcode to be produced
+ that can be used across GPU toolchains. The implementation follows `the SPIR
+ specification <https://www.khronos.org/spir>`_. There are two flavors
+ available for 32 and 64 bits.
+
+ .. code-block:: console
+
+ $ clang -target spir-unknown-unknown test.cl
+ $ clang -target spir64-unknown-unknown test.cl
+
+ All known OpenCL extensions are supported in the SPIR targets. Clang will
+ generate SPIR v1.2 compatible IR for OpenCL versions up to 2.0 and SPIR v2.0
+ for OpenCL v2.0.
+
+- x86 is used by some implementations that are x86 compatible and currently
+ remains for backwards compatibility (with older implementations prior to
+ SPIR target support). For "non-SPMD" targets which cannot spawn multiple
+ work-items on the fly using hardware, which covers practically all non-GPU
+ devices such as CPUs and DSPs, additional processing is needed for the kernels
+ to support multiple work-item execution. For this, a 3rd party toolchain,
+ such as for example `POCL <http://portablecl.org/>`_, can be used.
+
+ This target does not support multiple memory segments and, therefore, the fake
+ address space map can be added using the :ref:`-ffake-address-space-map
+ <opencl_fake_address_space_map>` flag.
+
+.. _opencl_header:
+
+OpenCL Header
+-------------
+
+By default Clang will not include standard headers and therefore OpenCL builtin
+functions and some types (i.e. vectors) are unknown. The default CL header is,
+however, provided in the Clang installation and can be enabled by passing the
+``-finclude-default-header`` flag to the Clang frontend.
+
+ .. code-block:: console
+
+ $ echo "bool is_wg_uniform(int i){return get_enqueued_local_size(i)==get_local_size(i);}" > test.cl
+ $ clang -Xclang -finclude-default-header -cl-std=CL2.0 test.cl
+
+Because the header is very large and long to parse, PCH (:doc:`PCHInternals`)
+and modules (:doc:`Modules`) are used internally to improve the compilation
+speed.
+
+To enable modules for OpenCL:
+
+ .. code-block:: console
+
+ $ clang -target spir-unknown-unknown -c -emit-llvm -Xclang -finclude-default-header -fmodules -fimplicit-module-maps -fmodules-cache-path=<path to the generated module> test.cl
+
+OpenCL Metadata
+---------------
+
+Clang uses metadata to provide additional OpenCL semantics in IR needed for
+backends and OpenCL runtime.
+
+Each kernel will have function metadata attached to it, specifying the arguments.
+Kernel argument metadata is used to provide source level information for querying
+at runtime, for example using the `clGetKernelArgInfo
+<https://www.khronos.org/registry/OpenCL/specs/opencl-1.2.pdf#167>`_
+call.
+
+Note that ``-cl-kernel-arg-info`` enables more information about the original CL
+code to be added e.g. kernel parameter names will appear in the OpenCL metadata
+along with other information.
+
+The IDs used to encode the OpenCL's logical address spaces in the argument info
+metadata follows the SPIR address space mapping as defined in the SPIR
+specification `section 2.2
+<https://www.khronos.org/registry/spir/specs/spir_spec-2.0.pdf#18>`_
+
+OpenCL-Specific Attributes
+--------------------------
+
+OpenCL support in Clang contains a set of attribute taken directly from the
+specification as well as additional attributes.
+
+See also :doc:`AttributeReference`.
+
+nosvm
+^^^^^
+
+Clang supports this attribute to comply to OpenCL v2.0 conformance, but it
+does not have any effect on the IR. For more details reffer to the specification
+`section 6.7.2
+<https://www.khronos.org/registry/cl/specs/opencl-2.0-openclc.pdf#49>`_
+
+
+opencl_hint_unroll
+^^^^^^^^^^^^^^^^^^
+
+The implementation of this feature mirrors the unroll hint for C.
+More details on the syntax can be found in the specification
+`section 6.11.5
+<https://www.khronos.org/registry/cl/specs/opencl-2.0-openclc.pdf#61>`_
+
+convergent
+^^^^^^^^^^
+
+To make sure no invalid optimizations occur for single program multiple data
+(SPMD) / single instruction multiple thread (SIMT) Clang provides attributes that
+can be used for special functions that have cross work item semantics.
+An example is the subgroup operations such as `intel_sub_group_shuffle
+<https://www.khronos.org/registry/cl/extensions/intel/cl_intel_subgroups.txt>`_
+
+ .. code-block:: c
+
+ // Define custom my_sub_group_shuffle(data, c)
+ // that makes use of intel_sub_group_shuffle
+ r1 = …
+ if (r0) r1 = computeA();
+ // Shuffle data from r1 into r3
+ // of threads id r2.
+ r3 = my_sub_group_shuffle(r1, r2);
+ if (r0) r3 = computeB();
+
+with non-SPMD semantics this is optimized to the following equivalent code:
+
+ .. code-block:: c
+
+ r1 = …
+ if (!r0)
+ // Incorrect functionality! The data in r1
+ // have not been computed by all threads yet.
+ r3 = my_sub_group_shuffle(r1, r2);
+ else {
+ r1 = computeA();
+ r3 = my_sub_group_shuffle(r1, r2);
+ r3 = computeB();
+ }
+
+Declaring the function ``my_sub_group_shuffle`` with the convergent attribute
+would prevent this:
+
+ .. code-block:: c
+
+ my_sub_group_shuffle() __attribute__((convergent));
+
+Using ``convergent`` guarantees correct execution by keeping CFG equivalence
+wrt operations marked as ``convergent``. CFG ``G´`` is equivalent to ``G`` wrt
+node ``Ni`` : ``iff ∀ Nj (i≠j)`` domination and post-domination relations with
+respect to ``Ni`` remain the same in both ``G`` and ``G´``.
+
+noduplicate
+^^^^^^^^^^^
+
+``noduplicate`` is more restrictive with respect to optimizations than
+``convergent`` because a convergent function only preserves CFG equivalence.
+This allows some optimizations to happen as long as the control flow remains
+unmodified.
+
+ .. code-block:: c
+
+ for (int i=0; i<4; i++)
+ my_sub_group_shuffle()
+
+can be modified to:
+
+ .. code-block:: c
+
+ my_sub_group_shuffle();
+ my_sub_group_shuffle();
+ my_sub_group_shuffle();
+ my_sub_group_shuffle();
+
+while using ``noduplicate`` would disallow this. Also ``noduplicate`` doesn't
+have the same safe semantics of CFG as ``convergent`` and can cause changes in
+CFG that modify semantics of the original program.
+
+``noduplicate`` is kept for backwards compatibility only and it considered to be
+deprecated for future uses.
+
+.. _opencl_addrsp:
+
+address_space
+^^^^^^^^^^^^^
+
+Clang has arbitrary address space support using the ``address_space(N)``
+attribute, where ``N`` is an integer number in the range ``0`` to ``16777215``
+(``0xffffffu``).
+
+An OpenCL implementation provides a list of standard address spaces using
+keywords: ``private``, ``local``, ``global``, and ``generic``. In the AST and
+in the IR local, global, or generic will be represented by the address space
+attribute with the corresponding unique number. Note that private does not have
+any corresponding attribute added and, therefore, is represented by the absence
+of an address space number. The specific IDs for an address space do not have to
+match between the AST and the IR. Typically in the AST address space numbers
+represent logical segments while in the IR they represent physical segments.
+Therefore, machines with flat memory segments can map all AST address space
+numbers to the same physical segment ID or skip address space attribute
+completely while generating the IR. However, if the address space information
+is needed by the IR passes e.g. to improve alias analysis, it is recommended
+to keep it and only lower to reflect physical memory segments in the late
+machine passes.
+
+OpenCL builtins
+---------------
+
+There are some standard OpenCL functions that are implemented as Clang builtins:
+
+- All pipe functions from `section 6.13.16.2/6.13.16.3
+ <https://www.khronos.org/registry/cl/specs/opencl-2.0-openclc.pdf#160>`_ of
+ the OpenCL v2.0 kernel language specification. `
+
+- Address space qualifier conversion functions ``to_global``/``to_local``/``to_private``
+ from `section 6.13.9
+ <https://www.khronos.org/registry/cl/specs/opencl-2.0-openclc.pdf#101>`_.
+
+- All the ``enqueue_kernel`` functions from `section 6.13.17.1
+ <https://www.khronos.org/registry/cl/specs/opencl-2.0-openclc.pdf#164>`_ and
+ enqueue query functions from `section 6.13.17.5
+ <https://www.khronos.org/registry/cl/specs/opencl-2.0-openclc.pdf#171>`_.
+
.. _target_features:
Target-Specific Features and Limitations
@@ -2102,7 +2462,7 @@ Clang expects the GCC executable "gcc.exe" compiled for
clang-cl
========
-clang-cl is an alternative command-line interface to Clang driver, designed for
+clang-cl is an alternative command-line interface to Clang, designed for
compatibility with the Visual C++ compiler, cl.exe.
To enable clang-cl to find system headers, libraries, and the linker when run
@@ -2110,7 +2470,7 @@ from the command-line, it should be executed inside a Visual Studio Native Tools
Command Prompt or a regular Command Prompt where the environment has been set
up using e.g. `vcvars32.bat <http://msdn.microsoft.com/en-us/library/f2ccy3wt.aspx>`_.
-clang-cl can also be used from inside Visual Studio by using an LLVM Platform
+clang-cl can also be used from inside Visual Studio by using an LLVM Platform
Toolset.
Command-Line Options
@@ -2145,116 +2505,125 @@ Execute ``clang-cl /?`` to see a list of supported options:
::
CL.EXE COMPATIBILITY OPTIONS:
- /? Display available options
- /arch:<value> Set architecture for code generation
- /Brepro- Emit an object file which cannot be reproduced over time
- /Brepro Emit an object file which can be reproduced over time
- /C Don't discard comments when preprocessing
- /c Compile only
- /D <macro[=value]> Define macro
- /EH<value> Exception handling model
- /EP Disable linemarker output and preprocess to stdout
- /E Preprocess to stdout
- /fallback Fall back to cl.exe if clang-cl fails to compile
- /FA Output assembly code file during compilation
- /Fa<file or directory> Output assembly code to this file during compilation (with /FA)
- /Fe<file or directory> Set output executable file or directory (ends in / or \)
- /FI <value> Include file before parsing
- /Fi<file> Set preprocess output file name (with /P)
- /Fo<file or directory> Set output object file, or directory (ends in / or \) (with /c)
+ /? Display available options
+ /arch:<value> Set architecture for code generation
+ /Brepro- Emit an object file which cannot be reproduced over time
+ /Brepro Emit an object file which can be reproduced over time
+ /C Don't discard comments when preprocessing
+ /c Compile only
+ /D <macro[=value]> Define macro
+ /EH<value> Exception handling model
+ /EP Disable linemarker output and preprocess to stdout
+ /execution-charset:<value>
+ Runtime encoding, supports only UTF-8
+ /E Preprocess to stdout
+ /fallback Fall back to cl.exe if clang-cl fails to compile
+ /FA Output assembly code file during compilation
+ /Fa<file or directory> Output assembly code to this file during compilation (with /FA)
+ /Fe<file or directory> Set output executable file or directory (ends in / or \)
+ /FI <value> Include file before parsing
+ /Fi<file> Set preprocess output file name (with /P)
+ /Fo<file or directory> Set output object file, or directory (ends in / or \) (with /c)
/fp:except-
/fp:except
/fp:fast
/fp:precise
/fp:strict
- /Fp<filename> Set pch filename (with /Yc and /Yu)
- /GA Assume thread-local variables are defined in the executable
- /Gd Set __cdecl as a default calling convention
- /GF- Disable string pooling
- /GR- Disable emission of RTTI data
- /GR Enable emission of RTTI data
- /Gr Set __fastcall as a default calling convention
- /GS- Disable buffer security check
- /GS Enable buffer security check
- /Gs<value> Set stack probe size
- /Gv Set __vectorcall as a default calling convention
- /Gw- Don't put each data item in its own section
- /Gw Put each data item in its own section
- /GX- Enable exception handling
- /GX Enable exception handling
- /Gy- Don't put each function in its own section
- /Gy Put each function in its own section
- /Gz Set __stdcall as a default calling convention
- /help Display available options
- /imsvc <dir> Add directory to system include search path, as if part of %INCLUDE%
- /I <dir> Add directory to include search path
- /J Make char type unsigned
- /LDd Create debug DLL
- /LD Create DLL
- /link <options> Forward options to the linker
- /MDd Use DLL debug run-time
- /MD Use DLL run-time
- /MTd Use static debug run-time
- /MT Use static run-time
- /Od Disable optimization
- /Oi- Disable use of builtin functions
- /Oi Enable use of builtin functions
- /Os Optimize for size
- /Ot Optimize for speed
- /O<value> Optimization level
- /o <file or directory> Set output file or directory (ends in / or \)
- /P Preprocess to file
- /Qvec- Disable the loop vectorization passes
- /Qvec Enable the loop vectorization passes
- /showIncludes Print info about included files to stderr
- /std:<value> Language standard to compile for
- /TC Treat all source files as C
- /Tc <filename> Specify a C source file
- /TP Treat all source files as C++
- /Tp <filename> Specify a C++ source file
- /U <macro> Undefine macro
- /vd<value> Control vtordisp placement
- /vmb Use a best-case representation method for member pointers
- /vmg Use a most-general representation for member pointers
- /vmm Set the default most-general representation to multiple inheritance
- /vms Set the default most-general representation to single inheritance
- /vmv Set the default most-general representation to virtual inheritance
- /volatile:iso Volatile loads and stores have standard semantics
- /volatile:ms Volatile loads and stores have acquire and release semantics
- /W0 Disable all warnings
- /W1 Enable -Wall
- /W2 Enable -Wall
- /W3 Enable -Wall
- /W4 Enable -Wall and -Wextra
- /Wall Enable -Wall and -Wextra
- /WX- Do not treat warnings as errors
- /WX Treat warnings as errors
- /w Disable all warnings
- /Y- Disable precompiled headers, overrides /Yc and /Yu
- /Yc<filename> Generate a pch file for all code up to and including <filename>
- /Yu<filename> Load a pch file and use it instead of all code up to and including <filename>
- /Z7 Enable CodeView debug information in object files
- /Zc:sizedDealloc- Disable C++14 sized global deallocation functions
- /Zc:sizedDealloc Enable C++14 sized global deallocation functions
- /Zc:strictStrings Treat string literals as const
- /Zc:threadSafeInit- Disable thread-safe initialization of static variables
- /Zc:threadSafeInit Enable thread-safe initialization of static variables
- /Zc:trigraphs- Disable trigraphs (default)
- /Zc:trigraphs Enable trigraphs
- /Zd Emit debug line number tables only
- /Zi Alias for /Z7. Does not produce PDBs.
- /Zl Don't mention any default libraries in the object file
- /Zp Set the default maximum struct packing alignment to 1
- /Zp<value> Specify the default maximum struct packing alignment
- /Zs Syntax-check only
+ /Fp<filename> Set pch filename (with /Yc and /Yu)
+ /GA Assume thread-local variables are defined in the executable
+ /Gd Set __cdecl as a default calling convention
+ /GF- Disable string pooling
+ /GR- Disable emission of RTTI data
+ /GR Enable emission of RTTI data
+ /Gr Set __fastcall as a default calling convention
+ /GS- Disable buffer security check
+ /GS Enable buffer security check
+ /Gs<value> Set stack probe size
+ /Gv Set __vectorcall as a default calling convention
+ /Gw- Don't put each data item in its own section
+ /Gw Put each data item in its own section
+ /GX- Enable exception handling
+ /GX Enable exception handling
+ /Gy- Don't put each function in its own section
+ /Gy Put each function in its own section
+ /Gz Set __stdcall as a default calling convention
+ /help Display available options
+ /imsvc <dir> Add directory to system include search path, as if part of %INCLUDE%
+ /I <dir> Add directory to include search path
+ /J Make char type unsigned
+ /LDd Create debug DLL
+ /LD Create DLL
+ /link <options> Forward options to the linker
+ /MDd Use DLL debug run-time
+ /MD Use DLL run-time
+ /MTd Use static debug run-time
+ /MT Use static run-time
+ /Od Disable optimization
+ /Oi- Disable use of builtin functions
+ /Oi Enable use of builtin functions
+ /Os Optimize for size
+ /Ot Optimize for speed
+ /O<value> Optimization level
+ /o <file or directory> Set output file or directory (ends in / or \)
+ /P Preprocess to file
+ /Qvec- Disable the loop vectorization passes
+ /Qvec Enable the loop vectorization passes
+ /showIncludes Print info about included files to stderr
+ /source-charset:<value> Source encoding, supports only UTF-8
+ /std:<value> Language standard to compile for
+ /TC Treat all source files as C
+ /Tc <filename> Specify a C source file
+ /TP Treat all source files as C++
+ /Tp <filename> Specify a C++ source file
+ /utf-8 Set source and runtime encoding to UTF-8 (default)
+ /U <macro> Undefine macro
+ /vd<value> Control vtordisp placement
+ /vmb Use a best-case representation method for member pointers
+ /vmg Use a most-general representation for member pointers
+ /vmm Set the default most-general representation to multiple inheritance
+ /vms Set the default most-general representation to single inheritance
+ /vmv Set the default most-general representation to virtual inheritance
+ /volatile:iso Volatile loads and stores have standard semantics
+ /volatile:ms Volatile loads and stores have acquire and release semantics
+ /W0 Disable all warnings
+ /W1 Enable -Wall
+ /W2 Enable -Wall
+ /W3 Enable -Wall
+ /W4 Enable -Wall and -Wextra
+ /Wall Enable -Wall and -Wextra
+ /WX- Do not treat warnings as errors
+ /WX Treat warnings as errors
+ /w Disable all warnings
+ /Y- Disable precompiled headers, overrides /Yc and /Yu
+ /Yc<filename> Generate a pch file for all code up to and including <filename>
+ /Yu<filename> Load a pch file and use it instead of all code up to and including <filename>
+ /Z7 Enable CodeView debug information in object files
+ /Zc:sizedDealloc- Disable C++14 sized global deallocation functions
+ /Zc:sizedDealloc Enable C++14 sized global deallocation functions
+ /Zc:strictStrings Treat string literals as const
+ /Zc:threadSafeInit- Disable thread-safe initialization of static variables
+ /Zc:threadSafeInit Enable thread-safe initialization of static variables
+ /Zc:trigraphs- Disable trigraphs (default)
+ /Zc:trigraphs Enable trigraphs
+ /Zd Emit debug line number tables only
+ /Zi Alias for /Z7. Does not produce PDBs.
+ /Zl Don't mention any default libraries in the object file
+ /Zp Set the default maximum struct packing alignment to 1
+ /Zp<value> Specify the default maximum struct packing alignment
+ /Zs Syntax-check only
OPTIONS:
-### Print (but do not run) the commands to run for this compilation
--analyze Run the static analyzer
-fansi-escape-codes Use ANSI escape codes for diagnostics
-fcolor-diagnostics Use colors in diagnostics
+ -fdelayed-template-parsing
+ Parse templated function definitions at the end of the translation unit
+ -fdiagnostics-absolute-paths
+ Print absolute paths in diagnostics
-fdiagnostics-parseable-fixits
Print fix-its in machine parseable form
+ -flto Enable LTO in 'full' mode
-fms-compatibility-version=<value>
Dot-separated value representing the Microsoft compiler version
number to report in _MSC_VER (0 = don't define it (default))
@@ -2262,12 +2631,23 @@ Execute ``clang-cl /?`` to see a list of supported options:
-fms-extensions Accept some non-standard constructs supported by the Microsoft compiler
-fmsc-version=<value> Microsoft compiler version number to report in _MSC_VER
(0 = don't define it (default))
+ -fno-delayed-template-parsing
+ Disable delayed template parsing
-fno-sanitize-coverage=<value>
Disable specified features of coverage instrumentation for Sanitizers
-fno-sanitize-recover=<value>
Disable recovery for specified sanitizers
-fno-sanitize-trap=<value>
Disable trapping for specified sanitizers
+ -fno-standalone-debug Limit debug information produced to reduce size of debug binary
+ -fprofile-instr-generate=<file>
+ Generate instrumented code to collect execution counts into <file>
+ (overridden by LLVM_PROFILE_FILE env var)
+ -fprofile-instr-generate
+ Generate instrumented code to collect execution counts into default.profraw file
+ (overriden by '=' form of option or LLVM_PROFILE_FILE env var)
+ -fprofile-instr-use=<value>
+ Use instrumentation data for profile-guided optimization
-fsanitize-blacklist=<value>
Path to blacklist file for sanitizers
-fsanitize-coverage=<value>
@@ -2277,6 +2657,7 @@ Execute ``clang-cl /?`` to see a list of supported options:
-fsanitize-trap=<value> Enable trapping for specified sanitizers
-fsanitize=<check> Turn on runtime checks for various forms of undefined or suspicious
behavior. See user manual for available checks
+ -fstandalone-debug Emit full debug info for all types used by the program
-gcodeview Generate CodeView debug information
-gline-tables-only Emit debug line number tables only
-miamcu Use Intel MCU ABI
diff --git a/include/clang-c/Index.h b/include/clang-c/Index.h
index e9d9ab03a8b08..15fde19eb9740 100644
--- a/include/clang-c/Index.h
+++ b/include/clang-c/Index.h
@@ -2370,7 +2370,11 @@ enum CXCursorKind {
*/
CXCursor_OMPTargetTeamsDistributeParallelForSimdDirective = 278,
- CXCursor_LastStmt = CXCursor_OMPTargetTeamsDistributeParallelForSimdDirective,
+ /** \brief OpenMP target teams distribute simd directive.
+ */
+ CXCursor_OMPTargetTeamsDistributeSimdDirective = 279,
+
+ CXCursor_LastStmt = CXCursor_OMPTargetTeamsDistributeSimdDirective,
/**
* \brief Cursor that represents the translation unit itself.
diff --git a/include/clang/AST/Decl.h b/include/clang/AST/Decl.h
index b2e332d6d85cb..8b52891af2f8b 100644
--- a/include/clang/AST/Decl.h
+++ b/include/clang/AST/Decl.h
@@ -2061,6 +2061,10 @@ public:
/// limited representation in the AST.
SourceRange getReturnTypeSourceRange() const;
+ /// \brief Attempt to compute an informative source range covering the
+ /// function exception specification, if any.
+ SourceRange getExceptionSpecSourceRange() const;
+
/// \brief Determine the type of an expression that calls this function.
QualType getCallResultType() const {
assert(getType()->getAs<FunctionType>() && "Expected a FunctionType!");
diff --git a/include/clang/AST/DeclTemplate.h b/include/clang/AST/DeclTemplate.h
index 2af95c02c4603..dc50a190de42d 100644
--- a/include/clang/AST/DeclTemplate.h
+++ b/include/clang/AST/DeclTemplate.h
@@ -2028,8 +2028,7 @@ public:
SourceLocation L,
DeclarationName Name,
TemplateParameterList *Params,
- NamedDecl *Decl,
- ClassTemplateDecl *PrevDecl);
+ NamedDecl *Decl);
/// \brief Create an empty class template node.
static ClassTemplateDecl *CreateDeserialized(ASTContext &C, unsigned ID);
diff --git a/include/clang/AST/RecursiveASTVisitor.h b/include/clang/AST/RecursiveASTVisitor.h
index cbf0bee69f004..10a930abe6fb1 100644
--- a/include/clang/AST/RecursiveASTVisitor.h
+++ b/include/clang/AST/RecursiveASTVisitor.h
@@ -2672,6 +2672,9 @@ DEF_TRAVERSE_STMT(OMPTargetTeamsDistributeParallelForDirective,
DEF_TRAVERSE_STMT(OMPTargetTeamsDistributeParallelForSimdDirective,
{ TRY_TO(TraverseOMPExecutableDirective(S)); })
+DEF_TRAVERSE_STMT(OMPTargetTeamsDistributeSimdDirective,
+ { TRY_TO(TraverseOMPExecutableDirective(S)); })
+
// OpenMP clauses.
template <typename Derived>
bool RecursiveASTVisitor<Derived>::TraverseOMPClause(OMPClause *C) {
diff --git a/include/clang/AST/StmtOpenMP.h b/include/clang/AST/StmtOpenMP.h
index 61cae7b6d258c..ec532ecd58815 100644
--- a/include/clang/AST/StmtOpenMP.h
+++ b/include/clang/AST/StmtOpenMP.h
@@ -3711,6 +3711,75 @@ public:
}
};
+/// This represents '#pragma omp target teams distribute simd' combined
+/// directive.
+///
+/// \code
+/// #pragma omp target teams distribute simd private(x)
+/// \endcode
+/// In this example directive '#pragma omp target teams distribute simd'
+/// has clause 'private' with the variables 'x'
+///
+class OMPTargetTeamsDistributeSimdDirective final : public OMPLoopDirective {
+ friend class ASTStmtReader;
+
+ /// Build directive with the given start and end location.
+ ///
+ /// \param StartLoc Starting location of the directive kind.
+ /// \param EndLoc Ending location of the directive.
+ /// \param CollapsedNum Number of collapsed nested loops.
+ /// \param NumClauses Number of clauses.
+ ///
+ OMPTargetTeamsDistributeSimdDirective(SourceLocation StartLoc,
+ SourceLocation EndLoc,
+ unsigned CollapsedNum,
+ unsigned NumClauses)
+ : OMPLoopDirective(this, OMPTargetTeamsDistributeSimdDirectiveClass,
+ OMPD_target_teams_distribute_simd, StartLoc, EndLoc,
+ CollapsedNum, NumClauses) {}
+
+ /// Build an empty directive.
+ ///
+ /// \param CollapsedNum Number of collapsed nested loops.
+ /// \param NumClauses Number of clauses.
+ ///
+ explicit OMPTargetTeamsDistributeSimdDirective(unsigned CollapsedNum,
+ unsigned NumClauses)
+ : OMPLoopDirective(this, OMPTargetTeamsDistributeSimdDirectiveClass,
+ OMPD_target_teams_distribute_simd, SourceLocation(),
+ SourceLocation(), CollapsedNum, NumClauses) {}
+
+public:
+ /// Creates directive with a list of \a Clauses.
+ ///
+ /// \param C AST context.
+ /// \param StartLoc Starting location of the directive kind.
+ /// \param EndLoc Ending Location of the directive.
+ /// \param CollapsedNum Number of collapsed loops.
+ /// \param Clauses List of clauses.
+ /// \param AssociatedStmt Statement, associated with the directive.
+ /// \param Exprs Helper expressions for CodeGen.
+ ///
+ static OMPTargetTeamsDistributeSimdDirective *
+ Create(const ASTContext &C, SourceLocation StartLoc, SourceLocation EndLoc,
+ unsigned CollapsedNum, ArrayRef<OMPClause *> Clauses,
+ Stmt *AssociatedStmt, const HelperExprs &Exprs);
+
+ /// Creates an empty directive with the place for \a NumClauses clauses.
+ ///
+ /// \param C AST context.
+ /// \param CollapsedNum Number of collapsed nested loops.
+ /// \param NumClauses Number of clauses.
+ ///
+ static OMPTargetTeamsDistributeSimdDirective *
+ CreateEmpty(const ASTContext &C, unsigned NumClauses, unsigned CollapsedNum,
+ EmptyShell);
+
+ static bool classof(const Stmt *T) {
+ return T->getStmtClass() == OMPTargetTeamsDistributeSimdDirectiveClass;
+ }
+};
+
} // end namespace clang
#endif
diff --git a/include/clang/AST/TypeLoc.h b/include/clang/AST/TypeLoc.h
index 7de666838d444..5b7d9e6e3ce10 100644
--- a/include/clang/AST/TypeLoc.h
+++ b/include/clang/AST/TypeLoc.h
@@ -1351,6 +1351,19 @@ class FunctionTypeLoc : public ConcreteTypeLoc<UnqualTypeLoc,
FunctionTypeLoc,
FunctionType,
FunctionLocInfo> {
+ bool hasExceptionSpec() const {
+ if (auto *FPT = dyn_cast<FunctionProtoType>(getTypePtr())) {
+ return FPT->hasExceptionSpec();
+ }
+ return false;
+ }
+
+ SourceRange *getExceptionSpecRangePtr() const {
+ assert(hasExceptionSpec() && "No exception spec range");
+ // After the Info comes the ParmVarDecl array, and after that comes the
+ // exception specification information.
+ return (SourceRange *)(getParmArray() + getNumParams());
+ }
public:
SourceLocation getLocalRangeBegin() const {
return getLocalData()->LocalRangeBegin;
@@ -1384,6 +1397,16 @@ public:
return SourceRange(getLParenLoc(), getRParenLoc());
}
+ SourceRange getExceptionSpecRange() const {
+ if (hasExceptionSpec())
+ return *getExceptionSpecRangePtr();
+ return SourceRange();
+ }
+ void setExceptionSpecRange(SourceRange R) {
+ if (hasExceptionSpec())
+ *getExceptionSpecRangePtr() = R;
+ }
+
ArrayRef<ParmVarDecl *> getParams() const {
return llvm::makeArrayRef(getParmArray(), getNumParams());
}
@@ -1416,12 +1439,15 @@ public:
setLocalRangeEnd(Loc);
for (unsigned i = 0, e = getNumParams(); i != e; ++i)
setParam(i, nullptr);
+ if (hasExceptionSpec())
+ setExceptionSpecRange(Loc);
}
/// \brief Returns the size of the type source info data block that is
/// specific to this type.
unsigned getExtraLocalDataSize() const {
- return getNumParams() * sizeof(ParmVarDecl *);
+ unsigned ExceptSpecSize = hasExceptionSpec() ? sizeof(SourceRange) : 0;
+ return (getNumParams() * sizeof(ParmVarDecl *)) + ExceptSpecSize;
}
unsigned getExtraLocalDataAlignment() const { return alignof(ParmVarDecl *); }
diff --git a/include/clang/Basic/AttrDocs.td b/include/clang/Basic/AttrDocs.td
index 49b0a533cec3c..8f6a7ea601b34 100644
--- a/include/clang/Basic/AttrDocs.td
+++ b/include/clang/Basic/AttrDocs.td
@@ -386,6 +386,7 @@ warnings or errors at compile-time if calls to the attributed function meet
certain user-defined criteria. For example:
.. code-block:: c
+
void abs(int a)
__attribute__((diagnose_if(a >= 0, "Redundant abs call", "warning")));
void must_abs(int a)
diff --git a/include/clang/Basic/DiagnosticSemaKinds.td b/include/clang/Basic/DiagnosticSemaKinds.td
index 6a8933f23ecde..3971cf60d5e0d 100644
--- a/include/clang/Basic/DiagnosticSemaKinds.td
+++ b/include/clang/Basic/DiagnosticSemaKinds.td
@@ -8720,10 +8720,6 @@ def err_coroutine_invalid_func_context : Error<
"|a copy assignment operator|a move assignment operator|the 'main' function"
"|a constexpr function|a function with a deduced return type"
"|a varargs function}0">;
-def ext_coroutine_without_co_await_co_yield : ExtWarn<
- "'co_return' used in a function "
- "that uses neither 'co_await' nor 'co_yield'">,
- InGroup<DiagGroup<"coreturn-without-coawait">>;
def err_implied_std_coroutine_traits_not_found : Error<
"you need to include <experimental/coroutine> before defining a coroutine">;
def err_malformed_std_coroutine_traits : Error<
diff --git a/include/clang/Basic/OpenMPKinds.def b/include/clang/Basic/OpenMPKinds.def
index 58b54ce0bcd63..74ec26f19ac20 100644
--- a/include/clang/Basic/OpenMPKinds.def
+++ b/include/clang/Basic/OpenMPKinds.def
@@ -165,6 +165,9 @@
#ifndef OPENMP_TARGET_TEAMS_DISTRIBUTE_PARALLEL_FOR_SIMD_CLAUSE
#define OPENMP_TARGET_TEAMS_DISTRIBUTE_PARALLEL_FOR_SIMD_CLAUSE(Name)
#endif
+#ifndef OPENMP_TARGET_TEAMS_DISTRIBUTE_SIMD_CLAUSE
+#define OPENMP_TARGET_TEAMS_DISTRIBUTE_SIMD_CLAUSE(Name)
+#endif
// OpenMP directives.
OPENMP_DIRECTIVE(threadprivate)
@@ -218,6 +221,7 @@ OPENMP_DIRECTIVE_EXT(target_teams, "target teams")
OPENMP_DIRECTIVE_EXT(target_teams_distribute, "target teams distribute")
OPENMP_DIRECTIVE_EXT(target_teams_distribute_parallel_for, "target teams distribute parallel for")
OPENMP_DIRECTIVE_EXT(target_teams_distribute_parallel_for_simd, "target teams distribute parallel for simd")
+OPENMP_DIRECTIVE_EXT(target_teams_distribute_simd, "target teams distribute simd")
// OpenMP clauses.
OPENMP_CLAUSE(if, OMPIfClause)
@@ -446,7 +450,6 @@ OPENMP_TARGET_CLAUSE(firstprivate)
OPENMP_TARGET_CLAUSE(is_device_ptr)
// Clauses allowed for OpenMP directive 'target data'.
-// TODO More clauses for 'target data' directive.
OPENMP_TARGET_DATA_CLAUSE(if)
OPENMP_TARGET_DATA_CLAUSE(device)
OPENMP_TARGET_DATA_CLAUSE(map)
@@ -483,7 +486,6 @@ OPENMP_TARGET_PARALLEL_CLAUSE(reduction)
OPENMP_TARGET_PARALLEL_CLAUSE(is_device_ptr)
// Clauses allowed for OpenMP directive 'target parallel for'.
-// TODO: add target clauses 'is_device_ptr'
OPENMP_TARGET_PARALLEL_FOR_CLAUSE(if)
OPENMP_TARGET_PARALLEL_FOR_CLAUSE(device)
OPENMP_TARGET_PARALLEL_FOR_CLAUSE(map)
@@ -502,9 +504,9 @@ OPENMP_TARGET_PARALLEL_FOR_CLAUSE(collapse)
OPENMP_TARGET_PARALLEL_FOR_CLAUSE(schedule)
OPENMP_TARGET_PARALLEL_FOR_CLAUSE(ordered)
OPENMP_TARGET_PARALLEL_FOR_CLAUSE(linear)
+OPENMP_TARGET_PARALLEL_FOR_CLAUSE(is_device_ptr)
// Clauses allowed for OpenMP directive 'target update'.
-// TODO More clauses for 'target update' directive.
OPENMP_TARGET_UPDATE_CLAUSE(if)
OPENMP_TARGET_UPDATE_CLAUSE(device)
OPENMP_TARGET_UPDATE_CLAUSE(to)
@@ -513,7 +515,6 @@ OPENMP_TARGET_UPDATE_CLAUSE(nowait)
OPENMP_TARGET_UPDATE_CLAUSE(depend)
// Clauses allowed for OpenMP directive 'teams'.
-// TODO More clauses for 'teams' directive.
OPENMP_TEAMS_CLAUSE(default)
OPENMP_TEAMS_CLAUSE(private)
OPENMP_TEAMS_CLAUSE(firstprivate)
@@ -523,7 +524,6 @@ OPENMP_TEAMS_CLAUSE(num_teams)
OPENMP_TEAMS_CLAUSE(thread_limit)
// Clauses allowed for OpenMP directive 'ordered'.
-// TODO More clauses for 'ordered' directive.
OPENMP_ORDERED_CLAUSE(threads)
OPENMP_ORDERED_CLAUSE(simd)
OPENMP_ORDERED_CLAUSE(depend)
@@ -633,7 +633,6 @@ OPENMP_DISTRIBUTE_SIMD_CLAUSE(simdlen)
OPENMP_DISTRIBUTE_SIMD_CLAUSE(reduction)
// Clauses allowed for OpenMP directive 'target parallel for simd'.
-// TODO: add target clauses 'is_device_ptr'
OPENMP_TARGET_PARALLEL_FOR_SIMD_CLAUSE(if)
OPENMP_TARGET_PARALLEL_FOR_SIMD_CLAUSE(device)
OPENMP_TARGET_PARALLEL_FOR_SIMD_CLAUSE(map)
@@ -655,6 +654,7 @@ OPENMP_TARGET_PARALLEL_FOR_SIMD_CLAUSE(linear)
OPENMP_TARGET_PARALLEL_FOR_SIMD_CLAUSE(safelen)
OPENMP_TARGET_PARALLEL_FOR_SIMD_CLAUSE(simdlen)
OPENMP_TARGET_PARALLEL_FOR_SIMD_CLAUSE(aligned)
+OPENMP_TARGET_PARALLEL_FOR_SIMD_CLAUSE(is_device_ptr)
// Clauses allowed for OpenMP directive 'target simd'.
OPENMP_TARGET_SIMD_CLAUSE(if)
@@ -824,6 +824,28 @@ OPENMP_TARGET_TEAMS_DISTRIBUTE_PARALLEL_FOR_SIMD_CLAUSE(aligned)
OPENMP_TARGET_TEAMS_DISTRIBUTE_PARALLEL_FOR_SIMD_CLAUSE(safelen)
OPENMP_TARGET_TEAMS_DISTRIBUTE_PARALLEL_FOR_SIMD_CLAUSE(simdlen)
+// Clauses allowed for OpenMP directive 'target teams distribute simd'.
+OPENMP_TARGET_TEAMS_DISTRIBUTE_SIMD_CLAUSE(if)
+OPENMP_TARGET_TEAMS_DISTRIBUTE_SIMD_CLAUSE(device)
+OPENMP_TARGET_TEAMS_DISTRIBUTE_SIMD_CLAUSE(map)
+OPENMP_TARGET_TEAMS_DISTRIBUTE_SIMD_CLAUSE(private)
+OPENMP_TARGET_TEAMS_DISTRIBUTE_SIMD_CLAUSE(nowait)
+OPENMP_TARGET_TEAMS_DISTRIBUTE_SIMD_CLAUSE(depend)
+OPENMP_TARGET_TEAMS_DISTRIBUTE_SIMD_CLAUSE(defaultmap)
+OPENMP_TARGET_TEAMS_DISTRIBUTE_SIMD_CLAUSE(firstprivate)
+OPENMP_TARGET_TEAMS_DISTRIBUTE_SIMD_CLAUSE(lastprivate)
+OPENMP_TARGET_TEAMS_DISTRIBUTE_SIMD_CLAUSE(is_device_ptr)
+OPENMP_TARGET_TEAMS_DISTRIBUTE_SIMD_CLAUSE(shared)
+OPENMP_TARGET_TEAMS_DISTRIBUTE_SIMD_CLAUSE(reduction)
+OPENMP_TARGET_TEAMS_DISTRIBUTE_SIMD_CLAUSE(num_teams)
+OPENMP_TARGET_TEAMS_DISTRIBUTE_SIMD_CLAUSE(thread_limit)
+OPENMP_TARGET_TEAMS_DISTRIBUTE_SIMD_CLAUSE(collapse)
+OPENMP_TARGET_TEAMS_DISTRIBUTE_SIMD_CLAUSE(dist_schedule)
+OPENMP_TARGET_TEAMS_DISTRIBUTE_SIMD_CLAUSE(linear)
+OPENMP_TARGET_TEAMS_DISTRIBUTE_SIMD_CLAUSE(aligned)
+OPENMP_TARGET_TEAMS_DISTRIBUTE_SIMD_CLAUSE(safelen)
+OPENMP_TARGET_TEAMS_DISTRIBUTE_SIMD_CLAUSE(simdlen)
+
#undef OPENMP_TASKLOOP_SIMD_CLAUSE
#undef OPENMP_TASKLOOP_CLAUSE
#undef OPENMP_LINEAR_KIND
@@ -875,3 +897,4 @@ OPENMP_TARGET_TEAMS_DISTRIBUTE_PARALLEL_FOR_SIMD_CLAUSE(simdlen)
#undef OPENMP_TARGET_TEAMS_DISTRIBUTE_CLAUSE
#undef OPENMP_TARGET_TEAMS_DISTRIBUTE_PARALLEL_FOR_CLAUSE
#undef OPENMP_TARGET_TEAMS_DISTRIBUTE_PARALLEL_FOR_SIMD_CLAUSE
+#undef OPENMP_TARGET_TEAMS_DISTRIBUTE_SIMD_CLAUSE
diff --git a/include/clang/Basic/StmtNodes.td b/include/clang/Basic/StmtNodes.td
index 2e92e5006ff41..67a5ab773aa63 100644
--- a/include/clang/Basic/StmtNodes.td
+++ b/include/clang/Basic/StmtNodes.td
@@ -244,3 +244,4 @@ def OMPTargetTeamsDirective : DStmt<OMPExecutableDirective>;
def OMPTargetTeamsDistributeDirective : DStmt<OMPLoopDirective>;
def OMPTargetTeamsDistributeParallelForDirective : DStmt<OMPLoopDirective>;
def OMPTargetTeamsDistributeParallelForSimdDirective : DStmt<OMPLoopDirective>;
+def OMPTargetTeamsDistributeSimdDirective : DStmt<OMPLoopDirective>;
diff --git a/include/clang/Driver/CLCompatOptions.td b/include/clang/Driver/CLCompatOptions.td
index cb2745afb7e4c..60048c49c0f74 100644
--- a/include/clang/Driver/CLCompatOptions.td
+++ b/include/clang/Driver/CLCompatOptions.td
@@ -27,7 +27,7 @@ class CLCompileFlag<string name> : Option<["/", "-"], name, KIND_FLAG>,
Group<cl_compile_Group>, Flags<[CLOption, DriverOption]>;
class CLIgnoredFlag<string name> : Option<["/", "-"], name, KIND_FLAG>,
- Group<cl_ignored_Group>, Flags<[CLOption, DriverOption, HelpHidden]>;
+ Group<cl_ignored_Group>, Flags<[CLOption, DriverOption]>;
class CLJoined<string name> : Option<["/", "-"], name, KIND_JOINED>,
Group<cl_Group>, Flags<[CLOption, DriverOption]>;
@@ -299,7 +299,7 @@ def _SLASH_d2Zi_PLUS : CLIgnoredFlag<"d2Zi+">;
def _SLASH_errorReport : CLIgnoredJoined<"errorReport">;
def _SLASH_FC : CLIgnoredFlag<"FC">;
def _SLASH_Fd : CLIgnoredJoined<"Fd">;
-def _SLASH_FS : CLIgnoredFlag<"FS">, HelpText<"Force synchronous PDB writes">;
+def _SLASH_FS : CLIgnoredFlag<"FS">;
def _SLASH_GF : CLIgnoredFlag<"GF">;
def _SLASH_kernel_ : CLIgnoredFlag<"kernel-">;
def _SLASH_nologo : CLIgnoredFlag<"nologo">;
@@ -308,7 +308,8 @@ def _SLASH_openmp_ : CLIgnoredFlag<"openmp-">;
def _SLASH_RTC : CLIgnoredJoined<"RTC">;
def _SLASH_sdl : CLIgnoredFlag<"sdl">;
def _SLASH_sdl_ : CLIgnoredFlag<"sdl-">;
-def _SLASH_utf8 : CLIgnoredFlag<"utf-8">;
+def _SLASH_utf8 : CLIgnoredFlag<"utf-8">,
+ HelpText<"Set source and runtime encoding to UTF-8 (default)">;
def _SLASH_w : CLIgnoredJoined<"w">;
def _SLASH_Zc_auto : CLIgnoredFlag<"Zc:auto">;
def _SLASH_Zc_forScope : CLIgnoredFlag<"Zc:forScope">;
diff --git a/include/clang/Driver/Options.td b/include/clang/Driver/Options.td
index 7f4e59a2d2336..6be159fad6945 100644
--- a/include/clang/Driver/Options.td
+++ b/include/clang/Driver/Options.td
@@ -1032,6 +1032,7 @@ def fno_ms_extensions : Flag<["-"], "fno-ms-extensions">, Group<f_Group>,
def fno_ms_compatibility : Flag<["-"], "fno-ms-compatibility">, Group<f_Group>,
Flags<[CoreOption]>;
def fno_delayed_template_parsing : Flag<["-"], "fno-delayed-template-parsing">, Group<f_Group>,
+ HelpText<"Disable delayed template parsing">,
Flags<[DriverOption, CoreOption]>;
def fno_objc_exceptions: Flag<["-"], "fno-objc-exceptions">, Group<f_Group>;
def fno_objc_legacy_dispatch : Flag<["-"], "fno-objc-legacy-dispatch">, Group<f_Group>;
diff --git a/include/clang/Index/IndexSymbol.h b/include/clang/Index/IndexSymbol.h
index 559b212b92668..d19e5ebef2f02 100644
--- a/include/clang/Index/IndexSymbol.h
+++ b/include/clang/Index/IndexSymbol.h
@@ -64,6 +64,8 @@ enum class SymbolSubKind {
None,
CXXCopyConstructor,
CXXMoveConstructor,
+ AccessorGetter,
+ AccessorSetter,
};
/// Set of properties that provide additional info about a symbol.
@@ -80,7 +82,7 @@ static const unsigned SymbolPropertyBitNum = 7;
typedef unsigned SymbolPropertySet;
/// Set of roles that are attributed to symbol occurrences.
-enum class SymbolRole : uint16_t {
+enum class SymbolRole : uint32_t {
Declaration = 1 << 0,
Definition = 1 << 1,
Reference = 1 << 2,
@@ -99,8 +101,10 @@ enum class SymbolRole : uint16_t {
RelationCalledBy = 1 << 13,
RelationExtendedBy = 1 << 14,
RelationAccessorOf = 1 << 15,
+ RelationContainedBy = 1 << 16,
+ RelationIBTypeOf = 1 << 17,
};
-static const unsigned SymbolRoleBitNum = 16;
+static const unsigned SymbolRoleBitNum = 18;
typedef unsigned SymbolRoleSet;
/// Represents a relation to another symbol for a symbol occurrence.
diff --git a/include/clang/Lex/HeaderSearch.h b/include/clang/Lex/HeaderSearch.h
index 4df3e783117a3..51983b9ab5d8e 100644
--- a/include/clang/Lex/HeaderSearch.h
+++ b/include/clang/Lex/HeaderSearch.h
@@ -406,7 +406,8 @@ public:
/// \return false if \#including the file will have no effect or true
/// if we should include it.
bool ShouldEnterIncludeFile(Preprocessor &PP, const FileEntry *File,
- bool isImport, Module *CorrespondingModule);
+ bool isImport, bool ModulesEnabled,
+ Module *CorrespondingModule);
/// \brief Return whether the specified file is a normal header,
/// a system header, or a C++ friendly system header.
diff --git a/include/clang/Lex/ModuleMap.h b/include/clang/Lex/ModuleMap.h
index b3a2421af86eb..46136725d87a8 100644
--- a/include/clang/Lex/ModuleMap.h
+++ b/include/clang/Lex/ModuleMap.h
@@ -316,6 +316,14 @@ public:
BuiltinIncludeDir = Dir;
}
+ /// \brief Get the directory that contains Clang-supplied include files.
+ const DirectoryEntry *getBuiltinDir() const {
+ return BuiltinIncludeDir;
+ }
+
+ /// \brief Is this a compiler builtin header?
+ static bool isBuiltinHeader(StringRef FileName);
+
/// \brief Add a module map callback.
void addModuleMapCallbacks(std::unique_ptr<ModuleMapCallbacks> Callback) {
Callbacks.push_back(std::move(Callback));
diff --git a/include/clang/Parse/Parser.h b/include/clang/Parse/Parser.h
index 972f13daca46b..fe159022c223e 100644
--- a/include/clang/Parse/Parser.h
+++ b/include/clang/Parse/Parser.h
@@ -600,11 +600,8 @@ private:
public:
// If NeedType is true, then TryAnnotateTypeOrScopeToken will try harder to
// find a type name by attempting typo correction.
- bool TryAnnotateTypeOrScopeToken(bool EnteringContext = false,
- bool NeedType = false);
- bool TryAnnotateTypeOrScopeTokenAfterScopeSpec(bool EnteringContext,
- bool NeedType,
- CXXScopeSpec &SS,
+ bool TryAnnotateTypeOrScopeToken();
+ bool TryAnnotateTypeOrScopeTokenAfterScopeSpec(CXXScopeSpec &SS,
bool IsNewScope);
bool TryAnnotateCXXScopeToken(bool EnteringContext = false);
diff --git a/include/clang/Sema/Sema.h b/include/clang/Sema/Sema.h
index d5e4b069f8b7b..c180a8ea3ee11 100644
--- a/include/clang/Sema/Sema.h
+++ b/include/clang/Sema/Sema.h
@@ -1709,7 +1709,8 @@ public:
static bool adjustContextForLocalExternDecl(DeclContext *&DC);
void DiagnoseFunctionSpecifiers(const DeclSpec &DS);
- void CheckShadow(Scope *S, VarDecl *D, const LookupResult& R);
+ NamedDecl *getShadowedDeclaration(const VarDecl *D, const LookupResult &R);
+ void CheckShadow(VarDecl *D, NamedDecl *ShadowedDecl, const LookupResult &R);
void CheckShadow(Scope *S, VarDecl *D);
/// Warn if 'E', which is an expression that is about to be modified, refers
@@ -1790,9 +1791,8 @@ public:
bool SetParamDefaultArgument(ParmVarDecl *Param, Expr *DefaultArg,
SourceLocation EqualLoc);
- void AddInitializerToDecl(Decl *dcl, Expr *init, bool DirectInit,
- bool TypeMayContainAuto);
- void ActOnUninitializedDecl(Decl *dcl, bool TypeMayContainAuto);
+ void AddInitializerToDecl(Decl *dcl, Expr *init, bool DirectInit);
+ void ActOnUninitializedDecl(Decl *dcl);
void ActOnInitializerError(Decl *Dcl);
bool canInitializeWithParenthesizedList(QualType TargetType);
@@ -1807,8 +1807,7 @@ public:
void FinalizeDeclaration(Decl *D);
DeclGroupPtrTy FinalizeDeclaratorGroup(Scope *S, const DeclSpec &DS,
ArrayRef<Decl *> Group);
- DeclGroupPtrTy BuildDeclaratorGroup(MutableArrayRef<Decl *> Group,
- bool TypeMayContainAuto = true);
+ DeclGroupPtrTy BuildDeclaratorGroup(MutableArrayRef<Decl *> Group);
/// Should be called on all declarations that might have attached
/// documentation comments.
@@ -4920,8 +4919,7 @@ public:
TypeSourceInfo *AllocTypeInfo,
Expr *ArraySize,
SourceRange DirectInitRange,
- Expr *Initializer,
- bool TypeMayContainAuto = true);
+ Expr *Initializer);
bool CheckAllocatedType(QualType AllocType, SourceLocation Loc,
SourceRange R);
@@ -8584,6 +8582,12 @@ public:
ArrayRef<OMPClause *> Clauses, Stmt *AStmt, SourceLocation StartLoc,
SourceLocation EndLoc,
llvm::DenseMap<ValueDecl *, Expr *> &VarsWithImplicitDSA);
+ /// Called on well-formed '\#pragma omp target teams distribute simd' after
+ /// parsing of the associated statement.
+ StmtResult ActOnOpenMPTargetTeamsDistributeSimdDirective(
+ ArrayRef<OMPClause *> Clauses, Stmt *AStmt, SourceLocation StartLoc,
+ SourceLocation EndLoc,
+ llvm::DenseMap<ValueDecl *, Expr *> &VarsWithImplicitDSA);
/// Checks correctness of linear modifiers.
bool CheckOpenMPLinearModifier(OpenMPLinearClauseKind LinKind,
diff --git a/include/clang/Serialization/ASTBitCodes.h b/include/clang/Serialization/ASTBitCodes.h
index 61e2f18045ea6..acbd6d1deb5b3 100644
--- a/include/clang/Serialization/ASTBitCodes.h
+++ b/include/clang/Serialization/ASTBitCodes.h
@@ -1517,6 +1517,7 @@ namespace clang {
STMT_OMP_TARGET_TEAMS_DISTRIBUTE_DIRECTIVE,
STMT_OMP_TARGET_TEAMS_DISTRIBUTE_PARALLEL_FOR_DIRECTIVE,
STMT_OMP_TARGET_TEAMS_DISTRIBUTE_PARALLEL_FOR_SIMD_DIRECTIVE,
+ STMT_OMP_TARGET_TEAMS_DISTRIBUTE_SIMD_DIRECTIVE,
EXPR_OMP_ARRAY_SECTION,
// ARC
diff --git a/lib/AST/ASTImporter.cpp b/lib/AST/ASTImporter.cpp
index 67e96ea828bdf..1ccb746633a76 100644
--- a/lib/AST/ASTImporter.cpp
+++ b/lib/AST/ASTImporter.cpp
@@ -4671,8 +4671,7 @@ Decl *ASTNodeImporter::VisitClassTemplateDecl(ClassTemplateDecl *D) {
ClassTemplateDecl *D2 = ClassTemplateDecl::Create(Importer.getToContext(), DC,
Loc, Name, TemplateParams,
- D2Templated,
- /*PrevDecl=*/nullptr);
+ D2Templated);
D2Templated->setDescribedClassTemplate(D2);
D2->setAccess(D->getAccess());
diff --git a/lib/AST/Decl.cpp b/lib/AST/Decl.cpp
index c3fa1c87affd1..81f08787d515d 100644
--- a/lib/AST/Decl.cpp
+++ b/lib/AST/Decl.cpp
@@ -2990,6 +2990,18 @@ SourceRange FunctionDecl::getReturnTypeSourceRange() const {
return RTRange;
}
+SourceRange FunctionDecl::getExceptionSpecSourceRange() const {
+ const TypeSourceInfo *TSI = getTypeSourceInfo();
+ if (!TSI)
+ return SourceRange();
+ FunctionTypeLoc FTL =
+ TSI->getTypeLoc().IgnoreParens().getAs<FunctionTypeLoc>();
+ if (!FTL)
+ return SourceRange();
+
+ return FTL.getExceptionSpecRange();
+}
+
const Attr *FunctionDecl::getUnusedResultAttr() const {
QualType RetType = getReturnType();
if (RetType->isRecordType()) {
diff --git a/lib/AST/DeclTemplate.cpp b/lib/AST/DeclTemplate.cpp
index 8643cbfcd960a..a5fbb0a3baece 100644
--- a/lib/AST/DeclTemplate.cpp
+++ b/lib/AST/DeclTemplate.cpp
@@ -297,12 +297,10 @@ ClassTemplateDecl *ClassTemplateDecl::Create(ASTContext &C,
SourceLocation L,
DeclarationName Name,
TemplateParameterList *Params,
- NamedDecl *Decl,
- ClassTemplateDecl *PrevDecl) {
+ NamedDecl *Decl) {
AdoptTemplateParameterList(Params, cast<DeclContext>(Decl));
ClassTemplateDecl *New = new (C, DC) ClassTemplateDecl(C, DC, L, Name,
Params, Decl);
- New->setPreviousDecl(PrevDecl);
return New;
}
diff --git a/lib/AST/Expr.cpp b/lib/AST/Expr.cpp
index 93f3ad5f2bdd5..14f31d0c6b8ce 100644
--- a/lib/AST/Expr.cpp
+++ b/lib/AST/Expr.cpp
@@ -562,8 +562,7 @@ std::string PredefinedExpr::ComputeName(IdentType IT, const Decl *CurrentDecl) {
FT = dyn_cast<FunctionProtoType>(AFT);
if (IT == FuncSig) {
- assert(FT && "We must have a written prototype in this case.");
- switch (FT->getCallConv()) {
+ switch (AFT->getCallConv()) {
case CC_C: POut << "__cdecl "; break;
case CC_X86StdCall: POut << "__stdcall "; break;
case CC_X86FastCall: POut << "__fastcall "; break;
@@ -587,12 +586,15 @@ std::string PredefinedExpr::ComputeName(IdentType IT, const Decl *CurrentDecl) {
if (FT->isVariadic()) {
if (FD->getNumParams()) POut << ", ";
POut << "...";
+ } else if ((IT == FuncSig || !Context.getLangOpts().CPlusPlus) &&
+ !Decl->getNumParams()) {
+ POut << "void";
}
}
POut << ")";
if (const CXXMethodDecl *MD = dyn_cast<CXXMethodDecl>(FD)) {
- const FunctionType *FT = MD->getType()->castAs<FunctionType>();
+ assert(FT && "We must have a written prototype in this case.");
if (FT->isConst())
POut << " const";
if (FT->isVolatile())
diff --git a/lib/AST/ExprConstant.cpp b/lib/AST/ExprConstant.cpp
index fe77c7f6f3bfe..a8512b294055d 100644
--- a/lib/AST/ExprConstant.cpp
+++ b/lib/AST/ExprConstant.cpp
@@ -1627,8 +1627,17 @@ static bool CheckLiteralType(EvalInfo &Info, const Expr *E,
// C++1y: A constant initializer for an object o [...] may also invoke
// constexpr constructors for o and its subobjects even if those objects
// are of non-literal class types.
- if (Info.getLangOpts().CPlusPlus14 && This &&
- Info.EvaluatingDecl == This->getLValueBase())
+ //
+ // C++11 missed this detail for aggregates, so classes like this:
+ // struct foo_t { union { int i; volatile int j; } u; };
+ // are not (obviously) initializable like so:
+ // __attribute__((__require_constant_initialization__))
+ // static const foo_t x = {{0}};
+ // because "i" is a subobject with non-literal initialization (due to the
+ // volatile member of the union). See:
+ // http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_active.html#1677
+ // Therefore, we use the C++1y behavior.
+ if (This && Info.EvaluatingDecl == This->getLValueBase())
return true;
// Prvalue constant expressions must be of literal types.
diff --git a/lib/AST/StmtOpenMP.cpp b/lib/AST/StmtOpenMP.cpp
index a7c71bb5f45c4..880817a1339b4 100644
--- a/lib/AST/StmtOpenMP.cpp
+++ b/lib/AST/StmtOpenMP.cpp
@@ -1720,3 +1720,59 @@ OMPTargetTeamsDistributeParallelForSimdDirective::CreateEmpty(
CollapsedNum, NumClauses);
}
+OMPTargetTeamsDistributeSimdDirective *
+OMPTargetTeamsDistributeSimdDirective::Create(
+ const ASTContext &C, SourceLocation StartLoc, SourceLocation EndLoc,
+ unsigned CollapsedNum, ArrayRef<OMPClause *> Clauses, Stmt *AssociatedStmt,
+ const HelperExprs &Exprs) {
+ auto Size = llvm::alignTo(sizeof(OMPTargetTeamsDistributeSimdDirective),
+ alignof(OMPClause *));
+ void *Mem = C.Allocate(
+ Size + sizeof(OMPClause *) * Clauses.size() +
+ sizeof(Stmt *) *
+ numLoopChildren(CollapsedNum, OMPD_target_teams_distribute_simd));
+ OMPTargetTeamsDistributeSimdDirective *Dir = new (Mem)
+ OMPTargetTeamsDistributeSimdDirective(StartLoc, EndLoc, CollapsedNum,
+ Clauses.size());
+ Dir->setClauses(Clauses);
+ Dir->setAssociatedStmt(AssociatedStmt);
+ Dir->setIterationVariable(Exprs.IterationVarRef);
+ Dir->setLastIteration(Exprs.LastIteration);
+ Dir->setCalcLastIteration(Exprs.CalcLastIteration);
+ Dir->setPreCond(Exprs.PreCond);
+ Dir->setCond(Exprs.Cond);
+ Dir->setInit(Exprs.Init);
+ Dir->setInc(Exprs.Inc);
+ Dir->setIsLastIterVariable(Exprs.IL);
+ Dir->setLowerBoundVariable(Exprs.LB);
+ Dir->setUpperBoundVariable(Exprs.UB);
+ Dir->setStrideVariable(Exprs.ST);
+ Dir->setEnsureUpperBound(Exprs.EUB);
+ Dir->setNextLowerBound(Exprs.NLB);
+ Dir->setNextUpperBound(Exprs.NUB);
+ Dir->setNumIterations(Exprs.NumIterations);
+ Dir->setPrevLowerBoundVariable(Exprs.PrevLB);
+ Dir->setPrevUpperBoundVariable(Exprs.PrevUB);
+ Dir->setCounters(Exprs.Counters);
+ Dir->setPrivateCounters(Exprs.PrivateCounters);
+ Dir->setInits(Exprs.Inits);
+ Dir->setUpdates(Exprs.Updates);
+ Dir->setFinals(Exprs.Finals);
+ Dir->setPreInits(Exprs.PreInits);
+ return Dir;
+}
+
+OMPTargetTeamsDistributeSimdDirective *
+OMPTargetTeamsDistributeSimdDirective::CreateEmpty(const ASTContext &C,
+ unsigned NumClauses,
+ unsigned CollapsedNum,
+ EmptyShell) {
+ auto Size = llvm::alignTo(sizeof(OMPTargetTeamsDistributeSimdDirective),
+ alignof(OMPClause *));
+ void *Mem = C.Allocate(
+ Size + sizeof(OMPClause *) * NumClauses +
+ sizeof(Stmt *) *
+ numLoopChildren(CollapsedNum, OMPD_target_teams_distribute_simd));
+ return new (Mem)
+ OMPTargetTeamsDistributeSimdDirective(CollapsedNum, NumClauses);
+}
diff --git a/lib/AST/StmtPrinter.cpp b/lib/AST/StmtPrinter.cpp
index a9c64c3ba6ae5..1ba1aa40ec5c8 100644
--- a/lib/AST/StmtPrinter.cpp
+++ b/lib/AST/StmtPrinter.cpp
@@ -1250,6 +1250,12 @@ void StmtPrinter::VisitOMPTargetTeamsDistributeParallelForSimdDirective(
PrintOMPExecutableDirective(Node);
}
+void StmtPrinter::VisitOMPTargetTeamsDistributeSimdDirective(
+ OMPTargetTeamsDistributeSimdDirective *Node) {
+ Indent() << "#pragma omp target teams distribute simd ";
+ PrintOMPExecutableDirective(Node);
+}
+
//===----------------------------------------------------------------------===//
// Expr printing methods.
//===----------------------------------------------------------------------===//
diff --git a/lib/AST/StmtProfile.cpp b/lib/AST/StmtProfile.cpp
index df36bf06b8435..bcd2e96875e78 100644
--- a/lib/AST/StmtProfile.cpp
+++ b/lib/AST/StmtProfile.cpp
@@ -768,6 +768,11 @@ void StmtProfiler::VisitOMPTargetTeamsDistributeParallelForSimdDirective(
VisitOMPLoopDirective(S);
}
+void StmtProfiler::VisitOMPTargetTeamsDistributeSimdDirective(
+ const OMPTargetTeamsDistributeSimdDirective *S) {
+ VisitOMPLoopDirective(S);
+}
+
void StmtProfiler::VisitExpr(const Expr *S) {
VisitStmt(S);
}
diff --git a/lib/Analysis/BodyFarm.cpp b/lib/Analysis/BodyFarm.cpp
index d202a0406461c..56c812c34c507 100644
--- a/lib/Analysis/BodyFarm.cpp
+++ b/lib/Analysis/BodyFarm.cpp
@@ -467,6 +467,8 @@ static Stmt *createObjCPropertyGetter(ASTContext &Ctx,
ASTMaker M(Ctx);
const VarDecl *selfVar = Prop->getGetterMethodDecl()->getSelfDecl();
+ if (!selfVar)
+ return nullptr;
Expr *loadedIVar =
M.makeObjCIvarRef(
diff --git a/lib/Analysis/CFG.cpp b/lib/Analysis/CFG.cpp
index a1a463f1d0376..d56e0e8fa1d0d 100644
--- a/lib/Analysis/CFG.cpp
+++ b/lib/Analysis/CFG.cpp
@@ -2175,19 +2175,15 @@ CFGBlock *CFGBuilder::VisitIfStmt(IfStmt *I) {
SaveAndRestore<LocalScope::const_iterator> save_scope_pos(ScopePos);
// Create local scope for C++17 if init-stmt if one exists.
- if (Stmt *Init = I->getInit()) {
- LocalScope::const_iterator BeginScopePos = ScopePos;
+ if (Stmt *Init = I->getInit())
addLocalScopeForStmt(Init);
- addAutomaticObjDtors(ScopePos, BeginScopePos, I);
- }
// Create local scope for possible condition variable.
// Store scope position. Add implicit destructor.
- if (VarDecl *VD = I->getConditionVariable()) {
- LocalScope::const_iterator BeginScopePos = ScopePos;
+ if (VarDecl *VD = I->getConditionVariable())
addLocalScopeForVarDecl(VD);
- addAutomaticObjDtors(ScopePos, BeginScopePos, I);
- }
+
+ addAutomaticObjDtors(ScopePos, save_scope_pos.get(), I);
// The block we were processing is now finished. Make it the successor
// block.
@@ -2256,36 +2252,39 @@ CFGBlock *CFGBuilder::VisitIfStmt(IfStmt *I) {
// removes infeasible paths from the control-flow graph by having the
// control-flow transfer of '&&' or '||' go directly into the then/else
// blocks directly.
- if (!I->getConditionVariable())
- if (BinaryOperator *Cond =
- dyn_cast<BinaryOperator>(I->getCond()->IgnoreParens()))
- if (Cond->isLogicalOp())
- return VisitLogicalOperator(Cond, I, ThenBlock, ElseBlock).first;
-
- // Now create a new block containing the if statement.
- Block = createBlock(false);
+ BinaryOperator *Cond =
+ I->getConditionVariable()
+ ? nullptr
+ : dyn_cast<BinaryOperator>(I->getCond()->IgnoreParens());
+ CFGBlock *LastBlock;
+ if (Cond && Cond->isLogicalOp())
+ LastBlock = VisitLogicalOperator(Cond, I, ThenBlock, ElseBlock).first;
+ else {
+ // Now create a new block containing the if statement.
+ Block = createBlock(false);
- // Set the terminator of the new block to the If statement.
- Block->setTerminator(I);
+ // Set the terminator of the new block to the If statement.
+ Block->setTerminator(I);
- // See if this is a known constant.
- const TryResult &KnownVal = tryEvaluateBool(I->getCond());
+ // See if this is a known constant.
+ const TryResult &KnownVal = tryEvaluateBool(I->getCond());
- // Add the successors. If we know that specific branches are
- // unreachable, inform addSuccessor() of that knowledge.
- addSuccessor(Block, ThenBlock, /* isReachable = */ !KnownVal.isFalse());
- addSuccessor(Block, ElseBlock, /* isReachable = */ !KnownVal.isTrue());
+ // Add the successors. If we know that specific branches are
+ // unreachable, inform addSuccessor() of that knowledge.
+ addSuccessor(Block, ThenBlock, /* isReachable = */ !KnownVal.isFalse());
+ addSuccessor(Block, ElseBlock, /* isReachable = */ !KnownVal.isTrue());
- // Add the condition as the last statement in the new block. This may create
- // new blocks as the condition may contain control-flow. Any newly created
- // blocks will be pointed to be "Block".
- CFGBlock *LastBlock = addStmt(I->getCond());
+ // Add the condition as the last statement in the new block. This may
+ // create new blocks as the condition may contain control-flow. Any newly
+ // created blocks will be pointed to be "Block".
+ LastBlock = addStmt(I->getCond());
- // If the IfStmt contains a condition variable, add it and its
- // initializer to the CFG.
- if (const DeclStmt* DS = I->getConditionVariableDeclStmt()) {
- autoCreateBlock();
- LastBlock = addStmt(const_cast<DeclStmt *>(DS));
+ // If the IfStmt contains a condition variable, add it and its
+ // initializer to the CFG.
+ if (const DeclStmt* DS = I->getConditionVariableDeclStmt()) {
+ autoCreateBlock();
+ LastBlock = addStmt(const_cast<DeclStmt *>(DS));
+ }
}
// Finally, if the IfStmt contains a C++17 init-stmt, add it to the CFG.
@@ -3078,19 +3077,15 @@ CFGBlock *CFGBuilder::VisitSwitchStmt(SwitchStmt *Terminator) {
SaveAndRestore<LocalScope::const_iterator> save_scope_pos(ScopePos);
// Create local scope for C++17 switch init-stmt if one exists.
- if (Stmt *Init = Terminator->getInit()) {
- LocalScope::const_iterator BeginScopePos = ScopePos;
+ if (Stmt *Init = Terminator->getInit())
addLocalScopeForStmt(Init);
- addAutomaticObjDtors(ScopePos, BeginScopePos, Terminator);
- }
// Create local scope for possible condition variable.
// Store scope position. Add implicit destructor.
- if (VarDecl *VD = Terminator->getConditionVariable()) {
- LocalScope::const_iterator SwitchBeginScopePos = ScopePos;
+ if (VarDecl *VD = Terminator->getConditionVariable())
addLocalScopeForVarDecl(VD);
- addAutomaticObjDtors(ScopePos, SwitchBeginScopePos, Terminator);
- }
+
+ addAutomaticObjDtors(ScopePos, save_scope_pos.get(), Terminator);
if (Block) {
if (badCFG)
diff --git a/lib/Analysis/ReachableCode.cpp b/lib/Analysis/ReachableCode.cpp
index 69d000c03bac1..a2f3203762f76 100644
--- a/lib/Analysis/ReachableCode.cpp
+++ b/lib/Analysis/ReachableCode.cpp
@@ -218,11 +218,21 @@ static bool isConfigurationValue(const Stmt *S,
}
case Stmt::UnaryOperatorClass: {
const UnaryOperator *UO = cast<UnaryOperator>(S);
- if (SilenceableCondVal)
- *SilenceableCondVal = UO->getSourceRange();
- return UO->getOpcode() == UO_LNot &&
- isConfigurationValue(UO->getSubExpr(), PP, SilenceableCondVal,
- IncludeIntegers, WrappedInParens);
+ if (UO->getOpcode() != UO_LNot)
+ return false;
+ bool SilenceableCondValNotSet =
+ SilenceableCondVal && SilenceableCondVal->getBegin().isInvalid();
+ bool IsSubExprConfigValue =
+ isConfigurationValue(UO->getSubExpr(), PP, SilenceableCondVal,
+ IncludeIntegers, WrappedInParens);
+ // Update the silenceable condition value source range only if the range
+ // was set directly by the child expression.
+ if (SilenceableCondValNotSet &&
+ SilenceableCondVal->getBegin().isValid() &&
+ *SilenceableCondVal ==
+ UO->getSubExpr()->IgnoreCasts()->getSourceRange())
+ *SilenceableCondVal = UO->getSourceRange();
+ return IsSubExprConfigValue;
}
default:
return false;
diff --git a/lib/Basic/OpenMPKinds.cpp b/lib/Basic/OpenMPKinds.cpp
index 7bd1f8762bff8..905c3693d3783 100644
--- a/lib/Basic/OpenMPKinds.cpp
+++ b/lib/Basic/OpenMPKinds.cpp
@@ -700,6 +700,16 @@ bool clang::isAllowedClauseForDirective(OpenMPDirectiveKind DKind,
break;
}
break;
+ case OMPD_target_teams_distribute_simd:
+ switch (CKind) {
+#define OPENMP_TARGET_TEAMS_DISTRIBUTE_SIMD_CLAUSE(Name) \
+ case OMPC_##Name: \
+ return true;
+#include "clang/Basic/OpenMPKinds.def"
+ default:
+ break;
+ }
+ break;
case OMPD_declare_target:
case OMPD_end_declare_target:
case OMPD_unknown:
@@ -732,7 +742,8 @@ bool clang::isOpenMPLoopDirective(OpenMPDirectiveKind DKind) {
DKind == OMPD_teams_distribute_parallel_for ||
DKind == OMPD_target_teams_distribute ||
DKind == OMPD_target_teams_distribute_parallel_for ||
- DKind == OMPD_target_teams_distribute_parallel_for_simd;
+ DKind == OMPD_target_teams_distribute_parallel_for_simd ||
+ DKind == OMPD_target_teams_distribute_simd;
}
bool clang::isOpenMPWorksharingDirective(OpenMPDirectiveKind DKind) {
@@ -773,7 +784,8 @@ bool clang::isOpenMPTargetExecutionDirective(OpenMPDirectiveKind DKind) {
DKind == OMPD_target_parallel_for_simd || DKind == OMPD_target_simd ||
DKind == OMPD_target_teams || DKind == OMPD_target_teams_distribute ||
DKind == OMPD_target_teams_distribute_parallel_for ||
- DKind == OMPD_target_teams_distribute_parallel_for_simd;
+ DKind == OMPD_target_teams_distribute_parallel_for_simd ||
+ DKind == OMPD_target_teams_distribute_simd;
}
bool clang::isOpenMPTargetDataManagementDirective(OpenMPDirectiveKind DKind) {
@@ -792,7 +804,8 @@ bool clang::isOpenMPTeamsDirective(OpenMPDirectiveKind DKind) {
return isOpenMPNestingTeamsDirective(DKind) ||
DKind == OMPD_target_teams || DKind == OMPD_target_teams_distribute ||
DKind == OMPD_target_teams_distribute_parallel_for ||
- DKind == OMPD_target_teams_distribute_parallel_for_simd;
+ DKind == OMPD_target_teams_distribute_parallel_for_simd ||
+ DKind == OMPD_target_teams_distribute_simd;
}
bool clang::isOpenMPSimdDirective(OpenMPDirectiveKind DKind) {
@@ -802,7 +815,8 @@ bool clang::isOpenMPSimdDirective(OpenMPDirectiveKind DKind) {
DKind == OMPD_distribute_simd || DKind == OMPD_target_simd ||
DKind == OMPD_teams_distribute_simd ||
DKind == OMPD_teams_distribute_parallel_for_simd ||
- DKind == OMPD_target_teams_distribute_parallel_for_simd;
+ DKind == OMPD_target_teams_distribute_parallel_for_simd ||
+ DKind == OMPD_target_teams_distribute_simd;
}
bool clang::isOpenMPNestingDistributeDirective(OpenMPDirectiveKind Kind) {
@@ -819,7 +833,8 @@ bool clang::isOpenMPDistributeDirective(OpenMPDirectiveKind Kind) {
Kind == OMPD_teams_distribute_parallel_for ||
Kind == OMPD_target_teams_distribute ||
Kind == OMPD_target_teams_distribute_parallel_for ||
- Kind == OMPD_target_teams_distribute_parallel_for_simd;
+ Kind == OMPD_target_teams_distribute_parallel_for_simd ||
+ Kind == OMPD_target_teams_distribute_simd;
}
bool clang::isOpenMPPrivate(OpenMPClauseKind Kind) {
@@ -845,5 +860,6 @@ bool clang::isOpenMPLoopBoundSharingDirective(OpenMPDirectiveKind Kind) {
Kind == OMPD_teams_distribute_parallel_for ||
Kind == OMPD_target_teams_distribute ||
Kind == OMPD_target_teams_distribute_parallel_for ||
- Kind == OMPD_target_teams_distribute_parallel_for_simd;
+ Kind == OMPD_target_teams_distribute_parallel_for_simd ||
+ Kind == OMPD_target_teams_distribute_simd;
}
diff --git a/lib/Basic/Targets.cpp b/lib/Basic/Targets.cpp
index 4d2b3d007599e..89e3f3ebbe3f7 100644
--- a/lib/Basic/Targets.cpp
+++ b/lib/Basic/Targets.cpp
@@ -2663,6 +2663,12 @@ class X86TargetInfo : public TargetInfo {
CK_BDVER4,
//@}
+ /// \name zen
+ /// Zen architecture processors.
+ //@{
+ CK_ZNVER1,
+ //@}
+
/// This specification is deprecated and will be removed in the future.
/// Users should prefer \see CK_K8.
// FIXME: Warn on this when the CPU is set to it.
@@ -2744,6 +2750,7 @@ class X86TargetInfo : public TargetInfo {
.Case("bdver2", CK_BDVER2)
.Case("bdver3", CK_BDVER3)
.Case("bdver4", CK_BDVER4)
+ .Case("znver1", CK_ZNVER1)
.Case("x86-64", CK_x86_64)
.Case("geode", CK_Geode)
.Default(CK_Generic);
@@ -2943,6 +2950,7 @@ public:
case CK_BDVER2:
case CK_BDVER3:
case CK_BDVER4:
+ case CK_ZNVER1:
case CK_x86_64:
return true;
}
@@ -3190,6 +3198,33 @@ bool X86TargetInfo::initFeatureMap(
setFeatureEnabledImpl(Features, "cx16", true);
setFeatureEnabledImpl(Features, "fxsr", true);
break;
+ case CK_ZNVER1:
+ setFeatureEnabledImpl(Features, "adx", true);
+ setFeatureEnabledImpl(Features, "aes", true);
+ setFeatureEnabledImpl(Features, "avx2", true);
+ setFeatureEnabledImpl(Features, "bmi", true);
+ setFeatureEnabledImpl(Features, "bmi2", true);
+ setFeatureEnabledImpl(Features, "clflushopt", true);
+ setFeatureEnabledImpl(Features, "cx16", true);
+ setFeatureEnabledImpl(Features, "f16c", true);
+ setFeatureEnabledImpl(Features, "fma", true);
+ setFeatureEnabledImpl(Features, "fsgsbase", true);
+ setFeatureEnabledImpl(Features, "fxsr", true);
+ setFeatureEnabledImpl(Features, "lzcnt", true);
+ setFeatureEnabledImpl(Features, "mwaitx", true);
+ setFeatureEnabledImpl(Features, "movbe", true);
+ setFeatureEnabledImpl(Features, "pclmul", true);
+ setFeatureEnabledImpl(Features, "popcnt", true);
+ setFeatureEnabledImpl(Features, "prfchw", true);
+ setFeatureEnabledImpl(Features, "rdrnd", true);
+ setFeatureEnabledImpl(Features, "rdseed", true);
+ setFeatureEnabledImpl(Features, "sha", true);
+ setFeatureEnabledImpl(Features, "sse4a", true);
+ setFeatureEnabledImpl(Features, "xsave", true);
+ setFeatureEnabledImpl(Features, "xsavec", true);
+ setFeatureEnabledImpl(Features, "xsaveopt", true);
+ setFeatureEnabledImpl(Features, "xsaves", true);
+ break;
case CK_BDVER4:
setFeatureEnabledImpl(Features, "avx2", true);
setFeatureEnabledImpl(Features, "bmi2", true);
@@ -3741,6 +3776,9 @@ void X86TargetInfo::getTargetDefines(const LangOptions &Opts,
case CK_BDVER4:
defineCPUMacros(Builder, "bdver4");
break;
+ case CK_ZNVER1:
+ defineCPUMacros(Builder, "znver1");
+ break;
case CK_Geode:
defineCPUMacros(Builder, "geode");
break;
diff --git a/lib/Basic/Version.cpp b/lib/Basic/Version.cpp
index a1a67c2bc144d..b91efeb34c7fb 100644
--- a/lib/Basic/Version.cpp
+++ b/lib/Basic/Version.cpp
@@ -36,7 +36,7 @@ std::string getClangRepositoryPath() {
// If the SVN_REPOSITORY is empty, try to use the SVN keyword. This helps us
// pick up a tag in an SVN export, for example.
- StringRef SVNRepository("$URL: https://llvm.org/svn/llvm-project/cfe/trunk/lib/Basic/Version.cpp $");
+ StringRef SVNRepository("$URL: https://llvm.org/svn/llvm-project/cfe/branches/release_40/lib/Basic/Version.cpp $");
if (URL.empty()) {
URL = SVNRepository.slice(SVNRepository.find(':'),
SVNRepository.find("/lib/Basic"));
diff --git a/lib/CodeGen/CGBuiltin.cpp b/lib/CodeGen/CGBuiltin.cpp
index 4d34b3e9222f6..2ede1d46b3d5f 100644
--- a/lib/CodeGen/CGBuiltin.cpp
+++ b/lib/CodeGen/CGBuiltin.cpp
@@ -4318,9 +4318,9 @@ Value *CodeGenFunction::EmitARMBuiltinExpr(unsigned BuiltinID,
}
if (BuiltinID == ARM::BI__builtin_arm_rbit) {
- return Builder.CreateCall(CGM.getIntrinsic(Intrinsic::arm_rbit),
- EmitScalarExpr(E->getArg(0)),
- "rbit");
+ llvm::Value *Arg = EmitScalarExpr(E->getArg(0));
+ return Builder.CreateCall(
+ CGM.getIntrinsic(Intrinsic::bitreverse, Arg->getType()), Arg, "rbit");
}
if (BuiltinID == ARM::BI__clear_cache) {
@@ -5226,14 +5226,14 @@ Value *CodeGenFunction::EmitAArch64BuiltinExpr(unsigned BuiltinID,
"rbit of unusual size!");
llvm::Value *Arg = EmitScalarExpr(E->getArg(0));
return Builder.CreateCall(
- CGM.getIntrinsic(Intrinsic::aarch64_rbit, Arg->getType()), Arg, "rbit");
+ CGM.getIntrinsic(Intrinsic::bitreverse, Arg->getType()), Arg, "rbit");
}
if (BuiltinID == AArch64::BI__builtin_arm_rbit64) {
assert((getContext().getTypeSize(E->getType()) == 64) &&
"rbit of unusual size!");
llvm::Value *Arg = EmitScalarExpr(E->getArg(0));
return Builder.CreateCall(
- CGM.getIntrinsic(Intrinsic::aarch64_rbit, Arg->getType()), Arg, "rbit");
+ CGM.getIntrinsic(Intrinsic::bitreverse, Arg->getType()), Arg, "rbit");
}
if (BuiltinID == AArch64::BI__clear_cache) {
diff --git a/lib/CodeGen/CGDecl.cpp b/lib/CodeGen/CGDecl.cpp
index d76136380160b..0a88b2310beb4 100644
--- a/lib/CodeGen/CGDecl.cpp
+++ b/lib/CodeGen/CGDecl.cpp
@@ -311,7 +311,7 @@ CodeGenFunction::AddInitializerToStaticVarDecl(const VarDecl &D,
if (!Init) {
if (!getLangOpts().CPlusPlus)
CGM.ErrorUnsupported(D.getInit(), "constant l-value expression");
- else if (Builder.GetInsertBlock()) {
+ else if (HaveInsertPoint()) {
// Since we have a static initializer, this global variable can't
// be constant.
GV->setConstant(false);
@@ -352,7 +352,7 @@ CodeGenFunction::AddInitializerToStaticVarDecl(const VarDecl &D,
GV->setConstant(CGM.isTypeConstant(D.getType(), true));
GV->setInitializer(Init);
- if (hasNontrivialDestruction(D.getType())) {
+ if (hasNontrivialDestruction(D.getType()) && HaveInsertPoint()) {
// We have a constant initializer, but a nontrivial destructor. We still
// need to perform a guarded "initialization" in order to register the
// destructor.
diff --git a/lib/CodeGen/CGDeclCXX.cpp b/lib/CodeGen/CGDeclCXX.cpp
index 8d9d0b21bfe11..f56e182169311 100644
--- a/lib/CodeGen/CGDeclCXX.cpp
+++ b/lib/CodeGen/CGDeclCXX.cpp
@@ -353,9 +353,6 @@ CodeGenModule::EmitCXXGlobalVarDeclInitFunc(const VarDecl *D,
if (D->getTLSKind()) {
// FIXME: Should we support init_priority for thread_local?
- // FIXME: Ideally, initialization of instantiated thread_local static data
- // members of class templates should not trigger initialization of other
- // entities in the TU.
// FIXME: We only need to register one __cxa_thread_atexit function for the
// entire TU.
CXXThreadLocalInits.push_back(Fn);
diff --git a/lib/CodeGen/CGOpenMPRuntime.cpp b/lib/CodeGen/CGOpenMPRuntime.cpp
index 27af344fae87a..db9de2ab6ad5c 100644
--- a/lib/CodeGen/CGOpenMPRuntime.cpp
+++ b/lib/CodeGen/CGOpenMPRuntime.cpp
@@ -99,10 +99,11 @@ class CGOpenMPOutlinedRegionInfo final : public CGOpenMPRegionInfo {
public:
CGOpenMPOutlinedRegionInfo(const CapturedStmt &CS, const VarDecl *ThreadIDVar,
const RegionCodeGenTy &CodeGen,
- OpenMPDirectiveKind Kind, bool HasCancel)
+ OpenMPDirectiveKind Kind, bool HasCancel,
+ StringRef HelperName)
: CGOpenMPRegionInfo(CS, ParallelOutlinedRegion, CodeGen, Kind,
HasCancel),
- ThreadIDVar(ThreadIDVar) {
+ ThreadIDVar(ThreadIDVar), HelperName(HelperName) {
assert(ThreadIDVar != nullptr && "No ThreadID in OpenMP region.");
}
@@ -111,7 +112,7 @@ public:
const VarDecl *getThreadIDVariable() const override { return ThreadIDVar; }
/// \brief Get the name of the capture helper.
- StringRef getHelperName() const override { return ".omp_outlined."; }
+ StringRef getHelperName() const override { return HelperName; }
static bool classof(const CGCapturedStmtInfo *Info) {
return CGOpenMPRegionInfo::classof(Info) &&
@@ -123,6 +124,7 @@ private:
/// \brief A variable or parameter storing global thread id for OpenMP
/// constructs.
const VarDecl *ThreadIDVar;
+ StringRef HelperName;
};
/// \brief API for captured statement code generation in OpenMP constructs.
@@ -855,7 +857,7 @@ llvm::Value *CGOpenMPRuntime::emitParallelOrTeamsOutlinedFunction(
else if (auto *OPFD = dyn_cast<OMPParallelForDirective>(&D))
HasCancel = OPFD->hasCancel();
CGOpenMPOutlinedRegionInfo CGInfo(*CS, ThreadIDVar, CodeGen, InnermostKind,
- HasCancel);
+ HasCancel, getOutlinedHelperName());
CodeGenFunction::CGCapturedStmtRAII CapInfoRAII(CGF, &CGInfo);
return CGF.GenerateOpenMPCapturedStmtFunction(*CS);
}
@@ -1892,9 +1894,9 @@ llvm::Function *CGOpenMPRuntime::emitThreadPrivateVarDefinition(
/// } else {
/// ElseGen();
/// }
-static void emitOMPIfClause(CodeGenFunction &CGF, const Expr *Cond,
- const RegionCodeGenTy &ThenGen,
- const RegionCodeGenTy &ElseGen) {
+void CGOpenMPRuntime::emitOMPIfClause(CodeGenFunction &CGF, const Expr *Cond,
+ const RegionCodeGenTy &ThenGen,
+ const RegionCodeGenTy &ElseGen) {
CodeGenFunction::LexicalScope ConditionScope(CGF, Cond->getSourceRange());
// If the condition constant folds and can be elided, try to avoid emitting
diff --git a/lib/CodeGen/CGOpenMPRuntime.h b/lib/CodeGen/CGOpenMPRuntime.h
index 9a784dff0ae84..61ddc702ed24a 100644
--- a/lib/CodeGen/CGOpenMPRuntime.h
+++ b/lib/CodeGen/CGOpenMPRuntime.h
@@ -130,6 +130,35 @@ protected:
bool IsOffloadEntry,
const RegionCodeGenTy &CodeGen);
+ /// \brief Emits code for OpenMP 'if' clause using specified \a CodeGen
+ /// function. Here is the logic:
+ /// if (Cond) {
+ /// ThenGen();
+ /// } else {
+ /// ElseGen();
+ /// }
+ void emitOMPIfClause(CodeGenFunction &CGF, const Expr *Cond,
+ const RegionCodeGenTy &ThenGen,
+ const RegionCodeGenTy &ElseGen);
+
+ /// \brief Emits object of ident_t type with info for source location.
+ /// \param Flags Flags for OpenMP location.
+ ///
+ llvm::Value *emitUpdateLocation(CodeGenFunction &CGF, SourceLocation Loc,
+ unsigned Flags = 0);
+
+ /// \brief Returns pointer to ident_t type.
+ llvm::Type *getIdentTyPointerTy();
+
+ /// \brief Gets thread id value for the current thread.
+ ///
+ llvm::Value *getThreadID(CodeGenFunction &CGF, SourceLocation Loc);
+
+ /// \brief Get the function name of an outlined region.
+ // The name can be customized depending on the target.
+ //
+ virtual StringRef getOutlinedHelperName() const { return ".omp_outlined."; }
+
private:
/// \brief Default const ident_t object used for initialization of all other
/// ident_t objects.
@@ -388,15 +417,6 @@ private:
/// \brief Build type kmp_routine_entry_t (if not built yet).
void emitKmpRoutineEntryT(QualType KmpInt32Ty);
- /// \brief Emits object of ident_t type with info for source location.
- /// \param Flags Flags for OpenMP location.
- ///
- llvm::Value *emitUpdateLocation(CodeGenFunction &CGF, SourceLocation Loc,
- unsigned Flags = 0);
-
- /// \brief Returns pointer to ident_t type.
- llvm::Type *getIdentTyPointerTy();
-
/// \brief Returns pointer to kmpc_micro type.
llvm::Type *getKmpc_MicroPointerTy();
@@ -432,10 +452,6 @@ private:
/// stored.
virtual Address emitThreadIDAddress(CodeGenFunction &CGF, SourceLocation Loc);
- /// \brief Gets thread id value for the current thread.
- ///
- llvm::Value *getThreadID(CodeGenFunction &CGF, SourceLocation Loc);
-
/// \brief Gets (if variable with the given name already exist) or creates
/// internal global variable with the specified Name. The created variable has
/// linkage CommonLinkage by default and is initialized by null value.
diff --git a/lib/CodeGen/CGOpenMPRuntimeNVPTX.cpp b/lib/CodeGen/CGOpenMPRuntimeNVPTX.cpp
index bc1458b1c2034..6a6d832e33cd5 100644
--- a/lib/CodeGen/CGOpenMPRuntimeNVPTX.cpp
+++ b/lib/CodeGen/CGOpenMPRuntimeNVPTX.cpp
@@ -26,8 +26,57 @@ enum OpenMPRTLFunctionNVPTX {
OMPRTL_NVPTX__kmpc_kernel_init,
/// \brief Call to void __kmpc_kernel_deinit();
OMPRTL_NVPTX__kmpc_kernel_deinit,
+ /// \brief Call to void __kmpc_kernel_prepare_parallel(void
+ /// *outlined_function);
+ OMPRTL_NVPTX__kmpc_kernel_prepare_parallel,
+ /// \brief Call to bool __kmpc_kernel_parallel(void **outlined_function);
+ OMPRTL_NVPTX__kmpc_kernel_parallel,
+ /// \brief Call to void __kmpc_kernel_end_parallel();
+ OMPRTL_NVPTX__kmpc_kernel_end_parallel,
+ /// Call to void __kmpc_serialized_parallel(ident_t *loc, kmp_int32
+ /// global_tid);
+ OMPRTL_NVPTX__kmpc_serialized_parallel,
+ /// Call to void __kmpc_end_serialized_parallel(ident_t *loc, kmp_int32
+ /// global_tid);
+ OMPRTL_NVPTX__kmpc_end_serialized_parallel,
};
-} // namespace
+
+/// Pre(post)-action for different OpenMP constructs specialized for NVPTX.
+class NVPTXActionTy final : public PrePostActionTy {
+ llvm::Value *EnterCallee;
+ ArrayRef<llvm::Value *> EnterArgs;
+ llvm::Value *ExitCallee;
+ ArrayRef<llvm::Value *> ExitArgs;
+ bool Conditional;
+ llvm::BasicBlock *ContBlock = nullptr;
+
+public:
+ NVPTXActionTy(llvm::Value *EnterCallee, ArrayRef<llvm::Value *> EnterArgs,
+ llvm::Value *ExitCallee, ArrayRef<llvm::Value *> ExitArgs,
+ bool Conditional = false)
+ : EnterCallee(EnterCallee), EnterArgs(EnterArgs), ExitCallee(ExitCallee),
+ ExitArgs(ExitArgs), Conditional(Conditional) {}
+ void Enter(CodeGenFunction &CGF) override {
+ llvm::Value *EnterRes = CGF.EmitRuntimeCall(EnterCallee, EnterArgs);
+ if (Conditional) {
+ llvm::Value *CallBool = CGF.Builder.CreateIsNotNull(EnterRes);
+ auto *ThenBlock = CGF.createBasicBlock("omp_if.then");
+ ContBlock = CGF.createBasicBlock("omp_if.end");
+ // Generate the branch (If-stmt)
+ CGF.Builder.CreateCondBr(CallBool, ThenBlock, ContBlock);
+ CGF.EmitBlock(ThenBlock);
+ }
+ }
+ void Done(CodeGenFunction &CGF) {
+ // Emit the rest of blocks/branches
+ CGF.EmitBranch(ContBlock);
+ CGF.EmitBlock(ContBlock, true);
+ }
+ void Exit(CodeGenFunction &CGF) override {
+ CGF.EmitRuntimeCall(ExitCallee, ExitArgs);
+ }
+};
+} // anonymous namespace
/// Get the GPU warp size.
static llvm::Value *getNVPTXWarpSize(CodeGenFunction &CGF) {
@@ -118,6 +167,7 @@ void CGOpenMPRuntimeNVPTX::emitGenericKernel(const OMPExecutableDirective &D,
const RegionCodeGenTy &CodeGen) {
EntryFunctionState EST;
WorkerFunctionState WST(CGM);
+ Work.clear();
// Emit target region as a standalone region.
class NVPTXPrePostActionTy : public PrePostActionTy {
@@ -246,7 +296,10 @@ void CGOpenMPRuntimeNVPTX::emitWorkerLoop(CodeGenFunction &CGF,
CGF.InitTempAlloca(ExecStatus, Bld.getInt8(/*C=*/0));
CGF.InitTempAlloca(WorkFn, llvm::Constant::getNullValue(CGF.Int8PtrTy));
- // TODO: Call into runtime to get parallel work.
+ llvm::Value *Args[] = {WorkFn.getPointer()};
+ llvm::Value *Ret = CGF.EmitRuntimeCall(
+ createNVPTXRuntimeFunction(OMPRTL_NVPTX__kmpc_kernel_parallel), Args);
+ Bld.CreateStore(Bld.CreateZExt(Ret, CGF.Int8Ty), ExecStatus);
// On termination condition (workid == 0), exit loop.
llvm::Value *ShouldTerminate =
@@ -261,10 +314,42 @@ void CGOpenMPRuntimeNVPTX::emitWorkerLoop(CodeGenFunction &CGF,
// Signal start of parallel region.
CGF.EmitBlock(ExecuteBB);
- // TODO: Add parallel work.
+
+ // Process work items: outlined parallel functions.
+ for (auto *W : Work) {
+ // Try to match this outlined function.
+ auto *ID = Bld.CreatePointerBitCastOrAddrSpaceCast(W, CGM.Int8PtrTy);
+
+ llvm::Value *WorkFnMatch =
+ Bld.CreateICmpEQ(Bld.CreateLoad(WorkFn), ID, "work_match");
+
+ llvm::BasicBlock *ExecuteFNBB = CGF.createBasicBlock(".execute.fn");
+ llvm::BasicBlock *CheckNextBB = CGF.createBasicBlock(".check.next");
+ Bld.CreateCondBr(WorkFnMatch, ExecuteFNBB, CheckNextBB);
+
+ // Execute this outlined function.
+ CGF.EmitBlock(ExecuteFNBB);
+
+ // Insert call to work function.
+ // FIXME: Pass arguments to outlined function from master thread.
+ auto *Fn = cast<llvm::Function>(W);
+ Address ZeroAddr =
+ CGF.CreateDefaultAlignTempAlloca(CGF.Int32Ty, /*Name=*/".zero.addr");
+ CGF.InitTempAlloca(ZeroAddr, CGF.Builder.getInt32(/*C=*/0));
+ llvm::Value *FnArgs[] = {ZeroAddr.getPointer(), ZeroAddr.getPointer()};
+ CGF.EmitCallOrInvoke(Fn, FnArgs);
+
+ // Go to end of parallel region.
+ CGF.EmitBranch(TerminateBB);
+
+ CGF.EmitBlock(CheckNextBB);
+ }
// Signal end of parallel region.
CGF.EmitBlock(TerminateBB);
+ CGF.EmitRuntimeCall(
+ createNVPTXRuntimeFunction(OMPRTL_NVPTX__kmpc_kernel_end_parallel),
+ llvm::None);
CGF.EmitBranch(BarrierBB);
// All active and inactive workers wait at a barrier after parallel region.
@@ -296,10 +381,53 @@ CGOpenMPRuntimeNVPTX::createNVPTXRuntimeFunction(unsigned Function) {
case OMPRTL_NVPTX__kmpc_kernel_deinit: {
// Build void __kmpc_kernel_deinit();
llvm::FunctionType *FnTy =
- llvm::FunctionType::get(CGM.VoidTy, {}, /*isVarArg*/ false);
+ llvm::FunctionType::get(CGM.VoidTy, llvm::None, /*isVarArg*/ false);
RTLFn = CGM.CreateRuntimeFunction(FnTy, "__kmpc_kernel_deinit");
break;
}
+ case OMPRTL_NVPTX__kmpc_kernel_prepare_parallel: {
+ /// Build void __kmpc_kernel_prepare_parallel(
+ /// void *outlined_function);
+ llvm::Type *TypeParams[] = {CGM.Int8PtrTy};
+ llvm::FunctionType *FnTy =
+ llvm::FunctionType::get(CGM.VoidTy, TypeParams, /*isVarArg*/ false);
+ RTLFn = CGM.CreateRuntimeFunction(FnTy, "__kmpc_kernel_prepare_parallel");
+ break;
+ }
+ case OMPRTL_NVPTX__kmpc_kernel_parallel: {
+ /// Build bool __kmpc_kernel_parallel(void **outlined_function);
+ llvm::Type *TypeParams[] = {CGM.Int8PtrPtrTy};
+ llvm::Type *RetTy = CGM.getTypes().ConvertType(CGM.getContext().BoolTy);
+ llvm::FunctionType *FnTy =
+ llvm::FunctionType::get(RetTy, TypeParams, /*isVarArg*/ false);
+ RTLFn = CGM.CreateRuntimeFunction(FnTy, "__kmpc_kernel_parallel");
+ break;
+ }
+ case OMPRTL_NVPTX__kmpc_kernel_end_parallel: {
+ /// Build void __kmpc_kernel_end_parallel();
+ llvm::FunctionType *FnTy =
+ llvm::FunctionType::get(CGM.VoidTy, llvm::None, /*isVarArg*/ false);
+ RTLFn = CGM.CreateRuntimeFunction(FnTy, "__kmpc_kernel_end_parallel");
+ break;
+ }
+ case OMPRTL_NVPTX__kmpc_serialized_parallel: {
+ // Build void __kmpc_serialized_parallel(ident_t *loc, kmp_int32
+ // global_tid);
+ llvm::Type *TypeParams[] = {getIdentTyPointerTy(), CGM.Int32Ty};
+ llvm::FunctionType *FnTy =
+ llvm::FunctionType::get(CGM.VoidTy, TypeParams, /*isVarArg*/ false);
+ RTLFn = CGM.CreateRuntimeFunction(FnTy, "__kmpc_serialized_parallel");
+ break;
+ }
+ case OMPRTL_NVPTX__kmpc_end_serialized_parallel: {
+ // Build void __kmpc_end_serialized_parallel(ident_t *loc, kmp_int32
+ // global_tid);
+ llvm::Type *TypeParams[] = {getIdentTyPointerTy(), CGM.Int32Ty};
+ llvm::FunctionType *FnTy =
+ llvm::FunctionType::get(CGM.VoidTy, TypeParams, /*isVarArg*/ false);
+ RTLFn = CGM.CreateRuntimeFunction(FnTy, "__kmpc_end_serialized_parallel");
+ break;
+ }
}
return RTLFn;
}
@@ -362,9 +490,12 @@ llvm::Value *CGOpenMPRuntimeNVPTX::emitParallelOrTeamsOutlinedFunction(
OutlinedFun = cast<llvm::Function>(OutlinedFunVal);
OutlinedFun->removeFnAttr(llvm::Attribute::NoInline);
OutlinedFun->addFnAttr(llvm::Attribute::AlwaysInline);
- } else
- llvm_unreachable("parallel directive is not yet supported for nvptx "
- "backend.");
+ } else {
+ llvm::Value *OutlinedFunVal =
+ CGOpenMPRuntime::emitParallelOrTeamsOutlinedFunction(
+ D, ThreadIDVar, InnermostKind, CodeGen);
+ OutlinedFun = cast<llvm::Function>(OutlinedFunVal);
+ }
return OutlinedFun;
}
@@ -387,3 +518,81 @@ void CGOpenMPRuntimeNVPTX::emitTeamsCall(CodeGenFunction &CGF,
OutlinedFnArgs.append(CapturedVars.begin(), CapturedVars.end());
CGF.EmitCallOrInvoke(OutlinedFn, OutlinedFnArgs);
}
+
+void CGOpenMPRuntimeNVPTX::emitParallelCall(
+ CodeGenFunction &CGF, SourceLocation Loc, llvm::Value *OutlinedFn,
+ ArrayRef<llvm::Value *> CapturedVars, const Expr *IfCond) {
+ if (!CGF.HaveInsertPoint())
+ return;
+
+ emitGenericParallelCall(CGF, Loc, OutlinedFn, CapturedVars, IfCond);
+}
+
+void CGOpenMPRuntimeNVPTX::emitGenericParallelCall(
+ CodeGenFunction &CGF, SourceLocation Loc, llvm::Value *OutlinedFn,
+ ArrayRef<llvm::Value *> CapturedVars, const Expr *IfCond) {
+ llvm::Function *Fn = cast<llvm::Function>(OutlinedFn);
+
+ auto &&L0ParallelGen = [this, Fn, &CapturedVars](CodeGenFunction &CGF,
+ PrePostActionTy &) {
+ CGBuilderTy &Bld = CGF.Builder;
+
+ // Prepare for parallel region. Indicate the outlined function.
+ llvm::Value *Args[] = {Bld.CreateBitOrPointerCast(Fn, CGM.Int8PtrTy)};
+ CGF.EmitRuntimeCall(
+ createNVPTXRuntimeFunction(OMPRTL_NVPTX__kmpc_kernel_prepare_parallel),
+ Args);
+
+ // Activate workers. This barrier is used by the master to signal
+ // work for the workers.
+ syncCTAThreads(CGF);
+
+ // OpenMP [2.5, Parallel Construct, p.49]
+ // There is an implied barrier at the end of a parallel region. After the
+ // end of a parallel region, only the master thread of the team resumes
+ // execution of the enclosing task region.
+ //
+ // The master waits at this barrier until all workers are done.
+ syncCTAThreads(CGF);
+
+ // Remember for post-processing in worker loop.
+ Work.push_back(Fn);
+ };
+
+ auto *RTLoc = emitUpdateLocation(CGF, Loc);
+ auto *ThreadID = getThreadID(CGF, Loc);
+ llvm::Value *Args[] = {RTLoc, ThreadID};
+
+ auto &&SeqGen = [this, Fn, &CapturedVars, &Args](CodeGenFunction &CGF,
+ PrePostActionTy &) {
+ auto &&CodeGen = [this, Fn, &CapturedVars, &Args](CodeGenFunction &CGF,
+ PrePostActionTy &Action) {
+ Action.Enter(CGF);
+
+ llvm::SmallVector<llvm::Value *, 16> OutlinedFnArgs;
+ OutlinedFnArgs.push_back(
+ llvm::ConstantPointerNull::get(CGM.Int32Ty->getPointerTo()));
+ OutlinedFnArgs.push_back(
+ llvm::ConstantPointerNull::get(CGM.Int32Ty->getPointerTo()));
+ OutlinedFnArgs.append(CapturedVars.begin(), CapturedVars.end());
+ CGF.EmitCallOrInvoke(Fn, OutlinedFnArgs);
+ };
+
+ RegionCodeGenTy RCG(CodeGen);
+ NVPTXActionTy Action(
+ createNVPTXRuntimeFunction(OMPRTL_NVPTX__kmpc_serialized_parallel),
+ Args,
+ createNVPTXRuntimeFunction(OMPRTL_NVPTX__kmpc_end_serialized_parallel),
+ Args);
+ RCG.setAction(Action);
+ RCG(CGF);
+ };
+
+ if (IfCond)
+ emitOMPIfClause(CGF, IfCond, L0ParallelGen, SeqGen);
+ else {
+ CodeGenFunction::RunCleanupsScope Scope(CGF);
+ RegionCodeGenTy ThenRCG(L0ParallelGen);
+ ThenRCG(CGF);
+ }
+}
diff --git a/lib/CodeGen/CGOpenMPRuntimeNVPTX.h b/lib/CodeGen/CGOpenMPRuntimeNVPTX.h
index 63a02965a5bd3..4010b46a4cbd6 100644
--- a/lib/CodeGen/CGOpenMPRuntimeNVPTX.h
+++ b/lib/CodeGen/CGOpenMPRuntimeNVPTX.h
@@ -25,6 +25,9 @@ namespace CodeGen {
class CGOpenMPRuntimeNVPTX : public CGOpenMPRuntime {
private:
+ // Parallel outlined function work for workers to execute.
+ llvm::SmallVector<llvm::Function *, 16> Work;
+
struct EntryFunctionState {
llvm::BasicBlock *ExitBB = nullptr;
};
@@ -100,6 +103,29 @@ private:
bool IsOffloadEntry,
const RegionCodeGenTy &CodeGen) override;
+ /// \brief Emits code for parallel or serial call of the \a OutlinedFn with
+ /// variables captured in a record which address is stored in \a
+ /// CapturedStruct.
+ /// This call is for the Generic Execution Mode.
+ /// \param OutlinedFn Outlined function to be run in parallel threads. Type of
+ /// this function is void(*)(kmp_int32 *, kmp_int32, struct context_vars*).
+ /// \param CapturedVars A pointer to the record with the references to
+ /// variables used in \a OutlinedFn function.
+ /// \param IfCond Condition in the associated 'if' clause, if it was
+ /// specified, nullptr otherwise.
+ void emitGenericParallelCall(CodeGenFunction &CGF, SourceLocation Loc,
+ llvm::Value *OutlinedFn,
+ ArrayRef<llvm::Value *> CapturedVars,
+ const Expr *IfCond);
+
+protected:
+ /// \brief Get the function name of an outlined region.
+ // The name can be customized depending on the target.
+ //
+ StringRef getOutlinedHelperName() const override {
+ return "__omp_outlined__";
+ }
+
public:
explicit CGOpenMPRuntimeNVPTX(CodeGenModule &CGM);
@@ -137,6 +163,20 @@ public:
void emitTeamsCall(CodeGenFunction &CGF, const OMPExecutableDirective &D,
SourceLocation Loc, llvm::Value *OutlinedFn,
ArrayRef<llvm::Value *> CapturedVars) override;
+
+ /// \brief Emits code for parallel or serial call of the \a OutlinedFn with
+ /// variables captured in a record which address is stored in \a
+ /// CapturedStruct.
+ /// \param OutlinedFn Outlined function to be run in parallel threads. Type of
+ /// this function is void(*)(kmp_int32 *, kmp_int32, struct context_vars*).
+ /// \param CapturedVars A pointer to the record with the references to
+ /// variables used in \a OutlinedFn function.
+ /// \param IfCond Condition in the associated 'if' clause, if it was
+ /// specified, nullptr otherwise.
+ void emitParallelCall(CodeGenFunction &CGF, SourceLocation Loc,
+ llvm::Value *OutlinedFn,
+ ArrayRef<llvm::Value *> CapturedVars,
+ const Expr *IfCond) override;
};
} // CodeGen namespace.
diff --git a/lib/CodeGen/CGStmt.cpp b/lib/CodeGen/CGStmt.cpp
index 8d391f95d9f7a..8370607db50f9 100644
--- a/lib/CodeGen/CGStmt.cpp
+++ b/lib/CodeGen/CGStmt.cpp
@@ -330,6 +330,10 @@ void CodeGenFunction::EmitStmt(const Stmt *S) {
EmitOMPTargetTeamsDistributeParallelForSimdDirective(
cast<OMPTargetTeamsDistributeParallelForSimdDirective>(*S));
break;
+ case Stmt::OMPTargetTeamsDistributeSimdDirectiveClass:
+ EmitOMPTargetTeamsDistributeSimdDirective(
+ cast<OMPTargetTeamsDistributeSimdDirective>(*S));
+ break;
}
}
diff --git a/lib/CodeGen/CGStmtOpenMP.cpp b/lib/CodeGen/CGStmtOpenMP.cpp
index 386c4f0fe69c3..39e1cdfdbe2a1 100644
--- a/lib/CodeGen/CGStmtOpenMP.cpp
+++ b/lib/CodeGen/CGStmtOpenMP.cpp
@@ -2042,6 +2042,16 @@ void CodeGenFunction::EmitOMPTargetTeamsDistributeParallelForSimdDirective(
});
}
+void CodeGenFunction::EmitOMPTargetTeamsDistributeSimdDirective(
+ const OMPTargetTeamsDistributeSimdDirective &S) {
+ CGM.getOpenMPRuntime().emitInlinedDirective(
+ *this, OMPD_target_teams_distribute_simd,
+ [&S](CodeGenFunction &CGF, PrePostActionTy &) {
+ CGF.EmitStmt(
+ cast<CapturedStmt>(S.getAssociatedStmt())->getCapturedStmt());
+ });
+}
+
/// \brief Emit a helper variable and return corresponding lvalue.
static LValue EmitOMPHelperVar(CodeGenFunction &CGF,
const DeclRefExpr *Helper) {
diff --git a/lib/CodeGen/CodeGenFunction.h b/lib/CodeGen/CodeGenFunction.h
index 05522cd400240..586134023240b 100644
--- a/lib/CodeGen/CodeGenFunction.h
+++ b/lib/CodeGen/CodeGenFunction.h
@@ -2701,6 +2701,8 @@ public:
const OMPTargetTeamsDistributeParallelForDirective &S);
void EmitOMPTargetTeamsDistributeParallelForSimdDirective(
const OMPTargetTeamsDistributeParallelForSimdDirective &S);
+ void EmitOMPTargetTeamsDistributeSimdDirective(
+ const OMPTargetTeamsDistributeSimdDirective &S);
/// Emit outlined function for the target directive.
static std::pair<llvm::Function * /*OutlinedFn*/,
diff --git a/lib/CodeGen/CodeGenModule.cpp b/lib/CodeGen/CodeGenModule.cpp
index ab29d2dbb566b..36005430ae4c3 100644
--- a/lib/CodeGen/CodeGenModule.cpp
+++ b/lib/CodeGen/CodeGenModule.cpp
@@ -1243,9 +1243,15 @@ void CodeGenModule::EmitModuleLinkOptions() {
SmallVector<clang::Module *, 16> Stack;
// Seed the stack with imported modules.
- for (Module *M : ImportedModules)
+ for (Module *M : ImportedModules) {
+ // Do not add any link flags when an implementation TU of a module imports
+ // a header of that same module.
+ if (M->getTopLevelModuleName() == getLangOpts().CurrentModule &&
+ !getLangOpts().isCompilingModule())
+ continue;
if (Visited.insert(M).second)
Stack.push_back(M);
+ }
// Find all of the modules to import, making a little effort to prune
// non-leaf modules.
diff --git a/lib/CodeGen/ItaniumCXXABI.cpp b/lib/CodeGen/ItaniumCXXABI.cpp
index b5d90ea59a498..f7a8dd66c527c 100644
--- a/lib/CodeGen/ItaniumCXXABI.cpp
+++ b/lib/CodeGen/ItaniumCXXABI.cpp
@@ -2272,7 +2272,21 @@ void ItaniumCXXABI::EmitThreadLocalInitFuncs(
ArrayRef<llvm::Function *> CXXThreadLocalInits,
ArrayRef<const VarDecl *> CXXThreadLocalInitVars) {
llvm::Function *InitFunc = nullptr;
- if (!CXXThreadLocalInits.empty()) {
+
+ // Separate initializers into those with ordered (or partially-ordered)
+ // initialization and those with unordered initialization.
+ llvm::SmallVector<llvm::Function *, 8> OrderedInits;
+ llvm::SmallDenseMap<const VarDecl *, llvm::Function *> UnorderedInits;
+ for (unsigned I = 0; I != CXXThreadLocalInits.size(); ++I) {
+ if (isTemplateInstantiation(
+ CXXThreadLocalInitVars[I]->getTemplateSpecializationKind()))
+ UnorderedInits[CXXThreadLocalInitVars[I]->getCanonicalDecl()] =
+ CXXThreadLocalInits[I];
+ else
+ OrderedInits.push_back(CXXThreadLocalInits[I]);
+ }
+
+ if (!OrderedInits.empty()) {
// Generate a guarded initialization function.
llvm::FunctionType *FTy =
llvm::FunctionType::get(CGM.VoidTy, /*isVarArg=*/false);
@@ -2289,24 +2303,28 @@ void ItaniumCXXABI::EmitThreadLocalInitFuncs(
CharUnits GuardAlign = CharUnits::One();
Guard->setAlignment(GuardAlign.getQuantity());
- CodeGenFunction(CGM)
- .GenerateCXXGlobalInitFunc(InitFunc, CXXThreadLocalInits,
- Address(Guard, GuardAlign));
+ CodeGenFunction(CGM).GenerateCXXGlobalInitFunc(InitFunc, OrderedInits,
+ Address(Guard, GuardAlign));
// On Darwin platforms, use CXX_FAST_TLS calling convention.
if (CGM.getTarget().getTriple().isOSDarwin()) {
InitFunc->setCallingConv(llvm::CallingConv::CXX_FAST_TLS);
InitFunc->addFnAttr(llvm::Attribute::NoUnwind);
}
}
+
+ // Emit thread wrappers.
for (const VarDecl *VD : CXXThreadLocals) {
llvm::GlobalVariable *Var =
cast<llvm::GlobalVariable>(CGM.GetGlobalValue(CGM.getMangledName(VD)));
+ llvm::Function *Wrapper = getOrCreateThreadLocalWrapper(VD, Var);
// Some targets require that all access to thread local variables go through
// the thread wrapper. This means that we cannot attempt to create a thread
// wrapper or a thread helper.
- if (isThreadWrapperReplaceable(VD, CGM) && !VD->hasDefinition())
+ if (isThreadWrapperReplaceable(VD, CGM) && !VD->hasDefinition()) {
+ Wrapper->setLinkage(llvm::Function::ExternalLinkage);
continue;
+ }
// Mangle the name for the thread_local initialization function.
SmallString<256> InitFnName;
@@ -2322,18 +2340,21 @@ void ItaniumCXXABI::EmitThreadLocalInitFuncs(
bool InitIsInitFunc = false;
if (VD->hasDefinition()) {
InitIsInitFunc = true;
- if (InitFunc)
+ llvm::Function *InitFuncToUse = InitFunc;
+ if (isTemplateInstantiation(VD->getTemplateSpecializationKind()))
+ InitFuncToUse = UnorderedInits.lookup(VD->getCanonicalDecl());
+ if (InitFuncToUse)
Init = llvm::GlobalAlias::create(Var->getLinkage(), InitFnName.str(),
- InitFunc);
+ InitFuncToUse);
} else {
// Emit a weak global function referring to the initialization function.
// This function will not exist if the TU defining the thread_local
// variable in question does not need any dynamic initialization for
// its thread_local variables.
llvm::FunctionType *FnTy = llvm::FunctionType::get(CGM.VoidTy, false);
- Init = llvm::Function::Create(
- FnTy, llvm::GlobalVariable::ExternalWeakLinkage, InitFnName.str(),
- &CGM.getModule());
+ Init = llvm::Function::Create(FnTy,
+ llvm::GlobalVariable::ExternalWeakLinkage,
+ InitFnName.str(), &CGM.getModule());
const CGFunctionInfo &FI = CGM.getTypes().arrangeNullaryFunction();
CGM.SetLLVMFunctionAttributes(nullptr, FI, cast<llvm::Function>(Init));
}
@@ -2341,7 +2362,6 @@ void ItaniumCXXABI::EmitThreadLocalInitFuncs(
if (Init)
Init->setVisibility(Var->getVisibility());
- llvm::Function *Wrapper = getOrCreateThreadLocalWrapper(VD, Var);
llvm::LLVMContext &Context = CGM.getModule().getContext();
llvm::BasicBlock *Entry = llvm::BasicBlock::Create(Context, "", Wrapper);
CGBuilderTy Builder(CGM, Entry);
diff --git a/lib/Driver/ToolChains.cpp b/lib/Driver/ToolChains.cpp
index 547e660ae09b5..9bc9ae4f6a523 100644
--- a/lib/Driver/ToolChains.cpp
+++ b/lib/Driver/ToolChains.cpp
@@ -1531,7 +1531,7 @@ bool Generic_GCC::GCCInstallationDetector::getBiarchSibling(Multilib &M) const {
static const char *const AArch64LibDirs[] = {"/lib64", "/lib"};
static const char *const AArch64Triples[] = {
"aarch64-none-linux-gnu", "aarch64-linux-gnu", "aarch64-linux-android",
- "aarch64-redhat-linux"};
+ "aarch64-redhat-linux", "aarch64-suse-linux"};
static const char *const AArch64beLibDirs[] = {"/lib"};
static const char *const AArch64beTriples[] = {"aarch64_be-none-linux-gnu",
"aarch64_be-linux-gnu"};
diff --git a/lib/Driver/Tools.cpp b/lib/Driver/Tools.cpp
index e267cdb2649f2..b4a83347defae 100644
--- a/lib/Driver/Tools.cpp
+++ b/lib/Driver/Tools.cpp
@@ -6431,11 +6431,13 @@ void Clang::ConstructJob(Compilation &C, const JobAction &JA,
A->claim();
// We translate this by hand to the -cc1 argument, since nightly test uses
- // it and developers have been trained to spell it with -mllvm.
- if (StringRef(A->getValue(0)) == "-disable-llvm-passes") {
- CmdArgs.push_back("-disable-llvm-passes");
- } else
+ // it and developers have been trained to spell it with -mllvm. Both
+ // spellings are now deprecated and should be removed.
+ if (StringRef(A->getValue(0)) == "-disable-llvm-optzns") {
+ CmdArgs.push_back("-disable-llvm-optzns");
+ } else {
A->render(Args, CmdArgs);
+ }
}
// With -save-temps, we want to save the unoptimized bitcode output from the
diff --git a/lib/Format/ContinuationIndenter.cpp b/lib/Format/ContinuationIndenter.cpp
index bf075ab6d53ea..6bb6fb3060352 100644
--- a/lib/Format/ContinuationIndenter.cpp
+++ b/lib/Format/ContinuationIndenter.cpp
@@ -1003,12 +1003,15 @@ void ContinuationIndenter::moveStatePastScopeOpener(LineState &State,
// Generally inherit NoLineBreak from the current scope to nested scope.
// However, don't do this for non-empty nested blocks, dict literals and
// array literals as these follow different indentation rules.
+ const FormatToken *Previous = Current.getPreviousNonComment();
bool NoLineBreak =
Current.Children.empty() &&
!Current.isOneOf(TT_DictLiteral, TT_ArrayInitializerLSquare) &&
(State.Stack.back().NoLineBreak ||
(Current.is(TT_TemplateOpener) &&
- State.Stack.back().ContainsUnwrappedBuilder));
+ State.Stack.back().ContainsUnwrappedBuilder) ||
+ (Current.is(tok::l_brace) && !Newline && Previous &&
+ Previous->is(tok::comma)));
State.Stack.push_back(ParenState(NewIndent, NewIndentLevel, LastSpace,
AvoidBinPacking, NoLineBreak));
State.Stack.back().NestedBlockIndent = NestedBlockIndent;
diff --git a/lib/Frontend/InitPreprocessor.cpp b/lib/Frontend/InitPreprocessor.cpp
index 17603ada11d18..4502c92499a77 100644
--- a/lib/Frontend/InitPreprocessor.cpp
+++ b/lib/Frontend/InitPreprocessor.cpp
@@ -286,12 +286,12 @@ static void DefineFastIntType(unsigned TypeWidth, bool IsSigned,
/// Get the value the ATOMIC_*_LOCK_FREE macro should have for a type with
/// the specified properties.
-static const char *getLockFreeValue(unsigned TypeWidth, unsigned TypeAlign,
- unsigned InlineWidth) {
+static const char *getLockFreeValue(unsigned TypeWidth, unsigned InlineWidth) {
// Fully-aligned, power-of-2 sizes no larger than the inline
// width will be inlined as lock-free operations.
- if (TypeWidth == TypeAlign && (TypeWidth & (TypeWidth - 1)) == 0 &&
- TypeWidth <= InlineWidth)
+ // Note: we do not need to check alignment since _Atomic(T) is always
+ // appropriately-aligned in clang.
+ if ((TypeWidth & (TypeWidth - 1)) == 0 && TypeWidth <= InlineWidth)
return "2"; // "always lock free"
// We cannot be certain what operations the lib calls might be
// able to implement as lock-free on future processors.
@@ -881,7 +881,6 @@ static void InitializePredefinedMacros(const TargetInfo &TI,
#define DEFINE_LOCK_FREE_MACRO(TYPE, Type) \
Builder.defineMacro("__GCC_ATOMIC_" #TYPE "_LOCK_FREE", \
getLockFreeValue(TI.get##Type##Width(), \
- TI.get##Type##Align(), \
InlineWidthBits));
DEFINE_LOCK_FREE_MACRO(BOOL, Bool);
DEFINE_LOCK_FREE_MACRO(CHAR, Char);
@@ -894,7 +893,6 @@ static void InitializePredefinedMacros(const TargetInfo &TI,
DEFINE_LOCK_FREE_MACRO(LLONG, LongLong);
Builder.defineMacro("__GCC_ATOMIC_POINTER_LOCK_FREE",
getLockFreeValue(TI.getPointerWidth(0),
- TI.getPointerAlign(0),
InlineWidthBits));
#undef DEFINE_LOCK_FREE_MACRO
}
diff --git a/lib/Headers/altivec.h b/lib/Headers/altivec.h
index a8618816d5bbb..a01d9d837ad16 100644
--- a/lib/Headers/altivec.h
+++ b/lib/Headers/altivec.h
@@ -7664,13 +7664,15 @@ vec_rlmi(vector unsigned long long __a, vector unsigned long long __b,
static __inline__ vector unsigned int __ATTRS_o_ai
vec_rlnm(vector unsigned int __a, vector unsigned int __b,
vector unsigned int __c) {
- return __builtin_altivec_vrlwnm(__a, __b) & __c;
+ vector unsigned int OneByte = { 0x8, 0x8, 0x8, 0x8 };
+ return __builtin_altivec_vrlwnm(__a, ((__c << OneByte) | __b));
}
static __inline__ vector unsigned long long __ATTRS_o_ai
vec_rlnm(vector unsigned long long __a, vector unsigned long long __b,
vector unsigned long long __c) {
- return __builtin_altivec_vrldnm(__a, __b) & __c;
+ vector unsigned long long OneByte = { 0x8, 0x8 };
+ return __builtin_altivec_vrldnm(__a, ((__c << OneByte) | __b));
}
#endif
diff --git a/lib/Index/IndexDecl.cpp b/lib/Index/IndexDecl.cpp
index 1225391dc2a6c..7d60aad3895d1 100644
--- a/lib/Index/IndexDecl.cpp
+++ b/lib/Index/IndexDecl.cpp
@@ -46,10 +46,13 @@ public:
}
void handleDeclarator(const DeclaratorDecl *D,
- const NamedDecl *Parent = nullptr) {
+ const NamedDecl *Parent = nullptr,
+ bool isIBType = false) {
if (!Parent) Parent = D;
- IndexCtx.indexTypeSourceInfo(D->getTypeSourceInfo(), Parent);
+ IndexCtx.indexTypeSourceInfo(D->getTypeSourceInfo(), Parent,
+ Parent->getLexicalDeclContext(),
+ /*isBase=*/false, isIBType);
IndexCtx.indexNestedNameSpecifierLoc(D->getQualifierLoc(), Parent);
if (IndexCtx.shouldIndexFunctionLocalSymbols()) {
// Only index parameters in definitions, parameters in declarations are
@@ -92,8 +95,11 @@ public:
if (!IndexCtx.handleDecl(D, (unsigned)SymbolRole::Dynamic, Relations))
return false;
IndexCtx.indexTypeSourceInfo(D->getReturnTypeSourceInfo(), D);
- for (const auto *I : D->parameters())
- handleDeclarator(I, D);
+ bool hasIBActionAndFirst = D->hasAttr<IBActionAttr>();
+ for (const auto *I : D->parameters()) {
+ handleDeclarator(I, D, /*isIBType=*/hasIBActionAndFirst);
+ hasIBActionAndFirst = false;
+ }
if (D->isThisDeclarationADefinition()) {
const Stmt *Body = D->getBody();
@@ -283,11 +289,12 @@ public:
bool VisitObjCCategoryDecl(const ObjCCategoryDecl *D) {
const ObjCInterfaceDecl *C = D->getClassInterface();
- if (C)
- TRY_TO(IndexCtx.handleReference(C, D->getLocation(), D, D,
- SymbolRoleSet(), SymbolRelation{
- (unsigned)SymbolRole::RelationExtendedBy, D
- }));
+ if (!C)
+ return true;
+ TRY_TO(IndexCtx.handleReference(C, D->getLocation(), D, D, SymbolRoleSet(),
+ SymbolRelation{
+ (unsigned)SymbolRole::RelationExtendedBy, D
+ }));
SourceLocation CategoryLoc = D->getCategoryNameLoc();
if (!CategoryLoc.isValid())
CategoryLoc = D->getLocation();
@@ -333,6 +340,9 @@ public:
handleObjCMethod(MD, D);
if (!IndexCtx.handleDecl(D))
return false;
+ if (IBOutletCollectionAttr *attr = D->getAttr<IBOutletCollectionAttr>())
+ IndexCtx.indexTypeSourceInfo(attr->getInterfaceLoc(), D,
+ D->getLexicalDeclContext(), false, true);
IndexCtx.indexTypeSourceInfo(D->getTypeSourceInfo(), D);
return true;
}
diff --git a/lib/Index/IndexSymbol.cpp b/lib/Index/IndexSymbol.cpp
index be847e762091f..84984fce4dc7f 100644
--- a/lib/Index/IndexSymbol.cpp
+++ b/lib/Index/IndexSymbol.cpp
@@ -152,10 +152,18 @@ SymbolInfo index::getSymbolInfo(const Decl *D) {
Info.Lang = SymbolLanguage::ObjC;
break;
case Decl::ObjCMethod:
- if (cast<ObjCMethodDecl>(D)->isInstanceMethod())
+ if (cast<ObjCMethodDecl>(D)->isInstanceMethod()) {
+ const ObjCMethodDecl *MD = cast<ObjCMethodDecl>(D);
Info.Kind = SymbolKind::InstanceMethod;
- else
+ if (MD->isPropertyAccessor()) {
+ if (MD->param_size())
+ Info.SubKind = SymbolSubKind::AccessorSetter;
+ else
+ Info.SubKind = SymbolSubKind::AccessorGetter;
+ }
+ } else {
Info.Kind = SymbolKind::ClassMethod;
+ }
Info.Lang = SymbolLanguage::ObjC;
if (isUnitTest(cast<ObjCMethodDecl>(D)))
Info.Properties |= (unsigned)SymbolProperty::UnitTest;
@@ -289,6 +297,8 @@ void index::applyForEachSymbolRole(SymbolRoleSet Roles,
APPLY_FOR_ROLE(RelationCalledBy);
APPLY_FOR_ROLE(RelationExtendedBy);
APPLY_FOR_ROLE(RelationAccessorOf);
+ APPLY_FOR_ROLE(RelationContainedBy);
+ APPLY_FOR_ROLE(RelationIBTypeOf);
#undef APPLY_FOR_ROLE
}
@@ -317,6 +327,8 @@ void index::printSymbolRoles(SymbolRoleSet Roles, raw_ostream &OS) {
case SymbolRole::RelationCalledBy: OS << "RelCall"; break;
case SymbolRole::RelationExtendedBy: OS << "RelExt"; break;
case SymbolRole::RelationAccessorOf: OS << "RelAcc"; break;
+ case SymbolRole::RelationContainedBy: OS << "RelCont"; break;
+ case SymbolRole::RelationIBTypeOf: OS << "RelIBType"; break;
}
});
}
@@ -375,6 +387,8 @@ StringRef index::getSymbolSubKindString(SymbolSubKind K) {
case SymbolSubKind::None: return "<none>";
case SymbolSubKind::CXXCopyConstructor: return "cxx-copy-ctor";
case SymbolSubKind::CXXMoveConstructor: return "cxx-move-ctor";
+ case SymbolSubKind::AccessorGetter: return "acc-get";
+ case SymbolSubKind::AccessorSetter: return "acc-set";
}
llvm_unreachable("invalid symbol subkind");
}
diff --git a/lib/Index/IndexTypeSourceInfo.cpp b/lib/Index/IndexTypeSourceInfo.cpp
index 619a9a48befd1..38bbb30fedf18 100644
--- a/lib/Index/IndexTypeSourceInfo.cpp
+++ b/lib/Index/IndexTypeSourceInfo.cpp
@@ -26,12 +26,16 @@ class TypeIndexer : public RecursiveASTVisitor<TypeIndexer> {
public:
TypeIndexer(IndexingContext &indexCtx, const NamedDecl *parent,
- const DeclContext *DC, bool isBase)
+ const DeclContext *DC, bool isBase, bool isIBType)
: IndexCtx(indexCtx), Parent(parent), ParentDC(DC), IsBase(isBase) {
if (IsBase) {
assert(Parent);
Relations.emplace_back((unsigned)SymbolRole::RelationBaseOf, Parent);
}
+ if (isIBType) {
+ assert(Parent);
+ Relations.emplace_back((unsigned)SymbolRole::RelationIBTypeOf, Parent);
+ }
}
bool shouldWalkTypesOfTypeLocs() const { return false; }
@@ -93,13 +97,13 @@ public:
bool VisitObjCInterfaceTypeLoc(ObjCInterfaceTypeLoc TL) {
return IndexCtx.handleReference(TL.getIFaceDecl(), TL.getNameLoc(),
- Parent, ParentDC, SymbolRoleSet());
+ Parent, ParentDC, SymbolRoleSet(), Relations);
}
bool VisitObjCObjectTypeLoc(ObjCObjectTypeLoc TL) {
for (unsigned i = 0, e = TL.getNumProtocols(); i != e; ++i) {
IndexCtx.handleReference(TL.getProtocol(i), TL.getProtocolLoc(i),
- Parent, ParentDC, SymbolRoleSet());
+ Parent, ParentDC, SymbolRoleSet(), Relations);
}
return true;
}
@@ -130,23 +134,25 @@ public:
void IndexingContext::indexTypeSourceInfo(TypeSourceInfo *TInfo,
const NamedDecl *Parent,
const DeclContext *DC,
- bool isBase) {
+ bool isBase,
+ bool isIBType) {
if (!TInfo || TInfo->getTypeLoc().isNull())
return;
- indexTypeLoc(TInfo->getTypeLoc(), Parent, DC, isBase);
+ indexTypeLoc(TInfo->getTypeLoc(), Parent, DC, isBase, isIBType);
}
void IndexingContext::indexTypeLoc(TypeLoc TL,
const NamedDecl *Parent,
const DeclContext *DC,
- bool isBase) {
+ bool isBase,
+ bool isIBType) {
if (TL.isNull())
return;
if (!DC)
DC = Parent->getLexicalDeclContext();
- TypeIndexer(*this, Parent, DC, isBase).TraverseTypeLoc(TL);
+ TypeIndexer(*this, Parent, DC, isBase, isIBType).TraverseTypeLoc(TL);
}
void IndexingContext::indexNestedNameSpecifierLoc(NestedNameSpecifierLoc NNS,
diff --git a/lib/Index/IndexingContext.cpp b/lib/Index/IndexingContext.cpp
index e623a495b47bf..6dd6c0cfb28ea 100644
--- a/lib/Index/IndexingContext.cpp
+++ b/lib/Index/IndexingContext.cpp
@@ -312,9 +312,20 @@ bool IndexingContext::handleDeclOccurrence(const Decl *D, SourceLocation Loc,
Roles |= Rel.Roles;
};
- if (!IsRef && Parent && !cast<DeclContext>(Parent)->isFunctionOrMethod()) {
- addRelation(SymbolRelation{(unsigned)SymbolRole::RelationChildOf, Parent});
+ if (Parent) {
+ if (IsRef) {
+ addRelation(SymbolRelation{
+ (unsigned)SymbolRole::RelationContainedBy,
+ Parent
+ });
+ } else if (!cast<DeclContext>(Parent)->isFunctionOrMethod()) {
+ addRelation(SymbolRelation{
+ (unsigned)SymbolRole::RelationChildOf,
+ Parent
+ });
+ }
}
+
for (auto &Rel : Relations) {
addRelation(SymbolRelation(Rel.Roles,
Rel.RelatedSymbol->getCanonicalDecl()));
diff --git a/lib/Index/IndexingContext.h b/lib/Index/IndexingContext.h
index 600fc433b58d1..dd1dd328cd445 100644
--- a/lib/Index/IndexingContext.h
+++ b/lib/Index/IndexingContext.h
@@ -85,11 +85,13 @@ public:
void indexTypeSourceInfo(TypeSourceInfo *TInfo, const NamedDecl *Parent,
const DeclContext *DC = nullptr,
- bool isBase = false);
+ bool isBase = false,
+ bool isIBType = false);
void indexTypeLoc(TypeLoc TL, const NamedDecl *Parent,
const DeclContext *DC = nullptr,
- bool isBase = false);
+ bool isBase = false,
+ bool isIBType = false);
void indexNestedNameSpecifierLoc(NestedNameSpecifierLoc NNS,
const NamedDecl *Parent,
diff --git a/lib/Lex/HeaderSearch.cpp b/lib/Lex/HeaderSearch.cpp
index fa2a76ef47caf..c667f4bf22070 100644
--- a/lib/Lex/HeaderSearch.cpp
+++ b/lib/Lex/HeaderSearch.cpp
@@ -1092,13 +1092,51 @@ void HeaderSearch::MarkFileModuleHeader(const FileEntry *FE,
}
bool HeaderSearch::ShouldEnterIncludeFile(Preprocessor &PP,
- const FileEntry *File,
- bool isImport, Module *M) {
+ const FileEntry *File, bool isImport,
+ bool ModulesEnabled, Module *M) {
++NumIncluded; // Count # of attempted #includes.
// Get information about this file.
HeaderFileInfo &FileInfo = getFileInfo(File);
+ // FIXME: this is a workaround for the lack of proper modules-aware support
+ // for #import / #pragma once
+ auto TryEnterImported = [&](void) -> bool {
+ if (!ModulesEnabled)
+ return false;
+ // Modules with builtins are special; multiple modules use builtins as
+ // modular headers, example:
+ //
+ // module stddef { header "stddef.h" export * }
+ //
+ // After module map parsing, this expands to:
+ //
+ // module stddef {
+ // header "/path_to_builtin_dirs/stddef.h"
+ // textual "stddef.h"
+ // }
+ //
+ // It's common that libc++ and system modules will both define such
+ // submodules. Make sure cached results for a builtin header won't
+ // prevent other builtin modules to potentially enter the builtin header.
+ // Note that builtins are header guarded and the decision to actually
+ // enter them is postponed to the controlling macros logic below.
+ bool TryEnterHdr = false;
+ if (FileInfo.isCompilingModuleHeader && FileInfo.isModuleHeader)
+ TryEnterHdr = File->getDir() == ModMap.getBuiltinDir() &&
+ ModuleMap::isBuiltinHeader(
+ llvm::sys::path::filename(File->getName()));
+
+ // Textual headers can be #imported from different modules. Since ObjC
+ // headers find in the wild might rely only on #import and do not contain
+ // controlling macros, be conservative and only try to enter textual headers
+ // if such macro is present.
+ if (!FileInfo.isModuleHeader &&
+ FileInfo.getControllingMacro(ExternalLookup))
+ TryEnterHdr = true;
+ return TryEnterHdr;
+ };
+
// If this is a #import directive, check that we have not already imported
// this header.
if (isImport) {
@@ -1106,11 +1144,12 @@ bool HeaderSearch::ShouldEnterIncludeFile(Preprocessor &PP,
FileInfo.isImport = true;
// Has this already been #import'ed or #include'd?
- if (FileInfo.NumIncludes) return false;
+ if (FileInfo.NumIncludes && !TryEnterImported())
+ return false;
} else {
// Otherwise, if this is a #include of a file that was previously #import'd
// or if this is the second #include of a #pragma once file, ignore it.
- if (FileInfo.isImport)
+ if (FileInfo.isImport && !TryEnterImported())
return false;
}
diff --git a/lib/Lex/ModuleMap.cpp b/lib/Lex/ModuleMap.cpp
index 9d0f2eb2fa79f..1488f624da64f 100644
--- a/lib/Lex/ModuleMap.cpp
+++ b/lib/Lex/ModuleMap.cpp
@@ -144,7 +144,7 @@ static StringRef sanitizeFilenameAsIdentifier(StringRef Name,
/// \brief Determine whether the given file name is the name of a builtin
/// header, supplied by Clang to replace, override, or augment existing system
/// headers.
-static bool isBuiltinHeader(StringRef FileName) {
+bool ModuleMap::isBuiltinHeader(StringRef FileName) {
return llvm::StringSwitch<bool>(FileName)
.Case("float.h", true)
.Case("iso646.h", true)
@@ -165,7 +165,7 @@ ModuleMap::findKnownHeader(const FileEntry *File) {
HeadersMap::iterator Known = Headers.find(File);
if (HeaderInfo.getHeaderSearchOpts().ImplicitModuleMaps &&
Known == Headers.end() && File->getDir() == BuiltinIncludeDir &&
- isBuiltinHeader(llvm::sys::path::filename(File->getName()))) {
+ ModuleMap::isBuiltinHeader(llvm::sys::path::filename(File->getName()))) {
HeaderInfo.loadTopLevelSystemModules();
return Headers.find(File);
}
@@ -446,9 +446,19 @@ ModuleMap::isHeaderUnavailableInModule(const FileEntry *Header,
I = Known->second.begin(),
E = Known->second.end();
I != E; ++I) {
- if (I->isAvailable() && (!RequestingModule ||
- I->getModule()->isSubModuleOf(RequestingModule)))
+
+ if (I->isAvailable() &&
+ (!RequestingModule ||
+ I->getModule()->isSubModuleOf(RequestingModule))) {
+ // When no requesting module is available, the caller is looking if a
+ // header is part a module by only looking into the module map. This is
+ // done by warn_uncovered_module_header checks; don't consider textual
+ // headers part of it in this mode, otherwise we get misleading warnings
+ // that a umbrella header is not including a textual header.
+ if (!RequestingModule && I->getRole() == ModuleMap::TextualHeader)
+ continue;
return false;
+ }
}
return true;
}
@@ -1879,7 +1889,7 @@ void ModuleMapParser::parseHeaderDecl(MMToken::TokenKind LeadingToken,
// supplied by Clang. Find that builtin header.
if (ActiveModule->IsSystem && LeadingToken != MMToken::UmbrellaKeyword &&
BuiltinIncludeDir && BuiltinIncludeDir != Directory &&
- isBuiltinHeader(Header.FileName)) {
+ ModuleMap::isBuiltinHeader(Header.FileName)) {
SmallString<128> BuiltinPathName(BuiltinIncludeDir->getName());
llvm::sys::path::append(BuiltinPathName, Header.FileName);
BuiltinFile = SourceMgr.getFileManager().getFile(BuiltinPathName);
diff --git a/lib/Lex/PPDirectives.cpp b/lib/Lex/PPDirectives.cpp
index 9661e7b13f720..322c5809cd2c7 100644
--- a/lib/Lex/PPDirectives.cpp
+++ b/lib/Lex/PPDirectives.cpp
@@ -1999,6 +1999,7 @@ void Preprocessor::HandleIncludeDirective(SourceLocation HashLoc,
bool SkipHeader = false;
if (ShouldEnter &&
!HeaderInfo.ShouldEnterIncludeFile(*this, File, isImport,
+ getLangOpts().Modules,
SuggestedModule.getModule())) {
ShouldEnter = false;
SkipHeader = true;
diff --git a/lib/Parse/ParseDecl.cpp b/lib/Parse/ParseDecl.cpp
index 833d93e4548ae..2d320878014b2 100644
--- a/lib/Parse/ParseDecl.cpp
+++ b/lib/Parse/ParseDecl.cpp
@@ -1591,7 +1591,7 @@ Parser::ParseSimpleDeclaration(unsigned Context,
DS.complete(TheDecl);
if (AnonRecord) {
Decl* decls[] = {AnonRecord, TheDecl};
- return Actions.BuildDeclaratorGroup(decls, /*TypeMayContainAuto=*/false);
+ return Actions.BuildDeclaratorGroup(decls);
}
return Actions.ConvertDeclToDeclGroup(TheDecl);
}
@@ -2045,8 +2045,6 @@ Decl *Parser::ParseDeclarationAfterDeclaratorAndAttributes(
}
}
- bool TypeContainsAuto = D.getDeclSpec().containsPlaceholderType();
-
// Parse declarator '=' initializer.
// If a '==' or '+=' is found, suggest a fixit to '='.
if (isTokenEqualOrEqualTypo()) {
@@ -2106,7 +2104,7 @@ Decl *Parser::ParseDeclarationAfterDeclaratorAndAttributes(
Actions.ActOnInitializerError(ThisDecl);
} else
Actions.AddInitializerToDecl(ThisDecl, Init.get(),
- /*DirectInit=*/false, TypeContainsAuto);
+ /*DirectInit=*/false);
}
} else if (Tok.is(tok::l_paren)) {
// Parse C++ direct initializer: '(' expression-list ')'
@@ -2149,7 +2147,7 @@ Decl *Parser::ParseDeclarationAfterDeclaratorAndAttributes(
T.getCloseLocation(),
Exprs);
Actions.AddInitializerToDecl(ThisDecl, Initializer.get(),
- /*DirectInit=*/true, TypeContainsAuto);
+ /*DirectInit=*/true);
}
} else if (getLangOpts().CPlusPlus11 && Tok.is(tok::l_brace) &&
(!CurParsedObjCImpl || !D.isFunctionDeclarator())) {
@@ -2171,11 +2169,10 @@ Decl *Parser::ParseDeclarationAfterDeclaratorAndAttributes(
if (Init.isInvalid()) {
Actions.ActOnInitializerError(ThisDecl);
} else
- Actions.AddInitializerToDecl(ThisDecl, Init.get(),
- /*DirectInit=*/true, TypeContainsAuto);
+ Actions.AddInitializerToDecl(ThisDecl, Init.get(), /*DirectInit=*/true);
} else {
- Actions.ActOnUninitializedDecl(ThisDecl, TypeContainsAuto);
+ Actions.ActOnUninitializedDecl(ThisDecl);
}
Actions.FinalizeDeclaration(ThisDecl);
diff --git a/lib/Parse/ParseDeclCXX.cpp b/lib/Parse/ParseDeclCXX.cpp
index 4002b09d2bc49..3f1fe7e06fe33 100644
--- a/lib/Parse/ParseDeclCXX.cpp
+++ b/lib/Parse/ParseDeclCXX.cpp
@@ -710,7 +710,7 @@ Parser::ParseUsingDeclaration(unsigned Context,
: "using declaration"))
SkipUntil(tok::semi);
- return Actions.BuildDeclaratorGroup(DeclsInGroup, /*MayContainAuto*/false);
+ return Actions.BuildDeclaratorGroup(DeclsInGroup);
}
Decl *Parser::ParseAliasDeclarationAfterDeclarator(
@@ -2539,7 +2539,7 @@ Parser::ParseCXXClassMemberDeclaration(AccessSpecifier AS,
DS.complete(TheDecl);
if (AnonRecord) {
Decl* decls[] = {AnonRecord, TheDecl};
- return Actions.BuildDeclaratorGroup(decls, /*TypeMayContainAuto=*/false);
+ return Actions.BuildDeclaratorGroup(decls);
}
return Actions.ConvertDeclToDeclGroup(TheDecl);
}
@@ -2769,11 +2769,10 @@ Parser::ParseCXXClassMemberDeclaration(AccessSpecifier AS,
if (Init.isInvalid())
SkipUntil(tok::comma, StopAtSemi | StopBeforeMatch);
else if (ThisDecl)
- Actions.AddInitializerToDecl(ThisDecl, Init.get(), EqualLoc.isInvalid(),
- DS.containsPlaceholderType());
+ Actions.AddInitializerToDecl(ThisDecl, Init.get(), EqualLoc.isInvalid());
} else if (ThisDecl && DS.getStorageClassSpec() == DeclSpec::SCS_static)
// No initializer.
- Actions.ActOnUninitializedDecl(ThisDecl, DS.containsPlaceholderType());
+ Actions.ActOnUninitializedDecl(ThisDecl);
if (ThisDecl) {
if (!ThisDecl->isInvalidDecl()) {
@@ -3545,7 +3544,7 @@ Parser::tryParseExceptionSpecification(bool Delayed,
Actions.CheckBooleanCondition(KeywordLoc, NoexceptExpr.get());
NoexceptRange = SourceRange(KeywordLoc, T.getCloseLocation());
} else {
- NoexceptType = EST_None;
+ NoexceptType = EST_BasicNoexcept;
}
} else {
// There is no argument.
diff --git a/lib/Parse/ParseExpr.cpp b/lib/Parse/ParseExpr.cpp
index 55b5ff498574c..e7b6c6ff90b35 100644
--- a/lib/Parse/ParseExpr.cpp
+++ b/lib/Parse/ParseExpr.cpp
@@ -198,7 +198,7 @@ ExprResult Parser::ParseConstantExpression(TypeCastState isTypeCast) {
// An expression is potentially evaluated unless it appears where an
// integral constant expression is required (see 5.19) [...].
// C++98 and C++11 have no such rule, but this is only a defect in C++98.
- EnterExpressionEvaluationContext Unevaluated(Actions,
+ EnterExpressionEvaluationContext ConstantEvaluated(Actions,
Sema::ConstantEvaluated);
ExprResult LHS(ParseCastExpression(false, false, isTypeCast));
diff --git a/lib/Parse/ParseExprCXX.cpp b/lib/Parse/ParseExprCXX.cpp
index ca1b3b1ad01bb..124266a42bd5a 100644
--- a/lib/Parse/ParseExprCXX.cpp
+++ b/lib/Parse/ParseExprCXX.cpp
@@ -735,7 +735,7 @@ ExprResult Parser::TryParseLambdaExpression() {
/// sometimes skip the initializers for init-captures and not fully
/// populate \p Intro. This flag will be set to \c true if we do so.
/// \return A DiagnosticID if it hit something unexpected. The location for
-/// for the diagnostic is that of the current token.
+/// the diagnostic is that of the current token.
Optional<unsigned> Parser::ParseLambdaIntroducer(LambdaIntroducer &Intro,
bool *SkippedInits) {
typedef Optional<unsigned> DiagResult;
@@ -1818,8 +1818,7 @@ Sema::ConditionResult Parser::ParseCXXCondition(StmtResult *InitStmt,
}
if (!InitExpr.isInvalid())
- Actions.AddInitializerToDecl(DeclOut, InitExpr.get(), !CopyInitialization,
- DS.containsPlaceholderType());
+ Actions.AddInitializerToDecl(DeclOut, InitExpr.get(), !CopyInitialization);
else
Actions.ActOnInitializerError(DeclOut);
diff --git a/lib/Parse/ParseOpenMP.cpp b/lib/Parse/ParseOpenMP.cpp
index f9ea8af00f50a..cab7d3432db32 100644
--- a/lib/Parse/ParseOpenMP.cpp
+++ b/lib/Parse/ParseOpenMP.cpp
@@ -119,6 +119,7 @@ static OpenMPDirectiveKind ParseOpenMPDirectiveKind(Parser &P) {
{ OMPD_target, OMPD_teams, OMPD_target_teams },
{ OMPD_target_teams, OMPD_distribute, OMPD_target_teams_distribute },
{ OMPD_target_teams_distribute, OMPD_parallel, OMPD_target_teams_distribute_parallel },
+ { OMPD_target_teams_distribute, OMPD_simd, OMPD_target_teams_distribute_simd },
{ OMPD_target_teams_distribute_parallel, OMPD_for, OMPD_target_teams_distribute_parallel_for },
{ OMPD_target_teams_distribute_parallel_for, OMPD_simd, OMPD_target_teams_distribute_parallel_for_simd }
};
@@ -760,6 +761,7 @@ Parser::DeclGroupPtrTy Parser::ParseOpenMPDeclarativeDirectiveWithExtDecl(
case OMPD_target_teams_distribute:
case OMPD_target_teams_distribute_parallel_for:
case OMPD_target_teams_distribute_parallel_for_simd:
+ case OMPD_target_teams_distribute_simd:
Diag(Tok, diag::err_omp_unexpected_directive)
<< getOpenMPDirectiveName(DKind);
break;
@@ -799,7 +801,8 @@ Parser::DeclGroupPtrTy Parser::ParseOpenMPDeclarativeDirectiveWithExtDecl(
/// 'teams distribute parallel for' | 'target teams' |
/// 'target teams distribute' |
/// 'target teams distribute parallel for' |
-/// 'target teams distribute parallel for simd' {clause}
+/// 'target teams distribute parallel for simd' |
+/// 'target teams distribute simd' {clause}
/// annot_pragma_openmp_end
///
StmtResult Parser::ParseOpenMPDeclarativeOrExecutableDirective(
@@ -916,7 +919,8 @@ StmtResult Parser::ParseOpenMPDeclarativeOrExecutableDirective(
case OMPD_target_teams:
case OMPD_target_teams_distribute:
case OMPD_target_teams_distribute_parallel_for:
- case OMPD_target_teams_distribute_parallel_for_simd: {
+ case OMPD_target_teams_distribute_parallel_for_simd:
+ case OMPD_target_teams_distribute_simd: {
ConsumeToken();
// Parse directive name of the 'critical' directive if any.
if (DKind == OMPD_critical) {
diff --git a/lib/Parse/Parser.cpp b/lib/Parse/Parser.cpp
index d8a4ea63153a7..52e5194e62362 100644
--- a/lib/Parse/Parser.cpp
+++ b/lib/Parse/Parser.cpp
@@ -938,7 +938,7 @@ Parser::ParseDeclOrFunctionDefInternal(ParsedAttributesWithRange &attrs,
Actions.setCurrentOpenCLExtensionForDecl(TheDecl);
if (AnonRecord) {
Decl* decls[] = {AnonRecord, TheDecl};
- return Actions.BuildDeclaratorGroup(decls, /*TypeMayContainAuto=*/false);
+ return Actions.BuildDeclaratorGroup(decls);
}
return Actions.ConvertDeclToDeclGroup(TheDecl);
}
@@ -1472,8 +1472,7 @@ Parser::TryAnnotateName(bool IsAddressOfOperand,
return ANK_Error;
if (Tok.isNot(tok::identifier) || SS.isInvalid()) {
- if (TryAnnotateTypeOrScopeTokenAfterScopeSpec(EnteringContext, false, SS,
- !WasScopeAnnotation))
+ if (TryAnnotateTypeOrScopeTokenAfterScopeSpec(SS, !WasScopeAnnotation))
return ANK_Error;
return ANK_Unresolved;
}
@@ -1486,8 +1485,7 @@ Parser::TryAnnotateName(bool IsAddressOfOperand,
if (isTentativelyDeclared(Name)) {
// Identifier has been tentatively declared, and thus cannot be resolved as
// an expression. Fall back to annotating it as a type.
- if (TryAnnotateTypeOrScopeTokenAfterScopeSpec(EnteringContext, false, SS,
- !WasScopeAnnotation))
+ if (TryAnnotateTypeOrScopeTokenAfterScopeSpec(SS, !WasScopeAnnotation))
return ANK_Error;
return Tok.is(tok::annot_typename) ? ANK_Success : ANK_TentativeDecl;
}
@@ -1625,7 +1623,7 @@ bool Parser::TryKeywordIdentFallback(bool DisableKeyword) {
///
/// Note that this routine emits an error if you call it with ::new or ::delete
/// as the current tokens, so only call it in contexts where these are invalid.
-bool Parser::TryAnnotateTypeOrScopeToken(bool EnteringContext, bool NeedType) {
+bool Parser::TryAnnotateTypeOrScopeToken() {
assert((Tok.is(tok::identifier) || Tok.is(tok::coloncolon) ||
Tok.is(tok::kw_typename) || Tok.is(tok::annot_cxxscope) ||
Tok.is(tok::kw_decltype) || Tok.is(tok::annot_template_id) ||
@@ -1642,7 +1640,7 @@ bool Parser::TryAnnotateTypeOrScopeToken(bool EnteringContext, bool NeedType) {
if (getLangOpts().MSVCCompat && NextToken().is(tok::kw_typedef)) {
Token TypedefToken;
PP.Lex(TypedefToken);
- bool Result = TryAnnotateTypeOrScopeToken(EnteringContext, NeedType);
+ bool Result = TryAnnotateTypeOrScopeToken();
PP.EnterToken(Tok);
Tok = TypedefToken;
if (!Result)
@@ -1667,8 +1665,7 @@ bool Parser::TryAnnotateTypeOrScopeToken(bool EnteringContext, bool NeedType) {
Tok.is(tok::annot_decltype)) {
// Attempt to recover by skipping the invalid 'typename'
if (Tok.is(tok::annot_decltype) ||
- (!TryAnnotateTypeOrScopeToken(EnteringContext, NeedType) &&
- Tok.isAnnotation())) {
+ (!TryAnnotateTypeOrScopeToken() && Tok.isAnnotation())) {
unsigned DiagID = diag::err_expected_qualified_after_typename;
// MS compatibility: MSVC permits using known types with typename.
// e.g. "typedef typename T* pointer_type"
@@ -1728,33 +1725,24 @@ bool Parser::TryAnnotateTypeOrScopeToken(bool EnteringContext, bool NeedType) {
CXXScopeSpec SS;
if (getLangOpts().CPlusPlus)
- if (ParseOptionalCXXScopeSpecifier(SS, nullptr, EnteringContext))
+ if (ParseOptionalCXXScopeSpecifier(SS, nullptr, /*EnteringContext*/false))
return true;
- return TryAnnotateTypeOrScopeTokenAfterScopeSpec(EnteringContext, NeedType,
- SS, !WasScopeAnnotation);
+ return TryAnnotateTypeOrScopeTokenAfterScopeSpec(SS, !WasScopeAnnotation);
}
/// \brief Try to annotate a type or scope token, having already parsed an
/// optional scope specifier. \p IsNewScope should be \c true unless the scope
/// specifier was extracted from an existing tok::annot_cxxscope annotation.
-bool Parser::TryAnnotateTypeOrScopeTokenAfterScopeSpec(bool EnteringContext,
- bool NeedType,
- CXXScopeSpec &SS,
+bool Parser::TryAnnotateTypeOrScopeTokenAfterScopeSpec(CXXScopeSpec &SS,
bool IsNewScope) {
if (Tok.is(tok::identifier)) {
- IdentifierInfo *CorrectedII = nullptr;
// Determine whether the identifier is a type name.
if (ParsedType Ty = Actions.getTypeName(
*Tok.getIdentifierInfo(), Tok.getLocation(), getCurScope(), &SS,
false, NextToken().is(tok::period), nullptr,
/*IsCtorOrDtorName=*/false,
- /*NonTrivialTypeSourceInfo*/ true,
- NeedType ? &CorrectedII : nullptr)) {
- // A FixIt was applied as a result of typo correction
- if (CorrectedII)
- Tok.setIdentifierInfo(CorrectedII);
-
+ /*NonTrivialTypeSourceInfo*/ true)) {
SourceLocation BeginLoc = Tok.getLocation();
if (SS.isNotEmpty()) // it was a C++ qualified type name.
BeginLoc = SS.getBeginLoc();
@@ -1803,11 +1791,11 @@ bool Parser::TryAnnotateTypeOrScopeTokenAfterScopeSpec(bool EnteringContext,
UnqualifiedId TemplateName;
TemplateName.setIdentifier(Tok.getIdentifierInfo(), Tok.getLocation());
bool MemberOfUnknownSpecialization;
- if (TemplateNameKind TNK =
- Actions.isTemplateName(getCurScope(), SS,
- /*hasTemplateKeyword=*/false, TemplateName,
- /*ObjectType=*/nullptr, EnteringContext,
- Template, MemberOfUnknownSpecialization)) {
+ if (TemplateNameKind TNK = Actions.isTemplateName(
+ getCurScope(), SS,
+ /*hasTemplateKeyword=*/false, TemplateName,
+ /*ObjectType=*/nullptr, /*EnteringContext*/false, Template,
+ MemberOfUnknownSpecialization)) {
// Consume the identifier.
ConsumeToken();
if (AnnotateTemplateIdToken(Template, TNK, SS, SourceLocation(),
diff --git a/lib/Sema/AnalysisBasedWarnings.cpp b/lib/Sema/AnalysisBasedWarnings.cpp
index 5953d020b4fbc..a987a8ce0b310 100644
--- a/lib/Sema/AnalysisBasedWarnings.cpp
+++ b/lib/Sema/AnalysisBasedWarnings.cpp
@@ -56,6 +56,8 @@ using namespace clang;
namespace {
class UnreachableCodeHandler : public reachable_code::Callback {
Sema &S;
+ SourceRange PreviousSilenceableCondVal;
+
public:
UnreachableCodeHandler(Sema &s) : S(s) {}
@@ -64,6 +66,14 @@ namespace {
SourceRange SilenceableCondVal,
SourceRange R1,
SourceRange R2) override {
+ // Avoid reporting multiple unreachable code diagnostics that are
+ // triggered by the same conditional value.
+ if (PreviousSilenceableCondVal.isValid() &&
+ SilenceableCondVal.isValid() &&
+ PreviousSilenceableCondVal == SilenceableCondVal)
+ return;
+ PreviousSilenceableCondVal = SilenceableCondVal;
+
unsigned diag = diag::warn_unreachable;
switch (UK) {
case reachable_code::UK_Break:
diff --git a/lib/Sema/SemaCoroutine.cpp b/lib/Sema/SemaCoroutine.cpp
index 3109358df4645..9814b4a84f29b 100644
--- a/lib/Sema/SemaCoroutine.cpp
+++ b/lib/Sema/SemaCoroutine.cpp
@@ -187,7 +187,7 @@ static FunctionScopeInfo *checkCoroutineContext(Sema &S, SourceLocation Loc,
S.Context.getTrivialTypeSourceInfo(T, Loc), SC_None);
S.CheckVariableDeclarationType(ScopeInfo->CoroutinePromise);
if (!ScopeInfo->CoroutinePromise->isInvalidDecl())
- S.ActOnUninitializedDecl(ScopeInfo->CoroutinePromise, false);
+ S.ActOnUninitializedDecl(ScopeInfo->CoroutinePromise);
}
return ScopeInfo;
@@ -578,17 +578,6 @@ void Sema::CheckCompletedCoroutineBody(FunctionDecl *FD, Stmt *&Body) {
isa<CoyieldExpr>(First) ? 1 : 2);
}
- bool AnyCoawaits = false;
- bool AnyCoyields = false;
- for (auto *CoroutineStmt : Fn->CoroutineStmts) {
- AnyCoawaits |= isa<CoawaitExpr>(CoroutineStmt);
- AnyCoyields |= isa<CoyieldExpr>(CoroutineStmt);
- }
-
- if (!AnyCoawaits && !AnyCoyields)
- Diag(Fn->CoroutineStmts.front()->getLocStart(),
- diag::ext_coroutine_without_co_await_co_yield);
-
SourceLocation Loc = FD->getLocation();
// Form a declaration statement for the promise declaration, so that AST
diff --git a/lib/Sema/SemaDecl.cpp b/lib/Sema/SemaDecl.cpp
index c32757565dd10..adcf2ee00e756 100644
--- a/lib/Sema/SemaDecl.cpp
+++ b/lib/Sema/SemaDecl.cpp
@@ -1044,7 +1044,8 @@ Corrected:
}
// We can have a type template here if we're classifying a template argument.
- if (isa<TemplateDecl>(FirstDecl) && !isa<FunctionTemplateDecl>(FirstDecl))
+ if (isa<TemplateDecl>(FirstDecl) && !isa<FunctionTemplateDecl>(FirstDecl) &&
+ !isa<VarTemplateDecl>(FirstDecl))
return NameClassification::TypeTemplate(
TemplateName(cast<TemplateDecl>(FirstDecl)));
@@ -4503,7 +4504,7 @@ Decl *Sema::BuildAnonymousStructOrUnion(Scope *S, DeclSpec &DS,
// trivial in almost all cases, except if a union member has an in-class
// initializer:
// union { int n = 0; };
- ActOnUninitializedDecl(Anon, /*TypeMayContainAuto=*/false);
+ ActOnUninitializedDecl(Anon);
}
Anon->setImplicit();
@@ -6425,9 +6426,10 @@ NamedDecl *Sema::ActOnVariableDeclarator(
}
}
- // Diagnose shadowed variables before filtering for scope.
- if (D.getCXXScopeSpec().isEmpty())
- CheckShadow(S, NewVD, Previous);
+ // Find the shadowed declaration before filtering for scope.
+ NamedDecl *ShadowedDecl = D.getCXXScopeSpec().isEmpty()
+ ? getShadowedDeclaration(NewVD, Previous)
+ : nullptr;
// Don't consider existing declarations that are in a different
// scope and are out-of-semantic-context declarations (if the new
@@ -6522,6 +6524,10 @@ NamedDecl *Sema::ActOnVariableDeclarator(
}
}
+ // Diagnose shadowed variables iff this isn't a redeclaration.
+ if (ShadowedDecl && !D.isRedeclaration())
+ CheckShadow(NewVD, ShadowedDecl, Previous);
+
ProcessPragmaWeak(S, NewVD);
// If this is the first declaration of an extern C variable, update
@@ -6595,33 +6601,40 @@ static SourceLocation getCaptureLocation(const LambdaScopeInfo *LSI,
return SourceLocation();
}
-/// \brief Diagnose variable or built-in function shadowing. Implements
-/// -Wshadow.
-///
-/// This method is called whenever a VarDecl is added to a "useful"
-/// scope.
-///
-/// \param S the scope in which the shadowing name is being declared
-/// \param R the lookup of the name
-///
-void Sema::CheckShadow(Scope *S, VarDecl *D, const LookupResult& R) {
+/// \brief Return the declaration shadowed by the given variable \p D, or null
+/// if it doesn't shadow any declaration or shadowing warnings are disabled.
+NamedDecl *Sema::getShadowedDeclaration(const VarDecl *D,
+ const LookupResult &R) {
// Return if warning is ignored.
if (Diags.isIgnored(diag::warn_decl_shadow, R.getNameLoc()))
- return;
+ return nullptr;
// Don't diagnose declarations at file scope.
if (D->hasGlobalStorage())
- return;
-
- DeclContext *NewDC = D->getDeclContext();
+ return nullptr;
// Only diagnose if we're shadowing an unambiguous field or variable.
if (R.getResultKind() != LookupResult::Found)
- return;
+ return nullptr;
- NamedDecl* ShadowedDecl = R.getFoundDecl();
- if (!isa<VarDecl>(ShadowedDecl) && !isa<FieldDecl>(ShadowedDecl))
- return;
+ NamedDecl *ShadowedDecl = R.getFoundDecl();
+ return isa<VarDecl>(ShadowedDecl) || isa<FieldDecl>(ShadowedDecl)
+ ? ShadowedDecl
+ : nullptr;
+}
+
+/// \brief Diagnose variable or built-in function shadowing. Implements
+/// -Wshadow.
+///
+/// This method is called whenever a VarDecl is added to a "useful"
+/// scope.
+///
+/// \param ShadowedDecl the declaration that is shadowed by the given variable
+/// \param R the lookup of the name
+///
+void Sema::CheckShadow(VarDecl *D, NamedDecl *ShadowedDecl,
+ const LookupResult &R) {
+ DeclContext *NewDC = D->getDeclContext();
if (FieldDecl *FD = dyn_cast<FieldDecl>(ShadowedDecl)) {
// Fields are not shadowed by variables in C++ static methods.
@@ -6732,7 +6745,8 @@ void Sema::CheckShadow(Scope *S, VarDecl *D) {
LookupResult R(*this, D->getDeclName(), D->getLocation(),
Sema::LookupOrdinaryName, Sema::ForRedeclaration);
LookupName(R, S);
- CheckShadow(S, D, R);
+ if (NamedDecl *ShadowedDecl = getShadowedDeclaration(D, R))
+ CheckShadow(D, ShadowedDecl, R);
}
/// Check if 'E', which is an expression that is about to be modified, refers
@@ -9782,8 +9796,7 @@ QualType Sema::deduceVarTypeFromInitializer(VarDecl *VDecl,
/// AddInitializerToDecl - Adds the initializer Init to the
/// declaration dcl. If DirectInit is true, this is C++ direct
/// initialization rather than copy initialization.
-void Sema::AddInitializerToDecl(Decl *RealDecl, Expr *Init,
- bool DirectInit, bool TypeMayContainAuto) {
+void Sema::AddInitializerToDecl(Decl *RealDecl, Expr *Init, bool DirectInit) {
// If there is no declaration, there was an error parsing it. Just ignore
// the initializer.
if (!RealDecl || RealDecl->isInvalidDecl()) {
@@ -9808,7 +9821,7 @@ void Sema::AddInitializerToDecl(Decl *RealDecl, Expr *Init,
}
// C++11 [decl.spec.auto]p6. Deduce the type which 'auto' stands in for.
- if (TypeMayContainAuto && VDecl->getType()->isUndeducedType()) {
+ if (VDecl->getType()->isUndeducedType()) {
// Attempt typo correction early so that the type of the init expression can
// be deduced based on the chosen correction if the original init contains a
// TypoExpr.
@@ -10280,8 +10293,7 @@ bool Sema::canInitializeWithParenthesizedList(QualType TargetType) {
TargetType->getContainedAutoType();
}
-void Sema::ActOnUninitializedDecl(Decl *RealDecl,
- bool TypeMayContainAuto) {
+void Sema::ActOnUninitializedDecl(Decl *RealDecl) {
// If there is no declaration, there was an error parsing it. Just ignore it.
if (!RealDecl)
return;
@@ -10297,7 +10309,7 @@ void Sema::ActOnUninitializedDecl(Decl *RealDecl,
}
// C++11 [dcl.spec.auto]p3
- if (TypeMayContainAuto && Type->getContainedAutoType()) {
+ if (Type->isUndeducedType()) {
Diag(Var->getLocation(), diag::err_auto_var_requires_init)
<< Var->getDeclName() << Type;
Var->setInvalidDecl();
@@ -11081,32 +11093,32 @@ Sema::DeclGroupPtrTy Sema::FinalizeDeclaratorGroup(Scope *S, const DeclSpec &DS,
}
}
- return BuildDeclaratorGroup(Decls, DS.containsPlaceholderType());
+ return BuildDeclaratorGroup(Decls);
}
/// BuildDeclaratorGroup - convert a list of declarations into a declaration
/// group, performing any necessary semantic checking.
Sema::DeclGroupPtrTy
-Sema::BuildDeclaratorGroup(MutableArrayRef<Decl *> Group,
- bool TypeMayContainAuto) {
- // C++0x [dcl.spec.auto]p7:
- // If the type deduced for the template parameter U is not the same in each
+Sema::BuildDeclaratorGroup(MutableArrayRef<Decl *> Group) {
+ // C++14 [dcl.spec.auto]p7: (DR1347)
+ // If the type that replaces the placeholder type is not the same in each
// deduction, the program is ill-formed.
- // FIXME: When initializer-list support is added, a distinction is needed
- // between the deduced type U and the deduced type which 'auto' stands for.
- // auto a = 0, b = { 1, 2, 3 };
- // is legal because the deduced type U is 'int' in both cases.
- if (TypeMayContainAuto && Group.size() > 1) {
+ if (Group.size() > 1) {
QualType Deduced;
CanQualType DeducedCanon;
VarDecl *DeducedDecl = nullptr;
for (unsigned i = 0, e = Group.size(); i != e; ++i) {
if (VarDecl *D = dyn_cast<VarDecl>(Group[i])) {
AutoType *AT = D->getType()->getContainedAutoType();
+ // FIXME: DR1265: if we have a function pointer declaration, we can have
+ // an 'auto' from a trailing return type. In that case, the return type
+ // must match the various other uses of 'auto'.
+ if (!AT)
+ continue;
// Don't reissue diagnostics when instantiating a template.
- if (AT && D->isInvalidDecl())
+ if (D->isInvalidDecl())
break;
- QualType U = AT ? AT->getDeducedType() : QualType();
+ QualType U = AT->getDeducedType();
if (!U.isNull()) {
CanQualType UCanon = Context.getCanonicalType(U);
if (Deduced.isNull()) {
diff --git a/lib/Sema/SemaDeclObjC.cpp b/lib/Sema/SemaDeclObjC.cpp
index d172c951e7494..b43e5b9e32789 100644
--- a/lib/Sema/SemaDeclObjC.cpp
+++ b/lib/Sema/SemaDeclObjC.cpp
@@ -1712,7 +1712,7 @@ Sema::ActOnForwardProtocolDeclaration(SourceLocation AtProtocolLoc,
DeclsInGroup.push_back(PDecl);
}
- return BuildDeclaratorGroup(DeclsInGroup, false);
+ return BuildDeclaratorGroup(DeclsInGroup);
}
Decl *Sema::
@@ -2019,7 +2019,7 @@ Sema::ActOnFinishObjCImplementation(Decl *ObjCImpDecl, ArrayRef<Decl *> Decls) {
DeclsInGroup.push_back(ObjCImpDecl);
- return BuildDeclaratorGroup(DeclsInGroup, false);
+ return BuildDeclaratorGroup(DeclsInGroup);
}
void Sema::CheckImplementationIvars(ObjCImplementationDecl *ImpDecl,
@@ -3043,7 +3043,7 @@ Sema::ActOnForwardClassDeclaration(SourceLocation AtClassLoc,
DeclsInGroup.push_back(IDecl);
}
- return BuildDeclaratorGroup(DeclsInGroup, false);
+ return BuildDeclaratorGroup(DeclsInGroup);
}
static bool tryMatchRecordTypes(ASTContext &Context,
diff --git a/lib/Sema/SemaExprCXX.cpp b/lib/Sema/SemaExprCXX.cpp
index 1379440e8a031..b2fb33f53432d 100644
--- a/lib/Sema/SemaExprCXX.cpp
+++ b/lib/Sema/SemaExprCXX.cpp
@@ -1504,14 +1504,12 @@ Sema::ActOnCXXNew(SourceLocation StartLoc, bool UseGlobal,
SourceLocation PlacementLParen, MultiExprArg PlacementArgs,
SourceLocation PlacementRParen, SourceRange TypeIdParens,
Declarator &D, Expr *Initializer) {
- bool TypeContainsAuto = D.getDeclSpec().containsPlaceholderType();
-
Expr *ArraySize = nullptr;
// If the specified type is an array, unwrap it and save the expression.
if (D.getNumTypeObjects() > 0 &&
D.getTypeObject(0).Kind == DeclaratorChunk::Array) {
- DeclaratorChunk &Chunk = D.getTypeObject(0);
- if (TypeContainsAuto)
+ DeclaratorChunk &Chunk = D.getTypeObject(0);
+ if (D.getDeclSpec().containsPlaceholderType())
return ExprError(Diag(Chunk.Loc, diag::err_new_array_of_auto)
<< D.getSourceRange());
if (Chunk.Arr.hasStatic)
@@ -1588,8 +1586,7 @@ Sema::ActOnCXXNew(SourceLocation StartLoc, bool UseGlobal,
TInfo,
ArraySize,
DirectInitRange,
- Initializer,
- TypeContainsAuto);
+ Initializer);
}
static bool isLegalArrayNewInitializer(CXXNewExpr::InitializationStyle Style,
@@ -1621,8 +1618,7 @@ Sema::BuildCXXNew(SourceRange Range, bool UseGlobal,
TypeSourceInfo *AllocTypeInfo,
Expr *ArraySize,
SourceRange DirectInitRange,
- Expr *Initializer,
- bool TypeMayContainAuto) {
+ Expr *Initializer) {
SourceRange TypeRange = AllocTypeInfo->getTypeLoc().getSourceRange();
SourceLocation StartLoc = Range.getBegin();
@@ -1648,7 +1644,7 @@ Sema::BuildCXXNew(SourceRange Range, bool UseGlobal,
}
// C++11 [dcl.spec.auto]p6. Deduce the type which 'auto' stands in for.
- if (TypeMayContainAuto && AllocType->isUndeducedType()) {
+ if (AllocType->isUndeducedType()) {
if (initStyle == CXXNewExpr::NoInit || NumInits == 0)
return ExprError(Diag(StartLoc, diag::err_auto_new_requires_ctor_arg)
<< AllocType << TypeRange);
diff --git a/lib/Sema/SemaOpenMP.cpp b/lib/Sema/SemaOpenMP.cpp
index edceb537df75d..dcd19c8d817d0 100644
--- a/lib/Sema/SemaOpenMP.cpp
+++ b/lib/Sema/SemaOpenMP.cpp
@@ -1089,7 +1089,7 @@ void Sema::EndOpenMPDSABlock(Stmt *CurDirective) {
auto *VDPrivate = buildVarDecl(
*this, DE->getExprLoc(), Type.getUnqualifiedType(),
VD->getName(), VD->hasAttrs() ? &VD->getAttrs() : nullptr);
- ActOnUninitializedDecl(VDPrivate, /*TypeMayContainAuto=*/false);
+ ActOnUninitializedDecl(VDPrivate);
if (VDPrivate->isInvalidDecl())
continue;
PrivateCopies.push_back(buildDeclRefExpr(
@@ -1701,7 +1701,8 @@ void Sema::ActOnOpenMPRegionStart(OpenMPDirectiveKind DKind, Scope *CurScope) {
case OMPD_teams_distribute_parallel_for:
case OMPD_target_teams_distribute:
case OMPD_target_teams_distribute_parallel_for:
- case OMPD_target_teams_distribute_parallel_for_simd: {
+ case OMPD_target_teams_distribute_parallel_for_simd:
+ case OMPD_target_teams_distribute_simd: {
QualType KmpInt32Ty = Context.getIntTypeForBitwidth(32, 1);
QualType KmpInt32PtrTy =
Context.getPointerType(KmpInt32Ty).withConst().withRestrict();
@@ -1761,8 +1762,7 @@ static OMPCapturedExprDecl *buildCaptureDecl(Sema &S, IdentifierInfo *Id,
if (!WithInit)
CED->addAttr(OMPCaptureNoInitAttr::CreateImplicit(C, SourceRange()));
S.CurContext->addHiddenDecl(CED);
- S.AddInitializerToDecl(CED, Init, /*DirectInit=*/false,
- /*TypeMayContainAuto=*/true);
+ S.AddInitializerToDecl(CED, Init, /*DirectInit=*/false);
return CED;
}
@@ -2446,6 +2446,11 @@ StmtResult Sema::ActOnOpenMPExecutableDirective(
AllowedNameModifiers.push_back(OMPD_target);
AllowedNameModifiers.push_back(OMPD_parallel);
break;
+ case OMPD_target_teams_distribute_simd:
+ Res = ActOnOpenMPTargetTeamsDistributeSimdDirective(
+ ClausesWithImplicit, AStmt, StartLoc, EndLoc, VarsWithInheritedDSA);
+ AllowedNameModifiers.push_back(OMPD_target);
+ break;
case OMPD_declare_target:
case OMPD_end_declare_target:
case OMPD_threadprivate:
@@ -3970,33 +3975,32 @@ CheckOpenMPLoop(OpenMPDirectiveKind DKind, Expr *CollapseLoopCountExpr,
// Lower bound variable, initialized with zero.
VarDecl *LBDecl = buildVarDecl(SemaRef, InitLoc, VType, ".omp.lb");
LB = buildDeclRefExpr(SemaRef, LBDecl, VType, InitLoc);
- SemaRef.AddInitializerToDecl(
- LBDecl, SemaRef.ActOnIntegerConstant(InitLoc, 0).get(),
- /*DirectInit*/ false, /*TypeMayContainAuto*/ false);
+ SemaRef.AddInitializerToDecl(LBDecl,
+ SemaRef.ActOnIntegerConstant(InitLoc, 0).get(),
+ /*DirectInit*/ false);
// Upper bound variable, initialized with last iteration number.
VarDecl *UBDecl = buildVarDecl(SemaRef, InitLoc, VType, ".omp.ub");
UB = buildDeclRefExpr(SemaRef, UBDecl, VType, InitLoc);
SemaRef.AddInitializerToDecl(UBDecl, LastIteration.get(),
- /*DirectInit*/ false,
- /*TypeMayContainAuto*/ false);
+ /*DirectInit*/ false);
// A 32-bit variable-flag where runtime returns 1 for the last iteration.
// This will be used to implement clause 'lastprivate'.
QualType Int32Ty = SemaRef.Context.getIntTypeForBitwidth(32, true);
VarDecl *ILDecl = buildVarDecl(SemaRef, InitLoc, Int32Ty, ".omp.is_last");
IL = buildDeclRefExpr(SemaRef, ILDecl, Int32Ty, InitLoc);
- SemaRef.AddInitializerToDecl(
- ILDecl, SemaRef.ActOnIntegerConstant(InitLoc, 0).get(),
- /*DirectInit*/ false, /*TypeMayContainAuto*/ false);
+ SemaRef.AddInitializerToDecl(ILDecl,
+ SemaRef.ActOnIntegerConstant(InitLoc, 0).get(),
+ /*DirectInit*/ false);
// Stride variable returned by runtime (we initialize it to 1 by default).
VarDecl *STDecl =
buildVarDecl(SemaRef, InitLoc, StrideVType, ".omp.stride");
ST = buildDeclRefExpr(SemaRef, STDecl, StrideVType, InitLoc);
- SemaRef.AddInitializerToDecl(
- STDecl, SemaRef.ActOnIntegerConstant(InitLoc, 1).get(),
- /*DirectInit*/ false, /*TypeMayContainAuto*/ false);
+ SemaRef.AddInitializerToDecl(STDecl,
+ SemaRef.ActOnIntegerConstant(InitLoc, 1).get(),
+ /*DirectInit*/ false);
// Build expression: UB = min(UB, LastIteration)
// It is necessary for CodeGen of directives with static scheduling.
@@ -6428,6 +6432,39 @@ StmtResult Sema::ActOnOpenMPTargetTeamsDistributeParallelForSimdDirective(
Context, StartLoc, EndLoc, NestedLoopCount, Clauses, AStmt, B);
}
+StmtResult Sema::ActOnOpenMPTargetTeamsDistributeSimdDirective(
+ ArrayRef<OMPClause *> Clauses, Stmt *AStmt, SourceLocation StartLoc,
+ SourceLocation EndLoc,
+ llvm::DenseMap<ValueDecl *, Expr *> &VarsWithImplicitDSA) {
+ if (!AStmt)
+ return StmtError();
+
+ auto *CS = cast<CapturedStmt>(AStmt);
+ // 1.2.2 OpenMP Language Terminology
+ // Structured block - An executable statement with a single entry at the
+ // top and a single exit at the bottom.
+ // The point of exit cannot be a branch out of the structured block.
+ // longjmp() and throw() must not violate the entry/exit criteria.
+ CS->getCapturedDecl()->setNothrow();
+
+ OMPLoopDirective::HelperExprs B;
+ // In presence of clause 'collapse' with number of loops, it will
+ // define the nested loops number.
+ auto NestedLoopCount = CheckOpenMPLoop(
+ OMPD_target_teams_distribute_simd, getCollapseNumberExpr(Clauses),
+ nullptr /*ordered not a clause on distribute*/, AStmt, *this, *DSAStack,
+ VarsWithImplicitDSA, B);
+ if (NestedLoopCount == 0)
+ return StmtError();
+
+ assert((CurContext->isDependentContext() || B.builtAll()) &&
+ "omp target teams distribute simd loop exprs were not built");
+
+ getCurFunction()->setHasBranchProtectedScope();
+ return OMPTargetTeamsDistributeSimdDirective::Create(
+ Context, StartLoc, EndLoc, NestedLoopCount, Clauses, AStmt, B);
+}
+
OMPClause *Sema::ActOnOpenMPSingleExprClause(OpenMPClauseKind Kind, Expr *Expr,
SourceLocation StartLoc,
SourceLocation LParenLoc,
@@ -7448,10 +7485,13 @@ OMPClause *Sema::ActOnOpenMPPrivateClause(ArrayRef<Expr *> VarList,
// A list item cannot appear in both a map clause and a data-sharing
// attribute clause on the same construct
if (CurrDir == OMPD_target || CurrDir == OMPD_target_parallel ||
- CurrDir == OMPD_target_teams ||
+ CurrDir == OMPD_target_teams ||
CurrDir == OMPD_target_teams_distribute ||
CurrDir == OMPD_target_teams_distribute_parallel_for ||
- CurrDir == OMPD_target_teams_distribute_parallel_for_simd) {
+ CurrDir == OMPD_target_teams_distribute_parallel_for_simd ||
+ CurrDir == OMPD_target_teams_distribute_simd ||
+ CurrDir == OMPD_target_parallel_for_simd ||
+ CurrDir == OMPD_target_parallel_for) {
OpenMPClauseKind ConflictKind;
if (DSAStack->checkMappableExprComponentListsForDecl(
VD, /*CurrentRegionOnly=*/true,
@@ -7481,7 +7521,7 @@ OMPClause *Sema::ActOnOpenMPPrivateClause(ArrayRef<Expr *> VarList,
Type = Type.getUnqualifiedType();
auto VDPrivate = buildVarDecl(*this, ELoc, Type, D->getName(),
D->hasAttrs() ? &D->getAttrs() : nullptr);
- ActOnUninitializedDecl(VDPrivate, /*TypeMayContainAuto=*/false);
+ ActOnUninitializedDecl(VDPrivate);
if (VDPrivate->isInvalidDecl())
continue;
auto VDPrivateRefExpr = buildDeclRefExpr(
@@ -7709,10 +7749,13 @@ OMPClause *Sema::ActOnOpenMPFirstprivateClause(ArrayRef<Expr *> VarList,
// A list item cannot appear in both a map clause and a data-sharing
// attribute clause on the same construct
if (CurrDir == OMPD_target || CurrDir == OMPD_target_parallel ||
- CurrDir == OMPD_target_teams ||
+ CurrDir == OMPD_target_teams ||
CurrDir == OMPD_target_teams_distribute ||
CurrDir == OMPD_target_teams_distribute_parallel_for ||
- CurrDir == OMPD_target_teams_distribute_parallel_for_simd) {
+ CurrDir == OMPD_target_teams_distribute_parallel_for_simd ||
+ CurrDir == OMPD_target_teams_distribute_simd ||
+ CurrDir == OMPD_target_parallel_for_simd ||
+ CurrDir == OMPD_target_parallel_for) {
OpenMPClauseKind ConflictKind;
if (DSAStack->checkMappableExprComponentListsForDecl(
VD, /*CurrentRegionOnly=*/true,
@@ -7784,7 +7827,7 @@ OMPClause *Sema::ActOnOpenMPFirstprivateClause(ArrayRef<Expr *> VarList,
RefExpr->getExprLoc());
AddInitializerToDecl(VDPrivate,
DefaultLvalueConversion(VDInitRefExpr).get(),
- /*DirectInit=*/false, /*TypeMayContainAuto=*/false);
+ /*DirectInit=*/false);
}
if (VDPrivate->isInvalidDecl()) {
if (IsImplicitClause) {
@@ -8634,10 +8677,9 @@ OMPClause *Sema::ActOnOpenMPReductionClause(
}
}
if (Init && DeclareReductionRef.isUnset()) {
- AddInitializerToDecl(RHSVD, Init, /*DirectInit=*/false,
- /*TypeMayContainAuto=*/false);
+ AddInitializerToDecl(RHSVD, Init, /*DirectInit=*/false);
} else if (!Init)
- ActOnUninitializedDecl(RHSVD, /*TypeMayContainAuto=*/false);
+ ActOnUninitializedDecl(RHSVD);
if (RHSVD->isInvalidDecl())
continue;
if (!RHSVD->hasInit() && DeclareReductionRef.isUnset()) {
@@ -8886,7 +8928,7 @@ OMPClause *Sema::ActOnOpenMPLinearClause(
else
InitExpr = VD ? SimpleRefExpr : Ref;
AddInitializerToDecl(Init, DefaultLvalueConversion(InitExpr).get(),
- /*DirectInit=*/false, /*TypeMayContainAuto=*/false);
+ /*DirectInit=*/false);
auto InitRef = buildDeclRefExpr(*this, Init, Type, ELoc);
DSAStack->addDSA(D, RefExpr->IgnoreParens(), OMPC_linear, Ref);
@@ -10231,7 +10273,8 @@ checkMappableExpressionList(Sema &SemaRef, DSAStackTy *DSAS,
if ((DKind == OMPD_target || DKind == OMPD_target_teams ||
DKind == OMPD_target_teams_distribute ||
DKind == OMPD_target_teams_distribute_parallel_for ||
- DKind == OMPD_target_teams_distribute_parallel_for_simd) && VD) {
+ DKind == OMPD_target_teams_distribute_parallel_for_simd ||
+ DKind == OMPD_target_teams_distribute_simd) && VD) {
auto DVar = DSAS->getTopDSA(VD, false);
if (isOpenMPPrivate(DVar.CKind)) {
SemaRef.Diag(ELoc, diag::err_omp_variable_in_given_clause_and_dsa)
@@ -10963,7 +11006,7 @@ OMPClause *Sema::ActOnOpenMPUseDevicePtrClause(ArrayRef<Expr *> VarList,
RefExpr->getExprLoc());
AddInitializerToDecl(VDPrivate,
DefaultLvalueConversion(VDInitRefExpr).get(),
- /*DirectInit=*/false, /*TypeMayContainAuto=*/false);
+ /*DirectInit=*/false);
// If required, build a capture to implement the privatization initialized
// with the current list item value.
diff --git a/lib/Sema/SemaOverload.cpp b/lib/Sema/SemaOverload.cpp
index 41f4fa746fc6c..afdae4ed6d7d3 100644
--- a/lib/Sema/SemaOverload.cpp
+++ b/lib/Sema/SemaOverload.cpp
@@ -6596,7 +6596,9 @@ Sema::AddMethodTemplateCandidate(FunctionTemplateDecl *MethodTmpl,
Candidate.Function = MethodTmpl->getTemplatedDecl();
Candidate.Viable = false;
Candidate.IsSurrogate = false;
- Candidate.IgnoreObjectArgument = false;
+ Candidate.IgnoreObjectArgument =
+ cast<CXXMethodDecl>(Candidate.Function)->isStatic() ||
+ ObjectType.isNull();
Candidate.ExplicitCallArguments = Args.size();
if (Result == TDK_NonDependentConversionFailure)
Candidate.FailureKind = ovl_fail_bad_conversion;
@@ -6658,7 +6660,11 @@ Sema::AddTemplateOverloadCandidate(FunctionTemplateDecl *FunctionTemplate,
Candidate.Function = FunctionTemplate->getTemplatedDecl();
Candidate.Viable = false;
Candidate.IsSurrogate = false;
- Candidate.IgnoreObjectArgument = false;
+ // Ignore the object argument if there is one, since we don't have an object
+ // type.
+ Candidate.IgnoreObjectArgument =
+ isa<CXXMethodDecl>(Candidate.Function) &&
+ !isa<CXXConstructorDecl>(Candidate.Function);
Candidate.ExplicitCallArguments = Args.size();
if (Result == TDK_NonDependentConversionFailure)
Candidate.FailureKind = ovl_fail_bad_conversion;
@@ -10490,56 +10496,42 @@ static void CompleteNonViableCandidate(Sema &S, OverloadCandidate *Cand,
// operation somehow.
bool SuppressUserConversions = false;
- const FunctionProtoType *Proto;
- unsigned ArgIdx = 0;
+ unsigned ConvIdx = 0;
+ ArrayRef<QualType> ParamTypes;
if (Cand->IsSurrogate) {
QualType ConvType
= Cand->Surrogate->getConversionType().getNonReferenceType();
if (const PointerType *ConvPtrType = ConvType->getAs<PointerType>())
ConvType = ConvPtrType->getPointeeType();
- Proto = ConvType->getAs<FunctionProtoType>();
- ArgIdx = 1;
+ ParamTypes = ConvType->getAs<FunctionProtoType>()->getParamTypes();
+ // Conversion 0 is 'this', which doesn't have a corresponding argument.
+ ConvIdx = 1;
} else if (Cand->Function) {
- Proto = Cand->Function->getType()->getAs<FunctionProtoType>();
+ ParamTypes =
+ Cand->Function->getType()->getAs<FunctionProtoType>()->getParamTypes();
if (isa<CXXMethodDecl>(Cand->Function) &&
- !isa<CXXConstructorDecl>(Cand->Function))
- ArgIdx = 1;
+ !isa<CXXConstructorDecl>(Cand->Function)) {
+ // Conversion 0 is 'this', which doesn't have a corresponding argument.
+ ConvIdx = 1;
+ }
} else {
- // Builtin binary operator with a bad first conversion.
+ // Builtin operator.
assert(ConvCount <= 3);
- for (unsigned ConvIdx = (Cand->IgnoreObjectArgument ? 1 : 0);
- ConvIdx != ConvCount; ++ConvIdx) {
- if (Cand->Conversions[ConvIdx].isInitialized())
- continue;
- if (Cand->BuiltinTypes.ParamTypes[ConvIdx]->isDependentType())
- Cand->Conversions[ConvIdx].setAsIdentityConversion(
- Args[ConvIdx]->getType());
- else
- Cand->Conversions[ConvIdx] = TryCopyInitialization(
- S, Args[ConvIdx], Cand->BuiltinTypes.ParamTypes[ConvIdx],
- SuppressUserConversions,
- /*InOverloadResolution*/ true,
- /*AllowObjCWritebackConversion=*/
- S.getLangOpts().ObjCAutoRefCount);
- // FIXME: If the conversion is bad, try to fix it.
- }
- return;
+ ParamTypes = Cand->BuiltinTypes.ParamTypes;
}
// Fill in the rest of the conversions.
- unsigned NumParams = Proto->getNumParams();
- for (unsigned ConvIdx = (Cand->IgnoreObjectArgument ? 1 : 0);
- ConvIdx != ConvCount; ++ConvIdx, ++ArgIdx) {
+ for (unsigned ArgIdx = 0; ConvIdx != ConvCount; ++ConvIdx, ++ArgIdx) {
if (Cand->Conversions[ConvIdx].isInitialized()) {
- // Found the bad conversion.
- } else if (ArgIdx < NumParams) {
- if (Proto->getParamType(ArgIdx)->isDependentType())
+ // We've already checked this conversion.
+ } else if (ArgIdx < ParamTypes.size()) {
+ if (ParamTypes[ArgIdx]->isDependentType())
Cand->Conversions[ConvIdx].setAsIdentityConversion(
Args[ArgIdx]->getType());
else {
Cand->Conversions[ConvIdx] =
- TryCopyInitialization(S, Args[ArgIdx], Proto->getParamType(ArgIdx),
+ TryCopyInitialization(S, Args[ArgIdx], ParamTypes[ArgIdx],
SuppressUserConversions,
/*InOverloadResolution=*/true,
/*AllowObjCWritebackConversion=*/
diff --git a/lib/Sema/SemaStmt.cpp b/lib/Sema/SemaStmt.cpp
index 50f0a22ff02b3..a8832e9a1c54d 100644
--- a/lib/Sema/SemaStmt.cpp
+++ b/lib/Sema/SemaStmt.cpp
@@ -1881,8 +1881,7 @@ static bool FinishForRangeVarDecl(Sema &SemaRef, VarDecl *Decl, Expr *Init,
SemaRef.inferObjCARCLifetime(Decl))
Decl->setInvalidDecl();
- SemaRef.AddInitializerToDecl(Decl, Init, /*DirectInit=*/false,
- /*TypeMayContainAuto=*/false);
+ SemaRef.AddInitializerToDecl(Decl, Init, /*DirectInit=*/false);
SemaRef.FinalizeDeclaration(Decl);
SemaRef.CurContext->addHiddenDecl(Decl);
return false;
@@ -2005,8 +2004,7 @@ StmtResult Sema::ActOnCXXForRangeStmt(Scope *S, SourceLocation ForLoc,
// Claim the type doesn't contain auto: we've already done the checking.
DeclGroupPtrTy RangeGroup =
- BuildDeclaratorGroup(MutableArrayRef<Decl *>((Decl **)&RangeVar, 1),
- /*TypeMayContainAuto=*/ false);
+ BuildDeclaratorGroup(MutableArrayRef<Decl *>((Decl **)&RangeVar, 1));
StmtResult RangeDecl = ActOnDeclStmt(RangeGroup, RangeLoc, RangeLoc);
if (RangeDecl.isInvalid()) {
LoopVar->setInvalidDecl();
@@ -2408,8 +2406,7 @@ Sema::BuildCXXForRangeStmt(SourceLocation ForLoc, SourceLocation CoawaitLoc,
// Attach *__begin as initializer for VD. Don't touch it if we're just
// trying to determine whether this would be a valid range.
if (!LoopVar->isInvalidDecl() && Kind != BFRK_Check) {
- AddInitializerToDecl(LoopVar, DerefExpr.get(), /*DirectInit=*/false,
- /*TypeMayContainAuto=*/true);
+ AddInitializerToDecl(LoopVar, DerefExpr.get(), /*DirectInit=*/false);
if (LoopVar->isInvalidDecl())
NoteForRangeBeginEndFunction(*this, BeginExpr.get(), BEF_begin);
}
diff --git a/lib/Sema/SemaTemplate.cpp b/lib/Sema/SemaTemplate.cpp
index 795e6025d96f6..8ad5b5951ea34 100644
--- a/lib/Sema/SemaTemplate.cpp
+++ b/lib/Sema/SemaTemplate.cpp
@@ -1224,9 +1224,17 @@ Sema::CheckClassTemplate(Scope *S, unsigned TagSpec, TagUseKind TUK,
}
}
+ // If this is a templated friend in a dependent context we should not put it
+ // on the redecl chain. In some cases, the templated friend can be the most
+ // recent declaration tricking the template instantiator to make substitutions
+ // there.
+ // FIXME: Figure out how to combine with shouldLinkDependentDeclWithPrevious
+ bool ShouldAddRedecl
+ = !(TUK == TUK_Friend && CurContext->isDependentContext());
+
CXXRecordDecl *NewClass =
CXXRecordDecl::Create(Context, Kind, SemanticContext, KWLoc, NameLoc, Name,
- PrevClassTemplate?
+ PrevClassTemplate && ShouldAddRedecl ?
PrevClassTemplate->getTemplatedDecl() : nullptr,
/*DelayTypeCreation=*/true);
SetNestedNameSpecifier(NewClass, SS);
@@ -1245,7 +1253,11 @@ Sema::CheckClassTemplate(Scope *S, unsigned TagSpec, TagUseKind TUK,
ClassTemplateDecl *NewTemplate
= ClassTemplateDecl::Create(Context, SemanticContext, NameLoc,
DeclarationName(Name), TemplateParams,
- NewClass, PrevClassTemplate);
+ NewClass);
+
+ if (ShouldAddRedecl)
+ NewTemplate->setPreviousDecl(PrevClassTemplate);
+
NewClass->setDescribedClassTemplate(NewTemplate);
if (ModulePrivateLoc.isValid())
@@ -1653,6 +1665,7 @@ struct DependencyChecker : RecursiveASTVisitor<DependencyChecker> {
typedef RecursiveASTVisitor<DependencyChecker> super;
unsigned Depth;
+ bool FindLessThanDepth;
// Whether we're looking for a use of a template parameter that makes the
// overall construct type-dependent / a dependent type. This is strictly
@@ -1663,25 +1676,16 @@ struct DependencyChecker : RecursiveASTVisitor<DependencyChecker> {
bool Match;
SourceLocation MatchLoc;
- DependencyChecker(unsigned Depth, bool IgnoreNonTypeDependent)
- : Depth(Depth), IgnoreNonTypeDependent(IgnoreNonTypeDependent),
- Match(false) {}
+ DependencyChecker(unsigned Depth, bool IgnoreNonTypeDependent,
+ bool FindLessThanDepth = false)
+ : Depth(Depth), FindLessThanDepth(FindLessThanDepth),
+ IgnoreNonTypeDependent(IgnoreNonTypeDependent), Match(false) {}
DependencyChecker(TemplateParameterList *Params, bool IgnoreNonTypeDependent)
- : IgnoreNonTypeDependent(IgnoreNonTypeDependent), Match(false) {
- NamedDecl *ND = Params->getParam(0);
- if (TemplateTypeParmDecl *PD = dyn_cast<TemplateTypeParmDecl>(ND)) {
- Depth = PD->getDepth();
- } else if (NonTypeTemplateParmDecl *PD =
- dyn_cast<NonTypeTemplateParmDecl>(ND)) {
- Depth = PD->getDepth();
- } else {
- Depth = cast<TemplateTemplateParmDecl>(ND)->getDepth();
- }
- }
+ : DependencyChecker(Params->getDepth(), IgnoreNonTypeDependent) {}
bool Matches(unsigned ParmDepth, SourceLocation Loc = SourceLocation()) {
- if (ParmDepth >= Depth) {
+ if (FindLessThanDepth ^ (ParmDepth >= Depth)) {
Match = true;
MatchLoc = Loc;
return true;
@@ -2336,15 +2340,7 @@ QualType Sema::CheckTemplateIdType(TemplateName Name,
// A<T, T> have identical types when A is declared as:
//
// template<typename T, typename U = T> struct A;
- TemplateName CanonName = Context.getCanonicalTemplateName(Name);
- CanonType = Context.getTemplateSpecializationType(CanonName,
- Converted);
-
- // FIXME: CanonType is not actually the canonical type, and unfortunately
- // it is a TemplateSpecializationType that we will never use again.
- // In the future, we need to teach getTemplateSpecializationType to only
- // build the canonical type and return that to us.
- CanonType = Context.getCanonicalType(CanonType);
+ CanonType = Context.getCanonicalTemplateSpecializationType(Name, Converted);
// This might work out to be a current instantiation, in which
// case the canonical type needs to be the InjectedClassNameType.
@@ -3452,7 +3448,7 @@ SubstDefaultTemplateArgument(Sema &SemaRef,
SourceLocation TemplateLoc,
SourceLocation RAngleLoc,
TemplateTypeParmDecl *Param,
- SmallVectorImpl<TemplateArgument> &Converted) {
+ SmallVectorImpl<TemplateArgument> &Converted) {
TypeSourceInfo *ArgType = Param->getDefaultArgumentInfo();
// If the argument type is dependent, instantiate it now based
@@ -5838,6 +5834,15 @@ Sema::BuildExpressionFromIntegralTemplateArgument(const TemplateArgument &Arg,
return E;
}
+static bool isDependentOnOuter(NonTypeTemplateParmDecl *NTTP) {
+ if (NTTP->getDepth() == 0 || !NTTP->getType()->isDependentType())
+ return false;
+ DependencyChecker Checker(NTTP->getDepth(), /*IgnoreNonTypeDependent*/ false,
+ /*FindLessThanDepth*/ true);
+ Checker.TraverseType(NTTP->getType());
+ return Checker.Match;
+}
+
/// \brief Match two template parameters within template parameter lists.
static bool MatchTemplateParameterKind(Sema &S, NamedDecl *New, NamedDecl *Old,
bool Complain,
@@ -5894,11 +5899,10 @@ static bool MatchTemplateParameterKind(Sema &S, NamedDecl *New, NamedDecl *Old,
// If we are matching a template template argument to a template
// template parameter and one of the non-type template parameter types
- // is dependent, then we must wait until template instantiation time
- // to actually compare the arguments.
+ // is dependent on an outer template's parameter, then we must wait until
+ // template instantiation time to actually compare the arguments.
if (Kind == Sema::TPL_TemplateTemplateArgumentMatch &&
- (OldNTTP->getType()->isDependentType() ||
- NewNTTP->getType()->isDependentType()))
+ (isDependentOnOuter(OldNTTP) || isDependentOnOuter(NewNTTP)))
return true;
if (!S.Context.hasSameType(OldNTTP->getType(), NewNTTP->getType())) {
@@ -7785,6 +7789,7 @@ Sema::ActOnExplicitInstantiation(Scope *S,
Specialization->setTemplateKeywordLoc(TemplateLoc);
Specialization->setBraceRange(SourceRange());
+ bool PreviouslyDLLExported = Specialization->hasAttr<DLLExportAttr>();
if (Attr)
ProcessDeclAttributeList(S, Specialization, Attr);
@@ -7847,8 +7852,9 @@ Sema::ActOnExplicitInstantiation(Scope *S,
// Fix a TSK_ImplicitInstantiation followed by a
// TSK_ExplicitInstantiationDefinition
- if (Old_TSK == TSK_ImplicitInstantiation &&
- Specialization->hasAttr<DLLExportAttr>() &&
+ bool NewlyDLLExported =
+ !PreviouslyDLLExported && Specialization->hasAttr<DLLExportAttr>();
+ if (Old_TSK == TSK_ImplicitInstantiation && NewlyDLLExported &&
(Context.getTargetInfo().getCXXABI().isMicrosoft() ||
Context.getTargetInfo().getTriple().isWindowsItaniumEnvironment())) {
// In the MS ABI, an explicit instantiation definition can add a dll
diff --git a/lib/Sema/SemaTemplateInstantiate.cpp b/lib/Sema/SemaTemplateInstantiate.cpp
index ba4a5b7bc0d78..9f744a1dc1b2c 100644
--- a/lib/Sema/SemaTemplateInstantiate.cpp
+++ b/lib/Sema/SemaTemplateInstantiate.cpp
@@ -2264,9 +2264,6 @@ bool Sema::InstantiateInClassInitializer(
if (auto *L = getASTMutationListener())
L->DefaultMemberInitializerInstantiated(Instantiation);
- // Exit the scope of this instantiation.
- SavedContext.pop();
-
// Return true if the in-class initializer is still missing.
return !Instantiation->getInClassInitializer();
}
diff --git a/lib/Sema/SemaTemplateInstantiateDecl.cpp b/lib/Sema/SemaTemplateInstantiateDecl.cpp
index d2a5e5cb5312e..48d8b94af1539 100644
--- a/lib/Sema/SemaTemplateInstantiateDecl.cpp
+++ b/lib/Sema/SemaTemplateInstantiateDecl.cpp
@@ -1219,8 +1219,10 @@ Decl *TemplateDeclInstantiator::VisitClassTemplateDecl(ClassTemplateDecl *D) {
ClassTemplateDecl *Inst
= ClassTemplateDecl::Create(SemaRef.Context, DC, D->getLocation(),
- D->getIdentifier(), InstParams, RecordInst,
- PrevClassTemplate);
+ D->getIdentifier(), InstParams, RecordInst);
+ assert(!(isFriend && Owner->isDependentContext()));
+ Inst->setPreviousDecl(PrevClassTemplate);
+
RecordInst->setDescribedClassTemplate(Inst);
if (isFriend) {
@@ -4085,7 +4087,6 @@ void Sema::InstantiateVariableInitializer(
}
if (!Init.isInvalid()) {
- bool TypeMayContainAuto = true;
Expr *InitExpr = Init.get();
if (Var->hasAttr<DLLImportAttr>() &&
@@ -4094,9 +4095,9 @@ void Sema::InstantiateVariableInitializer(
// Do not dynamically initialize dllimport variables.
} else if (InitExpr) {
bool DirectInit = OldVar->isDirectInit();
- AddInitializerToDecl(Var, InitExpr, DirectInit, TypeMayContainAuto);
+ AddInitializerToDecl(Var, InitExpr, DirectInit);
} else
- ActOnUninitializedDecl(Var, TypeMayContainAuto);
+ ActOnUninitializedDecl(Var);
} else {
// FIXME: Not too happy about invalidating the declaration
// because of a bogus initializer.
@@ -4119,7 +4120,7 @@ void Sema::InstantiateVariableInitializer(
if (Var->isCXXForRangeDecl())
return;
- ActOnUninitializedDecl(Var, false);
+ ActOnUninitializedDecl(Var);
}
}
diff --git a/lib/Sema/SemaType.cpp b/lib/Sema/SemaType.cpp
index ae9a3ee790e1a..29b21426790ed 100644
--- a/lib/Sema/SemaType.cpp
+++ b/lib/Sema/SemaType.cpp
@@ -5263,7 +5263,7 @@ namespace {
ParmVarDecl *Param = cast<ParmVarDecl>(FTI.Params[i].Param);
TL.setParam(tpi++, Param);
}
- // FIXME: exception specs
+ TL.setExceptionSpecRange(FTI.getExceptionSpecRange());
}
void VisitParenTypeLoc(ParenTypeLoc TL) {
assert(Chunk.Kind == DeclaratorChunk::Paren);
diff --git a/lib/Sema/TreeTransform.h b/lib/Sema/TreeTransform.h
index 66892936e5731..c2aa3fef67c8c 100644
--- a/lib/Sema/TreeTransform.h
+++ b/lib/Sema/TreeTransform.h
@@ -5023,6 +5023,7 @@ QualType TreeTransform<Derived>::TransformFunctionProtoType(
NewTL.setLocalRangeBegin(TL.getLocalRangeBegin());
NewTL.setLParenLoc(TL.getLParenLoc());
NewTL.setRParenLoc(TL.getRParenLoc());
+ NewTL.setExceptionSpecRange(TL.getExceptionSpecRange());
NewTL.setLocalRangeEnd(TL.getLocalRangeEnd());
for (unsigned i = 0, e = NewTL.getNumParams(); i != e; ++i)
NewTL.setParam(i, ParamDecls[i]);
@@ -7779,6 +7780,18 @@ StmtResult TreeTransform<Derived>::
return Res;
}
+template <typename Derived>
+StmtResult
+TreeTransform<Derived>::TransformOMPTargetTeamsDistributeSimdDirective(
+ OMPTargetTeamsDistributeSimdDirective *D) {
+ DeclarationNameInfo DirName;
+ getDerived().getSema().StartOpenMPDSABlock(
+ OMPD_target_teams_distribute_simd, DirName, nullptr, D->getLocStart());
+ auto Res = getDerived().TransformOMPExecutableDirective(D);
+ getDerived().getSema().EndOpenMPDSABlock(Res.get());
+ return Res;
+}
+
//===----------------------------------------------------------------------===//
// OpenMP clause transformation
diff --git a/lib/Serialization/ASTReader.cpp b/lib/Serialization/ASTReader.cpp
index 7f890051e641e..53224e2b493d4 100644
--- a/lib/Serialization/ASTReader.cpp
+++ b/lib/Serialization/ASTReader.cpp
@@ -5990,6 +5990,8 @@ void TypeLocReader::VisitFunctionTypeLoc(FunctionTypeLoc TL) {
TL.setLocalRangeBegin(ReadSourceLocation());
TL.setLParenLoc(ReadSourceLocation());
TL.setRParenLoc(ReadSourceLocation());
+ TL.setExceptionSpecRange(SourceRange(Reader->ReadSourceLocation(*F, Record, Idx),
+ Reader->ReadSourceLocation(*F, Record, Idx)));
TL.setLocalRangeEnd(ReadSourceLocation());
for (unsigned i = 0, e = TL.getNumParams(); i != e; ++i) {
TL.setParam(i, Reader->ReadDeclAs<ParmVarDecl>(*F, Record, Idx));
diff --git a/lib/Serialization/ASTReaderDecl.cpp b/lib/Serialization/ASTReaderDecl.cpp
index 6e18b208a9aeb..c6919193391bb 100644
--- a/lib/Serialization/ASTReaderDecl.cpp
+++ b/lib/Serialization/ASTReaderDecl.cpp
@@ -748,6 +748,7 @@ void ASTDeclReader::VisitFunctionDecl(FunctionDecl *FD) {
FD->IsExplicitlyDefaulted = Record.readInt();
FD->HasImplicitReturnZero = Record.readInt();
FD->IsConstexpr = Record.readInt();
+ FD->UsesSEHTry = Record.readInt();
FD->HasSkippedBody = Record.readInt();
FD->IsLateTemplateParsed = Record.readInt();
FD->setCachedLinkage(Linkage(Record.readInt()));
diff --git a/lib/Serialization/ASTReaderStmt.cpp b/lib/Serialization/ASTReaderStmt.cpp
index 19fac55664aeb..686a69bbbcd2d 100644
--- a/lib/Serialization/ASTReaderStmt.cpp
+++ b/lib/Serialization/ASTReaderStmt.cpp
@@ -2865,6 +2865,11 @@ void ASTStmtReader::VisitOMPTargetTeamsDistributeParallelForSimdDirective(
VisitOMPLoopDirective(D);
}
+void ASTStmtReader::VisitOMPTargetTeamsDistributeSimdDirective(
+ OMPTargetTeamsDistributeSimdDirective *D) {
+ VisitOMPLoopDirective(D);
+}
+
//===----------------------------------------------------------------------===//
// ASTReader Implementation
//===----------------------------------------------------------------------===//
@@ -3651,6 +3656,14 @@ Stmt *ASTReader::ReadStmtFromStream(ModuleFile &F) {
break;
}
+ case STMT_OMP_TARGET_TEAMS_DISTRIBUTE_SIMD_DIRECTIVE: {
+ auto NumClauses = Record[ASTStmtReader::NumStmtFields];
+ auto CollapsedNum = Record[ASTStmtReader::NumStmtFields + 1];
+ S = OMPTargetTeamsDistributeSimdDirective::CreateEmpty(
+ Context, NumClauses, CollapsedNum, Empty);
+ break;
+ }
+
case EXPR_CXX_OPERATOR_CALL:
S = new (Context) CXXOperatorCallExpr(Context, Empty);
break;
diff --git a/lib/Serialization/ASTWriter.cpp b/lib/Serialization/ASTWriter.cpp
index 39e842db2baae..886523ea94319 100644
--- a/lib/Serialization/ASTWriter.cpp
+++ b/lib/Serialization/ASTWriter.cpp
@@ -629,6 +629,7 @@ void TypeLocWriter::VisitFunctionTypeLoc(FunctionTypeLoc TL) {
Record.AddSourceLocation(TL.getLocalRangeBegin());
Record.AddSourceLocation(TL.getLParenLoc());
Record.AddSourceLocation(TL.getRParenLoc());
+ Record.AddSourceRange(TL.getExceptionSpecRange());
Record.AddSourceLocation(TL.getLocalRangeEnd());
for (unsigned i = 0, e = TL.getNumParams(); i != e; ++i)
Record.AddDeclRef(TL.getParam(i));
diff --git a/lib/Serialization/ASTWriterDecl.cpp b/lib/Serialization/ASTWriterDecl.cpp
index 8e1480739a5f2..d8466e9cbf3ba 100644
--- a/lib/Serialization/ASTWriterDecl.cpp
+++ b/lib/Serialization/ASTWriterDecl.cpp
@@ -529,6 +529,7 @@ void ASTDeclWriter::VisitFunctionDecl(FunctionDecl *D) {
Record.push_back(D->IsExplicitlyDefaulted);
Record.push_back(D->HasImplicitReturnZero);
Record.push_back(D->IsConstexpr);
+ Record.push_back(D->UsesSEHTry);
Record.push_back(D->HasSkippedBody);
Record.push_back(D->IsLateTemplateParsed);
Record.push_back(D->getLinkageInternal());
@@ -2032,6 +2033,7 @@ void ASTWriter::WriteDeclAbbrevs() {
Abv->Add(BitCodeAbbrevOp(BitCodeAbbrevOp::Fixed, 1)); // ExplicitlyDefaulted
Abv->Add(BitCodeAbbrevOp(BitCodeAbbrevOp::Fixed, 1)); // ImplicitReturnZero
Abv->Add(BitCodeAbbrevOp(BitCodeAbbrevOp::Fixed, 1)); // Constexpr
+ Abv->Add(BitCodeAbbrevOp(BitCodeAbbrevOp::Fixed, 1)); // UsesSEHTry
Abv->Add(BitCodeAbbrevOp(BitCodeAbbrevOp::Fixed, 1)); // SkippedBody
Abv->Add(BitCodeAbbrevOp(BitCodeAbbrevOp::Fixed, 1)); // LateParsed
Abv->Add(BitCodeAbbrevOp(BitCodeAbbrevOp::Fixed, 3)); // Linkage
diff --git a/lib/Serialization/ASTWriterStmt.cpp b/lib/Serialization/ASTWriterStmt.cpp
index 162b2bd252607..01fd98ceadb2c 100644
--- a/lib/Serialization/ASTWriterStmt.cpp
+++ b/lib/Serialization/ASTWriterStmt.cpp
@@ -2563,6 +2563,12 @@ void ASTStmtWriter::VisitOMPTargetTeamsDistributeParallelForSimdDirective(
STMT_OMP_TARGET_TEAMS_DISTRIBUTE_PARALLEL_FOR_SIMD_DIRECTIVE;
}
+void ASTStmtWriter::VisitOMPTargetTeamsDistributeSimdDirective(
+ OMPTargetTeamsDistributeSimdDirective *D) {
+ VisitOMPLoopDirective(D);
+ Code = serialization::STMT_OMP_TARGET_TEAMS_DISTRIBUTE_SIMD_DIRECTIVE;
+}
+
//===----------------------------------------------------------------------===//
// ASTWriter Implementation
//===----------------------------------------------------------------------===//
diff --git a/lib/StaticAnalyzer/Core/ExprEngine.cpp b/lib/StaticAnalyzer/Core/ExprEngine.cpp
index 7e7e329dc4d78..d563f8e9eac02 100644
--- a/lib/StaticAnalyzer/Core/ExprEngine.cpp
+++ b/lib/StaticAnalyzer/Core/ExprEngine.cpp
@@ -515,8 +515,9 @@ void ExprEngine::ProcessInitializer(const CFGInitializer Init,
Init = ASE->getBase()->IgnoreImplicit();
SVal LValue = State->getSVal(Init, stackFrame);
- if (Optional<Loc> LValueLoc = LValue.getAs<Loc>())
- InitVal = State->getSVal(*LValueLoc);
+ if (!Field->getType()->isReferenceType())
+ if (Optional<Loc> LValueLoc = LValue.getAs<Loc>())
+ InitVal = State->getSVal(*LValueLoc);
// If we fail to get the value for some reason, use a symbolic value.
if (InitVal.isUnknownOrUndef()) {
@@ -870,6 +871,7 @@ void ExprEngine::Visit(const Stmt *S, ExplodedNode *Pred,
case Stmt::OMPTargetTeamsDistributeDirectiveClass:
case Stmt::OMPTargetTeamsDistributeParallelForDirectiveClass:
case Stmt::OMPTargetTeamsDistributeParallelForSimdDirectiveClass:
+ case Stmt::OMPTargetTeamsDistributeSimdDirectiveClass:
llvm_unreachable("Stmt should not be in analyzer evaluation loop");
case Stmt::ObjCSubscriptRefExprClass:
diff --git a/lib/StaticAnalyzer/Core/SValBuilder.cpp b/lib/StaticAnalyzer/Core/SValBuilder.cpp
index 10b0858b84887..ffaa0eda918aa 100644
--- a/lib/StaticAnalyzer/Core/SValBuilder.cpp
+++ b/lib/StaticAnalyzer/Core/SValBuilder.cpp
@@ -218,6 +218,18 @@ SValBuilder::getDerivedRegionValueSymbolVal(SymbolRef parentSymbol,
}
DefinedSVal SValBuilder::getMemberPointer(const DeclaratorDecl* DD) {
+ assert(!DD || isa<CXXMethodDecl>(DD) || isa<FieldDecl>(DD));
+
+ if (auto *MD = dyn_cast_or_null<CXXMethodDecl>(DD)) {
+ // Sema treats pointers to static member functions as have function pointer
+ // type, so return a function pointer for the method.
+ // We don't need to play a similar trick for static member fields
+ // because these are represented as plain VarDecls and not FieldDecls
+ // in the AST.
+ if (MD->isStatic())
+ return getFunctionPointer(MD);
+ }
+
return nonloc::PointerToMember(DD);
}
diff --git a/test/Analysis/initializer.cpp b/test/Analysis/initializer.cpp
index b31c315ba524b..09509271dae0c 100644
--- a/test/Analysis/initializer.cpp
+++ b/test/Analysis/initializer.cpp
@@ -197,3 +197,10 @@ namespace ReferenceInitialization {
}
};
+
+namespace PR31592 {
+struct C {
+ C() : f("}") { } // no-crash
+ const char(&f)[2];
+};
+}
diff --git a/test/Analysis/pointer-to-member.cpp b/test/Analysis/pointer-to-member.cpp
index eef20627a1329..039782b44b747 100644
--- a/test/Analysis/pointer-to-member.cpp
+++ b/test/Analysis/pointer-to-member.cpp
@@ -77,7 +77,8 @@ bool testDereferencing() {
namespace testPointerToMemberFunction {
struct A {
virtual int foo() { return 1; }
- int bar() { return 2; }
+ int bar() { return 2; }
+ int static staticMemberFunction(int p) { return p + 1; };
};
struct B : public A {
@@ -111,11 +112,19 @@ namespace testPointerToMemberFunction {
clang_analyzer_eval((APtr->*AFP)() == 3); // expected-warning{{TRUE}}
}
+
+ void testPointerToStaticMemberCall() {
+ int (*fPtr)(int) = &A::staticMemberFunction;
+ if (fPtr != 0) { // no-crash
+ clang_analyzer_eval(fPtr(2) == 3); // expected-warning{{TRUE}}
+ }
+ }
} // end of testPointerToMemberFunction namespace
namespace testPointerToMemberData {
struct A {
int i;
+ static int j;
};
void testPointerToMemberData() {
@@ -126,6 +135,13 @@ namespace testPointerToMemberData {
a.*AMdPointer += 1;
clang_analyzer_eval(a.i == 43); // expected-warning{{TRUE}}
+
+ int *ptrToStaticField = &A::j;
+ if (ptrToStaticField != 0) {
+ *ptrToStaticField = 7;
+ clang_analyzer_eval(*ptrToStaticField == 7); // expected-warning{{TRUE}}
+ clang_analyzer_eval(A::j == 7); // expected-warning{{TRUE}}
+ }
}
} // end of testPointerToMemberData namespace
diff --git a/test/Analysis/properties.m b/test/Analysis/properties.m
index b1305341e5d4b..235a9687821d5 100644
--- a/test/Analysis/properties.m
+++ b/test/Analysis/properties.m
@@ -315,6 +315,32 @@ void testConsistencyAssign(Person *p) {
}
@end
+__attribute__((objc_root_class))
+@interface ClassWithPrivatePropertyInClassExtensionWithProtocolShadowingCategory
+@end
+
+@protocol HasStuff
+@property (nonatomic, readonly) int stuffProperty;
+@end
+
+@interface ClassWithPrivatePropertyInClassExtensionWithProtocolShadowingCategory (Private)
+@property (nonatomic, readonly) int stuffProperty;
+@end
+
+@interface ClassWithPrivatePropertyInClassExtensionWithProtocolShadowingCategory (Internal) <HasStuff>
+@end
+
+@interface ClassWithPrivatePropertyInClassExtensionWithProtocolShadowingCategory() <HasStuff>
+@end
+
+@implementation ClassWithPrivatePropertyInClassExtensionWithProtocolShadowingCategory
+@synthesize stuffProperty = _stuffProperty;
+
+-(void)foo {
+ (void)self.stuffProperty;
+}
+@end
+
//------
// Setter ivar invalidation.
//------
diff --git a/test/CXX/basic/basic.start/basic.start.init/p2.cpp b/test/CXX/basic/basic.start/basic.start.init/p2.cpp
new file mode 100644
index 0000000000000..36158210ac930
--- /dev/null
+++ b/test/CXX/basic/basic.start/basic.start.init/p2.cpp
@@ -0,0 +1,21 @@
+// RUN: %clang_cc1 -verify %s -pedantic-errors -std=c++11
+// RUN: %clang_cc1 -verify %s -pedantic-errors -std=c++14
+// expected-no-diagnostics
+
+struct foo_t {
+ union {
+ int i;
+ volatile int j;
+ } u;
+};
+
+__attribute__((__require_constant_initialization__))
+static const foo_t x = {{0}};
+
+union foo_u {
+ int i;
+ volatile int j;
+};
+
+__attribute__((__require_constant_initialization__))
+static const foo_u y = {0};
diff --git a/test/CXX/drs/dr0xx.cpp b/test/CXX/drs/dr0xx.cpp
index c988b6aba57e5..055f40f98f660 100644
--- a/test/CXX/drs/dr0xx.cpp
+++ b/test/CXX/drs/dr0xx.cpp
@@ -1032,7 +1032,7 @@ namespace dr91 { // dr91: yes
int k = f(U());
}
-namespace dr92 { // dr92: 4.0 c++17
+namespace dr92 { // dr92: 4 c++17
void f() throw(int, float); // expected-error 0-1{{ISO C++1z does not allow}} expected-note 0-1{{use 'noexcept}}
void (*p)() throw(int) = &f; // expected-error 0-1{{ISO C++1z does not allow}} expected-note 0-1{{use 'noexcept}}
#if __cplusplus <= 201402L
diff --git a/test/CXX/drs/dr12xx.cpp b/test/CXX/drs/dr12xx.cpp
index 72d8d683ab7a7..45b33f9d7daf1 100644
--- a/test/CXX/drs/dr12xx.cpp
+++ b/test/CXX/drs/dr12xx.cpp
@@ -3,7 +3,7 @@
// RUN: %clang_cc1 -std=c++14 %s -verify -fexceptions -fcxx-exceptions -pedantic-errors
// RUN: %clang_cc1 -std=c++1z %s -verify -fexceptions -fcxx-exceptions -pedantic-errors
-namespace dr1213 { // dr1213: 4.0
+namespace dr1213 { // dr1213: 4
#if __cplusplus >= 201103L
using T = int[3];
int &&r = T{}[1];
@@ -26,7 +26,7 @@ struct Derived : Base {
};
} // dr1250
-namespace dr1295 { // dr1295: 4.0
+namespace dr1295 { // dr1295: 4
struct X {
unsigned bitfield : 4;
};
diff --git a/test/CXX/drs/dr13xx.cpp b/test/CXX/drs/dr13xx.cpp
index 28e667f77f844..f35ead7b5e94a 100644
--- a/test/CXX/drs/dr13xx.cpp
+++ b/test/CXX/drs/dr13xx.cpp
@@ -31,7 +31,7 @@ namespace dr1315 { // dr1315: partial
// expected-error@-1 {{type of specialized non-type template argument depends on a template parameter of the partial specialization}}
}
-namespace dr1330 { // dr1330: 4.0 c++11
+namespace dr1330 { // dr1330: 4 c++11
// exception-specifications are parsed in a context where the class is complete.
struct A {
void f() throw(T) {} // expected-error 0-1{{C++1z}} expected-note 0-1{{noexcept}}
@@ -175,7 +175,7 @@ namespace dr1359 { // dr1359: 3.5
#endif
}
-namespace dr1388 { // dr1388: 4.0
+namespace dr1388 { // dr1388: 4
template<typename A, typename ...T> void f(T..., A); // expected-note 1+{{candidate}} expected-error 0-1{{C++11}}
template<typename ...T> void g(T..., int); // expected-note 1+{{candidate}} expected-error 0-1{{C++11}}
template<typename ...T, typename A> void h(T..., A); // expected-note 1+{{candidate}} expected-error 0-1{{C++11}}
diff --git a/test/CXX/drs/dr14xx.cpp b/test/CXX/drs/dr14xx.cpp
index 9e724d9183460..116437b1ab3c7 100644
--- a/test/CXX/drs/dr14xx.cpp
+++ b/test/CXX/drs/dr14xx.cpp
@@ -343,7 +343,7 @@ namespace dr1490 { // dr1490: 3.7 c++11
std::initializer_list<char>{"abc"}; // expected-error {{expected unqualified-id}}}
} // dr190
-namespace dr1495 { // dr1495: 4.0
+namespace dr1495 { // dr1495: 4
// Deduction succeeds in both directions.
template<typename T, typename U> struct A {}; // expected-note {{template is declared here}}
template<typename T, typename U> struct A<U, T> {}; // expected-error {{class template partial specialization is not more specialized}}
diff --git a/test/CXX/drs/dr15xx.cpp b/test/CXX/drs/dr15xx.cpp
index fb0d9334f6b6f..a68928f727ef3 100644
--- a/test/CXX/drs/dr15xx.cpp
+++ b/test/CXX/drs/dr15xx.cpp
@@ -3,7 +3,7 @@
// RUN: %clang_cc1 -std=c++14 -triple x86_64-unknown-unknown %s -verify -fexceptions -fcxx-exceptions -pedantic-errors
// RUN: %clang_cc1 -std=c++1z -triple x86_64-unknown-unknown %s -verify -fexceptions -fcxx-exceptions -pedantic-errors
-namespace dr1512 { // dr1512: 4.0
+namespace dr1512 { // dr1512: 4
void f(char *p) {
if (p > 0) {} // expected-error {{ordered comparison between pointer and zero}}
#if __cplusplus >= 201103L
@@ -135,7 +135,7 @@ namespace dr1512 { // dr1512: 4.0
}
}
-namespace dr1518 { // dr1518: 4.0
+namespace dr1518 { // dr1518: 4
#if __cplusplus >= 201103L
struct Z0 { // expected-note 0+ {{candidate}}
explicit Z0() = default; // expected-note 0+ {{here}}
diff --git a/test/CXX/drs/dr16xx.cpp b/test/CXX/drs/dr16xx.cpp
index 02aa5f9909eb3..c0b7c29e5dd17 100644
--- a/test/CXX/drs/dr16xx.cpp
+++ b/test/CXX/drs/dr16xx.cpp
@@ -86,7 +86,7 @@ namespace dr1645 { // dr1645: 3.9
#endif
}
-namespace dr1653 { // dr1653: 4.0 c++17
+namespace dr1653 { // dr1653: 4 c++17
void f(bool b) {
++b;
b++;
diff --git a/test/CXX/drs/dr18xx.cpp b/test/CXX/drs/dr18xx.cpp
index 436bccc8e42e3..e4ec199fcae8e 100644
--- a/test/CXX/drs/dr18xx.cpp
+++ b/test/CXX/drs/dr18xx.cpp
@@ -7,7 +7,7 @@
// expected-no-diagnostics
#endif
-void dr1891() { // dr1891: 4.0
+void dr1891() { // dr1891: 4
#if __cplusplus >= 201103L
int n;
auto a = []{}; // expected-note 2{{candidate}} expected-note 2{{here}}
diff --git a/test/CXX/drs/dr2xx.cpp b/test/CXX/drs/dr2xx.cpp
index a9f0c8fcc9995..68261f6c00f11 100644
--- a/test/CXX/drs/dr2xx.cpp
+++ b/test/CXX/drs/dr2xx.cpp
@@ -679,7 +679,7 @@ namespace dr258 { // dr258: yes
} f; // expected-error {{abstract}}
}
-namespace dr259 { // dr259: 4.0
+namespace dr259 { // dr259: 4
template<typename T> struct A {};
template struct A<int>; // expected-note {{previous}}
template struct A<int>; // expected-error {{duplicate explicit instantiation}}
diff --git a/test/CXX/drs/dr5xx.cpp b/test/CXX/drs/dr5xx.cpp
index f065128cd4bd8..89e404f5fd6d0 100644
--- a/test/CXX/drs/dr5xx.cpp
+++ b/test/CXX/drs/dr5xx.cpp
@@ -863,7 +863,7 @@ namespace dr580 { // dr580: partial
// dr582: na
-namespace dr583 { // dr583: 4.0
+namespace dr583 { // dr583: 4
// see n3624
int *p;
bool b1 = p < 0; // expected-error {{ordered comparison between pointer and zero}}
diff --git a/test/CXX/drs/dr6xx.cpp b/test/CXX/drs/dr6xx.cpp
index 9dfcc7d6b4646..8b9a69960767a 100644
--- a/test/CXX/drs/dr6xx.cpp
+++ b/test/CXX/drs/dr6xx.cpp
@@ -142,7 +142,7 @@ namespace dr615 { // dr615: yes
static int n = f();
}
-namespace dr616 { // dr616: 4.0
+namespace dr616 { // dr616: 4
#if __cplusplus >= 201103L
struct S { int n; } s;
S f();
diff --git a/test/CodeGen/always_inline.c b/test/CodeGen/always_inline.c
index 19d93d9db0664..8e4a7c70b183e 100644
--- a/test/CodeGen/always_inline.c
+++ b/test/CodeGen/always_inline.c
@@ -1,7 +1,7 @@
// RUN: %clang -emit-llvm -S -o %t %s
// RUN: not grep '@f0' %t
// RUN: not grep 'call ' %t
-// RUN: %clang -mllvm -disable-llvm-passes -emit-llvm -S -o %t %s
+// RUN: %clang -Xclang -disable-llvm-passes -emit-llvm -S -o %t %s
// RUN: grep '@f0' %t | count 2
//static int f0() {
diff --git a/test/CodeGen/arm_acle.c b/test/CodeGen/arm_acle.c
index 0884394fbf199..b4f39bef15722 100644
--- a/test/CodeGen/arm_acle.c
+++ b/test/CodeGen/arm_acle.c
@@ -244,23 +244,23 @@ int16_t test_revsh(int16_t t) {
}
// ARM-LABEL: test_rbit
-// AArch32: call i32 @llvm.arm.rbit
-// AArch64: call i32 @llvm.aarch64.rbit.i32
+// AArch32: call i32 @llvm.bitreverse.i32
+// AArch64: call i32 @llvm.bitreverse.i32
uint32_t test_rbit(uint32_t t) {
return __rbit(t);
}
// ARM-LABEL: test_rbitl
-// AArch32: call i32 @llvm.arm.rbit
-// AArch64: call i64 @llvm.aarch64.rbit.i64
+// AArch32: call i32 @llvm.bitreverse.i32
+// AArch64: call i64 @llvm.bitreverse.i64
long test_rbitl(long t) {
return __rbitl(t);
}
// ARM-LABEL: test_rbitll
-// AArch32: call i32 @llvm.arm.rbit
-// AArch32: call i32 @llvm.arm.rbit
-// AArch64: call i64 @llvm.aarch64.rbit.i64
+// AArch32: call i32 @llvm.bitreverse.i32
+// AArch32: call i32 @llvm.bitreverse.i32
+// AArch64: call i64 @llvm.bitreverse.i64
uint64_t test_rbitll(uint64_t t) {
return __rbitll(t);
}
diff --git a/test/CodeGen/builtins-arm.c b/test/CodeGen/builtins-arm.c
index a385bd27546a4..0dc4c7dd77906 100644
--- a/test/CodeGen/builtins-arm.c
+++ b/test/CodeGen/builtins-arm.c
@@ -68,7 +68,7 @@ void test_barrier() {
__builtin_arm_isb(3); //CHECK: call {{.*}} @llvm.arm.isb(i32 3)
}
-// CHECK: call {{.*}} @llvm.arm.rbit(i32 %a)
+// CHECK: call {{.*}} @llvm.bitreverse.i32(i32 %a)
unsigned rbit(unsigned a) {
return __builtin_arm_rbit(a);
diff --git a/test/CodeGen/builtins-arm64.c b/test/CodeGen/builtins-arm64.c
index 20eb2abc94765..dc5fb6f31cffe 100644
--- a/test/CodeGen/builtins-arm64.c
+++ b/test/CodeGen/builtins-arm64.c
@@ -10,12 +10,12 @@ void *tp (void) {
// CHECK: call {{.*}} @llvm.thread.pointer()
}
-// CHECK: call {{.*}} @llvm.aarch64.rbit.i32(i32 %a)
+// CHECK: call {{.*}} @llvm.bitreverse.i32(i32 %a)
unsigned rbit(unsigned a) {
return __builtin_arm_rbit(a);
}
-// CHECK: call {{.*}} @llvm.aarch64.rbit.i64(i64 %a)
+// CHECK: call {{.*}} @llvm.bitreverse.i64(i64 %a)
unsigned long long rbit64(unsigned long long a) {
return __builtin_arm_rbit64(a);
}
diff --git a/test/CodeGen/builtins-ppc-p9vector.c b/test/CodeGen/builtins-ppc-p9vector.c
index bd0ad182f15fe..42316970d8da5 100644
--- a/test/CodeGen/builtins-ppc-p9vector.c
+++ b/test/CodeGen/builtins-ppc-p9vector.c
@@ -868,20 +868,24 @@ vector unsigned long long test76(void) {
return vec_rlmi(vula, vula, vula);
}
vector unsigned int test77(void) {
+// CHECK-BE: %[[RES1:.+]] = shl <4 x i32
+// CHECK-BE: %[[RES2:.+]] = or <4 x i32> %[[RES1]]
// CHECK-BE: @llvm.ppc.altivec.vrlwnm(<4 x i32
-// CHECK-BE: and <4 x i32
// CHECK-BE: ret <4 x i32>
+// CHECK: %[[RES1:.+]] = shl <4 x i32
+// CHECK: %[[RES2:.+]] = or <4 x i32> %[[RES1]]
// CHECK: @llvm.ppc.altivec.vrlwnm(<4 x i32
-// CHECK: and <4 x i32
// CHECK: ret <4 x i32>
return vec_rlnm(vuia, vuia, vuia);
}
vector unsigned long long test78(void) {
+// CHECK-BE: %[[RES1:.+]] = shl <2 x i64
+// CHECK-BE: %[[RES2:.+]] = or <2 x i64> %[[RES1]]
// CHECK-BE: @llvm.ppc.altivec.vrldnm(<2 x i64
-// CHECK-BE: and <2 x i64
// CHECK-BE-NEXT: ret <2 x i64>
+// CHECK: %[[RES1:.+]] = shl <2 x i64
+// CHECK: %[[RES2:.+]] = or <2 x i64> %[[RES1]]
// CHECK: @llvm.ppc.altivec.vrldnm(<2 x i64
-// CHECK: and <2 x i64
// CHECK-NEXT: ret <2 x i64>
return vec_rlnm(vula, vula, vula);
}
diff --git a/test/CodeGen/integer-overflow.c b/test/CodeGen/integer-overflow.c
index 6a7c3e51ee1bb..0b28bc5b8a2d0 100644
--- a/test/CodeGen/integer-overflow.c
+++ b/test/CodeGen/integer-overflow.c
@@ -65,13 +65,37 @@ void test1() {
// TRAPV: getelementptr inbounds i32, i32*
// CATCH_UB: getelementptr inbounds i32, i32*
- // PR9350: char increment never overflows.
- extern volatile signed char PR9350;
+ // PR9350: char pre-increment never overflows.
+ extern volatile signed char PR9350_char_inc;
// DEFAULT: add i8 {{.*}}, 1
// WRAPV: add i8 {{.*}}, 1
// TRAPV: add i8 {{.*}}, 1
// CATCH_UB: add i8 {{.*}}, 1
- ++PR9350;
+ ++PR9350_char_inc;
+
+ // PR9350: char pre-decrement never overflows.
+ extern volatile signed char PR9350_char_dec;
+ // DEFAULT: add i8 {{.*}}, -1
+ // WRAPV: add i8 {{.*}}, -1
+ // TRAPV: add i8 {{.*}}, -1
+ // CATCH_UB: add i8 {{.*}}, -1
+ --PR9350_char_dec;
+
+ // PR9350: short pre-increment never overflows.
+ extern volatile signed short PR9350_short_inc;
+ // DEFAULT: add i16 {{.*}}, 1
+ // WRAPV: add i16 {{.*}}, 1
+ // TRAPV: add i16 {{.*}}, 1
+ // CATCH_UB: add i16 {{.*}}, 1
+ ++PR9350_short_inc;
+
+ // PR9350: short pre-decrement never overflows.
+ extern volatile signed short PR9350_short_dec;
+ // DEFAULT: add i16 {{.*}}, -1
+ // WRAPV: add i16 {{.*}}, -1
+ // TRAPV: add i16 {{.*}}, -1
+ // CATCH_UB: add i16 {{.*}}, -1
+ --PR9350_short_dec;
// PR24256: don't instrument __builtin_frame_address.
__builtin_frame_address(0 + 0);
diff --git a/test/CodeGenCXX/cxx11-thread-local.cpp b/test/CodeGenCXX/cxx11-thread-local.cpp
index f465cbdeea847..3231a76ba9208 100644
--- a/test/CodeGenCXX/cxx11-thread-local.cpp
+++ b/test/CodeGenCXX/cxx11-thread-local.cpp
@@ -6,18 +6,18 @@
int f();
int g();
-// LINUX: @a = thread_local global i32 0
-// DARWIN: @a = internal thread_local global i32 0
+// LINUX-DAG: @a = thread_local global i32 0
+// DARWIN-DAG: @a = internal thread_local global i32 0
thread_local int a = f();
extern thread_local int b;
-// CHECK: @c = global i32 0
+// CHECK-DAG: @c = global i32 0
int c = b;
-// CHECK: @_ZL1d = internal thread_local global i32 0
+// CHECK-DAG: @_ZL1d = internal thread_local global i32 0
static thread_local int d = g();
struct U { static thread_local int m; };
-// LINUX: @_ZN1U1mE = thread_local global i32 0
-// DARWIN: @_ZN1U1mE = internal thread_local global i32 0
+// LINUX-DAG: @_ZN1U1mE = thread_local global i32 0
+// DARWIN-DAG: @_ZN1U1mE = internal thread_local global i32 0
thread_local int U::m = f();
namespace MismatchedInitType {
@@ -35,37 +35,64 @@ namespace MismatchedInitType {
template<typename T> struct V { static thread_local int m; };
template<typename T> thread_local int V<T>::m = g();
-// CHECK: @e = global i32 0
-int e = V<int>::m;
+template<typename T> struct W { static thread_local int m; };
+template<typename T> thread_local int W<T>::m = 123;
-// CHECK: @_ZN1VIiE1mE = linkonce_odr thread_local global i32 0
+struct Dtor { ~Dtor(); };
+template<typename T> struct X { static thread_local Dtor m; };
+template<typename T> thread_local Dtor X<T>::m;
-// CHECK: @_ZZ1fvE1n = internal thread_local global i32 0
+// CHECK-DAG: @e = global
+void *e = V<int>::m + W<int>::m + &X<int>::m;
-// CHECK: @_ZGVZ1fvE1n = internal thread_local global i8 0
+template thread_local int V<float>::m;
+template thread_local int W<float>::m;
+template thread_local Dtor X<float>::m;
-// CHECK: @_ZZ8tls_dtorvE1s = internal thread_local global
-// CHECK: @_ZGVZ8tls_dtorvE1s = internal thread_local global i8 0
+extern template thread_local int V<char>::m;
+extern template thread_local int W<char>::m;
+extern template thread_local Dtor X<char>::m;
-// CHECK: @_ZZ8tls_dtorvE1t = internal thread_local global
-// CHECK: @_ZGVZ8tls_dtorvE1t = internal thread_local global i8 0
+void *e2 = V<char>::m + W<char>::m + &X<char>::m;
-// CHECK: @_ZZ8tls_dtorvE1u = internal thread_local global
-// CHECK: @_ZGVZ8tls_dtorvE1u = internal thread_local global i8 0
-// CHECK: @_ZGRZ8tls_dtorvE1u_ = internal thread_local global
+// CHECK-DAG: @_ZN1VIiE1mE = linkonce_odr thread_local global i32 0
+// CHECK-DAG: @_ZN1WIiE1mE = linkonce_odr thread_local global i32 123
+// CHECK-DAG: @_ZN1XIiE1mE = linkonce_odr thread_local global {{.*}}
+// CHECK-DAG: @_ZN1VIfE1mE = weak_odr thread_local global i32 0
+// CHECK-DAG: @_ZN1WIfE1mE = weak_odr thread_local global i32 123
+// CHECK-DAG: @_ZN1XIfE1mE = weak_odr thread_local global {{.*}}
-// CHECK: @_ZGVN1VIiE1mE = linkonce_odr thread_local global i64 0
+// CHECK-DAG: @_ZZ1fvE1n = internal thread_local global i32 0
-// CHECK: @__tls_guard = internal thread_local global i8 0
+// CHECK-DAG: @_ZGVZ1fvE1n = internal thread_local global i8 0
-// CHECK: @llvm.global_ctors = appending global {{.*}} @[[GLOBAL_INIT:[^ ]*]]
+// CHECK-DAG: @_ZZ8tls_dtorvE1s = internal thread_local global
+// CHECK-DAG: @_ZGVZ8tls_dtorvE1s = internal thread_local global i8 0
-// LINUX: @_ZTH1a = alias void (), void ()* @__tls_init
-// DARWIN: @_ZTH1a = internal alias void (), void ()* @__tls_init
-// CHECK: @_ZTHL1d = internal alias void (), void ()* @__tls_init
-// LINUX: @_ZTHN1U1mE = alias void (), void ()* @__tls_init
-// DARWIN: @_ZTHN1U1mE = internal alias void (), void ()* @__tls_init
-// CHECK: @_ZTHN1VIiE1mE = linkonce_odr alias void (), void ()* @__tls_init
+// CHECK-DAG: @_ZZ8tls_dtorvE1t = internal thread_local global
+// CHECK-DAG: @_ZGVZ8tls_dtorvE1t = internal thread_local global i8 0
+
+// CHECK-DAG: @_ZZ8tls_dtorvE1u = internal thread_local global
+// CHECK-DAG: @_ZGVZ8tls_dtorvE1u = internal thread_local global i8 0
+// CHECK-DAG: @_ZGRZ8tls_dtorvE1u_ = internal thread_local global
+
+// CHECK-DAG: @_ZGVN1VIiE1mE = linkonce_odr thread_local global i64 0
+
+// CHECK-DAG: @__tls_guard = internal thread_local global i8 0
+
+// CHECK-DAG: @llvm.global_ctors = appending global {{.*}} @[[GLOBAL_INIT:[^ ]*]]
+
+// LINUX-DAG: @_ZTH1a = alias void (), void ()* @__tls_init
+// DARWIN-DAG: @_ZTH1a = internal alias void (), void ()* @__tls_init
+// CHECK-DAG: @_ZTHL1d = internal alias void (), void ()* @__tls_init
+// LINUX-DAG: @_ZTHN1U1mE = alias void (), void ()* @__tls_init
+// DARWIN-DAG: @_ZTHN1U1mE = internal alias void (), void ()* @__tls_init
+// CHECK-DAG: @_ZTHN1VIiE1mE = linkonce_odr alias void (), void ()* @[[V_M_INIT:[^, ]*]]
+// CHECK-NOT: @_ZTHN1WIiE1mE =
+// CHECK-DAG: @_ZTHN1XIiE1mE = linkonce_odr alias void (), void ()* @[[X_M_INIT:[^, ]*]]
+// CHECK-DAG: @_ZTHN1VIfE1mE = weak_odr alias void (), void ()* @[[VF_M_INIT:[^, ]*]]
+// CHECK-NOT: @_ZTHN1WIfE1mE =
+// CHECK-DAG: @_ZTHN1XIfE1mE = weak_odr alias void (), void ()* @[[XF_M_INIT:[^, ]*]]
// Individual variable initialization functions:
@@ -118,7 +145,9 @@ int f() {
// LINUX: call i32* @_ZTWN1VIiE1mE()
// DARWIN: call cxx_fast_tlscc i32* @_ZTWN1VIiE1mE()
// CHECK-NEXT: load i32, i32* %{{.*}}, align 4
-// CHECK-NEXT: store i32 %{{.*}}, i32* @e, align 4
+// LINUX: call {{.*}}* @_ZTWN1XIiE1mE()
+// DARWIN: call cxx_fast_tlscc {{.*}}* @_ZTWN1XIiE1mE()
+// CHECK: store {{.*}} @e
// LINUX-LABEL: define weak_odr hidden i32* @_ZTWN1VIiE1mE()
// DARWIN-LABEL: define weak_odr hidden cxx_fast_tlscc i32* @_ZTWN1VIiE1mE()
@@ -126,6 +155,64 @@ int f() {
// DARWIN: call cxx_fast_tlscc void @_ZTHN1VIiE1mE()
// CHECK: ret i32* @_ZN1VIiE1mE
+// LINUX-LABEL: define weak_odr hidden i32* @_ZTWN1WIiE1mE()
+// DARWIN-LABEL: define weak_odr hidden cxx_fast_tlscc i32* @_ZTWN1WIiE1mE()
+// CHECK-NOT: call
+// CHECK: ret i32* @_ZN1WIiE1mE
+
+// LINUX-LABEL: define weak_odr hidden {{.*}}* @_ZTWN1XIiE1mE()
+// DARWIN-LABEL: define weak_odr hidden cxx_fast_tlscc {{.*}}* @_ZTWN1XIiE1mE()
+// LINUX: call void @_ZTHN1XIiE1mE()
+// DARWIN: call cxx_fast_tlscc void @_ZTHN1XIiE1mE()
+// CHECK: ret {{.*}}* @_ZN1XIiE1mE
+
+// CHECK: define internal {{.*}} @[[VF_M_INIT]]()
+// LINUX-SAME: comdat($_ZN1VIfE1mE)
+// DARWIN-NOT: comdat
+// CHECK: load i8, i8* bitcast (i64* @_ZGVN1VIfE1mE to i8*)
+// CHECK: %[[VF_M_INITIALIZED:.*]] = icmp eq i8 %{{.*}}, 0
+// CHECK: br i1 %[[VF_M_INITIALIZED]],
+// need init:
+// CHECK: call i32 @_Z1gv()
+// CHECK: store i32 %{{.*}}, i32* @_ZN1VIfE1mE, align 4
+// CHECK: store i64 1, i64* @_ZGVN1VIfE1mE
+// CHECK: br label
+
+// CHECK: define internal {{.*}} @[[XF_M_INIT]]()
+// LINUX-SAME: comdat($_ZN1XIfE1mE)
+// DARWIN-NOT: comdat
+// CHECK: load i8, i8* bitcast (i64* @_ZGVN1XIfE1mE to i8*)
+// CHECK: %[[XF_M_INITIALIZED:.*]] = icmp eq i8 %{{.*}}, 0
+// CHECK: br i1 %[[XF_M_INITIALIZED]],
+// need init:
+// LINUX: call {{.*}}__cxa_thread_atexit
+// DARWIN: call {{.*}}_tlv_atexit
+// CHECK: store i64 1, i64* @_ZGVN1XIfE1mE
+// CHECK: br label
+
+// LINUX: declare i32 @__cxa_thread_atexit(void (i8*)*, i8*, i8*)
+// DARWIN: declare i32 @_tlv_atexit(void (i8*)*, i8*, i8*)
+
+// DARWIN: declare cxx_fast_tlscc i32* @_ZTWN1VIcE1mE()
+// LINUX: define weak_odr hidden i32* @_ZTWN1VIcE1mE()
+// LINUX-NOT: comdat
+// LINUX: br i1 icmp ne (void ()* @_ZTHN1VIcE1mE,
+// LINUX: call void @_ZTHN1VIcE1mE()
+// LINUX: ret i32* @_ZN1VIcE1mE
+
+// DARWIN: declare cxx_fast_tlscc i32* @_ZTWN1WIcE1mE()
+// LINUX: define weak_odr hidden i32* @_ZTWN1WIcE1mE()
+// LINUX-NOT: comdat
+// LINUX: br i1 icmp ne (void ()* @_ZTHN1WIcE1mE,
+// LINUX: call void @_ZTHN1WIcE1mE()
+// LINUX: ret i32* @_ZN1WIcE1mE
+
+// DARWIN: declare cxx_fast_tlscc {{.*}}* @_ZTWN1XIcE1mE()
+// LINUX: define weak_odr hidden {{.*}}* @_ZTWN1XIcE1mE()
+// LINUX-NOT: comdat
+// LINUX: br i1 icmp ne (void ()* @_ZTHN1XIcE1mE,
+// LINUX: call void @_ZTHN1XIcE1mE()
+// LINUX: ret {{.*}}* @_ZN1XIcE1mE
struct S { S(); ~S(); };
struct T { ~T(); };
@@ -154,9 +241,6 @@ void tls_dtor() {
static thread_local const S &u = S();
}
-// LINUX: declare i32 @__cxa_thread_atexit(void (i8*)*, i8*, i8*)
-// DARWIN: declare i32 @_tlv_atexit(void (i8*)*, i8*, i8*)
-
// CHECK: define {{.*}} @_Z7PR15991v(
int PR15991() {
thread_local int n;
@@ -184,7 +268,9 @@ void set_anon_i() {
// LINUX-LABEL: define internal i32* @_ZTWN12_GLOBAL__N_16anon_iE()
// DARWIN-LABEL: define internal cxx_fast_tlscc i32* @_ZTWN12_GLOBAL__N_16anon_iE()
-// CHECK: define {{.*}} @[[V_M_INIT:.*]]()
+// CHECK: define internal {{.*}} @[[V_M_INIT]]()
+// LINUX-SAME: comdat($_ZN1VIiE1mE)
+// DARWIN-NOT: comdat
// CHECK: load i8, i8* bitcast (i64* @_ZGVN1VIiE1mE to i8*)
// CHECK: %[[V_M_INITIALIZED:.*]] = icmp eq i8 %{{.*}}, 0
// CHECK: br i1 %[[V_M_INITIALIZED]],
@@ -194,6 +280,18 @@ void set_anon_i() {
// CHECK: store i64 1, i64* @_ZGVN1VIiE1mE
// CHECK: br label
+// CHECK: define internal {{.*}} @[[X_M_INIT]]()
+// LINUX-SAME: comdat($_ZN1XIiE1mE)
+// DARWIN-NOT: comdat
+// CHECK: load i8, i8* bitcast (i64* @_ZGVN1XIiE1mE to i8*)
+// CHECK: %[[X_M_INITIALIZED:.*]] = icmp eq i8 %{{.*}}, 0
+// CHECK: br i1 %[[X_M_INITIALIZED]],
+// need init:
+// LINUX: call {{.*}}__cxa_thread_atexit
+// DARWIN: call {{.*}}_tlv_atexit
+// CHECK: store i64 1, i64* @_ZGVN1XIiE1mE
+// CHECK: br label
+
// CHECK: define {{.*}}@[[GLOBAL_INIT:.*]]()
// CHECK: call void @[[C_INIT]]()
// CHECK: call void @[[E_INIT]]()
@@ -205,10 +303,13 @@ void set_anon_i() {
// CHECK: br i1 %[[NEED_TLS_INIT]],
// init:
// CHECK: store i8 1, i8* @__tls_guard
+// CHECK-NOT: call void @[[V_M_INIT]]()
// CHECK: call void @[[A_INIT]]()
+// CHECK-NOT: call void @[[V_M_INIT]]()
// CHECK: call void @[[D_INIT]]()
+// CHECK-NOT: call void @[[V_M_INIT]]()
// CHECK: call void @[[U_M_INIT]]()
-// CHECK: call void @[[V_M_INIT]]()
+// CHECK-NOT: call void @[[V_M_INIT]]()
// LIUNX: define weak_odr hidden i32* @_ZTW1a() {
diff --git a/test/CodeGenCXX/dllexport.cpp b/test/CodeGenCXX/dllexport.cpp
index fe40bc0aac129..33e524cc9b012 100644
--- a/test/CodeGenCXX/dllexport.cpp
+++ b/test/CodeGenCXX/dllexport.cpp
@@ -732,13 +732,27 @@ USEMEMFUNC(ExplicitInstantiationDeclExportedDefTemplate<int>, f);
// M32-DAG: define weak_odr dllexport x86_thiscallcc %struct.ExplicitInstantiationDeclExportedDefTemplate* @"\01??0?$ExplicitInstantiationDeclExportedDefTemplate@H@@QAE@XZ"
// G32-DAG: define weak_odr x86_thiscallcc void @_ZN44ExplicitInstantiationDeclExportedDefTemplateIiE1fEv
-template <typename T> struct ImplicitInstantiationExplicitInstantiationDefExportedTemplate { void f() {} };
+template <typename T> struct ImplicitInstantiationExportedExplicitInstantiationDefTemplate { virtual void f() {} };
+ImplicitInstantiationExportedExplicitInstantiationDefTemplate<int> ImplicitInstantiationExportedExplicitInstantiationDefTemplateInstance;
+template struct __declspec(dllexport) ImplicitInstantiationExportedExplicitInstantiationDefTemplate<int>;
+USEMEMFUNC(ImplicitInstantiationExportedExplicitInstantiationDefTemplate<int>, f);
+// M32-DAG: define weak_odr dllexport x86_thiscallcc void @"\01?f@?$ImplicitInstantiationExportedExplicitInstantiationDefTemplate@H@@UAEXXZ"
+// G32-DAG: define weak_odr x86_thiscallcc void @_ZN61ImplicitInstantiationExportedExplicitInstantiationDefTemplateIiE1fEv
+
+template <typename T> struct __declspec(dllexport) ImplicitInstantiationExplicitInstantiationDefExportedTemplate { virtual void f() {} };
ImplicitInstantiationExplicitInstantiationDefExportedTemplate<int> ImplicitInstantiationExplicitInstantiationDefExportedTemplateInstance;
-template class __declspec(dllexport) ImplicitInstantiationExplicitInstantiationDefExportedTemplate<int>;
+template struct ImplicitInstantiationExplicitInstantiationDefExportedTemplate<int>;
USEMEMFUNC(ImplicitInstantiationExplicitInstantiationDefExportedTemplate<int>, f);
-// M32-DAG: define weak_odr dllexport x86_thiscallcc void @"\01?f@?$ImplicitInstantiationExplicitInstantiationDefExportedTemplate@H@@QAEXXZ"
+// M32-DAG: define weak_odr dllexport x86_thiscallcc void @"\01?f@?$ImplicitInstantiationExplicitInstantiationDefExportedTemplate@H@@UAEXXZ"
// G32-DAG: define weak_odr x86_thiscallcc void @_ZN61ImplicitInstantiationExplicitInstantiationDefExportedTemplateIiE1fEv
+template <typename T> struct __declspec(dllexport) ImplicitInstantiationExportedExplicitInstantiationDefExportedTemplate { virtual void f() {} };
+ImplicitInstantiationExportedExplicitInstantiationDefExportedTemplate<int> ImplicitInstantiationExportedExplicitInstantiationDefExportedTemplateInstance;
+template struct __declspec(dllexport) ImplicitInstantiationExportedExplicitInstantiationDefExportedTemplate<int>;
+USEMEMFUNC(ImplicitInstantiationExportedExplicitInstantiationDefExportedTemplate<int>, f);
+// M32-DAG: define weak_odr dllexport x86_thiscallcc void @"\01?f@?$ImplicitInstantiationExportedExplicitInstantiationDefExportedTemplate@H@@UAEXXZ"
+// G32-DAG: define weak_odr x86_thiscallcc void @_ZN69ImplicitInstantiationExportedExplicitInstantiationDefExportedTemplateIiE1fEv
+
namespace { struct InternalLinkageType {}; }
struct __declspec(dllexport) PR23308 {
void f(InternalLinkageType*);
diff --git a/test/CodeGenCXX/funcsig.cpp b/test/CodeGenCXX/funcsig.cpp
index 2a6e641aec9c5..16e5f7e1c9b14 100644
--- a/test/CodeGenCXX/funcsig.cpp
+++ b/test/CodeGenCXX/funcsig.cpp
@@ -1,22 +1,43 @@
-// RUN: %clang_cc1 -std=c++11 -triple i686-pc-win32 %s -fms-extensions -fno-rtti -emit-llvm -o - | FileCheck %s
+// RUN: %clang_cc1 -std=c++11 -triple i686-pc-win32 %s -fms-extensions -fno-rtti -emit-llvm -o - | FileCheck %s --check-prefix=CHECK --check-prefix=CHECK-CXX
+// RUN: %clang_cc1 -x c -triple i686-pc-win32 %s -fms-extensions -fno-rtti -emit-llvm -o - | FileCheck %s --check-prefix=CHECK --check-prefix=CHECK-C
// Similar to predefined-expr.cpp, but not as exhaustive, since it's basically
// equivalent to __PRETTY_FUNCTION__.
-extern "C" int printf(const char *, ...);
+#ifdef __cplusplus
+extern "C"
+#endif
+int printf(const char *, ...);
-void freeFunc(int *, char) {
+void funcNoProto() {
+ printf("__FUNCSIG__ %s\n\n", __FUNCSIG__);
+}
+// CHECK-C: @"\01??_C@_0BL@IHLLLCAO@void?5__cdecl?5funcNoProto?$CI?$CJ?$AA@" = linkonce_odr unnamed_addr constant [27 x i8] c"void __cdecl funcNoProto()\00"
+// CHECK-CXX: @"\01??_C@_0BP@PJOECCJN@void?5__cdecl?5funcNoProto?$CIvoid?$CJ?$AA@" = linkonce_odr unnamed_addr constant [31 x i8] c"void __cdecl funcNoProto(void)\00"
+
+void funcNoParams(void) {
+ printf("__FUNCSIG__ %s\n\n", __FUNCSIG__);
+}
+// CHECK: @"\01??_C@_0CA@GBIDFNBN@void?5__cdecl?5funcNoParams?$CIvoid?$CJ?$AA@" = linkonce_odr unnamed_addr constant [32 x i8] c"void __cdecl funcNoParams(void)\00"
+
+void freeFunc(int *p, char c) {
printf("__FUNCSIG__ %s\n\n", __FUNCSIG__);
}
// CHECK: @"\01??_C@_0CD@KLGMNNL@void?5__cdecl?5freeFunc?$CIint?5?$CK?0?5cha@" = linkonce_odr unnamed_addr constant [{{.*}} x i8] c"void __cdecl freeFunc(int *, char)\00"
+#ifdef __cplusplus
+void funcVarargs(...) {
+ printf("__FUNCSIG__ %s\n\n", __FUNCSIG__);
+}
+// CHECK-CXX: @"\01??_C@_0BO@BOBPLEKP@void?5__cdecl?5funcVarargs?$CI?4?4?4?$CJ?$AA@" = linkonce_odr unnamed_addr constant [30 x i8] c"void __cdecl funcVarargs(...)\00"
+
struct TopLevelClass {
void topLevelMethod(int *, char);
};
void TopLevelClass::topLevelMethod(int *, char) {
printf("__FUNCSIG__ %s\n\n", __FUNCSIG__);
}
-// CHECK: @"\01??_C@_0DL@OBHNMDP@void?5__thiscall?5TopLevelClass?3?3t@" = linkonce_odr unnamed_addr constant [{{.*}} x i8] c"void __thiscall TopLevelClass::topLevelMethod(int *, char)\00"
+// CHECK-CXX: @"\01??_C@_0DL@OBHNMDP@void?5__thiscall?5TopLevelClass?3?3t@" = linkonce_odr unnamed_addr constant [{{.*}} x i8] c"void __thiscall TopLevelClass::topLevelMethod(int *, char)\00"
namespace NS {
struct NamespacedClass {
@@ -25,5 +46,6 @@ struct NamespacedClass {
void NamespacedClass::namespacedMethod(int *, char) {
printf("__FUNCSIG__ %s\n\n", __FUNCSIG__);
}
-// CHECK: @"\01??_C@_0ED@PFDKIEBA@void?5__thiscall?5NS?3?3NamespacedCl@" = linkonce_odr unnamed_addr constant [{{.*}} x i8] c"void __thiscall NS::NamespacedClass::namespacedMethod(int *, char)\00"
+// CHECK-CXX: @"\01??_C@_0ED@PFDKIEBA@void?5__thiscall?5NS?3?3NamespacedCl@" = linkonce_odr unnamed_addr constant [{{.*}} x i8] c"void __thiscall NS::NamespacedClass::namespacedMethod(int *, char)\00"
}
+#endif
diff --git a/test/CodeGenCXX/global-array-destruction.cpp b/test/CodeGenCXX/global-array-destruction.cpp
index cb3524b3f0f09..1ae7b72838bd5 100644
--- a/test/CodeGenCXX/global-array-destruction.cpp
+++ b/test/CodeGenCXX/global-array-destruction.cpp
@@ -39,7 +39,7 @@ struct T {
T t[2][3] = { 1.0, 2, 3.0, 4, 5.0, 6, 7.0, 8, 9.0, 10, 11.0, 12 };
// CHECK: call {{.*}} @__cxa_atexit
-// CHECK: getelementptr inbounds ({{.*}} bitcast {{.*}}* @t to %struct.T*), i64 6
+// CHECK: getelementptr inbounds ({{.*}} getelementptr inbounds ([2 x [3 x {{.*}}]], [2 x [3 x {{.*}}]]* @t, i32 0, i32 0, i32 0), i64 6)
// CHECK: call void @_ZN1TD1Ev
// CHECK: icmp eq {{.*}} @t
// CHECK: br i1 {{.*}}
@@ -47,9 +47,9 @@ T t[2][3] = { 1.0, 2, 3.0, 4, 5.0, 6, 7.0, 8, 9.0, 10, 11.0, 12 };
static T t2[2][3] = { 1.0, 2, 3.0, 4, 5.0, 6, 7.0, 8, 9.0, 10, 11.0, 12 };
// CHECK: call {{.*}} @__cxa_atexit
-// CHECK: getelementptr inbounds ({{.*}} bitcast {{.*}}* @_ZL2t2 to %struct.T*), i64 6
+// CHECK: getelementptr inbounds ({{.*}} getelementptr inbounds ([2 x [3 x {{.*}}]], [2 x [3 x {{.*}}]]* @_ZL2t2, i32 0, i32 0, i32 0), i64 6)
// CHECK: call void @_ZN1TD1Ev
-// CHECK: icmp eq {{.*}} @_ZL2t
+// CHECK: icmp eq {{.*}} @_ZL2t2
// CHECK: br i1 {{.*}}
using U = T[2][3];
diff --git a/test/CodeGenCXX/pr31054.cpp b/test/CodeGenCXX/pr31054.cpp
new file mode 100644
index 0000000000000..33b17b9eafc89
--- /dev/null
+++ b/test/CodeGenCXX/pr31054.cpp
@@ -0,0 +1,12 @@
+// RUN: %clang_cc1 -triple x86_64-unknown-unknown -emit-llvm -o - %s | FileCheck %s
+
+struct A { ~A(); };
+void func() {
+ return;
+ static A k;
+}
+
+// Test that we did not crash, by checking whether function was created.
+// CHECK-LABEL: define void @_Z4funcv() #0 {
+// CHECK: ret void
+// CHECK: }
diff --git a/test/Driver/Inputs/opensuse_42.2_aarch64_tree/usr/lib64/crt1.o b/test/Driver/Inputs/opensuse_42.2_aarch64_tree/usr/lib64/crt1.o
new file mode 100644
index 0000000000000..e69de29bb2d1d
--- /dev/null
+++ b/test/Driver/Inputs/opensuse_42.2_aarch64_tree/usr/lib64/crt1.o
diff --git a/test/Driver/Inputs/opensuse_42.2_aarch64_tree/usr/lib64/crti.o b/test/Driver/Inputs/opensuse_42.2_aarch64_tree/usr/lib64/crti.o
new file mode 100644
index 0000000000000..e69de29bb2d1d
--- /dev/null
+++ b/test/Driver/Inputs/opensuse_42.2_aarch64_tree/usr/lib64/crti.o
diff --git a/test/Driver/Inputs/opensuse_42.2_aarch64_tree/usr/lib64/crtn.o b/test/Driver/Inputs/opensuse_42.2_aarch64_tree/usr/lib64/crtn.o
new file mode 100644
index 0000000000000..e69de29bb2d1d
--- /dev/null
+++ b/test/Driver/Inputs/opensuse_42.2_aarch64_tree/usr/lib64/crtn.o
diff --git a/test/Driver/Inputs/opensuse_42.2_aarch64_tree/usr/lib64/gcc/aarch64-suse-linux/4.8/crtbegin.o b/test/Driver/Inputs/opensuse_42.2_aarch64_tree/usr/lib64/gcc/aarch64-suse-linux/4.8/crtbegin.o
new file mode 100644
index 0000000000000..e69de29bb2d1d
--- /dev/null
+++ b/test/Driver/Inputs/opensuse_42.2_aarch64_tree/usr/lib64/gcc/aarch64-suse-linux/4.8/crtbegin.o
diff --git a/test/Driver/Inputs/opensuse_42.2_aarch64_tree/usr/lib64/gcc/aarch64-suse-linux/4.8/crtend.o b/test/Driver/Inputs/opensuse_42.2_aarch64_tree/usr/lib64/gcc/aarch64-suse-linux/4.8/crtend.o
new file mode 100644
index 0000000000000..e69de29bb2d1d
--- /dev/null
+++ b/test/Driver/Inputs/opensuse_42.2_aarch64_tree/usr/lib64/gcc/aarch64-suse-linux/4.8/crtend.o
diff --git a/test/Driver/cl-options.c b/test/Driver/cl-options.c
index 25c9cd089e88f..69238227c542f 100644
--- a/test/Driver/cl-options.c
+++ b/test/Driver/cl-options.c
@@ -535,7 +535,7 @@
// RUN: -fno-ms-compatibility \
// RUN: -fms-extensions \
// RUN: -fno-ms-extensions \
-// RUN: -mllvm -disable-llvm-passes \
+// RUN: -Xclang -disable-llvm-passes \
// RUN: -resource-dir asdf \
// RUN: -resource-dir=asdf \
// RUN: -Wunused-variable \
diff --git a/test/Driver/disable-llvm.c b/test/Driver/disable-llvm.c
new file mode 100644
index 0000000000000..3ac6b9e919376
--- /dev/null
+++ b/test/Driver/disable-llvm.c
@@ -0,0 +1,22 @@
+// We support a CC1 option for disabling LLVM's passes.
+// RUN: %clang -O2 -Xclang -disable-llvm-passes -### %s 2>&1 \
+// RUN: | FileCheck --check-prefix=DISABLED %s
+// DISABLED: -cc1
+// DISABLED-NOT: "-mllvm" "-disable-llvm-passes"
+// DISABLED: "-disable-llvm-passes"
+//
+// We also support two alternative spellings for historical reasons.
+// RUN: %clang -O2 -Xclang -disable-llvm-optzns -### %s 2>&1 \
+// RUN: | FileCheck --check-prefix=DISABLED-LEGACY %s
+// RUN: %clang -O2 -mllvm -disable-llvm-optzns -### %s 2>&1 \
+// RUN: | FileCheck --check-prefix=DISABLED-LEGACY %s
+// DISABLED-LEGACY: -cc1
+// DISABLED-LEGACY-NOT: "-mllvm" "-disable-llvm-optzns"
+// DISABLED-LEGACY: "-disable-llvm-optzns"
+//
+// The main flag shouldn't be specially handled when used with '-mllvm'.
+// RUN: %clang -O2 -mllvm -disable-llvm-passes -### %s 2>&1 | FileCheck --check-prefix=MLLVM %s
+// MLLVM: -cc1
+// MLLVM-NOT: -disable-llvm-passes
+// MLLVM: "-mllvm" "-disable-llvm-passes"
+// MLLVM-NOT: -disable-llvm-passes
diff --git a/test/Driver/linux-ld.c b/test/Driver/linux-ld.c
index 8fa71a507bf9d..5d1001beb02c7 100644
--- a/test/Driver/linux-ld.c
+++ b/test/Driver/linux-ld.c
@@ -618,6 +618,26 @@
// CHECK-SUSE-10-3-PPC64: "-L[[SYSROOT]]/lib/../lib64"
// CHECK-SUSE-10-3-PPC64: "-L[[SYSROOT]]/usr/lib/../lib64"
//
+// Check openSuse Leap 42.2 on AArch64
+// RUN: %clang -no-canonical-prefixes %s -### -o %t.o 2>&1 \
+// RUN: --target=arm64-unknown-linux-gnu \
+// RUN: --gcc-toolchain="" \
+// RUN: --sysroot=%S/Inputs/opensuse_42.2_aarch64_tree \
+// RUN: | FileCheck --check-prefix=CHECK-OPENSUSE-42-2-AARCH64 %s
+// RUN: %clang -no-canonical-prefixes %s -### -o %t.o 2>&1 \
+// RUN: --target=aarch64-unknown-linux-gnu \
+// RUN: --gcc-toolchain="" \
+// RUN: --sysroot=%S/Inputs/opensuse_42.2_aarch64_tree \
+// RUN: | FileCheck --check-prefix=CHECK-OPENSUSE-42-2-AARCH64 %s
+// CHECK-OPENSUSE-42-2-AARCH64: "{{.*}}ld{{(.exe)?}}" "--sysroot=[[SYSROOT:[^"]+]]"
+// CHECK-OPENSUSE-42-2-AARCH64: "{{.*}}/usr/lib64/gcc/aarch64-suse-linux/4.8/../../../../lib64{{/|\\\\}}crt1.o"
+// CHECK-OPENSUSE-42-2-AARCH64: "{{.*}}/usr/lib64/gcc/aarch64-suse-linux/4.8/../../../../lib64{{/|\\\\}}crti.o"
+// CHECK-OPENSUSE-42-2-AARCH64: "{{.*}}/usr/lib64/gcc/aarch64-suse-linux/4.8{{/|\\\\}}crtbegin.o"
+// CHECK-OPENSUSE-42-2-AARCH64: "-L[[SYSROOT]]/usr/lib64/gcc/aarch64-suse-linux/4.8"
+// CHECK-OPENSUSE-42-2-AARCH64: "-L[[SYSROOT]]/usr/lib64/gcc/aarch64-suse-linux/4.8/../../../../lib64"
+// CHECK-OPENSUSE-42-2-AARCH64: "{{.*}}/usr/lib64/gcc/aarch64-suse-linux/4.8{{/|\\\\}}crtend.o"
+// CHECK-OPENSUSE-42-2-AARCH64: "{{.*}}/usr/lib64/gcc/aarch64-suse-linux/4.8/../../../../lib64{{/|\\\\}}crtn.o"
+//
// Check dynamic-linker for different archs
// RUN: %clang %s -### -o %t.o 2>&1 \
// RUN: --target=arm-linux-gnueabi \
diff --git a/test/Driver/x86-march.c b/test/Driver/x86-march.c
index fd6e30b015930..b12bf405b0b0d 100644
--- a/test/Driver/x86-march.c
+++ b/test/Driver/x86-march.c
@@ -36,6 +36,30 @@
// RUN: | FileCheck %s -check-prefix=broadwell
// broadwell: "-target-cpu" "broadwell"
//
+// RUN: %clang -target x86_64-unknown-unknown -c -### %s -march=skylake 2>&1 \
+// RUN: | FileCheck %s -check-prefix=skylake
+// skylake: "-target-cpu" "skylake"
+//
+// RUN: %clang -target x86_64-unknown-unknown -c -### %s -march=skylake-avx512 2>&1 \
+// RUN: | FileCheck %s -check-prefix=skylake-avx512
+// skylake-avx512: "-target-cpu" "skylake-avx512"
+//
+// RUN: %clang -target x86_64-unknown-unknown -c -### %s -march=skx 2>&1 \
+// RUN: | FileCheck %s -check-prefix=skx
+// skx: "-target-cpu" "skx"
+//
+// RUN: %clang -target x86_64-unknown-unknown -c -### %s -march=knl 2>&1 \
+// RUN: | FileCheck %s -check-prefix=knl
+// knl: "-target-cpu" "knl"
+//
+// RUN: %clang -target x86_64-unknown-unknown -c -### %s -march=cannonlake 2>&1 \
+// RUN: | FileCheck %s -check-prefix=cannonlake
+// cannonlake: "-target-cpu" "cannonlake"
+//
+// RUN: %clang -target x86_64-unknown-unknown -c -### %s -march=lakemont 2>&1 \
+// RUN: | FileCheck %s -check-prefix=lakemont
+// lakemont: "-target-cpu" "lakemont"
+//
// RUN: %clang -target x86_64-unknown-unknown -c -### %s -march=bonnell 2>&1 \
// RUN: | FileCheck %s -check-prefix=bonnell
// bonnell: "-target-cpu" "bonnell"
@@ -103,3 +127,7 @@
// RUN: %clang -target x86_64-unknown-unknown -c -### %s -march=btver2 2>&1 \
// RUN: | FileCheck %s -check-prefix=btver2
// btver2: "-target-cpu" "btver2"
+//
+// RUN: %clang -target x86_64-unknown-unknown -c -### %s -march=znver1 2>&1 \
+// RUN: | FileCheck %s -check-prefix=znver1
+// znver1: "-target-cpu" "znver1"
diff --git a/test/Frontend/x86-target-cpu.c b/test/Frontend/x86-target-cpu.c
index 769c40a016e32..4e0db5568a933 100644
--- a/test/Frontend/x86-target-cpu.c
+++ b/test/Frontend/x86-target-cpu.c
@@ -9,6 +9,11 @@
// RUN: %clang_cc1 -triple x86_64-unknown-unknown -target-cpu ivybridge -verify %s
// RUN: %clang_cc1 -triple x86_64-unknown-unknown -target-cpu haswell -verify %s
// RUN: %clang_cc1 -triple x86_64-unknown-unknown -target-cpu broadwell -verify %s
+// RUN: %clang_cc1 -triple x86_64-unknown-unknown -target-cpu skylake -verify %s
+// RUN: %clang_cc1 -triple x86_64-unknown-unknown -target-cpu skylake-avx512 -verify %s
+// RUN: %clang_cc1 -triple x86_64-unknown-unknown -target-cpu skx -verify %s
+// RUN: %clang_cc1 -triple x86_64-unknown-unknown -target-cpu cannonlake -verify %s
+// RUN: %clang_cc1 -triple x86_64-unknown-unknown -target-cpu knl -verify %s
// RUN: %clang_cc1 -triple x86_64-unknown-unknown -target-cpu bonnell -verify %s
// RUN: %clang_cc1 -triple x86_64-unknown-unknown -target-cpu silvermont -verify %s
// RUN: %clang_cc1 -triple x86_64-unknown-unknown -target-cpu k8 -verify %s
@@ -26,5 +31,6 @@
// RUN: %clang_cc1 -triple x86_64-unknown-unknown -target-cpu bdver4 -verify %s
// RUN: %clang_cc1 -triple x86_64-unknown-unknown -target-cpu btver1 -verify %s
// RUN: %clang_cc1 -triple x86_64-unknown-unknown -target-cpu btver2 -verify %s
+// RUN: %clang_cc1 -triple x86_64-unknown-unknown -target-cpu znver1 -verify %s
//
// expected-no-diagnostics
diff --git a/test/Index/Core/designated-inits.c b/test/Index/Core/designated-inits.c
index 24bb9a9acdf0c..a31cb95a4b82d 100644
--- a/test/Index/Core/designated-inits.c
+++ b/test/Index/Core/designated-inits.c
@@ -5,7 +5,7 @@ struct MyStruct {
};
enum {
- MyValToSet;
+ MyValToSet
};
// CHECK: [[@LINE+1]]:14 | struct/C | MyStruct |
@@ -20,7 +20,7 @@ const struct MyStruct _MyStruct[]
[0] = {
[0][0] = {
[0] = {
- // CHECK: [[@LINE+2]]:14 | field/C | myfield | {{.*}} | Ref |
+ // CHECK: [[@LINE+2]]:14 | field/C | myfield | {{.*}} | Ref,RelCont |
// CHECK: [[@LINE+1]]:24 | enumerator/C | MyValToSet |
.myfield = MyValToSet,
// CHECK-NOT: | field/C | myfield |
diff --git a/test/Index/Core/index-source.cpp b/test/Index/Core/index-source.cpp
index 0e898d8c83ab6..68eafecf6795f 100644
--- a/test/Index/Core/index-source.cpp
+++ b/test/Index/Core/index-source.cpp
@@ -21,7 +21,7 @@ public:
};
TemplCls<int> gtv(0);
-// CHECK: [[@LINE-1]]:1 | class(Gen)/C++ | TemplCls | c:@ST>1#T@TemplCls | <no-cgname> | Ref | rel: 0
+// CHECK: [[@LINE-1]]:1 | class(Gen)/C++ | TemplCls | c:@ST>1#T@TemplCls | <no-cgname> | Ref,RelCont | rel: 1
template <typename T>
class BT {
@@ -38,7 +38,7 @@ class BT {
// CHECK: [[@LINE+1]]:23 | type-alias/C | size_t |
typedef unsigned long size_t;
// CHECK: [[@LINE+2]]:7 | function/C | operator new | c:@F@operator new#l# | __Znwm |
-// CHECK: [[@LINE+1]]:20 | type-alias/C | size_t | {{.*}} | Ref |
+// CHECK: [[@LINE+1]]:20 | type-alias/C | size_t | {{.*}} | Ref,RelCont |
void* operator new(size_t sz);
// CHECK: [[@LINE+1]]:37 | variable(Gen)/C++ | tmplVar | c:index-source.cpp@VT>1#T@tmplVar | __ZL7tmplVar | Def | rel: 0
@@ -46,8 +46,8 @@ template<typename T> static const T tmplVar = T(0);
// CHECK: [[@LINE+1]]:29 | variable(Gen,TS)/C++ | tmplVar | c:index-source.cpp@tmplVar>#I | __ZL7tmplVarIiE | Def | rel: 0
template<> static const int tmplVar<int> = 0;
// CHECK: [[@LINE+2]]:5 | variable/C | gvi | c:@gvi | _gvi | Def | rel: 0
-// CHECK: [[@LINE+1]]:11 | variable(Gen,TS)/C++ | tmplVar | c:index-source.cpp@tmplVar>#I | __ZL7tmplVarIiE | Ref,Read | rel: 0
+// CHECK: [[@LINE+1]]:11 | variable(Gen,TS)/C++ | tmplVar | c:index-source.cpp@tmplVar>#I | __ZL7tmplVarIiE | Ref,Read,RelCont | rel: 1
int gvi = tmplVar<int>;
// CHECK: [[@LINE+2]]:5 | variable/C | gvf | c:@gvf | _gvf | Def | rel: 0
-// CHECK: [[@LINE+1]]:11 | variable(Gen)/C++ | tmplVar | c:index-source.cpp@VT>1#T@tmplVar | __ZL7tmplVar | Ref,Read | rel: 0
+// CHECK: [[@LINE+1]]:11 | variable(Gen)/C++ | tmplVar | c:index-source.cpp@VT>1#T@tmplVar | __ZL7tmplVar | Ref,Read,RelCont | rel: 1
int gvf = tmplVar<float>;
diff --git a/test/Index/Core/index-source.m b/test/Index/Core/index-source.m
index fc1b6232cfe85..3debcd262b248 100644
--- a/test/Index/Core/index-source.m
+++ b/test/Index/Core/index-source.m
@@ -5,18 +5,35 @@
-(void)meth;
// CHECK: [[@LINE-1]]:1 | instance-method/ObjC | meth | c:objc(cs)Base(im)meth | -[Base meth] | Decl,Dyn,RelChild | rel: 1
// CHECK-NEXT: RelChild | Base | c:objc(cs)Base
++(Base*)class_meth;
+// CHECK: [[@LINE-1]]:1 | class-method/ObjC | class_meth | c:objc(cs)Base(cm)class_meth | +[Base class_meth] | Decl,Dyn,RelChild | rel: 1
+// CHECK: [[@LINE-2]]:3 | class/ObjC | Base | c:objc(cs)Base | _OBJC_CLASS_$_Base | Ref,RelCont | rel: 1
+// CHECK-NEXT: RelCont | class_meth | c:objc(cs)Base(cm)class_meth
+
@end
void foo();
-// CHECK: [[@LINE+1]]:6 | function/C | goo | c:@F@goo | _goo | Def | rel: 0
+// CHECK: [[@LINE+3]]:6 | function/C | goo | c:@F@goo | _goo | Def | rel: 0
+// CHECK: [[@LINE+2]]:10 | class/ObjC | Base | c:objc(cs)Base | _OBJC_CLASS_$_Base | Ref,RelCont | rel: 1
+// CHECK-NEXT: RelCont | goo | c:@F@goo
void goo(Base *b) {
- // CHECK: [[@LINE+2]]:3 | function/C | foo | c:@F@foo | _foo | Ref,Call,RelCall | rel: 1
- // CHECK-NEXT: RelCall | goo | c:@F@goo
+ // CHECK: [[@LINE+2]]:3 | function/C | foo | c:@F@foo | _foo | Ref,Call,RelCall,RelCont | rel: 1
+ // CHECK-NEXT: RelCall,RelCont | goo | c:@F@goo
foo();
- // CHECK: [[@LINE+3]]:6 | instance-method/ObjC | meth | c:objc(cs)Base(im)meth | -[Base meth] | Ref,Call,Dyn,RelRec,RelCall | rel: 2
- // CHECK-NEXT: RelCall | goo | c:@F@goo
+ // CHECK: [[@LINE+3]]:6 | instance-method/ObjC | meth | c:objc(cs)Base(im)meth | -[Base meth] | Ref,Call,Dyn,RelRec,RelCall,RelCont | rel: 2
+ // CHECK-NEXT: RelCall,RelCont | goo | c:@F@goo
// CHECK-NEXT: RelRec | Base | c:objc(cs)Base
[b meth];
+
+ // CHECK: [[@LINE+2]]:4 | class/ObjC | Base | c:objc(cs)Base | _OBJC_CLASS_$_Base | Ref,RelCont | rel: 1
+ // CHECK-NEXT: RelCont | goo | c:@F@goo
+ [Base class_meth];
+
+ // CHECK: [[@LINE+4]]:3 | class/ObjC | Base | c:objc(cs)Base | _OBJC_CLASS_$_Base | Ref,RelCont | rel: 1
+ // CHECK-NEXT: RelCont | goo | c:@F@goo
+ // CHECK: [[@LINE+2]]:14 | class/ObjC | Base | c:objc(cs)Base | _OBJC_CLASS_$_Base | Ref,RelCont | rel: 1
+ // CHECK-NEXT: RelCont | goo | c:@F@goo
+ Base *f = (Base *) 2;
}
// CHECK: [[@LINE+1]]:11 | protocol/ObjC | Prot1 | c:objc(pl)Prot1 | <no-cgname> | Decl | rel: 0
@@ -24,18 +41,18 @@ void goo(Base *b) {
@end
// CHECK: [[@LINE+3]]:11 | protocol/ObjC | Prot2 | c:objc(pl)Prot2 | <no-cgname> | Decl | rel: 0
-// CHECK: [[@LINE+2]]:17 | protocol/ObjC | Prot1 | c:objc(pl)Prot1 | <no-cgname> | Ref,RelBase | rel: 1
-// CHECK-NEXT: RelBase | Prot2 | c:objc(pl)Prot2
+// CHECK: [[@LINE+2]]:17 | protocol/ObjC | Prot1 | c:objc(pl)Prot1 | <no-cgname> | Ref,RelBase,RelCont | rel: 1
+// CHECK-NEXT: RelBase,RelCont | Prot2 | c:objc(pl)Prot2
@protocol Prot2<Prot1>
@end
// CHECK: [[@LINE+7]]:12 | class/ObjC | Sub | c:objc(cs)Sub | _OBJC_CLASS_$_Sub | Decl | rel: 0
-// CHECK: [[@LINE+6]]:18 | class/ObjC | Base | c:objc(cs)Base | _OBJC_CLASS_$_Base | Ref,RelBase | rel: 1
-// CHECK-NEXT: RelBase | Sub | c:objc(cs)Sub
-// CHECK: [[@LINE+4]]:23 | protocol/ObjC | Prot2 | c:objc(pl)Prot2 | <no-cgname> | Ref,RelBase | rel: 1
-// CHECK-NEXT: RelBase | Sub | c:objc(cs)Sub
-// CHECK: [[@LINE+2]]:30 | protocol/ObjC | Prot1 | c:objc(pl)Prot1 | <no-cgname> | Ref,RelBase | rel: 1
-// CHECK-NEXT: RelBase | Sub | c:objc(cs)Sub
+// CHECK: [[@LINE+6]]:18 | class/ObjC | Base | c:objc(cs)Base | _OBJC_CLASS_$_Base | Ref,RelBase,RelCont | rel: 1
+// CHECK-NEXT: RelBase,RelCont | Sub | c:objc(cs)Sub
+// CHECK: [[@LINE+4]]:23 | protocol/ObjC | Prot2 | c:objc(pl)Prot2 | <no-cgname> | Ref,RelBase,RelCont | rel: 1
+// CHECK-NEXT: RelBase,RelCont | Sub | c:objc(cs)Sub
+// CHECK: [[@LINE+2]]:30 | protocol/ObjC | Prot1 | c:objc(pl)Prot1 | <no-cgname> | Ref,RelBase,RelCont | rel: 1
+// CHECK-NEXT: RelBase,RelCont | Sub | c:objc(cs)Sub
@interface Sub : Base<Prot2, Prot1>
@end
@@ -68,8 +85,9 @@ enum {
// CHECK: [[@LINE+1]]:13 | type-alias/C | jmp_buf | c:index-source.m@T@jmp_buf | <no-cgname> | Def | rel: 0
typedef int jmp_buf[(18)];
-// CHECK: [[@LINE+2]]:12 | function/C | setjmp | c:@F@setjmp | _setjmp | Decl | rel: 0
-// CHECK: [[@LINE+1]]:19 | type-alias/C | jmp_buf | c:index-source.m@T@jmp_buf | <no-cgname> | Ref | rel: 0
+// CHECK: [[@LINE+3]]:12 | function/C | setjmp | c:@F@setjmp | _setjmp | Decl | rel: 0
+// CHECK: [[@LINE+2]]:19 | type-alias/C | jmp_buf | c:index-source.m@T@jmp_buf | <no-cgname> | Ref,RelCont | rel: 1
+// CHECK-NEXT: RelCont | setjmp | c:@F@setjmp
extern int setjmp(jmp_buf);
@class I1;
@@ -80,26 +98,40 @@ extern int setjmp(jmp_buf);
@interface I2
@property (readwrite) id prop;
+
+// CHECK: [[@LINE+4]]:63 | instance-property(IB,IBColl)/ObjC | buttons | c:objc(cs)I2(py)buttons | <no-cgname> | Decl,RelChild | rel: 1
+// CHECK-NEXT: RelChild | I2 | c:objc(cs)I2
+// CHECK: [[@LINE+2]]:50 | class/ObjC | I1 | c:objc(cs)I1 | _OBJC_CLASS_$_I1 | Ref,RelCont,RelIBType | rel: 1
+// CHECK-NEXT: RelCont,RelIBType | buttons | c:objc(cs)I2(py)buttons
+@property (nonatomic, strong) IBOutletCollection(I1) NSArray *buttons;
@end
// CHECK: [[@LINE+2]]:17 | field/ObjC | _prop | c:objc(cs)I2@_prop | <no-cgname> | Def,Impl,RelChild | rel: 1
// CHECK-NEXT: RelChild | I2 | c:objc(cs)I2
@implementation I2
-// CHECK: [[@LINE+5]]:13 | instance-property/ObjC | prop | c:objc(cs)I2(py)prop | <no-cgname> | Ref | rel: 0
-// CHECK: [[@LINE+4]]:13 | instance-method/ObjC | prop | c:objc(cs)I2(im)prop | -[I2 prop] | Def,RelChild | rel: 1
+// CHECK: [[@LINE+6]]:13 | instance-property/ObjC | prop | c:objc(cs)I2(py)prop | <no-cgname> | Ref,RelCont | rel: 1
+// CHECK-NEXT: RelCont | I2 | c:objc(cs)I2
+// CHECK: [[@LINE+4]]:13 | instance-method/acc-get/ObjC | prop | c:objc(cs)I2(im)prop | -[I2 prop] | Def,RelChild | rel: 1
// CHECK-NEXT: RelChild | I2 | c:objc(cs)I2
-// CHECK: [[@LINE+2]]:13 | instance-method/ObjC | setProp: | c:objc(cs)I2(im)setProp: | -[I2 setProp:] | Def,RelChild | rel: 1
+// CHECK: [[@LINE+2]]:13 | instance-method/acc-set/ObjC | setProp: | c:objc(cs)I2(im)setProp: | -[I2 setProp:] | Def,RelChild | rel: 1
// CHECK-NEXT: RelChild | I2 | c:objc(cs)I2
@synthesize prop = _prop;
+
+// CHECK: [[@LINE+5]]:1 | instance-method(IB)/ObjC | doAction:foo: | c:objc(cs)I2(im)doAction:foo: | -[I2 doAction:foo:] | Def,Dyn,RelChild | rel: 1
+// CHECK-NEXT: RelChild | I2 | c:objc(cs)I2
+// CHECK: [[@LINE+3]]:22 | class/ObjC | I1 | c:objc(cs)I1 | _OBJC_CLASS_$_I1 | Ref,RelCont,RelIBType | rel: 1
+// CHECK-NEXT: RelCont,RelIBType | doAction:foo: | c:objc(cs)I2(im)doAction:foo:
+// CHECK: [[@LINE+1]]:39 | class/ObjC | I1 | c:objc(cs)I1 | _OBJC_CLASS_$_I1 | Ref,RelCont | rel: 1
+-(IBAction)doAction:(I1 *)sender foo:(I1 *)bar {}
@end
@interface I3
@property (readwrite) id prop;
-// CHECK: [[@LINE+3]]:1 | instance-method/ObjC | prop | c:objc(cs)I3(im)prop | -[I3 prop] | Decl,Dyn,RelChild,RelAcc | rel: 2
+// CHECK: [[@LINE+3]]:1 | instance-method/acc-get/ObjC | prop | c:objc(cs)I3(im)prop | -[I3 prop] | Decl,Dyn,RelChild,RelAcc | rel: 2
// CHECK-NEXT: RelChild | I3 | c:objc(cs)I3
// CHECK-NEXT: RelAcc | prop | c:objc(cs)I3(py)prop
-(id)prop;
-// CHECK: [[@LINE+3]]:1 | instance-method/ObjC | setProp: | c:objc(cs)I3(im)setProp: | -[I3 setProp:] | Decl,Dyn,RelChild,RelAcc | rel: 2
+// CHECK: [[@LINE+3]]:1 | instance-method/acc-set/ObjC | setProp: | c:objc(cs)I3(im)setProp: | -[I3 setProp:] | Decl,Dyn,RelChild,RelAcc | rel: 2
// CHECK-NEXT: RelChild | I3 | c:objc(cs)I3
// CHECK-NEXT: RelAcc | prop | c:objc(cs)I3(py)prop
-(void)setProp:(id)p;
@@ -107,26 +139,27 @@ extern int setjmp(jmp_buf);
// CHECK: [[@LINE+1]]:17 | class/ObjC | I3 | c:objc(cs)I3 | <no-cgname> | Def | rel: 0
@implementation I3
-// CHECK: [[@LINE+3]]:13 | instance-property/ObjC | prop | c:objc(cs)I3(py)prop | <no-cgname> | Ref | rel: 0
-// CHECK: [[@LINE+2]]:13 | instance-method/ObjC | prop | c:objc(cs)I3(im)prop | -[I3 prop] | Def,RelChild | rel: 1
-// CHECK: [[@LINE+1]]:13 | instance-method/ObjC | setProp: | c:objc(cs)I3(im)setProp: | -[I3 setProp:] | Def,RelChild | rel: 1
+// CHECK: [[@LINE+4]]:13 | instance-property/ObjC | prop | c:objc(cs)I3(py)prop | <no-cgname> | Ref,RelCont | rel: 1
+// CHECK-NEXT: RelCont | I3 | c:objc(cs)I3
+// CHECK: [[@LINE+2]]:13 | instance-method/acc-get/ObjC | prop | c:objc(cs)I3(im)prop | -[I3 prop] | Def,RelChild | rel: 1
+// CHECK: [[@LINE+1]]:13 | instance-method/acc-set/ObjC | setProp: | c:objc(cs)I3(im)setProp: | -[I3 setProp:] | Def,RelChild | rel: 1
@synthesize prop = _prop;
@end
-// CHECK: [[@LINE+5]]:12 | class/ObjC | I3 | c:objc(cs)I3 | _OBJC_CLASS_$_I3 | Ref,RelExt | rel: 1
-// CHECK-NEXT: RelExt | bar | c:objc(cy)I3@bar
+// CHECK: [[@LINE+5]]:12 | class/ObjC | I3 | c:objc(cs)I3 | _OBJC_CLASS_$_I3 | Ref,RelExt,RelCont | rel: 1
+// CHECK-NEXT: RelExt,RelCont | bar | c:objc(cy)I3@bar
// CHECK: [[@LINE+3]]:15 | extension/ObjC | bar | c:objc(cy)I3@bar | <no-cgname> | Decl | rel: 0
-// CHECK: [[@LINE+2]]:21 | protocol/ObjC | Prot1 | c:objc(pl)Prot1 | <no-cgname> | Ref,RelBase | rel: 1
-// CHECK-NEXT: RelBase | bar | c:objc(cy)I3@bar
+// CHECK: [[@LINE+2]]:21 | protocol/ObjC | Prot1 | c:objc(pl)Prot1 | <no-cgname> | Ref,RelBase,RelCont | rel: 1
+// CHECK-NEXT: RelBase,RelCont | bar | c:objc(cy)I3@bar
@interface I3(bar) <Prot1>
@end
-// CHECK: [[@LINE+2]]:17 | class/ObjC | I3 | c:objc(cs)I3 | _OBJC_CLASS_$_I3 | Ref | rel: 0
+// CHECK: [[@LINE+2]]:17 | class/ObjC | I3 | c:objc(cs)I3 | _OBJC_CLASS_$_I3 | Ref,RelCont | rel: 1
// CHECK: [[@LINE+1]]:20 | extension/ObjC | I3 | c:objc(cy)I3@bar | <no-cgname> | Def | rel: 0
@implementation I3(bar)
@end
-// CHECK: [[@LINE+1]]:12 | extension/ObjC | <no-name> | <no-usr> | <no-cgname> | Decl | rel: 0
+// CHECK-NOT: [[@LINE+1]]:12 | extension/ObjC |
@interface NonExistent()
@end
@@ -137,15 +170,15 @@ extern int setjmp(jmp_buf);
@end
// CHECK: [[@LINE+4]]:41 | type-alias/C | MyEnumerator | c:index-source.m@T@MyEnumerator | <no-cgname> | Def | rel: 0
-// CHECK: [[@LINE+3]]:26 | protocol/ObjC | MyEnumerating | c:objc(pl)MyEnumerating | <no-cgname> | Ref | rel: 0
-// CHECK: [[@LINE+2]]:9 | class/ObjC | MyGenCls | c:objc(cs)MyGenCls | _OBJC_CLASS_$_MyGenCls | Ref | rel: 0
-// CHECK: [[@LINE+1]]:18 | class/ObjC | Base | c:objc(cs)Base | _OBJC_CLASS_$_Base | Ref | rel: 0
+// CHECK: [[@LINE+3]]:26 | protocol/ObjC | MyEnumerating | c:objc(pl)MyEnumerating | <no-cgname> | Ref,RelCont | rel: 1
+// CHECK: [[@LINE+2]]:9 | class/ObjC | MyGenCls | c:objc(cs)MyGenCls | _OBJC_CLASS_$_MyGenCls | Ref,RelCont | rel: 1
+// CHECK: [[@LINE+1]]:18 | class/ObjC | Base | c:objc(cs)Base | _OBJC_CLASS_$_Base | Ref,RelCont | rel: 1
typedef MyGenCls<Base *><MyEnumerating> MyEnumerator;
// CHECK: [[@LINE+5]]:12 | class/ObjC | PermanentEnumerator | c:objc(cs)PermanentEnumerator | _OBJC_CLASS_$_PermanentEnumerator | Decl | rel: 0
-// CHECK: [[@LINE+4]]:34 | class/ObjC | MyGenCls | c:objc(cs)MyGenCls | _OBJC_CLASS_$_MyGenCls | Ref,RelBase | rel: 1
-// CHECK-NEXT: RelBase | PermanentEnumerator | c:objc(cs)PermanentEnumerator
-// CHECK: [[@LINE+2]]:34 | protocol/ObjC | MyEnumerating | c:objc(pl)MyEnumerating | <no-cgname> | Ref,RelBase | rel: 1
-// CHECK-NEXT: RelBase | PermanentEnumerator | c:objc(cs)PermanentEnumerator
+// CHECK: [[@LINE+4]]:34 | class/ObjC | MyGenCls | c:objc(cs)MyGenCls | _OBJC_CLASS_$_MyGenCls | Ref,RelBase,RelCont | rel: 1
+// CHECK-NEXT: RelBase,RelCont | PermanentEnumerator | c:objc(cs)PermanentEnumerator
+// CHECK: [[@LINE+2]]:34 | protocol/ObjC | MyEnumerating | c:objc(pl)MyEnumerating | <no-cgname> | Ref,RelBase,RelCont | rel: 1
+// CHECK-NEXT: RelBase,RelCont | PermanentEnumerator | c:objc(cs)PermanentEnumerator
@interface PermanentEnumerator : MyEnumerator
@end
diff --git a/test/Index/Core/index-subkinds.m b/test/Index/Core/index-subkinds.m
index 38be73b31e91a..6783f6dde308c 100644
--- a/test/Index/Core/index-subkinds.m
+++ b/test/Index/Core/index-subkinds.m
@@ -26,12 +26,12 @@
-(void)testIt2 {}
@end
-// CHECK: [[@LINE+3]]:12 | class(test)/ObjC | MyTestCase | c:objc(cs)MyTestCase | _OBJC_CLASS_$_MyTestCase | Ref,RelExt | rel: 1
-// CHECK-NEXT: RelExt | cat | c:objc(cy)MyTestCase@cat
+// CHECK: [[@LINE+3]]:12 | class(test)/ObjC | MyTestCase | c:objc(cs)MyTestCase | _OBJC_CLASS_$_MyTestCase | Ref,RelExt,RelCont | rel: 1
+// CHECK-NEXT: RelExt,RelCont | cat | c:objc(cy)MyTestCase@cat
// CHECK: [[@LINE+1]]:23 | extension/ObjC | cat | c:objc(cy)MyTestCase@cat | <no-cgname> | Decl | rel: 0
@interface MyTestCase(cat)
@end
-// CHECK: [[@LINE+2]]:17 | class(test)/ObjC | MyTestCase | c:objc(cs)MyTestCase | _OBJC_CLASS_$_MyTestCase | Ref | rel: 0
+// CHECK: [[@LINE+2]]:17 | class(test)/ObjC | MyTestCase | c:objc(cs)MyTestCase | _OBJC_CLASS_$_MyTestCase | Ref,RelCont | rel: 1
// CHECK: [[@LINE+1]]:28 | extension/ObjC | MyTestCase | c:objc(cy)MyTestCase@cat | <no-cgname> | Def | rel: 0
@implementation MyTestCase(cat)
// CHECK: [[@LINE+1]]:1 | instance-method(test)/ObjC | testInCat | c:objc(cs)MyTestCase(im)testInCat | -[MyTestCase(cat) testInCat] | Def,Dyn,RelChild | rel: 1
@@ -42,7 +42,7 @@
@class NSButton;
@interface IBCls
-// CHECK: [[@LINE+2]]:34 | instance-method/ObjC | prop | c:objc(cs)IBCls(im)prop | -[IBCls prop] | Decl,Dyn,RelChild,RelAcc | rel: 2
+// CHECK: [[@LINE+2]]:34 | instance-method/acc-get/ObjC | prop | c:objc(cs)IBCls(im)prop | -[IBCls prop] | Decl,Dyn,RelChild,RelAcc | rel: 2
// CHECK: [[@LINE+1]]:34 | instance-property(IB)/ObjC | prop | c:objc(cs)IBCls(py)prop | <no-cgname> | Decl,RelChild | rel: 1
@property (readonly) IBOutlet id prop;
// CHECK: [[@LINE+1]]:54 | instance-property(IB,IBColl)/ObjC | propColl | c:objc(cs)IBCls(py)propColl | <no-cgname> | Decl,RelChild | rel: 1
diff --git a/test/Index/Core/index-with-module.m b/test/Index/Core/index-with-module.m
index 03fd5cd5b8d31..e50b247e8d570 100644
--- a/test/Index/Core/index-with-module.m
+++ b/test/Index/Core/index-with-module.m
@@ -7,6 +7,6 @@
#include "ModA.h"
void foo() {
- // CHECK: [[@LINE+1]]:3 | function/C | ModA_func | c:@F@ModA_func | {{.*}} | Ref,Call,RelCall | rel: 1
+ // CHECK: [[@LINE+1]]:3 | function/C | ModA_func | c:@F@ModA_func | {{.*}} | Ref,Call,RelCall,RelCont | rel: 1
ModA_func();
}
diff --git a/test/Index/index-templates.cpp b/test/Index/index-templates.cpp
index 79b9c181ecaf4..966cc4f5ea7fe 100644
--- a/test/Index/index-templates.cpp
+++ b/test/Index/index-templates.cpp
@@ -49,9 +49,9 @@ template class vector<int*>;
struct Z4 {
template<typename T> T getAs();
};
-
+template<typename T, T> struct value { };
void template_exprs() {
- f<Unsigned, OneDimension, array>(array<Unsigned, OneDimension>());
+ f<Unsigned, OneDimension, value>(value<Unsigned, OneDimension>());
Z4().getAs<Unsigned>();
}
@@ -173,7 +173,7 @@ using alias = T;
// CHECK-LOAD: index-templates.cpp:54:3: DeclRefExpr=f:4:6 RefName=[54:3 - 54:4] RefName=[54:4 - 54:35] Extent=[54:3 - 54:35]
// CHECK-LOAD: index-templates.cpp:54:5: TypeRef=Unsigned:42:18 Extent=[54:5 - 54:13]
// CHECK-LOAD: index-templates.cpp:54:15: DeclRefExpr=OneDimension:35:16 Extent=[54:15 - 54:27]
-// CHECK-LOAD: index-templates.cpp:54:29: TemplateRef=array:37:8 Extent=[54:29 - 54:34]
+// CHECK-LOAD: index-templates.cpp:54:29: TemplateRef=value:52:32 Extent=[54:29 - 54:34]
// CHECK-LOAD: index-templates.cpp:55:8: MemberRefExpr=getAs:50:26 SingleRefName=[55:8 - 55:13] RefName=[55:8 - 55:13] Extent=[55:3 - 55:23]
// CHECK-LOAD: index-templates.cpp:55:3: CallExpr=Z4:49:8 Extent=[55:3 - 55:7]
// CHECK-LOAD: index-templates.cpp:55:14: TypeRef=Unsigned:42:18 Extent=[55:14 - 55:22]
diff --git a/test/Misc/ast-dump-decl.cpp b/test/Misc/ast-dump-decl.cpp
index 1cfcd509efabd..c966e133eb5dd 100644
--- a/test/Misc/ast-dump-decl.cpp
+++ b/test/Misc/ast-dump-decl.cpp
@@ -336,7 +336,6 @@ namespace testCanonicalTemplate {
// CHECK-NEXT: ClassTemplateDecl{{.*}} TestClassTemplate
// CHECK-NEXT: TemplateTypeParmDecl
// CHECK-NEXT: CXXRecordDecl{{.*}} class TestClassTemplate
- // CHECK-NEXT: ClassTemplateSpecialization{{.*}} 'TestClassTemplate'
// CHECK-NEXT: ClassTemplateSpecializationDecl{{.*}} class TestClassTemplate
// CHECK-NEXT: TemplateArgument{{.*}}A
// CHECK-NEXT: CXXRecordDecl{{.*}} class TestClassTemplate
diff --git a/test/Modules/Inputs/FooFramework.framework/Modules/module.modulemap b/test/Modules/Inputs/FooFramework.framework/Modules/module.modulemap
new file mode 100644
index 0000000000000..62e56364abaf7
--- /dev/null
+++ b/test/Modules/Inputs/FooFramework.framework/Modules/module.modulemap
@@ -0,0 +1,12 @@
+framework module FooFramework {
+ umbrella header "FooUmbrella.h"
+
+ export *
+ module * {
+ export *
+ }
+
+ explicit module Private {
+ textual header "Baz_Private.h"
+ }
+}
diff --git a/test/Modules/Inputs/FooFramework.framework/PrivateHeaders/Bar.h b/test/Modules/Inputs/FooFramework.framework/PrivateHeaders/Bar.h
new file mode 100644
index 0000000000000..d16b395055f92
--- /dev/null
+++ b/test/Modules/Inputs/FooFramework.framework/PrivateHeaders/Bar.h
@@ -0,0 +1,2 @@
+@interface Bar
+@end
diff --git a/test/Modules/Inputs/FooFramework.framework/PrivateHeaders/Baz_Private.h b/test/Modules/Inputs/FooFramework.framework/PrivateHeaders/Baz_Private.h
new file mode 100644
index 0000000000000..3ea082b874c0a
--- /dev/null
+++ b/test/Modules/Inputs/FooFramework.framework/PrivateHeaders/Baz_Private.h
@@ -0,0 +1,3 @@
+#ifndef Baz_h
+#define Baz_h
+#endif /* Baz_h */
diff --git a/test/Modules/Inputs/FooFramework.framework/PrivateHeaders/Foo.h b/test/Modules/Inputs/FooFramework.framework/PrivateHeaders/Foo.h
new file mode 100644
index 0000000000000..26b96988d5882
--- /dev/null
+++ b/test/Modules/Inputs/FooFramework.framework/PrivateHeaders/Foo.h
@@ -0,0 +1,10 @@
+__attribute__((objc_root_class))
+@interface NSObject
++ (instancetype) alloc;
+- (instancetype) init;
+- (instancetype)retain;
+- (void)release;
+@end
+
+@interface Foo : NSObject
+@end
diff --git a/test/Modules/Inputs/FooFramework.framework/PrivateHeaders/FooUmbrella.h b/test/Modules/Inputs/FooFramework.framework/PrivateHeaders/FooUmbrella.h
new file mode 100644
index 0000000000000..c752fb299e003
--- /dev/null
+++ b/test/Modules/Inputs/FooFramework.framework/PrivateHeaders/FooUmbrella.h
@@ -0,0 +1,3 @@
+#import <FooFramework/Foo.h>
+#import <FooFramework/Bar.h>
+
diff --git a/test/Modules/Inputs/PR31469/empty.h b/test/Modules/Inputs/PR31469/empty.h
new file mode 100644
index 0000000000000..51e115f57fc6d
--- /dev/null
+++ b/test/Modules/Inputs/PR31469/empty.h
@@ -0,0 +1 @@
+// This file is triggers loading of module M.
diff --git a/test/Modules/Inputs/PR31469/module.modulemap b/test/Modules/Inputs/PR31469/module.modulemap
new file mode 100644
index 0000000000000..bada81d04ee30
--- /dev/null
+++ b/test/Modules/Inputs/PR31469/module.modulemap
@@ -0,0 +1,5 @@
+module M {
+ module "textual_shadow" { header "textual_file_shadow.h" export *}
+ module "trigger" { header "empty.h" export * }
+ export *
+}
diff --git a/test/Modules/Inputs/PR31469/textual.h b/test/Modules/Inputs/PR31469/textual.h
new file mode 100644
index 0000000000000..abdc662fb5ef8
--- /dev/null
+++ b/test/Modules/Inputs/PR31469/textual.h
@@ -0,0 +1,17 @@
+namespace A {
+inline
+namespace __1 {
+ template <class _Tp> class allocator;
+ template <class _Tp, class _Alloc = allocator<_Tp>> class list;
+ template <class _VoidPtr> class __list_iterator {
+ //template <class> friend class list; // causes another crash in ASTDeclReader::attachPreviousDecl
+ template <class, class> friend class list;
+ };
+ template <class _Tp, class _Alloc> class __list_imp {};
+ template <class _Tp, class _Alloc> class list : __list_imp<_Tp, _Alloc> {
+ public:
+ list() {}
+ };
+ template <class _Tp> void f(list<_Tp>);
+}
+}
diff --git a/test/Modules/Inputs/PR31469/textual_file_shadow.h b/test/Modules/Inputs/PR31469/textual_file_shadow.h
new file mode 100644
index 0000000000000..48a53dd4a83fd
--- /dev/null
+++ b/test/Modules/Inputs/PR31469/textual_file_shadow.h
@@ -0,0 +1,2 @@
+#include "textual.h"
+
diff --git a/test/Modules/Inputs/import-textual/M/A/A.h b/test/Modules/Inputs/import-textual/M/A/A.h
new file mode 100644
index 0000000000000..ebe4979d7c1e5
--- /dev/null
+++ b/test/Modules/Inputs/import-textual/M/A/A.h
@@ -0,0 +1,4 @@
+
+#import "someheader.h"
+
+typedef myint aint;
diff --git a/test/Modules/Inputs/import-textual/M/B/B.h b/test/Modules/Inputs/import-textual/M/B/B.h
new file mode 100644
index 0000000000000..ba85071c014a3
--- /dev/null
+++ b/test/Modules/Inputs/import-textual/M/B/B.h
@@ -0,0 +1,4 @@
+
+#import "someheader.h"
+
+typedef myint bint;
diff --git a/test/Modules/Inputs/import-textual/M/module.modulemap b/test/Modules/Inputs/import-textual/M/module.modulemap
new file mode 100644
index 0000000000000..f80194876caae
--- /dev/null
+++ b/test/Modules/Inputs/import-textual/M/module.modulemap
@@ -0,0 +1,17 @@
+
+module M {
+
+ module A {
+ header "A/A.h"
+ textual header "someheader.h"
+ export *
+ }
+
+ module B {
+ header "B/B.h"
+ textual header "someheader.h"
+ export *
+ }
+
+ export *
+}
diff --git a/test/Modules/Inputs/import-textual/M/someheader.h b/test/Modules/Inputs/import-textual/M/someheader.h
new file mode 100644
index 0000000000000..16fae408724db
--- /dev/null
+++ b/test/Modules/Inputs/import-textual/M/someheader.h
@@ -0,0 +1,6 @@
+#ifndef C_GUARD
+#define C_GUARD
+
+typedef int myint;
+
+#endif
diff --git a/test/Modules/Inputs/import-textual/M2/A/A.h b/test/Modules/Inputs/import-textual/M2/A/A.h
new file mode 100644
index 0000000000000..ebe4979d7c1e5
--- /dev/null
+++ b/test/Modules/Inputs/import-textual/M2/A/A.h
@@ -0,0 +1,4 @@
+
+#import "someheader.h"
+
+typedef myint aint;
diff --git a/test/Modules/Inputs/import-textual/M2/B/B.h b/test/Modules/Inputs/import-textual/M2/B/B.h
new file mode 100644
index 0000000000000..ba85071c014a3
--- /dev/null
+++ b/test/Modules/Inputs/import-textual/M2/B/B.h
@@ -0,0 +1,4 @@
+
+#import "someheader.h"
+
+typedef myint bint;
diff --git a/test/Modules/Inputs/import-textual/M2/module.modulemap b/test/Modules/Inputs/import-textual/M2/module.modulemap
new file mode 100644
index 0000000000000..f80194876caae
--- /dev/null
+++ b/test/Modules/Inputs/import-textual/M2/module.modulemap
@@ -0,0 +1,17 @@
+
+module M {
+
+ module A {
+ header "A/A.h"
+ textual header "someheader.h"
+ export *
+ }
+
+ module B {
+ header "B/B.h"
+ textual header "someheader.h"
+ export *
+ }
+
+ export *
+}
diff --git a/test/Modules/Inputs/import-textual/M2/someheader.h b/test/Modules/Inputs/import-textual/M2/someheader.h
new file mode 100644
index 0000000000000..df2009a019b5e
--- /dev/null
+++ b/test/Modules/Inputs/import-textual/M2/someheader.h
@@ -0,0 +1 @@
+typedef int myint;
diff --git a/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/c++/v1/cstddef b/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/c++/v1/cstddef
new file mode 100644
index 0000000000000..4898c05fdbb5a
--- /dev/null
+++ b/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/c++/v1/cstddef
@@ -0,0 +1,9 @@
+#ifndef _LIBCPP_CSTDDEF
+#define _LIBCPP_CSTDDEF
+
+#include <stddef.h>
+#include <type_traits>
+
+typedef ptrdiff_t my_ptrdiff_t;
+
+#endif
diff --git a/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/c++/v1/math.h b/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/c++/v1/math.h
index f761b910f3ef1..9e2b693612590 100644
--- a/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/c++/v1/math.h
+++ b/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/c++/v1/math.h
@@ -4,4 +4,6 @@
#include_next <math.h>
template<typename T> T abs(T t) { return (t < 0) ? -t : t; }
+#include <type_traits>
+
#endif
diff --git a/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/c++/v1/module.modulemap b/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/c++/v1/module.modulemap
index b06142a61a207..f57c11c42385a 100644
--- a/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/c++/v1/module.modulemap
+++ b/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/c++/v1/module.modulemap
@@ -6,5 +6,7 @@ module "libc++" {
// FIXME: remove "textual" from stdint module below once the issue
// between umbrella headers and builtins is resolved.
module stdint { textual header "stdint.h" export * }
+ module type_traits { header "type_traits" export * }
+ module cstddef { header "cstddef" export * }
module __config { header "__config" export * }
}
diff --git a/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/c++/v1/stddef.h b/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/c++/v1/stddef.h
index bd42008e16951..14167cfe1d729 100644
--- a/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/c++/v1/stddef.h
+++ b/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/c++/v1/stddef.h
@@ -2,5 +2,6 @@
#define LIBCXX_STDDEF_H
#include <__config>
+#include_next <stddef.h>
#endif
diff --git a/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/c++/v1/type_traits b/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/c++/v1/type_traits
new file mode 100644
index 0000000000000..a91056e008a02
--- /dev/null
+++ b/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/c++/v1/type_traits
@@ -0,0 +1,6 @@
+#ifndef _LIBCPP_TYPE_TRAITS
+#define _LIBCPP_TYPE_TRAITS
+
+#include <cstddef>
+
+#endif
diff --git a/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/module.modulemap b/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/module.modulemap
index 7244cb0987e7d..25b9468d29163 100644
--- a/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/module.modulemap
+++ b/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/module.modulemap
@@ -5,4 +5,12 @@ module libc [no_undeclared_includes] {
module stdint { header "stdint.h" export * }
module stdio { header "stdio.h" export * }
module util { header "util.h" export * }
+ module POSIX {
+ module sys {
+ module types {
+ umbrella header "sys/_types/_types.h"
+ export *
+ }
+ }
+ }
}
diff --git a/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/stddef.h b/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/stddef.h
index eca72412a651c..b98249f0864f9 100644
--- a/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/stddef.h
+++ b/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/stddef.h
@@ -1 +1,6 @@
-// stddef.h
+#ifndef __STDDEF_H__
+#define __STDDEF_H__
+
+#include "sys/_types/_ptrdiff_t.h"
+
+#endif
diff --git a/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/sys/_types/_ptrdiff_t.h b/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/sys/_types/_ptrdiff_t.h
new file mode 100644
index 0000000000000..d14110e4644cf
--- /dev/null
+++ b/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/sys/_types/_ptrdiff_t.h
@@ -0,0 +1,4 @@
+#ifndef _PTRDIFF_T
+#define _PTRDIFF_T
+typedef int * ptrdiff_t;
+#endif /* _PTRDIFF_T */
diff --git a/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/sys/_types/_types.h b/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/sys/_types/_types.h
new file mode 100644
index 0000000000000..33d5e514433ca
--- /dev/null
+++ b/test/Modules/Inputs/libc-libcxx/sysroot/usr/include/sys/_types/_types.h
@@ -0,0 +1,6 @@
+#ifndef _SYS_TYPES_UMBRELLA
+#define _SYS_TYPES_UMBRELLA
+
+#include "_ptrdiff_t.h"
+
+#endif
diff --git a/test/Modules/Inputs/module-impl-with-link/foo.h b/test/Modules/Inputs/module-impl-with-link/foo.h
new file mode 100644
index 0000000000000..90fe1bcc58511
--- /dev/null
+++ b/test/Modules/Inputs/module-impl-with-link/foo.h
@@ -0,0 +1 @@
+//empty
diff --git a/test/Modules/Inputs/module-impl-with-link/module.modulemap b/test/Modules/Inputs/module-impl-with-link/module.modulemap
new file mode 100644
index 0000000000000..b85f8b6fe804c
--- /dev/null
+++ b/test/Modules/Inputs/module-impl-with-link/module.modulemap
@@ -0,0 +1,4 @@
+module Clib {
+ header "foo.h"
+ link "Clib"
+}
diff --git a/test/Modules/builtin-import.mm b/test/Modules/builtin-import.mm
new file mode 100644
index 0000000000000..2536ac51c42f1
--- /dev/null
+++ b/test/Modules/builtin-import.mm
@@ -0,0 +1,12 @@
+// REQUIRES: system-darwin
+
+// RUN: rm -rf %t
+// RUN: %clang -cc1 -fsyntax-only -nostdinc++ -isysroot %S/Inputs/libc-libcxx/sysroot -isystem %S/Inputs/libc-libcxx/sysroot/usr/include/c++/v1 -std=c++11 -fmodules -fimplicit-module-maps -fmodules-cache-path=%t -x objective-c++ -fmodules-local-submodule-visibility %s
+
+#include <stdio.h>
+#include <stddef.h>
+#include <cstddef>
+
+typedef ptrdiff_t try1_ptrdiff_t;
+typedef my_ptrdiff_t try2_ptrdiff_t;
+
diff --git a/test/Modules/cxx-templates.cpp b/test/Modules/cxx-templates.cpp
index 401b7704900ba..59e9136bd142f 100644
--- a/test/Modules/cxx-templates.cpp
+++ b/test/Modules/cxx-templates.cpp
@@ -49,14 +49,8 @@ void g() {
// expected-note@Inputs/cxx-templates-a.h:11 {{candidate}}
// expected-note@Inputs/cxx-templates-b.h:11 {{candidate}}
- // FIXME: This should be valid, but we incorrectly match the template template
- // argument against both template template parameters.
- template_param_kinds_3<Tmpl_T_T_A>(); // expected-error {{ambiguous}}
- // expected-note@Inputs/cxx-templates-a.h:12 {{candidate}}
- // expected-note@Inputs/cxx-templates-b.h:12 {{candidate}}
- template_param_kinds_3<Tmpl_T_T_B>(); // expected-error {{ambiguous}}
- // expected-note@Inputs/cxx-templates-a.h:12 {{candidate}}
- // expected-note@Inputs/cxx-templates-b.h:12 {{candidate}}
+ template_param_kinds_3<Tmpl_T_T_A>();
+ template_param_kinds_3<Tmpl_T_T_B>();
// Trigger the instantiation of a template in 'a' that uses a type defined in
// 'common'. That type is not visible here.
diff --git a/test/Modules/import-textual-noguard.mm b/test/Modules/import-textual-noguard.mm
new file mode 100644
index 0000000000000..dd124b6609d00
--- /dev/null
+++ b/test/Modules/import-textual-noguard.mm
@@ -0,0 +1,8 @@
+// RUN: rm -rf %t
+// RUN: %clang_cc1 -fsyntax-only -std=c++11 -fmodules -fimplicit-module-maps -I%S/Inputs/import-textual/M2 -fmodules-cache-path=%t -x objective-c++ -fmodules-local-submodule-visibility %s -verify
+
+#include "A/A.h" // expected-error {{could not build module 'M'}}
+#include "B/B.h"
+
+typedef aint xxx;
+typedef bint yyy;
diff --git a/test/Modules/import-textual.mm b/test/Modules/import-textual.mm
new file mode 100644
index 0000000000000..6593239d7fd70
--- /dev/null
+++ b/test/Modules/import-textual.mm
@@ -0,0 +1,10 @@
+// RUN: rm -rf %t
+// RUN: %clang_cc1 -fsyntax-only -std=c++11 -fmodules -fimplicit-module-maps -I%S/Inputs/import-textual/M -fmodules-cache-path=%t -x objective-c++ -fmodules-local-submodule-visibility %s -verify
+
+// expected-no-diagnostics
+
+#include "A/A.h"
+#include "B/B.h"
+
+typedef aint xxx;
+typedef bint yyy;
diff --git a/test/Modules/module-impl-with-link.c b/test/Modules/module-impl-with-link.c
new file mode 100644
index 0000000000000..5e5ca83aafd66
--- /dev/null
+++ b/test/Modules/module-impl-with-link.c
@@ -0,0 +1,7 @@
+// RUN: rm -rf %t
+// RUN: %clang_cc1 -fmodules-cache-path=%t -fmodules -fimplicit-module-maps -fmodule-name=Clib %s -I %S/Inputs/module-impl-with-link -emit-llvm -o -
+#include "foo.h"
+// CHECK: !{{[0-9]+}} = !{i32 6, !"Linker Options", ![[LINK_OPTIONS:[0-9]+]]}
+// Make sure we don't generate linker option for module Clib since this TU is
+// an implementation of Clib.
+// CHECK: ![[LINK_OPTIONS]] = !{}
diff --git a/test/Modules/pr31469.cpp b/test/Modules/pr31469.cpp
new file mode 100644
index 0000000000000..8f7d52285c875
--- /dev/null
+++ b/test/Modules/pr31469.cpp
@@ -0,0 +1,15 @@
+// RUN: rm -rf %t
+// RUN: %clang_cc1 -std=c++11 -I%S/Inputs/PR31469 -verify %s
+// RUN: %clang_cc1 -std=c++11 -I%S/Inputs/PR31469 -fmodules -fmodules-local-submodule-visibility \
+// RUN: -fimplicit-module-maps -fmodules-cache-path=%t -verify %s
+
+#include "textual.h"
+#include "empty.h"
+
+namespace A {
+ template <class _Tp> void f();
+}
+
+A::list<int> use;
+
+// expected-no-diagnostics
diff --git a/test/Modules/textual-hdr-in-umbrella-hdr.m b/test/Modules/textual-hdr-in-umbrella-hdr.m
new file mode 100644
index 0000000000000..f92cdb91b2368
--- /dev/null
+++ b/test/Modules/textual-hdr-in-umbrella-hdr.m
@@ -0,0 +1,10 @@
+// RUN: rm -rf %t.cache
+// RUN: %clang_cc1 -fmodules -fmodules-cache-path=%t.cache \
+// RUN: %s -fsyntax-only -F %S/Inputs -Wincomplete-umbrella -verify
+
+// expected-no-diagnostics
+
+#import <FooFramework/Foo.h>
+
+@implementation Foo
+@end
diff --git a/test/OpenMP/nesting_of_regions.cpp b/test/OpenMP/nesting_of_regions.cpp
index 9b3a2b39be52a..6282de4cc4787 100644
--- a/test/OpenMP/nesting_of_regions.cpp
+++ b/test/OpenMP/nesting_of_regions.cpp
@@ -208,6 +208,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp parallel
+ {
+#pragma omp target teams distribute simd // OK
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// SIMD DIRECTIVE
#pragma omp simd
@@ -453,6 +459,12 @@ void foo() {
for (int j = 0; j < 10; ++j)
;
}
+#pragma omp simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int j = 0; j < 10; ++j)
+ ;
+ }
// FOR DIRECTIVE
#pragma omp for
@@ -711,6 +723,12 @@ void foo() {
for (int j = 0; j < 10; ++j)
;
}
+#pragma omp for
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // OK
+ for (int j = 0; j < 10; ++j)
+ ;
+ }
// FOR SIMD DIRECTIVE
#pragma omp for simd
@@ -957,6 +975,12 @@ void foo() {
for (int j = 0; j < 10; ++j)
;
}
+#pragma omp for simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int j = 0; j < 10; ++j)
+ ;
+ }
// SECTIONS DIRECTIVE
#pragma omp sections
@@ -1220,6 +1244,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp sections
+ {
+#pragma omp target teams distribute simd // OK
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// SECTION DIRECTIVE
#pragma omp section // expected-error {{orphaned 'omp section' directives are prohibited, it must be closely nested to a sections region}}
@@ -1549,6 +1579,13 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp sections
+ {
+#pragma omp section
+#pragma omp target teams distribute simd // OK
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// SINGLE DIRECTIVE
#pragma omp single
@@ -1798,6 +1835,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp single
+ {
+#pragma omp target teams distribute simd // OK
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// MASTER DIRECTIVE
#pragma omp master
@@ -2047,6 +2090,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp master
+ {
+#pragma omp target teams distribute simd // OK
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// CRITICAL DIRECTIVE
#pragma omp critical
@@ -2310,6 +2359,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp critical
+ {
+#pragma omp target teams distribute simd // OK
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// PARALLEL FOR DIRECTIVE
#pragma omp parallel for
@@ -2573,6 +2628,12 @@ void foo() {
for (int j = 0; j < 10; ++j)
;
}
+#pragma omp parallel for
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // OK
+ for (int j = 0; j < 10; ++j)
+ ;
+ }
// PARALLEL FOR SIMD DIRECTIVE
#pragma omp parallel for simd
@@ -2837,6 +2898,12 @@ void foo() {
for (int j = 0; j < 10; ++j)
;
}
+#pragma omp parallel for simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int j = 0; j < 10; ++j)
+ ;
+ }
// PARALLEL SECTIONS DIRECTIVE
#pragma omp parallel sections
@@ -3089,6 +3156,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp parallel sections
+ {
+#pragma omp target teams distribute simd // OK
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// TASK DIRECTIVE
#pragma omp task
@@ -3288,6 +3361,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp task
+ {
+#pragma omp target teams distribute simd // OK
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// ORDERED DIRECTIVE
#pragma omp ordered
@@ -3558,6 +3637,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp ordered
+ {
+#pragma omp target teams distribute simd // OK
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// ATOMIC DIRECTIVE
#pragma omp atomic
@@ -3874,6 +3959,14 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp atomic
+ // expected-error@+2 {{the statement for 'atomic' must be an expression statement of form '++x;', '--x;', 'x++;', 'x--;', 'x binop= expr;', 'x = x binop expr' or 'x = expr binop x', where x is an l-value expression with scalar type}}
+ // expected-note@+1 {{expected an expression statement}}
+ {
+#pragma omp target teams distribute simd // expected-error {{OpenMP constructs may not be nested inside an atomic region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// TARGET DIRECTIVE
#pragma omp target
@@ -4090,6 +4183,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp target
+ {
+#pragma omp target teams distribute simd // expected-error {{region cannot be nested inside 'target' region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// TARGET PARALLEL DIRECTIVE
#pragma omp target parallel
@@ -4299,6 +4398,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp target parallel
+ {
+#pragma omp target teams distribute simd // expected-error {{region cannot be nested inside 'target parallel' region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// TARGET PARALLEL FOR DIRECTIVE
#pragma omp target parallel for
@@ -4562,6 +4667,12 @@ void foo() {
for (int j = 0; j < 10; ++j)
;
}
+#pragma omp target parallel for
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{region cannot be nested inside 'target parallel for' region}}
+ for (int j = 0; j < 10; ++j)
+ ;
+ }
// TEAMS DIRECTIVE
#pragma omp teams // expected-error {{orphaned 'omp teams' directives are prohibited; perhaps you forget to enclose the directive into a target region?}}
@@ -4824,6 +4935,13 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp target
+#pragma omp teams
+ {
+#pragma omp target teams distribute simd // expected-error {{region cannot be nested inside 'target' region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// TASKLOOP DIRECTIVE
#pragma omp taskloop
@@ -5078,6 +5196,12 @@ void foo() {
for (int j = 0; j < 10; ++j)
++a;
}
+#pragma omp taskloop
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // OK
+ for (int j = 0; j < 10; ++j)
+ ++a;
+ }
// DISTRIBUTE DIRECTIVE
#pragma omp target
@@ -5374,6 +5498,14 @@ void foo() {
for (int j = 0; j < 10; ++j)
;
}
+#pragma omp target
+#pragma omp teams
+#pragma omp distribute
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{region cannot be nested inside 'target' region}}
+ for (int j = 0; j < 10; ++j)
+ ;
+ }
// DISTRIBUTE PARALLEL FOR DIRECTIVE
#pragma omp target
@@ -5678,6 +5810,14 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp target
+#pragma omp teams
+#pragma omp distribute parallel for
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{region cannot be nested inside 'target' region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// DISTRIBUTE PARALLEL FOR SIMD DIRECTIVE
#pragma omp target
@@ -5990,6 +6130,14 @@ void foo() {
for (int i = 0; i < 10; ++i)
++a;
}
+#pragma omp target
+#pragma omp teams
+#pragma omp distribute parallel for simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ++a;
+ }
// TARGET SIMD DIRECTIVE
#pragma omp target simd
@@ -6207,6 +6355,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
++a;
}
+#pragma omp target simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ++a;
+ }
// TEAMS DISTRIBUTE DIRECTIVE
#pragma omp teams distribute // expected-error {{orphaned 'omp teams distribute' directives are prohibited; perhaps you forget to enclose the directive into a target region?}}
@@ -6463,6 +6617,13 @@ void foo() {
for (int i = 0; i < 10; ++i)
++a;
}
+#pragma omp target
+#pragma omp teams distribute
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{region cannot be nested inside 'target' region}}
+ for (int i = 0; i < 10; ++i)
+ ++a;
+ }
// TEAMS DISTRIBUTE DIRECTIVE
#pragma omp teams distribute // expected-error {{orphaned 'omp teams distribute' directives are prohibited; perhaps you forget to enclose the directive into a target region?}}
@@ -6739,6 +6900,13 @@ void foo() {
for (int i = 0; i < 10; ++i)
++a;
}
+#pragma omp target
+#pragma omp teams distribute
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{region cannot be nested inside 'target' region}}
+ for (int i = 0; i < 10; ++i)
+ ++a;
+ }
// TEAMS DISTRIBUTE SIMD DIRECTIVE
#pragma omp teams distribute simd // expected-error {{orphaned 'omp teams distribute simd' directives are prohibited; perhaps you forget to enclose the directive into a target region?}}
@@ -7015,6 +7183,13 @@ void foo() {
for (int i = 0; i < 10; ++i)
++a;
}
+#pragma omp target
+#pragma omp teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ++a;
+ }
// TEAMS DISTRIBUTE PARALLEL FOR SIMD DIRECTIVE
#pragma omp teams distribute parallel for simd // expected-error {{orphaned 'omp teams distribute parallel for simd' directives are prohibited; perhaps you forget to enclose the directive into a target region?}}
@@ -7291,6 +7466,13 @@ void foo() {
for (int i = 0; i < 10; ++i)
++a;
}
+#pragma omp target
+#pragma omp teams distribute parallel for simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ++a;
+ }
// TEAMS DISTRIBUTE PARALLEL FOR DIRECTIVE
#pragma omp teams distribute parallel for // expected-error {{orphaned 'omp teams distribute parallel for' directives are prohibited; perhaps you forget to enclose the directive into a target region?}}
@@ -7567,6 +7749,13 @@ void foo() {
for (int i = 0; i < 10; ++i)
++a;
}
+#pragma omp target
+#pragma omp teams distribute parallel for
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{region cannot be nested inside 'target' region}}
+ for (int i = 0; i < 10; ++i)
+ ++a;
+ }
// TARGET TEAMS DIRECTIVE
#pragma omp target teams
@@ -7782,6 +7971,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp target teams
+ {
+#pragma omp target teams distribute simd // expected-error {{region cannot be nested inside 'target teams' region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// TARGET TEAMS DISTRIBUTE DIRECTIVE
#pragma omp target teams distribute // OK
@@ -8019,6 +8214,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp target teams distribute
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{region cannot be nested inside 'target teams distribute' region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// TARGET TEAMS DISTRIBUTE PARALLEL FOR DIRECTIVE
#pragma omp target teams distribute parallel for // OK
@@ -8256,6 +8457,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp target teams distribute parallel for
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{region cannot be nested inside 'target teams distribute parallel for' region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// TARGET TEAMS DISTRIBUTE PARALLEL FOR SIMD DIRECTIVE
#pragma omp target teams distribute parallel for simd // OK
@@ -8493,6 +8700,255 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp target teams distribute parallel for simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+
+// TARGET TEAMS DISTRIBUTE SIMD DIRECTIVE
+#pragma omp target teams distribute simd // OK
+ for (int i = 0; i < 10; ++i)
+ ;
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp distribute parallel for simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp distribute // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp for // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp simd // expected-warning {{OpenMP only allows an ordered construct with the simd clause nested in a simd construct}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp for simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp parallel // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp sections // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ {
+ bar();
+ }
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp section // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ {
+ bar();
+ }
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp single // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ {
+ bar();
+ }
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp master // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ {
+ bar();
+ }
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp critical // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ {
+ bar();
+ }
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp parallel // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ {
+#pragma omp single
+ {
+ bar();
+ }
+ }
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp parallel for // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp parallel for simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp parallel sections // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ {
+ bar();
+ }
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp task // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ {
+ bar();
+ }
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp taskyield // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ bar();
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp barrier // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ bar();
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp taskwait // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ bar();
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp flush // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ bar();
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp ordered // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ bar();
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp atomic // expected-error {{OpenMP constructs may not be nested inside a simd region}}OK
+ ++a;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ ++a;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target parallel // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ ++a;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target parallel for // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target enter data map(to: a) // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ ++a;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target exit data map(from: a) // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ ++a;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp teams // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ ++a;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target update to(a) // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ ++a;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp distribute simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ++a;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ++a;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp teams distribute // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ++a;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp teams distribute simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ++a;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp teams distribute parallel for simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ++a;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp teams distribute parallel for // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ a++;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute parallel for // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute parallel for simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
}
@@ -8700,6 +9156,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp parallel
+ {
+#pragma omp target teams distribute simd // OK
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// SIMD DIRECTIVE
#pragma omp simd
@@ -8929,6 +9391,12 @@ void foo() {
for (int j = 0; j < 10; ++j)
;
}
+#pragma omp simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int j = 0; j < 10; ++j)
+ ;
+ }
// FOR DIRECTIVE
#pragma omp for
@@ -9178,6 +9646,12 @@ void foo() {
for (int j = 0; j < 10; ++j)
;
}
+#pragma omp for
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // OK
+ for (int j = 0; j < 10; ++j)
+ ;
+ }
// FOR SIMD DIRECTIVE
#pragma omp for simd
@@ -9407,6 +9881,12 @@ void foo() {
for (int j = 0; j < 10; ++j)
;
}
+#pragma omp for simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int j = 0; j < 10; ++j)
+ ;
+ }
// SECTIONS DIRECTIVE
#pragma omp sections
@@ -9645,6 +10125,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp sections
+ {
+#pragma omp target teams distribute simd // OK
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// SECTION DIRECTIVE
#pragma omp section // expected-error {{orphaned 'omp section' directives are prohibited, it must be closely nested to a sections region}}
@@ -9984,6 +10470,13 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp sections
+ {
+#pragma omp section
+#pragma omp target teams distribute simd // OK
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// SINGLE DIRECTIVE
#pragma omp single
@@ -10223,6 +10716,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp single
+ {
+#pragma omp target teams distribute simd // OK
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// MASTER DIRECTIVE
#pragma omp master
@@ -10472,6 +10971,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp master
+ {
+#pragma omp target teams distribute simd // OK
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// CRITICAL DIRECTIVE
#pragma omp critical
@@ -10740,6 +11245,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp critical
+ {
+#pragma omp target teams distribute simd // OK
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// PARALLEL FOR DIRECTIVE
#pragma omp parallel for
@@ -11004,6 +11515,12 @@ void foo() {
for (int j = 0; j < 10; ++j)
;
}
+#pragma omp parallel for
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // OK
+ for (int j = 0; j < 10; ++j)
+ ;
+ }
// PARALLEL FOR SIMD DIRECTIVE
#pragma omp parallel for simd
@@ -11268,6 +11785,12 @@ void foo() {
for (int j = 0; j < 10; ++j)
;
}
+#pragma omp parallel for simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int j = 0; j < 10; ++j)
+ ;
+ }
// PARALLEL SECTIONS DIRECTIVE
#pragma omp parallel sections
@@ -11516,6 +12039,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp parallel sections
+ {
+#pragma omp target teams distribute simd // OK
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// TASK DIRECTIVE
#pragma omp task
@@ -11714,6 +12243,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp task
+ {
+#pragma omp target teams distribute simd // OK
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// ATOMIC DIRECTIVE
#pragma omp atomic
@@ -12029,6 +12564,14 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp atomic
+ // expected-error@+2 {{the statement for 'atomic' must be an expression statement of form '++x;', '--x;', 'x++;', 'x--;', 'x binop= expr;', 'x = x binop expr' or 'x = expr binop x', where x is an l-value expression with scalar type}}
+ // expected-note@+1 {{expected an expression statement}}
+ {
+#pragma omp target teams distribute simd // expected-error {{OpenMP constructs may not be nested inside an atomic region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// TARGET DIRECTIVE
#pragma omp target
@@ -12241,6 +12784,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp target
+ {
+#pragma omp target teams distribute simd // expected-error {{region cannot be nested inside 'target' region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// TARGET PARALLEL DIRECTIVE
#pragma omp target parallel
@@ -12450,6 +12999,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp target parallel
+ {
+#pragma omp target teams distribute simd // expected-error {{region cannot be nested inside 'target parallel' region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// TARGET PARALLEL FOR DIRECTIVE
#pragma omp target parallel for
@@ -12714,6 +13269,12 @@ void foo() {
for (int j = 0; j < 10; ++j)
;
}
+#pragma omp target parallel for
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{region cannot be nested inside 'target parallel for' region}}
+ for (int j = 0; j < 10; ++j)
+ ;
+ }
// TEAMS DIRECTIVE
#pragma omp target
@@ -12978,6 +13539,13 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp target
+#pragma omp teams
+ {
+#pragma omp target teams distribute simd // expected-error {{region cannot be nested inside 'target' region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// TASKLOOP DIRECTIVE
#pragma omp taskloop
@@ -13232,6 +13800,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp taskloop
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // OK
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// DISTRIBUTE DIRECTIVE
#pragma omp target
@@ -13537,6 +14111,14 @@ void foo() {
for (int i = 0; i < 10; ++i)
++a;
}
+#pragma omp target
+#pragma omp teams
+#pragma omp distribute
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{region cannot be nested inside 'target' region}}
+ for (int i = 0; i < 10; ++i)
+ ++a;
+ }
// DISTRIBUTE PARALLEL FOR DIRECTIVE
#pragma omp target
@@ -13850,6 +14432,14 @@ void foo() {
for (int i = 0; i < 10; ++i)
++a;
}
+#pragma omp target
+#pragma omp teams
+#pragma omp distribute parallel for
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{region cannot be nested inside 'target' region}}
+ for (int i = 0; i < 10; ++i)
+ ++a;
+ }
// DISTRIBUTE PARALLEL FOR SIMD DIRECTIVE
#pragma omp target
@@ -14154,6 +14744,14 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp target
+#pragma omp teams
+#pragma omp distribute parallel for simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// DISTRIBUTE SIMD DIRECTIVE
#pragma omp target
@@ -14458,6 +15056,14 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp target
+#pragma omp teams
+#pragma omp distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// TARGET SIMD DIRECTIVE
#pragma omp target simd
@@ -14686,6 +15292,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp target simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// TEAMS DISTRIBUTE DIRECTIVE
#pragma omp teams distribute // expected-error {{orphaned 'omp teams distribute' directives are prohibited; perhaps you forget to enclose the directive into a target region?}}
@@ -14962,6 +15574,13 @@ void foo() {
for (int i = 0; i < 10; ++i)
++a;
}
+#pragma omp target
+#pragma omp teams distribute
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{region cannot be nested inside 'target' region}}
+ for (int i = 0; i < 10; ++i)
+ ++a;
+ }
// TEAMS DISTRIBUTE SIMD DIRECTIVE
#pragma omp teams distribute simd // expected-error {{orphaned 'omp teams distribute simd' directives are prohibited; perhaps you forget to enclose the directive into a target region?}}
@@ -15238,6 +15857,13 @@ void foo() {
for (int i = 0; i < 10; ++i)
++a;
}
+#pragma omp target
+#pragma omp teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ++a;
+ }
// TEAMS DISTRIBUTE PARALLEL FOR SIMD DIRECTIVE
#pragma omp teams distribute parallel for simd // expected-error {{orphaned 'omp teams distribute parallel for simd' directives are prohibited; perhaps you forget to enclose the directive into a target region?}}
@@ -15514,6 +16140,13 @@ void foo() {
for (int i = 0; i < 10; ++i)
++a;
}
+#pragma omp target
+#pragma omp teams distribute parallel for simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ++a;
+ }
// TEAMS DISTRIBUTE PARALLEL FOR DIRECTIVE
#pragma omp teams distribute parallel for // expected-error {{orphaned 'omp teams distribute parallel for' directives are prohibited; perhaps you forget to enclose the directive into a target region?}}
@@ -15790,6 +16423,13 @@ void foo() {
for (int i = 0; i < 10; ++i)
++a;
}
+#pragma omp target
+#pragma omp teams distribute parallel for
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{region cannot be nested inside 'target' region}}
+ for (int i = 0; i < 10; ++i)
+ ++a;
+ }
// TARGET TEAMS DIRECTIVE
#pragma omp target teams
@@ -16005,6 +16645,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
+#pragma omp target teams
+ {
+#pragma omp target teams distribute simd // expected-error {{region cannot be nested inside 'target teams' region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
// TARGET TEAMS DISTRIBUTE DIRECTIVE
#pragma omp target teams distribute // OK
@@ -16242,6 +16888,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
++a;
}
+#pragma omp target teams distribute
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{region cannot be nested inside 'target teams distribute' region}}
+ for (int i = 0; i < 10; ++i)
+ ++a;
+ }
// TARGET TEAMS DISTRIBUTE PARALLEL FOR DIRECTIVE
#pragma omp target teams distribute parallel for // OK
@@ -16479,6 +17131,12 @@ void foo() {
for (int i = 0; i < 10; ++i)
++a;
}
+#pragma omp target teams distribute parallel for
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{region cannot be nested inside 'target teams distribute parallel for' region}}
+ for (int i = 0; i < 10; ++i)
+ ++a;
+ }
// TARGET TEAMS DISTRIBUTE PARALLEL FOR SIMD DIRECTIVE
#pragma omp target teams distribute parallel for simd // OK
@@ -16716,7 +17374,256 @@ void foo() {
for (int i = 0; i < 10; ++i)
;
}
-
+#pragma omp target teams distribute parallel for simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+
+// TARGET TEAMS DISTRIBUTE SIMD DIRECTIVE
+#pragma omp target teams distribute simd // OK
+ for (int i = 0; i < 10; ++i)
+ ;
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp distribute parallel for simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp distribute // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp for // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp simd // expected-warning {{OpenMP only allows an ordered construct with the simd clause nested in a simd construct}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp for simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp parallel // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp sections // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ {
+ bar();
+ }
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp section // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ {
+ bar();
+ }
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp single // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ {
+ bar();
+ }
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp master // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ {
+ bar();
+ }
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp critical // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ {
+ bar();
+ }
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp parallel // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ {
+#pragma omp single
+ {
+ bar();
+ }
+ }
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp parallel for // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp parallel for simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp parallel sections // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ {
+ bar();
+ }
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp task // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ {
+ bar();
+ }
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp taskyield // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ bar();
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp barrier // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ bar();
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp taskwait // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ bar();
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp flush // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ bar();
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp ordered // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ bar();
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp atomic // expected-error {{OpenMP constructs may not be nested inside a simd region}}OK
+ ++a;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ ++a;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target parallel // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ ++a;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target parallel for // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target enter data map(to: a) // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ ++a;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target exit data map(from: a) // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ ++a;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp teams // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ ++a;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target update to(a) // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ ++a;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp distribute simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ++a;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ++a;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp teams distribute // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ++a;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp teams distribute simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ++a;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp teams distribute parallel for simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ++a;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp teams distribute parallel for // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ a++;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute parallel for // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute parallel for simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+#pragma omp target teams distribute simd // expected-error {{OpenMP constructs may not be nested inside a simd region}}
+ for (int i = 0; i < 10; ++i)
+ ;
+ }
+
return foo<int>();
}
diff --git a/test/OpenMP/nvptx_parallel_codegen.cpp b/test/OpenMP/nvptx_parallel_codegen.cpp
new file mode 100644
index 0000000000000..224f245696690
--- /dev/null
+++ b/test/OpenMP/nvptx_parallel_codegen.cpp
@@ -0,0 +1,317 @@
+// Test target codegen - host bc file has to be created first.
+// RUN: %clang_cc1 -verify -fopenmp -x c++ -triple powerpc64le-unknown-unknown -fopenmp-targets=nvptx64-nvidia-cuda -emit-llvm-bc %s -o %t-ppc-host.bc
+// RUN: %clang_cc1 -verify -fopenmp -x c++ -triple nvptx64-unknown-unknown -fopenmp-targets=nvptx64-nvidia-cuda -emit-llvm %s -fopenmp-is-device -fopenmp-host-ir-file-path %t-ppc-host.bc -o - | FileCheck %s --check-prefix CHECK --check-prefix CHECK-64
+// RUN: %clang_cc1 -verify -fopenmp -x c++ -triple i386-unknown-unknown -fopenmp-targets=nvptx-nvidia-cuda -emit-llvm-bc %s -o %t-x86-host.bc
+// RUN: %clang_cc1 -verify -fopenmp -x c++ -triple nvptx-unknown-unknown -fopenmp-targets=nvptx-nvidia-cuda -emit-llvm %s -fopenmp-is-device -fopenmp-host-ir-file-path %t-x86-host.bc -o - | FileCheck %s --check-prefix CHECK --check-prefix CHECK-32
+// RUN: %clang_cc1 -verify -fopenmp -fexceptions -fcxx-exceptions -x c++ -triple nvptx-unknown-unknown -fopenmp-targets=nvptx-nvidia-cuda -emit-llvm %s -fopenmp-is-device -fopenmp-host-ir-file-path %t-x86-host.bc -o - | FileCheck %s --check-prefix CHECK --check-prefix CHECK-32
+// expected-no-diagnostics
+#ifndef HEADER
+#define HEADER
+
+template<typename tx>
+tx ftemplate(int n) {
+ tx a = 0;
+ short aa = 0;
+ tx b[10];
+
+ #pragma omp target if(0)
+ {
+ #pragma omp parallel
+ {
+ int a = 41;
+ }
+ a += 1;
+ }
+
+ #pragma omp target
+ {
+ #pragma omp parallel
+ {
+ int a = 42;
+ }
+ #pragma omp parallel if(0)
+ {
+ int a = 43;
+ }
+ #pragma omp parallel if(1)
+ {
+ int a = 44;
+ }
+ a += 1;
+ }
+
+ #pragma omp target if(n>40)
+ {
+ #pragma omp parallel if(n>1000)
+ {
+ int a = 45;
+ }
+ a += 1;
+ aa += 1;
+ b[2] += 1;
+ }
+
+ return a;
+}
+
+int bar(int n){
+ int a = 0;
+
+ a += ftemplate<int>(n);
+
+ return a;
+}
+
+ // CHECK-NOT: define {{.*}}void {{@__omp_offloading_.+template.+l17}}_worker()
+
+
+
+
+
+
+ // CHECK-LABEL: define {{.*}}void {{@__omp_offloading_.+template.+l26}}_worker()
+ // CHECK-DAG: [[OMP_EXEC_STATUS:%.+]] = alloca i8,
+ // CHECK-DAG: [[OMP_WORK_FN:%.+]] = alloca i8*,
+ // CHECK: store i8* null, i8** [[OMP_WORK_FN]],
+ // CHECK: store i8 0, i8* [[OMP_EXEC_STATUS]],
+ // CHECK: br label {{%?}}[[AWAIT_WORK:.+]]
+ //
+ // CHECK: [[AWAIT_WORK]]
+ // CHECK: call void @llvm.nvvm.barrier0()
+ // CHECK: [[KPR:%.+]] = call i1 @__kmpc_kernel_parallel(i8** [[OMP_WORK_FN]])
+ // CHECK: [[KPRB:%.+]] = zext i1 [[KPR]] to i8
+ // store i8 [[KPRB]], i8* [[OMP_EXEC_STATUS]], align 1
+ // CHECK: [[WORK:%.+]] = load i8*, i8** [[OMP_WORK_FN]],
+ // CHECK: [[SHOULD_EXIT:%.+]] = icmp eq i8* [[WORK]], null
+ // CHECK: br i1 [[SHOULD_EXIT]], label {{%?}}[[EXIT:.+]], label {{%?}}[[SEL_WORKERS:.+]]
+ //
+ // CHECK: [[SEL_WORKERS]]
+ // CHECK: [[ST:%.+]] = load i8, i8* [[OMP_EXEC_STATUS]]
+ // CHECK: [[IS_ACTIVE:%.+]] = icmp ne i8 [[ST]], 0
+ // CHECK: br i1 [[IS_ACTIVE]], label {{%?}}[[EXEC_PARALLEL:.+]], label {{%?}}[[BAR_PARALLEL:.+]]
+ //
+ // CHECK: [[EXEC_PARALLEL]]
+ // CHECK: [[WF1:%.+]] = load i8*, i8** [[OMP_WORK_FN]],
+ // CHECK: [[WM1:%.+]] = icmp eq i8* [[WF1]], bitcast (void (i32*, i32*)* [[PARALLEL_FN1:@.+]] to i8*)
+ // CHECK: br i1 [[WM1]], label {{%?}}[[EXEC_PFN1:.+]], label {{%?}}[[CHECK_NEXT1:.+]]
+ //
+ // CHECK: [[EXEC_PFN1]]
+ // CHECK: call void [[PARALLEL_FN1]](
+ // CHECK: br label {{%?}}[[TERM_PARALLEL:.+]]
+ //
+ // CHECK: [[CHECK_NEXT1]]
+ // CHECK: [[WF2:%.+]] = load i8*, i8** [[OMP_WORK_FN]],
+ // CHECK: [[WM2:%.+]] = icmp eq i8* [[WF2]], bitcast (void (i32*, i32*)* [[PARALLEL_FN2:@.+]] to i8*)
+ // CHECK: br i1 [[WM2]], label {{%?}}[[EXEC_PFN2:.+]], label {{%?}}[[CHECK_NEXT2:.+]]
+ //
+ // CHECK: [[EXEC_PFN2]]
+ // CHECK: call void [[PARALLEL_FN2]](
+ // CHECK: br label {{%?}}[[TERM_PARALLEL:.+]]
+ //
+ // CHECK: [[CHECK_NEXT2]]
+ // CHECK: br label {{%?}}[[TERM_PARALLEL:.+]]
+ //
+ // CHECK: [[TERM_PARALLEL]]
+ // CHECK: call void @__kmpc_kernel_end_parallel()
+ // CHECK: br label {{%?}}[[BAR_PARALLEL]]
+ //
+ // CHECK: [[BAR_PARALLEL]]
+ // CHECK: call void @llvm.nvvm.barrier0()
+ // CHECK: br label {{%?}}[[AWAIT_WORK]]
+ //
+ // CHECK: [[EXIT]]
+ // CHECK: ret void
+
+ // CHECK: define {{.*}}void [[T6:@__omp_offloading_.+template.+l26]](i[[SZ:32|64]]
+ // Create local storage for each capture.
+ // CHECK: [[LOCAL_A:%.+]] = alloca i[[SZ]],
+ // CHECK-DAG: store i[[SZ]] [[ARG_A:%.+]], i[[SZ]]* [[LOCAL_A]]
+ // Store captures in the context.
+ // CHECK-64-DAG:[[REF_A:%.+]] = bitcast i[[SZ]]* [[LOCAL_A]] to i32*
+ //
+ // CHECK-DAG: [[TID:%.+]] = call i32 @llvm.nvvm.read.ptx.sreg.tid.x()
+ // CHECK-DAG: [[NTH:%.+]] = call i32 @llvm.nvvm.read.ptx.sreg.ntid.x()
+ // CHECK-DAG: [[WS:%.+]] = call i32 @llvm.nvvm.read.ptx.sreg.warpsize()
+ // CHECK-DAG: [[TH_LIMIT:%.+]] = sub i32 [[NTH]], [[WS]]
+ // CHECK: [[IS_WORKER:%.+]] = icmp ult i32 [[TID]], [[TH_LIMIT]]
+ // CHECK: br i1 [[IS_WORKER]], label {{%?}}[[WORKER:.+]], label {{%?}}[[CHECK_MASTER:.+]]
+ //
+ // CHECK: [[WORKER]]
+ // CHECK: {{call|invoke}} void [[T6]]_worker()
+ // CHECK: br label {{%?}}[[EXIT:.+]]
+ //
+ // CHECK: [[CHECK_MASTER]]
+ // CHECK-DAG: [[CMTID:%.+]] = call i32 @llvm.nvvm.read.ptx.sreg.tid.x()
+ // CHECK-DAG: [[CMNTH:%.+]] = call i32 @llvm.nvvm.read.ptx.sreg.ntid.x()
+ // CHECK-DAG: [[CMWS:%.+]] = call i32 @llvm.nvvm.read.ptx.sreg.warpsize()
+ // CHECK: [[IS_MASTER:%.+]] = icmp eq i32 [[CMTID]],
+ // CHECK: br i1 [[IS_MASTER]], label {{%?}}[[MASTER:.+]], label {{%?}}[[EXIT]]
+ //
+ // CHECK: [[MASTER]]
+ // CHECK-DAG: [[MNTH:%.+]] = call i32 @llvm.nvvm.read.ptx.sreg.ntid.x()
+ // CHECK-DAG: [[MWS:%.+]] = call i32 @llvm.nvvm.read.ptx.sreg.warpsize()
+ // CHECK: [[MTMP1:%.+]] = sub i32 [[MNTH]], [[MWS]]
+ // CHECK: call void @__kmpc_kernel_init(i32 [[MTMP1]]
+ // CHECK: call void @__kmpc_kernel_prepare_parallel(i8* bitcast (void (i32*, i32*)* [[PARALLEL_FN1]] to i8*))
+ // CHECK: call void @llvm.nvvm.barrier0()
+ // CHECK: call void @llvm.nvvm.barrier0()
+ // CHECK: call void @__kmpc_serialized_parallel(
+ // CHECK: {{call|invoke}} void [[PARALLEL_FN3:@.+]](
+ // CHECK: call void @__kmpc_end_serialized_parallel(
+ // CHECK: call void @__kmpc_kernel_prepare_parallel(i8* bitcast (void (i32*, i32*)* [[PARALLEL_FN2]] to i8*))
+ // CHECK: call void @llvm.nvvm.barrier0()
+ // CHECK: call void @llvm.nvvm.barrier0()
+ // CHECK-64-DAG: load i32, i32* [[REF_A]]
+ // CHECK-32-DAG: load i32, i32* [[LOCAL_A]]
+ // CHECK: br label {{%?}}[[TERMINATE:.+]]
+ //
+ // CHECK: [[TERMINATE]]
+ // CHECK: call void @__kmpc_kernel_deinit()
+ // CHECK: call void @llvm.nvvm.barrier0()
+ // CHECK: br label {{%?}}[[EXIT]]
+ //
+ // CHECK: [[EXIT]]
+ // CHECK: ret void
+
+ // CHECK-DAG: define internal void [[PARALLEL_FN1]](
+ // CHECK: [[A:%.+]] = alloca i[[SZ:32|64]],
+ // CHECK: store i[[SZ]] 42, i[[SZ]]* %a,
+ // CHECK: ret void
+
+ // CHECK-DAG: define internal void [[PARALLEL_FN3]](
+ // CHECK: [[A:%.+]] = alloca i[[SZ:32|64]],
+ // CHECK: store i[[SZ]] 43, i[[SZ]]* %a,
+ // CHECK: ret void
+
+ // CHECK-DAG: define internal void [[PARALLEL_FN2]](
+ // CHECK: [[A:%.+]] = alloca i[[SZ:32|64]],
+ // CHECK: store i[[SZ]] 44, i[[SZ]]* %a,
+ // CHECK: ret void
+
+
+
+
+
+
+
+ // CHECK-LABEL: define {{.*}}void {{@__omp_offloading_.+template.+l43}}_worker()
+ // CHECK-DAG: [[OMP_EXEC_STATUS:%.+]] = alloca i8,
+ // CHECK-DAG: [[OMP_WORK_FN:%.+]] = alloca i8*,
+ // CHECK: store i8* null, i8** [[OMP_WORK_FN]],
+ // CHECK: store i8 0, i8* [[OMP_EXEC_STATUS]],
+ // CHECK: br label {{%?}}[[AWAIT_WORK:.+]]
+ //
+ // CHECK: [[AWAIT_WORK]]
+ // CHECK: call void @llvm.nvvm.barrier0()
+ // CHECK: [[KPR:%.+]] = call i1 @__kmpc_kernel_parallel(i8** [[OMP_WORK_FN]])
+ // CHECK: [[KPRB:%.+]] = zext i1 [[KPR]] to i8
+ // store i8 [[KPRB]], i8* [[OMP_EXEC_STATUS]], align 1
+ // CHECK: [[WORK:%.+]] = load i8*, i8** [[OMP_WORK_FN]],
+ // CHECK: [[SHOULD_EXIT:%.+]] = icmp eq i8* [[WORK]], null
+ // CHECK: br i1 [[SHOULD_EXIT]], label {{%?}}[[EXIT:.+]], label {{%?}}[[SEL_WORKERS:.+]]
+ //
+ // CHECK: [[SEL_WORKERS]]
+ // CHECK: [[ST:%.+]] = load i8, i8* [[OMP_EXEC_STATUS]]
+ // CHECK: [[IS_ACTIVE:%.+]] = icmp ne i8 [[ST]], 0
+ // CHECK: br i1 [[IS_ACTIVE]], label {{%?}}[[EXEC_PARALLEL:.+]], label {{%?}}[[BAR_PARALLEL:.+]]
+ //
+ // CHECK: [[EXEC_PARALLEL]]
+ // CHECK: [[WF:%.+]] = load i8*, i8** [[OMP_WORK_FN]],
+ // CHECK: [[WM:%.+]] = icmp eq i8* [[WF]], bitcast (void (i32*, i32*)* [[PARALLEL_FN4:@.+]] to i8*)
+ // CHECK: br i1 [[WM]], label {{%?}}[[EXEC_PFN:.+]], label {{%?}}[[CHECK_NEXT:.+]]
+ //
+ // CHECK: [[EXEC_PFN]]
+ // CHECK: call void [[PARALLEL_FN4]](
+ // CHECK: br label {{%?}}[[TERM_PARALLEL:.+]]
+ //
+ // CHECK: [[CHECK_NEXT]]
+ // CHECK: br label {{%?}}[[TERM_PARALLEL:.+]]
+ //
+ // CHECK: [[TERM_PARALLEL]]
+ // CHECK: call void @__kmpc_kernel_end_parallel()
+ // CHECK: br label {{%?}}[[BAR_PARALLEL]]
+ //
+ // CHECK: [[BAR_PARALLEL]]
+ // CHECK: call void @llvm.nvvm.barrier0()
+ // CHECK: br label {{%?}}[[AWAIT_WORK]]
+ //
+ // CHECK: [[EXIT]]
+ // CHECK: ret void
+
+ // CHECK: define {{.*}}void [[T6:@__omp_offloading_.+template.+l43]](i[[SZ:32|64]]
+ // Create local storage for each capture.
+ // CHECK: [[LOCAL_N:%.+]] = alloca i[[SZ]],
+ // CHECK: [[LOCAL_A:%.+]] = alloca i[[SZ]],
+ // CHECK: [[LOCAL_AA:%.+]] = alloca i[[SZ]],
+ // CHECK: [[LOCAL_B:%.+]] = alloca [10 x i32]*
+ // CHECK-DAG: store i[[SZ]] [[ARG_N:%.+]], i[[SZ]]* [[LOCAL_N]]
+ // CHECK-DAG: store i[[SZ]] [[ARG_A:%.+]], i[[SZ]]* [[LOCAL_A]]
+ // CHECK-DAG: store i[[SZ]] [[ARG_AA:%.+]], i[[SZ]]* [[LOCAL_AA]]
+ // CHECK-DAG: store [10 x i32]* [[ARG_B:%.+]], [10 x i32]** [[LOCAL_B]]
+ // Store captures in the context.
+ // CHECK-64-DAG:[[REF_N:%.+]] = bitcast i[[SZ]]* [[LOCAL_N]] to i32*
+ // CHECK-64-DAG:[[REF_A:%.+]] = bitcast i[[SZ]]* [[LOCAL_A]] to i32*
+ // CHECK-DAG: [[REF_AA:%.+]] = bitcast i[[SZ]]* [[LOCAL_AA]] to i16*
+ // CHECK-DAG: [[REF_B:%.+]] = load [10 x i32]*, [10 x i32]** [[LOCAL_B]],
+ //
+ // CHECK-DAG: [[TID:%.+]] = call i32 @llvm.nvvm.read.ptx.sreg.tid.x()
+ // CHECK-DAG: [[NTH:%.+]] = call i32 @llvm.nvvm.read.ptx.sreg.ntid.x()
+ // CHECK-DAG: [[WS:%.+]] = call i32 @llvm.nvvm.read.ptx.sreg.warpsize()
+ // CHECK-DAG: [[TH_LIMIT:%.+]] = sub i32 [[NTH]], [[WS]]
+ // CHECK: [[IS_WORKER:%.+]] = icmp ult i32 [[TID]], [[TH_LIMIT]]
+ // CHECK: br i1 [[IS_WORKER]], label {{%?}}[[WORKER:.+]], label {{%?}}[[CHECK_MASTER:.+]]
+ //
+ // CHECK: [[WORKER]]
+ // CHECK: {{call|invoke}} void [[T6]]_worker()
+ // CHECK: br label {{%?}}[[EXIT:.+]]
+ //
+ // CHECK: [[CHECK_MASTER]]
+ // CHECK-DAG: [[CMTID:%.+]] = call i32 @llvm.nvvm.read.ptx.sreg.tid.x()
+ // CHECK-DAG: [[CMNTH:%.+]] = call i32 @llvm.nvvm.read.ptx.sreg.ntid.x()
+ // CHECK-DAG: [[CMWS:%.+]] = call i32 @llvm.nvvm.read.ptx.sreg.warpsize()
+ // CHECK: [[IS_MASTER:%.+]] = icmp eq i32 [[CMTID]],
+ // CHECK: br i1 [[IS_MASTER]], label {{%?}}[[MASTER:.+]], label {{%?}}[[EXIT]]
+ //
+ // CHECK: [[MASTER]]
+ // CHECK-DAG: [[MNTH:%.+]] = call i32 @llvm.nvvm.read.ptx.sreg.ntid.x()
+ // CHECK-DAG: [[MWS:%.+]] = call i32 @llvm.nvvm.read.ptx.sreg.warpsize()
+ // CHECK: [[MTMP1:%.+]] = sub i32 [[MNTH]], [[MWS]]
+ // CHECK: call void @__kmpc_kernel_init(i32 [[MTMP1]]
+ // CHECK-64: [[N:%.+]] = load i32, i32* [[REF_N]],
+ // CHECK-32: [[N:%.+]] = load i32, i32* [[LOCAL_N]],
+ // CHECK: [[CMP:%.+]] = icmp sgt i32 [[N]], 1000
+ // CHECK: br i1 [[CMP]], label {{%?}}[[IF_THEN:.+]], label {{%?}}[[IF_ELSE:.+]]
+ //
+ // CHECK: [[IF_THEN]]
+ // CHECK: call void @__kmpc_kernel_prepare_parallel(i8* bitcast (void (i32*, i32*)* [[PARALLEL_FN4]] to i8*))
+ // CHECK: call void @llvm.nvvm.barrier0()
+ // CHECK: call void @llvm.nvvm.barrier0()
+ // CHECK: br label {{%?}}[[IF_END:.+]]
+ //
+ // CHECK: [[IF_ELSE]]
+ // CHECK: call void @__kmpc_serialized_parallel(
+ // CHECK: {{call|invoke}} void [[PARALLEL_FN4]](
+ // CHECK: call void @__kmpc_end_serialized_parallel(
+ // br label [[IF_END]]
+ //
+ // CHECK: [[IF_END]]
+ // CHECK-64-DAG: load i32, i32* [[REF_A]]
+ // CHECK-32-DAG: load i32, i32* [[LOCAL_A]]
+ // CHECK-DAG: load i16, i16* [[REF_AA]]
+ // CHECK-DAG: getelementptr inbounds [10 x i32], [10 x i32]* [[REF_B]], i[[SZ]] 0, i[[SZ]] 2
+ //
+ // CHECK: br label {{%?}}[[TERMINATE:.+]]
+ //
+ // CHECK: [[TERMINATE]]
+ // CHECK: call void @__kmpc_kernel_deinit()
+ // CHECK: call void @llvm.nvvm.barrier0()
+ // CHECK: br label {{%?}}[[EXIT]]
+ //
+ // CHECK: [[EXIT]]
+ // CHECK: ret void
+
+ // CHECK: define internal void [[PARALLEL_FN4]](
+ // CHECK: [[A:%.+]] = alloca i[[SZ:32|64]],
+ // CHECK: store i[[SZ]] 45, i[[SZ]]* %a,
+ // CHECK: ret void
+#endif
diff --git a/test/OpenMP/target_parallel_for_is_device_ptr_ast_print.cpp b/test/OpenMP/target_parallel_for_is_device_ptr_ast_print.cpp
new file mode 100644
index 0000000000000..eaa0941a388e8
--- /dev/null
+++ b/test/OpenMP/target_parallel_for_is_device_ptr_ast_print.cpp
@@ -0,0 +1,315 @@
+// RUN: %clang_cc1 -verify -fopenmp -std=c++11 -ast-print %s | FileCheck %s
+// RUN: %clang_cc1 -fopenmp -x c++ -std=c++11 -emit-pch -o %t %s
+// RUN: %clang_cc1 -fopenmp -std=c++11 -include-pch %t -fsyntax-only -verify %s -ast-print | FileCheck %s
+// expected-no-diagnostics
+
+#ifndef HEADER
+#define HEADER
+
+void foo() {}
+
+struct ST {
+ int *a;
+};
+typedef int arr[10];
+typedef ST STarr[10];
+struct SA {
+ const int da[5] = { 0 };
+ ST g[10];
+ STarr &rg = g;
+ int i;
+ int &j = i;
+ int *k = &j;
+ int *&z = k;
+ int aa[10];
+ arr &raa = aa;
+ void func(int arg) {
+#pragma omp target parallel for is_device_ptr(k)
+ for (int i=0; i<100; i++) foo();
+
+#pragma omp target parallel for is_device_ptr(z)
+ for (int i=0; i<100; i++) foo();
+
+#pragma omp target parallel for is_device_ptr(aa) // OK
+ for (int i=0; i<100; i++) foo();
+
+#pragma omp target parallel for is_device_ptr(raa) // OK
+ for (int i=0; i<100; i++) foo();
+
+#pragma omp target parallel for is_device_ptr(g) // OK
+ for (int i=0; i<100; i++) foo();
+
+#pragma omp target parallel for is_device_ptr(rg) // OK
+ for (int i=0; i<100; i++) foo();
+
+#pragma omp target parallel for is_device_ptr(da) // OK
+ for (int i=0; i<100; i++) foo();
+
+ return;
+ }
+};
+// CHECK: struct SA
+// CHECK-NEXT: const int da[5] = {0};
+// CHECK-NEXT: ST g[10];
+// CHECK-NEXT: STarr &rg = this->g;
+// CHECK-NEXT: int i;
+// CHECK-NEXT: int &j = this->i;
+// CHECK-NEXT: int *k = &this->j;
+// CHECK-NEXT: int *&z = this->k;
+// CHECK-NEXT: int aa[10];
+// CHECK-NEXT: arr &raa = this->aa;
+// CHECK-NEXT: func(
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(this->k)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(this->z)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(this->aa)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(this->raa)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(this->g)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(this->rg)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(this->da)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+
+struct SB {
+ unsigned A;
+ unsigned B;
+ float Arr[100];
+ float *Ptr;
+ float *foo() {
+ return &Arr[0];
+ }
+};
+
+struct SC {
+ unsigned A : 2;
+ unsigned B : 3;
+ unsigned C;
+ unsigned D;
+ float Arr[100];
+ SB S;
+ SB ArrS[100];
+ SB *PtrS;
+ SB *&RPtrS;
+ float *Ptr;
+
+ SC(SB *&_RPtrS) : RPtrS(_RPtrS) {}
+};
+
+union SD {
+ unsigned A;
+ float B;
+};
+
+struct S1;
+extern S1 a;
+class S2 {
+ mutable int a;
+public:
+ S2():a(0) { }
+ S2(S2 &s2):a(s2.a) { }
+ static float S2s;
+ static const float S2sc;
+};
+const float S2::S2sc = 0;
+const S2 b;
+const S2 ba[5];
+class S3 {
+ int a;
+public:
+ S3():a(0) { }
+ S3(S3 &s3):a(s3.a) { }
+};
+const S3 c;
+const S3 ca[5];
+extern const int f;
+class S4 {
+ int a;
+ S4();
+ S4(const S4 &s4);
+public:
+ S4(int v):a(v) { }
+};
+class S5 {
+ int a;
+ S5():a(0) {}
+ S5(const S5 &s5):a(s5.a) { }
+public:
+ S5(int v):a(v) { }
+};
+
+S3 h;
+#pragma omp threadprivate(h)
+
+typedef struct {
+ int a;
+} S6;
+
+template <typename T>
+T tmain(T argc) {
+ const T da[5] = { 0 };
+ S6 h[10];
+ auto &rh = h;
+ T i;
+ T &j = i;
+ T *k = &j;
+ T *&z = k;
+ T aa[10];
+ auto &raa = aa;
+#pragma omp target parallel for is_device_ptr(k)
+ for (int i=0; i<100; i++) foo();
+#pragma omp target parallel for is_device_ptr(z)
+ for (int i=0; i<100; i++) foo();
+#pragma omp target parallel for is_device_ptr(aa)
+ for (int i=0; i<100; i++) foo();
+#pragma omp target parallel for is_device_ptr(raa)
+ for (int i=0; i<100; i++) foo();
+#pragma omp target parallel for is_device_ptr(h)
+ for (int i=0; i<100; i++) foo();
+#pragma omp target parallel for is_device_ptr(rh)
+ for (int i=0; i<100; i++) foo();
+#pragma omp target parallel for is_device_ptr(da)
+ for (int i=0; i<100; i++) foo();
+ return 0;
+}
+
+// CHECK: template<> int tmain<int>(int argc) {
+// CHECK-NEXT: const int da[5] = {0};
+// CHECK-NEXT: S6 h[10];
+// CHECK-NEXT: auto &rh = h;
+// CHECK-NEXT: int i;
+// CHECK-NEXT: int &j = i;
+// CHECK-NEXT: int *k = &j;
+// CHECK-NEXT: int *&z = k;
+// CHECK-NEXT: int aa[10];
+// CHECK-NEXT: auto &raa = aa;
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(k)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(z)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(aa)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(raa)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(h)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(rh)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(da)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+
+// CHECK: template<> int *tmain<int *>(int *argc) {
+// CHECK-NEXT: int *const da[5] = {0};
+// CHECK-NEXT: S6 h[10];
+// CHECK-NEXT: auto &rh = h;
+// CHECK-NEXT: int *i;
+// CHECK-NEXT: int *&j = i;
+// CHECK-NEXT: int **k = &j;
+// CHECK-NEXT: int **&z = k;
+// CHECK-NEXT: int *aa[10];
+// CHECK-NEXT: auto &raa = aa;
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(k)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(z)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(aa)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(raa)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(h)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(rh)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(da)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+
+// CHECK-LABEL: int main(int argc, char **argv) {
+int main(int argc, char **argv) {
+ const int da[5] = { 0 };
+ S6 h[10];
+ auto &rh = h;
+ int i;
+ int &j = i;
+ int *k = &j;
+ int *&z = k;
+ int aa[10];
+ auto &raa = aa;
+// CHECK-NEXT: const int da[5] = {0};
+// CHECK-NEXT: S6 h[10];
+// CHECK-NEXT: auto &rh = h;
+// CHECK-NEXT: int i;
+// CHECK-NEXT: int &j = i;
+// CHECK-NEXT: int *k = &j;
+// CHECK-NEXT: int *&z = k;
+// CHECK-NEXT: int aa[10];
+// CHECK-NEXT: auto &raa = aa;
+#pragma omp target parallel for is_device_ptr(k)
+ for (int i=0; i<100; i++) foo();
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(k)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+
+#pragma omp target parallel for is_device_ptr(z)
+ for (int i=0; i<100; i++) foo();
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(z)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+
+#pragma omp target parallel for is_device_ptr(aa)
+ for (int i=0; i<100; i++) foo();
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(aa)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+
+#pragma omp target parallel for is_device_ptr(raa)
+ for (int i=0; i<100; i++) foo();
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(raa)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+
+#pragma omp target parallel for is_device_ptr(h)
+ for (int i=0; i<100; i++) foo();
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(h)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+
+#pragma omp target parallel for is_device_ptr(rh)
+ for (int i=0; i<100; i++) foo();
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(rh)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+
+#pragma omp target parallel for is_device_ptr(da)
+ for (int i=0; i<100; i++) foo();
+// CHECK-NEXT: #pragma omp target parallel for is_device_ptr(da)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: foo();
+ return tmain<int>(argc) + *tmain<int *>(&argc);
+}
+
+
+#endif
diff --git a/test/OpenMP/target_parallel_for_is_device_ptr_messages.cpp b/test/OpenMP/target_parallel_for_is_device_ptr_messages.cpp
new file mode 100644
index 0000000000000..b3b33bf91ed0f
--- /dev/null
+++ b/test/OpenMP/target_parallel_for_is_device_ptr_messages.cpp
@@ -0,0 +1,311 @@
+// RUN: %clang_cc1 -std=c++11 -verify -fopenmp %s
+
+struct ST {
+ int *a;
+};
+typedef int arr[10];
+typedef ST STarr[10];
+typedef struct {
+ int a;
+} S;
+struct SA {
+ const int d = 5;
+ const int da[5] = { 0 };
+ ST e;
+ ST g[10];
+ STarr &rg = g;
+ int i;
+ int &j = i;
+ int *k = &j;
+ int *&z = k;
+ int aa[10];
+ arr &raa = aa;
+ S *ps;
+ void func(int arg) {
+#pragma omp target parallel for is_device_ptr // expected-error {{expected '(' after 'is_device_ptr'}}
+ for (int ii=0; ii<10; ii++)
+ ;
+#pragma omp target parallel for is_device_ptr( // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error {{expected expression}}
+ for (int ii=0; ii<10; ii++)
+ ;
+#pragma omp target parallel for is_device_ptr() // expected-error {{expected expression}}
+ for (int ii=0; ii<10; ii++)
+ ;
+#pragma omp target parallel for is_device_ptr(alloc) // expected-error {{use of undeclared identifier 'alloc'}}
+ for (int ii=0; ii<10; ii++)
+ ;
+#pragma omp target parallel for is_device_ptr(arg // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int ii=0; ii<10; ii++)
+ ;
+#pragma omp target parallel for is_device_ptr(i) // expected-error {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int ii=0; ii<10; ii++)
+ ;
+#pragma omp target parallel for is_device_ptr(j) // expected-error {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int ii=0; ii<10; ii++)
+ ;
+#pragma omp target parallel for is_device_ptr(k) // OK
+ for (int ii=0; ii<10; ii++)
+ ;
+#pragma omp target parallel for is_device_ptr(z) // OK
+ for (int ii=0; ii<10; ii++)
+ ;
+#pragma omp target parallel for is_device_ptr(aa) // OK
+ for (int ii=0; ii<10; ii++)
+ ;
+#pragma omp target parallel for is_device_ptr(raa) // OK
+ for (int ii=0; ii<10; ii++)
+ ;
+#pragma omp target parallel for is_device_ptr(e) // expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int ii=0; ii<10; ii++)
+ ;
+#pragma omp target parallel for is_device_ptr(g) // OK
+ for (int ii=0; ii<10; ii++)
+ ;
+#pragma omp target parallel for is_device_ptr(rg) // OK
+ for (int ii=0; ii<10; ii++)
+ ;
+#pragma omp target parallel for is_device_ptr(k,i,j) // expected-error2 {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int ii=0; ii<10; ii++)
+ ;
+#pragma omp target parallel for is_device_ptr(d) // expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int ii=0; ii<10; ii++)
+ ;
+#pragma omp target parallel for is_device_ptr(da) // OK
+ for (int ii=0; ii<10; ii++)
+ ;
+#pragma omp target parallel for map(ps) is_device_ptr(ps) // expected-error{{variable already marked as mapped in current construct}} expected-note{{used here}}
+ for (int ii=0; ii<10; ii++)
+ ;
+#pragma omp target parallel for is_device_ptr(ps) map(ps) // expected-error{{variable already marked as mapped in current construct}} expected-note{{used here}}
+ for (int ii=0; ii<10; ii++)
+ ;
+#pragma omp target parallel for map(ps->a) is_device_ptr(ps) // expected-error{{variable already marked as mapped in current construct}} expected-note{{used here}}
+ for (int ii=0; ii<10; ii++)
+ ;
+#pragma omp target parallel for is_device_ptr(ps) map(ps->a) // expected-error{{pointer cannot be mapped along with a section derived from itself}} expected-note{{used here}}
+ for (int ii=0; ii<10; ii++)
+ ;
+#pragma omp target parallel for firstprivate(ps) is_device_ptr(ps) // expected-error{{firstprivate variable cannot be in a is_device_ptr clause in '#pragma omp target parallel for' directive}} expected-note{{defined as firstprivate}}
+ for (int ii=0; ii<10; ii++)
+ ;
+#pragma omp target parallel for private(ps) is_device_ptr(ps) // expected-error{{private variable cannot be in a is_device_ptr clause in '#pragma omp target parallel for' directive}} expected-note{{defined as private}}
+ for (int ii=0; ii<10; ii++)
+ ;
+
+ return;
+ }
+};
+struct SB {
+ unsigned A;
+ unsigned B;
+ float Arr[100];
+ float *Ptr;
+ float *foo() {
+ return &Arr[0];
+ }
+};
+
+struct SC {
+ unsigned A : 2;
+ unsigned B : 3;
+ unsigned C;
+ unsigned D;
+ float Arr[100];
+ SB S;
+ SB ArrS[100];
+ SB *PtrS;
+ SB *&RPtrS;
+ float *Ptr;
+
+ SC(SB *&_RPtrS) : RPtrS(_RPtrS) {}
+};
+
+union SD {
+ unsigned A;
+ float B;
+};
+
+struct S1;
+extern S1 a;
+class S2 {
+ mutable int a;
+public:
+ S2():a(0) { }
+ S2(S2 &s2):a(s2.a) { }
+ static float S2s;
+ static const float S2sc;
+};
+const float S2::S2sc = 0;
+const S2 b;
+const S2 ba[5];
+class S3 {
+ int a;
+public:
+ S3():a(0) { }
+ S3(S3 &s3):a(s3.a) { }
+};
+const S3 c;
+const S3 ca[5];
+extern const int f;
+class S4 {
+ int a;
+ S4();
+ S4(const S4 &s4);
+public:
+ S4(int v):a(v) { }
+};
+class S5 {
+ int a;
+ S5():a(0) {}
+ S5(const S5 &s5):a(s5.a) { }
+public:
+ S5(int v):a(v) { }
+};
+
+S3 h;
+#pragma omp threadprivate(h)
+
+typedef struct {
+ int a;
+} S6;
+
+template <typename T, int I>
+T tmain(T argc) {
+ const T d = 5;
+ const T da[5] = { 0 };
+ S4 e(4);
+ S5 g(5);
+ S6 h[10];
+ auto &rh = h;
+ T i;
+ T &j = i;
+ T *k = &j;
+ T *&z = k;
+ T aa[10];
+ auto &raa = aa;
+#pragma omp target parallel for is_device_ptr // expected-error {{expected '(' after 'is_device_ptr'}}
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr( // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error {{expected expression}}
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr() // expected-error {{expected expression}}
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(alloc) // expected-error {{use of undeclared identifier 'alloc'}}
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(argc // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(i) // expected-error {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(j) // expected-error {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(k) // OK
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(z) // OK
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(aa) // OK
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(raa) // OK
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(e) // expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(g) // expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(h) // OK
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(rh) // OK
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(k,i,j) // expected-error2 {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(d) // expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(da) // OK
+ for (int kk=0; kk<20; kk++)
+ ;
+ return 0;
+}
+
+int main(int argc, char **argv) {
+ const int d = 5;
+ const int da[5] = { 0 };
+ S4 e(4);
+ S5 g(5);
+ S6 h[10];
+ auto &rh = h;
+ int i;
+ int &j = i;
+ int *k = &j;
+ int *&z = k;
+ int aa[10];
+ auto &raa = aa;
+#pragma omp target parallel for is_device_ptr // expected-error {{expected '(' after 'is_device_ptr'}}
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr( // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error {{expected expression}}
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr() // expected-error {{expected expression}}
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(alloc) // expected-error {{use of undeclared identifier 'alloc'}}
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(argc // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(i) // expected-error {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(j) // expected-error {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(k) // OK
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(z) // OK
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(aa) // OK
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(raa) // OK
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(e) // expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(g) // expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(h) // OK
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(rh) // OK
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(k,i,j) // expected-error2 {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(d) // expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int kk=0; kk<20; kk++)
+ ;
+#pragma omp target parallel for is_device_ptr(da) // OK
+ for (int kk=0; kk<20; kk++)
+ ;
+ return tmain<int, 3>(argc); // expected-note {{in instantiation of function template specialization 'tmain<int, 3>' requested here}}
+}
diff --git a/test/OpenMP/target_parallel_for_simd_is_device_ptr_ast_print.cpp b/test/OpenMP/target_parallel_for_simd_is_device_ptr_ast_print.cpp
new file mode 100644
index 0000000000000..af98f99ada959
--- /dev/null
+++ b/test/OpenMP/target_parallel_for_simd_is_device_ptr_ast_print.cpp
@@ -0,0 +1,318 @@
+// RUN: %clang_cc1 -verify -fopenmp -std=c++11 -ast-print %s | FileCheck %s
+// RUN: %clang_cc1 -fopenmp -x c++ -std=c++11 -emit-pch -o %t %s
+// RUN: %clang_cc1 -fopenmp -std=c++11 -include-pch %t -fsyntax-only -verify %s -ast-print | FileCheck %s
+// expected-no-diagnostics
+
+#ifndef HEADER
+#define HEADER
+struct ST {
+ int *a;
+};
+typedef int arr[10];
+typedef ST STarr[10];
+struct SA {
+ const int da[5] = { 0 };
+ ST g[10];
+ STarr &rg = g;
+ int i;
+ int &j = i;
+ int *k = &j;
+ int *&z = k;
+ int aa[10];
+ arr &raa = aa;
+ void func(int arg) {
+#pragma omp target parallel for simd is_device_ptr(k)
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(z)
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(aa) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(raa) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(g) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(rg) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(da) // OK
+ for (int i=0; i<100; i++)
+ ;
+ return;
+ }
+};
+// CHECK: struct SA
+// CHECK-NEXT: const int da[5] = {0};
+// CHECK-NEXT: ST g[10];
+// CHECK-NEXT: STarr &rg = this->g;
+// CHECK-NEXT: int i;
+// CHECK-NEXT: int &j = this->i;
+// CHECK-NEXT: int *k = &this->j;
+// CHECK-NEXT: int *&z = this->k;
+// CHECK-NEXT: int aa[10];
+// CHECK-NEXT: arr &raa = this->aa;
+// CHECK-NEXT: func(
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(this->k)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(this->z)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(this->aa)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(this->raa)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(this->g)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(this->rg)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(this->da)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+
+struct SB {
+ unsigned A;
+ unsigned B;
+ float Arr[100];
+ float *Ptr;
+ float *foo() {
+ return &Arr[0];
+ }
+};
+
+struct SC {
+ unsigned A : 2;
+ unsigned B : 3;
+ unsigned C;
+ unsigned D;
+ float Arr[100];
+ SB S;
+ SB ArrS[100];
+ SB *PtrS;
+ SB *&RPtrS;
+ float *Ptr;
+
+ SC(SB *&_RPtrS) : RPtrS(_RPtrS) {}
+};
+
+union SD {
+ unsigned A;
+ float B;
+};
+
+struct S1;
+extern S1 a;
+class S2 {
+ mutable int a;
+public:
+ S2():a(0) { }
+ S2(S2 &s2):a(s2.a) { }
+ static float S2s;
+ static const float S2sc;
+};
+const float S2::S2sc = 0;
+const S2 b;
+const S2 ba[5];
+class S3 {
+ int a;
+public:
+ S3():a(0) { }
+ S3(S3 &s3):a(s3.a) { }
+};
+const S3 c;
+const S3 ca[5];
+extern const int f;
+class S4 {
+ int a;
+ S4();
+ S4(const S4 &s4);
+public:
+ S4(int v):a(v) { }
+};
+class S5 {
+ int a;
+ S5():a(0) {}
+ S5(const S5 &s5):a(s5.a) { }
+public:
+ S5(int v):a(v) { }
+};
+
+S3 h;
+#pragma omp threadprivate(h)
+
+typedef struct {
+ int a;
+} S6;
+
+template <typename T>
+T tmain(T argc) {
+ const T da[5] = { 0 };
+ S6 h[10];
+ auto &rh = h;
+ T i;
+ T &j = i;
+ T *k = &j;
+ T *&z = k;
+ T aa[10];
+ auto &raa = aa;
+#pragma omp target parallel for simd is_device_ptr(k)
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(z)
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(aa)
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(raa)
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(h)
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(rh)
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(da)
+ for (int i=0; i<100; i++)
+ ;
+ return 0;
+}
+
+// CHECK: template<> int tmain<int>(int argc) {
+// CHECK-NEXT: const int da[5] = {0};
+// CHECK-NEXT: S6 h[10];
+// CHECK-NEXT: auto &rh = h;
+// CHECK-NEXT: int i;
+// CHECK-NEXT: int &j = i;
+// CHECK-NEXT: int *k = &j;
+// CHECK-NEXT: int *&z = k;
+// CHECK-NEXT: int aa[10];
+// CHECK-NEXT: auto &raa = aa;
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(k)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(z)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(aa)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(raa)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(h)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(rh)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(da)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+
+// CHECK: template<> int *tmain<int *>(int *argc) {
+// CHECK-NEXT: int *const da[5] = {0};
+// CHECK-NEXT: S6 h[10];
+// CHECK-NEXT: auto &rh = h;
+// CHECK-NEXT: int *i;
+// CHECK-NEXT: int *&j = i;
+// CHECK-NEXT: int **k = &j;
+// CHECK-NEXT: int **&z = k;
+// CHECK-NEXT: int *aa[10];
+// CHECK-NEXT: auto &raa = aa;
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(k)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(z)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(aa)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(raa)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(h)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(rh)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(da)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+
+// CHECK-LABEL: int main(int argc, char **argv) {
+int main(int argc, char **argv) {
+ const int da[5] = { 0 };
+ S6 h[10];
+ auto &rh = h;
+ int i;
+ int &j = i;
+ int *k = &j;
+ int *&z = k;
+ int aa[10];
+ auto &raa = aa;
+// CHECK-NEXT: const int da[5] = {0};
+// CHECK-NEXT: S6 h[10];
+// CHECK-NEXT: auto &rh = h;
+// CHECK-NEXT: int i;
+// CHECK-NEXT: int &j = i;
+// CHECK-NEXT: int *k = &j;
+// CHECK-NEXT: int *&z = k;
+// CHECK-NEXT: int aa[10];
+// CHECK-NEXT: auto &raa = aa;
+#pragma omp target parallel for simd is_device_ptr(k)
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(k)
+ for (int i=0; i<100; i++)
+ ;
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+#pragma omp target parallel for simd is_device_ptr(z)
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(z)
+ for (int i=0; i<100; i++)
+ ;
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+#pragma omp target parallel for simd is_device_ptr(aa)
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(aa)
+ for (int i=0; i<100; i++)
+ ;
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+#pragma omp target parallel for simd is_device_ptr(raa)
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(raa)
+ for (int i=0; i<100; i++)
+ ;
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+#pragma omp target parallel for simd is_device_ptr(h)
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(h)
+ for (int i=0; i<100; i++)
+ ;
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+#pragma omp target parallel for simd is_device_ptr(rh)
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(rh)
+ for (int i=0; i<100; i++)
+ ;
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+#pragma omp target parallel for simd is_device_ptr(da)
+// CHECK-NEXT: #pragma omp target parallel for simd is_device_ptr(da)
+ for (int i=0; i<100; i++)
+ ;
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+ return tmain<int>(argc) + *tmain<int *>(&argc);
+}
+#endif
diff --git a/test/OpenMP/target_parallel_for_simd_is_device_ptr_messages.cpp b/test/OpenMP/target_parallel_for_simd_is_device_ptr_messages.cpp
new file mode 100644
index 0000000000000..435b9a95e9e61
--- /dev/null
+++ b/test/OpenMP/target_parallel_for_simd_is_device_ptr_messages.cpp
@@ -0,0 +1,337 @@
+// RUN: %clang_cc1 -std=c++11 -verify -fopenmp %s
+struct ST {
+ int *a;
+};
+typedef int arr[10];
+typedef ST STarr[10];
+struct SA {
+ const int d = 5;
+ const int da[5] = { 0 };
+ ST e;
+ ST g[10];
+ STarr &rg = g;
+ int i;
+ int &j = i;
+ int *k = &j;
+ int *&z = k;
+ int aa[10];
+ arr &raa = aa;
+ void func(int arg) {
+#pragma omp target parallel for simd is_device_ptr // expected-error {{expected '(' after 'is_device_ptr'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr( // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error {{expected expression}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr() // expected-error {{expected expression}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(alloc) // expected-error {{use of undeclared identifier 'alloc'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(arg // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(i) // expected-error {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(j) // expected-error {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(k) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(z) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(aa) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(raa) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(e) // expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(g) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(rg) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(k,i,j) // expected-error2 {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(d) // expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(da) // OK
+ for (int i=0; i<100; i++)
+ ;
+ return;
+ }
+};
+struct SB {
+ unsigned A;
+ unsigned B;
+ float Arr[100];
+ float *Ptr;
+ float *foo() {
+ return &Arr[0];
+ }
+};
+
+struct SC {
+ unsigned A : 2;
+ unsigned B : 3;
+ unsigned C;
+ unsigned D;
+ float Arr[100];
+ SB S;
+ SB ArrS[100];
+ SB *PtrS;
+ SB *&RPtrS;
+ float *Ptr;
+
+ SC(SB *&_RPtrS) : RPtrS(_RPtrS) {}
+};
+
+union SD {
+ unsigned A;
+ float B;
+};
+
+struct S1;
+extern S1 a;
+class S2 {
+ mutable int a;
+public:
+ S2():a(0) { }
+ S2(S2 &s2):a(s2.a) { }
+ static float S2s;
+ static const float S2sc;
+};
+const float S2::S2sc = 0;
+const S2 b;
+const S2 ba[5];
+class S3 {
+ int a;
+public:
+ S3():a(0) { }
+ S3(S3 &s3):a(s3.a) { }
+};
+const S3 c;
+const S3 ca[5];
+extern const int f;
+class S4 {
+ int a;
+ S4();
+ S4(const S4 &s4);
+public:
+ S4(int v):a(v) { }
+};
+class S5 {
+ int a;
+ S5():a(0) {}
+ S5(const S5 &s5):a(s5.a) { }
+public:
+ S5(int v):a(v) { }
+};
+
+S3 h;
+#pragma omp threadprivate(h)
+
+typedef struct {
+ int a;
+} S6;
+
+template <typename T, int I>
+T tmain(T argc) {
+ const T d = 5;
+ const T da[5] = { 0 };
+ S4 e(4);
+ S5 g(5);
+ S6 h[10];
+ auto &rh = h;
+ T i;
+ T &j = i;
+ T *k = &j;
+ T *&z = k;
+ T aa[10];
+ auto &raa = aa;
+ S6 *ps;
+#pragma omp target parallel for simd is_device_ptr // expected-error {{expected '(' after 'is_device_ptr'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr( // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error {{expected expression}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr() // expected-error {{expected expression}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(alloc) // expected-error {{use of undeclared identifier 'alloc'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(argc // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(i) // expected-error {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(j) // expected-error {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(k) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(z) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(aa) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(raa) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(e) // expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(g) // expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(h) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(rh) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(k,i,j) // expected-error2 {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(d) // expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(da) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd map(ps) is_device_ptr(ps) // expected-error{{variable already marked as mapped in current construct}} expected-note{{used here}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(ps) map(ps) // expected-error{{variable already marked as mapped in current construct}} expected-note{{used here}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd map(ps->a) is_device_ptr(ps) // expected-error{{variable already marked as mapped in current construct}} expected-note{{used here}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(ps) map(ps->a) // expected-error{{pointer cannot be mapped along with a section derived from itself}} expected-note{{used here}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(ps) firstprivate(ps) // expected-error{{firstprivate variable cannot be in a is_device_ptr clause in '#pragma omp target parallel for simd' directive}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd firstprivate(ps) is_device_ptr(ps) // expected-error{{firstprivate variable cannot be in a is_device_ptr clause in '#pragma omp target parallel for simd' directive}} expected-note{{defined as firstprivate}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(ps) private(ps) // expected-error{{private variable cannot be in a is_device_ptr clause in '#pragma omp target parallel for simd' directive}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd private(ps) is_device_ptr(ps) // expected-error{{private variable cannot be in a is_device_ptr clause in '#pragma omp target parallel for simd' directive}} expected-note{{defined as private}}
+ for (int i=0; i<100; i++)
+ ;
+ return 0;
+}
+
+int main(int argc, char **argv) {
+ const int d = 5;
+ const int da[5] = { 0 };
+ S4 e(4);
+ S5 g(5);
+ S6 h[10];
+ auto &rh = h;
+ int i;
+ int &j = i;
+ int *k = &j;
+ int *&z = k;
+ int aa[10];
+ auto &raa = aa;
+ S6 *ps;
+#pragma omp target parallel for simd is_device_ptr // expected-error {{expected '(' after 'is_device_ptr'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr( // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error {{expected expression}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr() // expected-error {{expected expression}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(alloc) // expected-error {{use of undeclared identifier 'alloc'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(argc // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(i) // expected-error {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(j) // expected-error {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(k) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(z) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(aa) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(raa) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(e) // expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(g) // expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(h) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(rh) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(k,i,j) // expected-error2 {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(d) // expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(da) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd map(ps) is_device_ptr(ps) // expected-error{{variable already marked as mapped in current construct}} expected-note{{used here}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(ps) map(ps) // expected-error{{variable already marked as mapped in current construct}} expected-note{{used here}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd map(ps->a) is_device_ptr(ps) // expected-error{{variable already marked as mapped in current construct}} expected-note{{used here}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(ps) map(ps->a) // expected-error{{pointer cannot be mapped along with a section derived from itself}} expected-note{{used here}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(ps) firstprivate(ps) // expected-error{{firstprivate variable cannot be in a is_device_ptr clause in '#pragma omp target parallel for simd' directive}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd firstprivate(ps) is_device_ptr(ps) // expected-error{{firstprivate variable cannot be in a is_device_ptr clause in '#pragma omp target parallel for simd' directive}} expected-note{{defined as firstprivate}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd is_device_ptr(ps) private(ps) // expected-error{{private variable cannot be in a is_device_ptr clause in '#pragma omp target parallel for simd' directive}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target parallel for simd private(ps) is_device_ptr(ps) // expected-error{{private variable cannot be in a is_device_ptr clause in '#pragma omp target parallel for simd' directive}} expected-note{{defined as private}}
+ for (int i=0; i<100; i++)
+ ;
+ return tmain<int, 3>(argc); // expected-note {{in instantiation of function template specialization 'tmain<int, 3>' requested here}}
+}
diff --git a/test/OpenMP/target_teams_distribute_collapse_messages.cpp b/test/OpenMP/target_teams_distribute_collapse_messages.cpp
index f646655a09e18..4bc4a7b79ccf1 100644
--- a/test/OpenMP/target_teams_distribute_collapse_messages.cpp
+++ b/test/OpenMP/target_teams_distribute_collapse_messages.cpp
@@ -1,8 +1,13 @@
// RUN: %clang_cc1 -verify -fopenmp %s
+// RUN: %clang_cc1 -verify -fopenmp -std=c++98 %s
+// RUN: %clang_cc1 -verify -fopenmp -std=c++11 %s
void foo() {
}
+#if __cplusplus >= 201103L
+// expected-note@+2 4 {{declared here}}
+#endif
bool foobool(int argc) {
return argc;
}
@@ -43,6 +48,9 @@ T tmain(T argc, S **argv) { //expected-note 2 {{declared here}}
for (int i = ST; i < N; i++)
argv[0][i] = argv[0][i] - argv[0][i-ST]; // expected-error 2 {{expected 2 for loops after '#pragma omp target teams distribute', but found only 1}}
+#if __cplusplus >= 201103L
+// expected-note@+5 2 {{non-constexpr function 'foobool' cannot be used in a constant expression}}
+#endif
// expected-error@+3 2 {{directive '#pragma omp target teams distribute' cannot contain more than one 'collapse' clause}}
// expected-error@+2 2 {{argument to 'collapse' clause must be a strictly positive integer value}}
// expected-error@+1 2 {{expression is not an integral constant expression}}
@@ -54,7 +62,11 @@ T tmain(T argc, S **argv) { //expected-note 2 {{declared here}}
for (int i = ST; i < N; i++)
argv[0][i] = argv[0][i] - argv[0][i-ST];
-// expected-error@+1 2 {{expression is not an integral constant expression}}
+#if __cplusplus <= 199711L
+ // expected-error@+4 2 {{expression is not an integral constant expression}}
+#else
+ // expected-error@+2 2 {{integral constant expression must have integral or unscoped enumeration type, not 'char *'}}
+#endif
#pragma omp target teams distribute collapse (argv[1]=2) // expected-error {{expected ')'}} expected-note {{to match this '('}}
for (int i = ST; i < N; i++)
argv[0][i] = argv[0][i] - argv[0][i-ST];
@@ -93,10 +105,17 @@ int main(int argc, char **argv) {
for (int i = 4; i < 12; i++)
argv[0][i] = argv[0][i] - argv[0][i-4]; // expected-error {{expected 4 for loops after '#pragma omp target teams distribute', but found only 1}}
-#pragma omp target teams distribute collapse (foobool(1) > 0 ? 1 : 2) // expected-error {{expression is not an integral constant expression}}
+// expected-error@+4 {{expression is not an integral constant expression}}
+#if __cplusplus >= 201103L
+// expected-note@+2 {{non-constexpr function 'foobool' cannot be used in a constant expression}}
+#endif
+#pragma omp target teams distribute collapse (foobool(1) > 0 ? 1 : 2)
for (int i = 4; i < 12; i++)
argv[0][i] = argv[0][i] - argv[0][i-4];
+#if __cplusplus >= 201103L
+ // expected-note@+5{{non-constexpr function 'foobool' cannot be used in a constant expression}}
+#endif
// expected-error@+3 {{expression is not an integral constant expression}}
// expected-error@+2 2 {{directive '#pragma omp target teams distribute' cannot contain more than one 'collapse' clause}}
// expected-error@+1 2 {{argument to 'collapse' clause must be a strictly positive integer value}}
@@ -108,7 +127,11 @@ int main(int argc, char **argv) {
for (int i = 4; i < 12; i++)
argv[0][i] = argv[0][i] - argv[0][i-4];
-// expected-error@+1 {{expression is not an integral constant expression}}
+#if __cplusplus <= 199711L
+ // expected-error@+4 {{expression is not an integral constant expression}}
+#else
+ // expected-error@+2 {{integral constant expression must have integral or unscoped enumeration type, not 'char *'}}
+#endif
#pragma omp target teams distribute collapse (argv[1]=2) // expected-error {{expected ')'}} expected-note {{to match this '('}}
for (int i = 4; i < 12; i++)
argv[0][i] = argv[0][i] - argv[0][i-4];
diff --git a/test/OpenMP/target_teams_distribute_simd_aligned_messages.cpp b/test/OpenMP/target_teams_distribute_simd_aligned_messages.cpp
new file mode 100644
index 0000000000000..e9df563ded2c3
--- /dev/null
+++ b/test/OpenMP/target_teams_distribute_simd_aligned_messages.cpp
@@ -0,0 +1,231 @@
+// RUN: %clang_cc1 -x c++ -std=c++11 -verify -fopenmp %s
+
+struct B {
+ static int ib[20]; // expected-note 0 {{'B::ib' declared here}}
+ static constexpr int bfoo() { return 8; }
+};
+namespace X {
+ B x; // expected-note {{'x' defined here}}
+};
+constexpr int bfoo() { return 4; }
+
+int **z;
+const int C1 = 1;
+const int C2 = 2;
+void test_aligned_colons(int *&rp)
+{
+ int *B = 0;
+
+#pragma omp target teams distribute simd aligned(B:bfoo())
+ for (int i = 0; i < 10; ++i) ;
+
+#pragma omp target teams distribute simd aligned(B::ib:B:bfoo()) // expected-error {{unexpected ':' in nested name specifier; did you mean '::'}}
+ for (int i = 0; i < 10; ++i) ;
+
+#pragma omp target teams distribute simd aligned(B:B::bfoo())
+ for (int i = 0; i < 10; ++i) ;
+
+#pragma omp target teams distribute simd aligned(z:B:bfoo()) // expected-error {{unexpected ':' in nested name specifier; did you mean '::'?}}
+ for (int i = 0; i < 10; ++i) ;
+
+#pragma omp target teams distribute simd aligned(B:B::bfoo())
+ for (int i = 0; i < 10; ++i) ;
+
+#pragma omp target teams distribute simd aligned(X::x : ::z) // expected-error {{integral constant expression must have integral or unscoped enumeration type, not 'int **'}} expected-error {{argument of aligned clause should be array, pointer, reference to array or reference to pointer, not 'B'}}
+ for (int i = 0; i < 10; ++i) ;
+
+#pragma omp target teams distribute simd aligned(B,rp,::z: X::x) // expected-error {{integral constant expression must have integral or unscoped enumeration type, not 'B'}}
+ for (int i = 0; i < 10; ++i) ;
+
+#pragma omp target teams distribute simd aligned(::z)
+ for (int i = 0; i < 10; ++i) ;
+
+#pragma omp target teams distribute simd aligned(B::bfoo()) // expected-error {{expected variable name}}
+ for (int i = 0; i < 10; ++i) ;
+
+#pragma omp target teams distribute simd aligned(B::ib,B:C1+C2) // expected-warning {{aligned clause will be ignored because the requested alignment is not a power of 2}}
+ for (int i = 0; i < 10; ++i) ;
+}
+
+// expected-note@+1 {{'num' defined here}}
+template<int L, class T, class N> T test_template(T* arr, N num) {
+ N i;
+ T sum = (T)0;
+ T ind2 = - num * L;
+ // Negative number is passed as L.
+
+#pragma omp target teams distribute simd aligned(arr:L) // expected-error {{argument to 'aligned' clause must be a strictly positive integer value}}
+ for (i = 0; i < num; ++i) {
+ T cur = arr[(int)ind2];
+ ind2 += L;
+ sum += cur;
+ }
+
+#pragma omp target teams distribute simd aligned(num:4) // expected-error {{argument of aligned clause should be array, pointer, reference to array or reference to pointer, not 'int'}}
+ for (i = 0; i < num; ++i);
+
+ return T();
+}
+
+template<int LEN> int test_warn() {
+ int *ind2 = 0;
+#pragma omp target teams distribute simd aligned(ind2:LEN) // expected-error {{argument to 'aligned' clause must be a strictly positive integer value}}
+ for (int i = 0; i < 100; i++) {
+ ind2 += LEN;
+ }
+ return 0;
+}
+
+struct S1; // expected-note 2 {{declared here}}
+extern S1 a; // expected-note {{'a' declared here}}
+class S2 {
+ mutable int a;
+public:
+ S2():a(0) { }
+};
+const S2 b; // expected-note 1 {{'b' defined here}}
+const S2 ba[5];
+class S3 {
+ int a;
+public:
+ S3():a(0) { }
+};
+const S3 ca[5];
+class S4 {
+ int a;
+ S4();
+public:
+ S4(int v):a(v) { }
+};
+class S5 {
+ int a;
+ S5():a(0) {}
+public:
+ S5(int v):a(v) { }
+};
+
+S3 h; // expected-note 2 {{'h' defined here}}
+#pragma omp threadprivate(h)
+
+template<class I, class C> int foomain(I argc, C **argv) {
+ I e(argc);
+ I g(argc);
+ int i; // expected-note {{declared here}} expected-note {{'i' defined here}}
+ // expected-note@+2 {{declared here}}
+ // expected-note@+1 {{reference to 'i' is not a constant expression}}
+ int &j = i;
+
+#pragma omp target teams distribute simd aligned // expected-error {{expected '(' after 'aligned'}}
+ for (I k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd aligned ( // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (I k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd aligned () // expected-error {{expected expression}}
+ for (I k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd aligned (argc // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (I k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd aligned (argc, // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (I k = 0; k < argc; ++k) ++k;
+
+// FIXME: Should argc really be a pointer?
+#pragma omp target teams distribute simd aligned (*argc > 0 ? argv[1] : argv[2]) // expected-error {{expected variable name}}
+ for (I k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd aligned (argc : 5) // expected-warning {{aligned clause will be ignored because the requested alignment is not a power of 2}}
+ for (I k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd aligned (S1) // expected-error {{'S1' does not refer to a value}}
+ for (I k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd aligned (argv[1]) // expected-error {{expected variable name}}
+ for (I k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd aligned(e, g)
+ for (I k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd aligned(h) // expected-error {{argument of aligned clause should be array, pointer, reference to array or reference to pointer, not 'S3'}}
+ for (I k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd aligned(i) // expected-error {{argument of aligned clause should be array, pointer, reference to array or reference to pointer, not 'int'}}
+ for (I k = 0; k < argc; ++k) ++k;
+
+ #pragma omp parallel
+ {
+ int *v = 0;
+ I i;
+ #pragma omp target teams distribute simd aligned(v:16)
+ for (I k = 0; k < argc; ++k) { i = k; v += 2; }
+ }
+ float *f;
+
+#pragma omp target teams distribute simd aligned(f)
+ for (I k = 0; k < argc; ++k) ++k;
+
+ int v = 0;
+
+#pragma omp target teams distribute simd aligned(f:j) // expected-note {{initializer of 'j' is not a constant expression}} expected-error {{expression is not an integral constant expression}}
+
+ for (I k = 0; k < argc; ++k) { ++k; v += j; }
+
+#pragma omp target teams distribute simd aligned(f)
+ for (I k = 0; k < argc; ++k) ++k;
+
+ return 0;
+}
+
+// expected-note@+1 2 {{'argc' defined here}}
+int main(int argc, char **argv) {
+ double darr[100];
+ // expected-note@+1 {{in instantiation of function template specialization 'test_template<-4, double, int>' requested here}}
+ test_template<-4>(darr, 4);
+ test_warn<4>(); // ok
+ // expected-note@+1 {{in instantiation of function template specialization 'test_warn<0>' requested here}}
+ test_warn<0>();
+
+ int i;
+ int &j = i;
+
+#pragma omp target teams distribute simd aligned // expected-error {{expected '(' after 'aligned'}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd aligned ( // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd aligned () // expected-error {{expected expression}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd aligned (argv // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd aligned (argc, // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error {{argument of aligned clause should be array, pointer, reference to array or reference to pointer, not 'int'}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams
+#pragma omp distribute simd aligned (argc > 0 ? argv[1] : argv[2]) // expected-error {{expected variable name}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams
+#pragma omp distribute simd aligned (argc) // expected-error {{argument of aligned clause should be array, pointer, reference to array or reference to pointer, not 'int'}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd aligned (S1) // expected-error {{'S1' does not refer to a value}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd aligned (a, b) // expected-error {{argument of aligned clause should be array, pointer, reference to array or reference to pointer, not 'S1'}} expected-error {{argument of aligned clause should be array, pointer, reference to array or reference to pointer, not 'S2'}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd aligned (argv[1]) // expected-error {{expected variable name}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd aligned(h) // expected-error {{argument of aligned clause should be array, pointer, reference to array or reference to pointer, not 'S3'}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+ int *pargc = &argc;
+ // expected-note@+1 {{in instantiation of function template specialization 'foomain<int *, char>' requested here}}
+ foomain<int*,char>(pargc,argv);
+ return 0;
+}
+
diff --git a/test/OpenMP/target_teams_distribute_simd_ast_print.cpp b/test/OpenMP/target_teams_distribute_simd_ast_print.cpp
new file mode 100644
index 0000000000000..77732ef560116
--- /dev/null
+++ b/test/OpenMP/target_teams_distribute_simd_ast_print.cpp
@@ -0,0 +1,198 @@
+// RUN: %clang_cc1 -verify -fopenmp -ast-print %s | FileCheck %s
+// RUN: %clang_cc1 -fopenmp -x c++ -std=c++11 -emit-pch -o %t %s
+// RUN: %clang_cc1 -fopenmp -std=c++11 -include-pch %t -fsyntax-only -verify %s -ast-print | FileCheck %s
+// expected-no-diagnostics
+
+#ifndef HEADER
+#define HEADER
+
+void foo() {}
+
+struct S {
+ S(): a(0) {}
+ S(int v) : a(v) {}
+ int a;
+ typedef int type;
+};
+
+template <typename T>
+class S7 : public T {
+protected:
+ T a;
+ S7() : a(0) {}
+
+public:
+ S7(typename T::type v) : a(v) {
+#pragma omp target teams distribute simd private(a) private(this->a) private(T::a)
+ for (int k = 0; k < a.a; ++k)
+ ++this->a.a;
+ }
+ S7 &operator=(S7 &s) {
+#pragma omp target teams distribute simd private(a) private(this->a)
+ for (int k = 0; k < s.a.a; ++k)
+ ++s.a.a;
+ return *this;
+ }
+ void foo() {
+ int b, argv, d, c, e, f;
+#pragma omp target teams distribute simd private(b), firstprivate(argv) shared(d) reduction(+:c) reduction(max:e) num_teams(f) thread_limit(d)
+ for (int k = 0; k < a.a; ++k)
+ ++a.a;
+ }
+ void bar() {
+ int arr[10];
+ const int alen = 16;
+ const int slen1 = 8;
+ const int slen2 = 8;
+#pragma omp target teams distribute simd simdlen(slen1) safelen(slen2) aligned(arr:alen)
+ for (int k = 0; k < a.a; ++k)
+ ++a.a;
+ }
+};
+// CHECK: #pragma omp target teams distribute simd private(this->a) private(this->a) private(T::a)
+// CHECK: #pragma omp target teams distribute simd private(this->a) private(this->a)
+// CHECK: #pragma omp target teams distribute simd private(b) firstprivate(argv) shared(d) reduction(+: c) reduction(max: e) num_teams(f) thread_limit(d)
+// CHECK: #pragma omp target teams distribute simd simdlen(slen1) safelen(slen2) aligned(arr: alen)
+// CHECK: #pragma omp target teams distribute simd private(this->a) private(this->a) private(this->S::a)
+
+class S8 : public S7<S> {
+ S8() {}
+
+public:
+ S8(int v) : S7<S>(v){
+#pragma omp target teams distribute simd private(a) private(this->a) private(S7<S>::a)
+ for (int k = 0; k < a.a; ++k)
+ ++this->a.a;
+ }
+ S8 &operator=(S8 &s) {
+#pragma omp target teams distribute simd private(a) private(this->a)
+ for (int k = 0; k < s.a.a; ++k)
+ ++s.a.a;
+ return *this;
+ }
+ void bar() {
+ int b, argv, d, c, e, f;
+#pragma omp target teams distribute simd private(b), firstprivate(argv) shared(d) reduction(+:c) reduction(max:e) num_teams(f) thread_limit(d)
+ for (int k = 0; k < a.a; ++k)
+ ++a.a;
+ }
+ void foo() {
+ const int alen = 16;
+ const int slen1 = 8;
+ const int slen2 = 8;
+ int arr[10];
+#pragma omp target teams distribute simd simdlen(slen1) safelen(slen2) aligned(arr:alen)
+ for (int k = 0; k < a.a; ++k)
+ ++a.a;
+ }
+};
+// CHECK: #pragma omp target teams distribute simd private(this->a) private(this->a) private(this->S7<S>::a)
+// CHECK: #pragma omp target teams distribute simd private(this->a) private(this->a)
+// CHECK: #pragma omp target teams distribute simd private(b) firstprivate(argv) shared(d) reduction(+: c) reduction(max: e) num_teams(f) thread_limit(d)
+// CHECK: #pragma omp target teams distribute simd simdlen(slen1) safelen(slen2) aligned(arr: alen)
+
+template <class T, int N>
+T tmain(T argc) {
+ T b = argc, c, d, e, f, g;
+ static T a;
+// CHECK: static T a;
+ const T clen = 5;
+ const T alen = 16;
+ int arr[10];
+#pragma omp target teams distribute simd
+ for (int i=0; i < 2; ++i)
+ a = 2;
+// CHECK: #pragma omp target teams distribute simd
+// CHECK-NEXT: for (int i = 0; i < 2; ++i)
+// CHECK-NEXT: a = 2;
+#pragma omp target teams distribute simd private(argc, b), firstprivate(c, d), collapse(2)
+ for (int i = 0; i < 10; ++i)
+ for (int j = 0; j < 10; ++j)
+ foo();
+// CHECK: #pragma omp target teams distribute simd private(argc,b) firstprivate(c,d) collapse(2)
+// CHECK-NEXT: for (int i = 0; i < 10; ++i)
+// CHECK-NEXT: for (int j = 0; j < 10; ++j)
+// CHECK-NEXT: foo();
+ for (int i = 0; i < 10; ++i)
+ foo();
+// CHECK: for (int i = 0; i < 10; ++i)
+// CHECK-NEXT: foo();
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i)
+ foo();
+// CHECK: #pragma omp target teams distribute simd
+// CHECK-NEXT: for (int i = 0; i < 10; ++i)
+// CHECK-NEXT: foo();
+#pragma omp target teams distribute simd private(b), firstprivate(argc) shared(d) reduction(+:c) reduction(max:e) num_teams(f) thread_limit(d)
+ for (int k = 0; k < 10; ++k)
+ e += d + argc;
+// CHECK: #pragma omp target teams distribute simd private(b) firstprivate(argc) shared(d) reduction(+: c) reduction(max: e) num_teams(f) thread_limit(d)
+// CHECK-NEXT: for (int k = 0; k < 10; ++k)
+// CHECK-NEXT: e += d + argc;
+#pragma omp target teams distribute simd simdlen(clen-1) linear(d)
+ for (int k = 0; k < 10; ++k)
+ e += d + argc;
+// CHECK: #pragma omp target teams distribute simd simdlen(clen - 1) linear(d)
+// CHECK-NEXT: for (int k = 0; k < 10; ++k)
+// CHECK-NEXT: e += d + argc;
+#pragma omp target teams distribute simd safelen(clen-1) aligned(arr:alen)
+ for (int k = 0; k < 10; ++k)
+ e += d + argc + arr[k];
+// CHECK: #pragma omp target teams distribute simd safelen(clen - 1) aligned(arr: alen)
+// CHECK-NEXT: for (int k = 0; k < 10; ++k)
+// CHECK-NEXT: e += d + argc + arr[k];
+ return T();
+}
+
+int main (int argc, char **argv) {
+ int b = argc, c, d, e, f, g;
+ static int a;
+// CHECK: static int a;
+ const int clen = 5;
+ const int N = 10;
+ int arr[10];
+#pragma omp target teams distribute simd
+ for (int i=0; i < 2; ++i)
+ a = 2;
+// CHECK: #pragma omp target teams distribute simd
+// CHECK-NEXT: for (int i = 0; i < 2; ++i)
+// CHECK-NEXT: a = 2;
+#pragma omp target teams distribute simd private(argc,b),firstprivate(argv, c), collapse(2)
+ for (int i = 0; i < 10; ++i)
+ for (int j = 0; j < 10; ++j)
+ foo();
+// CHECK: #pragma omp target teams distribute simd private(argc,b) firstprivate(argv,c) collapse(2)
+// CHECK-NEXT: for (int i = 0; i < 10; ++i)
+// CHECK-NEXT: for (int j = 0; j < 10; ++j)
+// CHECK-NEXT: foo();
+ for (int i = 0; i < 10; ++i)
+ foo();
+// CHECK: for (int i = 0; i < 10; ++i)
+// CHECK-NEXT: foo();
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i)foo();
+// CHECK: #pragma omp target teams distribute simd
+// CHECK-NEXT: for (int i = 0; i < 10; ++i)
+// CHECK-NEXT: foo();
+#pragma omp target teams distribute simd private(b), firstprivate(argc) shared(d) reduction(+:c) reduction(max:e) num_teams(f) thread_limit(d)
+ for (int k = 0; k < 10; ++k)
+ e += d + argc;
+// CHECK: #pragma omp target teams distribute simd private(b) firstprivate(argc) shared(d) reduction(+: c) reduction(max: e) num_teams(f) thread_limit(d)
+// CHECK-NEXT: for (int k = 0; k < 10; ++k)
+// CHECK-NEXT: e += d + argc;
+#pragma omp target teams distribute simd simdlen(clen-1) linear(d)
+ for (int k = 0; k < 10; ++k)
+ e += d + argc;
+// CHECK: #pragma omp target teams distribute simd simdlen(clen - 1) linear(d)
+// CHECK-NEXT: for (int k = 0; k < 10; ++k)
+// CHECK-NEXT: e += d + argc;
+#pragma omp target teams distribute simd safelen(clen-1) aligned(arr:N+6)
+ for (int k = 0; k < 10; ++k)
+ e += d + argc + arr[k];
+// CHECK: #pragma omp target teams distribute simd safelen(clen - 1) aligned(arr: N + 6)
+// CHECK-NEXT: for (int k = 0; k < 10; ++k)
+// CHECK-NEXT: e += d + argc + arr[k];
+ return (0);
+}
+
+#endif
diff --git a/test/OpenMP/target_teams_distribute_simd_collapse_messages.cpp b/test/OpenMP/target_teams_distribute_simd_collapse_messages.cpp
new file mode 100644
index 0000000000000..39937f90fb34a
--- /dev/null
+++ b/test/OpenMP/target_teams_distribute_simd_collapse_messages.cpp
@@ -0,0 +1,149 @@
+// RUN: %clang_cc1 -verify -fopenmp %s
+// RUN: %clang_cc1 -verify -fopenmp -std=c++98 %s
+// RUN: %clang_cc1 -verify -fopenmp -std=c++11 %s
+
+void foo() {
+}
+
+#if __cplusplus >= 201103L
+// expected-note@+2 4 {{declared here}}
+#endif
+bool foobool(int argc) {
+ return argc;
+}
+
+struct S1; // expected-note {{declared here}}
+
+template <class T, typename S, int N, int ST> // expected-note {{declared here}}
+T tmain(T argc, S **argv) { //expected-note 2 {{declared here}}
+#pragma omp target teams distribute simd collapse // expected-error {{expected '(' after 'collapse'}}
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#pragma omp target teams distribute simd collapse ( // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i = ST; i < N; i++)
+
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+#pragma omp target teams distribute simd collapse () // expected-error {{expected expression}}
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+// expected-error@+3 {{expected ')'}} expected-note@+3 {{to match this '('}}
+// expected-error@+2 2 {{expression is not an integral constant expression}}
+// expected-note@+1 2 {{read of non-const variable 'argc' is not allowed in a constant expression}}
+#pragma omp target teams distribute simd collapse (argc
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+// expected-error@+1 2 {{argument to 'collapse' clause must be a strictly positive integer value}}
+#pragma omp target teams distribute simd collapse (ST // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#pragma omp target teams distribute simd collapse (1)) // expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#pragma omp target teams distribute simd collapse ((ST > 0) ? 1 + ST : 2) // expected-note 2 {{as specified in 'collapse' clause}}
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST]; // expected-error 2 {{expected 2 for loops after '#pragma omp target teams distribute simd', but found only 1}}
+
+// expected-error@+6 2 {{directive '#pragma omp target teams distribute simd' cannot contain more than one 'collapse' clause}}
+// expected-error@+5 2 {{argument to 'collapse' clause must be a strictly positive integer value}}
+// expected-error@+4 2 {{expression is not an integral constant expression}}
+#if __cplusplus >= 201103L
+// expected-note@+2 2 {{non-constexpr function 'foobool' cannot be used in a constant expression}}
+#endif
+#pragma omp target teams distribute simd collapse (foobool(argc)), collapse (true), collapse (-5)
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#pragma omp distribute collapse (S) // expected-error {{'S' does not refer to a value}}
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#if __cplusplus <= 199711L
+ // expected-error@+4 2 {{expression is not an integral constant expression}}
+#else
+ // expected-error@+2 2 {{integral constant expression must have integral or unscoped enumeration type, not 'char *'}}
+#endif
+#pragma omp target teams distribute simd collapse (argv[1]=2) // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#pragma omp target teams distribute simd collapse (1)
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#pragma omp target teams distribute simd collapse (N) // expected-error {{argument to 'collapse' clause must be a strictly positive integer value}}
+ for (T i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#pragma omp target teams distribute simd collapse (2) // expected-note {{as specified in 'collapse' clause}}
+ foo(); // expected-error {{expected 2 for loops after '#pragma omp target teams distribute simd'}}
+ return argc;
+}
+
+int main(int argc, char **argv) {
+#pragma omp target teams distribute simd collapse // expected-error {{expected '(' after 'collapse'}}
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4];
+
+#pragma omp target teams distribute simd collapse ( // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4];
+
+#pragma omp target teams distribute simd collapse () // expected-error {{expected expression}}
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4];
+
+#pragma omp target teams distribute simd collapse (4 // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-note {{as specified in 'collapse' clause}}
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4]; // expected-error {{expected 4 for loops after '#pragma omp target teams distribute simd', but found only 1}}
+
+#pragma omp target teams distribute simd collapse (2+2)) // expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}} expected-note {{as specified in 'collapse' clause}}
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4]; // expected-error {{expected 4 for loops after '#pragma omp target teams distribute simd', but found only 1}}
+
+#if __cplusplus >= 201103L
+ // expected-note@+2 {{non-constexpr function 'foobool' cannot be used in a constant expression}}
+#endif
+#pragma omp target teams distribute simd collapse (foobool(1) > 0 ? 1 : 2) // expected-error {{expression is not an integral constant expression}}
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4];
+
+// expected-error@+6 {{expression is not an integral constant expression}}
+// expected-error@+5 2 {{directive '#pragma omp target teams distribute simd' cannot contain more than one 'collapse' clause}}
+// expected-error@+4 2 {{argument to 'collapse' clause must be a strictly positive integer value}}
+#if __cplusplus >= 201103L
+// expected-note@+2 {{non-constexpr function 'foobool' cannot be used in a constant expression}}
+#endif
+#pragma omp target teams distribute simd collapse (foobool(argc)), collapse (true), collapse (-5)
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4];
+
+#pragma omp target teams distribute simd collapse (S1) // expected-error {{'S1' does not refer to a value}}
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4];
+
+#if __cplusplus >= 201103L
+ // expected-error@+4 {{integral constant expression must have integral or unscoped enumeration type, not 'char *'}}
+#else
+ // expected-error@+2 {{expression is not an integral constant expression}}
+#endif
+#pragma omp target teams distribute simd collapse (argv[1]=2) // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4];
+
+// expected-error@+3 {{statement after '#pragma omp target teams distribute simd' must be a for loop}}
+// expected-note@+1 {{in instantiation of function template specialization 'tmain<int, char, -1, -2>' requested here}}
+#pragma omp target teams distribute simd collapse(collapse(tmain<int, char, -1, -2>(argc, argv) // expected-error 2 {{expected ')'}} expected-note 2 {{to match this '('}}
+ foo();
+
+#pragma omp target teams distribute simd collapse (2) // expected-note {{as specified in 'collapse' clause}}
+ foo(); // expected-error {{expected 2 for loops after '#pragma omp target teams distribute simd'}}
+
+// expected-note@+1 {{in instantiation of function template specialization 'tmain<int, char, 1, 0>' requested here}}
+ return tmain<int, char, 1, 0>(argc, argv);
+}
+
diff --git a/test/OpenMP/target_teams_distribute_simd_defaultmap_messages.cpp b/test/OpenMP/target_teams_distribute_simd_defaultmap_messages.cpp
new file mode 100644
index 0000000000000..3bea411540a2f
--- /dev/null
+++ b/test/OpenMP/target_teams_distribute_simd_defaultmap_messages.cpp
@@ -0,0 +1,58 @@
+// RUN: %clang_cc1 -verify -fopenmp %s
+
+void foo() {
+}
+
+template <class T, typename S, int N, int ST>
+T tmain(T argc, S **argv) {
+ int i;
+#pragma omp target teams distribute simd defaultmap // expected-error {{expected '(' after 'defaultmap'}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd defaultmap ( // expected-error {{expected 'tofrom' in OpenMP clause 'defaultmap'}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd defaultmap () // expected-error {{expected 'tofrom' in OpenMP clause 'defaultmap'}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd defaultmap (tofrom // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-warning {{missing ':' after defaultmap modifier - ignoring}} expected-error {{expected 'scalar' in OpenMP clause 'defaultmap'}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd defaultmap (tofrom: // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error {{expected 'scalar' in OpenMP clause 'defaultmap'}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd defaultmap (tofrom) // expected-warning {{missing ':' after defaultmap modifier - ignoring}} expected-error {{expected 'scalar' in OpenMP clause 'defaultmap'}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd defaultmap (tofrom scalar) // expected-warning {{missing ':' after defaultmap modifier - ignoring}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd defaultmap (tofrom, // expected-error {{expected ')'}} expected-error {{expected 'scalar' in OpenMP clause 'defaultmap'}} expected-warning {{missing ':' after defaultmap modifier - ignoring}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd defaultmap (scalar: // expected-error {{expected ')'}} expected-error {{expected 'tofrom' in OpenMP clause 'defaultmap'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd defaultmap (tofrom, scalar // expected-error {{expected ')'}} expected-warning {{missing ':' after defaultmap modifier - ignoring}} expected-error {{expected 'scalar' in OpenMP clause 'defaultmap'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+
+ return argc;
+}
+
+int main(int argc, char **argv) {
+ int i;
+#pragma omp target teams distribute simd defaultmap // expected-error {{expected '(' after 'defaultmap'}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd defaultmap ( // expected-error {{expected 'tofrom' in OpenMP clause 'defaultmap'}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd defaultmap () // expected-error {{expected 'tofrom' in OpenMP clause 'defaultmap'}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd defaultmap (tofrom // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-warning {{missing ':' after defaultmap modifier - ignoring}} expected-error {{expected 'scalar' in OpenMP clause 'defaultmap'}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd defaultmap (tofrom: // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error {{expected 'scalar' in OpenMP clause 'defaultmap'}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd defaultmap (tofrom) // expected-warning {{missing ':' after defaultmap modifier - ignoring}} expected-error {{expected 'scalar' in OpenMP clause 'defaultmap'}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd defaultmap (tofrom scalar) // expected-warning {{missing ':' after defaultmap modifier - ignoring}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd defaultmap (tofrom, // expected-error {{expected ')'}} expected-error {{expected 'scalar' in OpenMP clause 'defaultmap'}} expected-warning {{missing ':' after defaultmap modifier - ignoring}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd defaultmap (scalar: // expected-error {{expected ')'}} expected-error {{expected 'tofrom' in OpenMP clause 'defaultmap'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd defaultmap (tofrom, scalar // expected-error {{expected ')'}} expected-warning {{missing ':' after defaultmap modifier - ignoring}} expected-error {{expected 'scalar' in OpenMP clause 'defaultmap'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+
+ return tmain<int, char, 1, 0>(argc, argv);
+}
+
diff --git a/test/OpenMP/target_teams_distribute_simd_depend_messages.cpp b/test/OpenMP/target_teams_distribute_simd_depend_messages.cpp
new file mode 100644
index 0000000000000..39d12d8d4d0e5
--- /dev/null
+++ b/test/OpenMP/target_teams_distribute_simd_depend_messages.cpp
@@ -0,0 +1,90 @@
+// RUN: %clang_cc1 -verify -fopenmp -ferror-limit 100 -o - -std=c++11 %s
+
+void foo() {
+}
+
+bool foobool(int argc) {
+ return argc;
+}
+
+struct S1; // expected-note {{declared here}}
+
+class vector {
+ public:
+ int operator[](int index) { return 0; }
+};
+
+int main(int argc, char **argv, char *env[]) {
+ vector vec;
+ typedef float V __attribute__((vector_size(16)));
+ V a;
+ auto arr = x; // expected-error {{use of undeclared identifier 'x'}}
+ int i;
+
+#pragma omp target teams distribute simd depend // expected-error {{expected '(' after 'depend'}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend ( // expected-error {{expected 'in', 'out' or 'inout' in OpenMP clause 'depend'}} expected-error {{expected ')'}} expected-note {{to match this '('}} expected-warning {{missing ':' after dependency type - ignoring}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend () // expected-error {{expected 'in', 'out' or 'inout' in OpenMP clause 'depend'}} expected-warning {{missing ':' after dependency type - ignoring}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend (argc // expected-error {{expected 'in', 'out' or 'inout' in OpenMP clause 'depend'}} expected-warning {{missing ':' after dependency type - ignoring}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend (source : argc) // expected-error {{expected 'in', 'out' or 'inout' in OpenMP clause 'depend'}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend (source) // expected-error {{expected expression}} expected-warning {{missing ':' after dependency type - ignoring}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend (in : argc)) // expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend (out: ) // expected-error {{expected expression}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend (inout : foobool(argc)), depend (in, argc) // expected-error {{expected variable name, array element or array section}} expected-warning {{missing ':' after dependency type - ignoring}} expected-error {{expected expression}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend (out :S1) // expected-error {{'S1' does not refer to a value}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend(in : argv[1][1] = '2') // expected-error {{expected variable name, array element or array section}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend (in : vec[1]) // expected-error {{expected variable name, array element or array section}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend (in : argv[0])
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend (in : ) // expected-error {{expected expression}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend (in : main) // expected-error {{expected variable name, array element or array section}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend(in : a[0]) // expected-error{{expected variable name, array element or array section}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend (in : vec[1:2]) // expected-error {{ value is not an array or pointer}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend (in : argv[ // expected-error {{expected expression}} expected-error {{expected ']'}} expected-error {{expected ')'}} expected-note {{to match this '['}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend (in : argv[: // expected-error {{expected expression}} expected-error {{expected ']'}} expected-error {{expected ')'}} expected-note {{to match this '['}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend (in : argv[:] // expected-error {{section length is unspecified and cannot be inferred because subscripted value is not an array}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend (in : argv[argc: // expected-error {{expected expression}} expected-error {{expected ']'}} expected-error {{expected ')'}} expected-note {{to match this '['}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend (in : argv[argc:argc] // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend (in : argv[0:-1]) // expected-error {{section length is evaluated to a negative value -1}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend (in : argv[-1:0])
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend (in : argv[:]) // expected-error {{section length is unspecified and cannot be inferred because subscripted value is not an array}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend (in : argv[3:4:1]) // expected-error {{expected ']'}} expected-note {{to match this '['}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend(in:a[0:1]) // expected-error {{subscripted value is not an array or pointer}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend(in:argv[argv[:2]:1]) // expected-error {{OpenMP array section is not allowed here}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend(in:argv[0:][:]) // expected-error {{section length is unspecified and cannot be inferred because subscripted value is not an array}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend(in:env[0:][:]) // expected-error {{section length is unspecified and cannot be inferred because subscripted value is an array of unknown bound}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend(in : argv[ : argc][1 : argc - 1])
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd depend(in : arr[0])
+ for (i = 0; i < argc; ++i) foo();
+
+ return 0;
+}
diff --git a/test/OpenMP/target_teams_distribute_simd_device_messages.cpp b/test/OpenMP/target_teams_distribute_simd_device_messages.cpp
new file mode 100644
index 0000000000000..e9246cb29def3
--- /dev/null
+++ b/test/OpenMP/target_teams_distribute_simd_device_messages.cpp
@@ -0,0 +1,40 @@
+// RUN: %clang_cc1 -verify -fopenmp %s
+
+void foo() {
+}
+
+bool foobool(int argc) {
+ return argc;
+}
+
+struct S1; // expected-note {{declared here}}
+
+int main(int argc, char **argv) {
+ int i;
+#pragma omp target teams distribute simd device // expected-error {{expected '(' after 'device'}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd device ( // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd device () // expected-error {{expected expression}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd device (argc // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd device (argc)) // expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd device (argc > 0 ? argv[1] : argv[2]) // expected-error {{expression must have integral or unscoped enumeration type, not 'char *'}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd device (argc + argc)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd device (argc), device (argc+1) // expected-error {{directive '#pragma omp target teams distribute simd' cannot contain more than one 'device' clause}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd device (S1) // expected-error {{'S1' does not refer to a value}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd device (-2) // expected-error {{argument to 'device' clause must be a non-negative integer value}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd device (-10u)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd device (3.14) // expected-error {{expression must have integral or unscoped enumeration type, not 'double'}}
+ for (i = 0; i < argc; ++i) foo();
+
+ return 0;
+}
diff --git a/test/OpenMP/target_teams_distribute_simd_dist_schedule_messages.cpp b/test/OpenMP/target_teams_distribute_simd_dist_schedule_messages.cpp
new file mode 100644
index 0000000000000..9b9239d64e9d5
--- /dev/null
+++ b/test/OpenMP/target_teams_distribute_simd_dist_schedule_messages.cpp
@@ -0,0 +1,84 @@
+// RUN: %clang_cc1 -verify -fopenmp %s
+
+void foo() {
+}
+
+bool foobool(int argc) {
+ return argc;
+}
+
+struct S1; // expected-note {{declared here}} expected-note {{declared here}}
+
+template <class T, int N>
+T tmain(T argc) {
+ T b = argc, c, d, e, f, g;
+ char ** argv;
+ static T a;
+// CHECK: static T a;
+
+#pragma omp target teams distribute simd dist_schedule // expected-error {{expected '(' after 'dist_schedule'}}
+ for (int i = 0; i < 10; ++i) foo();
+
+#pragma omp target teams distribute simd dist_schedule ( // expected-error {{expected 'static' in OpenMP clause 'dist_schedule'}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i = 0; i < 10; ++i) foo();
+
+#pragma omp target teams distribute simd dist_schedule () // expected-error {{expected 'static' in OpenMP clause 'dist_schedule'}}
+ for (int i = 0; i < 10; ++i) foo();
+
+#pragma omp target teams distribute simd dist_schedule (static // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i = 0; i < 10; ++i) foo();
+
+#pragma omp target teams distribute simd dist_schedule (static, // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i = 0; i < 10; ++i) foo();
+
+#pragma omp target teams distribute simd dist_schedule (argc)) // expected-error {{expected 'static' in OpenMP clause 'dist_schedule'}} expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+ for (int i = 0; i < 10; ++i) foo();
+
+#pragma omp target teams distribute simd dist_schedule (static, argc > 0 ? argv[1] : argv[2]) // expected-error2 {{expression must have integral or unscoped enumeration type, not 'char *'}}
+ for (int i = 0; i < 10; ++i) foo();
+
+#pragma omp target teams distribute simd dist_schedule (static), dist_schedule (static, 1) // expected-error {{directive '#pragma omp target teams distribute simd' cannot contain more than one 'dist_schedule' clause}}
+ for (int i = 0; i < 10; ++i) foo();
+
+#pragma omp target teams distribute simd dist_schedule (static, S1) // expected-error {{'S1' does not refer to a value}}
+ for (int i = 0; i < 10; ++i) foo();
+
+#pragma omp target teams distribute simd dist_schedule (static, argv[1]=2) // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error3 {{expression must have integral or unscoped enumeration type, not 'char *'}}
+ for (int i = 0; i < 10; ++i) foo();
+
+ return T();
+}
+
+int main(int argc, char **argv) {
+#pragma omp target teams distribute simd dist_schedule // expected-error {{expected '(' after 'dist_schedule'}}
+ for (int i = 0; i < 10; ++i) foo();
+
+#pragma omp target teams distribute simd dist_schedule ( // expected-error {{expected 'static' in OpenMP clause 'dist_schedule'}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i = 0; i < 10; ++i) foo();
+
+#pragma omp target teams distribute simd dist_schedule () // expected-error {{expected 'static' in OpenMP clause 'dist_schedule'}}
+ for (int i = 0; i < 10; ++i) foo();
+
+#pragma omp target teams distribute simd dist_schedule (static // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i = 0; i < 10; ++i) foo();
+
+#pragma omp target teams distribute simd dist_schedule (static, // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i = 0; i < 10; ++i) foo();
+
+#pragma omp target teams distribute simd dist_schedule (argc)) // expected-error {{expected 'static' in OpenMP clause 'dist_schedule'}} expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+ for (int i = 0; i < 10; ++i) foo();
+
+#pragma omp target teams distribute simd dist_schedule (static, argc > 0 ? argv[1] : argv[2]) // expected-error {{expression must have integral or unscoped enumeration type, not 'char *'}}
+ for (int i = 0; i < 10; ++i) foo();
+
+#pragma omp target teams distribute simd dist_schedule (static), dist_schedule (static, 1) // expected-error {{directive '#pragma omp target teams distribute simd' cannot contain more than one 'dist_schedule' clause}}
+ for (int i = 0; i < 10; ++i) foo();
+
+#pragma omp target teams distribute simd dist_schedule (static, S1) // expected-error {{'S1' does not refer to a value}}
+ for (int i = 0; i < 10; ++i) foo();
+
+#pragma omp target teams distribute simd dist_schedule (static, argv[1]=2) // expected-error {{expression must have integral or unscoped enumeration type, not 'char *'}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i = 0; i < 10; ++i) foo();
+
+ return (tmain<int, 5>(argc) + tmain<char, 1>(argv[0][0])); // expected-note {{in instantiation of function template specialization 'tmain<int, 5>' requested here}} expected-note {{in instantiation of function template specialization 'tmain<char, 1>' requested here}}
+}
diff --git a/test/OpenMP/target_teams_distribute_simd_firstprivate_messages.cpp b/test/OpenMP/target_teams_distribute_simd_firstprivate_messages.cpp
new file mode 100644
index 0000000000000..b9b039efd9297
--- /dev/null
+++ b/test/OpenMP/target_teams_distribute_simd_firstprivate_messages.cpp
@@ -0,0 +1,134 @@
+// RUN: %clang_cc1 -verify -fopenmp %s
+
+void foo() {
+}
+
+bool foobool(int argc) {
+ return argc;
+}
+
+struct S1; // expected-note {{declared here}} expected-note{{forward declaration of 'S1'}}
+extern S1 a;
+class S2 {
+ mutable int a;
+
+public:
+ S2() : a(0) {}
+ S2(const S2 &s2) : a(s2.a) {}
+ static float S2s;
+ static const float S2sc;
+};
+const float S2::S2sc = 0;
+const S2 b;
+const S2 ba[5];
+class S3 {
+ int a;
+ S3 &operator=(const S3 &s3);
+
+public:
+ S3() : a(0) {} // expected-note {{candidate constructor not viable: requires 0 arguments, but 1 was provided}} expected-note {{candidate constructor not viable: requires 0 arguments, but 1 was provided}}
+ S3(S3 &s3) : a(s3.a) {} // expected-note {{candidate constructor not viable: 1st argument ('const S3') would lose const qualifier}} expected-note {{candidate constructor not viable: 1st argument ('const S3') would lose const qualifier}}
+};
+const S3 c;
+const S3 ca[5];
+extern const int f;
+class S4 {
+ int a;
+ S4();
+ S4(const S4 &s4);
+public:
+ S4(int v):a(v) { }
+};
+class S5 {
+ int a;
+ S5():a(0) {}
+ S5(const S5 &s5):a(s5.a) { }
+public:
+ S5(int v):a(v) { }
+};
+class S6 {
+ int a;
+public:
+ S6() : a(0) { }
+};
+
+S3 h;
+#pragma omp threadprivate(h) // expected-note {{defined as threadprivate or thread local}}
+
+int main(int argc, char **argv) {
+ const int d = 5;
+ const int da[5] = { 0 };
+ S4 e(4);
+ S5 g(5);
+ S6 p;
+ int i;
+ int &j = i;
+
+#pragma omp target teams distribute simd firstprivate // expected-error {{expected '(' after 'firstprivate'}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd firstprivate ( // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd firstprivate () // expected-error {{expected expression}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd firstprivate (argc // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd firstprivate (argc, // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd firstprivate (argc > 0 ? argv[1] : argv[2]) // expected-error {{expected variable name}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd firstprivate (argc)
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd firstprivate (S1) // expected-error {{'S1' does not refer to a value}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd firstprivate (a, b, c, d, f) // expected-error {{firstprivate variable with incomplete type 'S1'}} expected-error {{no matching constructor for initialization of 'S3'}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd firstprivate (argv[1]) // expected-error {{expected variable name}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd firstprivate(ba)
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd firstprivate(ca) // expected-error {{no matching constructor for initialization of 'S3'}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd firstprivate(da)
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd firstprivate(S2::S2s)
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd firstprivate(S2::S2sc)
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd firstprivate(h) // expected-error {{threadprivate or thread local variable cannot be firstprivate}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd private(i), firstprivate(i) // expected-error {{private variable cannot be firstprivate}} expected-note 2 {{defined as private}}
+ for (i = 0; i < argc; ++i) foo(); // expected-error {{loop iteration variable in the associated loop of 'omp target teams distribute simd' directive may not be private, predetermined as linear}}
+
+#pragma omp target teams distribute simd firstprivate(i)
+ for (j = 0; j < argc; ++j) foo();
+
+#pragma omp target teams distribute simd firstprivate(i) // expected-note {{defined as firstprivate}}
+ for (i = 0; i < argc; ++i) foo(); // expected-error {{loop iteration variable in the associated loop of 'omp target teams distribute simd' directive may not be firstprivate, predetermined as linear}}
+
+#pragma omp target teams distribute simd firstprivate(j)
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd lastprivate(argc), firstprivate(argc) // OK
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd firstprivate(argc) map(argc) // expected-error {{firstprivate variable cannot be in a map clause in '#pragma omp target teams distribute simd' directive}} expected-note {{defined as firstprivate}}
+ for (i = 0; i < argc; ++i) foo();
+
+ return 0;
+}
diff --git a/test/OpenMP/target_teams_distribute_simd_if_messages.cpp b/test/OpenMP/target_teams_distribute_simd_if_messages.cpp
new file mode 100644
index 0000000000000..6cb2ad44aa110
--- /dev/null
+++ b/test/OpenMP/target_teams_distribute_simd_if_messages.cpp
@@ -0,0 +1,101 @@
+// RUN: %clang_cc1 -verify -fopenmp -fopenmp-version=45 -ferror-limit 100 %s
+
+void foo() {
+}
+
+bool foobool(int argc) {
+ return argc;
+}
+
+struct S1; // expected-note {{declared here}}
+
+template <class T, class S> // expected-note {{declared here}}
+int tmain(T argc, S **argv) {
+ T i;
+#pragma omp target teams distribute simd if // expected-error {{expected '(' after 'if'}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if ( // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if () // expected-error {{expected expression}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if (argc // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if (argc)) // expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if (argc > 0 ? argv[1] : argv[2])
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if (foobool(argc)), if (true) // expected-error {{directive '#pragma omp target teams distribute simd' cannot contain more than one 'if' clause}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if (S) // expected-error {{'S' does not refer to a value}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if (argv[1]=2) // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if (argc argc) // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if(argc)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if(target // expected-error {{use of undeclared identifier 'target'}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if(target : // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if(target : argc // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if(target: argc)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if(target : argc) if (distribute:argc) // expected-error {{directive name modifier 'distribute' is not allowed for '#pragma omp target teams distribute simd'}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if(target: argc) if (target:argc) // expected-error {{directive '#pragma omp target teams distribute simd' cannot contain more than one 'if' clause with 'target' name modifier}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if(target: argc) if (argc) // expected-note {{previous clause with directive name modifier specified here}} expected-error {{no more 'if' clause is allowed}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if(distribute : argc) // expected-error {{directive name modifier 'distribute' is not allowed for '#pragma omp target teams distribute simd'}}
+ for (i = 0; i < argc; ++i) foo();
+
+ return 0;
+}
+
+int main(int argc, char **argv) {
+ int i;
+#pragma omp target teams distribute simd if // expected-error {{expected '(' after 'if'}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if ( // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if () // expected-error {{expected expression}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if (argc // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if (argc)) // expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if (argc > 0 ? argv[1] : argv[2])
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if (foobool(argc)), if (true) // expected-error {{directive '#pragma omp target teams distribute simd' cannot contain more than one 'if' clause}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if (S1) // expected-error {{'S1' does not refer to a value}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if (argv[1]=2) // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if (argc argc) // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if (1 0) // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if(if(tmain(argc, argv) // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if(target // expected-error {{use of undeclared identifier 'target'}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if(target : // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if(target: argc // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if(target: argc)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if(target : argc) if (distribute:argc) // expected-error {{directive name modifier 'distribute' is not allowed for '#pragma omp target teams distribute simd'}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if(target: argc) if (target:argc) // expected-error {{directive '#pragma omp target teams distribute simd' cannot contain more than one 'if' clause with 'target' name modifier}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if(target: argc) if (argc) // expected-note {{previous clause with directive name modifier specified here}} expected-error {{no more 'if' clause is allowed}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd if(distribute : argc) // expected-error {{directive name modifier 'distribute' is not allowed for '#pragma omp target teams distribute simd'}}
+ for (i = 0; i < argc; ++i) foo();
+
+ return tmain(argc, argv);
+}
diff --git a/test/OpenMP/target_teams_distribute_simd_is_device_ptr_ast_print.cpp b/test/OpenMP/target_teams_distribute_simd_is_device_ptr_ast_print.cpp
new file mode 100644
index 0000000000000..61aede4cb9e67
--- /dev/null
+++ b/test/OpenMP/target_teams_distribute_simd_is_device_ptr_ast_print.cpp
@@ -0,0 +1,318 @@
+// RUN: %clang_cc1 -verify -fopenmp -std=c++11 -ast-print %s | FileCheck %s
+// RUN: %clang_cc1 -fopenmp -x c++ -std=c++11 -emit-pch -o %t %s
+// RUN: %clang_cc1 -fopenmp -std=c++11 -include-pch %t -fsyntax-only -verify %s -ast-print | FileCheck %s
+// expected-no-diagnostics
+
+#ifndef HEADER
+#define HEADER
+struct ST {
+ int *a;
+};
+typedef int arr[10];
+typedef ST STarr[10];
+struct SA {
+ const int da[5] = { 0 };
+ ST g[10];
+ STarr &rg = g;
+ int i;
+ int &j = i;
+ int *k = &j;
+ int *&z = k;
+ int aa[10];
+ arr &raa = aa;
+ void func(int arg) {
+#pragma omp target teams distribute simd is_device_ptr(k)
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(z)
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(aa) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(raa) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(g) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(rg) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(da) // OK
+ for (int i=0; i<100; i++)
+ ;
+ return;
+ }
+};
+// CHECK: struct SA
+// CHECK-NEXT: const int da[5] = {0};
+// CHECK-NEXT: ST g[10];
+// CHECK-NEXT: STarr &rg = this->g;
+// CHECK-NEXT: int i;
+// CHECK-NEXT: int &j = this->i;
+// CHECK-NEXT: int *k = &this->j;
+// CHECK-NEXT: int *&z = this->k;
+// CHECK-NEXT: int aa[10];
+// CHECK-NEXT: arr &raa = this->aa;
+// CHECK-NEXT: func(
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(this->k)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(this->z)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(this->aa)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(this->raa)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(this->g)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(this->rg)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(this->da)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+
+struct SB {
+ unsigned A;
+ unsigned B;
+ float Arr[100];
+ float *Ptr;
+ float *foo() {
+ return &Arr[0];
+ }
+};
+
+struct SC {
+ unsigned A : 2;
+ unsigned B : 3;
+ unsigned C;
+ unsigned D;
+ float Arr[100];
+ SB S;
+ SB ArrS[100];
+ SB *PtrS;
+ SB *&RPtrS;
+ float *Ptr;
+
+ SC(SB *&_RPtrS) : RPtrS(_RPtrS) {}
+};
+
+union SD {
+ unsigned A;
+ float B;
+};
+
+struct S1;
+extern S1 a;
+class S2 {
+ mutable int a;
+public:
+ S2():a(0) { }
+ S2(S2 &s2):a(s2.a) { }
+ static float S2s;
+ static const float S2sc;
+};
+const float S2::S2sc = 0;
+const S2 b;
+const S2 ba[5];
+class S3 {
+ int a;
+public:
+ S3():a(0) { }
+ S3(S3 &s3):a(s3.a) { }
+};
+const S3 c;
+const S3 ca[5];
+extern const int f;
+class S4 {
+ int a;
+ S4();
+ S4(const S4 &s4);
+public:
+ S4(int v):a(v) { }
+};
+class S5 {
+ int a;
+ S5():a(0) {}
+ S5(const S5 &s5):a(s5.a) { }
+public:
+ S5(int v):a(v) { }
+};
+
+S3 h;
+#pragma omp threadprivate(h)
+
+typedef struct {
+ int a;
+} S6;
+
+template <typename T>
+T tmain(T argc) {
+ const T da[5] = { 0 };
+ S6 h[10];
+ auto &rh = h;
+ T i;
+ T &j = i;
+ T *k = &j;
+ T *&z = k;
+ T aa[10];
+ auto &raa = aa;
+#pragma omp target teams distribute simd is_device_ptr(k)
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(z)
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(aa)
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(raa)
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(h)
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(rh)
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(da)
+ for (int i=0; i<100; i++)
+ ;
+ return 0;
+}
+
+// CHECK: template<> int tmain<int>(int argc) {
+// CHECK-NEXT: const int da[5] = {0};
+// CHECK-NEXT: S6 h[10];
+// CHECK-NEXT: auto &rh = h;
+// CHECK-NEXT: int i;
+// CHECK-NEXT: int &j = i;
+// CHECK-NEXT: int *k = &j;
+// CHECK-NEXT: int *&z = k;
+// CHECK-NEXT: int aa[10];
+// CHECK-NEXT: auto &raa = aa;
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(k)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(z)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(aa)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(raa)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(h)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(rh)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(da)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+
+// CHECK: template<> int *tmain<int *>(int *argc) {
+// CHECK-NEXT: int *const da[5] = {0};
+// CHECK-NEXT: S6 h[10];
+// CHECK-NEXT: auto &rh = h;
+// CHECK-NEXT: int *i;
+// CHECK-NEXT: int *&j = i;
+// CHECK-NEXT: int **k = &j;
+// CHECK-NEXT: int **&z = k;
+// CHECK-NEXT: int *aa[10];
+// CHECK-NEXT: auto &raa = aa;
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(k)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(z)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(aa)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(raa)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(h)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(rh)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(da)
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+
+// CHECK-LABEL: int main(int argc, char **argv) {
+int main(int argc, char **argv) {
+ const int da[5] = { 0 };
+ S6 h[10];
+ auto &rh = h;
+ int i;
+ int &j = i;
+ int *k = &j;
+ int *&z = k;
+ int aa[10];
+ auto &raa = aa;
+// CHECK-NEXT: const int da[5] = {0};
+// CHECK-NEXT: S6 h[10];
+// CHECK-NEXT: auto &rh = h;
+// CHECK-NEXT: int i;
+// CHECK-NEXT: int &j = i;
+// CHECK-NEXT: int *k = &j;
+// CHECK-NEXT: int *&z = k;
+// CHECK-NEXT: int aa[10];
+// CHECK-NEXT: auto &raa = aa;
+#pragma omp target teams distribute simd is_device_ptr(k)
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(k)
+ for (int i=0; i<100; i++)
+ ;
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+#pragma omp target teams distribute simd is_device_ptr(z)
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(z)
+ for (int i=0; i<100; i++)
+ ;
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+#pragma omp target teams distribute simd is_device_ptr(aa)
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(aa)
+ for (int i=0; i<100; i++)
+ ;
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+#pragma omp target teams distribute simd is_device_ptr(raa)
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(raa)
+ for (int i=0; i<100; i++)
+ ;
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+#pragma omp target teams distribute simd is_device_ptr(h)
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(h)
+ for (int i=0; i<100; i++)
+ ;
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+#pragma omp target teams distribute simd is_device_ptr(rh)
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(rh)
+ for (int i=0; i<100; i++)
+ ;
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+#pragma omp target teams distribute simd is_device_ptr(da)
+// CHECK-NEXT: #pragma omp target teams distribute simd is_device_ptr(da)
+ for (int i=0; i<100; i++)
+ ;
+// CHECK-NEXT: for (int i = 0; i < 100; i++)
+// CHECK-NEXT: ;
+ return tmain<int>(argc) + *tmain<int *>(&argc);
+}
+#endif
diff --git a/test/OpenMP/target_teams_distribute_simd_is_device_ptr_messages.cpp b/test/OpenMP/target_teams_distribute_simd_is_device_ptr_messages.cpp
new file mode 100644
index 0000000000000..013b703a91e9d
--- /dev/null
+++ b/test/OpenMP/target_teams_distribute_simd_is_device_ptr_messages.cpp
@@ -0,0 +1,337 @@
+// RUN: %clang_cc1 -std=c++11 -verify -fopenmp %s
+struct ST {
+ int *a;
+};
+typedef int arr[10];
+typedef ST STarr[10];
+struct SA {
+ const int d = 5;
+ const int da[5] = { 0 };
+ ST e;
+ ST g[10];
+ STarr &rg = g;
+ int i;
+ int &j = i;
+ int *k = &j;
+ int *&z = k;
+ int aa[10];
+ arr &raa = aa;
+ void func(int arg) {
+#pragma omp target teams distribute simd is_device_ptr // expected-error {{expected '(' after 'is_device_ptr'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr( // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error {{expected expression}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr() // expected-error {{expected expression}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(alloc) // expected-error {{use of undeclared identifier 'alloc'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(arg // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(i) // expected-error {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(j) // expected-error {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(k) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(z) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(aa) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(raa) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(e) // expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(g) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(rg) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(k,i,j) // expected-error2 {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(d) // expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(da) // OK
+ for (int i=0; i<100; i++)
+ ;
+ return;
+ }
+};
+struct SB {
+ unsigned A;
+ unsigned B;
+ float Arr[100];
+ float *Ptr;
+ float *foo() {
+ return &Arr[0];
+ }
+};
+
+struct SC {
+ unsigned A : 2;
+ unsigned B : 3;
+ unsigned C;
+ unsigned D;
+ float Arr[100];
+ SB S;
+ SB ArrS[100];
+ SB *PtrS;
+ SB *&RPtrS;
+ float *Ptr;
+
+ SC(SB *&_RPtrS) : RPtrS(_RPtrS) {}
+};
+
+union SD {
+ unsigned A;
+ float B;
+};
+
+struct S1;
+extern S1 a;
+class S2 {
+ mutable int a;
+public:
+ S2():a(0) { }
+ S2(S2 &s2):a(s2.a) { }
+ static float S2s;
+ static const float S2sc;
+};
+const float S2::S2sc = 0;
+const S2 b;
+const S2 ba[5];
+class S3 {
+ int a;
+public:
+ S3():a(0) { }
+ S3(S3 &s3):a(s3.a) { }
+};
+const S3 c;
+const S3 ca[5];
+extern const int f;
+class S4 {
+ int a;
+ S4();
+ S4(const S4 &s4);
+public:
+ S4(int v):a(v) { }
+};
+class S5 {
+ int a;
+ S5():a(0) {}
+ S5(const S5 &s5):a(s5.a) { }
+public:
+ S5(int v):a(v) { }
+};
+
+S3 h;
+#pragma omp threadprivate(h)
+
+typedef struct {
+ int a;
+} S6;
+
+template <typename T, int I>
+T tmain(T argc) {
+ const T d = 5;
+ const T da[5] = { 0 };
+ S4 e(4);
+ S5 g(5);
+ S6 h[10];
+ auto &rh = h;
+ T i;
+ T &j = i;
+ T *k = &j;
+ T *&z = k;
+ T aa[10];
+ auto &raa = aa;
+ S6 *ps;
+#pragma omp target teams distribute simd is_device_ptr // expected-error {{expected '(' after 'is_device_ptr'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr( // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error {{expected expression}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr() // expected-error {{expected expression}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(alloc) // expected-error {{use of undeclared identifier 'alloc'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(argc // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(i) // expected-error {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(j) // expected-error {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(k) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(z) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(aa) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(raa) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(e) // expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(g) // expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(h) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(rh) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(k,i,j) // expected-error2 {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(d) // expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(da) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd map(ps) is_device_ptr(ps) // expected-error{{variable already marked as mapped in current construct}} expected-note{{used here}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(ps) map(ps) // expected-error{{variable already marked as mapped in current construct}} expected-note{{used here}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd map(ps->a) is_device_ptr(ps) // expected-error{{variable already marked as mapped in current construct}} expected-note{{used here}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(ps) map(ps->a) // expected-error{{pointer cannot be mapped along with a section derived from itself}} expected-note{{used here}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(ps) firstprivate(ps) // expected-error{{firstprivate variable cannot be in a is_device_ptr clause in '#pragma omp target teams distribute simd' directive}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd firstprivate(ps) is_device_ptr(ps) // expected-error{{firstprivate variable cannot be in a is_device_ptr clause in '#pragma omp target teams distribute simd' directive}} expected-note{{defined as firstprivate}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(ps) private(ps) // expected-error{{private variable cannot be in a is_device_ptr clause in '#pragma omp target teams distribute simd' directive}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd private(ps) is_device_ptr(ps) // expected-error{{private variable cannot be in a is_device_ptr clause in '#pragma omp target teams distribute simd' directive}} expected-note{{defined as private}}
+ for (int i=0; i<100; i++)
+ ;
+ return 0;
+}
+
+int main(int argc, char **argv) {
+ const int d = 5;
+ const int da[5] = { 0 };
+ S4 e(4);
+ S5 g(5);
+ S6 h[10];
+ auto &rh = h;
+ int i;
+ int &j = i;
+ int *k = &j;
+ int *&z = k;
+ int aa[10];
+ auto &raa = aa;
+ S6 *ps;
+#pragma omp target teams distribute simd is_device_ptr // expected-error {{expected '(' after 'is_device_ptr'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr( // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error {{expected expression}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr() // expected-error {{expected expression}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(alloc) // expected-error {{use of undeclared identifier 'alloc'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(argc // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(i) // expected-error {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(j) // expected-error {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(k) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(z) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(aa) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(raa) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(e) // expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(g) // expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(h) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(rh) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(k,i,j) // expected-error2 {{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(d) // expected-error{{expected pointer, array, reference to pointer, or reference to array in 'is_device_ptr clause'}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(da) // OK
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd map(ps) is_device_ptr(ps) // expected-error{{variable already marked as mapped in current construct}} expected-note{{used here}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(ps) map(ps) // expected-error{{variable already marked as mapped in current construct}} expected-note{{used here}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd map(ps->a) is_device_ptr(ps) // expected-error{{variable already marked as mapped in current construct}} expected-note{{used here}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(ps) map(ps->a) // expected-error{{pointer cannot be mapped along with a section derived from itself}} expected-note{{used here}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(ps) firstprivate(ps) // expected-error{{firstprivate variable cannot be in a is_device_ptr clause in '#pragma omp target teams distribute simd' directive}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd firstprivate(ps) is_device_ptr(ps) // expected-error{{firstprivate variable cannot be in a is_device_ptr clause in '#pragma omp target teams distribute simd' directive}} expected-note{{defined as firstprivate}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd is_device_ptr(ps) private(ps) // expected-error{{private variable cannot be in a is_device_ptr clause in '#pragma omp target teams distribute simd' directive}}
+ for (int i=0; i<100; i++)
+ ;
+#pragma omp target teams distribute simd private(ps) is_device_ptr(ps) // expected-error{{private variable cannot be in a is_device_ptr clause in '#pragma omp target teams distribute simd' directive}} expected-note{{defined as private}}
+ for (int i=0; i<100; i++)
+ ;
+ return tmain<int, 3>(argc); // expected-note {{in instantiation of function template specialization 'tmain<int, 3>' requested here}}
+}
diff --git a/test/OpenMP/target_teams_distribute_simd_lastprivate_messages.cpp b/test/OpenMP/target_teams_distribute_simd_lastprivate_messages.cpp
new file mode 100644
index 0000000000000..3b533e2e54849
--- /dev/null
+++ b/test/OpenMP/target_teams_distribute_simd_lastprivate_messages.cpp
@@ -0,0 +1,233 @@
+// RUN: %clang_cc1 -verify -fopenmp %s
+
+void foo() {
+}
+
+bool foobool(int argc) {
+ return argc;
+}
+
+struct S1; // expected-note 2 {{declared here}} expected-note 2 {{forward declaration of 'S1'}}
+extern S1 a;
+class S2 {
+ mutable int a;
+
+public:
+ S2() : a(0) {}
+ S2(S2 &s2) : a(s2.a) {}
+ const S2 &operator =(const S2&) const;
+ S2 &operator =(const S2&);
+ static float S2s; // expected-note {{static data member is predetermined as shared}}
+ static const float S2sc;
+};
+const float S2::S2sc = 0; // expected-note {{static data member is predetermined as shared}}
+const S2 b;
+const S2 ba[5];
+class S3 {
+ int a;
+ S3 &operator=(const S3 &s3); // expected-note 2 {{implicitly declared private here}}
+
+public:
+ S3() : a(0) {}
+ S3(S3 &s3) : a(s3.a) {}
+};
+const S3 c; // expected-note {{global variable is predetermined as shared}}
+const S3 ca[5]; // expected-note {{global variable is predetermined as shared}}
+extern const int f; // expected-note {{global variable is predetermined as shared}}
+class S4 {
+ int a;
+ S4(); // expected-note 3 {{implicitly declared private here}}
+ S4(const S4 &s4);
+
+public:
+ S4(int v) : a(v) {}
+};
+class S5 {
+ int a;
+ S5() : a(0) {} // expected-note {{implicitly declared private here}}
+
+public:
+ S5(const S5 &s5) : a(s5.a) {}
+ S5(int v) : a(v) {}
+};
+class S6 {
+ int a;
+ S6() : a(0) {}
+
+public:
+ S6(const S6 &s6) : a(s6.a) {}
+ S6(int v) : a(v) {}
+};
+
+S3 h;
+#pragma omp threadprivate(h) // expected-note 2 {{defined as threadprivate or thread local}}
+
+template <class I, class C>
+int foomain(int argc, char **argv) {
+ I e(4);
+ I g(5);
+ int i;
+ int &j = i;
+#pragma omp target teams distribute simd lastprivate // expected-error {{expected '(' after 'lastprivate'}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd lastprivate( // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd lastprivate() // expected-error {{expected expression}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd lastprivate(argc // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd lastprivate(argc, // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd lastprivate(argc > 0 ? argv[1] : argv[2]) // expected-error {{expected variable name}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd lastprivate(argc)
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd lastprivate(S1) // expected-error {{'S1' does not refer to a value}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd lastprivate(a, b) // expected-error {{lastprivate variable with incomplete type 'S1'}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd lastprivate(argv[1]) // expected-error {{expected variable name}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd lastprivate(e, g) // expected-error 2 {{calling a private constructor of class 'S4'}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd lastprivate(h) // expected-error {{threadprivate or thread local variable cannot be lastprivate}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+ int v = 0;
+#pragma omp target teams distribute simd lastprivate(i)
+ for (int k = 0; k < argc; ++k) {
+ i = k;
+ v += i;
+ }
+
+#pragma omp target teams distribute simd lastprivate(j) private(i)
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd lastprivate(i)
+ for (int k = 0; k < argc; ++k) ++k;
+
+ return 0;
+}
+
+void bar(S4 a[2]) {
+#pragma omp target teams distribute simd lastprivate(a)
+ for (int i = 0; i < 2; ++i) foo();
+}
+
+namespace A {
+double x;
+#pragma omp threadprivate(x) // expected-note {{defined as threadprivate or thread local}}
+}
+namespace B {
+using A::x;
+}
+
+int main(int argc, char **argv) {
+ const int d = 5; // expected-note {{constant variable is predetermined as shared}}
+ const int da[5] = {0}; // expected-note {{constant variable is predetermined as shared}}
+ S4 e(4);
+ S5 g(5);
+ S3 m;
+ S6 n(2);
+ int i;
+ int &j = i;
+ float k;
+#pragma omp target teams distribute simd lastprivate // expected-error {{expected '(' after 'lastprivate'}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd lastprivate( // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd lastprivate() // expected-error {{expected expression}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd lastprivate(argc // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd lastprivate(argc, // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd lastprivate(argc > 0 ? argv[1] : argv[2]) // expected-error {{expected variable name}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd lastprivate(argc)
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd lastprivate(S1) // expected-error {{'S1' does not refer to a value}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd lastprivate(a, b, c, d, f) // expected-error {{lastprivate variable with incomplete type 'S1'}} expected-error 3 {{shared variable cannot be lastprivate}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd lastprivate(argv[1]) // expected-error {{expected variable name}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd lastprivate(2 * 2) // expected-error {{expected variable name}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd lastprivate(ba)
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd lastprivate(ca) // expected-error {{shared variable cannot be lastprivate}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd lastprivate(da) // expected-error {{shared variable cannot be lastprivate}}
+ for (i = 0; i < argc; ++i) foo();
+
+ int xa;
+#pragma omp target teams distribute simd lastprivate(xa) // OK
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd lastprivate(S2::S2s) // expected-error {{shared variable cannot be lastprivate}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd lastprivate(S2::S2sc) // expected-error {{shared variable cannot be lastprivate}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd lastprivate(e, g) // expected-error {{calling a private constructor of class 'S4'}} expected-error {{calling a private constructor of class 'S5'}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd lastprivate(m) // expected-error {{'operator=' is a private member of 'S3'}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd lastprivate(h) // expected-error {{threadprivate or thread local variable cannot be lastprivate}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd lastprivate(B::x) // expected-error {{threadprivate or thread local variable cannot be lastprivate}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd private(xa), lastprivate(xa) // expected-error {{private variable cannot be lastprivate}} expected-note {{defined as private}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd lastprivate(xa)
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd lastprivate(j)
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd firstprivate(m) lastprivate(m) // expected-error {{'operator=' is a private member of 'S3'}}
+ for (i = 0; i < argc; ++i) foo();
+
+#pragma omp target teams distribute simd lastprivate(n) firstprivate(n) // OK
+ for (i = 0; i < argc; ++i) foo();
+
+ static int si;
+#pragma omp target teams distribute simd lastprivate(si) // OK
+ for (i = 0; i < argc; ++i) si = i + 1;
+
+#pragma omp target teams distribute simd lastprivate(k) map(k) // expected-error {{lastprivate variable cannot be in a map clause in '#pragma omp target teams distribute simd' directive}} expected-note {{defined as lastprivate}}
+ for (i = 0; i < argc; ++i) foo();
+
+ return foomain<S4, S5>(argc, argv); // expected-note {{in instantiation of function template specialization 'foomain<S4, S5>' requested here}}
+}
diff --git a/test/OpenMP/target_teams_distribute_simd_linear_messages.cpp b/test/OpenMP/target_teams_distribute_simd_linear_messages.cpp
new file mode 100644
index 0000000000000..8db57a0f3665d
--- /dev/null
+++ b/test/OpenMP/target_teams_distribute_simd_linear_messages.cpp
@@ -0,0 +1,248 @@
+// RUN: %clang_cc1 -verify -fopenmp %s
+
+namespace X {
+ int x;
+};
+
+struct B {
+ static int ib; // expected-note {{'B::ib' declared here}}
+ static int bfoo() { return 8; }
+};
+
+int bfoo() { return 4; }
+
+int z;
+const int C1 = 1;
+const int C2 = 2;
+void test_linear_colons()
+{
+ int B = 0;
+
+#pragma omp target teams distribute simd linear(B:bfoo())
+ for (int i = 0; i < 10; ++i) ;
+
+#pragma omp target teams distribute simd linear(B::ib:B:bfoo()) // expected-error {{unexpected ':' in nested name specifier; did you mean '::'}}
+ for (int i = 0; i < 10; ++i) ;
+
+#pragma omp target teams distribute simd linear(B:ib) // expected-error {{use of undeclared identifier 'ib'; did you mean 'B::ib'}}
+ for (int i = 0; i < 10; ++i) ;
+
+#pragma omp target teams distribute simd linear(z:B:ib) // expected-error {{unexpected ':' in nested name specifier; did you mean '::'?}}
+ for (int i = 0; i < 10; ++i) ;
+
+#pragma omp target teams distribute simd linear(B:B::bfoo())
+ for (int i = 0; i < 10; ++i) ;
+
+#pragma omp target teams distribute simd linear(X::x : ::z)
+ for (int i = 0; i < 10; ++i) ;
+
+#pragma omp target teams distribute simd linear(B,::z, X::x)
+ for (int i = 0; i < 10; ++i) ;
+
+#pragma omp target teams distribute simd linear(::z)
+ for (int i = 0; i < 10; ++i) ;
+
+#pragma omp target teams distribute simd linear(B::bfoo()) // expected-error {{expected variable name}}
+ for (int i = 0; i < 10; ++i) ;
+
+#pragma omp target teams distribute simd linear(B::ib,B:C1+C2)
+ for (int i = 0; i < 10; ++i) ;
+}
+
+template<int L, class T, class N> T test_template(T* arr, N num) {
+ N i;
+ T sum = (T)0;
+ T ind2 = - num * L; // expected-note {{'ind2' defined here}}
+
+#pragma omp target teams distribute simd linear(ind2:L) // expected-error {{argument of a linear clause should be of integral or pointer type}}
+ for (i = 0; i < num; ++i) {
+ T cur = arr[(int)ind2];
+ ind2 += L;
+ sum += cur;
+ }
+ return T();
+}
+
+template<int LEN> int test_warn() {
+ int ind2 = 0;
+ #pragma omp target teams distribute simd linear(ind2:LEN) // expected-warning {{zero linear step (ind2 should probably be const)}}
+ for (int i = 0; i < 100; i++) {
+ ind2 += LEN;
+ }
+ return ind2;
+}
+
+struct S1; // expected-note 2 {{declared here}} expected-note 2 {{forward declaration of 'S1'}}
+extern S1 a;
+class S2 {
+ mutable int a;
+public:
+ S2():a(0) { }
+};
+const S2 b; // expected-note 2 {{'b' defined here}}
+const S2 ba[5];
+class S3 {
+ int a;
+public:
+ S3():a(0) { }
+};
+const S3 ca[5];
+class S4 {
+ int a;
+ S4();
+public:
+ S4(int v):a(v) { }
+};
+class S5 {
+ int a;
+ S5():a(0) {}
+public:
+ S5(int v):a(v) { }
+};
+
+S3 h;
+#pragma omp threadprivate(h) // expected-note 2 {{defined as threadprivate or thread local}}
+
+template<class I, class C> int foomain(I argc, C **argv) {
+ I e(4);
+ I g(5);
+ int i;
+ int &j = i;
+
+#pragma omp target teams distribute simd linear // expected-error {{expected '(' after 'linear'}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd linear ( // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd linear () // expected-error {{expected expression}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd linear (argc // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd linear (argc, // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd linear (argc > 0 ? argv[1] : argv[2]) // expected-error {{expected variable name}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd linear (argc : 5)
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd linear (S1) // expected-error {{'S1' does not refer to a value}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd linear (a, b:B::ib) // expected-error {{linear variable with incomplete type 'S1'}} expected-error {{const-qualified variable cannot be linear}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd linear (argv[1]) // expected-error {{expected variable name}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd linear(e, g)
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd linear(h) // expected-error {{threadprivate or thread local variable cannot be linear}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd linear(i)
+ for (int k = 0; k < argc; ++k) ++k;
+
+ #pragma omp parallel
+ {
+ int v = 0;
+ int i;
+ #pragma omp target teams distribute simd linear(v:i)
+ for (int k = 0; k < argc; ++k) { i = k; v += i; }
+ }
+
+#pragma omp target teams distribute simd linear(j)
+ for (int k = 0; k < argc; ++k) ++k;
+
+ int v = 0;
+
+#pragma omp target teams distribute simd linear(v:j)
+ for (int k = 0; k < argc; ++k) { ++k; v += j; }
+
+#pragma omp target teams distribute simd linear(i)
+ for (int k = 0; k < argc; ++k) ++k;
+ return 0;
+}
+
+namespace A {
+double x;
+#pragma omp threadprivate(x) // expected-note {{defined as threadprivate or thread local}}
+}
+namespace C {
+using A::x;
+}
+
+int main(int argc, char **argv) {
+ double darr[100];
+ // expected-note@+1 {{in instantiation of function template specialization 'test_template<-4, double, int>' requested here}}
+ test_template<-4>(darr, 4);
+ // expected-note@+1 {{in instantiation of function template specialization 'test_warn<0>' requested here}}
+ test_warn<0>();
+
+ S4 e(4); // expected-note {{'e' defined here}}
+ S5 g(5); // expected-note {{'g' defined here}}
+ int i;
+ int &j = i;
+
+#pragma omp target teams distribute simd linear // expected-error {{expected '(' after 'linear'}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd linear ( // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd linear () // expected-error {{expected expression}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd linear (argc // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd linear (argc, // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd linear (argc > 0 ? argv[1] : argv[2]) // expected-error {{expected variable name}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd linear (argc)
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd linear (S1) // expected-error {{'S1' does not refer to a value}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+
+#pragma omp target teams distribute simd linear (a, b) // expected-error {{linear variable with incomplete type 'S1'}} expected-error {{const-qualified variable cannot be linear}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd linear (argv[1]) // expected-error {{expected variable name}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd linear(e, g) // expected-error {{argument of a linear clause should be of integral or pointer type, not 'S4'}} expected-error {{argument of a linear clause should be of integral or pointer type, not 'S5'}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd linear(h, C::x) // expected-error 2 {{threadprivate or thread local variable cannot be linear}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+ #pragma omp parallel
+ {
+ int i;
+ #pragma omp target teams distribute simd linear(i)
+ for (int k = 0; k < argc; ++k) ++k;
+
+ #pragma omp target teams distribute simd linear(i : 4)
+ for (int k = 0; k < argc; ++k) { ++k; i += 4; }
+ }
+
+#pragma omp target teams distribute simd linear(j)
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd linear(i)
+ for (int k = 0; k < argc; ++k) ++k;
+
+ foomain<int,char>(argc,argv); // expected-note {{in instantiation of function template specialization 'foomain<int, char>' requested here}}
+ return 0;
+}
+
diff --git a/test/OpenMP/target_teams_distribute_simd_loop_messages.cpp b/test/OpenMP/target_teams_distribute_simd_loop_messages.cpp
new file mode 100644
index 0000000000000..3ddabce5e8d76
--- /dev/null
+++ b/test/OpenMP/target_teams_distribute_simd_loop_messages.cpp
@@ -0,0 +1,627 @@
+// RUN: %clang_cc1 -fsyntax-only -fopenmp -x c++ -std=c++11 -fexceptions -fcxx-exceptions -verify %s
+
+class S {
+ int a;
+ S() : a(0) {}
+
+public:
+ S(int v) : a(v) {}
+ S(const S &s) : a(s.a) {}
+};
+
+static int sii;
+// expected-note@+1 {{defined as threadprivate or thread local}}
+#pragma omp threadprivate(sii)
+static int globalii;
+
+int test_iteration_spaces() {
+ const int N = 100;
+ float a[N], b[N], c[N];
+ int ii, jj, kk;
+ float fii;
+ double dii;
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; i += 1) {
+ c[i] = a[i] + b[i];
+ }
+#pragma omp target teams distribute simd
+ for (char i = 0; i < 10; i++) {
+ c[i] = a[i] + b[i];
+ }
+#pragma omp target teams distribute simd
+ for (char i = 0; i < 10; i += '\1') {
+ c[i] = a[i] + b[i];
+ }
+#pragma omp target teams distribute simd
+ for (long long i = 0; i < 10; i++) {
+ c[i] = a[i] + b[i];
+ }
+#pragma omp target teams distribute simd
+// expected-error@+1 {{expression must have integral or unscoped enumeration type, not 'double'}}
+ for (long long i = 0; i < 10; i += 1.5) {
+ c[i] = a[i] + b[i];
+ }
+#pragma omp target teams distribute simd
+ for (long long i = 0; i < 'z'; i += 1u) {
+ c[i] = a[i] + b[i];
+ }
+#pragma omp target teams distribute simd
+// expected-error@+1 {{variable must be of integer or random access iterator type}}
+ for (float fi = 0; fi < 10.0; fi++) {
+ c[(int)fi] = a[(int)fi] + b[(int)fi];
+ }
+#pragma omp target teams distribute simd
+// expected-error@+1 {{variable must be of integer or random access iterator type}}
+ for (double fi = 0; fi < 10.0; fi++) {
+ c[(int)fi] = a[(int)fi] + b[(int)fi];
+ }
+#pragma omp target teams distribute simd
+// expected-error@+1 {{initialization clause of OpenMP for loop is not in canonical form ('var = init' or 'T var = init')}}
+ for (int &ref = ii; ref < 10; ref++) {
+ }
+#pragma omp target teams distribute simd
+// expected-error@+1 {{initialization clause of OpenMP for loop is not in canonical form ('var = init' or 'T var = init')}}
+ for (int i; i < 10; i++)
+ c[i] = a[i];
+
+#pragma omp target teams distribute simd
+// expected-error@+1 {{initialization clause of OpenMP for loop is not in canonical form ('var = init' or 'T var = init')}}
+ for (int i = 0, j = 0; i < 10; ++i)
+ c[i] = a[i];
+
+#pragma omp target teams distribute simd
+// expected-error@+1 {{initialization clause of OpenMP for loop is not in canonical form ('var = init' or 'T var = init')}}
+ for (; ii < 10; ++ii)
+ c[ii] = a[ii];
+
+#pragma omp target teams distribute simd
+// expected-warning@+2 {{expression result unused}}
+// expected-error@+1 {{initialization clause of OpenMP for loop is not in canonical form ('var = init' or 'T var = init')}}
+ for (ii + 1; ii < 10; ++ii)
+ c[ii] = a[ii];
+
+#pragma omp target teams distribute simd
+// expected-error@+1 {{initialization clause of OpenMP for loop is not in canonical form ('var = init' or 'T var = init')}}
+ for (c[ii] = 0; ii < 10; ++ii)
+ c[ii] = a[ii];
+
+#pragma omp target teams distribute simd
+// Ok to skip parenthesises.
+ for (((ii)) = 0; ii < 10; ++ii)
+ c[ii] = a[ii];
+
+#pragma omp target teams distribute simd
+// expected-error@+1 {{condition of OpenMP for loop must be a relational comparison ('<', '<=', '>', or '>=') of loop variable 'i'}}
+ for (int i = 0; i; i++)
+ c[i] = a[i];
+
+#pragma omp target teams distribute simd
+// expected-error@+2 {{condition of OpenMP for loop must be a relational comparison ('<', '<=', '>', or '>=') of loop variable 'i'}}
+// expected-error@+1 {{increment clause of OpenMP for loop must perform simple addition or subtraction on loop variable 'i'}}
+ for (int i = 0; jj < kk; ii++)
+ c[i] = a[i];
+
+#pragma omp target teams distribute simd
+// expected-error@+1 {{condition of OpenMP for loop must be a relational comparison ('<', '<=', '>', or '>=') of loop variable 'i'}}
+ for (int i = 0; !!i; i++)
+ c[i] = a[i];
+
+#pragma omp target teams distribute simd
+// expected-error@+1 {{condition of OpenMP for loop must be a relational comparison ('<', '<=', '>', or '>=') of loop variable 'i'}}
+ for (int i = 0; i != 1; i++)
+ c[i] = a[i];
+
+#pragma omp target teams distribute simd
+// expected-error@+1 {{condition of OpenMP for loop must be a relational comparison ('<', '<=', '>', or '>=') of loop variable 'i'}}
+ for (int i = 0;; i++)
+ c[i] = a[i];
+
+// Ok.
+#pragma omp target teams distribute simd
+ for (int i = 11; i > 10; i--)
+ c[i] = a[i];
+
+// Ok.
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i)
+ c[i] = a[i];
+
+// Ok.
+#pragma omp target teams distribute simd
+ for (ii = 0; ii < 10; ++ii)
+ c[ii] = a[ii];
+
+#pragma omp target teams distribute simd
+// expected-error@+1 {{increment clause of OpenMP for loop must perform simple addition or subtraction on loop variable 'ii'}}
+ for (ii = 0; ii < 10; ++jj)
+ c[ii] = a[jj];
+
+#pragma omp target teams distribute simd
+// expected-error@+1 {{increment clause of OpenMP for loop must perform simple addition or subtraction on loop variable 'ii'}}
+ for (ii = 0; ii < 10; ++++ii)
+ c[ii] = a[ii];
+
+// Ok but undefined behavior (in general, cannot check that incr
+// is really loop-invariant).
+#pragma omp target teams distribute simd
+ for (ii = 0; ii < 10; ii = ii + ii)
+ c[ii] = a[ii];
+
+#pragma omp target teams distribute simd
+// expected-error@+1 {{expression must have integral or unscoped enumeration type, not 'float'}}
+ for (ii = 0; ii < 10; ii = ii + 1.0f)
+ c[ii] = a[ii];
+
+// Ok - step was converted to integer type.
+#pragma omp target teams distribute simd
+ for (ii = 0; ii < 10; ii = ii + (int)1.1f)
+ c[ii] = a[ii];
+
+#pragma omp target teams distribute simd
+// expected-error@+1 {{increment clause of OpenMP for loop must perform simple addition or subtraction on loop variable 'ii'}}
+ for (ii = 0; ii < 10; jj = ii + 2)
+ c[ii] = a[ii];
+
+#pragma omp target teams distribute simd
+// expected-warning@+2 {{relational comparison result unused}}
+// expected-error@+1 {{increment clause of OpenMP for loop must perform simple addition or subtraction on loop variable 'ii'}}
+ for (ii = 0; ii<10; jj> kk + 2)
+ c[ii] = a[ii];
+
+#pragma omp target teams distribute simd
+// expected-error@+1 {{increment clause of OpenMP for loop must perform simple addition or subtraction on loop variable 'ii'}}
+ for (ii = 0; ii < 10;)
+ c[ii] = a[ii];
+
+#pragma omp target teams distribute simd
+// expected-warning@+2 {{expression result unused}}
+// expected-error@+1 {{increment clause of OpenMP for loop must perform simple addition or subtraction on loop variable 'ii'}}
+ for (ii = 0; ii < 10; !ii)
+ c[ii] = a[ii];
+
+#pragma omp target teams distribute simd
+// expected-error@+1 {{increment clause of OpenMP for loop must perform simple addition or subtraction on loop variable 'ii'}}
+ for (ii = 0; ii < 10; ii ? ++ii : ++jj)
+ c[ii] = a[ii];
+
+#pragma omp target teams distribute simd
+// expected-error@+1 {{increment clause of OpenMP for loop must perform simple addition or subtraction on loop variable 'ii'}}
+ for (ii = 0; ii < 10; ii = ii < 10)
+ c[ii] = a[ii];
+
+#pragma omp target teams distribute simd
+// expected-note@+2 {{loop step is expected to be positive due to this condition}}
+// expected-error@+1 {{increment expression must cause 'ii' to increase on each iteration of OpenMP for loop}}
+ for (ii = 0; ii < 10; ii = ii + 0)
+ c[ii] = a[ii];
+
+#pragma omp target teams distribute simd
+// expected-note@+2 {{loop step is expected to be positive due to this condition}}
+// expected-error@+1 {{increment expression must cause 'ii' to increase on each iteration of OpenMP for loop}}
+ for (ii = 0; ii < 10; ii = ii + (int)(0.8 - 0.45))
+ c[ii] = a[ii];
+
+#pragma omp target teams distribute simd
+// expected-note@+2 {{loop step is expected to be positive due to this condition}}
+// expected-error@+1 {{increment expression must cause 'ii' to increase on each iteration of OpenMP for loop}}
+ for (ii = 0; (ii) < 10; ii -= 25)
+ c[ii] = a[ii];
+
+#pragma omp target teams distribute simd
+// expected-note@+2 {{loop step is expected to be positive due to this condition}}
+// expected-error@+1 {{increment expression must cause 'ii' to increase on each iteration of OpenMP for loop}}
+ for (ii = 0; (ii < 10); ii -= 0)
+ c[ii] = a[ii];
+
+#pragma omp target teams distribute simd
+// expected-note@+2 {{loop step is expected to be negative due to this condition}}
+// expected-error@+1 {{increment expression must cause 'ii' to decrease on each iteration of OpenMP for loop}}
+ for (ii = 0; ii > 10; (ii += 0))
+ c[ii] = a[ii];
+
+#pragma omp target teams distribute simd
+// expected-note@+2 {{loop step is expected to be positive due to this condition}}
+// expected-error@+1 {{increment expression must cause 'ii' to increase on each iteration of OpenMP for loop}}
+ for (ii = 0; ii < 10; (ii) = (1 - 1) + (ii))
+ c[ii] = a[ii];
+
+#pragma omp target teams distribute simd
+// expected-note@+2 {{loop step is expected to be negative due to this condition}}
+// expected-error@+1 {{increment expression must cause 'ii' to decrease on each iteration of OpenMP for loop}}
+ for ((ii = 0); ii > 10; (ii -= 0))
+ c[ii] = a[ii];
+
+#pragma omp target teams distribute simd
+// expected-note@+2 {{loop step is expected to be positive due to this condition}}
+// expected-error@+1 {{increment expression must cause 'ii' to increase on each iteration of OpenMP for loop}}
+ for (ii = 0; (ii < 10); (ii -= 0))
+ c[ii] = a[ii];
+
+#pragma omp target teams distribute simd firstprivate(ii) // expected-note {{defined as firstprivate}}
+// expected-error@+1 {{loop iteration variable in the associated loop of 'omp target teams distribute simd' directive may not be firstprivate, predetermined as linear}}
+ for (ii = 0; ii < 10; ii++)
+ c[ii] = a[ii];
+
+#pragma omp target teams distribute simd private(ii) // expected-note {{defined as private}}
+// expected-error@+1 {{loop iteration variable in the associated loop of 'omp target teams distribute simd' directive may not be private, predetermined as linear}}
+ for (ii = 0; ii < 10; ii++)
+ c[ii] = a[ii];
+
+#pragma omp target teams distribute simd lastprivate(ii) // expected-note {{defined as lastprivate}}
+// expected-error@+1 {{loop iteration variable in the associated loop of 'omp target teams distribute simd' directive may not be lastprivate, predetermined as linear}}
+ for (ii = 0; ii < 10; ii++)
+ c[ii] = a[ii];
+
+#pragma omp target teams distribute simd
+// expected-error@+1 {{loop iteration variable in the associated loop of 'omp target teams distribute simd' directive may not be threadprivate or thread local, predetermined as linear}}
+ for (sii = 0; sii < 10; sii++)
+ c[sii] = a[sii];
+
+ {
+#pragma omp target teams distribute simd collapse(2)
+ for (ii = 0; ii < 10; ii += 1)
+ for (globalii = 0; globalii < 10; globalii += 1)
+ c[globalii] += a[globalii] + ii;
+ }
+
+#pragma omp target teams distribute simd
+// expected-error@+1 {{statement after '#pragma omp target teams distribute simd' must be a for loop}}
+ for (auto &item : a) {
+ item = item + 1;
+ }
+
+#pragma omp target teams distribute simd
+// expected-note@+2 {{loop step is expected to be positive due to this condition}}
+// expected-error@+1 {{increment expression must cause 'i' to increase on each iteration of OpenMP for loop}}
+ for (unsigned i = 9; i < 10; i--) {
+ c[i] = a[i] + b[i];
+ }
+
+ int(*lb)[4] = nullptr;
+#pragma omp target teams distribute simd
+ for (int(*p)[4] = lb; p < lb + 8; ++p) {
+ }
+
+#pragma omp target teams distribute simd
+// expected-warning@+1 {{initialization clause of OpenMP for loop is not in canonical form ('var = init' or 'T var = init')}}
+ for (int a{0}; a < 10; ++a) {
+ }
+
+ return 0;
+}
+
+// Iterators allowed in openmp for-loops.
+namespace std {
+struct random_access_iterator_tag {};
+template <class Iter>
+struct iterator_traits {
+ typedef typename Iter::difference_type difference_type;
+ typedef typename Iter::iterator_category iterator_category;
+};
+template <class Iter>
+typename iterator_traits<Iter>::difference_type
+distance(Iter first, Iter last) { return first - last; }
+}
+class Iter0 {
+public:
+ Iter0() {}
+ Iter0(const Iter0 &) {}
+ Iter0 operator++() { return *this; }
+ Iter0 operator--() { return *this; }
+ bool operator<(Iter0 a) { return true; }
+};
+// expected-note@+2 {{candidate function not viable: no known conversion from 'GoodIter' to 'Iter0' for 1st argument}}
+// expected-note@+1 2 {{candidate function not viable: no known conversion from 'Iter1' to 'Iter0' for 1st argument}}
+int operator-(Iter0 a, Iter0 b) { return 0; }
+class Iter1 {
+public:
+ Iter1(float f = 0.0f, double d = 0.0) {}
+ Iter1(const Iter1 &) {}
+ Iter1 operator++() { return *this; }
+ Iter1 operator--() { return *this; }
+ bool operator<(Iter1 a) { return true; }
+ bool operator>=(Iter1 a) { return false; }
+};
+class GoodIter {
+public:
+ GoodIter() {}
+ GoodIter(const GoodIter &) {}
+ GoodIter(int fst, int snd) {}
+ GoodIter &operator=(const GoodIter &that) { return *this; }
+ GoodIter &operator=(const Iter0 &that) { return *this; }
+ GoodIter &operator+=(int x) { return *this; }
+ explicit GoodIter(void *) {}
+ GoodIter operator++() { return *this; }
+ GoodIter operator--() { return *this; }
+ bool operator!() { return true; }
+ bool operator<(GoodIter a) { return true; }
+ bool operator<=(GoodIter a) { return true; }
+ bool operator>=(GoodIter a) { return false; }
+ typedef int difference_type;
+ typedef std::random_access_iterator_tag iterator_category;
+};
+// expected-note@+2 {{candidate function not viable: no known conversion from 'const Iter0' to 'GoodIter' for 2nd argument}}
+// expected-note@+1 2 {{candidate function not viable: no known conversion from 'Iter1' to 'GoodIter' for 1st argument}}
+int operator-(GoodIter a, GoodIter b) { return 0; }
+// expected-note@+1 3 {{candidate function not viable: requires single argument 'a', but 2 arguments were provided}}
+GoodIter operator-(GoodIter a) { return a; }
+// expected-note@+2 {{candidate function not viable: no known conversion from 'const Iter0' to 'int' for 2nd argument}}
+// expected-note@+1 2 {{candidate function not viable: no known conversion from 'Iter1' to 'GoodIter' for 1st argument}}
+GoodIter operator-(GoodIter a, int v) { return GoodIter(); }
+// expected-note@+1 2 {{candidate function not viable: no known conversion from 'Iter0' to 'GoodIter' for 1st argument}}
+GoodIter operator+(GoodIter a, int v) { return GoodIter(); }
+// expected-note@+2 {{candidate function not viable: no known conversion from 'GoodIter' to 'int' for 1st argument}}
+// expected-note@+1 2 {{candidate function not viable: no known conversion from 'Iter1' to 'int' for 1st argument}}
+GoodIter operator-(int v, GoodIter a) { return GoodIter(); }
+// expected-note@+1 2 {{candidate function not viable: no known conversion from 'Iter0' to 'int' for 1st argument}}
+GoodIter operator+(int v, GoodIter a) { return GoodIter(); }
+
+int test_with_random_access_iterator() {
+ GoodIter begin, end;
+ Iter0 begin0, end0;
+#pragma omp target teams distribute simd
+ for (GoodIter I = begin; I < end; ++I)
+ ++I;
+#pragma omp target teams distribute simd
+// expected-error@+1 {{initialization clause of OpenMP for loop is not in canonical form ('var = init' or 'T var = init')}}
+ for (GoodIter &I = begin; I < end; ++I)
+ ++I;
+#pragma omp target teams distribute simd
+ for (GoodIter I = begin; I >= end; --I)
+ ++I;
+#pragma omp target teams distribute simd
+// expected-warning@+1 {{initialization clause of OpenMP for loop is not in canonical form ('var = init' or 'T var = init')}}
+ for (GoodIter I(begin); I < end; ++I)
+ ++I;
+#pragma omp target teams distribute simd
+// expected-warning@+1 {{initialization clause of OpenMP for loop is not in canonical form ('var = init' or 'T var = init')}}
+ for (GoodIter I(nullptr); I < end; ++I)
+ ++I;
+#pragma omp target teams distribute simd
+// expected-warning@+1 {{initialization clause of OpenMP for loop is not in canonical form ('var = init' or 'T var = init')}}
+ for (GoodIter I(0); I < end; ++I)
+ ++I;
+#pragma omp target teams distribute simd
+// expected-warning@+1 {{initialization clause of OpenMP for loop is not in canonical form ('var = init' or 'T var = init')}}
+ for (GoodIter I(1, 2); I < end; ++I)
+ ++I;
+#pragma omp target teams distribute simd
+ for (begin = GoodIter(0); begin < end; ++begin)
+ ++begin;
+#pragma omp target teams distribute simd
+// expected-error@+2 {{invalid operands to binary expression ('GoodIter' and 'const Iter0')}}
+// expected-error@+1 {{could not calculate number of iterations calling 'operator-' with upper and lower loop bounds}}
+ for (begin = begin0; begin < end; ++begin)
+ ++begin;
+#pragma omp target teams distribute simd
+// expected-error@+1 {{initialization clause of OpenMP for loop is not in canonical form ('var = init' or 'T var = init')}}
+ for (++begin; begin < end; ++begin)
+ ++begin;
+#pragma omp target teams distribute simd
+ for (begin = end; begin < end; ++begin)
+ ++begin;
+#pragma omp target teams distribute simd
+// expected-error@+1 {{condition of OpenMP for loop must be a relational comparison ('<', '<=', '>', or '>=') of loop variable 'I'}}
+ for (GoodIter I = begin; I - I; ++I)
+ ++I;
+#pragma omp target teams distribute simd
+// expected-error@+1 {{condition of OpenMP for loop must be a relational comparison ('<', '<=', '>', or '>=') of loop variable 'I'}}
+ for (GoodIter I = begin; begin < end; ++I)
+ ++I;
+#pragma omp target teams distribute simd
+// expected-error@+1 {{condition of OpenMP for loop must be a relational comparison ('<', '<=', '>', or '>=') of loop variable 'I'}}
+ for (GoodIter I = begin; !I; ++I)
+ ++I;
+#pragma omp target teams distribute simd
+// expected-note@+2 {{loop step is expected to be negative due to this condition}}
+// expected-error@+1 {{increment expression must cause 'I' to decrease on each iteration of OpenMP for loop}}
+ for (GoodIter I = begin; I >= end; I = I + 1)
+ ++I;
+#pragma omp target teams distribute simd
+ for (GoodIter I = begin; I >= end; I = I - 1)
+ ++I;
+#pragma omp target teams distribute simd
+// expected-error@+1 {{increment clause of OpenMP for loop must perform simple addition or subtraction on loop variable 'I'}}
+ for (GoodIter I = begin; I >= end; I = -I)
+ ++I;
+#pragma omp target teams distribute simd
+// expected-note@+2 {{loop step is expected to be negative due to this condition}}
+// expected-error@+1 {{increment expression must cause 'I' to decrease on each iteration of OpenMP for loop}}
+ for (GoodIter I = begin; I >= end; I = 2 + I)
+ ++I;
+#pragma omp target teams distribute simd
+// expected-error@+1 {{increment clause of OpenMP for loop must perform simple addition or subtraction on loop variable 'I'}}
+ for (GoodIter I = begin; I >= end; I = 2 - I)
+ ++I;
+#pragma omp target teams distribute simd
+// expected-error@+1 {{invalid operands to binary expression ('Iter0' and 'int')}}
+ for (Iter0 I = begin0; I < end0; ++I)
+ ++I;
+#pragma omp target teams distribute simd
+// Initializer is constructor without params.
+// expected-error@+2 {{invalid operands to binary expression ('Iter0' and 'int')}}
+// expected-warning@+1 {{initialization clause of OpenMP for loop is not in canonical form ('var = init' or 'T var = init')}}
+ for (Iter0 I; I < end0; ++I)
+ ++I;
+ Iter1 begin1, end1;
+#pragma omp target teams distribute simd
+// expected-error@+2 {{invalid operands to binary expression ('Iter1' and 'Iter1')}}
+// expected-error@+1 {{could not calculate number of iterations calling 'operator-' with upper and lower loop bounds}}
+ for (Iter1 I = begin1; I < end1; ++I)
+ ++I;
+#pragma omp target teams distribute simd
+// expected-note@+2 {{loop step is expected to be negative due to this condition}}
+// expected-error@+1 {{increment expression must cause 'I' to decrease on each iteration of OpenMP for loop}}
+ for (Iter1 I = begin1; I >= end1; ++I)
+ ++I;
+#pragma omp target teams distribute simd
+// expected-error@+4 {{invalid operands to binary expression ('Iter1' and 'float')}}
+// expected-error@+3 {{could not calculate number of iterations calling 'operator-' with upper and lower loop bounds}}
+// Initializer is constructor with all default params.
+// expected-warning@+1 {{initialization clause of OpenMP for loop is not in canonical form ('var = init' or 'T var = init')}}
+ for (Iter1 I; I < end1; ++I) {
+ }
+ return 0;
+}
+
+template <typename IT, int ST>
+class TC {
+public:
+ int dotest_lt(IT begin, IT end) {
+#pragma omp target teams distribute simd
+// expected-note@+2 {{loop step is expected to be positive due to this condition}}
+// expected-error@+1 {{increment expression must cause 'I' to increase on each iteration of OpenMP for loop}}
+ for (IT I = begin; I < end; I = I + ST) {
+ ++I;
+ }
+#pragma omp target teams distribute simd
+// expected-note@+2 {{loop step is expected to be positive due to this condition}}
+// expected-error@+1 {{increment expression must cause 'I' to increase on each iteration of OpenMP for loop}}
+ for (IT I = begin; I <= end; I += ST) {
+ ++I;
+ }
+#pragma omp target teams distribute simd
+ for (IT I = begin; I < end; ++I) {
+ ++I;
+ }
+ }
+
+ static IT step() {
+ return IT(ST);
+ }
+};
+template <typename IT, int ST = 0>
+int dotest_gt(IT begin, IT end) {
+#pragma omp target teams distribute simd
+// expected-note@+2 2 {{loop step is expected to be negative due to this condition}}
+// expected-error@+1 2 {{increment expression must cause 'I' to decrease on each iteration of OpenMP for loop}}
+ for (IT I = begin; I >= end; I = I + ST) {
+ ++I;
+ }
+#pragma omp target teams distribute simd
+// expected-note@+2 2 {{loop step is expected to be negative due to this condition}}
+// expected-error@+1 2 {{increment expression must cause 'I' to decrease on each iteration of OpenMP for loop}}
+ for (IT I = begin; I >= end; I += ST) {
+ ++I;
+ }
+
+#pragma omp target teams distribute simd
+// expected-note@+2 {{loop step is expected to be negative due to this condition}}
+// expected-error@+1 {{increment expression must cause 'I' to decrease on each iteration of OpenMP for loop}}
+ for (IT I = begin; I >= end; ++I) {
+ ++I;
+ }
+
+#pragma omp target teams distribute simd
+ for (IT I = begin; I < end; I += TC<int, ST>::step()) {
+ ++I;
+ }
+}
+
+void test_with_template() {
+ GoodIter begin, end;
+ TC<GoodIter, 100> t1;
+ TC<GoodIter, -100> t2;
+ t1.dotest_lt(begin, end);
+ t2.dotest_lt(begin, end); // expected-note {{in instantiation of member function 'TC<GoodIter, -100>::dotest_lt' requested here}}
+ dotest_gt(begin, end); // expected-note {{in instantiation of function template specialization 'dotest_gt<GoodIter, 0>' requested here}}
+ dotest_gt<unsigned, -10>(0, 100); // expected-note {{in instantiation of function template specialization 'dotest_gt<unsigned int, -10>' requested here}}
+}
+
+void test_loop_break() {
+ const int N = 100;
+ float a[N], b[N], c[N];
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; i++) {
+ c[i] = a[i] + b[i];
+ for (int j = 0; j < 10; ++j) {
+ if (a[i] > b[j])
+ break; // OK in nested loop
+ }
+ switch (i) {
+ case 1:
+ b[i]++;
+ break;
+ default:
+ break;
+ }
+ if (c[i] > 10)
+ break; // expected-error {{'break' statement cannot be used in OpenMP for loop}}
+
+ if (c[i] > 11)
+ break; // expected-error {{'break' statement cannot be used in OpenMP for loop}}
+ }
+
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; i++) {
+ for (int j = 0; j < 10; j++) {
+ c[i] = a[i] + b[i];
+ if (c[i] > 10) {
+ if (c[i] < 20) {
+ break; // OK
+ }
+ }
+ }
+ }
+}
+
+void test_loop_eh() {
+ const int N = 100;
+ float a[N], b[N], c[N];
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; i++) {
+ c[i] = a[i] + b[i];
+ try { // expected-error {{'try' statement cannot be used in OpenMP simd region}}
+ for (int j = 0; j < 10; ++j) {
+ if (a[i] > b[j])
+ throw a[i]; // expected-error {{throw' statement cannot be used in OpenMP simd region}}
+ }
+ throw a[i]; // expected-error {{throw' statement cannot be used in OpenMP simd region}}
+ } catch (float f) {
+ if (f > 0.1)
+ throw a[i]; // expected-error {{throw' statement cannot be used in OpenMP simd region}}
+ return; // expected-error {{cannot return from OpenMP region}}
+ }
+ switch (i) {
+ case 1:
+ b[i]++;
+ break;
+ default:
+ break;
+ }
+ for (int j = 0; j < 10; j++) {
+ if (c[i] > 10)
+ throw c[i]; // expected-error {{throw' statement cannot be used in OpenMP simd region}}
+ }
+ }
+ if (c[9] > 10)
+ throw c[9]; // OK
+
+#pragma omp target teams distribute simd
+ for (int i = 0; i < 10; ++i) {
+ struct S {
+ void g() { throw 0; }
+ };
+ }
+}
+
+void test_loop_firstprivate_lastprivate() {
+ S s(4);
+#pragma omp target teams distribute simd lastprivate(s) firstprivate(s)
+ for (int i = 0; i < 16; ++i)
+ ;
+}
+
+void test_ordered() {
+#pragma omp target teams distribute simd ordered // expected-error {{unexpected OpenMP clause 'ordered' in directive '#pragma omp target teams distribute simd'}}
+ for (int i = 0; i < 16; ++i)
+ ;
+}
+
+void test_nowait() {
+// expected-error@+1 {{directive '#pragma omp target teams distribute simd' cannot contain more than one 'nowait' clause}}
+#pragma omp target teams distribute simd nowait nowait
+ for (int i = 0; i < 16; ++i)
+ ;
+}
+
diff --git a/test/OpenMP/target_teams_distribute_simd_map_messages.cpp b/test/OpenMP/target_teams_distribute_simd_map_messages.cpp
new file mode 100644
index 0000000000000..414f6f83debbc
--- /dev/null
+++ b/test/OpenMP/target_teams_distribute_simd_map_messages.cpp
@@ -0,0 +1,281 @@
+// RUN: %clang_cc1 -verify -fopenmp -ferror-limit 100 %s
+
+void foo() {
+}
+
+bool foobool(int argc) {
+ return argc;
+}
+
+struct S1; // expected-note 2 {{declared here}}
+extern S1 a;
+class S2 {
+ mutable int a;
+public:
+ S2():a(0) { }
+ S2(S2 &s2):a(s2.a) { }
+ static float S2s; // expected-note 4 {{mappable type cannot contain static members}}
+ static const float S2sc; // expected-note 4 {{mappable type cannot contain static members}}
+};
+const float S2::S2sc = 0;
+const S2 b;
+const S2 ba[5];
+class S3 {
+ int a;
+public:
+ S3():a(0) { }
+ S3(S3 &s3):a(s3.a) { }
+};
+const S3 c;
+const S3 ca[5];
+extern const int f;
+class S4 {
+ int a;
+ S4();
+ S4(const S4 &s4);
+public:
+ S4(int v):a(v) { }
+};
+class S5 {
+ int a;
+ S5():a(0) {}
+ S5(const S5 &s5):a(s5.a) { }
+public:
+ S5(int v):a(v) { }
+};
+
+S3 h;
+#pragma omp threadprivate(h) // expected-note 2 {{defined as threadprivate or thread local}}
+
+typedef int from;
+
+template <typename T, int I> // expected-note {{declared here}}
+T tmain(T argc) {
+ const T d = 5;
+ const T da[5] = { 0 };
+ S4 e(4);
+ S5 g(5);
+ T i, t[20];
+ T &j = i;
+ T *k = &j;
+ T x;
+ T y;
+ T to, tofrom, always;
+ const T (&l)[5] = da;
+
+
+#pragma omp target teams distribute simd map // expected-error {{expected '(' after 'map'}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map( // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error {{expected expression}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map() // expected-error {{expected expression}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(alloc) // expected-error {{use of undeclared identifier 'alloc'}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(to argc // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error {{expected ',' or ')' in 'map' clause}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(to:) // expected-error {{expected expression}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(from: argc, // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(x: y) // expected-error {{incorrect map type, expected one of 'to', 'from', 'tofrom', 'alloc', 'release', or 'delete'}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(l[-1:]) // expected-error 2 {{array section must be a subset of the original array}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(l[:-1]) // expected-error 2 {{section length is evaluated to a negative value -1}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(x)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(tofrom: t[:I])
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(T: a) // expected-error {{incorrect map type, expected one of 'to', 'from', 'tofrom', 'alloc', 'release', or 'delete'}} expected-error {{incomplete type 'S1' where a complete type is required}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(T) // expected-error {{'T' does not refer to a value}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(I) // expected-error 2 {{expected expression containing only member accesses and/or array sections based on named variables}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(S2::S2s)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(S2::S2sc)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(x)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(to: x)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(to: to)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(to)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(to, x)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(to x) // expected-error {{expected ',' or ')' in 'map' clause}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(tofrom: argc > 0 ? x : y) // expected-error 2 {{expected expression containing only member accesses and/or array sections based on named variables}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(argc)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(S1) // expected-error {{'S1' does not refer to a value}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(a, b, c, d, f) // expected-error {{incomplete type 'S1' where a complete type is required}} expected-error 2 {{type 'S2' is not mappable to target}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(ba) // expected-error 2 {{type 'S2' is not mappable to target}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(ca)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(da)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(S2::S2s)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(S2::S2sc)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(e, g)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(h) // expected-error {{threadprivate variables are not allowed in 'map' clause}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(k), map(k) // expected-error 2 {{variable already marked as mapped in current construct}} expected-note 2 {{used here}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(k), map(k[:5]) // expected-error 2 {{pointer cannot be mapped along with a section derived from itself}} expected-note 2 {{used here}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(da)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(da[:4])
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target data map(k, j, l) // expected-note 2 {{used here}}
+#pragma omp target teams distribute simd map(k[:4]) // expected-error 2 {{pointer cannot be mapped along with a section derived from itself}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(j)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(l) map(l[:5]) // expected-error 2 {{variable already marked as mapped in current construct}} expected-note 2 {{used here}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target data map(k[:4], j, l[:5]) // expected-note 2 {{used here}}
+{
+#pragma omp target teams distribute simd map(k) // expected-error 2 {{pointer cannot be mapped along with a section derived from itself}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(j)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(l)
+ for (i = 0; i < argc; ++i) foo();
+}
+
+#pragma omp target teams distribute simd map(always, tofrom: x)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(always: x) // expected-error {{missing map type}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(tofrom, always: x) // expected-error {{incorrect map type modifier, expected 'always'}} expected-error {{incorrect map type, expected one of 'to', 'from', 'tofrom', 'alloc', 'release', or 'delete'}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(always, tofrom: always, tofrom, x)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(tofrom j) // expected-error {{expected ',' or ')' in 'map' clause}}
+ for (i = 0; i < argc; ++i) foo();
+
+ return 0;
+}
+
+int main(int argc, char **argv) {
+ const int d = 5;
+ const int da[5] = { 0 };
+ S4 e(4);
+ S5 g(5);
+ int i;
+ int &j = i;
+ int *k = &j;
+ int x;
+ int y;
+ int to, tofrom, always;
+ const int (&l)[5] = da;
+
+#pragma omp target teams distribute simd map // expected-error {{expected '(' after 'map'}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map( // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error {{expected expression}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map() // expected-error {{expected expression}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(alloc) // expected-error {{use of undeclared identifier 'alloc'}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(to argc // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error {{expected ',' or ')' in 'map' clause}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(to:) // expected-error {{expected expression}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(from: argc, // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(x: y) // expected-error {{incorrect map type, expected one of 'to', 'from', 'tofrom', 'alloc', 'release', or 'delete'}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(l[-1:]) // expected-error {{array section must be a subset of the original array}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(l[:-1]) // expected-error {{section length is evaluated to a negative value -1}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(x)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(to: x)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(to: to)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(to)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(to, x)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(to x) // expected-error {{expected ',' or ')' in 'map' clause}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(tofrom: argc > 0 ? argv[1] : argv[2]) // expected-error {{expected expression containing only member accesses and/or array sections based on named variables}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(argc)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(S1) // expected-error {{'S1' does not refer to a value}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(a, b, c, d, f) // expected-error {{incomplete type 'S1' where a complete type is required}} expected-error 2 {{type 'S2' is not mappable to target}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(argv[1])
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(ba) // expected-error 2 {{type 'S2' is not mappable to target}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(ca)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(da)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(S2::S2s)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(S2::S2sc)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(e, g)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(h) // expected-error {{threadprivate variables are not allowed in 'map' clause}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(k), map(k) // expected-error {{variable already marked as mapped in current construct}} expected-note {{used here}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(k), map(k[:5]) // expected-error {{pointer cannot be mapped along with a section derived from itself}} expected-note {{used here}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(da)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(da[:4])
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target data map(k, j, l) // expected-note {{used here}}
+#pragma omp target teams distribute simd map(k[:4]) // expected-error {{pointer cannot be mapped along with a section derived from itself}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(j)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(l) map(l[:5]) // expected-error 1 {{variable already marked as mapped in current construct}} expected-note 1 {{used here}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target data map(k[:4], j, l[:5]) // expected-note {{used here}}
+{
+#pragma omp target teams distribute simd map(k) // expected-error {{pointer cannot be mapped along with a section derived from itself}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(j)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(l)
+ for (i = 0; i < argc; ++i) foo();
+}
+
+#pragma omp target teams distribute simd map(always, tofrom: x)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(always: x) // expected-error {{missing map type}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(tofrom, always: x) // expected-error {{incorrect map type modifier, expected 'always'}} expected-error {{incorrect map type, expected one of 'to', 'from', 'tofrom', 'alloc', 'release', or 'delete'}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(always, tofrom: always, tofrom, x)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd map(tofrom j) // expected-error {{expected ',' or ')' in 'map' clause}}
+ for (i = 0; i < argc; ++i) foo();
+
+ return tmain<int, 3>(argc)+tmain<from, 4>(argc); // expected-note {{in instantiation of function template specialization 'tmain<int, 3>' requested here}} expected-note {{in instantiation of function template specialization 'tmain<int, 4>' requested here}}
+}
+
diff --git a/test/OpenMP/target_teams_distribute_simd_messages.cpp b/test/OpenMP/target_teams_distribute_simd_messages.cpp
new file mode 100644
index 0000000000000..aa82c947010f5
--- /dev/null
+++ b/test/OpenMP/target_teams_distribute_simd_messages.cpp
@@ -0,0 +1,93 @@
+// RUN: %clang_cc1 -verify -fopenmp -std=c++11 %s
+
+void foo() {
+}
+
+static int pvt;
+#pragma omp threadprivate(pvt)
+
+#pragma omp target teams distribute simd // expected-error {{unexpected OpenMP directive '#pragma omp target teams distribute simd'}}
+
+int main(int argc, char **argv) {
+#pragma omp target teams distribute simd { // expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+ for (int i = 0; i < argc; ++i)
+ foo();
+#pragma omp target teams distribute simd ( // expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+ for (int i = 0; i < argc; ++i)
+ foo();
+#pragma omp target teams distribute simd[ // expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+ for (int i = 0; i < argc; ++i)
+ foo();
+#pragma omp target teams distribute simd] // expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+ for (int i = 0; i < argc; ++i)
+ foo();
+#pragma omp target teams distribute simd) // expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+ for (int i = 0; i < argc; ++i)
+ foo();
+#pragma omp target teams distribute simd } // expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+ for (int i = 0; i < argc; ++i)
+ foo();
+#pragma omp target teams distribute simd
+ for (int i = 0; i < argc; ++i)
+ foo();
+// expected-warning@+1 {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+#pragma omp target teams distribute simd unknown()
+ for (int i = 0; i < argc; ++i)
+ foo();
+L1:
+ for (int i = 0; i < argc; ++i)
+ foo();
+#pragma omp target teams distribute simd
+ for (int i = 0; i < argc; ++i)
+ foo();
+#pragma omp target teams distribute simd
+ for (int i = 0; i < argc; ++i) {
+ goto L1; // expected-error {{use of undeclared label 'L1'}}
+ argc++;
+ }
+
+ for (int i = 0; i < 10; ++i) {
+ switch (argc) {
+ case (0):
+#pragma omp target teams distribute simd
+ for (int i = 0; i < argc; ++i) {
+ foo();
+ break; // expected-error {{'break' statement cannot be used in OpenMP for loop}}
+ continue;
+ }
+ default:
+ break;
+ }
+ }
+// expected-error@+1 {{unexpected OpenMP clause 'default' in directive '#pragma omp target teams distribute simd'}}
+#pragma omp target teams distribute simd default(none)
+ for (int i = 0; i < 10; ++i)
+ ++argc; // expected-error {{ariable 'argc' must have explicitly specified data sharing attributes}}
+
+ goto L2; // expected-error {{use of undeclared label 'L2'}}
+#pragma omp target teams distribute simd
+ for (int i = 0; i < argc; ++i)
+ L2:
+ foo();
+#pragma omp target teams distribute simd
+ for (int i = 0; i < argc; ++i) {
+ return 1; // expected-error {{cannot return from OpenMP region}}
+ }
+
+ [[]] // expected-error {{an attribute list cannot appear here}}
+#pragma omp target teams distribute simd
+ for (int n = 0; n < 100; ++n) {
+ }
+
+#pragma omp target teams distribute simd copyin(pvt) // expected-error {{unexpected OpenMP clause 'copyin' in directive '#pragma omp target teams distribute simd'}}
+ for (int n = 0; n < 100; ++n) {}
+
+ return 0;
+}
+
+void test_ordered() {
+#pragma omp target teams distribute simd ordered // expected-error {{unexpected OpenMP clause 'ordered' in directive '#pragma omp target teams distribute simd'}}
+ for (int i = 0; i < 16; ++i)
+ ;
+}
+
diff --git a/test/OpenMP/target_teams_distribute_simd_misc_messages.c b/test/OpenMP/target_teams_distribute_simd_misc_messages.c
new file mode 100644
index 0000000000000..c76fdea4fcf15
--- /dev/null
+++ b/test/OpenMP/target_teams_distribute_simd_misc_messages.c
@@ -0,0 +1,312 @@
+// RUN: %clang_cc1 -fsyntax-only -fopenmp -verify %s
+
+// expected-error@+1 {{unexpected OpenMP directive '#pragma omp target teams distribute simd'}}
+#pragma omp target teams distribute simd
+
+// expected-error@+1 {{unexpected OpenMP directive '#pragma omp target teams distribute simd'}}
+#pragma omp target teams distribute simd foo
+
+void test_no_clause() {
+ int i;
+#pragma omp target teams distribute simd
+ for (i = 0; i < 16; ++i)
+ ;
+
+// expected-error@+2 {{statement after '#pragma omp target teams distribute simd' must be a for loop}}
+#pragma omp target teams distribute simd
+ ++i;
+}
+
+void test_branch_protected_scope() {
+ int i = 0;
+L1:
+ ++i;
+
+ int x[24];
+
+#pragma omp target teams distribute simd
+ for (i = 0; i < 16; ++i) {
+ if (i == 5)
+ goto L1; // expected-error {{use of undeclared label 'L1'}}
+ else if (i == 6)
+ return; // expected-error {{cannot return from OpenMP region}}
+ else if (i == 7)
+ goto L2;
+ else if (i == 8) {
+ L2:
+ x[i]++;
+ }
+ }
+
+ if (x[0] == 0)
+ goto L2; // expected-error {{use of undeclared label 'L2'}}
+ else if (x[1] == 1)
+ goto L1;
+}
+
+void test_invalid_clause() {
+ int i;
+// expected-warning@+1 {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+#pragma omp target teams distribute simd foo bar
+ for (i = 0; i < 16; ++i)
+ ;
+}
+
+void test_non_identifiers() {
+ int i, x;
+
+// expected-warning@+1 {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+#pragma omp target teams distribute simd;
+ for (i = 0; i < 16; ++i)
+ ;
+
+// expected-warning@+1 {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+#pragma omp target teams distribute simd private(x);
+ for (i = 0; i < 16; ++i)
+ ;
+
+// expected-warning@+1 {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+#pragma omp target teams distribute simd, private(x);
+ for (i = 0; i < 16; ++i)
+ ;
+}
+
+extern int foo();
+
+void test_collapse() {
+ int i;
+// expected-error@+1 {{expected '('}}
+#pragma omp target teams distribute simd collapse
+ for (i = 0; i < 16; ++i)
+ ;
+// expected-error@+1 {{expected expression}} expected-error@+1 {{expected ')'}} expected-note@+1 {{to match this '('}}
+#pragma omp target teams distribute simd collapse(
+ for (i = 0; i < 16; ++i)
+ ;
+// expected-error@+1 {{expected expression}}
+#pragma omp target teams distribute simd collapse()
+ for (i = 0; i < 16; ++i)
+ ;
+// expected-error@+1 {{expected expression}} expected-error@+1 {{expected ')'}} expected-note@+1 {{to match this '('}}
+#pragma omp target teams distribute simd collapse(,
+ for (i = 0; i < 16; ++i)
+ ;
+// expected-error@+1 {{expected expression}} expected-error@+1 {{expected ')'}} expected-note@+1 {{to match this '('}}
+#pragma omp target teams distribute simd collapse(, )
+ for (i = 0; i < 16; ++i)
+ ;
+// expected-warning@+2 {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+// expected-error@+1 {{expected '('}}
+#pragma omp target teams distribute simd collapse 4)
+ for (i = 0; i < 16; ++i)
+ ;
+// expected-error@+2 {{expected ')'}}
+// expected-note@+1 {{to match this '('}} expected-note@+1 {{as specified in 'collapse' clause}}
+#pragma omp target teams distribute simd collapse(4
+ for (i = 0; i < 16; ++i)
+ ; // expected-error {{expected 4 for loops after '#pragma omp target teams distribute simd', but found only 1}}
+// expected-error@+2 {{expected ')'}}
+// expected-note@+1 {{to match this '('}} expected-note@+1 {{as specified in 'collapse' clause}}
+#pragma omp target teams distribute simd collapse(4,
+ for (i = 0; i < 16; ++i)
+ ; // expected-error {{expected 4 for loops after '#pragma omp target teams distribute simd', but found only 1}}
+// expected-error@+2 {{expected ')'}}
+// expected-note@+1 {{to match this '('}} expected-note@+1 {{as specified in 'collapse' clause}}
+#pragma omp target teams distribute simd collapse(4, )
+ for (i = 0; i < 16; ++i)
+ ; // expected-error {{expected 4 for loops after '#pragma omp target teams distribute simd', but found only 1}}
+// expected-note@+1 {{as specified in 'collapse' clause}}
+#pragma omp target teams distribute simd collapse(4)
+ for (i = 0; i < 16; ++i)
+ ; // expected-error {{expected 4 for loops after '#pragma omp target teams distribute simd', but found only 1}}
+// expected-error@+2 {{expected ')'}}
+// expected-note@+1 {{to match this '('}} expected-note@+1 {{as specified in 'collapse' clause}}
+#pragma omp target teams distribute simd collapse(4 4)
+ for (i = 0; i < 16; ++i)
+ ; // expected-error {{expected 4 for loops after '#pragma omp target teams distribute simd', but found only 1}}
+// expected-error@+2 {{expected ')'}}
+// expected-note@+1 {{to match this '('}} expected-note@+1 {{as specified in 'collapse' clause}}
+#pragma omp target teams distribute simd collapse(4, , 4)
+ for (i = 0; i < 16; ++i)
+ ; // expected-error {{expected 4 for loops after '#pragma omp target teams distribute simd', but found only 1}}
+#pragma omp target teams distribute simd collapse(4)
+ for (int i1 = 0; i1 < 16; ++i1)
+ for (int i2 = 0; i2 < 16; ++i2)
+ for (int i3 = 0; i3 < 16; ++i3)
+ for (int i4 = 0; i4 < 16; ++i4)
+ foo();
+// expected-error@+2 {{expected ')'}}
+// expected-note@+1 {{to match this '('}} expected-note@+1 {{as specified in 'collapse' clause}}
+#pragma omp target teams distribute simd collapse(4, 8)
+ for (i = 0; i < 16; ++i)
+ ; // expected-error {{expected 4 for loops after '#pragma omp target teams distribute simd', but found only 1}}
+// expected-error@+1 {{expression is not an integer constant expression}}
+#pragma omp target teams distribute simd collapse(2.5)
+ for (i = 0; i < 16; ++i)
+ ;
+// expected-error@+1 {{expression is not an integer constant expression}}
+#pragma omp target teams distribute simd collapse(foo())
+ for (i = 0; i < 16; ++i)
+ ;
+// expected-error@+1 {{argument to 'collapse' clause must be a strictly positive integer value}}
+#pragma omp target teams distribute simd collapse(-5)
+ for (i = 0; i < 16; ++i)
+ ;
+// expected-error@+1 {{argument to 'collapse' clause must be a strictly positive integer value}}
+#pragma omp target teams distribute simd collapse(0)
+ for (i = 0; i < 16; ++i)
+ ;
+// expected-error@+1 {{argument to 'collapse' clause must be a strictly positive integer value}}
+#pragma omp target teams distribute simd collapse(5 - 5)
+ for (i = 0; i < 16; ++i)
+ ;
+
+// expected-error@+4 {{OpenMP constructs may not be nested inside a simd region}}
+#pragma omp target teams distribute simd collapse(2) firstprivate(i)
+ for (i = 0; i < 16; ++i)
+ for (int j = 0; j < 16; ++j)
+#pragma omp parallel for reduction(+ : i, j)
+ for (int k = 0; k < 16; ++k)
+ i += j;
+}
+
+void test_private() {
+ int i;
+// expected-error@+2 {{expected expression}}
+// expected-error@+1 {{expected ')'}} expected-note@+1 {{to match this '('}}
+#pragma omp target teams distribute simd private(
+ for (i = 0; i < 16; ++i)
+ ;
+// expected-error@+2 {{expected ')'}} expected-note@+2 {{to match this '('}}
+// expected-error@+1 2 {{expected expression}}
+#pragma omp target teams distribute simd private(,
+ for (i = 0; i < 16; ++i)
+ ;
+// expected-error@+1 2 {{expected expression}}
+#pragma omp target teams distribute simd private(, )
+ for (i = 0; i < 16; ++i)
+ ;
+// expected-error@+1 {{expected expression}}
+#pragma omp target teams distribute simd private()
+ for (i = 0; i < 16; ++i)
+ ;
+// expected-error@+1 {{expected expression}}
+#pragma omp target teams distribute simd private(int)
+ for (i = 0; i < 16; ++i)
+ ;
+// expected-error@+1 {{expected variable name}}
+#pragma omp target teams distribute simd private(0)
+ for (i = 0; i < 16; ++i)
+ ;
+
+ int x, y, z;
+#pragma omp target teams distribute simd private(x)
+ for (i = 0; i < 16; ++i)
+ ;
+#pragma omp target teams distribute simd private(x, y)
+ for (i = 0; i < 16; ++i)
+ ;
+#pragma omp target teams distribute simd private(x, y, z)
+ for (i = 0; i < 16; ++i) {
+ x = y * i + z;
+ }
+}
+
+void test_lastprivate() {
+ int i;
+// expected-error@+2 {{expected ')'}} expected-note@+2 {{to match this '('}}
+// expected-error@+1 {{expected expression}}
+#pragma omp target teams distribute simd lastprivate(
+ for (i = 0; i < 16; ++i)
+ ;
+
+// expected-error@+2 {{expected ')'}} expected-note@+2 {{to match this '('}}
+// expected-error@+1 2 {{expected expression}}
+#pragma omp target teams distribute simd lastprivate(,
+ for (i = 0; i < 16; ++i)
+ ;
+// expected-error@+1 2 {{expected expression}}
+#pragma omp target teams distribute simd lastprivate(, )
+ for (i = 0; i < 16; ++i)
+ ;
+// expected-error@+1 {{expected expression}}
+#pragma omp target teams distribute simd lastprivate()
+ for (i = 0; i < 16; ++i)
+ ;
+// expected-error@+1 {{expected expression}}
+#pragma omp target teams distribute simd lastprivate(int)
+ for (i = 0; i < 16; ++i)
+ ;
+// expected-error@+1 {{expected variable name}}
+#pragma omp target teams distribute simd lastprivate(0)
+ for (i = 0; i < 16; ++i)
+ ;
+
+ int x, y, z;
+#pragma omp target teams distribute simd lastprivate(x)
+ for (i = 0; i < 16; ++i)
+ ;
+#pragma omp target teams distribute simd lastprivate(x, y)
+ for (i = 0; i < 16; ++i)
+ ;
+#pragma omp target teams distribute simd lastprivate(x, y, z)
+ for (i = 0; i < 16; ++i)
+ ;
+}
+
+void test_firstprivate() {
+ int i;
+// expected-error@+2 {{expected ')'}} expected-note@+2 {{to match this '('}}
+// expected-error@+1 {{expected expression}}
+#pragma omp target teams distribute simd firstprivate(
+ for (i = 0; i < 16; ++i)
+ ;
+
+// expected-error@+2 {{expected ')'}} expected-note@+2 {{to match this '('}}
+// expected-error@+1 2 {{expected expression}}
+#pragma omp target teams distribute simd firstprivate(,
+ for (i = 0; i < 16; ++i)
+ ;
+// expected-error@+1 2 {{expected expression}}
+#pragma omp target teams distribute simd firstprivate(, )
+ for (i = 0; i < 16; ++i)
+ ;
+// expected-error@+1 {{expected expression}}
+#pragma omp target teams distribute simd firstprivate()
+ for (i = 0; i < 16; ++i)
+ ;
+// expected-error@+1 {{expected expression}}
+#pragma omp target teams distribute simd firstprivate(int)
+ for (i = 0; i < 16; ++i)
+ ;
+// expected-error@+1 {{expected variable name}}
+#pragma omp target teams distribute simd firstprivate(0)
+ for (i = 0; i < 16; ++i)
+ ;
+
+ int x, y, z;
+#pragma omp target teams distribute simd lastprivate(x) firstprivate(x)
+ for (i = 0; i < 16; ++i)
+ ;
+#pragma omp target teams distribute simd lastprivate(x, y) firstprivate(x, y)
+ for (i = 0; i < 16; ++i)
+ ;
+#pragma omp target teams distribute simd lastprivate(x, y, z) firstprivate(x, y, z)
+ for (i = 0; i < 16; ++i)
+ ;
+}
+
+void test_loop_messages() {
+ float a[100], b[100], c[100];
+// expected-error@+2 {{variable must be of integer or pointer type}}
+#pragma omp target teams distribute simd
+ for (float fi = 0; fi < 10.0; fi++) {
+ c[(int)fi] = a[(int)fi] + b[(int)fi];
+ }
+// expected-error@+2 {{variable must be of integer or pointer type}}
+#pragma omp target teams distribute simd
+ for (double fi = 0; fi < 10.0; fi++) {
+ c[(int)fi] = a[(int)fi] + b[(int)fi];
+ }
+}
+
diff --git a/test/OpenMP/target_teams_distribute_simd_nowait_messages.cpp b/test/OpenMP/target_teams_distribute_simd_nowait_messages.cpp
new file mode 100644
index 0000000000000..6c2c2a50ab551
--- /dev/null
+++ b/test/OpenMP/target_teams_distribute_simd_nowait_messages.cpp
@@ -0,0 +1,18 @@
+// RUN: %clang_cc1 -fsyntax-only -verify -fopenmp %s
+
+void foo() {
+}
+
+int main(int argc, char **argv) {
+ int i;
+#pragma omp target teams distribute simd nowait( // expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd nowait (argc)) // expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd nowait device (-10u)
+ for (i = 0; i < argc; ++i) foo();
+#pragma omp target teams distribute simd nowait (3.14) device (-10u) // expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+ for (i = 0; i < argc; ++i) foo();
+
+ return 0;
+}
diff --git a/test/OpenMP/target_teams_distribute_simd_num_teams_messages.cpp b/test/OpenMP/target_teams_distribute_simd_num_teams_messages.cpp
new file mode 100644
index 0000000000000..63926bcfcbe95
--- /dev/null
+++ b/test/OpenMP/target_teams_distribute_simd_num_teams_messages.cpp
@@ -0,0 +1,85 @@
+// RUN: %clang_cc1 -verify -fopenmp -std=c++11 -ferror-limit 100 -o - %s
+
+void foo() {
+}
+
+bool foobool(int argc) {
+ return argc;
+}
+
+struct S1; // expected-note 2 {{declared here}}
+
+template <typename T, int C> // expected-note {{declared here}}
+T tmain(T argc) {
+ char **a;
+#pragma omp target teams distribute simd num_teams(C)
+ for (int i=0; i<100; i++) foo();
+#pragma omp target teams distribute simd num_teams(T) // expected-error {{'T' does not refer to a value}}
+ for (int i=0; i<100; i++) foo();
+#pragma omp target teams distribute simd num_teams // expected-error {{expected '(' after 'num_teams'}}
+ for (int i=0; i<100; i++) foo();
+#pragma omp target teams distribute simd num_teams( // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i=0; i<100; i++) foo();
+#pragma omp target teams distribute simd num_teams() // expected-error {{expected expression}}
+ for (int i=0; i<100; i++) foo();
+#pragma omp target teams distribute simd num_teams(argc // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i=0; i<100; i++) foo();
+#pragma omp target teams distribute simd num_teams(argc)) // expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+ for (int i=0; i<100; i++) foo();
+#pragma omp target teams distribute simd num_teams(argc > 0 ? a[1] : a[2]) // expected-error {{expression must have integral or unscoped enumeration type, not 'char *'}}
+ for (int i=0; i<100; i++) foo();
+#pragma omp target teams distribute simd num_teams(argc + argc)
+ for (int i=0; i<100; i++) foo();
+#pragma omp target teams distribute simd num_teams(argc), num_teams (argc+1) // expected-error {{directive '#pragma omp target teams distribute simd' cannot contain more than one 'num_teams' clause}}
+ for (int i=0; i<100; i++) foo();
+#pragma omp target teams distribute simd num_teams(S1) // expected-error {{'S1' does not refer to a value}}
+ for (int i=0; i<100; i++) foo();
+#pragma omp target teams distribute simd num_teams(-2) // expected-error {{argument to 'num_teams' clause must be a strictly positive integer value}}
+ for (int i=0; i<100; i++) foo();
+#pragma omp target teams distribute simd num_teams(-10u)
+ for (int i=0; i<100; i++) foo();
+#pragma omp target teams distribute simd num_teams(3.14) // expected-error 2 {{expression must have integral or unscoped enumeration type, not 'double'}}
+ for (int i=0; i<100; i++) foo();
+
+ return 0;
+}
+
+int main(int argc, char **argv) {
+#pragma omp target teams distribute simd num_teams // expected-error {{expected '(' after 'num_teams'}}
+ for (int i=0; i<100; i++) foo();
+
+#pragma omp target teams distribute simd num_teams ( // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i=0; i<100; i++) foo();
+
+#pragma omp target teams distribute simd num_teams () // expected-error {{expected expression}}
+ for (int i=0; i<100; i++) foo();
+
+#pragma omp target teams distribute simd num_teams (argc // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i=0; i<100; i++) foo();
+
+#pragma omp target teams distribute simd num_teams (argc)) // expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+ for (int i=0; i<100; i++) foo();
+
+#pragma omp target teams distribute simd num_teams (argc > 0 ? argv[1] : argv[2]) // expected-error {{expression must have integral or unscoped enumeration type, not 'char *'}}
+ for (int i=0; i<100; i++) foo();
+
+#pragma omp target teams distribute simd num_teams (argc + argc)
+ for (int i=0; i<100; i++) foo();
+
+#pragma omp target teams distribute simd num_teams (argc), num_teams (argc+1) // expected-error {{directive '#pragma omp target teams distribute simd' cannot contain more than one 'num_teams' clause}}
+ for (int i=0; i<100; i++) foo();
+
+#pragma omp target teams distribute simd num_teams (S1) // expected-error {{'S1' does not refer to a value}}
+ for (int i=0; i<100; i++) foo();
+
+#pragma omp target teams distribute simd num_teams (-2) // expected-error {{argument to 'num_teams' clause must be a strictly positive integer value}}
+ for (int i=0; i<100; i++) foo();
+
+#pragma omp target teams distribute simd num_teams (-10u)
+ for (int i=0; i<100; i++) foo();
+
+#pragma omp target teams distribute simd num_teams (3.14) // expected-error {{expression must have integral or unscoped enumeration type, not 'double'}}
+ for (int i=0; i<100; i++) foo();
+
+ return tmain<int, 10>(argc); // expected-note {{in instantiation of function template specialization 'tmain<int, 10>' requested here}}
+}
diff --git a/test/OpenMP/target_teams_distribute_simd_private_messages.cpp b/test/OpenMP/target_teams_distribute_simd_private_messages.cpp
new file mode 100644
index 0000000000000..3d351bdc7d827
--- /dev/null
+++ b/test/OpenMP/target_teams_distribute_simd_private_messages.cpp
@@ -0,0 +1,127 @@
+// RUN: %clang_cc1 -verify -fopenmp %s
+
+void foo() {
+}
+
+bool foobool(int argc) {
+ return argc;
+}
+
+struct S1; // expected-note {{declared here}} expected-note {{forward declaration of 'S1'}}
+extern S1 a;
+class S2 {
+ mutable int a;
+public:
+ S2():a(0) { }
+ static float S2s; // expected-note {{predetermined as shared}}
+};
+const S2 b;
+const S2 ba[5];
+class S3 {
+ int a;
+public:
+ S3():a(0) { }
+};
+const S3 c; // expected-note {{predetermined as shared}}
+const S3 ca[5]; // expected-note {{predetermined as shared}}
+extern const int f; // expected-note {{predetermined as shared}}
+class S4 {
+ int a;
+ S4(); // expected-note {{implicitly declared private here}}
+public:
+ S4(int v):a(v) { }
+};
+class S5 {
+ int a;
+ S5():a(0) {} // expected-note {{implicitly declared private here}}
+public:
+ S5(int v):a(v) { }
+};
+
+S3 h;
+#pragma omp threadprivate(h) // expected-note {{defined as threadprivate or thread local}}
+
+
+int main(int argc, char **argv) {
+ const int d = 5; // expected-note {{predetermined as shared}}
+ const int da[5] = { 0 }; // expected-note {{predetermined as shared}}
+ S4 e(4);
+ S5 g(5);
+ int i;
+ int &j = i;
+
+#pragma omp target teams distribute simd private // expected-error {{expected '(' after 'private'}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd private ( // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd private () // expected-error {{expected expression}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd private (argc // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd private (argc, // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd private (argc > 0 ? argv[1] : argv[2]) // expected-error {{expected variable name}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd private (argc)
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd private (S1) // expected-error {{'S1' does not refer to a value}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd private (a, b, c, d, f) // expected-error {{private variable with incomplete type 'S1'}} expected-error 3 {{shared variable cannot be private}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd private (argv[1]) // expected-error {{expected variable name}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd private(ba)
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd private(ca) // expected-error {{shared variable cannot be private}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd private(da) // expected-error {{shared variable cannot be private}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd private(S2::S2s) // expected-error {{shared variable cannot be private}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd private(e, g) // expected-error {{calling a private constructor of class 'S4'}} expected-error {{calling a private constructor of class 'S5'}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd private(h) // expected-error {{threadprivate or thread local variable cannot be private}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd shared(i)
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd firstprivate(i), private(i) // expected-error {{firstprivate variable cannot be private}} expected-note {{defined as firstprivate}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd private(j)
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp target teams distribute simd reduction(+:i)
+ for (int k = 0; k < argc; ++k) ++k;
+
+#pragma omp distribute private(i)
+ for (int k = 0; k < 10; ++k) {
+ #pragma omp target teams distribute simd private(i)
+ for (int x = 0; x < 10; ++x) foo();
+ }
+
+#pragma omp target teams distribute simd firstprivate(i)
+ for (int k = 0; k < 10; ++k) {
+ }
+
+#pragma omp target teams distribute simd private(j) map(j) // expected-error {{private variable cannot be in a map clause in '#pragma omp target teams distribute simd' directive}} expected-note {{defined as private}}
+ for (int k = 0; k < argc; ++k) ++k;
+
+ return 0;
+}
diff --git a/test/OpenMP/target_teams_distribute_simd_reduction_messages.cpp b/test/OpenMP/target_teams_distribute_simd_reduction_messages.cpp
new file mode 100644
index 0000000000000..1c0283285aa5a
--- /dev/null
+++ b/test/OpenMP/target_teams_distribute_simd_reduction_messages.cpp
@@ -0,0 +1,241 @@
+// RUN: %clang_cc1 -verify -fopenmp %s
+// RUN: %clang_cc1 -verify -fopenmp -std=c++98 %s
+// RUN: %clang_cc1 -verify -fopenmp -std=c++11 %s
+
+void foo() {
+}
+
+bool foobool(int argc) {
+ return argc;
+}
+
+struct S1; // expected-note {{declared here}} expected-note 4 {{forward declaration of 'S1'}}
+extern S1 a;
+class S2 {
+ mutable int a;
+ S2 &operator+(const S2 &arg) { return (*this); } // expected-note 3 {{implicitly declared private here}}
+
+public:
+ S2() : a(0) {}
+ S2(S2 &s2) : a(s2.a) {}
+ static float S2s; // expected-note 2 {{static data member is predetermined as shared}}
+ static const float S2sc;
+};
+const float S2::S2sc = 0; // expected-note 2 {{'S2sc' defined here}}
+S2 b; // expected-note 3 {{'b' defined here}}
+const S2 ba[5]; // expected-note 2 {{'ba' defined here}}
+class S3 {
+ int a;
+
+public:
+ int b;
+ S3() : a(0) {}
+ S3(const S3 &s3) : a(s3.a) {}
+ S3 operator+(const S3 &arg1) { return arg1; }
+};
+int operator+(const S3 &arg1, const S3 &arg2) { return 5; }
+S3 c; // expected-note 3 {{'c' defined here}}
+const S3 ca[5]; // expected-note 2 {{'ca' defined here}}
+extern const int f; // expected-note 4 {{'f' declared here}}
+class S4 {
+ int a;
+ S4(); // expected-note {{implicitly declared private here}}
+ S4(const S4 &s4);
+ S4 &operator+(const S4 &arg) { return (*this); }
+
+public:
+ S4(int v) : a(v) {}
+};
+S4 &operator&=(S4 &arg1, S4 &arg2) { return arg1; }
+class S5 {
+ int a;
+ S5() : a(0) {} // expected-note {{implicitly declared private here}}
+ S5(const S5 &s5) : a(s5.a) {}
+ S5 &operator+(const S5 &arg);
+
+public:
+ S5(int v) : a(v) {}
+};
+class S6 { // expected-note 3 {{candidate function (the implicit copy assignment operator) not viable: no known conversion from 'int' to 'const S6' for 1st argument}}
+#if __cplusplus >= 201103L // C++11 or later
+// expected-note@-2 3 {{candidate function (the implicit move assignment operator) not viable}}
+#endif
+ int a;
+
+public:
+ S6() : a(6) {}
+ operator int() { return 6; }
+} o;
+
+S3 h, k;
+#pragma omp threadprivate(h) // expected-note 2 {{defined as threadprivate or thread local}}
+
+template <class T> // expected-note {{declared here}}
+T tmain(T argc) {
+ const T d = T(); // expected-note 4 {{'d' defined here}}
+ const T da[5] = {T()}; // expected-note 2 {{'da' defined here}}
+ T qa[5] = {T()};
+ T i;
+ T &j = i; // expected-note 4 {{'j' defined here}}
+ S3 &p = k; // expected-note 2 {{'p' defined here}}
+ const T &r = da[(int)i]; // expected-note 2 {{'r' defined here}}
+ T &q = qa[(int)i]; // expected-note 2 {{'q' defined here}}
+ T fl;
+#pragma omp target teams distribute simd reduction // expected-error {{expected '(' after 'reduction'}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction + // expected-error {{expected '(' after 'reduction'}} expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction( // expected-error {{expected unqualified-id}} expected-warning {{missing ':' after reduction identifier - ignoring}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(- // expected-warning {{missing ':' after reduction identifier - ignoring}} expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction() // expected-error {{expected unqualified-id}} expected-warning {{missing ':' after reduction identifier - ignoring}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(*) // expected-warning {{missing ':' after reduction identifier - ignoring}} expected-error {{expected expression}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(\) // expected-error {{expected unqualified-id}} expected-warning {{missing ':' after reduction identifier - ignoring}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(& : argc // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error {{invalid operands to binary expression ('float' and 'float')}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(| : argc, // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error {{invalid operands to binary expression ('float' and 'float')}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(|| : argc ? i : argc) // expected-error 2 {{expected variable name, array element or array section}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(foo : argc) //expected-error {{incorrect reduction identifier, expected one of '+', '-', '*', '&', '|', '^', '&&', '||', 'min' or 'max' or declare reduction for type 'float'}} expected-error {{incorrect reduction identifier, expected one of '+', '-', '*', '&', '|', '^', '&&', '||', 'min' or 'max' or declare reduction for type 'int'}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(&& : argc)
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(^ : T) // expected-error {{'T' does not refer to a value}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(+ : a, b, c, d, f) // expected-error {{a reduction list item with incomplete type 'S1'}} expected-error 3 {{const-qualified list item cannot be reduction}} expected-error 2 {{'operator+' is a private member of 'S2'}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(min : a, b, c, d, f) // expected-error {{a reduction list item with incomplete type 'S1'}} expected-error 4 {{arguments of OpenMP clause 'reduction' for 'min' or 'max' must be of arithmetic type}} expected-error 3 {{const-qualified list item cannot be reduction}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(max : h.b) // expected-error {{expected variable name, array element or array section}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(+ : ba) // expected-error {{const-qualified list item cannot be reduction}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(* : ca) // expected-error {{const-qualified list item cannot be reduction}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(- : da) // expected-error {{const-qualified list item cannot be reduction}} expected-error {{const-qualified list item cannot be reduction}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(^ : fl) // expected-error {{invalid operands to binary expression ('float' and 'float')}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(&& : S2::S2s) // expected-error {{shared variable cannot be reduction}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(&& : S2::S2sc) // expected-error {{const-qualified list item cannot be reduction}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(+ : h, k) // expected-error {{threadprivate or thread local variable cannot be reduction}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(+ : o) // expected-error 2 {{no viable overloaded '='}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd private(i), reduction(+ : j), reduction(+ : q) // expected-error 4 {{argument of OpenMP clause 'reduction' must reference the same object in all threads}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp parallel private(k)
+#pragma omp target teams distribute simd reduction(+ : p), reduction(+ : p) // expected-error 2 {{argument of OpenMP clause 'reduction' must reference the same object in all threads}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(+ : p), reduction(+ : p) // expected-error 2 {{variable can appear only once in OpenMP 'reduction' clause}} expected-note 2 {{previously referenced here}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(+ : r) // expected-error 2 {{const-qualified list item cannot be reduction}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp parallel shared(i)
+#pragma omp parallel reduction(min : i)
+#pragma omp target teams distribute simd reduction(max : j) // expected-error 2 {{argument of OpenMP clause 'reduction' must reference the same object in all threads}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(+ : fl)
+ for (int j=0; j<100; j++) foo();
+
+ return T();
+}
+
+namespace A {
+double x;
+#pragma omp threadprivate(x) // expected-note {{defined as threadprivate or thread local}}
+}
+namespace B {
+using A::x;
+}
+
+int main(int argc, char **argv) {
+ const int d = 5; // expected-note 2 {{'d' defined here}}
+ const int da[5] = {0}; // expected-note {{'da' defined here}}
+ int qa[5] = {0};
+ S4 e(4);
+ S5 g(5);
+ int i;
+ int &j = i; // expected-note 2 {{'j' defined here}}
+ S3 &p = k; // expected-note 2 {{'p' defined here}}
+ const int &r = da[i]; // expected-note {{'r' defined here}}
+ int &q = qa[i]; // expected-note {{'q' defined here}}
+ float fl;
+#pragma omp target teams distribute simd reduction // expected-error {{expected '(' after 'reduction'}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction + // expected-error {{expected '(' after 'reduction'}} expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction( // expected-error {{expected unqualified-id}} expected-warning {{missing ':' after reduction identifier - ignoring}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(- // expected-warning {{missing ':' after reduction identifier - ignoring}} expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction() // expected-error {{expected unqualified-id}} expected-warning {{missing ':' after reduction identifier - ignoring}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(*) // expected-warning {{missing ':' after reduction identifier - ignoring}} expected-error {{expected expression}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(\) // expected-error {{expected unqualified-id}} expected-warning {{missing ':' after reduction identifier - ignoring}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(foo : argc // expected-error {{expected ')'}} expected-note {{to match this '('}} expected-error {{incorrect reduction identifier, expected one of '+', '-', '*', '&', '|', '^', '&&', '||', 'min' or 'max'}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(| : argc, // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(|| : argc > 0 ? argv[1] : argv[2]) // expected-error {{expected variable name, array element or array section}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(~ : argc) // expected-error {{expected unqualified-id}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(&& : argc)
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(^ : S1) // expected-error {{'S1' does not refer to a value}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(+ : a, b, c, d, f) // expected-error {{a reduction list item with incomplete type 'S1'}} expected-error 2 {{const-qualified list item cannot be reduction}} expected-error {{'operator+' is a private member of 'S2'}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(min : a, b, c, d, f) // expected-error {{a reduction list item with incomplete type 'S1'}} expected-error 2 {{arguments of OpenMP clause 'reduction' for 'min' or 'max' must be of arithmetic type}} expected-error 2 {{const-qualified list item cannot be reduction}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(max : h.b) // expected-error {{expected variable name, array element or array section}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(+ : ba) // expected-error {{const-qualified list item cannot be reduction}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(* : ca) // expected-error {{const-qualified list item cannot be reduction}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(- : da) // expected-error {{const-qualified list item cannot be reduction}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(^ : fl) // expected-error {{invalid operands to binary expression ('float' and 'float')}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(&& : S2::S2s) // expected-error {{shared variable cannot be reduction}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(&& : S2::S2sc) // expected-error {{const-qualified list item cannot be reduction}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(& : e, g) // expected-error {{calling a private constructor of class 'S4'}} expected-error {{invalid operands to binary expression ('S4' and 'S4')}} expected-error {{calling a private constructor of class 'S5'}} expected-error {{invalid operands to binary expression ('S5' and 'S5')}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(+ : h, k, B::x) // expected-error 2 {{threadprivate or thread local variable cannot be reduction}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(+ : o) // expected-error {{no viable overloaded '='}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd private(i), reduction(+ : j), reduction(+ : q) // expected-error 2 {{argument of OpenMP clause 'reduction' must reference the same object in all threads}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp parallel private(k)
+#pragma omp target teams distribute simd reduction(+ : p), reduction(+ : p) // expected-error 2 {{argument of OpenMP clause 'reduction' must reference the same object in all threads}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(+ : p), reduction(+ : p) // expected-error {{variable can appear only once in OpenMP 'reduction' clause}} expected-note {{previously referenced here}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(+ : r) // expected-error {{const-qualified list item cannot be reduction}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp parallel shared(i)
+#pragma omp parallel reduction(min : i)
+#pragma omp target teams distribute simd reduction(max : j) // expected-error {{argument of OpenMP clause 'reduction' must reference the same object in all threads}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd reduction(+ : fl)
+ for (int j=0; j<100; j++) foo();
+ static int m;
+#pragma omp target teams distribute simd reduction(+ : m) // OK
+ for (int j=0; j<100; j++) foo();
+
+ return tmain(argc) + tmain(fl); // expected-note {{in instantiation of function template specialization 'tmain<int>' requested here}} expected-note {{in instantiation of function template specialization 'tmain<float>' requested here}}
+}
diff --git a/test/OpenMP/target_teams_distribute_simd_safelen_messages.cpp b/test/OpenMP/target_teams_distribute_simd_safelen_messages.cpp
new file mode 100644
index 0000000000000..1f41c537ced6f
--- /dev/null
+++ b/test/OpenMP/target_teams_distribute_simd_safelen_messages.cpp
@@ -0,0 +1,133 @@
+// RUN: %clang_cc1 -verify -fopenmp %s
+// RUN: %clang_cc1 -verify -fopenmp -std=c++98 %s
+// RUN: %clang_cc1 -verify -fopenmp -std=c++11 %s
+
+void foo() {
+}
+
+#if __cplusplus >= 201103L
+// expected-note@+2 4 {{declared here}}
+#endif
+bool foobool(int argc) {
+ return argc;
+}
+
+struct S1; // expected-note {{declared here}}
+
+template <class T, typename S, int N, int ST> // expected-note {{declared here}}
+T tmain(T argc, S **argv) { //expected-note 2 {{declared here}}
+
+#pragma omp target teams distribute simd safelen // expected-error {{expected '(' after 'safelen'}}
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#pragma omp target teams distribute simd safelen ( // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#pragma omp target teams distribute simd safelen () // expected-error {{expected expression}}
+ for (int i = ST; i < N; i++) argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#pragma omp target teams distribute simd safelen (argc // expected-note {{to match this '('}} expected-error 2 {{expression is not an integral constant expression}} expected-note 2 {{read of non-const variable 'argc' is not allowed in a constant expression}} expected-error {{expected ')'}}
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#pragma omp target teams distribute simd safelen (ST // expected-error {{argument to 'safelen' clause must be a strictly positive integer value}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#pragma omp target teams distribute simd safelen (1)) // expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#pragma omp target teams distribute simd safelen ((ST > 0) ? 1 + ST : 2)
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#if __cplusplus >= 201103L
+ // expected-note@+2 2 {{non-constexpr function 'foobool' cannot be used in a constant expression}}
+#endif
+#pragma omp target teams distribute simd safelen (foobool(argc)), safelen (true), safelen (-5) // expected-error 2 {{directive '#pragma omp target teams distribute simd' cannot contain more than one 'safelen' clause}} expected-error 2 {{argument to 'safelen' clause must be a strictly positive integer value}} expected-error 2 {{expression is not an integral constant expression}}
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#pragma omp target teams distribute simd safelen (S) // expected-error {{'S' does not refer to a value}}
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#if __cplusplus <= 199711L
+ // expected-error@+4 2 {{expression is not an integral constant expression}}
+#else
+ // expected-error@+2 2 {{integral constant expression must have integral or unscoped enumeration type, not 'char *'}}
+#endif
+#pragma omp target teams distribute simd safelen (argv[1]=2) // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#pragma omp target teams distribute simd safelen (4)
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#pragma omp target teams distribute simd safelen (N) // expected-error {{argument to 'safelen' clause must be a strictly positive integer value}}
+ for (T i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+ return argc;
+}
+
+int main(int argc, char **argv) {
+#pragma omp target teams distribute simd safelen // expected-error {{expected '(' after 'safelen'}}
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4];
+
+#pragma omp target teams distribute simd safelen ( // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4];
+
+#pragma omp target teams distribute simd safelen () // expected-error {{expected expression}}
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4];
+
+#pragma omp target teams distribute simd safelen (4 // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4];
+
+#pragma omp target teams distribute simd safelen (2+2)) // expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4];
+
+#if __cplusplus >= 201103L
+ // expected-note@+2 {{non-constexpr function 'foobool' cannot be used in a constant expression}}
+#endif
+#pragma omp target teams distribute simd safelen (foobool(1) > 0 ? 1 : 2) // expected-error {{expression is not an integral constant expression}}
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4];
+
+#if __cplusplus >= 201103L
+ // expected-note@+2 {{non-constexpr function 'foobool' cannot be used in a constant expression}}
+#endif
+#pragma omp target teams distribute simd safelen (foobool(argc)), safelen (true), safelen (-5) // expected-error 2 {{argument to 'safelen' clause must be a strictly positive integer value}} expected-error 2 {{directive '#pragma omp target teams distribute simd' cannot contain more than one 'safelen' clause}} expected-error {{expression is not an integral constant expression}}
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4];
+
+#pragma omp target teams distribute simd safelen (S1) // expected-error {{'S1' does not refer to a value}}
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4];
+
+#if __cplusplus <= 199711L
+ // expected-error@+4 {{expression is not an integral constant expression}}
+#else
+ // expected-error@+2 {{integral constant expression must have integral or unscoped enumeration type, not 'char *'}}
+#endif
+#pragma omp target teams distribute simd safelen (argv[1]=2) // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4];
+
+// expected-note@+1 {{in instantiation of function template specialization 'tmain<int, char, -1, -2>' requested here}}
+#pragma omp target teams distribute simd safelen(safelen(tmain<int, char, -1, -2>(argc, argv) // expected-error 2 {{expected ')'}} expected-note 2 {{to match this '('}}
+ foo(); // expected-error {{statement after '#pragma omp target teams distribute simd' must be a for loop}}
+
+// expected-note@+1 {{in instantiation of function template specialization 'tmain<int, char, 12, 4>' requested here}}
+ return tmain<int, char, 12, 4>(argc, argv);
+}
+
diff --git a/test/OpenMP/target_teams_distribute_simd_shared_messages.cpp b/test/OpenMP/target_teams_distribute_simd_shared_messages.cpp
new file mode 100644
index 0000000000000..9f98ab9c80b68
--- /dev/null
+++ b/test/OpenMP/target_teams_distribute_simd_shared_messages.cpp
@@ -0,0 +1,106 @@
+// RUN: %clang_cc1 -verify -fopenmp %s
+
+void foo() {
+}
+
+bool foobool(int argc) {
+ return argc;
+}
+
+struct S1; // expected-note {{declared here}}
+extern S1 a;
+class S2 {
+ mutable int a;
+public:
+ S2():a(0) { }
+ S2(S2 &s2):a(s2.a) { }
+};
+const S2 b;
+const S2 ba[5];
+class S3 {
+ int a;
+public:
+ S3():a(0) { }
+ S3(S3 &s3):a(s3.a) { }
+};
+const S3 c;
+const S3 ca[5];
+extern const int f;
+class S4 {
+ int a;
+ S4();
+ S4(const S4 &s4);
+public:
+ S4(int v):a(v) { }
+};
+class S5 {
+ int a;
+ S5():a(0) {}
+ S5(const S5 &s5):a(s5.a) { }
+public:
+ S5(int v):a(v) { }
+};
+
+S3 h;
+#pragma omp threadprivate(h) // expected-note {{defined as threadprivate or thread local}}
+
+namespace A {
+double x;
+#pragma omp threadprivate(x) // expected-note {{defined as threadprivate or thread local}}
+}
+namespace B {
+using A::x;
+}
+
+int main(int argc, char **argv) {
+ const int d = 5;
+ const int da[5] = { 0 };
+ S4 e(4);
+ S5 g(5);
+ int i;
+ int &j = i;
+ #pragma omp target teams distribute simd shared // expected-error {{expected '(' after 'shared'}}
+ for (int j=0; j<100; j++) foo();
+ #pragma omp target teams distribute simd shared ( // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int j=0; j<100; j++) foo();
+ #pragma omp target teams distribute simd shared () // expected-error {{expected expression}}
+ for (int j=0; j<100; j++) foo();
+ #pragma omp target teams distribute simd shared (argc // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int j=0; j<100; j++) foo();
+ #pragma omp target teams distribute simd shared (argc, // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int j=0; j<100; j++) foo();
+ #pragma omp target teams distribute simd shared (argc > 0 ? argv[1] : argv[2]) // expected-error {{expected variable name}}
+ for (int j=0; j<100; j++) foo();
+ #pragma omp target teams distribute simd shared (argc)
+ for (int j=0; j<100; j++) foo();
+ #pragma omp target teams distribute simd shared (S1) // expected-error {{'S1' does not refer to a value}}
+ for (int j=0; j<100; j++) foo();
+ #pragma omp target teams distribute simd shared (a, b, c, d, f)
+ for (int j=0; j<100; j++) foo();
+ #pragma omp target teams distribute simd shared (argv[1]) // expected-error {{expected variable name}}
+ for (int j=0; j<100; j++) foo();
+ #pragma omp target teams distribute simd shared(ba)
+ for (int j=0; j<100; j++) foo();
+ #pragma omp target teams distribute simd shared(ca)
+ for (int j=0; j<100; j++) foo();
+ #pragma omp target teams distribute simd shared(da)
+ for (int j=0; j<100; j++) foo();
+ #pragma omp target teams distribute simd shared(e, g)
+ for (int j=0; j<100; j++) foo();
+ #pragma omp target teams distribute simd shared(h, B::x) // expected-error 2 {{threadprivate or thread local variable cannot be shared}}
+ for (int j=0; j<100; j++) foo();
+ #pragma omp target teams distribute simd private(i), shared(i) // expected-error {{private variable cannot be shared}} expected-note {{defined as private}}
+ for (int j=0; j<100; j++) foo();
+ #pragma omp target teams distribute simd firstprivate(i), shared(i) // expected-error {{firstprivate variable cannot be shared}} expected-note {{defined as firstprivate}}
+ for (int j=0; j<100; j++) foo();
+ #pragma omp target teams distribute simd private(i)
+ for (int j=0; j<100; j++) foo();
+ #pragma omp target teams distribute simd shared(i)
+ for (int j=0; j<100; j++) foo();
+ #pragma omp target teams distribute simd shared(j)
+ for (int j=0; j<100; j++) foo();
+ #pragma omp target teams distribute simd firstprivate(i)
+ for (int j=0; j<100; j++) foo();
+
+ return 0;
+}
diff --git a/test/OpenMP/target_teams_distribute_simd_simdlen_messages.cpp b/test/OpenMP/target_teams_distribute_simd_simdlen_messages.cpp
new file mode 100644
index 0000000000000..1b7ad66af69e5
--- /dev/null
+++ b/test/OpenMP/target_teams_distribute_simd_simdlen_messages.cpp
@@ -0,0 +1,133 @@
+// RUN: %clang_cc1 -verify -fopenmp %s
+// RUN: %clang_cc1 -verify -fopenmp -std=c++98 %s
+// RUN: %clang_cc1 -verify -fopenmp -std=c++11 %s
+
+void foo() {
+}
+
+#if __cplusplus >= 201103L
+// expected-note@+2 4 {{declared here}}
+#endif
+bool foobool(int argc) {
+ return argc;
+}
+
+struct S1; // expected-note {{declared here}}
+
+template <class T, typename S, int N, int ST> // expected-note {{declared here}}
+T tmain(T argc, S **argv) { //expected-note 2 {{declared here}}
+
+#pragma omp target teams distribute simd safelen // expected-error {{expected '(' after 'safelen'}}
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#pragma omp target teams distribute simd safelen ( // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#pragma omp target teams distribute simd safelen () // expected-error {{expected expression}}
+ for (int i = ST; i < N; i++) argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#pragma omp target teams distribute simd safelen (argc // expected-note {{to match this '('}} expected-error 2 {{expression is not an integral constant expression}} expected-note 2 {{read of non-const variable 'argc' is not allowed in a constant expression}} expected-error {{expected ')'}}
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#pragma omp target teams distribute simd safelen (ST // expected-error {{argument to 'safelen' clause must be a strictly positive integer value}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#pragma omp target teams distribute simd safelen (1)) // expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#pragma omp target teams distribute simd safelen ((ST > 0) ? 1 + ST : 2)
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#if __cplusplus >= 201103L
+ // expected-note@+2 2 {{non-constexpr function 'foobool' cannot be used in a constant expression}}
+#endif
+#pragma omp target teams distribute simd safelen (foobool(argc)), safelen (true), safelen (-5) // expected-error 2 {{directive '#pragma omp target teams distribute simd' cannot contain more than one 'safelen' clause}} expected-error 2 {{argument to 'safelen' clause must be a strictly positive integer value}} expected-error 2 {{expression is not an integral constant expression}}
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#pragma omp target teams distribute simd safelen (S) // expected-error {{'S' does not refer to a value}}
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#if __cplusplus <= 199711L
+ // expected-error@+4 2 {{expression is not an integral constant expression}}
+#else
+ // expected-error@+2 2 {{integral constant expression must have integral or unscoped enumeration type, not 'char *'}}
+#endif
+#pragma omp target teams distribute simd safelen (argv[1]=2) // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#pragma omp target teams distribute simd safelen (4)
+ for (int i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+#pragma omp target teams distribute simd safelen (N) // expected-error {{argument to 'safelen' clause must be a strictly positive integer value}}
+ for (T i = ST; i < N; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-ST];
+
+ return argc;
+}
+
+int main(int argc, char **argv) {
+#pragma omp target teams distribute simd safelen // expected-error {{expected '(' after 'safelen'}}
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4];
+
+#pragma omp target teams distribute simd safelen ( // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4];
+
+#pragma omp target teams distribute simd safelen () // expected-error {{expected expression}}
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4];
+
+#pragma omp target teams distribute simd safelen (4 // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4];
+
+#pragma omp target teams distribute simd safelen (2+2)) // expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4];
+
+#if __cplusplus >= 201103L
+ // expected-note@+2 {{non-constexpr function 'foobool' cannot be used in a constant expression}}
+#endif
+#pragma omp target teams distribute simd safelen (foobool(1) > 0 ? 1 : 2) // expected-error {{expression is not an integral constant expression}}
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4];
+
+#if __cplusplus >= 201103L
+ // expected-note@+2 {{non-constexpr function 'foobool' cannot be used in a constant expression}}
+#endif
+#pragma omp target teams distribute simd safelen (foobool(argc)), safelen (true), safelen (-5) // expected-error 2 {{argument to 'safelen' clause must be a strictly positive integer value}} expected-error 2 {{directive '#pragma omp target teams distribute simd' cannot contain more than one 'safelen' clause}} expected-error {{expression is not an integral constant expression}}
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4];
+
+#pragma omp target teams distribute simd safelen (S1) // expected-error {{'S1' does not refer to a value}}
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4];
+
+#if __cplusplus <= 199711L
+ // expected-error@+4 {{expression is not an integral constant expression}}
+#else
+ // expected-error@+2 {{integral constant expression must have integral or unscoped enumeration type, not 'char *'}}
+#endif
+#pragma omp target teams distribute simd safelen (argv[1]=2) // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int i = 4; i < 12; i++)
+ argv[0][i] = argv[0][i] - argv[0][i-4];
+
+ // expected-note@+1 {{in instantiation of function template specialization 'tmain<int, char, -1, -2>' requested here}}
+#pragma omp target teams distribute simd safelen(safelen(tmain<int, char, -1, -2>(argc, argv) // expected-error 2 {{expected ')'}} expected-note 2 {{to match this '('}}
+ foo(); // expected-error {{statement after '#pragma omp target teams distribute simd' must be a for loop}}
+
+ // expected-note@+1 {{in instantiation of function template specialization 'tmain<int, char, 12, 4>' requested here}}
+ return tmain<int, char, 12, 4>(argc, argv);
+}
+
diff --git a/test/OpenMP/target_teams_distribute_simd_thread_limit_messages.cpp b/test/OpenMP/target_teams_distribute_simd_thread_limit_messages.cpp
new file mode 100644
index 0000000000000..357f5dde313b6
--- /dev/null
+++ b/test/OpenMP/target_teams_distribute_simd_thread_limit_messages.cpp
@@ -0,0 +1,85 @@
+// RUN: %clang_cc1 -verify -fopenmp -std=c++11 %s
+
+void foo() {
+}
+
+bool foobool(int argc) {
+ return argc;
+}
+
+struct S1; // expected-note 2 {{declared here}}
+
+template <typename T, int C> // expected-note {{declared here}}
+T tmain(T argc) {
+ char **a;
+#pragma omp target teams distribute simd thread_limit(C)
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd thread_limit(T) // expected-error {{'T' does not refer to a value}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd thread_limit // expected-error {{expected '(' after 'thread_limit'}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd thread_limit( // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd thread_limit() // expected-error {{expected expression}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd thread_limit(argc // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd thread_limit(argc)) // expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd thread_limit(argc > 0 ? a[1] : a[2]) // expected-error {{expression must have integral or unscoped enumeration type, not 'char *'}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd thread_limit(argc + argc)
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd thread_limit(argc), thread_limit (argc+1) // expected-error {{directive '#pragma omp target teams distribute simd' cannot contain more than one 'thread_limit' clause}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd thread_limit(S1) // expected-error {{'S1' does not refer to a value}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd thread_limit(-2) // expected-error {{argument to 'thread_limit' clause must be a strictly positive integer value}}
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd thread_limit(-10u)
+ for (int j=0; j<100; j++) foo();
+#pragma omp target teams distribute simd thread_limit(3.14) // expected-error 2 {{expression must have integral or unscoped enumeration type, not 'double'}}
+ for (int j=0; j<100; j++) foo();
+
+ return 0;
+}
+
+int main(int argc, char **argv) {
+#pragma omp target teams distribute simd thread_limit // expected-error {{expected '(' after 'thread_limit'}}
+ for (int j=0; j<100; j++) foo();
+
+#pragma omp target teams distribute simd thread_limit ( // expected-error {{expected expression}} expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int j=0; j<100; j++) foo();
+
+#pragma omp target teams distribute simd thread_limit () // expected-error {{expected expression}}
+ for (int j=0; j<100; j++) foo();
+
+#pragma omp target teams distribute simd thread_limit (argc // expected-error {{expected ')'}} expected-note {{to match this '('}}
+ for (int j=0; j<100; j++) foo();
+
+#pragma omp target teams distribute simd thread_limit (argc)) // expected-warning {{extra tokens at the end of '#pragma omp target teams distribute simd' are ignored}}
+ for (int j=0; j<100; j++) foo();
+
+#pragma omp target teams distribute simd thread_limit (argc > 0 ? argv[1] : argv[2]) // expected-error {{expression must have integral or unscoped enumeration type, not 'char *'}}
+ for (int j=0; j<100; j++) foo();
+
+#pragma omp target teams distribute simd thread_limit (argc + argc)
+ for (int j=0; j<100; j++) foo();
+
+#pragma omp target teams distribute simd thread_limit (argc), thread_limit (argc+1) // expected-error {{directive '#pragma omp target teams distribute simd' cannot contain more than one 'thread_limit' clause}}
+ for (int j=0; j<100; j++) foo();
+
+#pragma omp target teams distribute simd thread_limit (S1) // expected-error {{'S1' does not refer to a value}}
+ for (int j=0; j<100; j++) foo();
+
+#pragma omp target teams distribute simd thread_limit (-2) // expected-error {{argument to 'thread_limit' clause must be a strictly positive integer value}}
+ for (int j=0; j<100; j++) foo();
+
+#pragma omp target teams distribute simd thread_limit (-10u)
+ for (int j=0; j<100; j++) foo();
+
+#pragma omp target teams distribute simd thread_limit (3.14) // expected-error {{expression must have integral or unscoped enumeration type, not 'double'}}
+ for (int j=0; j<100; j++) foo();
+
+ return tmain<int, 10>(argc); // expected-note {{in instantiation of function template specialization 'tmain<int, 10>' requested here}}
+}
diff --git a/test/OpenMP/threadprivate_codegen.cpp b/test/OpenMP/threadprivate_codegen.cpp
index 09f5ed5060ba3..318415761ac77 100644
--- a/test/OpenMP/threadprivate_codegen.cpp
+++ b/test/OpenMP/threadprivate_codegen.cpp
@@ -179,9 +179,9 @@ struct S5 {
// CHECK-TLS-DAG: @__dso_handle = external global i8
// CHECK-TLS-DAG: [[GS1_TLS_INIT:@_ZTHL3gs1]] = internal alias void (), void ()* @__tls_init
// CHECK-TLS-DAG: [[ARR_X_TLS_INIT:@_ZTH5arr_x]] = alias void (), void ()* @__tls_init
-// CHECK-TLS-DAG: [[ST_INT_ST_TLS_INIT:@_ZTHN2STIiE2stE]] = linkonce_odr alias void (), void ()* @__tls_init
-// CHECK-TLS-DAG: [[ST_FLOAT_ST_TLS_INIT:@_ZTHN2STIfE2stE]] = linkonce_odr alias void (), void ()* @__tls_init
-// CHECK-TLS-DAG: [[ST_S4_ST_TLS_INIT:@_ZTHN2STI2S4E2stE]] = linkonce_odr alias void (), void ()* @__tls_init
+
+
+// CHECK-TLS-DAG: [[ST_S4_ST_TLS_INIT:@_ZTHN2STI2S4E2stE]] = linkonce_odr alias void (), void ()* [[ST_S4_ST_CXX_INIT:@[^, ]*]]
struct Static {
static S3 s;
@@ -640,11 +640,11 @@ int main() {
// CHECK-TLS: ret [2 x [3 x [[S1]]]]* [[ARR_X]]
// CHECK-TLS: }
// CHECK-TLS: define {{.*}} i32* [[ST_INT_ST_TLS_INITD]] {{#[0-9]+}} {
-// CHECK-TLS: call void [[ST_INT_ST_TLS_INIT]]
+// CHECK-TLS-NOT: call
// CHECK-TLS: ret i32* [[ST_INT_ST]]
// CHECK-TLS: }
// CHECK-TLS: define {{.*}} float* [[ST_FLOAT_ST_TLS_INITD]] {{#[0-9]+}} {
-// CHECK-TLS: call void [[ST_FLOAT_ST_TLS_INIT]]
+// CHECK-TLS-NOT: call
// CHECK-TLS: ret float* [[ST_FLOAT_ST]]
// CHECK-TLS: }
// CHECK-TLS: define {{.*}} [[S4]]* [[ST_S4_ST_TLS_INITD]] {{#[0-9]+}} {
@@ -923,7 +923,7 @@ int foobar() {
// CHECK-TLS: define {{.*}}void [[SM_CTOR2]]([[SMAIN]]* {{.*}}, i32 {{.*}})
// CHECK-TLS: define {{.*}}void [[SM_DTOR2]]([[SMAIN]]* {{.*}})
-// CHECK-TLS: define internal void [[ST_S4_ST_CXX_INIT:@.*]]()
+// CHECK-TLS: define internal void [[ST_S4_ST_CXX_INIT]]()
// CHECK-TLS: call void [[ST_S4_ST_CTOR1:@.*]]([[S4]]* [[ST_S4_ST]], i32 23)
// CHECK-TLS: call i32 @__cxa_thread_atexit(void (i8*)* bitcast (void ([[S4]]*)* [[ST_S4_ST_DTOR1:.*]] to void (i8*)*), i8* bitcast ([[S4]]* [[ST_S4_ST]] to i8*)
// CHECK-TLS: }
@@ -945,7 +945,7 @@ int foobar() {
// CHECK-TLS: call void [[GS1_CXX_INIT]]
// CHECK-TLS-NOT: call void [[GS2_CXX_INIT]]
// CHECK-TLS: call void [[ARR_X_CXX_INIT]]
-// CHECK-TLS: call void [[ST_S4_ST_CXX_INIT]]
+// CHECK-TLS-NOT: call void [[ST_S4_ST_CXX_INIT]]
// CHECK-TLS: [[DONE_LABEL]]
// CHECK-TLS-DAG: declare {{.*}} void [[GS3_TLS_INIT]]
diff --git a/test/PCH/uses-seh.cpp b/test/PCH/uses-seh.cpp
new file mode 100644
index 0000000000000..6fbfc9766c488
--- /dev/null
+++ b/test/PCH/uses-seh.cpp
@@ -0,0 +1,29 @@
+// Make SEH works in PCH
+//
+// Test this without pch.
+// RUN: %clang_cc1 -fms-extensions -triple x86_64-windows-msvc -std=c++11 -include %s -emit-llvm -o - %s | FileCheck %s
+
+// Test with pch.
+// RUN: %clang_cc1 -fms-extensions -triple x86_64-windows-msvc -std=c++11 -emit-pch -o %t %s
+// RUN: %clang_cc1 -fms-extensions -triple x86_64-windows-msvc -std=c++11 -include-pch %t -emit-llvm -o - %s | FileCheck %s
+
+#ifndef HEADER
+#define HEADER
+
+int shouldCatch();
+inline int f() {
+ __try {
+ } __except (shouldCatch()) {
+ }
+ return 0;
+}
+int x = f();
+
+// CHECK: define linkonce_odr i32 @"\01?f@@YAHXZ"()
+// CHECK: define internal i32 @"\01?filt$0@0@f@@"({{.*}})
+
+#else
+
+// empty
+
+#endif
diff --git a/test/Preprocessor/predefined-arch-macros.c b/test/Preprocessor/predefined-arch-macros.c
index 51b587e403e03..883cc4d19b29a 100644
--- a/test/Preprocessor/predefined-arch-macros.c
+++ b/test/Preprocessor/predefined-arch-macros.c
@@ -1849,6 +1849,88 @@
// CHECK_BDVER4_M64: #define __tune_bdver4__ 1
// CHECK_BDVER4_M64: #define __x86_64 1
// CHECK_BDVER4_M64: #define __x86_64__ 1
+// RUN: %clang -march=znver1 -m32 -E -dM %s -o - 2>&1 \
+// RUN: -target i386-unknown-linux \
+// RUN: | FileCheck -match-full-lines %s -check-prefix=CHECK_ZNVER1_M32
+// CHECK_ZNVER1_M32-NOT: #define __3dNOW_A__ 1
+// CHECK_ZNVER1_M32-NOT: #define __3dNOW__ 1
+// CHECK_ZNVER1_M32: #define __ADX__ 1
+// CHECK_ZNVER1_M32: #define __AES__ 1
+// CHECK_ZNVER1_M32: #define __AVX2__ 1
+// CHECK_ZNVER1_M32: #define __AVX__ 1
+// CHECK_ZNVER1_M32: #define __BMI2__ 1
+// CHECK_ZNVER1_M32: #define __BMI__ 1
+// CHECK_ZNVER1_M32: #define __F16C__ 1
+// CHECK_ZNVER1_M32: #define __FMA__ 1
+// CHECK_ZNVER1_M32: #define __FSGSBASE__ 1
+// CHECK_ZNVER1_M32: #define __LZCNT__ 1
+// CHECK_ZNVER1_M32: #define __MMX__ 1
+// CHECK_ZNVER1_M32: #define __PCLMUL__ 1
+// CHECK_ZNVER1_M32: #define __POPCNT__ 1
+// CHECK_ZNVER1_M32: #define __PRFCHW__ 1
+// CHECK_ZNVER1_M32: #define __RDRND__ 1
+// CHECK_ZNVER1_M32: #define __RDSEED__ 1
+// CHECK_ZNVER1_M32: #define __SHA__ 1
+// CHECK_ZNVER1_M32: #define __SSE2_MATH__ 1
+// CHECK_ZNVER1_M32: #define __SSE2__ 1
+// CHECK_ZNVER1_M32: #define __SSE3__ 1
+// CHECK_ZNVER1_M32: #define __SSE4A__ 1
+// CHECK_ZNVER1_M32: #define __SSE4_1__ 1
+// CHECK_ZNVER1_M32: #define __SSE4_2__ 1
+// CHECK_ZNVER1_M32: #define __SSE_MATH__ 1
+// CHECK_ZNVER1_M32: #define __SSE__ 1
+// CHECK_ZNVER1_M32: #define __SSSE3__ 1
+// CHECK_ZNVER1_M32: #define __XSAVEC__ 1
+// CHECK_ZNVER1_M32: #define __XSAVEOPT__ 1
+// CHECK_ZNVER1_M32: #define __XSAVES__ 1
+// CHECK_ZNVER1_M32: #define __XSAVE__ 1
+// CHECK_ZNVER1_M32: #define __i386 1
+// CHECK_ZNVER1_M32: #define __i386__ 1
+// CHECK_ZNVER1_M32: #define __tune_znver1__ 1
+// CHECK_ZNVER1_M32: #define __znver1 1
+// CHECK_ZNVER1_M32: #define __znver1__ 1
+// RUN: %clang -march=znver1 -m64 -E -dM %s -o - 2>&1 \
+// RUN: -target i386-unknown-linux \
+// RUN: | FileCheck -match-full-lines %s -check-prefix=CHECK_ZNVER1_M64
+// CHECK_ZNVER1_M64-NOT: #define __3dNOW_A__ 1
+// CHECK_ZNVER1_M64-NOT: #define __3dNOW__ 1
+// CHECK_ZNVER1_M64: #define __ADX__ 1
+// CHECK_ZNVER1_M64: #define __AES__ 1
+// CHECK_ZNVER1_M64: #define __AVX2__ 1
+// CHECK_ZNVER1_M64: #define __AVX__ 1
+// CHECK_ZNVER1_M64: #define __BMI2__ 1
+// CHECK_ZNVER1_M64: #define __BMI__ 1
+// CHECK_ZNVER1_M64: #define __F16C__ 1
+// CHECK_ZNVER1_M64: #define __FMA__ 1
+// CHECK_ZNVER1_M64: #define __FSGSBASE__ 1
+// CHECK_ZNVER1_M64: #define __LZCNT__ 1
+// CHECK_ZNVER1_M64: #define __MMX__ 1
+// CHECK_ZNVER1_M64: #define __PCLMUL__ 1
+// CHECK_ZNVER1_M64: #define __POPCNT__ 1
+// CHECK_ZNVER1_M64: #define __PRFCHW__ 1
+// CHECK_ZNVER1_M64: #define __RDRND__ 1
+// CHECK_ZNVER1_M64: #define __RDSEED__ 1
+// CHECK_ZNVER1_M64: #define __SHA__ 1
+// CHECK_ZNVER1_M64: #define __SSE2_MATH__ 1
+// CHECK_ZNVER1_M64: #define __SSE2__ 1
+// CHECK_ZNVER1_M64: #define __SSE3__ 1
+// CHECK_ZNVER1_M64: #define __SSE4A__ 1
+// CHECK_ZNVER1_M64: #define __SSE4_1__ 1
+// CHECK_ZNVER1_M64: #define __SSE4_2__ 1
+// CHECK_ZNVER1_M64: #define __SSE_MATH__ 1
+// CHECK_ZNVER1_M64: #define __SSE__ 1
+// CHECK_ZNVER1_M64: #define __SSSE3__ 1
+// CHECK_ZNVER1_M64: #define __XSAVEC__ 1
+// CHECK_ZNVER1_M64: #define __XSAVEOPT__ 1
+// CHECK_ZNVER1_M64: #define __XSAVES__ 1
+// CHECK_ZNVER1_M64: #define __XSAVE__ 1
+// CHECK_ZNVER1_M64: #define __amd64 1
+// CHECK_ZNVER1_M64: #define __amd64__ 1
+// CHECK_ZNVER1_M64: #define __tune_znver1__ 1
+// CHECK_ZNVER1_M64: #define __x86_64 1
+// CHECK_ZNVER1_M64: #define __x86_64__ 1
+// CHECK_ZNVER1_M64: #define __znver1 1
+// CHECK_ZNVER1_M64: #define __znver1__ 1
//
// End X86/GCC/Linux tests ------------------
diff --git a/test/Profile/gcc-flag-compatibility.c b/test/Profile/gcc-flag-compatibility.c
index f685f69e4ba03..cfc1a35366082 100644
--- a/test/Profile/gcc-flag-compatibility.c
+++ b/test/Profile/gcc-flag-compatibility.c
@@ -18,14 +18,14 @@
// RUN: rm -rf %t.dir
// RUN: mkdir -p %t.dir/some/path
// RUN: llvm-profdata merge %S/Inputs/gcc-flag-compatibility.proftext -o %t.dir/some/path/default.profdata
-// RUN: %clang %s -o - -mllvm -disable-llvm-passes -emit-llvm -S -fprofile-use=%t.dir/some/path | FileCheck -check-prefix=PROFILE-USE-2 %s
+// RUN: %clang %s -o - -Xclang -disable-llvm-passes -emit-llvm -S -fprofile-use=%t.dir/some/path | FileCheck -check-prefix=PROFILE-USE-2 %s
// PROFILE-USE-2: = !{!"branch_weights", i32 101, i32 2}
// Check that -fprofile-use=some/path/file.prof reads some/path/file.prof
// RUN: rm -rf %t.dir
// RUN: mkdir -p %t.dir/some/path
// RUN: llvm-profdata merge %S/Inputs/gcc-flag-compatibility.proftext -o %t.dir/some/path/file.prof
-// RUN: %clang %s -o - -mllvm -disable-llvm-passes -emit-llvm -S -fprofile-use=%t.dir/some/path/file.prof | FileCheck -check-prefix=PROFILE-USE-3 %s
+// RUN: %clang %s -o - -Xclang -disable-llvm-passes -emit-llvm -S -fprofile-use=%t.dir/some/path/file.prof | FileCheck -check-prefix=PROFILE-USE-3 %s
// PROFILE-USE-3: = !{!"branch_weights", i32 101, i32 2}
int X = 0;
diff --git a/test/Sema/atomic-ops.c b/test/Sema/atomic-ops.c
index 8ebf3eaed4af2..d3ebdf67db0fa 100644
--- a/test/Sema/atomic-ops.c
+++ b/test/Sema/atomic-ops.c
@@ -14,11 +14,7 @@ _Static_assert(__GCC_ATOMIC_WCHAR_T_LOCK_FREE == 2, "");
_Static_assert(__GCC_ATOMIC_SHORT_LOCK_FREE == 2, "");
_Static_assert(__GCC_ATOMIC_INT_LOCK_FREE == 2, "");
_Static_assert(__GCC_ATOMIC_LONG_LOCK_FREE == 2, "");
-#ifdef __i386__
-_Static_assert(__GCC_ATOMIC_LLONG_LOCK_FREE == 1, "");
-#else
_Static_assert(__GCC_ATOMIC_LLONG_LOCK_FREE == 2, "");
-#endif
_Static_assert(__GCC_ATOMIC_POINTER_LOCK_FREE == 2, "");
_Static_assert(__c11_atomic_is_lock_free(1), "");
diff --git a/test/Sema/warn-unreachable.c b/test/Sema/warn-unreachable.c
index 31beff9cf1e0d..34e0296a20490 100644
--- a/test/Sema/warn-unreachable.c
+++ b/test/Sema/warn-unreachable.c
@@ -1,4 +1,5 @@
// RUN: %clang_cc1 %s -fsyntax-only -verify -fblocks -Wunreachable-code-aggressive -Wno-unused-value -Wno-covered-switch-default -I %S/Inputs
+// RUN: %clang_cc1 -fsyntax-only -fblocks -Wunreachable-code-aggressive -Wno-unused-value -Wno-covered-switch-default -fdiagnostics-parseable-fixits -I %S/Inputs %s 2>&1 | FileCheck %s
#include "warn-unreachable.h"
@@ -396,3 +397,57 @@ void test_with_paren_silencing(int x) {
else
calledFun();
}
+
+// rdar://24570531
+
+struct StructWithPointer {
+ void *p;
+};
+
+void emitJustOneWarningForOr(struct StructWithPointer *s) {
+ if (1 || !s->p) // expected-note {{silence by adding parentheses to mark code as explicitly dead}}
+ return; // CHECK: fix-it:"{{.*}}":{[[@LINE-1]]:7-[[@LINE-1]]:7}:"/* DISABLES CODE */ ("
+ // CHECK: fix-it:"{{.*}}":{[[@LINE-2]]:8-[[@LINE-2]]:8}:")"
+ emitJustOneWarningForOr(s); // expected-warning {{code will never be executed}}
+}
+
+void emitJustOneWarningForOrSilenced(struct StructWithPointer *s) {
+ if ((1) || !s->p)
+ return;
+
+ emitJustOneWarningForOrSilenced(s); // no warning
+}
+
+void emitJustOneWarningForOr2(struct StructWithPointer *s) {
+ if (1 || !s->p) // expected-warning {{code will never be executed}}
+ return; // expected-note@-1 {{silence by adding parentheses to mark code as explicitly dead}}
+ // CHECK: fix-it:"{{.*}}":{[[@LINE-2]]:7-[[@LINE-2]]:7}:"/* DISABLES CODE */ ("
+ // CHECK: fix-it:"{{.*}}":{[[@LINE-3]]:8-[[@LINE-3]]:8}:")"
+}
+
+void wrapOneInFixit(struct StructWithPointer *s) {
+ if (!s->p || 1) // expected-note {{silence by adding parentheses to mark code as explicitly dead}}
+ return; // CHECK: fix-it:"{{.*}}":{[[@LINE-1]]:16-[[@LINE-1]]:16}:"/* DISABLES CODE */ ("
+ // CHECK: fix-it:"{{.*}}":{[[@LINE-2]]:17-[[@LINE-2]]:17}:")"
+ wrapOneInFixit(s); // expected-warning {{code will never be executed}}
+}
+
+void unaryOpNoFixit() {
+ if (- 1)
+ return; // CHECK-NOT: fix-it:"{{.*}}":{[[@LINE-1]]
+ unaryOpNoFixit(); // expected-warning {{code will never be executed}}
+}
+
+void unaryOpStrictFixit(struct StructWithPointer *s) {
+ if (!(s->p && 0)) // expected-note {{silence by adding parentheses to mark code as explicitly dead}}
+ return; // CHECK: fix-it:"{{.*}}":{[[@LINE-1]]:17-[[@LINE-1]]:17}:"/* DISABLES CODE */ ("
+ // CHECK: fix-it:"{{.*}}":{[[@LINE-2]]:18-[[@LINE-2]]:18}:")"
+ unaryOpStrictFixit(s); // expected-warning {{code will never be executed}}
+}
+
+void unaryOpFixitCastSubExpr(int x) {
+ if (! (int)0) // expected-note {{silence by adding parentheses to mark code as explicitly dead}}
+ return; // CHECK: fix-it:"{{.*}}":{[[@LINE-1]]:7-[[@LINE-1]]:7}:"/* DISABLES CODE */ ("
+ // CHECK: fix-it:"{{.*}}":{[[@LINE-2]]:15-[[@LINE-2]]:15}:")"
+ unaryOpFixitCastSubExpr(x); // expected-warning {{code will never be executed}}
+}
diff --git a/test/SemaCXX/coroutines.cpp b/test/SemaCXX/coroutines.cpp
index a22383cd566b5..158b1a7c7dd4c 100644
--- a/test/SemaCXX/coroutines.cpp
+++ b/test/SemaCXX/coroutines.cpp
@@ -154,12 +154,11 @@ void mixed_await() {
}
void only_coreturn(void_tag) {
- co_return; // expected-warning {{'co_return' used in a function that uses neither 'co_await' nor 'co_yield'}}
+ co_return; // OK
}
void mixed_coreturn(void_tag, bool b) {
if (b)
- // expected-warning@+1 {{'co_return' used in a function that uses neither}}
co_return; // expected-note {{use of 'co_return'}}
else
return; // expected-error {{not allowed in coroutine}}
diff --git a/test/SemaCXX/cxx0x-class.cpp b/test/SemaCXX/cxx0x-class.cpp
index 2b1338f97fd77..8afb0fd6f3c0e 100644
--- a/test/SemaCXX/cxx0x-class.cpp
+++ b/test/SemaCXX/cxx0x-class.cpp
@@ -37,3 +37,11 @@ namespace Foo {
int y = x;
};
}
+
+// Instantiating another default member initializer while parsing one should
+// not cause us to mess up the 'this' override.
+template<typename> struct DefaultMemberTemplate { int n = 0; };
+class DefaultMemberInitSelf {
+ DefaultMemberTemplate<int> t = {};
+ int *p = &t.n;
+};
diff --git a/test/SemaCXX/cxx1y-variable-templates_top_level.cpp b/test/SemaCXX/cxx1y-variable-templates_top_level.cpp
index ec3e2b6f63d10..367f67bf5fa8f 100644
--- a/test/SemaCXX/cxx1y-variable-templates_top_level.cpp
+++ b/test/SemaCXX/cxx1y-variable-templates_top_level.cpp
@@ -464,3 +464,8 @@ template <typename... Args> Variadic_t<Args...> Variadic;
auto variadic1 = Variadic<>;
auto variadic2 = Variadic<int, int>;
#endif
+
+namespace VexingParse {
+ template <typename> int var; // expected-note {{declared here}}
+ int x(var); // expected-error {{cannot refer to variable template 'var' without a template argument list}}
+}
diff --git a/test/SemaCXX/diagnose_if-ext.cpp b/test/SemaCXX/diagnose_if-ext.cpp
new file mode 100644
index 0000000000000..d5625b501322e
--- /dev/null
+++ b/test/SemaCXX/diagnose_if-ext.cpp
@@ -0,0 +1,8 @@
+// RUN: %clang_cc1 -Wpedantic -fsyntax-only %s -verify
+
+void foo() __attribute__((diagnose_if(1, "", "error"))); // expected-warning{{'diagnose_if' is a clang extension}}
+void foo(int a) __attribute__((diagnose_if(a, "", "error"))); // expected-warning{{'diagnose_if' is a clang extension}}
+// FIXME: When diagnose_if gets a CXX11 spelling, this should be enabled.
+#if 0
+[[clang::diagnose_if(a, "", "error")]] void foo(double a);
+#endif
diff --git a/test/SemaCXX/uninitialized.cpp b/test/SemaCXX/uninitialized.cpp
index 5769a0c028c86..7a23f3cef2c4c 100644
--- a/test/SemaCXX/uninitialized.cpp
+++ b/test/SemaCXX/uninitialized.cpp
@@ -1,4 +1,4 @@
-// RUN: %clang_cc1 -fsyntax-only -Wall -Wuninitialized -Wno-unused-value -std=c++11 -verify %s
+// RUN: %clang_cc1 -fsyntax-only -Wall -Wuninitialized -Wno-unused-value -std=c++1z -verify %s
// definitions for std::move
namespace std {
@@ -1437,3 +1437,13 @@ void array_capture(bool b) {
[fname]{};
}
}
+
+void if_switch_init_stmt(int k) {
+ if (int n = 0; (n == k || k > 5)) {}
+
+ if (int n; (n == k || k > 5)) {} // expected-warning {{uninitialized}} expected-note {{initialize}}
+
+ switch (int n = 0; (n == k || k > 5)) {} // expected-warning {{boolean}}
+
+ switch (int n; (n == k || k > 5)) {} // expected-warning {{uninitialized}} expected-note {{initialize}} expected-warning {{boolean}}
+}
diff --git a/test/SemaCXX/warn-shadow-in-lambdas.cpp b/test/SemaCXX/warn-shadow-in-lambdas.cpp
index 575664482dbe1..b0dcd122a540d 100644
--- a/test/SemaCXX/warn-shadow-in-lambdas.cpp
+++ b/test/SemaCXX/warn-shadow-in-lambdas.cpp
@@ -137,3 +137,11 @@ void foo(int param) { // expected-note 1+ {{previous declaration is here}}
auto g3 = [param] // expected-note {{variable 'param' is explicitly captured here}}
(auto param) { ; }; // expected-warning {{declaration shadows a local variable}}
}
+
+void avoidWarningWhenRedefining() {
+ int a = 1;
+ auto l = [b = a] { // expected-note {{previous definition is here}}
+ // Don't warn on redefinitions.
+ int b = 0; // expected-error {{redefinition of 'b'}}
+ };
+}
diff --git a/test/SemaCXX/warn-shadow.cpp b/test/SemaCXX/warn-shadow.cpp
index 9d68fe7c47a66..1316b6dd88718 100644
--- a/test/SemaCXX/warn-shadow.cpp
+++ b/test/SemaCXX/warn-shadow.cpp
@@ -97,3 +97,13 @@ void rdar8883302() {
void test8() {
int bob; // expected-warning {{declaration shadows a variable in the global namespace}}
}
+
+namespace rdar29067894 {
+
+void avoidWarningWhenRedefining(int b) { // expected-note {{previous definition is here}}
+ int a = 0; // expected-note {{previous definition is here}}
+ int a = 1; // expected-error {{redefinition of 'a'}}
+ int b = 2; // expected-error {{redefinition of 'b'}}
+}
+
+}
diff --git a/test/SemaTemplate/deduction.cpp b/test/SemaTemplate/deduction.cpp
index 0c0e7d599ccb7..16e01a934630d 100644
--- a/test/SemaTemplate/deduction.cpp
+++ b/test/SemaTemplate/deduction.cpp
@@ -383,6 +383,23 @@ namespace deduction_after_explicit_pack {
template<typename... T> struct X { X(int); operator int(); };
template<typename... T> void p(T..., X<T...>, ...); // expected-note {{deduced conflicting}}
void q() { p(X<int>(0), 0); } // expected-error {{no match}}
+
+ struct A {
+ template <typename T> void f(T, void *, int = 0); // expected-note 2{{no known conversion from 'double' to 'void *' for 2nd argument}}
+ void f(); // expected-note 2{{requires 0}}
+
+ template <typename T> static void g(T, void *, int = 0); // expected-note 2{{no known conversion from 'double' to 'void *' for 2nd argument}}
+ void g(); // expected-note 2{{requires 0}}
+
+ void h() {
+ f(1.0, 2.0); // expected-error {{no match}}
+ g(1.0, 2.0); // expected-error {{no match}}
+ }
+ };
+ void f(A a) {
+ a.f(1.0, 2.0); // expected-error {{no match}}
+ a.g(1.0, 2.0); // expected-error {{no match}}
+ }
}
namespace overload_vs_pack {
diff --git a/test/SemaTemplate/temp_arg_template.cpp b/test/SemaTemplate/temp_arg_template.cpp
index 67cde53c928b3..b0df9149c6e01 100644
--- a/test/SemaTemplate/temp_arg_template.cpp
+++ b/test/SemaTemplate/temp_arg_template.cpp
@@ -100,3 +100,9 @@ struct S : public template_tuple<identity, identity> {
void foo() {
f7<identity>();
}
+
+namespace CheckDependentNonTypeParamTypes {
+ template<template<typename T, typename U, T v> class> struct A {}; // expected-note {{previous}}
+ template<typename T, typename U, U v> struct B {}; // expected-note {{different type}}
+ A<B> ab; // expected-error {{different template parameters}}
+}
diff --git a/test/SemaTemplate/temp_arg_template_cxx1z.cpp b/test/SemaTemplate/temp_arg_template_cxx1z.cpp
index b6b283b53c6be..aa517c3285993 100644
--- a/test/SemaTemplate/temp_arg_template_cxx1z.cpp
+++ b/test/SemaTemplate/temp_arg_template_cxx1z.cpp
@@ -70,30 +70,47 @@ namespace Auto {
template<template<int*> typename T> struct TIntPtr {};
template<template<auto> typename T> struct TAuto {};
template<template<auto*> typename T> struct TAutoPtr {};
+ template<template<decltype(auto)> typename T> struct TDecltypeAuto {};
template<auto> struct Auto;
template<auto*> struct AutoPtr;
+ template<decltype(auto)> struct DecltypeAuto;
template<int> struct Int;
template<int*> struct IntPtr;
TInt<Auto> ia;
- TInt<AutoPtr> iap; // FIXME: ill-formed
+ TInt<AutoPtr> iap; // expected-error {{different template parameters}}
+ TInt<DecltypeAuto> ida; // FIXME expected-error {{different template parameters}}
TInt<Int> ii;
TInt<IntPtr> iip; // expected-error {{different template parameters}}
TIntPtr<Auto> ipa;
TIntPtr<AutoPtr> ipap;
+ TIntPtr<DecltypeAuto> ipda; // FIXME expected-error {{different template parameters}}
TIntPtr<Int> ipi; // expected-error {{different template parameters}}
TIntPtr<IntPtr> ipip;
TAuto<Auto> aa;
- TAuto<AutoPtr> aap; // FIXME: ill-formed
- TAuto<Int> ai; // FIXME: ill-formed
- TAuto<IntPtr> aip; // FIXME: ill-formed
+ TAuto<AutoPtr> aap; // expected-error {{different template parameters}}
+ TAuto<Int> ai; // expected-error {{different template parameters}}
+ TAuto<IntPtr> aip; // expected-error {{different template parameters}}
TAutoPtr<Auto> apa;
TAutoPtr<AutoPtr> apap;
- TAutoPtr<Int> api; // FIXME: ill-formed
- TAutoPtr<IntPtr> apip; // FIXME: ill-formed
+ TAutoPtr<Int> api; // expected-error {{different template parameters}}
+ TAutoPtr<IntPtr> apip; // expected-error {{different template parameters}}
+
+ TDecltypeAuto<DecltypeAuto> dada;
+ TDecltypeAuto<Int> dai; // expected-error {{different template parameters}}
+ TDecltypeAuto<IntPtr> daip; // expected-error {{different template parameters}}
+
+ // FIXME: It's completely unclear what should happen here. A case can be made
+ // that 'auto' is more specialized, because it's always a prvalue, whereas
+ // 'decltype(auto)' could have any value category. Under that interpretation,
+ // we get the following results entirely backwards:
+ TAuto<DecltypeAuto> ada; // expected-error {{different template parameters}}
+ TAutoPtr<DecltypeAuto> apda; // expected-error {{different template parameters}}
+ TDecltypeAuto<Auto> daa;
+ TDecltypeAuto<AutoPtr> daa; // expected-error {{different template parameters}}
int n;
template<auto A, decltype(A) B = &n> struct SubstFailure;
diff --git a/tools/clang-fuzzer/ClangFuzzer.cpp b/tools/clang-fuzzer/ClangFuzzer.cpp
index afe57d4a666cf..1692882c0b5f1 100644
--- a/tools/clang-fuzzer/ClangFuzzer.cpp
+++ b/tools/clang-fuzzer/ClangFuzzer.cpp
@@ -42,7 +42,7 @@ extern "C" int LLVMFuzzerTestOneInput(uint8_t *data, size_t size) {
tooling::newFrontendActionFactory<clang::SyntaxOnlyAction>());
std::shared_ptr<PCHContainerOperations> PCHContainerOps =
std::make_shared<PCHContainerOperations>();
- action->runInvocation(Invocation.release(), Files.get(), PCHContainerOps,
+ action->runInvocation(std::move(Invocation), Files.get(), PCHContainerOps,
&Diags);
return 0;
}
diff --git a/tools/libclang/CIndex.cpp b/tools/libclang/CIndex.cpp
index 9cdb2ee8d6971..67fa2aea1d452 100644
--- a/tools/libclang/CIndex.cpp
+++ b/tools/libclang/CIndex.cpp
@@ -2016,6 +2016,8 @@ public:
const OMPTargetTeamsDistributeParallelForDirective *D);
void VisitOMPTargetTeamsDistributeParallelForSimdDirective(
const OMPTargetTeamsDistributeParallelForSimdDirective *D);
+ void VisitOMPTargetTeamsDistributeSimdDirective(
+ const OMPTargetTeamsDistributeSimdDirective *D);
private:
void AddDeclarationNameInfo(const Stmt *S);
@@ -2840,6 +2842,11 @@ void EnqueueVisitor::VisitOMPTargetTeamsDistributeParallelForSimdDirective(
VisitOMPLoopDirective(D);
}
+void EnqueueVisitor::VisitOMPTargetTeamsDistributeSimdDirective(
+ const OMPTargetTeamsDistributeSimdDirective *D) {
+ VisitOMPLoopDirective(D);
+}
+
void CursorVisitor::EnqueueWorkList(VisitorWorkList &WL, const Stmt *S) {
EnqueueVisitor(WL, MakeCXCursor(S, StmtParent, TU,RegionOfInterest)).Visit(S);
}
@@ -5011,6 +5018,8 @@ CXString clang_getCursorKindSpelling(enum CXCursorKind Kind) {
case CXCursor_OMPTargetTeamsDistributeParallelForSimdDirective:
return cxstring::createRef(
"OMPTargetTeamsDistributeParallelForSimdDirective");
+ case CXCursor_OMPTargetTeamsDistributeSimdDirective:
+ return cxstring::createRef("OMPTargetTeamsDistributeSimdDirective");
case CXCursor_OverloadCandidate:
return cxstring::createRef("OverloadCandidate");
case CXCursor_TypeAliasTemplateDecl:
diff --git a/tools/libclang/CXCursor.cpp b/tools/libclang/CXCursor.cpp
index e69835a6b1ea7..8731ca65c4233 100644
--- a/tools/libclang/CXCursor.cpp
+++ b/tools/libclang/CXCursor.cpp
@@ -679,6 +679,9 @@ CXCursor cxcursor::MakeCXCursor(const Stmt *S, const Decl *Parent,
case Stmt::OMPTargetTeamsDistributeParallelForSimdDirectiveClass:
K = CXCursor_OMPTargetTeamsDistributeParallelForSimdDirective;
break;
+ case Stmt::OMPTargetTeamsDistributeSimdDirectiveClass:
+ K = CXCursor_OMPTargetTeamsDistributeSimdDirective;
+ break;
}
CXCursor C = { K, 0, { Parent, S, TU } };
diff --git a/unittests/AST/SourceLocationTest.cpp b/unittests/AST/SourceLocationTest.cpp
index add85c3660244..5f69c54043614 100644
--- a/unittests/AST/SourceLocationTest.cpp
+++ b/unittests/AST/SourceLocationTest.cpp
@@ -670,5 +670,72 @@ TEST(CXXMethodDecl, CXXMethodDeclWithNoExceptSpecification) {
Language::Lang_CXX11));
}
+class ExceptionSpecRangeVerifier : public RangeVerifier<TypeLoc> {
+protected:
+ SourceRange getRange(const TypeLoc &Node) override {
+ auto T =
+ Node.getUnqualifiedLoc().castAs<FunctionProtoTypeLoc>();
+ assert(!T.isNull());
+ return T.getExceptionSpecRange();
+ }
+};
+
+class ParmVarExceptionSpecRangeVerifier : public RangeVerifier<ParmVarDecl> {
+protected:
+ SourceRange getRange(const ParmVarDecl &Node) override {
+ if (const TypeSourceInfo *TSI = Node.getTypeSourceInfo()) {
+ TypeLoc TL = TSI->getTypeLoc();
+ if (TL.getType()->isPointerType()) {
+ TL = TL.getNextTypeLoc().IgnoreParens();
+ if (auto FPTL = TL.getAs<FunctionProtoTypeLoc>()) {
+ return FPTL.getExceptionSpecRange();
+ }
+ }
+ }
+ return SourceRange();
+ }
+};
+
+TEST(FunctionDecl, ExceptionSpecifications) {
+ ExceptionSpecRangeVerifier Verifier;
+
+ Verifier.expectRange(1, 10, 1, 16);
+ EXPECT_TRUE(Verifier.match("void f() throw();\n", loc(functionType())));
+
+ Verifier.expectRange(1, 10, 1, 34);
+ EXPECT_TRUE(Verifier.match("void f() throw(void(void) throw());\n",
+ loc(functionType())));
+
+ Verifier.expectRange(1, 10, 1, 19);
+ std::vector<std::string> Args;
+ Args.push_back("-fms-extensions");
+ EXPECT_TRUE(Verifier.match("void f() throw(...);\n", loc(functionType()),
+ Args, Language::Lang_CXX));
+
+ Verifier.expectRange(1, 10, 1, 10);
+ EXPECT_TRUE(Verifier.match("void f() noexcept;\n", loc(functionType()),
+ Language::Lang_CXX11));
+
+ Verifier.expectRange(1, 10, 1, 24);
+ EXPECT_TRUE(Verifier.match("void f() noexcept(false);\n", loc(functionType()),
+ Language::Lang_CXX11));
+
+ Verifier.expectRange(1, 10, 1, 32);
+ EXPECT_TRUE(Verifier.match("void f() noexcept(noexcept(1+1));\n",
+ loc(functionType()), Language::Lang_CXX11));
+
+ ParmVarExceptionSpecRangeVerifier Verifier2;
+ Verifier2.expectRange(1, 25, 1, 31);
+ EXPECT_TRUE(Verifier2.match("void g(void (*fp)(void) throw());\n",
+ parmVarDecl(hasType(pointerType(pointee(
+ parenType(innerType(functionType()))))))));
+
+ Verifier2.expectRange(1, 25, 1, 38);
+ EXPECT_TRUE(Verifier2.match("void g(void (*fp)(void) noexcept(true));\n",
+ parmVarDecl(hasType(pointerType(pointee(
+ parenType(innerType(functionType())))))),
+ Language::Lang_CXX11));
+}
+
} // end namespace ast_matchers
} // end namespace clang
diff --git a/unittests/Format/FormatTest.cpp b/unittests/Format/FormatTest.cpp
index 629e85803d64a..b402b5c4a54c2 100644
--- a/unittests/Format/FormatTest.cpp
+++ b/unittests/Format/FormatTest.cpp
@@ -6816,6 +6816,14 @@ TEST_F(FormatTest, FormatsBracedListsInColumnLayout) {
" aaaaaa.aaaaaaa,\n"
" aaaaaa.aaaaaaa,\n"
"};");
+
+ // Don't create hanging lists.
+ verifyFormat("someFunction(Param,\n"
+ " {List1, List2,\n"
+ " List3});",
+ getLLVMStyleWithColumns(35));
+ verifyFormat("aaaaaaaaaaaaaaaaaaaaaaaaaaaaaa(aaaaaaaaaaaaaaaaaaa, {},\n"
+ " aaaaaaaaaaaaaaaaaaaaaaa);");
}
TEST_F(FormatTest, PullTrivialFunctionDefinitionsIntoSingleLine) {
diff --git a/www/cxx_dr_status.html b/www/cxx_dr_status.html
index e7d2e5f87c9c8..73727c014b4e8 100644
--- a/www/cxx_dr_status.html
+++ b/www/cxx_dr_status.html
@@ -28,7 +28,7 @@
<!--*************************************************************************-->
<h1>C++ Defect Report Support in Clang</h1>
<!--*************************************************************************-->
-<p>Last updated: $Date: 2017-01-09 09:01:21 +0100 (Mon, 09 Jan 2017) $</p>
+<p>Last updated: $Date: 2017-01-13 17:52:17 +0100 (Fri, 13 Jan 2017) $</p>
<h2 id="cxxdr">C++ defect report implementation status</h2>
@@ -591,7 +591,7 @@
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_defects.html#92">92</a></td>
<td>WP</td>
<td>Should <I>exception-specification</I>s be part of the type system?</td>
- <td class="svn" align="center">SVN (C++17 onwards)</td>
+ <td class="svn" align="center">Clang 4 (C++17 onwards)</td>
</tr>
<tr id="93">
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_defects.html#93">93</a></td>
@@ -1594,7 +1594,7 @@ accessible?</td>
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_defects.html#259">259</a></td>
<td>CD1</td>
<td>Restrictions on explicit specialization and instantiation</td>
- <td class="svn" align="center">SVN</td>
+ <td class="svn" align="center">Clang 4</td>
</tr>
<tr class="open" id="260">
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_active.html#260">260</a></td>
@@ -3541,7 +3541,7 @@ and <I>POD class</I></td>
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_defects.html#583">583</a></td>
<td>CD3</td>
<td>Relational pointer comparisons against the null pointer constant</td>
- <td class="svn" align="center">SVN</td>
+ <td class="svn" align="center">Clang 4</td>
</tr>
<tr id="584">
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_closed.html#584">584</a></td>
@@ -3739,7 +3739,7 @@ and <I>POD class</I></td>
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_defects.html#616">616</a></td>
<td>CD3</td>
<td>Definition of &#8220;indeterminate value&#8221;</td>
- <td class="svn" align="center">SVN</td>
+ <td class="svn" align="center">Clang 4</td>
</tr>
<tr class="open" id="617">
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_active.html#617">617</a></td>
@@ -7093,7 +7093,7 @@ and <I>POD class</I></td>
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_defects.html#1213">1213</a></td>
<td>CD3</td>
<td>Array subscripting and xvalues</td>
- <td class="svn" align="center">SVN</td>
+ <td class="svn" align="center">Clang 4</td>
</tr>
<tr id="1214">
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_defects.html#1214">1214</a></td>
@@ -7585,7 +7585,7 @@ and <I>POD class</I></td>
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_defects.html#1295">1295</a></td>
<td>CD3</td>
<td>Binding a reference to an rvalue bit-field</td>
- <td class="svn" align="center">SVN</td>
+ <td class="svn" align="center">Clang 4</td>
</tr>
<tr id="1296">
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_defects.html#1296">1296</a></td>
@@ -7795,7 +7795,7 @@ and <I>POD class</I></td>
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_defects.html#1330">1330</a></td>
<td>CD3</td>
<td>Delayed instantiation of <TT>noexcept</TT> specifiers</td>
- <td class="svn" align="center">SVN (C++11 onwards)</td>
+ <td class="svn" align="center">Clang 4 (C++11 onwards)</td>
</tr>
<tr class="open" id="1331">
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_closed.html#1331">1331</a></td>
@@ -8143,7 +8143,7 @@ and <I>POD class</I></td>
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_defects.html#1388">1388</a></td>
<td>CD3</td>
<td>Missing non-deduced context following a function parameter pack</td>
- <td class="svn" align="center">SVN</td>
+ <td class="svn" align="center">Clang 4</td>
</tr>
<tr id="1389">
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_closed.html#1389">1389</a></td>
@@ -8785,7 +8785,7 @@ and <I>POD class</I></td>
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_defects.html#1495">1495</a></td>
<td>CD3</td>
<td>Partial specialization of variadic class template</td>
- <td class="svn" align="center">SVN</td>
+ <td class="svn" align="center">Clang 4</td>
</tr>
<tr id="1496">
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_defects.html#1496">1496</a></td>
@@ -8887,7 +8887,7 @@ and <I>POD class</I></td>
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_defects.html#1512">1512</a></td>
<td>CD3</td>
<td>Pointer comparison vs qualification conversions</td>
- <td class="svn" align="center">SVN</td>
+ <td class="svn" align="center">Clang 4</td>
</tr>
<tr class="open" id="1513">
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_active.html#1513">1513</a></td>
@@ -8923,7 +8923,7 @@ and <I>POD class</I></td>
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_defects.html#1518">1518</a></td>
<td>DRWP</td>
<td>Explicit default constructors and copy-list-initialization</td>
- <td class="svn" align="center">SVN</td>
+ <td class="svn" align="center">Clang 4</td>
</tr>
<tr id="1519">
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_closed.html#1519">1519</a></td>
@@ -9733,7 +9733,7 @@ and <I>POD class</I></td>
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_defects.html#1653">1653</a></td>
<td>WP</td>
<td>Removing deprecated increment of <TT>bool</TT></td>
- <td class="svn" align="center">SVN (C++17 onwards)</td>
+ <td class="svn" align="center">Clang 4 (C++17 onwards)</td>
</tr>
<tr id="1654">
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_closed.html#1654">1654</a></td>
@@ -11161,7 +11161,7 @@ and <I>POD class</I></td>
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_defects.html#1891">1891</a></td>
<td>DRWP</td>
<td>Move constructor/assignment for closure class</td>
- <td class="svn" align="center">SVN</td>
+ <td class="svn" align="center">Clang 4</td>
</tr>
<tr id="1892">
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/cwg_defects.html#1892">1892</a></td>
diff --git a/www/cxx_status.html b/www/cxx_status.html
index c1dc78cf56b06..e55f45fffe5ce 100644
--- a/www/cxx_status.html
+++ b/www/cxx_status.html
@@ -25,7 +25,7 @@
<!--*************************************************************************-->
<h1>C++ Support in Clang</h1>
<!--*************************************************************************-->
-<p>Last updated: $Date: 2016-12-31 22:41:23 +0100 (Sat, 31 Dec 2016) $</p>
+<p>Last updated: $Date: 2017-01-13 17:52:17 +0100 (Fri, 13 Jan 2017) $</p>
<p>Clang fully implements all published ISO C++ standards (<a
href="#cxx98">C++98 / C++03</a>, <a
@@ -612,7 +612,7 @@ as the draft C++1z standard evolves.
<tr>
<td>Make exception specifications part of the type system</td>
<td><a href="http://www.open-std.org/jtc1/sc22/wg21/docs/papers/2015/p0012r1.html">P0012R1</a></td>
- <td class="svn" align="center">SVN</td>
+ <td class="svn" align="center">Clang 4</td>
</tr>
<tr>
<td><tt>__has_include</tt> in preprocessor conditionals</td>
@@ -679,7 +679,7 @@ as the draft C++1z standard evolves.
<tr>
<td>Dynamic memory allocation for over-aligned data</td>
<td><a href="http://wg21.link/p0035r4">P0035R4</a></td>
- <td class="svn" align="center">SVN</td>
+ <td class="svn" align="center">Clang 4</td>
</tr>
<tr>
<td>Template argument deduction for class templates</td>
@@ -689,17 +689,17 @@ as the draft C++1z standard evolves.
<tr>
<td>Non-type template parameters with <tt>auto</tt> type</td>
<td><a href="http://wg21.link/p0127r2">P0127R2</a></td>
- <td class="svn" align="center">SVN</td>
+ <td class="svn" align="center">Clang 4</td>
</tr>
<tr>
<td>Guaranteed copy elision</td>
<td><a href="http://wg21.link/p0135r1">P0135R1</a></td>
- <td class="svn" align="center">SVN</td>
+ <td class="svn" align="center">Clang 4</td>
</tr>
<tr>
<td rowspan=2>Stricter expression evaluation order</td>
<td><a href="http://wg21.link/p0145r3">P0145R3</a></td>
- <td class="svn" align="center" rowspan=2>SVN <a href="#p0145">(10)</a></td>
+ <td class="svn" align="center" rowspan=2>Clang 4 <a href="#p0145">(10)</a></td>
</tr>
<tr>
<td><a href="http://wg21.link/p0400r0">P0400R0</a></td>
@@ -722,7 +722,7 @@ as the draft C++1z standard evolves.
<tr>
<td>Structured bindings</td>
<td><a href="http://wg21.link/p0217r3">P0217R3</a></td>
- <td class="svn" align="center">SVN</td>
+ <td class="svn" align="center">Clang 4</td>
</tr>
<tr>
<td>Separate variable and condition for <tt>if</tt> and <tt>switch</tt></td>
@@ -738,12 +738,12 @@ as the draft C++1z standard evolves.
<tr>
<td>Removing deprecated dynamic exception specifications</td>
<td><a href="http://wg21.link/p0003r5">P0003R5</a></td>
- <td class="svn" align="center">SVN</td>
+ <td class="svn" align="center">Clang 4</td>
</tr>
<tr>
<td>Pack expansions in <em>using-declarations</em></td>
<td><a href="http://wg21.link/p0195r2">P0195R2</a></td>
- <td class="svn" align="center">SVN</td>
+ <td class="svn" align="center">Clang 4</td>
</tr>
</table>
@@ -765,10 +765,10 @@ reverse construction order in that ABI.
</span><br>
<span id="p0522">(12): Despite being the the resolution to a Defect Report, this
feature is disabled by default in all language versions, and can be enabled
-explicitly with the flag <tt>-frelaxed-template-template-args</tt>. The change
-to the standard lacks a corresponding change for template partial ordering,
-resulting in ambiguity errors for reasonable and previously-valid code. This
-issue is expected to be rectified soon.
+explicitly with the flag <tt>-frelaxed-template-template-args</tt> in Clang 4.
+The change to the standard lacks a corresponding change for template partial
+ordering, resulting in ambiguity errors for reasonable and previously-valid
+code. This issue is expected to be rectified soon.
</span>
</p>
</details>
@@ -802,8 +802,8 @@ and library features that are not part of standard C++.</p>
</td>
</tr>
<tr>
- <td class="svn" align="center">
- SVN (<a href="http://wg21.link/p0096r3">P0096R3</a>)</a>
+ <td class="full" align="center">
+ Clang 4 (<a href="http://wg21.link/p0096r3">P0096R3</a>)</a>
</td>
</tr>
<!-- FIXME: Implement latest recommendations.
diff --git a/www/index.html b/www/index.html
index 62354fe60c862..9a4050121d82a 100644
--- a/www/index.html
+++ b/www/index.html
@@ -15,10 +15,10 @@
<h1>clang: a C language family frontend for LLVM</h1>
<!--*********************************************************************-->
- <p>The goal of the Clang project is to create a new C, C++, Objective C and
- Objective C++ front-end for the <a href="http://www.llvm.org/">LLVM</a>
- compiler. You can <a href="get_started.html">get and build</a> the source
- today.</p>
+ <p>The goal of the Clang project is to create a new C based language
+ front-end: C, C++, Objective C/C++, OpenCL C and others for the
+ <a href="http://www.llvm.org/">LLVM</a> compiler. You can
+ <a href="get_started.html">get and build</a> the source today.</p>
<!--=====================================================================-->
<h2 id="goals">Features and Goals</h2>
diff --git a/www/make_cxx_dr_status b/www/make_cxx_dr_status
index 48f524208a4c0..8a05d41c08b50 100755
--- a/www/make_cxx_dr_status
+++ b/www/make_cxx_dr_status
@@ -108,10 +108,13 @@ def availability(issue):
if status == 'unknown':
avail = 'Unknown'
avail_style = ' class="none"'
- elif status == '4.0':
+ elif status == '5':
avail = 'SVN'
avail_style = ' class="svn"'
- elif re.match('^[0-9]+\.', status):
+ elif status == '4':
+ avail = 'Clang 4'
+ avail_style = ' class="svn"'
+ elif re.match('^[0-9]+\.?[0-9]*', status):
avail = 'Clang %s' % status
avail_style = ' class="full"'
elif status == 'yes':