vendor/wpa/2.6

304 files changed, 20753 insertions, 5385 deletions

diff --git a/src/ap/accounting.c b/src/ap/accounting.c
index a096de4d3e514..0aacc3c95b084 100644
--- a/src/ap/accounting.c
+++ b/src/ap/accounting.c
@@ -1,6 +1,6 @@
 /*
  * hostapd / RADIUS Accounting
- * Copyright (c) 2002-2009, 2012, Jouni Malinen <j@w1.fi>
+ * Copyright (c) 2002-2009, 2012-2015, Jouni Malinen <j@w1.fi>
  *
  * This software may be distributed under the terms of the BSD license.
  * See README for more details.
@@ -41,6 +41,7 @@ static struct radius_msg * accounting_msg(struct hostapd_data *hapd,
 	size_t len;
 	int i;
 	struct wpabuf *b;
+	struct os_time now;
 
 	msg = radius_msg_new(RADIUS_CODE_ACCOUNTING_REQUEST,
 			     radius_client_get_id(hapd->radius));
@@ -49,44 +50,24 @@ static struct radius_msg * accounting_msg(struct hostapd_data *hapd,
 		return NULL;
 	}
 
-	if (sta) {
-		radius_msg_make_authenticator(msg, (u8 *) sta, sizeof(*sta));
-
-		if ((hapd->conf->wpa & 2) &&
-		    !hapd->conf->disable_pmksa_caching &&
-		    sta->eapol_sm && sta->eapol_sm->acct_multi_session_id_hi) {
-			os_snprintf(buf, sizeof(buf), "%08X+%08X",
-				    sta->eapol_sm->acct_multi_session_id_hi,
-				    sta->eapol_sm->acct_multi_session_id_lo);
-			if (!radius_msg_add_attr(
-				    msg, RADIUS_ATTR_ACCT_MULTI_SESSION_ID,
-				    (u8 *) buf, os_strlen(buf))) {
-				wpa_printf(MSG_INFO,
-					   "Could not add Acct-Multi-Session-Id");
-				goto fail;
-			}
-		}
-	} else {
-		radius_msg_make_authenticator(msg, (u8 *) hapd, sizeof(*hapd));
-	}
-
 	if (!radius_msg_add_attr_int32(msg, RADIUS_ATTR_ACCT_STATUS_TYPE,
 				       status_type)) {
 		wpa_printf(MSG_INFO, "Could not add Acct-Status-Type");
 		goto fail;
 	}
 
-	if (!hostapd_config_get_radius_attr(hapd->conf->radius_acct_req_attr,
-					    RADIUS_ATTR_ACCT_AUTHENTIC) &&
-	    !radius_msg_add_attr_int32(msg, RADIUS_ATTR_ACCT_AUTHENTIC,
-				       hapd->conf->ieee802_1x ?
-				       RADIUS_ACCT_AUTHENTIC_RADIUS :
-				       RADIUS_ACCT_AUTHENTIC_LOCAL)) {
-		wpa_printf(MSG_INFO, "Could not add Acct-Authentic");
-		goto fail;
-	}
-
 	if (sta) {
+		if (!hostapd_config_get_radius_attr(
+			    hapd->conf->radius_acct_req_attr,
+			    RADIUS_ATTR_ACCT_AUTHENTIC) &&
+		    !radius_msg_add_attr_int32(msg, RADIUS_ATTR_ACCT_AUTHENTIC,
+					       hapd->conf->ieee802_1x ?
+					       RADIUS_ACCT_AUTHENTIC_RADIUS :
+					       RADIUS_ACCT_AUTHENTIC_LOCAL)) {
+			wpa_printf(MSG_INFO, "Could not add Acct-Authentic");
+			goto fail;
+		}
+
 		/* Use 802.1X identity if available */
 		val = ieee802_1x_get_identity(sta->eapol_sm, &len);
 
@@ -147,6 +128,32 @@ static struct radius_msg * accounting_msg(struct hostapd_data *hapd,
 			wpa_printf(MSG_ERROR, "Could not add CUI from ACL");
 			goto fail;
 		}
+
+		if (sta->ipaddr &&
+		    !radius_msg_add_attr_int32(msg,
+					       RADIUS_ATTR_FRAMED_IP_ADDRESS,
+					       be_to_host32(sta->ipaddr))) {
+			wpa_printf(MSG_ERROR,
+				   "Could not add Framed-IP-Address");
+			goto fail;
+		}
+	}
+
+	os_get_time(&now);
+	if (now.sec > 1000000000 &&
+	    !radius_msg_add_attr_int32(msg, RADIUS_ATTR_EVENT_TIMESTAMP,
+				       now.sec)) {
+		wpa_printf(MSG_INFO, "Could not add Event-Timestamp");
+		goto fail;
+	}
+
+	/*
+	 * Add Acct-Delay-Time with zero value for the first transmission. This
+	 * will be updated within radius_client.c when retransmitting the frame.
+	 */
+	if (!radius_msg_add_attr_int32(msg, RADIUS_ATTR_ACCT_DELAY_TIME, 0)) {
+		wpa_printf(MSG_INFO, "Could not add Acct-Delay-Time");
+		goto fail;
 	}
 
 	return msg;
@@ -164,19 +171,25 @@ static int accounting_sta_update_stats(struct hostapd_data *hapd,
 	if (hostapd_drv_read_sta_data(hapd, data, sta->addr))
 		return -1;
 
-	if (sta->last_rx_bytes > data->rx_bytes)
-		sta->acct_input_gigawords++;
-	if (sta->last_tx_bytes > data->tx_bytes)
-		sta->acct_output_gigawords++;
-	sta->last_rx_bytes = data->rx_bytes;
-	sta->last_tx_bytes = data->tx_bytes;
+	if (!data->bytes_64bit) {
+		/* Extend 32-bit counters from the driver to 64-bit counters */
+		if (sta->last_rx_bytes_lo > data->rx_bytes)
+			sta->last_rx_bytes_hi++;
+		sta->last_rx_bytes_lo = data->rx_bytes;
+
+		if (sta->last_tx_bytes_lo > data->tx_bytes)
+			sta->last_tx_bytes_hi++;
+		sta->last_tx_bytes_lo = data->tx_bytes;
+	}
 
 	hostapd_logger(hapd, sta->addr, HOSTAPD_MODULE_RADIUS,
-		       HOSTAPD_LEVEL_DEBUG, "updated TX/RX stats: "
-		       "Acct-Input-Octets=%lu Acct-Input-Gigawords=%u "
-		       "Acct-Output-Octets=%lu Acct-Output-Gigawords=%u",
-		       sta->last_rx_bytes, sta->acct_input_gigawords,
-		       sta->last_tx_bytes, sta->acct_output_gigawords);
+		       HOSTAPD_LEVEL_DEBUG,
+		       "updated TX/RX stats: rx_bytes=%llu [%u:%u] tx_bytes=%llu [%u:%u] bytes_64bit=%d",
+		       data->rx_bytes, sta->last_rx_bytes_hi,
+		       sta->last_rx_bytes_lo,
+		       data->tx_bytes, sta->last_tx_bytes_hi,
+		       sta->last_tx_bytes_lo,
+		       data->bytes_64bit);
 
 	return 0;
 }
@@ -217,12 +230,14 @@ void accounting_sta_start(struct hostapd_data *hapd, struct sta_info *sta)
 
 	hostapd_logger(hapd, sta->addr, HOSTAPD_MODULE_RADIUS,
 		       HOSTAPD_LEVEL_INFO,
-		       "starting accounting session %08X-%08X",
-		       sta->acct_session_id_hi, sta->acct_session_id_lo);
+		       "starting accounting session %016llX",
+		       (unsigned long long) sta->acct_session_id);
 
 	os_get_reltime(&sta->acct_session_start);
-	sta->last_rx_bytes = sta->last_tx_bytes = 0;
-	sta->acct_input_gigawords = sta->acct_output_gigawords = 0;
+	sta->last_rx_bytes_hi = 0;
+	sta->last_rx_bytes_lo = 0;
+	sta->last_tx_bytes_hi = 0;
+	sta->last_tx_bytes_lo = 0;
 	hostapd_drv_sta_clear_stats(hapd, sta->addr);
 
 	if (!hapd->conf->radius->acct_server)
@@ -251,8 +266,7 @@ static void accounting_sta_report(struct hostapd_data *hapd,
 	int cause = sta->acct_terminate_cause;
 	struct hostap_sta_driver_data data;
 	struct os_reltime now_r, diff;
-	struct os_time now;
-	u32 gigawords;
+	u64 bytes;
 
 	if (!hapd->conf->radius->acct_server)
 		return;
@@ -266,7 +280,6 @@ static void accounting_sta_report(struct hostapd_data *hapd,
 	}
 
 	os_get_reltime(&now_r);
-	os_get_time(&now);
 	os_reltime_sub(&now_r, &sta->acct_session_start, &diff);
 	if (!radius_msg_add_attr_int32(msg, RADIUS_ATTR_ACCT_SESSION_TIME,
 				       diff.sec)) {
@@ -287,48 +300,42 @@ static void accounting_sta_report(struct hostapd_data *hapd,
 			wpa_printf(MSG_INFO, "Could not add Acct-Output-Packets");
 			goto fail;
 		}
+		if (data.bytes_64bit)
+			bytes = data.rx_bytes;
+		else
+			bytes = ((u64) sta->last_rx_bytes_hi << 32) |
+				sta->last_rx_bytes_lo;
 		if (!radius_msg_add_attr_int32(msg,
 					       RADIUS_ATTR_ACCT_INPUT_OCTETS,
-					       data.rx_bytes)) {
+					       (u32) bytes)) {
 			wpa_printf(MSG_INFO, "Could not add Acct-Input-Octets");
 			goto fail;
 		}
-		gigawords = sta->acct_input_gigawords;
-#if __WORDSIZE == 64
-		gigawords += data.rx_bytes >> 32;
-#endif
-		if (gigawords &&
-		    !radius_msg_add_attr_int32(
-			    msg, RADIUS_ATTR_ACCT_INPUT_GIGAWORDS,
-			    gigawords)) {
+		if (!radius_msg_add_attr_int32(msg,
+					       RADIUS_ATTR_ACCT_INPUT_GIGAWORDS,
+					       (u32) (bytes >> 32))) {
 			wpa_printf(MSG_INFO, "Could not add Acct-Input-Gigawords");
 			goto fail;
 		}
+		if (data.bytes_64bit)
+			bytes = data.tx_bytes;
+		else
+			bytes = ((u64) sta->last_tx_bytes_hi << 32) |
+				sta->last_tx_bytes_lo;
 		if (!radius_msg_add_attr_int32(msg,
 					       RADIUS_ATTR_ACCT_OUTPUT_OCTETS,
-					       data.tx_bytes)) {
+					       (u32) bytes)) {
 			wpa_printf(MSG_INFO, "Could not add Acct-Output-Octets");
 			goto fail;
 		}
-		gigawords = sta->acct_output_gigawords;
-#if __WORDSIZE == 64
-		gigawords += data.tx_bytes >> 32;
-#endif
-		if (gigawords &&
-		    !radius_msg_add_attr_int32(
-			    msg, RADIUS_ATTR_ACCT_OUTPUT_GIGAWORDS,
-			    gigawords)) {
+		if (!radius_msg_add_attr_int32(msg,
+					       RADIUS_ATTR_ACCT_OUTPUT_GIGAWORDS,
+					       (u32) (bytes >> 32))) {
 			wpa_printf(MSG_INFO, "Could not add Acct-Output-Gigawords");
 			goto fail;
 		}
 	}
 
-	if (!radius_msg_add_attr_int32(msg, RADIUS_ATTR_EVENT_TIMESTAMP,
-				       now.sec)) {
-		wpa_printf(MSG_INFO, "Could not add Event-Timestamp");
-		goto fail;
-	}
-
 	if (eloop_terminated())
 		cause = RADIUS_ACCT_TERMINATE_CAUSE_ADMIN_REBOOT;
 
@@ -375,22 +382,17 @@ void accounting_sta_stop(struct hostapd_data *hapd, struct sta_info *sta)
 		eloop_cancel_timeout(accounting_interim_update, hapd, sta);
 		hostapd_logger(hapd, sta->addr, HOSTAPD_MODULE_RADIUS,
 			       HOSTAPD_LEVEL_INFO,
-			       "stopped accounting session %08X-%08X",
-			       sta->acct_session_id_hi,
-			       sta->acct_session_id_lo);
+			       "stopped accounting session %016llX",
+			       (unsigned long long) sta->acct_session_id);
 		sta->acct_session_started = 0;
 	}
 }
 
 
-void accounting_sta_get_id(struct hostapd_data *hapd,
-				  struct sta_info *sta)
+int accounting_sta_get_id(struct hostapd_data *hapd, struct sta_info *sta)
 {
-	sta->acct_session_id_lo = hapd->acct_session_id_lo++;
-	if (hapd->acct_session_id_lo == 0) {
-		hapd->acct_session_id_hi++;
-	}
-	sta->acct_session_id_hi = hapd->acct_session_id_hi;
+	return radius_gen_session_id((u8 *) &sta->acct_session_id,
+				     sizeof(sta->acct_session_id));
 }
 
 
@@ -437,12 +439,14 @@ static void accounting_report_state(struct hostapd_data *hapd, int on)
 	if (!msg)
 		return;
 
-	if (!radius_msg_add_attr_int32(msg, RADIUS_ATTR_ACCT_TERMINATE_CAUSE,
-				       RADIUS_ACCT_TERMINATE_CAUSE_NAS_REBOOT))
-	{
-		wpa_printf(MSG_INFO, "Could not add Acct-Terminate-Cause");
-		radius_msg_free(msg);
-		return;
+	if (hapd->acct_session_id) {
+		char buf[20];
+
+		os_snprintf(buf, sizeof(buf), "%016llX",
+			    (unsigned long long) hapd->acct_session_id);
+		if (!radius_msg_add_attr(msg, RADIUS_ATTR_ACCT_SESSION_ID,
+					 (u8 *) buf, os_strlen(buf)))
+			wpa_printf(MSG_ERROR, "Could not add Acct-Session-Id");
 	}
 
 	if (radius_client_send(hapd->radius, msg, RADIUS_ACCT, NULL) < 0)
@@ -450,6 +454,63 @@ static void accounting_report_state(struct hostapd_data *hapd, int on)
 }
 
 
+static void accounting_interim_error_cb(const u8 *addr, void *ctx)
+{
+	struct hostapd_data *hapd = ctx;
+	struct sta_info *sta;
+	unsigned int i, wait_time;
+	int res;
+
+	sta = ap_get_sta(hapd, addr);
+	if (!sta)
+		return;
+	sta->acct_interim_errors++;
+	if (sta->acct_interim_errors > 10 /* RADIUS_CLIENT_MAX_RETRIES */) {
+		wpa_printf(MSG_DEBUG,
+			   "Interim RADIUS accounting update failed for " MACSTR
+			   " - too many errors, abandon this interim accounting update",
+			   MAC2STR(addr));
+		sta->acct_interim_errors = 0;
+		/* Next update will be tried after normal update interval */
+		return;
+	}
+
+	/*
+	 * Use a shorter update interval as an improved retransmission mechanism
+	 * for failed interim accounting updates. This allows the statistics to
+	 * be updated for each retransmission.
+	 *
+	 * RADIUS client code has already waited RADIUS_CLIENT_FIRST_WAIT.
+	 * Schedule the first retry attempt immediately and every following one
+	 * with exponential backoff.
+	 */
+	if (sta->acct_interim_errors == 1) {
+		wait_time = 0;
+	} else {
+		wait_time = 3; /* RADIUS_CLIENT_FIRST_WAIT */
+		for (i = 1; i < sta->acct_interim_errors; i++)
+			wait_time *= 2;
+	}
+	res = eloop_deplete_timeout(wait_time, 0, accounting_interim_update,
+				    hapd, sta);
+	if (res == 1)
+		wpa_printf(MSG_DEBUG,
+			   "Interim RADIUS accounting update failed for " MACSTR
+			   " (error count: %u) - schedule next update in %u seconds",
+			   MAC2STR(addr), sta->acct_interim_errors, wait_time);
+	else if (res == 0)
+		wpa_printf(MSG_DEBUG,
+			   "Interim RADIUS accounting update failed for " MACSTR
+			   " (error count: %u)", MAC2STR(addr),
+			   sta->acct_interim_errors);
+	else
+		wpa_printf(MSG_DEBUG,
+			   "Interim RADIUS accounting update failed for " MACSTR
+			   " (error count: %u) - no timer found", MAC2STR(addr),
+			   sta->acct_interim_errors);
+}
+
+
 /**
  * accounting_init: Initialize accounting
  * @hapd: hostapd BSS data
@@ -457,20 +518,15 @@ static void accounting_report_state(struct hostapd_data *hapd, int on)
  */
 int accounting_init(struct hostapd_data *hapd)
 {
-	struct os_time now;
-
-	/* Acct-Session-Id should be unique over reboots. Using a random number
-	 * is preferred. If that is not available, take the current time. Mix
-	 * in microseconds to make this more likely to be unique. */
-	os_get_time(&now);
-	if (os_get_random((u8 *) &hapd->acct_session_id_hi,
-			  sizeof(hapd->acct_session_id_hi)) < 0)
-		hapd->acct_session_id_hi = now.sec;
-	hapd->acct_session_id_hi ^= now.usec;
+	if (radius_gen_session_id((u8 *) &hapd->acct_session_id,
+				  sizeof(hapd->acct_session_id)) < 0)
+		return -1;
 
 	if (radius_client_register(hapd->radius, RADIUS_ACCT,
 				   accounting_receive, hapd))
 		return -1;
+	radius_client_set_interim_error_cb(hapd->radius,
+					   accounting_interim_error_cb, hapd);
 
 	accounting_report_state(hapd, 1);
 
diff --git a/src/ap/accounting.h b/src/ap/accounting.h
index dcc54ee94b549..de5a33f3c7ce5 100644
--- a/src/ap/accounting.h
+++ b/src/ap/accounting.h
@@ -10,9 +10,10 @@
 #define ACCOUNTING_H
 
 #ifdef CONFIG_NO_ACCOUNTING
-static inline void accounting_sta_get_id(struct hostapd_data *hapd,
-					 struct sta_info *sta)
+static inline int accounting_sta_get_id(struct hostapd_data *hapd,
+					struct sta_info *sta)
 {
+	return 0;
 }
 
 static inline void accounting_sta_start(struct hostapd_data *hapd,
@@ -34,7 +35,7 @@ static inline void accounting_deinit(struct hostapd_data *hapd)
 {
 }
 #else /* CONFIG_NO_ACCOUNTING */
-void accounting_sta_get_id(struct hostapd_data *hapd, struct sta_info *sta);
+int accounting_sta_get_id(struct hostapd_data *hapd, struct sta_info *sta);
 void accounting_sta_start(struct hostapd_data *hapd, struct sta_info *sta);
 void accounting_sta_stop(struct hostapd_data *hapd, struct sta_info *sta);
 int accounting_init(struct hostapd_data *hapd);
diff --git a/src/ap/acs.c b/src/ap/acs.c
index 03d797fe8836a..5e8380535854f 100644
--- a/src/ap/acs.c
+++ b/src/ap/acs.c
@@ -599,8 +599,7 @@ acs_find_ideal_chan(struct hostapd_iface *iface)
 	wpa_printf(MSG_DEBUG, "ACS: Survey analysis for selected bandwidth %d MHz",
 		   n_chans == 1 ? 20 :
 		   n_chans == 2 ? 40 :
-		   n_chans == 4 ? 80 :
-		   -1);
+		   80);
 
 	for (i = 0; i < iface->current_mode->num_channels; i++) {
 		double total_weight;
@@ -933,6 +932,9 @@ enum hostapd_chan_status acs_init(struct hostapd_iface *iface)
 		return HOSTAPD_CHAN_ACS;
 	}
 
+	if (!iface->current_mode)
+		return HOSTAPD_CHAN_INVALID;
+
 	acs_cleanup(iface);
 
 	err = acs_request_scan(iface);
diff --git a/src/ap/ap_config.c b/src/ap/ap_config.c
index 9a96e50b7385b..228de2baf9462 100644
--- a/src/ap/ap_config.c
+++ b/src/ap/ap_config.c
@@ -38,6 +38,8 @@ static void hostapd_config_free_vlan(struct hostapd_bss_config *bss)
 
 void hostapd_config_defaults_bss(struct hostapd_bss_config *bss)
 {
+	dl_list_init(&bss->anqp_elem);
+
 	bss->logger_syslog_level = HOSTAPD_LEVEL_INFO;
 	bss->logger_stdout_level = HOSTAPD_LEVEL_INFO;
 	bss->logger_syslog = (unsigned int) -1;
@@ -63,6 +65,7 @@ void hostapd_config_defaults_bss(struct hostapd_bss_config *bss)
 	bss->dtim_period = 2;
 
 	bss->radius_server_auth_port = 1812;
+	bss->eap_sim_db_timeout = 1;
 	bss->ap_max_inactivity = AP_MAX_INACTIVITY;
 	bss->eapol_version = EAPOL_VERSION;
 
@@ -180,6 +183,7 @@ struct hostapd_config * hostapd_config_defaults(void)
 	conf->ignore_assoc_probability = 0.0;
 	conf->ignore_reassoc_probability = 0.0;
 	conf->corrupt_gtk_rekey_mic_probability = 0.0;
+	conf->ecsa_ie_only = 0;
 #endif /* CONFIG_TESTING_OPTIONS */
 
 	conf->acs = 0;
@@ -198,13 +202,6 @@ int hostapd_mac_comp(const void *a, const void *b)
 }
 
 
-int hostapd_mac_comp_empty(const void *a)
-{
-	macaddr empty = { 0 };
-	return os_memcmp(a, empty, sizeof(macaddr));
-}
-
-
 static int hostapd_config_read_wpa_psk(const char *fname,
 				       struct hostapd_ssid *ssid)
 {
@@ -410,6 +407,19 @@ void hostapd_config_clear_wpa_psk(struct hostapd_wpa_psk **l)
 }
 
 
+static void hostapd_config_free_anqp_elem(struct hostapd_bss_config *conf)
+{
+	struct anqp_element *elem;
+
+	while ((elem = dl_list_first(&conf->anqp_elem, struct anqp_element,
+				     list))) {
+		dl_list_del(&elem->list);
+		wpabuf_free(elem->payload);
+		os_free(elem);
+	}
+}
+
+
 void hostapd_config_free_bss(struct hostapd_bss_config *conf)
 {
 	struct hostapd_eap_user *user, *prev_user;
@@ -454,6 +464,7 @@ void hostapd_config_free_bss(struct hostapd_bss_config *conf)
 	os_free(conf->private_key);
 	os_free(conf->private_key_passwd);
 	os_free(conf->ocsp_stapling_response);
+	os_free(conf->ocsp_stapling_response_multi);
 	os_free(conf->dh_file);
 	os_free(conf->openssl_ciphers);
 	os_free(conf->pac_opaque_encr_key);
@@ -523,6 +534,7 @@ void hostapd_config_free_bss(struct hostapd_bss_config *conf)
 	os_free(conf->network_auth_type);
 	os_free(conf->anqp_3gpp_cell_net);
 	os_free(conf->domain_name);
+	hostapd_config_free_anqp_elem(conf);
 
 #ifdef CONFIG_RADIUS_TEST
 	os_free(conf->dump_msk_file);
@@ -555,6 +567,7 @@ void hostapd_config_free_bss(struct hostapd_bss_config *conf)
 #endif /* CONFIG_HS20 */
 
 	wpabuf_free(conf->vendor_elements);
+	wpabuf_free(conf->assocresp_elements);
 
 	os_free(conf->sae_groups);
 
@@ -594,6 +607,8 @@ void hostapd_config_free(struct hostapd_config *conf)
 #ifdef CONFIG_ACS
 	os_free(conf->acs_chan_bias);
 #endif /* CONFIG_ACS */
+	wpabuf_free(conf->lci);
+	wpabuf_free(conf->civic);
 
 	os_free(conf);
 }
@@ -610,7 +625,7 @@ void hostapd_config_free(struct hostapd_config *conf)
  * Perform a binary search for given MAC address from a pre-sorted list.
  */
 int hostapd_maclist_found(struct mac_acl_entry *list, int num_entries,
-			  const u8 *addr, int *vlan_id)
+			  const u8 *addr, struct vlan_description *vlan_id)
 {
 	int start, end, middle, res;
 
@@ -650,11 +665,26 @@ int hostapd_rate_found(int *list, int rate)
 }
 
 
-int hostapd_vlan_id_valid(struct hostapd_vlan *vlan, int vlan_id)
+int hostapd_vlan_valid(struct hostapd_vlan *vlan,
+		       struct vlan_description *vlan_desc)
 {
 	struct hostapd_vlan *v = vlan;
+	int i;
+
+	if (!vlan_desc->notempty || vlan_desc->untagged < 0 ||
+	    vlan_desc->untagged > MAX_VLAN_ID)
+		return 0;
+	for (i = 0; i < MAX_NUM_TAGGED_VLAN; i++) {
+		if (vlan_desc->tagged[i] < 0 ||
+		    vlan_desc->tagged[i] > MAX_VLAN_ID)
+			return 0;
+	}
+	if (!vlan_desc->untagged && !vlan_desc->tagged[0])
+		return 0;
+
 	while (v) {
-		if (v->vlan_id == vlan_id || v->vlan_id == VLAN_ID_WILDCARD)
+		if (!vlan_compare(&v->vlan_desc, vlan_desc) ||
+		    v->vlan_id == VLAN_ID_WILDCARD)
 			return 1;
 		v = v->next;
 	}
@@ -756,7 +786,7 @@ static int hostapd_config_check_bss(struct hostapd_bss_config *bss,
 		return -1;
 	}
 
-	if (full_config && hostapd_mac_comp_empty(bss->bssid) != 0) {
+	if (full_config && !is_zero_ether_addr(bss->bssid)) {
 		size_t i;
 
 		for (i = 0; i < conf->num_bss; i++) {
@@ -811,6 +841,15 @@ static int hostapd_config_check_bss(struct hostapd_bss_config *bss,
 	}
 #endif /* CONFIG_IEEE80211N */
 
+#ifdef CONFIG_IEEE80211AC
+	if (full_config && conf->ieee80211ac &&
+	    bss->ssid.security_policy == SECURITY_STATIC_WEP) {
+		bss->disable_11ac = 1;
+		wpa_printf(MSG_ERROR,
+			   "VHT (IEEE 802.11ac) with WEP is not allowed, disabling VHT capabilities");
+	}
+#endif /* CONFIG_IEEE80211AC */
+
 #ifdef CONFIG_WPS
 	if (full_config && bss->wps_state && bss->ignore_broadcast_ssid) {
 		wpa_printf(MSG_INFO, "WPS: ignore_broadcast_ssid "
@@ -847,6 +886,15 @@ static int hostapd_config_check_bss(struct hostapd_bss_config *bss,
 	}
 #endif /* CONFIG_HS20 */
 
+#ifdef CONFIG_MBO
+	if (full_config && bss->mbo_enabled && (bss->wpa & 2) &&
+	    bss->ieee80211w == NO_MGMT_FRAME_PROTECTION) {
+		wpa_printf(MSG_ERROR,
+			   "MBO: PMF needs to be enabled whenever using WPA2 with MBO");
+		return -1;
+	}
+#endif /* CONFIG_MBO */
+
 	return 0;
 }
 
diff --git a/src/ap/ap_config.h b/src/ap/ap_config.h
index de470a969b500..8c8f7e286bdae 100644
--- a/src/ap/ap_config.h
+++ b/src/ap/ap_config.h
@@ -10,12 +10,14 @@
 #define HOSTAPD_CONFIG_H
 
 #include "common/defs.h"
+#include "utils/list.h"
 #include "ip_addr.h"
 #include "common/wpa_common.h"
 #include "common/ieee802_11_defs.h"
 #include "common/ieee802_11_common.h"
 #include "wps/wps.h"
 #include "fst/fst.h"
+#include "vlan.h"
 
 /**
  * mesh_conf - local MBSS state and settings
@@ -39,6 +41,10 @@ struct mesh_conf {
 #define MESH_CONF_SEC_AUTH BIT(1)
 #define MESH_CONF_SEC_AMPE BIT(2)
 	unsigned int security;
+	enum mfp_options ieee80211w;
+	unsigned int pairwise_cipher;
+	unsigned int group_cipher;
+	unsigned int mgmt_group_cipher;
 	int dot11MeshMaxRetries;
 	int dot11MeshRetryTimeout; /* msec */
 	int dot11MeshConfirmTimeout; /* msec */
@@ -52,7 +58,7 @@ typedef u8 macaddr[ETH_ALEN];
 
 struct mac_acl_entry {
 	macaddr addr;
-	int vlan_id;
+	struct vlan_description vlan_id;
 };
 
 struct hostapd_radius_servers;
@@ -102,6 +108,7 @@ struct hostapd_ssid {
 #define DYNAMIC_VLAN_NAMING_WITH_DEVICE 1
 #define DYNAMIC_VLAN_NAMING_END 2
 	int vlan_naming;
+	int per_sta_vif;
 #ifdef CONFIG_FULL_DYNAMIC_VLAN
 	char *vlan_tagged_interface;
 #endif /* CONFIG_FULL_DYNAMIC_VLAN */
@@ -113,6 +120,7 @@ struct hostapd_ssid {
 struct hostapd_vlan {
 	struct hostapd_vlan *next;
 	int vlan_id; /* VLAN ID or -1 (VLAN_ID_WILDCARD) for wildcard entry */
+	struct vlan_description vlan_desc;
 	char ifname[IFNAMSIZ + 1];
 	int configured;
 	int dynamic_vlan;
@@ -124,9 +132,14 @@ struct hostapd_vlan {
 };
 
 #define PMK_LEN 32
+#define MIN_PASSPHRASE_LEN 8
+#define MAX_PASSPHRASE_LEN 63
 struct hostapd_sta_wpa_psk_short {
 	struct hostapd_sta_wpa_psk_short *next;
+	unsigned int is_passphrase:1;
 	u8 psk[PMK_LEN];
+	char passphrase[MAX_PASSPHRASE_LEN + 1];
+	int ref; /* (number of references held) - 1 */
 };
 
 struct hostapd_wpa_psk {
@@ -205,6 +218,13 @@ struct hostapd_nai_realm_data {
 	} eap_method[MAX_NAI_EAP_METHODS];
 };
 
+struct anqp_element {
+	struct dl_list list;
+	u16 infoid;
+	struct wpabuf *payload;
+};
+
+
 /**
  * struct hostapd_bss_config - Per-BSS configuration
  */
@@ -231,6 +251,7 @@ struct hostapd_bss_config {
 	struct hostapd_eap_user *eap_user;
 	char *eap_user_sqlite;
 	char *eap_sim_db;
+	unsigned int eap_sim_db_timeout;
 	int eap_server_erp; /* Whether ERP is enabled on internal EAP server */
 	struct hostapd_ip_addr own_ip_addr;
 	char *nas_identifier;
@@ -242,6 +263,7 @@ struct hostapd_bss_config {
 	int radius_das_port;
 	unsigned int radius_das_time_window;
 	int radius_das_require_event_timestamp;
+	int radius_das_require_message_authenticator;
 	struct hostapd_ip_addr radius_das_client_addr;
 	u8 *radius_das_shared_secret;
 	size_t radius_das_shared_secret_len;
@@ -332,6 +354,7 @@ struct hostapd_bss_config {
 	int check_crl;
 	unsigned int tls_session_lifetime;
 	char *ocsp_stapling_response;
+	char *ocsp_stapling_response_multi;
 	char *dh_file;
 	char *openssl_ciphers;
 	u8 *pac_opaque_encr_key;
@@ -358,6 +381,7 @@ struct hostapd_bss_config {
 
 	int ap_max_inactivity;
 	int ignore_broadcast_ssid;
+	int no_probe_resp_if_max_sta;
 
 	int wmm_enabled;
 	int wmm_uapsd;
@@ -481,8 +505,11 @@ struct hostapd_bss_config {
 	unsigned int nai_realm_count;
 	struct hostapd_nai_realm_data *nai_realm_data;
 
+	struct dl_list anqp_elem; /* list of struct anqp_element */
+
 	u16 gas_comeback_delay;
 	int gas_frag_limit;
+	int gas_address3;
 
 	u8 qos_map_set[16 + 2 * 21];
 	unsigned int qos_map_set_len;
@@ -536,6 +563,7 @@ struct hostapd_bss_config {
 #endif /* CONFIG_RADIUS_TEST */
 
 	struct wpabuf *vendor_elements;
+	struct wpabuf *assocresp_elements;
 
 	unsigned int sae_anti_clogging_threshold;
 	int *sae_groups;
@@ -551,12 +579,22 @@ struct hostapd_bss_config {
 #define MESH_ENABLED BIT(0)
 	int mesh;
 
-	int radio_measurements;
+	u8 radio_measurements[RRM_CAPABILITIES_IE_LEN];
 
 	int vendor_vht;
+	int use_sta_nsts;
 
 	char *no_probe_resp_if_seen_on;
 	char *no_auth_if_seen_on;
+
+	int pbss;
+
+#ifdef CONFIG_MBO
+	int mbo_enabled;
+#endif /* CONFIG_MBO */
+
+	int ftm_responder;
+	int ftm_initiator;
 };
 
 
@@ -638,6 +676,9 @@ struct hostapd_config {
 	u8 vht_oper_centr_freq_seg0_idx;
 	u8 vht_oper_centr_freq_seg1_idx;
 
+	/* Use driver-generated interface addresses when adding multiple BSSs */
+	u8 use_driver_iface_addr;
+
 #ifdef CONFIG_FST
 	struct fst_iface_cfg fst_cfg;
 #endif /* CONFIG_FST */
@@ -652,6 +693,7 @@ struct hostapd_config {
 	double ignore_assoc_probability;
 	double ignore_reassoc_probability;
 	double corrupt_gtk_rekey_mic_probability;
+	int ecsa_ie_only;
 #endif /* CONFIG_TESTING_OPTIONS */
 
 #ifdef CONFIG_ACS
@@ -662,11 +704,13 @@ struct hostapd_config {
 	} *acs_chan_bias;
 	unsigned int num_acs_chan_bias;
 #endif /* CONFIG_ACS */
+
+	struct wpabuf *lci;
+	struct wpabuf *civic;
 };
 
 
 int hostapd_mac_comp(const void *a, const void *b);
-int hostapd_mac_comp_empty(const void *a);
 struct hostapd_config * hostapd_config_defaults(void);
 void hostapd_config_defaults_bss(struct hostapd_bss_config *bss);
 void hostapd_config_free_eap_user(struct hostapd_eap_user *user);
@@ -674,13 +718,14 @@ void hostapd_config_clear_wpa_psk(struct hostapd_wpa_psk **p);
 void hostapd_config_free_bss(struct hostapd_bss_config *conf);
 void hostapd_config_free(struct hostapd_config *conf);
 int hostapd_maclist_found(struct mac_acl_entry *list, int num_entries,
-			  const u8 *addr, int *vlan_id);
+			  const u8 *addr, struct vlan_description *vlan_id);
 int hostapd_rate_found(int *list, int rate);
 const u8 * hostapd_get_psk(const struct hostapd_bss_config *conf,
 			   const u8 *addr, const u8 *p2p_dev_addr,
 			   const u8 *prev_psk);
 int hostapd_setup_wpa_psk(struct hostapd_bss_config *conf);
-int hostapd_vlan_id_valid(struct hostapd_vlan *vlan, int vlan_id);
+int hostapd_vlan_valid(struct hostapd_vlan *vlan,
+		       struct vlan_description *vlan_desc);
 const char * hostapd_get_vlan_id_ifname(struct hostapd_vlan *vlan,
 					int vlan_id);
 struct hostapd_radius_attr *
diff --git a/src/ap/ap_drv_ops.c b/src/ap/ap_drv_ops.c
index 6cafcb7493511..f1394654d3a8e 100644
--- a/src/ap/ap_drv_ops.c
+++ b/src/ap/ap_drv_ops.c
@@ -33,10 +33,36 @@ u32 hostapd_sta_flags_to_drv(u32 flags)
 		res |= WPA_STA_SHORT_PREAMBLE;
 	if (flags & WLAN_STA_MFP)
 		res |= WPA_STA_MFP;
+	if (flags & WLAN_STA_AUTH)
+		res |= WPA_STA_AUTHENTICATED;
+	if (flags & WLAN_STA_ASSOC)
+		res |= WPA_STA_ASSOCIATED;
 	return res;
 }
 
 
+static int add_buf(struct wpabuf **dst, const struct wpabuf *src)
+{
+	if (!src)
+		return 0;
+	if (wpabuf_resize(dst, wpabuf_len(src)) != 0)
+		return -1;
+	wpabuf_put_buf(*dst, src);
+	return 0;
+}
+
+
+static int add_buf_data(struct wpabuf **dst, const u8 *data, size_t len)
+{
+	if (!data || !len)
+		return 0;
+	if (wpabuf_resize(dst, len) != 0)
+		return -1;
+	wpabuf_put_data(*dst, data, len);
+	return 0;
+}
+
+
 int hostapd_build_ap_extra_ies(struct hostapd_data *hapd,
 			       struct wpabuf **beacon_ret,
 			       struct wpabuf **proberesp_ret,
@@ -49,82 +75,38 @@ int hostapd_build_ap_extra_ies(struct hostapd_data *hapd,
 
 	pos = buf;
 	pos = hostapd_eid_time_adv(hapd, pos);
-	if (pos != buf) {
-		if (wpabuf_resize(&beacon, pos - buf) != 0)
-			goto fail;
-		wpabuf_put_data(beacon, buf, pos - buf);
-	}
+	if (add_buf_data(&beacon, buf, pos - buf) < 0)
+		goto fail;
 	pos = hostapd_eid_time_zone(hapd, pos);
-	if (pos != buf) {
-		if (wpabuf_resize(&proberesp, pos - buf) != 0)
-			goto fail;
-		wpabuf_put_data(proberesp, buf, pos - buf);
-	}
+	if (add_buf_data(&proberesp, buf, pos - buf) < 0)
+		goto fail;
 
 	pos = buf;
 	pos = hostapd_eid_ext_capab(hapd, pos);
-	if (pos != buf) {
-		if (wpabuf_resize(&assocresp, pos - buf) != 0)
-			goto fail;
-		wpabuf_put_data(assocresp, buf, pos - buf);
-	}
+	if (add_buf_data(&assocresp, buf, pos - buf) < 0)
+		goto fail;
 	pos = hostapd_eid_interworking(hapd, pos);
 	pos = hostapd_eid_adv_proto(hapd, pos);
 	pos = hostapd_eid_roaming_consortium(hapd, pos);
-	if (pos != buf) {
-		if (wpabuf_resize(&beacon, pos - buf) != 0)
-			goto fail;
-		wpabuf_put_data(beacon, buf, pos - buf);
-
-		if (wpabuf_resize(&proberesp, pos - buf) != 0)
-			goto fail;
-		wpabuf_put_data(proberesp, buf, pos - buf);
-	}
+	if (add_buf_data(&beacon, buf, pos - buf) < 0 ||
+	    add_buf_data(&proberesp, buf, pos - buf) < 0)
+		goto fail;
 
 #ifdef CONFIG_FST
-	if (hapd->iface->fst_ies) {
-		size_t add = wpabuf_len(hapd->iface->fst_ies);
-
-		if (wpabuf_resize(&beacon, add) < 0)
-			goto fail;
-		wpabuf_put_buf(beacon, hapd->iface->fst_ies);
-		if (wpabuf_resize(&proberesp, add) < 0)
-			goto fail;
-		wpabuf_put_buf(proberesp, hapd->iface->fst_ies);
-		if (wpabuf_resize(&assocresp, add) < 0)
-			goto fail;
-		wpabuf_put_buf(assocresp, hapd->iface->fst_ies);
-	}
+	if (add_buf(&beacon, hapd->iface->fst_ies) < 0 ||
+	    add_buf(&proberesp, hapd->iface->fst_ies) < 0 ||
+	    add_buf(&assocresp, hapd->iface->fst_ies) < 0)
+		goto fail;
 #endif /* CONFIG_FST */
 
-	if (hapd->wps_beacon_ie) {
-		if (wpabuf_resize(&beacon, wpabuf_len(hapd->wps_beacon_ie)) <
-		    0)
-			goto fail;
-		wpabuf_put_buf(beacon, hapd->wps_beacon_ie);
-	}
-
-	if (hapd->wps_probe_resp_ie) {
-		if (wpabuf_resize(&proberesp,
-				  wpabuf_len(hapd->wps_probe_resp_ie)) < 0)
-			goto fail;
-		wpabuf_put_buf(proberesp, hapd->wps_probe_resp_ie);
-	}
+	if (add_buf(&beacon, hapd->wps_beacon_ie) < 0 ||
+	    add_buf(&proberesp, hapd->wps_probe_resp_ie) < 0)
+		goto fail;
 
 #ifdef CONFIG_P2P
-	if (hapd->p2p_beacon_ie) {
-		if (wpabuf_resize(&beacon, wpabuf_len(hapd->p2p_beacon_ie)) <
-		    0)
-			goto fail;
-		wpabuf_put_buf(beacon, hapd->p2p_beacon_ie);
-	}
-
-	if (hapd->p2p_probe_resp_ie) {
-		if (wpabuf_resize(&proberesp,
-				  wpabuf_len(hapd->p2p_probe_resp_ie)) < 0)
-			goto fail;
-		wpabuf_put_buf(proberesp, hapd->p2p_probe_resp_ie);
-	}
+	if (add_buf(&beacon, hapd->p2p_beacon_ie) < 0 ||
+	    add_buf(&proberesp, hapd->p2p_probe_resp_ie) < 0)
+		goto fail;
 #endif /* CONFIG_P2P */
 
 #ifdef CONFIG_P2P_MANAGER
@@ -148,8 +130,7 @@ int hostapd_build_ap_extra_ies(struct hostapd_data *hapd,
 #ifdef CONFIG_WPS
 	if (hapd->conf->wps_state) {
 		struct wpabuf *a = wps_build_assoc_resp_ie();
-		if (a && wpabuf_resize(&assocresp, wpabuf_len(a)) == 0)
-			wpabuf_put_buf(assocresp, a);
+		add_buf(&assocresp, a);
 		wpabuf_free(a);
 	}
 #endif /* CONFIG_WPS */
@@ -169,44 +150,36 @@ int hostapd_build_ap_extra_ies(struct hostapd_data *hapd,
 	if (hapd->p2p_group) {
 		struct wpabuf *a;
 		a = p2p_group_assoc_resp_ie(hapd->p2p_group, P2P_SC_SUCCESS);
-		if (a && wpabuf_resize(&assocresp, wpabuf_len(a)) == 0)
-			wpabuf_put_buf(assocresp, a);
+		add_buf(&assocresp, a);
 		wpabuf_free(a);
 	}
 #endif /* CONFIG_WIFI_DISPLAY */
 
 #ifdef CONFIG_HS20
-	pos = buf;
-	pos = hostapd_eid_hs20_indication(hapd, pos);
-	if (pos != buf) {
-		if (wpabuf_resize(&beacon, pos - buf) != 0)
-			goto fail;
-		wpabuf_put_data(beacon, buf, pos - buf);
-
-		if (wpabuf_resize(&proberesp, pos - buf) != 0)
-			goto fail;
-		wpabuf_put_data(proberesp, buf, pos - buf);
-	}
+	pos = hostapd_eid_hs20_indication(hapd, buf);
+	if (add_buf_data(&beacon, buf, pos - buf) < 0 ||
+	    add_buf_data(&proberesp, buf, pos - buf) < 0)
+		goto fail;
 
 	pos = hostapd_eid_osen(hapd, buf);
-	if (pos != buf) {
-		if (wpabuf_resize(&beacon, pos - buf) != 0)
-			goto fail;
-		wpabuf_put_data(beacon, buf, pos - buf);
+	if (add_buf_data(&beacon, buf, pos - buf) < 0 ||
+	    add_buf_data(&proberesp, buf, pos - buf) < 0)
+		goto fail;
+#endif /* CONFIG_HS20 */
 
-		if (wpabuf_resize(&proberesp, pos - buf) != 0)
+#ifdef CONFIG_MBO
+	if (hapd->conf->mbo_enabled) {
+		pos = hostapd_eid_mbo(hapd, buf, sizeof(buf));
+		if (add_buf_data(&beacon, buf, pos - buf) < 0 ||
+		    add_buf_data(&proberesp, buf, pos - buf) < 0 ||
+		    add_buf_data(&assocresp, buf, pos - buf) < 0)
 			goto fail;
-		wpabuf_put_data(proberesp, buf, pos - buf);
 	}
-#endif /* CONFIG_HS20 */
+#endif /* CONFIG_MBO */
 
-	if (hapd->conf->vendor_elements) {
-		size_t add = wpabuf_len(hapd->conf->vendor_elements);
-		if (wpabuf_resize(&beacon, add) == 0)
-			wpabuf_put_buf(beacon, hapd->conf->vendor_elements);
-		if (wpabuf_resize(&proberesp, add) == 0)
-			wpabuf_put_buf(proberesp, hapd->conf->vendor_elements);
-	}
+	add_buf(&beacon, hapd->conf->vendor_elements);
+	add_buf(&proberesp, hapd->conf->vendor_elements);
+	add_buf(&assocresp, hapd->conf->assocresp_elements);
 
 	*beacon_ret = beacon;
 	*proberesp_ret = proberesp;
@@ -390,7 +363,8 @@ int hostapd_sta_add(struct hostapd_data *hapd,
 		    u16 listen_interval,
 		    const struct ieee80211_ht_capabilities *ht_capab,
 		    const struct ieee80211_vht_capabilities *vht_capab,
-		    u32 flags, u8 qosinfo, u8 vht_opmode)
+		    u32 flags, u8 qosinfo, u8 vht_opmode, int supp_p2p_ps,
+		    int set)
 {
 	struct hostapd_sta_add_params params;
 
@@ -412,6 +386,8 @@ int hostapd_sta_add(struct hostapd_data *hapd,
 	params.vht_opmode = vht_opmode;
 	params.flags = hostapd_sta_flags_to_drv(flags);
 	params.qosinfo = qosinfo;
+	params.support_p2p_ps = supp_p2p_ps;
+	params.set = set;
 	return hapd->driver->sta_add(hapd->drv_priv, &params);
 }
 
@@ -468,7 +444,7 @@ int hostapd_if_add(struct hostapd_data *hapd, enum wpa_driver_if_type type,
 		return -1;
 	return hapd->driver->if_add(hapd->drv_priv, type, ifname, addr,
 				    bss_ctx, drv_priv, force_ifname, if_addr,
-				    bridge, use_existing);
+				    bridge, use_existing, 1);
 }
 
 
@@ -647,16 +623,28 @@ int hostapd_drv_set_key(const char *ifname, struct hostapd_data *hapd,
 int hostapd_drv_send_mlme(struct hostapd_data *hapd,
 			  const void *msg, size_t len, int noack)
 {
+	if (!hapd->driver || !hapd->driver->send_mlme || !hapd->drv_priv)
+		return 0;
+	return hapd->driver->send_mlme(hapd->drv_priv, msg, len, noack, 0,
+				       NULL, 0);
+}
+
+
+int hostapd_drv_send_mlme_csa(struct hostapd_data *hapd,
+			      const void *msg, size_t len, int noack,
+			      const u16 *csa_offs, size_t csa_offs_len)
+{
 	if (hapd->driver == NULL || hapd->driver->send_mlme == NULL)
 		return 0;
-	return hapd->driver->send_mlme(hapd->drv_priv, msg, len, noack, 0);
+	return hapd->driver->send_mlme(hapd->drv_priv, msg, len, noack, 0,
+				       csa_offs, csa_offs_len);
 }
 
 
 int hostapd_drv_sta_deauth(struct hostapd_data *hapd,
 			   const u8 *addr, int reason)
 {
-	if (hapd->driver == NULL || hapd->driver->sta_deauth == NULL)
+	if (!hapd->driver || !hapd->driver->sta_deauth || !hapd->drv_priv)
 		return 0;
 	return hapd->driver->sta_deauth(hapd->drv_priv, hapd->own_addr, addr,
 					reason);
@@ -666,7 +654,7 @@ int hostapd_drv_sta_deauth(struct hostapd_data *hapd,
 int hostapd_drv_sta_disassoc(struct hostapd_data *hapd,
 			     const u8 *addr, int reason)
 {
-	if (hapd->driver == NULL || hapd->driver->sta_disassoc == NULL)
+	if (!hapd->driver || !hapd->driver->sta_disassoc || !hapd->drv_priv)
 		return 0;
 	return hapd->driver->sta_disassoc(hapd->drv_priv, hapd->own_addr, addr,
 					  reason);
@@ -687,6 +675,36 @@ int hostapd_drv_send_action(struct hostapd_data *hapd, unsigned int freq,
 			    unsigned int wait, const u8 *dst, const u8 *data,
 			    size_t len)
 {
+	const u8 *bssid;
+	const u8 wildcard_bssid[ETH_ALEN] = {
+		0xff, 0xff, 0xff, 0xff, 0xff, 0xff
+	};
+
+	if (!hapd->driver || !hapd->driver->send_action || !hapd->drv_priv)
+		return 0;
+	bssid = hapd->own_addr;
+	if (!is_multicast_ether_addr(dst) &&
+	    len > 0 && data[0] == WLAN_ACTION_PUBLIC) {
+		struct sta_info *sta;
+
+		/*
+		 * Public Action frames to a STA that is not a member of the BSS
+		 * shall use wildcard BSSID value.
+		 */
+		sta = ap_get_sta(hapd, dst);
+		if (!sta || !(sta->flags & WLAN_STA_ASSOC))
+			bssid = wildcard_bssid;
+	}
+	return hapd->driver->send_action(hapd->drv_priv, freq, wait, dst,
+					 hapd->own_addr, bssid, data, len, 0);
+}
+
+
+int hostapd_drv_send_action_addr3_ap(struct hostapd_data *hapd,
+				     unsigned int freq,
+				     unsigned int wait, const u8 *dst,
+				     const u8 *data, size_t len)
+{
 	if (hapd->driver == NULL || hapd->driver->send_action == NULL)
 		return 0;
 	return hapd->driver->send_action(hapd->drv_priv, freq, wait, dst,
@@ -736,7 +754,7 @@ int hostapd_start_dfs_cac(struct hostapd_iface *iface,
 int hostapd_drv_set_qos_map(struct hostapd_data *hapd,
 			    const u8 *qos_map_set, u8 qos_map_set_len)
 {
-	if (hapd->driver == NULL || hapd->driver->set_qos_map == NULL)
+	if (!hapd->driver || !hapd->driver->set_qos_map || !hapd->drv_priv)
 		return 0;
 	return hapd->driver->set_qos_map(hapd->drv_priv, qos_map_set,
 					 qos_map_set_len);
@@ -762,6 +780,20 @@ static void hostapd_get_hw_mode_any_channels(struct hostapd_data *hapd,
 }
 
 
+void hostapd_get_ext_capa(struct hostapd_iface *iface)
+{
+	struct hostapd_data *hapd = iface->bss[0];
+
+	if (!hapd->driver || !hapd->driver->get_ext_capab)
+		return;
+
+	hapd->driver->get_ext_capab(hapd->drv_priv, WPA_IF_AP_BSS,
+				    &iface->extended_capa,
+				    &iface->extended_capa_mask,
+				    &iface->extended_capa_len);
+}
+
+
 int hostapd_drv_do_acs(struct hostapd_data *hapd)
 {
 	struct drv_acs_params params;
diff --git a/src/ap/ap_drv_ops.h b/src/ap/ap_drv_ops.h
index 82eaf3f08bb5b..0bb7954ec061f 100644
--- a/src/ap/ap_drv_ops.h
+++ b/src/ap/ap_drv_ops.h
@@ -41,7 +41,8 @@ int hostapd_sta_add(struct hostapd_data *hapd,
 		    u16 listen_interval,
 		    const struct ieee80211_ht_capabilities *ht_capab,
 		    const struct ieee80211_vht_capabilities *vht_capab,
-		    u32 flags, u8 qosinfo, u8 vht_opmode);
+		    u32 flags, u8 qosinfo, u8 vht_opmode, int supp_p2p_ps,
+		    int set);
 int hostapd_set_privacy(struct hostapd_data *hapd, int enabled);
 int hostapd_set_generic_elem(struct hostapd_data *hapd, const u8 *elem,
 			     size_t elem_len);
@@ -88,6 +89,9 @@ int hostapd_drv_set_key(const char *ifname,
 			const u8 *key, size_t key_len);
 int hostapd_drv_send_mlme(struct hostapd_data *hapd,
 			  const void *msg, size_t len, int noack);
+int hostapd_drv_send_mlme_csa(struct hostapd_data *hapd,
+			      const void *msg, size_t len, int noack,
+			      const u16 *csa_offs, size_t csa_offs_len);
 int hostapd_drv_sta_deauth(struct hostapd_data *hapd,
 			   const u8 *addr, int reason);
 int hostapd_drv_sta_disassoc(struct hostapd_data *hapd,
@@ -95,6 +99,10 @@ int hostapd_drv_sta_disassoc(struct hostapd_data *hapd,
 int hostapd_drv_send_action(struct hostapd_data *hapd, unsigned int freq,
 			    unsigned int wait, const u8 *dst, const u8 *data,
 			    size_t len);
+int hostapd_drv_send_action_addr3_ap(struct hostapd_data *hapd,
+				     unsigned int freq,
+				     unsigned int wait, const u8 *dst,
+				     const u8 *data, size_t len);
 int hostapd_add_sta_node(struct hostapd_data *hapd, const u8 *addr,
 			 u16 auth_alg);
 int hostapd_sta_auth(struct hostapd_data *hapd, const u8 *addr,
@@ -120,6 +128,8 @@ int hostapd_drv_wnm_oper(struct hostapd_data *hapd,
 int hostapd_drv_set_qos_map(struct hostapd_data *hapd, const u8 *qos_map_set,
 			    u8 qos_map_set_len);
 
+void hostapd_get_ext_capa(struct hostapd_iface *iface);
+
 static inline int hostapd_drv_set_countermeasures(struct hostapd_data *hapd,
 						  int enabled)
 {
@@ -150,7 +160,7 @@ static inline int hostapd_drv_get_inact_sec(struct hostapd_data *hapd,
 static inline int hostapd_drv_sta_remove(struct hostapd_data *hapd,
 					 const u8 *addr)
 {
-	if (hapd->driver == NULL || hapd->driver->sta_remove == NULL)
+	if (!hapd->driver || !hapd->driver->sta_remove || !hapd->drv_priv)
 		return 0;
 	return hapd->driver->sta_remove(hapd->drv_priv, addr);
 }
@@ -273,7 +283,7 @@ static inline int hostapd_drv_switch_channel(struct hostapd_data *hapd,
 static inline int hostapd_drv_status(struct hostapd_data *hapd, char *buf,
 				     size_t buflen)
 {
-	if (hapd->driver == NULL || hapd->driver->status == NULL)
+	if (!hapd->driver || !hapd->driver->status || !hapd->drv_priv)
 		return -1;
 	return hapd->driver->status(hapd->drv_priv, buf, buflen);
 }
@@ -332,7 +342,7 @@ static inline int hostapd_drv_vendor_cmd(struct hostapd_data *hapd,
 
 static inline int hostapd_drv_stop_ap(struct hostapd_data *hapd)
 {
-	if (hapd->driver == NULL || hapd->driver->stop_ap == NULL)
+	if (!hapd->driver || !hapd->driver->stop_ap || !hapd->drv_priv)
 		return 0;
 	return hapd->driver->stop_ap(hapd->drv_priv);
 }
diff --git a/src/ap/ap_mlme.c b/src/ap/ap_mlme.c
index 13604edc49406..e7308a01d7432 100644
--- a/src/ap/ap_mlme.c
+++ b/src/ap/ap_mlme.c
@@ -59,6 +59,7 @@ void mlme_authenticate_indication(struct hostapd_data *hapd,
 		       MAC2STR(sta->addr), mlme_auth_alg_str(sta->auth_alg));
 	if (sta->auth_alg != WLAN_AUTH_FT && !(sta->flags & WLAN_STA_MFP))
 		mlme_deletekeys_request(hapd, sta);
+	ap_sta_clear_disconnect_timeouts(hapd, sta);
 }
 
 
@@ -106,6 +107,7 @@ void mlme_associate_indication(struct hostapd_data *hapd, struct sta_info *sta)
 		       MAC2STR(sta->addr));
 	if (sta->auth_alg != WLAN_AUTH_FT)
 		mlme_deletekeys_request(hapd, sta);
+	ap_sta_clear_disconnect_timeouts(hapd, sta);
 }
 
 
@@ -130,6 +132,7 @@ void mlme_reassociate_indication(struct hostapd_data *hapd,
 		       MAC2STR(sta->addr));
 	if (sta->auth_alg != WLAN_AUTH_FT)
 		mlme_deletekeys_request(hapd, sta);
+	ap_sta_clear_disconnect_timeouts(hapd, sta);
 }
 
 
diff --git a/src/ap/authsrv.c b/src/ap/authsrv.c
index 934dcfc8d6318..cdb49cdd9d32f 100644
--- a/src/ap/authsrv.c
+++ b/src/ap/authsrv.c
@@ -173,6 +173,8 @@ int authsrv_init(struct hostapd_data *hapd)
 		params.openssl_ciphers = hapd->conf->openssl_ciphers;
 		params.ocsp_stapling_response =
 			hapd->conf->ocsp_stapling_response;
+		params.ocsp_stapling_response_multi =
+			hapd->conf->ocsp_stapling_response_multi;
 
 		if (tls_global_set_params(hapd->ssl_ctx, &params)) {
 			wpa_printf(MSG_ERROR, "Failed to set TLS parameters");
@@ -193,6 +195,7 @@ int authsrv_init(struct hostapd_data *hapd)
 	if (hapd->conf->eap_sim_db) {
 		hapd->eap_sim_db_priv =
 			eap_sim_db_init(hapd->conf->eap_sim_db,
+					hapd->conf->eap_sim_db_timeout,
 					hostapd_sim_db_cb, hapd);
 		if (hapd->eap_sim_db_priv == NULL) {
 			wpa_printf(MSG_ERROR, "Failed to initialize EAP-SIM "
diff --git a/src/ap/beacon.c b/src/ap/beacon.c
index 5fe8fd5660b41..233320d2e978c 100644
--- a/src/ap/beacon.c
+++ b/src/ap/beacon.c
@@ -29,6 +29,7 @@
 #include "beacon.h"
 #include "hs20.h"
 #include "dfs.h"
+#include "taxonomy.h"
 
 
 #ifdef NEED_AP_MLME
@@ -36,18 +37,21 @@
 static u8 * hostapd_eid_rm_enabled_capab(struct hostapd_data *hapd, u8 *eid,
 					 size_t len)
 {
-	if (!hapd->conf->radio_measurements || len < 2 + 4)
+	size_t i;
+
+	for (i = 0; i < RRM_CAPABILITIES_IE_LEN; i++) {
+		if (hapd->conf->radio_measurements[i])
+			break;
+	}
+
+	if (i == RRM_CAPABILITIES_IE_LEN || len < 2 + RRM_CAPABILITIES_IE_LEN)
 		return eid;
 
 	*eid++ = WLAN_EID_RRM_ENABLED_CAPABILITIES;
-	*eid++ = 5;
-	*eid++ = (hapd->conf->radio_measurements & BIT(0)) ?
-		WLAN_RRM_CAPS_NEIGHBOR_REPORT : 0x00;
-	*eid++ = 0x00;
-	*eid++ = 0x00;
-	*eid++ = 0x00;
-	*eid++ = 0x00;
-	return eid;
+	*eid++ = RRM_CAPABILITIES_IE_LEN;
+	os_memcpy(eid, hapd->conf->radio_measurements, RRM_CAPABILITIES_IE_LEN);
+
+	return eid + RRM_CAPABILITIES_IE_LEN;
 }
 
 
@@ -297,65 +301,65 @@ static u8 * hostapd_eid_wpa(struct hostapd_data *hapd, u8 *eid, size_t len)
 
 static u8 * hostapd_eid_csa(struct hostapd_data *hapd, u8 *eid)
 {
-	u8 chan;
-
-	if (!hapd->cs_freq_params.freq)
+#ifdef CONFIG_TESTING_OPTIONS
+	if (hapd->iface->cs_oper_class && hapd->iconf->ecsa_ie_only)
 		return eid;
+#endif /* CONFIG_TESTING_OPTIONS */
 
-	if (ieee80211_freq_to_chan(hapd->cs_freq_params.freq, &chan) ==
-	    NUM_HOSTAPD_MODES)
+	if (!hapd->cs_freq_params.channel)
 		return eid;
 
 	*eid++ = WLAN_EID_CHANNEL_SWITCH;
 	*eid++ = 3;
 	*eid++ = hapd->cs_block_tx;
-	*eid++ = chan;
+	*eid++ = hapd->cs_freq_params.channel;
 	*eid++ = hapd->cs_count;
 
 	return eid;
 }
 
 
-static u8 * hostapd_eid_secondary_channel(struct hostapd_data *hapd, u8 *eid)
+static u8 * hostapd_eid_ecsa(struct hostapd_data *hapd, u8 *eid)
 {
-	u8 sec_ch;
-
-	if (!hapd->cs_freq_params.sec_channel_offset)
+	if (!hapd->cs_freq_params.channel || !hapd->iface->cs_oper_class)
 		return eid;
 
-	if (hapd->cs_freq_params.sec_channel_offset == -1)
-		sec_ch = HT_INFO_HT_PARAM_SECONDARY_CHNL_BELOW;
-	else if (hapd->cs_freq_params.sec_channel_offset == 1)
-		sec_ch = HT_INFO_HT_PARAM_SECONDARY_CHNL_ABOVE;
-	else
-		return eid;
-
-	*eid++ = WLAN_EID_SECONDARY_CHANNEL_OFFSET;
-	*eid++ = 1;
-	*eid++ = sec_ch;
+	*eid++ = WLAN_EID_EXT_CHANSWITCH_ANN;
+	*eid++ = 4;
+	*eid++ = hapd->cs_block_tx;
+	*eid++ = hapd->iface->cs_oper_class;
+	*eid++ = hapd->cs_freq_params.channel;
+	*eid++ = hapd->cs_count;
 
 	return eid;
 }
 
 
-static u8 * hostapd_add_csa_elems(struct hostapd_data *hapd, u8 *pos,
-				  u8 *start, unsigned int *csa_counter_off)
+static u8 * hostapd_eid_supported_op_classes(struct hostapd_data *hapd, u8 *eid)
 {
-	u8 *old_pos = pos;
+	u8 op_class, channel;
 
-	if (!csa_counter_off)
-		return pos;
+	if (!(hapd->iface->drv_flags & WPA_DRIVER_FLAGS_AP_CSA) ||
+	    !hapd->iface->freq)
+		return eid;
 
-	*csa_counter_off = 0;
-	pos = hostapd_eid_csa(hapd, pos);
+	if (ieee80211_freq_to_channel_ext(hapd->iface->freq,
+					  hapd->iconf->secondary_channel,
+					  hapd->iconf->vht_oper_chwidth,
+					  &op_class, &channel) ==
+	    NUM_HOSTAPD_MODES)
+		return eid;
 
-	if (pos != old_pos) {
-		/* save an offset to the counter - should be last byte */
-		*csa_counter_off = pos - start - 1;
-		pos = hostapd_eid_secondary_channel(hapd, pos);
-	}
+	*eid++ = WLAN_EID_SUPPORTED_OPERATING_CLASSES;
+	*eid++ = 2;
 
-	return pos;
+	/* Current Operating Class */
+	*eid++ = op_class;
+
+	/* TODO: Advertise all the supported operating classes */
+	*eid++ = 0;
+
+	return eid;
 }
 
 
@@ -364,7 +368,7 @@ static u8 * hostapd_gen_probe_resp(struct hostapd_data *hapd,
 				   int is_p2p, size_t *resp_len)
 {
 	struct ieee80211_mgmt *resp;
-	u8 *pos, *epos;
+	u8 *pos, *epos, *csa_pos;
 	size_t buflen;
 
 #define MAX_PROBERESP_LEN 768
@@ -387,6 +391,9 @@ static u8 * hostapd_gen_probe_resp(struct hostapd_data *hapd,
 		buflen += 5 + 2 + sizeof(struct ieee80211_vht_capabilities) +
 			2 + sizeof(struct ieee80211_vht_operation);
 	}
+
+	buflen += hostapd_mbo_ie_len(hapd);
+
 	resp = os_zalloc(buflen);
 	if (resp == NULL)
 		return NULL;
@@ -424,6 +431,12 @@ static u8 * hostapd_gen_probe_resp(struct hostapd_data *hapd,
 	/* Power Constraint element */
 	pos = hostapd_eid_pwr_constraint(hapd, pos);
 
+	/* CSA IE */
+	csa_pos = hostapd_eid_csa(hapd, pos);
+	if (csa_pos != pos)
+		hapd->cs_c_off_proberesp = csa_pos - (u8 *) resp - 1;
+	pos = csa_pos;
+
 	/* ERP Information element */
 	pos = hostapd_eid_erp_info(hapd, pos);
 
@@ -437,7 +450,19 @@ static u8 * hostapd_gen_probe_resp(struct hostapd_data *hapd,
 
 	pos = hostapd_eid_rm_enabled_capab(hapd, pos, epos - pos);
 
+	/* eCSA IE */
+	csa_pos = hostapd_eid_ecsa(hapd, pos);
+	if (csa_pos != pos)
+		hapd->cs_c_off_ecsa_proberesp = csa_pos - (u8 *) resp - 1;
+	pos = csa_pos;
+
+	pos = hostapd_eid_supported_op_classes(hapd, pos);
+
 #ifdef CONFIG_IEEE80211N
+	/* Secondary Channel Offset element */
+	/* TODO: The standard doesn't specify a position for this element. */
+	pos = hostapd_eid_secondary_channel(hapd, pos);
+
 	pos = hostapd_eid_ht_capabilities(hapd, pos);
 	pos = hostapd_eid_ht_operation(hapd, pos);
 #endif /* CONFIG_IEEE80211N */
@@ -451,9 +476,6 @@ static u8 * hostapd_gen_probe_resp(struct hostapd_data *hapd,
 	pos = hostapd_eid_adv_proto(hapd, pos);
 	pos = hostapd_eid_roaming_consortium(hapd, pos);
 
-	pos = hostapd_add_csa_elems(hapd, pos, (u8 *)resp,
-				    &hapd->cs_c_off_proberesp);
-
 #ifdef CONFIG_FST
 	if (hapd->iface->fst_ies) {
 		os_memcpy(pos, wpabuf_head(hapd->iface->fst_ies),
@@ -464,8 +486,10 @@ static u8 * hostapd_gen_probe_resp(struct hostapd_data *hapd,
 
 #ifdef CONFIG_IEEE80211AC
 	if (hapd->iconf->ieee80211ac && !hapd->conf->disable_11ac) {
-		pos = hostapd_eid_vht_capabilities(hapd, pos);
+		pos = hostapd_eid_vht_capabilities(hapd, pos, 0);
 		pos = hostapd_eid_vht_operation(hapd, pos);
+		pos = hostapd_eid_txpower_envelope(hapd, pos);
+		pos = hostapd_eid_wb_chsw_wrapper(hapd, pos);
 	}
 	if (hapd->conf->vendor_vht)
 		pos = hostapd_eid_vendor_vht(hapd, pos);
@@ -501,6 +525,8 @@ static u8 * hostapd_gen_probe_resp(struct hostapd_data *hapd,
 	pos = hostapd_eid_osen(hapd, pos);
 #endif /* CONFIG_HS20 */
 
+	pos = hostapd_eid_mbo(hapd, pos, (u8 *) resp + buflen - pos);
+
 	if (hapd->conf->vendor_elements) {
 		os_memcpy(pos, wpabuf_head(hapd->conf->vendor_elements),
 			  wpabuf_len(hapd->conf->vendor_elements));
@@ -537,8 +563,8 @@ static enum ssid_match_result ssid_match(struct hostapd_data *hapd,
 
 	pos = ssid_list;
 	end = ssid_list + ssid_list_len;
-	while (pos + 1 <= end) {
-		if (pos + 2 + pos[1] > end)
+	while (end - pos >= 1) {
+		if (2 + pos[1] > end - pos)
 			break;
 		if (pos[1] == 0)
 			wildcard = 1;
@@ -574,7 +600,7 @@ void sta_track_expire(struct hostapd_iface *iface, int force)
 			   MAC2STR(info->addr));
 		dl_list_del(&info->list);
 		iface->num_sta_seen--;
-		os_free(info);
+		sta_track_del(info);
 	}
 }
 
@@ -607,6 +633,8 @@ void sta_track_add(struct hostapd_iface *iface, const u8 *addr)
 
 	/* Add a new entry */
 	info = os_zalloc(sizeof(*info));
+	if (info == NULL)
+		return;
 	os_memcpy(info->addr, addr, ETH_ALEN);
 	os_get_reltime(&info->last_seen);
 
@@ -648,6 +676,23 @@ sta_track_seen_on(struct hostapd_iface *iface, const u8 *addr,
 }
 
 
+#ifdef CONFIG_TAXONOMY
+void sta_track_claim_taxonomy_info(struct hostapd_iface *iface, const u8 *addr,
+				   struct wpabuf **probe_ie_taxonomy)
+{
+	struct hostapd_sta_info *info;
+
+	info = sta_track_get(iface, addr);
+	if (!info)
+		return;
+
+	wpabuf_free(*probe_ie_taxonomy);
+	*probe_ie_taxonomy = info->probe_ie_taxonomy;
+	info->probe_ie_taxonomy = NULL;
+}
+#endif /* CONFIG_TAXONOMY */
+
+
 void handle_probe_req(struct hostapd_data *hapd,
 		      const struct ieee80211_mgmt *mgmt, size_t len,
 		      int ssi_signal)
@@ -659,13 +704,16 @@ void handle_probe_req(struct hostapd_data *hapd,
 	size_t i, resp_len;
 	int noack;
 	enum ssid_match_result res;
+	int ret;
+	u16 csa_offs[2];
+	size_t csa_offs_len;
 
-	ie = mgmt->u.probe_req.variable;
-	if (len < IEEE80211_HDRLEN + sizeof(mgmt->u.probe_req))
+	if (len < IEEE80211_HDRLEN)
 		return;
+	ie = ((const u8 *) mgmt) + IEEE80211_HDRLEN;
 	if (hapd->iconf->track_sta_max_num)
 		sta_track_add(hapd->iface, mgmt->sa);
-	ie_len = len - (IEEE80211_HDRLEN + sizeof(mgmt->u.probe_req));
+	ie_len = len - IEEE80211_HDRLEN;
 
 	for (i = 0; hapd->probereq_cb && i < hapd->num_probereq_cb; i++)
 		if (hapd->probereq_cb[i].cb(hapd->probereq_cb[i].ctx,
@@ -711,7 +759,7 @@ void handle_probe_req(struct hostapd_data *hapd,
 	}
 
 #ifdef CONFIG_P2P
-	if (hapd->p2p && elems.wps_ie) {
+	if (hapd->p2p && hapd->p2p_group && elems.wps_ie) {
 		struct wpabuf *wps;
 		wps = ieee802_11_vendor_ie_concat(ie, ie_len, WPS_DEV_OUI_WFA);
 		if (wps && !p2p_group_match_dev_type(hapd->p2p_group, wps)) {
@@ -724,7 +772,7 @@ void handle_probe_req(struct hostapd_data *hapd,
 		wpabuf_free(wps);
 	}
 
-	if (hapd->p2p && elems.p2p) {
+	if (hapd->p2p && hapd->p2p_group && elems.p2p) {
 		struct wpabuf *p2p;
 		p2p = ieee802_11_vendor_ie_concat(ie, ie_len, P2P_IE_VENDOR_TYPE);
 		if (p2p && !p2p_group_match_dev_id(hapd->p2p_group, p2p)) {
@@ -754,6 +802,21 @@ void handle_probe_req(struct hostapd_data *hapd,
 	}
 #endif /* CONFIG_P2P */
 
+#ifdef CONFIG_TAXONOMY
+	{
+		struct sta_info *sta;
+		struct hostapd_sta_info *info;
+
+		if ((sta = ap_get_sta(hapd, mgmt->sa)) != NULL) {
+			taxonomy_sta_info_probe_req(hapd, sta, ie, ie_len);
+		} else if ((info = sta_track_get(hapd->iface,
+						 mgmt->sa)) != NULL) {
+			taxonomy_hostapd_sta_info_probe_req(hapd, info,
+							    ie, ie_len);
+		}
+	}
+#endif /* CONFIG_TAXONOMY */
+
 	res = ssid_match(hapd, elems.ssid, elems.ssid_len,
 			 elems.ssid_list, elems.ssid_list_len);
 	if (res == NO_SSID_MATCH) {
@@ -825,6 +888,17 @@ void handle_probe_req(struct hostapd_data *hapd,
 		return;
 	}
 
+	if (hapd->conf->no_probe_resp_if_max_sta &&
+	    is_multicast_ether_addr(mgmt->da) &&
+	    is_multicast_ether_addr(mgmt->bssid) &&
+	    hapd->num_sta >= hapd->conf->max_num_sta &&
+	    !ap_get_sta(hapd, mgmt->sa)) {
+		wpa_printf(MSG_MSGDUMP, "%s: Ignore Probe Request from " MACSTR
+			   " since no room for additional STA",
+			   hapd->conf->iface, MAC2STR(mgmt->sa));
+		return;
+	}
+
 #ifdef CONFIG_TESTING_OPTIONS
 	if (hapd->iconf->ignore_probe_probability > 0.0 &&
 	    drand48() < hapd->iconf->ignore_probe_probability) {
@@ -847,7 +921,22 @@ void handle_probe_req(struct hostapd_data *hapd,
 	noack = !!(res == WILDCARD_SSID_MATCH &&
 		   is_broadcast_ether_addr(mgmt->da));
 
-	if (hostapd_drv_send_mlme(hapd, resp, resp_len, noack) < 0)
+	csa_offs_len = 0;
+	if (hapd->csa_in_progress) {
+		if (hapd->cs_c_off_proberesp)
+			csa_offs[csa_offs_len++] =
+				hapd->cs_c_off_proberesp;
+
+		if (hapd->cs_c_off_ecsa_proberesp)
+			csa_offs[csa_offs_len++] =
+				hapd->cs_c_off_ecsa_proberesp;
+	}
+
+	ret = hostapd_drv_send_mlme_csa(hapd, resp, resp_len, noack,
+					csa_offs_len ? csa_offs : NULL,
+					csa_offs_len);
+
+	if (ret < 0)
 		wpa_printf(MSG_INFO, "handle_probe_req: send failed");
 
 	os_free(resp);
@@ -896,6 +985,16 @@ static u8 * hostapd_probe_resp_offloads(struct hostapd_data *hapd,
 #endif /* NEED_AP_MLME */
 
 
+void sta_track_del(struct hostapd_sta_info *info)
+{
+#ifdef CONFIG_TAXONOMY
+	wpabuf_free(info->probe_ie_taxonomy);
+	info->probe_ie_taxonomy = NULL;
+#endif /* CONFIG_TAXONOMY */
+	os_free(info);
+}
+
+
 int ieee802_11_build_ap_params(struct hostapd_data *hapd,
 			       struct wpa_driver_ap_params *params)
 {
@@ -906,7 +1005,7 @@ int ieee802_11_build_ap_params(struct hostapd_data *hapd,
 	size_t resp_len = 0;
 #ifdef NEED_AP_MLME
 	u16 capab_info;
-	u8 *pos, *tailpos;
+	u8 *pos, *tailpos, *csa_pos;
 
 #define BEACON_HEAD_BUF_SIZE 256
 #define BEACON_TAIL_BUF_SIZE 512
@@ -934,6 +1033,8 @@ int ieee802_11_build_ap_params(struct hostapd_data *hapd,
 	}
 #endif /* CONFIG_IEEE80211AC */
 
+	tail_len += hostapd_mbo_ie_len(hapd);
+
 	tailpos = tail = os_malloc(tail_len);
 	if (head == NULL || tail == NULL) {
 		wpa_printf(MSG_ERROR, "Failed to set beacon data");
@@ -987,6 +1088,12 @@ int ieee802_11_build_ap_params(struct hostapd_data *hapd,
 	/* Power Constraint element */
 	tailpos = hostapd_eid_pwr_constraint(hapd, tailpos);
 
+	/* CSA IE */
+	csa_pos = hostapd_eid_csa(hapd, tailpos);
+	if (csa_pos != tailpos)
+		hapd->cs_c_off_beacon = csa_pos - tail - 1;
+	tailpos = csa_pos;
+
 	/* ERP Information element */
 	tailpos = hostapd_eid_erp_info(hapd, tailpos);
 
@@ -1004,7 +1111,19 @@ int ieee802_11_build_ap_params(struct hostapd_data *hapd,
 	tailpos = hostapd_eid_bss_load(hapd, tailpos,
 				       tail + BEACON_TAIL_BUF_SIZE - tailpos);
 
+	/* eCSA IE */
+	csa_pos = hostapd_eid_ecsa(hapd, tailpos);
+	if (csa_pos != tailpos)
+		hapd->cs_c_off_ecsa_beacon = csa_pos - tail - 1;
+	tailpos = csa_pos;
+
+	tailpos = hostapd_eid_supported_op_classes(hapd, tailpos);
+
 #ifdef CONFIG_IEEE80211N
+	/* Secondary Channel Offset element */
+	/* TODO: The standard doesn't specify a position for this element. */
+	tailpos = hostapd_eid_secondary_channel(hapd, tailpos);
+
 	tailpos = hostapd_eid_ht_capabilities(hapd, tailpos);
 	tailpos = hostapd_eid_ht_operation(hapd, tailpos);
 #endif /* CONFIG_IEEE80211N */
@@ -1020,8 +1139,6 @@ int ieee802_11_build_ap_params(struct hostapd_data *hapd,
 	tailpos = hostapd_eid_interworking(hapd, tailpos);
 	tailpos = hostapd_eid_adv_proto(hapd, tailpos);
 	tailpos = hostapd_eid_roaming_consortium(hapd, tailpos);
-	tailpos = hostapd_add_csa_elems(hapd, tailpos, tail,
-					&hapd->cs_c_off_beacon);
 
 #ifdef CONFIG_FST
 	if (hapd->iface->fst_ies) {
@@ -1033,8 +1150,10 @@ int ieee802_11_build_ap_params(struct hostapd_data *hapd,
 
 #ifdef CONFIG_IEEE80211AC
 	if (hapd->iconf->ieee80211ac && !hapd->conf->disable_11ac) {
-		tailpos = hostapd_eid_vht_capabilities(hapd, tailpos);
+		tailpos = hostapd_eid_vht_capabilities(hapd, tailpos, 0);
 		tailpos = hostapd_eid_vht_operation(hapd, tailpos);
+		tailpos = hostapd_eid_txpower_envelope(hapd, tailpos);
+		tailpos = hostapd_eid_wb_chsw_wrapper(hapd, tailpos);
 	}
 	if (hapd->conf->vendor_vht)
 		tailpos = hostapd_eid_vendor_vht(hapd, tailpos);
@@ -1069,6 +1188,8 @@ int ieee802_11_build_ap_params(struct hostapd_data *hapd,
 	tailpos = hostapd_eid_osen(hapd, tailpos);
 #endif /* CONFIG_HS20 */
 
+	tailpos = hostapd_eid_mbo(hapd, tailpos, tail + tail_len - tailpos);
+
 	if (hapd->conf->vendor_elements) {
 		os_memcpy(tailpos, wpabuf_head(hapd->conf->vendor_elements),
 			  wpabuf_len(hapd->conf->vendor_elements));
@@ -1153,6 +1274,7 @@ int ieee802_11_build_ap_params(struct hostapd_data *hapd,
 		params->osen = 1;
 	}
 #endif /* CONFIG_HS20 */
+	params->pbss = hapd->conf->pbss;
 	return 0;
 }
 
diff --git a/src/ap/beacon.h b/src/ap/beacon.h
index d98f42e8157ae..fc711815cf65e 100644
--- a/src/ap/beacon.h
+++ b/src/ap/beacon.h
@@ -22,9 +22,12 @@ int ieee802_11_build_ap_params(struct hostapd_data *hapd,
 			       struct wpa_driver_ap_params *params);
 void ieee802_11_free_ap_params(struct wpa_driver_ap_params *params);
 void sta_track_add(struct hostapd_iface *iface, const u8 *addr);
+void sta_track_del(struct hostapd_sta_info *info);
 void sta_track_expire(struct hostapd_iface *iface, int force);
 struct hostapd_data *
 sta_track_seen_on(struct hostapd_iface *iface, const u8 *addr,
 		  const char *ifname);
+void sta_track_claim_taxonomy_info(struct hostapd_iface *iface, const u8 *addr,
+				   struct wpabuf **probe_ie_taxonomy);
 
 #endif /* BEACON_H */
diff --git a/src/ap/ctrl_iface_ap.c b/src/ap/ctrl_iface_ap.c
index c98978f33d05e..3680fda3153f5 100644
--- a/src/ap/ctrl_iface_ap.c
+++ b/src/ap/ctrl_iface_ap.c
@@ -22,6 +22,8 @@
 #include "p2p_hostapd.h"
 #include "ctrl_iface_ap.h"
 #include "ap_drv_ops.h"
+#include "mbo_ap.h"
+#include "taxonomy.h"
 
 
 static int hostapd_get_sta_tx_rx(struct hostapd_data *hapd,
@@ -35,9 +37,9 @@ static int hostapd_get_sta_tx_rx(struct hostapd_data *hapd,
 		return 0;
 
 	ret = os_snprintf(buf, buflen, "rx_packets=%lu\ntx_packets=%lu\n"
-			  "rx_bytes=%lu\ntx_bytes=%lu\n",
+			  "rx_bytes=%llu\ntx_bytes=%llu\ninactive_msec=%lu\n",
 			  data.rx_packets, data.tx_packets,
-			  data.rx_bytes, data.tx_bytes);
+			  data.rx_bytes, data.tx_bytes, data.inactive_msec);
 	if (os_snprintf_error(buflen, ret))
 		return 0;
 	return ret;
@@ -161,6 +163,19 @@ static int hostapd_ctrl_iface_sta_mib(struct hostapd_data *hapd,
 			len += res;
 	}
 
+	res = mbo_ap_get_info(sta, buf + len, buflen - len);
+	if (res >= 0)
+		len += res;
+
+	if (sta->supp_op_classes &&
+	    buflen - len > (unsigned) (17 + 2 * sta->supp_op_classes[0])) {
+		len += os_snprintf(buf + len, buflen - len, "supp_op_classes=");
+		len += wpa_snprintf_hex(buf + len, buflen - len,
+					sta->supp_op_classes + 1,
+					sta->supp_op_classes[0]);
+		len += os_snprintf(buf + len, buflen - len, "\n");
+	}
+
 	return len;
 }
 
@@ -244,7 +259,7 @@ static int p2p_manager_disconnect(struct hostapd_data *hapd, u16 stype,
 	int ret;
 	u8 *pos;
 
-	if (hapd->driver->send_frame == NULL)
+	if (!hapd->drv_priv || !hapd->driver->send_frame)
 		return -1;
 
 	mgmt = os_zalloc(sizeof(*mgmt) + 100);
@@ -255,7 +270,7 @@ static int p2p_manager_disconnect(struct hostapd_data *hapd, u16 stype,
 	wpa_dbg(hapd->msg_ctx, MSG_DEBUG, "P2P: Disconnect STA " MACSTR
 		" with minor reason code %u (stype=%u (%s))",
 		MAC2STR(addr), minor_reason_code, stype,
-		fc2str(mgmt->frame_control));
+		fc2str(le_to_host16(mgmt->frame_control)));
 
 	os_memcpy(mgmt->da, addr, ETH_ALEN);
 	os_memcpy(mgmt->sa, hapd->own_addr, ETH_ALEN);
@@ -311,7 +326,7 @@ int hostapd_ctrl_iface_deauthenticate(struct hostapd_data *hapd,
 	if (pos) {
 		struct ieee80211_mgmt mgmt;
 		int encrypt;
-		if (hapd->driver->send_frame == NULL)
+		if (!hapd->drv_priv || !hapd->driver->send_frame)
 			return -1;
 		pos += 6;
 		encrypt = atoi(pos);
@@ -338,7 +353,10 @@ int hostapd_ctrl_iface_deauthenticate(struct hostapd_data *hapd,
 	}
 #endif /* CONFIG_P2P_MANAGER */
 
-	hostapd_drv_sta_deauth(hapd, addr, reason);
+	if (os_strstr(txtaddr, " tx=0"))
+		hostapd_drv_sta_remove(hapd, addr);
+	else
+		hostapd_drv_sta_deauth(hapd, addr, reason);
 	sta = ap_get_sta(hapd, addr);
 	if (sta)
 		ap_sta_deauthenticate(hapd, sta, reason);
@@ -371,7 +389,7 @@ int hostapd_ctrl_iface_disassociate(struct hostapd_data *hapd,
 	if (pos) {
 		struct ieee80211_mgmt mgmt;
 		int encrypt;
-		if (hapd->driver->send_frame == NULL)
+		if (!hapd->drv_priv || !hapd->driver->send_frame)
 			return -1;
 		pos += 6;
 		encrypt = atoi(pos);
@@ -398,7 +416,10 @@ int hostapd_ctrl_iface_disassociate(struct hostapd_data *hapd,
 	}
 #endif /* CONFIG_P2P_MANAGER */
 
-	hostapd_drv_sta_disassoc(hapd, addr, reason);
+	if (os_strstr(txtaddr, " tx=0"))
+		hostapd_drv_sta_remove(hapd, addr);
+	else
+		hostapd_drv_sta_disassoc(hapd, addr, reason);
 	sta = ap_get_sta(hapd, addr);
 	if (sta)
 		ap_sta_disassociate(hapd, sta, reason);
@@ -409,6 +430,49 @@ int hostapd_ctrl_iface_disassociate(struct hostapd_data *hapd,
 }
 
 
+#ifdef CONFIG_TAXONOMY
+int hostapd_ctrl_iface_signature(struct hostapd_data *hapd,
+				 const char *txtaddr,
+				 char *buf, size_t buflen)
+{
+	u8 addr[ETH_ALEN];
+	struct sta_info *sta;
+
+	wpa_dbg(hapd->msg_ctx, MSG_DEBUG, "CTRL_IFACE SIGNATURE %s", txtaddr);
+
+	if (hwaddr_aton(txtaddr, addr))
+		return -1;
+
+	sta = ap_get_sta(hapd, addr);
+	if (!sta)
+		return -1;
+
+	return retrieve_sta_taxonomy(hapd, sta, buf, buflen);
+}
+#endif /* CONFIG_TAXONOMY */
+
+
+int hostapd_ctrl_iface_poll_sta(struct hostapd_data *hapd,
+				const char *txtaddr)
+{
+	u8 addr[ETH_ALEN];
+	struct sta_info *sta;
+
+	wpa_dbg(hapd->msg_ctx, MSG_DEBUG, "CTRL_IFACE POLL_STA %s", txtaddr);
+
+	if (hwaddr_aton(txtaddr, addr))
+		return -1;
+
+	sta = ap_get_sta(hapd, addr);
+	if (!sta)
+		return -1;
+
+	hostapd_drv_poll_client(hapd, hapd->own_addr, addr,
+				sta->flags & WLAN_STA_WMM);
+	return 0;
+}
+
+
 int hostapd_ctrl_iface_status(struct hostapd_data *hapd, char *buf,
 			      size_t buflen)
 {
@@ -473,20 +537,28 @@ int hostapd_ctrl_iface_status(struct hostapd_data *hapd, char *buf,
 			  "channel=%u\n"
 			  "secondary_channel=%d\n"
 			  "ieee80211n=%d\n"
-			  "ieee80211ac=%d\n"
-			  "vht_oper_chwidth=%d\n"
-			  "vht_oper_centr_freq_seg0_idx=%d\n"
-			  "vht_oper_centr_freq_seg1_idx=%d\n",
+			  "ieee80211ac=%d\n",
 			  iface->conf->channel,
-			  iface->conf->secondary_channel,
-			  iface->conf->ieee80211n,
-			  iface->conf->ieee80211ac,
-			  iface->conf->vht_oper_chwidth,
-			  iface->conf->vht_oper_centr_freq_seg0_idx,
-			  iface->conf->vht_oper_centr_freq_seg1_idx);
+			  iface->conf->ieee80211n && !hapd->conf->disable_11n ?
+			  iface->conf->secondary_channel : 0,
+			  iface->conf->ieee80211n && !hapd->conf->disable_11n,
+			  iface->conf->ieee80211ac &&
+			  !hapd->conf->disable_11ac);
 	if (os_snprintf_error(buflen - len, ret))
 		return len;
 	len += ret;
+	if (iface->conf->ieee80211ac && !hapd->conf->disable_11ac) {
+		ret = os_snprintf(buf + len, buflen - len,
+				  "vht_oper_chwidth=%d\n"
+				  "vht_oper_centr_freq_seg0_idx=%d\n"
+				  "vht_oper_centr_freq_seg1_idx=%d\n",
+				  iface->conf->vht_oper_chwidth,
+				  iface->conf->vht_oper_centr_freq_seg0_idx,
+				  iface->conf->vht_oper_centr_freq_seg1_idx);
+		if (os_snprintf_error(buflen - len, ret))
+			return len;
+		len += ret;
+	}
 
 	for (i = 0; i < iface->num_bss; i++) {
 		struct hostapd_data *bss = iface->bss[i];
@@ -554,3 +626,16 @@ int hostapd_ctrl_iface_stop_ap(struct hostapd_data *hapd)
 {
 	return hostapd_drv_stop_ap(hapd);
 }
+
+
+int hostapd_ctrl_iface_pmksa_list(struct hostapd_data *hapd, char *buf,
+				  size_t len)
+{
+	return wpa_auth_pmksa_list(hapd->wpa_auth, buf, len);
+}
+
+
+void hostapd_ctrl_iface_pmksa_flush(struct hostapd_data *hapd)
+{
+	wpa_auth_pmksa_flush(hapd->wpa_auth);
+}
diff --git a/src/ap/ctrl_iface_ap.h b/src/ap/ctrl_iface_ap.h
index e5297d03e810a..4f996800f1326 100644
--- a/src/ap/ctrl_iface_ap.h
+++ b/src/ap/ctrl_iface_ap.h
@@ -19,10 +19,18 @@ int hostapd_ctrl_iface_deauthenticate(struct hostapd_data *hapd,
 				      const char *txtaddr);
 int hostapd_ctrl_iface_disassociate(struct hostapd_data *hapd,
 				    const char *txtaddr);
+int hostapd_ctrl_iface_signature(struct hostapd_data *hapd,
+				 const char *txtaddr,
+				 char *buf, size_t buflen);
+int hostapd_ctrl_iface_poll_sta(struct hostapd_data *hapd,
+				const char *txtaddr);
 int hostapd_ctrl_iface_status(struct hostapd_data *hapd, char *buf,
 			      size_t buflen);
 int hostapd_parse_csa_settings(const char *pos,
 			       struct csa_settings *settings);
 int hostapd_ctrl_iface_stop_ap(struct hostapd_data *hapd);
+int hostapd_ctrl_iface_pmksa_list(struct hostapd_data *hapd, char *buf,
+				  size_t len);
+void hostapd_ctrl_iface_pmksa_flush(struct hostapd_data *hapd);
 
 #endif /* CTRL_IFACE_AP_H */
diff --git a/src/ap/dfs.c b/src/ap/dfs.c
index 715f19b6ac7bd..47adba7ef7261 100644
--- a/src/ap/dfs.c
+++ b/src/ap/dfs.c
@@ -450,7 +450,7 @@ dfs_get_valid_channel(struct hostapd_iface *iface,
 		return NULL;
 
 	if (os_get_random((u8 *) &_rand, sizeof(_rand)) < 0)
-		_rand = os_random();
+		return NULL;
 	chan_idx = _rand % num_available_chandefs;
 	dfs_find_channel(iface, &chan, chan_idx, skip_radar);
 
@@ -704,7 +704,8 @@ int hostapd_handle_dfs(struct hostapd_iface *iface)
 							skip_radar);
 			if (!channel) {
 				wpa_printf(MSG_ERROR, "could not get valid channel");
-				return -1;
+				hostapd_set_state(iface, HAPD_IFACE_DFS);
+				return 0;
 			}
 
 			iface->freq = channel->freq;
@@ -793,7 +794,6 @@ static int hostapd_dfs_start_channel_switch_cac(struct hostapd_iface *iface)
 
 	if (!channel) {
 		wpa_printf(MSG_ERROR, "No valid channel available");
-		hostapd_setup_interface_complete(iface, err);
 		return err;
 	}
 
@@ -817,16 +817,6 @@ static int hostapd_dfs_start_channel_switch_cac(struct hostapd_iface *iface)
 }
 
 
-static int hostapd_csa_in_progress(struct hostapd_iface *iface)
-{
-	unsigned int i;
-	for (i = 0; i < iface->num_bss; i++)
-		if (iface->bss[i]->csa_in_progress)
-			return 1;
-	return 0;
-}
-
-
 static int hostapd_dfs_start_channel_switch(struct hostapd_iface *iface)
 {
 	struct hostapd_channel_data *channel;
@@ -868,8 +858,9 @@ static int hostapd_dfs_start_channel_switch(struct hostapd_iface *iface)
 						&vht_oper_centr_freq_seg1_idx,
 						skip_radar);
 		if (!channel) {
-			/* FIXME: Wait for channel(s) to become available */
-			hostapd_disable_iface(iface);
+			wpa_printf(MSG_INFO,
+				   "%s: no DFS channels left, waiting for NOP to finish",
+				   __func__);
 			return err;
 		}
 
@@ -992,6 +983,11 @@ int hostapd_dfs_nop_finished(struct hostapd_iface *iface, int freq,
 	/* TODO add correct implementation here */
 	set_dfs_state(iface, freq, ht_enabled, chan_offset, chan_width,
 		      cf1, cf2, HOSTAPD_CHAN_DFS_USABLE);
+
+	/* Handle cases where all channels were initially unavailable */
+	if (iface->state == HAPD_IFACE_DFS && !iface->cac_started)
+		hostapd_handle_dfs(iface);
+
 	return 0;
 }
 
diff --git a/src/ap/dhcp_snoop.c b/src/ap/dhcp_snoop.c
index 3a77225f380e3..f0212fb2a984b 100644
--- a/src/ap/dhcp_snoop.c
+++ b/src/ap/dhcp_snoop.c
@@ -121,7 +121,8 @@ static void handle_dhcp(void *ctx, const u8 *src_addr, const u8 *buf,
 
 		wpa_printf(MSG_DEBUG, "dhcp_snoop: Found DHCPACK for " MACSTR
 			   " @ IPv4 address %s/%d",
-			   MAC2STR(sta->addr), ipaddr_str(ntohl(b->your_ip)),
+			   MAC2STR(sta->addr),
+			   ipaddr_str(be_to_host32(b->your_ip)),
 			   prefixlen);
 
 		if (sta->ipaddr == b->your_ip)
diff --git a/src/ap/drv_callbacks.c b/src/ap/drv_callbacks.c
index ca8b75c839060..3552b3e0d53b6 100644
--- a/src/ap/drv_callbacks.c
+++ b/src/ap/drv_callbacks.c
@@ -22,6 +22,7 @@
 #include "wnm_ap.h"
 #include "hostapd.h"
 #include "ieee802_11.h"
+#include "ieee802_11_auth.h"
 #include "sta_info.h"
 #include "accounting.h"
 #include "tkip_countermeasures.h"
@@ -33,6 +34,7 @@
 #include "hw_features.h"
 #include "dfs.h"
 #include "beacon.h"
+#include "mbo_ap.h"
 
 
 int hostapd_notif_assoc(struct hostapd_data *hapd, const u8 *addr,
@@ -114,6 +116,21 @@ int hostapd_notif_assoc(struct hostapd_data *hapd, const u8 *addr,
 	}
 	sta->flags &= ~(WLAN_STA_WPS | WLAN_STA_MAYBE_WPS | WLAN_STA_WPS2);
 
+	/*
+	 * ACL configurations to the drivers (implementing AP SME and ACL
+	 * offload) without hostapd's knowledge, can result in a disconnection
+	 * though the driver accepts the connection. Skip the hostapd check for
+	 * ACL if the driver supports ACL offload to avoid potentially
+	 * conflicting ACL rules.
+	 */
+	if (hapd->iface->drv_max_acl_mac_addrs == 0 &&
+	    hostapd_check_acl(hapd, addr, NULL) != HOSTAPD_ACL_ACCEPT) {
+		wpa_printf(MSG_INFO, "STA " MACSTR " not allowed to connect",
+			   MAC2STR(addr));
+		reason = WLAN_REASON_UNSPECIFIED;
+		goto fail;
+	}
+
 #ifdef CONFIG_P2P
 	if (elems.p2p) {
 		wpabuf_free(sta->p2p_ie);
@@ -164,6 +181,11 @@ int hostapd_notif_assoc(struct hostapd_data *hapd, const u8 *addr,
 		sta->mb_ies = NULL;
 #endif /* CONFIG_FST */
 
+	mbo_ap_check_sta_assoc(hapd, sta, &elems);
+
+	ap_copy_sta_supp_op_classes(sta, elems.supp_op_classes,
+				    elems.supp_op_classes_len);
+
 	if (hapd->conf->wpa) {
 		if (ie == NULL || ielen == 0) {
 #ifdef CONFIG_WPS
@@ -338,6 +360,17 @@ int hostapd_notif_assoc(struct hostapd_data *hapd, const u8 *addr,
 			return WLAN_STATUS_INVALID_IE;
 #endif /* CONFIG_HS20 */
 	}
+
+#ifdef CONFIG_MBO
+	if (hapd->conf->mbo_enabled && (hapd->conf->wpa & 2) &&
+	    elems.mbo && sta->cell_capa && !(sta->flags & WLAN_STA_MFP) &&
+	    hapd->conf->ieee80211w != NO_MGMT_FRAME_PROTECTION) {
+		wpa_printf(MSG_INFO,
+			   "MBO: Reject WPA2 association without PMF");
+		return WLAN_STATUS_UNSPECIFIED_FAILURE;
+	}
+#endif /* CONFIG_MBO */
+
 #ifdef CONFIG_WPS
 skip_wpa_check:
 #endif /* CONFIG_WPS */
@@ -447,7 +480,8 @@ void hostapd_event_ch_switch(struct hostapd_data *hapd, int freq, int ht,
 			     int offset, int width, int cf1, int cf2)
 {
 #ifdef NEED_AP_MLME
-	int channel, chwidth, seg0_idx = 0, seg1_idx = 0, is_dfs;
+	int channel, chwidth, is_dfs;
+	u8 seg0_idx = 0, seg1_idx = 0;
 
 	hostapd_logger(hapd, NULL, HOSTAPD_MODULE_IEEE80211,
 		       HOSTAPD_LEVEL_INFO,
@@ -491,8 +525,8 @@ void hostapd_event_ch_switch(struct hostapd_data *hapd, int freq, int ht,
 			seg1_idx = (cf2 - 5000) / 5;
 		break;
 	default:
-		seg0_idx = hostapd_hw_get_channel(hapd, cf1);
-		seg1_idx = hostapd_hw_get_channel(hapd, cf2);
+		ieee80211_freq_to_chan(cf1, &seg0_idx);
+		ieee80211_freq_to_chan(cf2, &seg1_idx);
 		break;
 	}
 
@@ -539,10 +573,11 @@ void hostapd_event_connect_failed_reason(struct hostapd_data *hapd,
 
 
 #ifdef CONFIG_ACS
-static void hostapd_acs_channel_selected(struct hostapd_data *hapd,
-					 struct acs_selected_channels *acs_res)
+void hostapd_acs_channel_selected(struct hostapd_data *hapd,
+				  struct acs_selected_channels *acs_res)
 {
 	int ret, i;
+	int err = 0;
 
 	if (hapd->iconf->channel) {
 		wpa_printf(MSG_INFO, "ACS: Channel was already set to %d",
@@ -564,7 +599,8 @@ static void hostapd_acs_channel_selected(struct hostapd_data *hapd,
 			hostapd_logger(hapd, NULL, HOSTAPD_MODULE_IEEE80211,
 				       HOSTAPD_LEVEL_WARNING,
 				       "driver selected to bad hw_mode");
-			return;
+			err = 1;
+			goto out;
 		}
 	}
 
@@ -574,7 +610,8 @@ static void hostapd_acs_channel_selected(struct hostapd_data *hapd,
 		hostapd_logger(hapd, NULL, HOSTAPD_MODULE_IEEE80211,
 			       HOSTAPD_LEVEL_WARNING,
 			       "driver switched to bad channel");
-		return;
+		err = 1;
+		goto out;
 	}
 
 	hapd->iconf->channel = acs_res->pri_channel;
@@ -588,7 +625,8 @@ static void hostapd_acs_channel_selected(struct hostapd_data *hapd,
 		hapd->iconf->secondary_channel = 1;
 	else {
 		wpa_printf(MSG_ERROR, "Invalid secondary channel!");
-		return;
+		err = 1;
+		goto out;
 	}
 
 	if (hapd->iface->conf->ieee80211ac) {
@@ -617,7 +655,8 @@ static void hostapd_acs_channel_selected(struct hostapd_data *hapd,
 		}
 	}
 
-	ret = hostapd_acs_completed(hapd->iface, 0);
+out:
+	ret = hostapd_acs_completed(hapd->iface, err);
 	if (ret) {
 		wpa_printf(MSG_ERROR,
 			   "ACS: Possibly channel configuration is invalid");
@@ -884,11 +923,24 @@ static void hostapd_mgmt_tx_cb(struct hostapd_data *hapd, const u8 *buf,
 			       size_t len, u16 stype, int ok)
 {
 	struct ieee80211_hdr *hdr;
+	struct hostapd_data *orig_hapd = hapd;
 
 	hdr = (struct ieee80211_hdr *) buf;
 	hapd = get_hapd_bssid(hapd->iface, get_hdr_bssid(hdr, len));
-	if (hapd == NULL || hapd == HAPD_BROADCAST)
+	if (!hapd)
 		return;
+	if (hapd == HAPD_BROADCAST) {
+		if (stype != WLAN_FC_STYPE_ACTION || len <= 25 ||
+		    buf[24] != WLAN_ACTION_PUBLIC)
+			return;
+		hapd = get_hapd_bssid(orig_hapd->iface, hdr->addr2);
+		if (!hapd || hapd == HAPD_BROADCAST)
+			return;
+		/*
+		 * Allow processing of TX status for a Public Action frame that
+		 * used wildcard BBSID.
+		 */
+	}
 	ieee802_11_mgmt_cb(hapd, buf, len, stype, ok);
 }
 
@@ -935,6 +987,8 @@ static void hostapd_event_eapol_rx(struct hostapd_data *hapd, const u8 *src,
 	ieee802_1x_receive(hapd, src, data, data_len);
 }
 
+#endif /* HOSTAPD */
+
 
 static struct hostapd_channel_data * hostapd_get_mode_channel(
 	struct hostapd_iface *iface, unsigned int freq)
@@ -944,8 +998,6 @@ static struct hostapd_channel_data * hostapd_get_mode_channel(
 
 	for (i = 0; i < iface->current_mode->num_channels; i++) {
 		chan = &iface->current_mode->channels[i];
-		if (!chan)
-			return NULL;
 		if ((unsigned int) chan->freq == freq)
 			return chan;
 	}
@@ -1009,10 +1061,9 @@ static void hostapd_single_channel_get_survey(struct hostapd_iface *iface,
 }
 
 
-static void hostapd_event_get_survey(struct hostapd_data *hapd,
-				     struct survey_results *survey_results)
+void hostapd_event_get_survey(struct hostapd_iface *iface,
+			      struct survey_results *survey_results)
 {
-	struct hostapd_iface *iface = hapd->iface;
 	struct freq_survey *survey, *tmp;
 	struct hostapd_channel_data *chan;
 
@@ -1044,6 +1095,7 @@ static void hostapd_event_get_survey(struct hostapd_data *hapd,
 }
 
 
+#ifdef HOSTAPD
 #ifdef NEED_AP_MLME
 
 static void hostapd_event_iface_unavailable(struct hostapd_data *hapd)
@@ -1251,7 +1303,7 @@ void wpa_supplicant_event(void *ctx, enum wpa_event_type event,
 			data->connect_failed_reason.code);
 		break;
 	case EVENT_SURVEY:
-		hostapd_event_get_survey(hapd, &data->survey_results);
+		hostapd_event_get_survey(hapd->iface, &data->survey_results);
 		break;
 #ifdef NEED_AP_MLME
 	case EVENT_INTERFACE_UNAVAILABLE:
@@ -1321,4 +1373,31 @@ void wpa_supplicant_event(void *ctx, enum wpa_event_type event,
 	}
 }
 
+
+void wpa_supplicant_event_global(void *ctx, enum wpa_event_type event,
+				 union wpa_event_data *data)
+{
+	struct hapd_interfaces *interfaces = ctx;
+	struct hostapd_data *hapd;
+
+	if (event != EVENT_INTERFACE_STATUS)
+		return;
+
+	hapd = hostapd_get_iface(interfaces, data->interface_status.ifname);
+	if (hapd && hapd->driver && hapd->driver->get_ifindex &&
+	    hapd->drv_priv) {
+		unsigned int ifindex;
+
+		ifindex = hapd->driver->get_ifindex(hapd->drv_priv);
+		if (ifindex != data->interface_status.ifindex) {
+			wpa_dbg(hapd->msg_ctx, MSG_DEBUG,
+				"interface status ifindex %d mismatch (%d)",
+				ifindex, data->interface_status.ifindex);
+			return;
+		}
+	}
+	if (hapd)
+		wpa_supplicant_event(hapd, event, data);
+}
+
 #endif /* HOSTAPD */
diff --git a/src/ap/gas_serv.c b/src/ap/gas_serv.c
index 9d19f98d0b7c7..6ce178de3b294 100644
--- a/src/ap/gas_serv.c
+++ b/src/ap/gas_serv.c
@@ -101,6 +101,7 @@ gas_serv_dialog_find(struct hostapd_data *hapd, const u8 *addr,
 		if (sta->gas_dialog[i].dialog_token != dialog_token ||
 		    !sta->gas_dialog[i].valid)
 			continue;
+		ap_sta_replenish_timeout(hapd, sta, 5);
 		return &sta->gas_dialog[i];
 	}
 	wpa_printf(MSG_DEBUG, "ANQP: Could not find dialog for "
@@ -167,27 +168,107 @@ static void anqp_add_hs_capab_list(struct hostapd_data *hapd,
 #endif /* CONFIG_HS20 */
 
 
+static struct anqp_element * get_anqp_elem(struct hostapd_data *hapd,
+					   u16 infoid)
+{
+	struct anqp_element *elem;
+
+	dl_list_for_each(elem, &hapd->conf->anqp_elem, struct anqp_element,
+			 list) {
+		if (elem->infoid == infoid)
+			return elem;
+	}
+
+	return NULL;
+}
+
+
+static void anqp_add_elem(struct hostapd_data *hapd, struct wpabuf *buf,
+			  u16 infoid)
+{
+	struct anqp_element *elem;
+
+	elem = get_anqp_elem(hapd, infoid);
+	if (!elem)
+		return;
+	if (wpabuf_tailroom(buf) < 2 + 2 + wpabuf_len(elem->payload)) {
+		wpa_printf(MSG_DEBUG, "ANQP: No room for InfoID %u payload",
+			   infoid);
+		return;
+	}
+
+	wpabuf_put_le16(buf, infoid);
+	wpabuf_put_le16(buf, wpabuf_len(elem->payload));
+	wpabuf_put_buf(buf, elem->payload);
+}
+
+
+static int anqp_add_override(struct hostapd_data *hapd, struct wpabuf *buf,
+			     u16 infoid)
+{
+	if (get_anqp_elem(hapd, infoid)) {
+		anqp_add_elem(hapd, buf, infoid);
+		return 1;
+	}
+
+	return 0;
+}
+
+
 static void anqp_add_capab_list(struct hostapd_data *hapd,
 				struct wpabuf *buf)
 {
 	u8 *len;
+	u16 id;
+
+	if (anqp_add_override(hapd, buf, ANQP_CAPABILITY_LIST))
+		return;
 
 	len = gas_anqp_add_element(buf, ANQP_CAPABILITY_LIST);
 	wpabuf_put_le16(buf, ANQP_CAPABILITY_LIST);
-	if (hapd->conf->venue_name)
+	if (hapd->conf->venue_name || get_anqp_elem(hapd, ANQP_VENUE_NAME))
 		wpabuf_put_le16(buf, ANQP_VENUE_NAME);
-	if (hapd->conf->network_auth_type)
+	if (get_anqp_elem(hapd, ANQP_EMERGENCY_CALL_NUMBER))
+		wpabuf_put_le16(buf, ANQP_EMERGENCY_CALL_NUMBER);
+	if (hapd->conf->network_auth_type ||
+	    get_anqp_elem(hapd, ANQP_NETWORK_AUTH_TYPE))
 		wpabuf_put_le16(buf, ANQP_NETWORK_AUTH_TYPE);
-	if (hapd->conf->roaming_consortium)
+	if (hapd->conf->roaming_consortium ||
+	    get_anqp_elem(hapd, ANQP_ROAMING_CONSORTIUM))
 		wpabuf_put_le16(buf, ANQP_ROAMING_CONSORTIUM);
-	if (hapd->conf->ipaddr_type_configured)
+	if (hapd->conf->ipaddr_type_configured ||
+	    get_anqp_elem(hapd, ANQP_IP_ADDR_TYPE_AVAILABILITY))
 		wpabuf_put_le16(buf, ANQP_IP_ADDR_TYPE_AVAILABILITY);
-	if (hapd->conf->nai_realm_data)
+	if (hapd->conf->nai_realm_data ||
+	    get_anqp_elem(hapd, ANQP_NAI_REALM))
 		wpabuf_put_le16(buf, ANQP_NAI_REALM);
-	if (hapd->conf->anqp_3gpp_cell_net)
+	if (hapd->conf->anqp_3gpp_cell_net ||
+	    get_anqp_elem(hapd, ANQP_3GPP_CELLULAR_NETWORK))
 		wpabuf_put_le16(buf, ANQP_3GPP_CELLULAR_NETWORK);
-	if (hapd->conf->domain_name)
+	if (get_anqp_elem(hapd, ANQP_AP_GEOSPATIAL_LOCATION))
+		wpabuf_put_le16(buf, ANQP_AP_GEOSPATIAL_LOCATION);
+	if (get_anqp_elem(hapd, ANQP_AP_CIVIC_LOCATION))
+		wpabuf_put_le16(buf, ANQP_AP_CIVIC_LOCATION);
+	if (get_anqp_elem(hapd, ANQP_AP_LOCATION_PUBLIC_URI))
+		wpabuf_put_le16(buf, ANQP_AP_LOCATION_PUBLIC_URI);
+	if (hapd->conf->domain_name || get_anqp_elem(hapd, ANQP_DOMAIN_NAME))
 		wpabuf_put_le16(buf, ANQP_DOMAIN_NAME);
+	if (get_anqp_elem(hapd, ANQP_EMERGENCY_ALERT_URI))
+		wpabuf_put_le16(buf, ANQP_EMERGENCY_ALERT_URI);
+	if (get_anqp_elem(hapd, ANQP_EMERGENCY_NAI))
+		wpabuf_put_le16(buf, ANQP_EMERGENCY_NAI);
+	if (get_anqp_elem(hapd, ANQP_NEIGHBOR_REPORT))
+		wpabuf_put_le16(buf, ANQP_NEIGHBOR_REPORT);
+	for (id = 273; id < 277; id++) {
+		if (get_anqp_elem(hapd, id))
+			wpabuf_put_le16(buf, id);
+	}
+	if (get_anqp_elem(hapd, ANQP_VENUE_URL))
+		wpabuf_put_le16(buf, ANQP_VENUE_URL);
+	if (get_anqp_elem(hapd, ANQP_ADVICE_OF_CHARGE))
+		wpabuf_put_le16(buf, ANQP_ADVICE_OF_CHARGE);
+	if (get_anqp_elem(hapd, ANQP_LOCAL_CONTENT))
+		wpabuf_put_le16(buf, ANQP_LOCAL_CONTENT);
 #ifdef CONFIG_HS20
 	anqp_add_hs_capab_list(hapd, buf);
 #endif /* CONFIG_HS20 */
@@ -197,6 +278,9 @@ static void anqp_add_capab_list(struct hostapd_data *hapd,
 
 static void anqp_add_venue_name(struct hostapd_data *hapd, struct wpabuf *buf)
 {
+	if (anqp_add_override(hapd, buf, ANQP_VENUE_NAME))
+		return;
+
 	if (hapd->conf->venue_name) {
 		u8 *len;
 		unsigned int i;
@@ -218,6 +302,9 @@ static void anqp_add_venue_name(struct hostapd_data *hapd, struct wpabuf *buf)
 static void anqp_add_network_auth_type(struct hostapd_data *hapd,
 				       struct wpabuf *buf)
 {
+	if (anqp_add_override(hapd, buf, ANQP_NETWORK_AUTH_TYPE))
+		return;
+
 	if (hapd->conf->network_auth_type) {
 		wpabuf_put_le16(buf, ANQP_NETWORK_AUTH_TYPE);
 		wpabuf_put_le16(buf, hapd->conf->network_auth_type_len);
@@ -233,6 +320,9 @@ static void anqp_add_roaming_consortium(struct hostapd_data *hapd,
 	unsigned int i;
 	u8 *len;
 
+	if (anqp_add_override(hapd, buf, ANQP_ROAMING_CONSORTIUM))
+		return;
+
 	len = gas_anqp_add_element(buf, ANQP_ROAMING_CONSORTIUM);
 	for (i = 0; i < hapd->conf->roaming_consortium_count; i++) {
 		struct hostapd_roaming_consortium *rc;
@@ -247,6 +337,9 @@ static void anqp_add_roaming_consortium(struct hostapd_data *hapd,
 static void anqp_add_ip_addr_type_availability(struct hostapd_data *hapd,
 					       struct wpabuf *buf)
 {
+	if (anqp_add_override(hapd, buf, ANQP_IP_ADDR_TYPE_AVAILABILITY))
+		return;
+
 	if (hapd->conf->ipaddr_type_configured) {
 		wpabuf_put_le16(buf, ANQP_IP_ADDR_TYPE_AVAILABILITY);
 		wpabuf_put_le16(buf, 1);
@@ -309,7 +402,7 @@ static int hs20_add_nai_home_realm_matches(struct hostapd_data *hapd,
 
 	pos = home_realm;
 	end = pos + home_realm_len;
-	if (pos + 1 > end) {
+	if (end - pos < 1) {
 		wpa_hexdump(MSG_DEBUG, "Too short NAI Home Realm Query",
 			    home_realm, home_realm_len);
 		return -1;
@@ -317,7 +410,7 @@ static int hs20_add_nai_home_realm_matches(struct hostapd_data *hapd,
 	num_realms = *pos++;
 
 	for (i = 0; i < num_realms && num_matching < 10; i++) {
-		if (pos + 2 > end) {
+		if (end - pos < 2) {
 			wpa_hexdump(MSG_DEBUG,
 				    "Truncated NAI Home Realm Query",
 				    home_realm, home_realm_len);
@@ -325,7 +418,7 @@ static int hs20_add_nai_home_realm_matches(struct hostapd_data *hapd,
 		}
 		encoding = *pos++;
 		realm_len = *pos++;
-		if (pos + realm_len > end) {
+		if (realm_len > end - pos) {
 			wpa_hexdump(MSG_DEBUG,
 				    "Truncated NAI Home Realm Query",
 				    home_realm, home_realm_len);
@@ -391,6 +484,10 @@ static void anqp_add_nai_realm(struct hostapd_data *hapd, struct wpabuf *buf,
 			       const u8 *home_realm, size_t home_realm_len,
 			       int nai_realm, int nai_home_realm)
 {
+	if (nai_realm && !nai_home_realm &&
+	    anqp_add_override(hapd, buf, ANQP_NAI_REALM))
+		return;
+
 	if (nai_realm && hapd->conf->nai_realm_data) {
 		u8 *len;
 		unsigned int i, j;
@@ -424,6 +521,9 @@ static void anqp_add_nai_realm(struct hostapd_data *hapd, struct wpabuf *buf,
 static void anqp_add_3gpp_cellular_network(struct hostapd_data *hapd,
 					   struct wpabuf *buf)
 {
+	if (anqp_add_override(hapd, buf, ANQP_3GPP_CELLULAR_NETWORK))
+		return;
+
 	if (hapd->conf->anqp_3gpp_cell_net) {
 		wpabuf_put_le16(buf, ANQP_3GPP_CELLULAR_NETWORK);
 		wpabuf_put_le16(buf,
@@ -436,6 +536,9 @@ static void anqp_add_3gpp_cellular_network(struct hostapd_data *hapd,
 
 static void anqp_add_domain_name(struct hostapd_data *hapd, struct wpabuf *buf)
 {
+	if (anqp_add_override(hapd, buf, ANQP_DOMAIN_NAME))
+		return;
+
 	if (hapd->conf->domain_name) {
 		wpabuf_put_le16(buf, ANQP_DOMAIN_NAME);
 		wpabuf_put_le16(buf, hapd->conf->domain_name_len);
@@ -683,20 +786,42 @@ static void anqp_add_icon_binary_file(struct hostapd_data *hapd,
 #endif /* CONFIG_HS20 */
 
 
+static size_t anqp_get_required_len(struct hostapd_data *hapd,
+				    const u16 *infoid,
+				    unsigned int num_infoid)
+{
+	size_t len = 0;
+	unsigned int i;
+
+	for (i = 0; i < num_infoid; i++) {
+		struct anqp_element *elem = get_anqp_elem(hapd, infoid[i]);
+
+		if (elem)
+			len += 2 + 2 + wpabuf_len(elem->payload);
+	}
+
+	return len;
+}
+
+
 static struct wpabuf *
 gas_serv_build_gas_resp_payload(struct hostapd_data *hapd,
 				unsigned int request,
 				const u8 *home_realm, size_t home_realm_len,
-				const u8 *icon_name, size_t icon_name_len)
+				const u8 *icon_name, size_t icon_name_len,
+				const u16 *extra_req,
+				unsigned int num_extra_req)
 {
 	struct wpabuf *buf;
 	size_t len;
+	unsigned int i;
 
 	len = 1400;
 	if (request & (ANQP_REQ_NAI_REALM | ANQP_REQ_NAI_HOME_REALM))
 		len += 1000;
 	if (request & ANQP_REQ_ICON_REQUEST)
 		len += 65536;
+	len += anqp_get_required_len(hapd, extra_req, num_extra_req);
 
 	buf = wpabuf_alloc(len);
 	if (buf == NULL)
@@ -706,6 +831,8 @@ gas_serv_build_gas_resp_payload(struct hostapd_data *hapd,
 		anqp_add_capab_list(hapd, buf);
 	if (request & ANQP_REQ_VENUE_NAME)
 		anqp_add_venue_name(hapd, buf);
+	if (request & ANQP_REQ_EMERGENCY_CALL_NUMBER)
+		anqp_add_elem(hapd, buf, ANQP_EMERGENCY_CALL_NUMBER);
 	if (request & ANQP_REQ_NETWORK_AUTH_TYPE)
 		anqp_add_network_auth_type(hapd, buf);
 	if (request & ANQP_REQ_ROAMING_CONSORTIUM)
@@ -718,8 +845,23 @@ gas_serv_build_gas_resp_payload(struct hostapd_data *hapd,
 				   request & ANQP_REQ_NAI_HOME_REALM);
 	if (request & ANQP_REQ_3GPP_CELLULAR_NETWORK)
 		anqp_add_3gpp_cellular_network(hapd, buf);
+	if (request & ANQP_REQ_AP_GEOSPATIAL_LOCATION)
+		anqp_add_elem(hapd, buf, ANQP_AP_GEOSPATIAL_LOCATION);
+	if (request & ANQP_REQ_AP_CIVIC_LOCATION)
+		anqp_add_elem(hapd, buf, ANQP_AP_CIVIC_LOCATION);
+	if (request & ANQP_REQ_AP_LOCATION_PUBLIC_URI)
+		anqp_add_elem(hapd, buf, ANQP_AP_LOCATION_PUBLIC_URI);
 	if (request & ANQP_REQ_DOMAIN_NAME)
 		anqp_add_domain_name(hapd, buf);
+	if (request & ANQP_REQ_EMERGENCY_ALERT_URI)
+		anqp_add_elem(hapd, buf, ANQP_EMERGENCY_ALERT_URI);
+	if (request & ANQP_REQ_TDLS_CAPABILITY)
+		anqp_add_elem(hapd, buf, ANQP_TDLS_CAPABILITY);
+	if (request & ANQP_REQ_EMERGENCY_NAI)
+		anqp_add_elem(hapd, buf, ANQP_EMERGENCY_NAI);
+
+	for (i = 0; i < num_extra_req; i++)
+		anqp_add_elem(hapd, buf, extra_req[i]);
 
 #ifdef CONFIG_HS20
 	if (request & ANQP_REQ_HS_CAPABILITY_LIST)
@@ -742,6 +884,8 @@ gas_serv_build_gas_resp_payload(struct hostapd_data *hapd,
 }
 
 
+#define ANQP_MAX_EXTRA_REQ 20
+
 struct anqp_query_info {
 	unsigned int request;
 	const u8 *home_realm_query;
@@ -749,6 +893,8 @@ struct anqp_query_info {
 	const u8 *icon_name;
 	size_t icon_name_len;
 	int p2p_sd;
+	u16 extra_req[ANQP_MAX_EXTRA_REQ];
+	unsigned int num_extra_req;
 };
 
 
@@ -776,6 +922,11 @@ static void rx_anqp_query_list_id(struct hostapd_data *hapd, u16 info_id,
 		set_anqp_req(ANQP_REQ_VENUE_NAME, "Venue Name",
 			     hapd->conf->venue_name != NULL, qi);
 		break;
+	case ANQP_EMERGENCY_CALL_NUMBER:
+		set_anqp_req(ANQP_REQ_EMERGENCY_CALL_NUMBER,
+			     "Emergency Call Number",
+			     get_anqp_elem(hapd, info_id) != NULL, qi);
+		break;
 	case ANQP_NETWORK_AUTH_TYPE:
 		set_anqp_req(ANQP_REQ_NETWORK_AUTH_TYPE, "Network Auth Type",
 			     hapd->conf->network_auth_type != NULL, qi);
@@ -798,13 +949,55 @@ static void rx_anqp_query_list_id(struct hostapd_data *hapd, u16 info_id,
 			     "3GPP Cellular Network",
 			     hapd->conf->anqp_3gpp_cell_net != NULL, qi);
 		break;
+	case ANQP_AP_GEOSPATIAL_LOCATION:
+		set_anqp_req(ANQP_REQ_AP_GEOSPATIAL_LOCATION,
+			     "AP Geospatial Location",
+			     get_anqp_elem(hapd, info_id) != NULL, qi);
+		break;
+	case ANQP_AP_CIVIC_LOCATION:
+		set_anqp_req(ANQP_REQ_AP_CIVIC_LOCATION,
+			     "AP Civic Location",
+			     get_anqp_elem(hapd, info_id) != NULL, qi);
+		break;
+	case ANQP_AP_LOCATION_PUBLIC_URI:
+		set_anqp_req(ANQP_REQ_AP_LOCATION_PUBLIC_URI,
+			     "AP Location Public URI",
+			     get_anqp_elem(hapd, info_id) != NULL, qi);
+		break;
 	case ANQP_DOMAIN_NAME:
 		set_anqp_req(ANQP_REQ_DOMAIN_NAME, "Domain Name",
 			     hapd->conf->domain_name != NULL, qi);
 		break;
+	case ANQP_EMERGENCY_ALERT_URI:
+		set_anqp_req(ANQP_REQ_EMERGENCY_ALERT_URI,
+			     "Emergency Alert URI",
+			     get_anqp_elem(hapd, info_id) != NULL, qi);
+		break;
+	case ANQP_TDLS_CAPABILITY:
+		set_anqp_req(ANQP_REQ_TDLS_CAPABILITY,
+			     "TDLS Capability",
+			     get_anqp_elem(hapd, info_id) != NULL, qi);
+		break;
+	case ANQP_EMERGENCY_NAI:
+		set_anqp_req(ANQP_REQ_EMERGENCY_NAI,
+			     "Emergency NAI",
+			     get_anqp_elem(hapd, info_id) != NULL, qi);
+		break;
 	default:
-		wpa_printf(MSG_DEBUG, "ANQP: Unsupported Info Id %u",
-			   info_id);
+		if (!get_anqp_elem(hapd, info_id)) {
+			wpa_printf(MSG_DEBUG, "ANQP: Unsupported Info Id %u",
+				   info_id);
+			break;
+		}
+		if (qi->num_extra_req == ANQP_MAX_EXTRA_REQ) {
+			wpa_printf(MSG_DEBUG,
+				   "ANQP: No more room for extra requests - ignore Info Id %u",
+				   info_id);
+			break;
+		}
+		wpa_printf(MSG_DEBUG, "ANQP: Info Id %u (local)", info_id);
+		qi->extra_req[qi->num_extra_req] = info_id;
+		qi->num_extra_req++;
 		break;
 	}
 }
@@ -817,7 +1010,7 @@ static void rx_anqp_query_list(struct hostapd_data *hapd,
 	wpa_printf(MSG_DEBUG, "ANQP: %u Info IDs requested in Query list",
 		   (unsigned int) (end - pos) / 2);
 
-	while (pos + 2 <= end) {
+	while (end - pos >= 2) {
 		rx_anqp_query_list_id(hapd, WPA_GET_LE16(pos), qi);
 		pos += 2;
 	}
@@ -906,7 +1099,7 @@ static void rx_anqp_vendor_specific(struct hostapd_data *hapd,
 	u32 oui;
 	u8 subtype;
 
-	if (pos + 4 > end) {
+	if (end - pos < 4) {
 		wpa_printf(MSG_DEBUG, "ANQP: Too short vendor specific ANQP "
 			   "Query element");
 		return;
@@ -942,7 +1135,7 @@ static void rx_anqp_vendor_specific(struct hostapd_data *hapd,
 	}
 	pos++;
 
-	if (pos + 1 >= end)
+	if (end - pos <= 1)
 		return;
 
 	subtype = *pos++;
@@ -973,14 +1166,16 @@ static void rx_anqp_vendor_specific(struct hostapd_data *hapd,
 
 static void gas_serv_req_local_processing(struct hostapd_data *hapd,
 					  const u8 *sa, u8 dialog_token,
-					  struct anqp_query_info *qi, int prot)
+					  struct anqp_query_info *qi, int prot,
+					  int std_addr3)
 {
 	struct wpabuf *buf, *tx_buf;
 
 	buf = gas_serv_build_gas_resp_payload(hapd, qi->request,
 					      qi->home_realm_query,
 					      qi->home_realm_query_len,
-					      qi->icon_name, qi->icon_name_len);
+					      qi->icon_name, qi->icon_name_len,
+					      qi->extra_req, qi->num_extra_req);
 	wpa_hexdump_buf(MSG_MSGDUMP, "ANQP: Locally generated ANQP responses",
 			buf);
 	if (!buf)
@@ -1033,15 +1228,22 @@ static void gas_serv_req_local_processing(struct hostapd_data *hapd,
 		return;
 	if (prot)
 		convert_to_protected_dual(tx_buf);
-	hostapd_drv_send_action(hapd, hapd->iface->freq, 0, sa,
-				wpabuf_head(tx_buf), wpabuf_len(tx_buf));
+	if (std_addr3)
+		hostapd_drv_send_action(hapd, hapd->iface->freq, 0, sa,
+					wpabuf_head(tx_buf),
+					wpabuf_len(tx_buf));
+	else
+		hostapd_drv_send_action_addr3_ap(hapd, hapd->iface->freq, 0, sa,
+						 wpabuf_head(tx_buf),
+						 wpabuf_len(tx_buf));
 	wpabuf_free(tx_buf);
 }
 
 
 static void gas_serv_rx_gas_initial_req(struct hostapd_data *hapd,
 					const u8 *sa,
-					const u8 *data, size_t len, int prot)
+					const u8 *data, size_t len, int prot,
+					int std_addr3)
 {
 	const u8 *pos = data;
 	const u8 *end = data + len;
@@ -1069,12 +1271,12 @@ static void gas_serv_rx_gas_initial_req(struct hostapd_data *hapd,
 	adv_proto = pos++;
 
 	slen = *pos++;
-	next = pos + slen;
-	if (next > end || slen < 2) {
+	if (slen > end - pos || slen < 2) {
 		wpa_msg(hapd->msg_ctx, MSG_DEBUG,
 			"GAS: Invalid IE in GAS Initial Request");
 		return;
 	}
+	next = pos + slen;
 	pos++; /* skip QueryRespLenLimit and PAME-BI */
 
 	if (*pos != ACCESS_NETWORK_QUERY_PROTOCOL) {
@@ -1093,19 +1295,26 @@ static void gas_serv_rx_gas_initial_req(struct hostapd_data *hapd,
 		wpabuf_put_le16(buf, 0); /* Query Response Length */
 		if (prot)
 			convert_to_protected_dual(buf);
-		hostapd_drv_send_action(hapd, hapd->iface->freq, 0, sa,
-					wpabuf_head(buf), wpabuf_len(buf));
+		if (std_addr3)
+			hostapd_drv_send_action(hapd, hapd->iface->freq, 0, sa,
+						wpabuf_head(buf),
+						wpabuf_len(buf));
+		else
+			hostapd_drv_send_action_addr3_ap(hapd,
+							 hapd->iface->freq, 0,
+							 sa, wpabuf_head(buf),
+							 wpabuf_len(buf));
 		wpabuf_free(buf);
 		return;
 	}
 
 	pos = next;
 	/* Query Request */
-	if (pos + 2 > end)
+	if (end - pos < 2)
 		return;
 	slen = WPA_GET_LE16(pos);
 	pos += 2;
-	if (pos + slen > end)
+	if (slen > end - pos)
 		return;
 	end = pos + slen;
 
@@ -1113,7 +1322,7 @@ static void gas_serv_rx_gas_initial_req(struct hostapd_data *hapd,
 	while (pos < end) {
 		u16 info_id, elen;
 
-		if (pos + 4 > end)
+		if (end - pos < 4)
 			return;
 
 		info_id = WPA_GET_LE16(pos);
@@ -1121,7 +1330,7 @@ static void gas_serv_rx_gas_initial_req(struct hostapd_data *hapd,
 		elen = WPA_GET_LE16(pos);
 		pos += 2;
 
-		if (pos + elen > end) {
+		if (elen > end - pos) {
 			wpa_printf(MSG_DEBUG, "ANQP: Invalid Query Request");
 			return;
 		}
@@ -1144,13 +1353,15 @@ static void gas_serv_rx_gas_initial_req(struct hostapd_data *hapd,
 		pos += elen;
 	}
 
-	gas_serv_req_local_processing(hapd, sa, dialog_token, &qi, prot);
+	gas_serv_req_local_processing(hapd, sa, dialog_token, &qi, prot,
+				      std_addr3);
 }
 
 
 static void gas_serv_rx_gas_comeback_req(struct hostapd_data *hapd,
 					 const u8 *sa,
-					 const u8 *data, size_t len, int prot)
+					 const u8 *data, size_t len, int prot,
+					 int std_addr3)
 {
 	struct gas_dialog_info *dialog;
 	struct wpabuf *buf, *tx_buf;
@@ -1226,8 +1437,14 @@ static void gas_serv_rx_gas_comeback_req(struct hostapd_data *hapd,
 send_resp:
 	if (prot)
 		convert_to_protected_dual(tx_buf);
-	hostapd_drv_send_action(hapd, hapd->iface->freq, 0, sa,
-				wpabuf_head(tx_buf), wpabuf_len(tx_buf));
+	if (std_addr3)
+		hostapd_drv_send_action(hapd, hapd->iface->freq, 0, sa,
+					wpabuf_head(tx_buf),
+					wpabuf_len(tx_buf));
+	else
+		hostapd_drv_send_action_addr3_ap(hapd, hapd->iface->freq, 0, sa,
+						 wpabuf_head(tx_buf),
+						 wpabuf_len(tx_buf));
 	wpabuf_free(tx_buf);
 }
 
@@ -1238,7 +1455,7 @@ static void gas_serv_rx_public_action(void *ctx, const u8 *buf, size_t len,
 	struct hostapd_data *hapd = ctx;
 	const struct ieee80211_mgmt *mgmt;
 	const u8 *sa, *data;
-	int prot;
+	int prot, std_addr3;
 
 	mgmt = (const struct ieee80211_mgmt *) buf;
 	if (len < IEEE80211_HDRLEN + 2)
@@ -1253,14 +1470,22 @@ static void gas_serv_rx_public_action(void *ctx, const u8 *buf, size_t len,
 	 */
 	prot = mgmt->u.action.category == WLAN_ACTION_PROTECTED_DUAL;
 	sa = mgmt->sa;
+	if (hapd->conf->gas_address3 == 1)
+		std_addr3 = 1;
+	else if (hapd->conf->gas_address3 == 2)
+		std_addr3 = 0;
+	else
+		std_addr3 = is_broadcast_ether_addr(mgmt->bssid);
 	len -= IEEE80211_HDRLEN + 1;
 	data = buf + IEEE80211_HDRLEN + 1;
 	switch (data[0]) {
 	case WLAN_PA_GAS_INITIAL_REQ:
-		gas_serv_rx_gas_initial_req(hapd, sa, data + 1, len - 1, prot);
+		gas_serv_rx_gas_initial_req(hapd, sa, data + 1, len - 1, prot,
+					    std_addr3);
 		break;
 	case WLAN_PA_GAS_COMEBACK_REQ:
-		gas_serv_rx_gas_comeback_req(hapd, sa, data + 1, len - 1, prot);
+		gas_serv_rx_gas_comeback_req(hapd, sa, data + 1, len - 1, prot,
+					     std_addr3);
 		break;
 	}
 }
diff --git a/src/ap/gas_serv.h b/src/ap/gas_serv.h
index 4ec3201967c00..9051e4f905135 100644
--- a/src/ap/gas_serv.h
+++ b/src/ap/gas_serv.h
@@ -9,10 +9,13 @@
 #ifndef GAS_SERV_H
 #define GAS_SERV_H
 
+/* First 16 ANQP InfoIDs can be included in the optimized bitmap */
 #define ANQP_REQ_CAPABILITY_LIST \
 	(1 << (ANQP_CAPABILITY_LIST - ANQP_QUERY_LIST))
 #define ANQP_REQ_VENUE_NAME \
 	(1 << (ANQP_VENUE_NAME - ANQP_QUERY_LIST))
+#define ANQP_REQ_EMERGENCY_CALL_NUMBER \
+	(1 << (ANQP_EMERGENCY_CALL_NUMBER - ANQP_QUERY_LIST))
 #define ANQP_REQ_NETWORK_AUTH_TYPE \
 	(1 << (ANQP_NETWORK_AUTH_TYPE - ANQP_QUERY_LIST))
 #define ANQP_REQ_ROAMING_CONSORTIUM \
@@ -23,8 +26,24 @@
 	(1 << (ANQP_NAI_REALM - ANQP_QUERY_LIST))
 #define ANQP_REQ_3GPP_CELLULAR_NETWORK \
 	(1 << (ANQP_3GPP_CELLULAR_NETWORK - ANQP_QUERY_LIST))
+#define ANQP_REQ_AP_GEOSPATIAL_LOCATION \
+	(1 << (ANQP_AP_GEOSPATIAL_LOCATION - ANQP_QUERY_LIST))
+#define ANQP_REQ_AP_CIVIC_LOCATION \
+	(1 << (ANQP_AP_CIVIC_LOCATION - ANQP_QUERY_LIST))
+#define ANQP_REQ_AP_LOCATION_PUBLIC_URI \
+	(1 << (ANQP_AP_LOCATION_PUBLIC_URI - ANQP_QUERY_LIST))
 #define ANQP_REQ_DOMAIN_NAME \
 	(1 << (ANQP_DOMAIN_NAME - ANQP_QUERY_LIST))
+#define ANQP_REQ_EMERGENCY_ALERT_URI \
+	(1 << (ANQP_EMERGENCY_ALERT_URI - ANQP_QUERY_LIST))
+#define ANQP_REQ_TDLS_CAPABILITY \
+	(1 << (ANQP_TDLS_CAPABILITY - ANQP_QUERY_LIST))
+#define ANQP_REQ_EMERGENCY_NAI \
+	(1 << (ANQP_EMERGENCY_NAI - ANQP_QUERY_LIST))
+/*
+ * First 16 Hotspot 2.0 vendor specific ANQP-elements can be included in the
+ * optimized bitmap.
+ */
 #define ANQP_REQ_HS_CAPABILITY_LIST \
 	(0x10000 << HS20_STYPE_CAPABILITY_LIST)
 #define ANQP_REQ_OPERATOR_FRIENDLY_NAME \
diff --git a/src/ap/hostapd.c b/src/ap/hostapd.c
index c09c17a446963..9fafc7f457bb0 100644
--- a/src/ap/hostapd.c
+++ b/src/ap/hostapd.c
@@ -12,6 +12,7 @@
 #include "utils/eloop.h"
 #include "common/ieee802_11_defs.h"
 #include "common/wpa_ctrl.h"
+#include "common/hw_features_common.h"
 #include "radius/radius_client.h"
 #include "radius/radius_das.h"
 #include "eap_server/tncs.h"
@@ -42,6 +43,8 @@
 #include "x_snoop.h"
 #include "dhcp_snoop.h"
 #include "ndisc_snoop.h"
+#include "neighbor_db.h"
+#include "rrm.h"
 
 
 static int hostapd_flush_old_stations(struct hostapd_data *hapd, u16 reason);
@@ -203,10 +206,12 @@ int hostapd_reload_config(struct hostapd_iface *iface)
 
 
 static void hostapd_broadcast_key_clear_iface(struct hostapd_data *hapd,
-					      char *ifname)
+					      const char *ifname)
 {
 	int i;
 
+	if (!ifname)
+		return;
 	for (i = 0; i < NUM_WEP_KEYS; i++) {
 		if (hostapd_drv_set_key(ifname, hapd, WPA_ALG_NONE, NULL, i,
 					0, NULL, 0, NULL, 0)) {
@@ -334,6 +339,8 @@ static void hostapd_free_hapd_data(struct hostapd_data *hapd)
 	wpabuf_free(hapd->mesh_pending_auth);
 	hapd->mesh_pending_auth = NULL;
 #endif /* CONFIG_MESH */
+
+	hostapd_clean_rrm(hapd);
 }
 
 
@@ -367,7 +374,7 @@ static void sta_track_deinit(struct hostapd_iface *iface)
 				     list))) {
 		dl_list_del(&info->list);
 		iface->num_sta_seen--;
-		os_free(info);
+		sta_track_del(info);
 	}
 }
 
@@ -511,6 +518,9 @@ static int hostapd_validate_bssid_configuration(struct hostapd_iface *iface)
 	if (hostapd_drv_none(hapd))
 		return 0;
 
+	if (iface->conf->use_driver_iface_addr)
+		return 0;
+
 	/* Generate BSSID mask that is large enough to cover the BSSIDs. */
 
 	/* Determine the bits necessary to cover the number of BSSIDs. */
@@ -520,7 +530,7 @@ static int hostapd_validate_bssid_configuration(struct hostapd_iface *iface)
 	/* Determine the bits necessary to any configured BSSIDs,
 	   if they are higher than the number of BSSIDs. */
 	for (j = 0; j < iface->conf->num_bss; j++) {
-		if (hostapd_mac_comp_empty(iface->conf->bss[j]->bssid) == 0) {
+		if (is_zero_ether_addr(iface->conf->bss[j]->bssid)) {
 			if (j)
 				auto_addr++;
 			continue;
@@ -672,7 +682,7 @@ static struct sta_info * hostapd_das_find_sta(struct hostapd_data *hapd,
 
 	if (attr->acct_session_id) {
 		num_attr++;
-		if (attr->acct_session_id_len != 17) {
+		if (attr->acct_session_id_len != 16) {
 			wpa_printf(MSG_DEBUG,
 				   "RADIUS DAS: Acct-Session-Id cannot match");
 			return NULL;
@@ -682,10 +692,9 @@ static struct sta_info * hostapd_das_find_sta(struct hostapd_data *hapd,
 		for (sta = hapd->sta_list; sta; sta = sta->next) {
 			if (!sta->radius_das_match)
 				continue;
-			os_snprintf(buf, sizeof(buf), "%08X-%08X",
-				    sta->acct_session_id_hi,
-				    sta->acct_session_id_lo);
-			if (os_memcmp(attr->acct_session_id, buf, 17) != 0)
+			os_snprintf(buf, sizeof(buf), "%016llX",
+				    (unsigned long long) sta->acct_session_id);
+			if (os_memcmp(attr->acct_session_id, buf, 16) != 0)
 				sta->radius_das_match = 0;
 			else
 				count++;
@@ -701,7 +710,7 @@ static struct sta_info * hostapd_das_find_sta(struct hostapd_data *hapd,
 
 	if (attr->acct_multi_session_id) {
 		num_attr++;
-		if (attr->acct_multi_session_id_len != 17) {
+		if (attr->acct_multi_session_id_len != 16) {
 			wpa_printf(MSG_DEBUG,
 				   "RADIUS DAS: Acct-Multi-Session-Id cannot match");
 			return NULL;
@@ -712,14 +721,14 @@ static struct sta_info * hostapd_das_find_sta(struct hostapd_data *hapd,
 			if (!sta->radius_das_match)
 				continue;
 			if (!sta->eapol_sm ||
-			    !sta->eapol_sm->acct_multi_session_id_hi) {
+			    !sta->eapol_sm->acct_multi_session_id) {
 				sta->radius_das_match = 0;
 				continue;
 			}
-			os_snprintf(buf, sizeof(buf), "%08X+%08X",
-				    sta->eapol_sm->acct_multi_session_id_hi,
-				    sta->eapol_sm->acct_multi_session_id_lo);
-			if (os_memcmp(attr->acct_multi_session_id, buf, 17) !=
+			os_snprintf(buf, sizeof(buf), "%016llX",
+				    (unsigned long long)
+				    sta->eapol_sm->acct_multi_session_id);
+			if (os_memcmp(attr->acct_multi_session_id, buf, 16) !=
 			    0)
 				sta->radius_das_match = 0;
 			else
@@ -905,12 +914,9 @@ static int hostapd_setup_bss(struct hostapd_data *hapd, int first)
 	hapd->started = 1;
 
 	if (!first || first == -1) {
-		if (hostapd_mac_comp_empty(conf->bssid) == 0) {
-			/* Allocate the next available BSSID. */
-			do {
-				inc_byte_array(hapd->own_addr, ETH_ALEN);
-			} while (mac_in_conf(hapd->iconf, hapd->own_addr));
-		} else {
+		u8 *addr = hapd->own_addr;
+
+		if (!is_zero_ether_addr(conf->bssid)) {
 			/* Allocate the configured BSSID. */
 			os_memcpy(hapd->own_addr, conf->bssid, ETH_ALEN);
 
@@ -922,11 +928,18 @@ static int hostapd_setup_bss(struct hostapd_data *hapd, int first)
 					   "the radio", conf->iface);
 				return -1;
 			}
+		} else if (hapd->iconf->use_driver_iface_addr) {
+			addr = NULL;
+		} else {
+			/* Allocate the next available BSSID. */
+			do {
+				inc_byte_array(hapd->own_addr, ETH_ALEN);
+			} while (mac_in_conf(hapd->iconf, hapd->own_addr));
 		}
 
 		hapd->interface_added = 1;
 		if (hostapd_if_add(hapd->iface->bss[0], WPA_IF_AP_BSS,
-				   conf->iface, hapd->own_addr, hapd,
+				   conf->iface, addr, hapd,
 				   &hapd->drv_priv, force_ifname, if_addr,
 				   conf->bridge[0] ? conf->bridge : NULL,
 				   first == -1)) {
@@ -935,11 +948,19 @@ static int hostapd_setup_bss(struct hostapd_data *hapd, int first)
 			hapd->interface_added = 0;
 			return -1;
 		}
+
+		if (!addr)
+			os_memcpy(hapd->own_addr, if_addr, ETH_ALEN);
 	}
 
 	if (conf->wmm_enabled < 0)
 		conf->wmm_enabled = hapd->iconf->ieee80211n;
 
+#ifdef CONFIG_IEEE80211R
+	if (is_zero_ether_addr(conf->r1_key_holder))
+		os_memcpy(conf->r1_key_holder, hapd->own_addr, ETH_ALEN);
+#endif /* CONFIG_IEEE80211R */
+
 #ifdef CONFIG_MESH
 	if (hapd->iface->mconf == NULL)
 		flush_old_stations = 0;
@@ -1022,6 +1043,8 @@ static int hostapd_setup_bss(struct hostapd_data *hapd, int first)
 		das_conf.time_window = conf->radius_das_time_window;
 		das_conf.require_event_timestamp =
 			conf->radius_das_require_event_timestamp;
+		das_conf.require_message_authenticator =
+			conf->radius_das_require_message_authenticator;
 		das_conf.ctx = hapd;
 		das_conf.disconnect = hostapd_das_disconnect;
 		hapd->radius_das = radius_das_init(&das_conf);
@@ -1509,15 +1532,128 @@ void fst_hostapd_fill_iface_obj(struct hostapd_data *hapd,
 #endif /* CONFIG_FST */
 
 
-/**
- * hostapd_setup_interface_complete - Complete interface setup
- *
- * This function is called when previous steps in the interface setup has been
- * completed. This can also start operations, e.g., DFS, that will require
- * additional processing before interface is ready to be enabled. Such
- * operations will call this function from eloop callbacks when finished.
- */
-int hostapd_setup_interface_complete(struct hostapd_iface *iface, int err)
+#ifdef NEED_AP_MLME
+static enum nr_chan_width hostapd_get_nr_chan_width(struct hostapd_data *hapd,
+						    int ht, int vht)
+{
+	if (!ht && !vht)
+		return NR_CHAN_WIDTH_20;
+	if (!hapd->iconf->secondary_channel)
+		return NR_CHAN_WIDTH_20;
+	if (!vht || hapd->iconf->vht_oper_chwidth == VHT_CHANWIDTH_USE_HT)
+		return NR_CHAN_WIDTH_40;
+	if (hapd->iconf->vht_oper_chwidth == VHT_CHANWIDTH_80MHZ)
+		return NR_CHAN_WIDTH_80;
+	if (hapd->iconf->vht_oper_chwidth == VHT_CHANWIDTH_160MHZ)
+		return NR_CHAN_WIDTH_160;
+	if (hapd->iconf->vht_oper_chwidth == VHT_CHANWIDTH_80P80MHZ)
+		return NR_CHAN_WIDTH_80P80;
+	return NR_CHAN_WIDTH_20;
+}
+#endif /* NEED_AP_MLME */
+
+
+static void hostapd_set_own_neighbor_report(struct hostapd_data *hapd)
+{
+#ifdef NEED_AP_MLME
+	u16 capab = hostapd_own_capab_info(hapd);
+	int ht = hapd->iconf->ieee80211n && !hapd->conf->disable_11n;
+	int vht = hapd->iconf->ieee80211ac && !hapd->conf->disable_11ac;
+	struct wpa_ssid_value ssid;
+	u8 channel, op_class;
+	int center_freq1 = 0, center_freq2 = 0;
+	enum nr_chan_width width;
+	u32 bssid_info;
+	struct wpabuf *nr;
+
+	if (!(hapd->conf->radio_measurements[0] &
+	      WLAN_RRM_CAPS_NEIGHBOR_REPORT))
+		return;
+
+	bssid_info = 3; /* AP is reachable */
+	bssid_info |= NEI_REP_BSSID_INFO_SECURITY; /* "same as the AP" */
+	bssid_info |= NEI_REP_BSSID_INFO_KEY_SCOPE; /* "same as the AP" */
+
+	if (capab & WLAN_CAPABILITY_SPECTRUM_MGMT)
+		bssid_info |= NEI_REP_BSSID_INFO_SPECTRUM_MGMT;
+
+	bssid_info |= NEI_REP_BSSID_INFO_RM; /* RRM is supported */
+
+	if (hapd->conf->wmm_enabled) {
+		bssid_info |= NEI_REP_BSSID_INFO_QOS;
+
+		if (hapd->conf->wmm_uapsd &&
+		    (hapd->iface->drv_flags & WPA_DRIVER_FLAGS_AP_UAPSD))
+			bssid_info |= NEI_REP_BSSID_INFO_APSD;
+	}
+
+	if (ht) {
+		bssid_info |= NEI_REP_BSSID_INFO_HT |
+			NEI_REP_BSSID_INFO_DELAYED_BA;
+
+		/* VHT bit added in IEEE P802.11-REVmc/D4.3 */
+		if (vht)
+			bssid_info |= NEI_REP_BSSID_INFO_VHT;
+	}
+
+	/* TODO: Set NEI_REP_BSSID_INFO_MOBILITY_DOMAIN if MDE is set */
+
+	ieee80211_freq_to_channel_ext(hapd->iface->freq,
+				      hapd->iconf->secondary_channel,
+				      hapd->iconf->vht_oper_chwidth,
+				      &op_class, &channel);
+	width = hostapd_get_nr_chan_width(hapd, ht, vht);
+	if (vht) {
+		center_freq1 = ieee80211_chan_to_freq(
+			NULL, op_class,
+			hapd->iconf->vht_oper_centr_freq_seg0_idx);
+		if (width == NR_CHAN_WIDTH_80P80)
+			center_freq2 = ieee80211_chan_to_freq(
+				NULL, op_class,
+				hapd->iconf->vht_oper_centr_freq_seg1_idx);
+	} else if (ht) {
+		center_freq1 = hapd->iface->freq +
+			10 * hapd->iconf->secondary_channel;
+	}
+
+	ssid.ssid_len = hapd->conf->ssid.ssid_len;
+	os_memcpy(ssid.ssid, hapd->conf->ssid.ssid, ssid.ssid_len);
+
+	/*
+	 * Neighbor Report element size = BSSID + BSSID info + op_class + chan +
+	 * phy type + wide bandwidth channel subelement.
+	 */
+	nr = wpabuf_alloc(ETH_ALEN + 4 + 1 + 1 + 1 + 5);
+	if (!nr)
+		return;
+
+	wpabuf_put_data(nr, hapd->own_addr, ETH_ALEN);
+	wpabuf_put_le32(nr, bssid_info);
+	wpabuf_put_u8(nr, op_class);
+	wpabuf_put_u8(nr, channel);
+	wpabuf_put_u8(nr, ieee80211_get_phy_type(hapd->iface->freq, ht, vht));
+
+	/*
+	 * Wide Bandwidth Channel subelement may be needed to allow the
+	 * receiving STA to send packets to the AP. See IEEE P802.11-REVmc/D5.0
+	 * Figure 9-301.
+	 */
+	wpabuf_put_u8(nr, WNM_NEIGHBOR_WIDE_BW_CHAN);
+	wpabuf_put_u8(nr, 3);
+	wpabuf_put_u8(nr, width);
+	wpabuf_put_u8(nr, center_freq1);
+	wpabuf_put_u8(nr, center_freq2);
+
+	hostapd_neighbor_set(hapd, hapd->own_addr, &ssid, nr, hapd->iconf->lci,
+			     hapd->iconf->civic);
+
+	wpabuf_free(nr);
+#endif /* NEED_AP_MLME */
+}
+
+
+static int hostapd_setup_interface_complete_sync(struct hostapd_iface *iface,
+						 int err)
 {
 	struct hostapd_data *hapd = iface->bss[0];
 	size_t j;
@@ -1633,7 +1769,7 @@ int hostapd_setup_interface_complete(struct hostapd_iface *iface, int err)
 			} while (j-- > 0);
 			goto fail;
 		}
-		if (hostapd_mac_comp_empty(hapd->conf->bssid) == 0)
+		if (is_zero_ether_addr(hapd->conf->bssid))
 			prev_addr = hapd->own_addr;
 	}
 	hapd = iface->bss[0];
@@ -1641,7 +1777,6 @@ int hostapd_setup_interface_complete(struct hostapd_iface *iface, int err)
 	hostapd_tx_queue_params(iface);
 
 	ap_list_init(iface);
-	dl_list_init(&iface->sta_seen);
 
 	hostapd_set_acl(hapd);
 
@@ -1701,6 +1836,9 @@ dfs_offload:
 	if (iface->interfaces && iface->interfaces->terminate_on_error > 0)
 		iface->interfaces->terminate_on_error--;
 
+	for (j = 0; j < iface->num_bss; j++)
+		hostapd_set_own_neighbor_report(iface->bss[j]);
+
 	return 0;
 
 fail:
@@ -1720,6 +1858,89 @@ fail:
 
 
 /**
+ * hostapd_setup_interface_complete - Complete interface setup
+ *
+ * This function is called when previous steps in the interface setup has been
+ * completed. This can also start operations, e.g., DFS, that will require
+ * additional processing before interface is ready to be enabled. Such
+ * operations will call this function from eloop callbacks when finished.
+ */
+int hostapd_setup_interface_complete(struct hostapd_iface *iface, int err)
+{
+	struct hapd_interfaces *interfaces = iface->interfaces;
+	struct hostapd_data *hapd = iface->bss[0];
+	unsigned int i;
+	int not_ready_in_sync_ifaces = 0;
+
+	if (!iface->need_to_start_in_sync)
+		return hostapd_setup_interface_complete_sync(iface, err);
+
+	if (err) {
+		wpa_printf(MSG_ERROR, "Interface initialization failed");
+		hostapd_set_state(iface, HAPD_IFACE_DISABLED);
+		iface->need_to_start_in_sync = 0;
+		wpa_msg(hapd->msg_ctx, MSG_INFO, AP_EVENT_DISABLED);
+		if (interfaces && interfaces->terminate_on_error)
+			eloop_terminate();
+		return -1;
+	}
+
+	if (iface->ready_to_start_in_sync) {
+		/* Already in ready and waiting. should never happpen */
+		return 0;
+	}
+
+	for (i = 0; i < interfaces->count; i++) {
+		if (interfaces->iface[i]->need_to_start_in_sync &&
+		    !interfaces->iface[i]->ready_to_start_in_sync)
+			not_ready_in_sync_ifaces++;
+	}
+
+	/*
+	 * Check if this is the last interface, if yes then start all the other
+	 * waiting interfaces. If not, add this interface to the waiting list.
+	 */
+	if (not_ready_in_sync_ifaces > 1 && iface->state == HAPD_IFACE_DFS) {
+		/*
+		 * If this interface went through CAC, do not synchronize, just
+		 * start immediately.
+		 */
+		iface->need_to_start_in_sync = 0;
+		wpa_printf(MSG_INFO,
+			   "%s: Finished CAC - bypass sync and start interface",
+			   iface->bss[0]->conf->iface);
+		return hostapd_setup_interface_complete_sync(iface, err);
+	}
+
+	if (not_ready_in_sync_ifaces > 1) {
+		/* need to wait as there are other interfaces still coming up */
+		iface->ready_to_start_in_sync = 1;
+		wpa_printf(MSG_INFO,
+			   "%s: Interface waiting to sync with other interfaces",
+			   iface->bss[0]->conf->iface);
+		return 0;
+	}
+
+	wpa_printf(MSG_INFO,
+		   "%s: Last interface to sync - starting all interfaces",
+		   iface->bss[0]->conf->iface);
+	iface->need_to_start_in_sync = 0;
+	hostapd_setup_interface_complete_sync(iface, err);
+	for (i = 0; i < interfaces->count; i++) {
+		if (interfaces->iface[i]->need_to_start_in_sync &&
+		    interfaces->iface[i]->ready_to_start_in_sync) {
+			hostapd_setup_interface_complete_sync(
+				interfaces->iface[i], 0);
+			/* Only once the interfaces are sync started */
+			interfaces->iface[i]->need_to_start_in_sync = 0;
+		}
+	}
+
+	return 0;
+}
+
+
+/**
  * hostapd_setup_interface - Setup of an interface
  * @iface: Pointer to interface data.
  * Returns: 0 on success, -1 on failure
@@ -1778,6 +1999,8 @@ hostapd_alloc_bss_data(struct hostapd_iface *hapd_iface,
 	hapd->iface = hapd_iface;
 	hapd->driver = hapd->iconf->driver;
 	hapd->ctrl_sock = -1;
+	dl_list_init(&hapd->ctrl_dst);
+	dl_list_init(&hapd->nr_db);
 
 	return hapd;
 }
@@ -1785,6 +2008,8 @@ hostapd_alloc_bss_data(struct hostapd_iface *hapd_iface,
 
 static void hostapd_bss_deinit(struct hostapd_data *hapd)
 {
+	if (!hapd)
+		return;
 	wpa_printf(MSG_DEBUG, "%s: deinit bss %s", __func__,
 		   hapd->conf->iface);
 	hostapd_bss_deinit_no_free(hapd);
@@ -1819,8 +2044,11 @@ void hostapd_interface_deinit(struct hostapd_iface *iface)
 	}
 #endif /* CONFIG_FST */
 
-	for (j = iface->num_bss - 1; j >= 0; j--)
+	for (j = iface->num_bss - 1; j >= 0; j--) {
+		if (!iface->bss)
+			break;
 		hostapd_bss_deinit(iface->bss[j]);
+	}
 }
 
 
@@ -1829,6 +2057,8 @@ void hostapd_interface_free(struct hostapd_iface *iface)
 	size_t j;
 	wpa_printf(MSG_DEBUG, "%s(%p)", __func__, iface);
 	for (j = 0; j < iface->num_bss; j++) {
+		if (!iface->bss)
+			break;
 		wpa_printf(MSG_DEBUG, "%s: free hapd %p",
 			   __func__, iface->bss[j]);
 		os_free(iface->bss[j]);
@@ -1837,6 +2067,20 @@ void hostapd_interface_free(struct hostapd_iface *iface)
 }
 
 
+struct hostapd_iface * hostapd_alloc_iface(void)
+{
+	struct hostapd_iface *hapd_iface;
+
+	hapd_iface = os_zalloc(sizeof(*hapd_iface));
+	if (!hapd_iface)
+		return NULL;
+
+	dl_list_init(&hapd_iface->sta_seen);
+
+	return hapd_iface;
+}
+
+
 /**
  * hostapd_init - Allocate and initialize per-interface data
  * @config_file: Path to the configuration file
@@ -1854,7 +2098,7 @@ struct hostapd_iface * hostapd_init(struct hapd_interfaces *interfaces,
 	struct hostapd_data *hapd;
 	size_t i;
 
-	hapd_iface = os_zalloc(sizeof(*hapd_iface));
+	hapd_iface = hostapd_alloc_iface();
 	if (hapd_iface == NULL)
 		goto fail;
 
@@ -2190,7 +2434,7 @@ hostapd_iface_alloc(struct hapd_interfaces *interfaces)
 		return NULL;
 	interfaces->iface = iface;
 	hapd_iface = interfaces->iface[interfaces->count] =
-		os_zalloc(sizeof(*hapd_iface));
+		hostapd_alloc_iface();
 	if (hapd_iface == NULL) {
 		wpa_printf(MSG_ERROR, "%s: Failed to allocate memory for "
 			   "the interface", __func__);
@@ -2557,6 +2801,7 @@ void hostapd_new_assoc_sta(struct hostapd_data *hapd, struct sta_info *sta,
 	}
 
 	hostapd_prune_associations(hapd, sta->addr);
+	ap_sta_clear_disconnect_timeouts(hapd, sta);
 
 	/* IEEE 802.11F (IAPP) */
 	if (hapd->conf->ieee802_11f)
@@ -2590,9 +2835,10 @@ void hostapd_new_assoc_sta(struct hostapd_data *hapd, struct sta_info *sta,
 		wpa_auth_sta_associated(hapd->wpa_auth, sta->wpa_sm);
 
 	if (!(hapd->iface->drv_flags & WPA_DRIVER_FLAGS_INACTIVITY_TIMER)) {
-		wpa_printf(MSG_DEBUG, "%s: reschedule ap_handle_timer timeout "
-			   "for " MACSTR " (%d seconds - ap_max_inactivity)",
-			   __func__, MAC2STR(sta->addr),
+		wpa_printf(MSG_DEBUG,
+			   "%s: %s: reschedule ap_handle_timer timeout for "
+			   MACSTR " (%d seconds - ap_max_inactivity)",
+			   hapd->conf->iface, __func__, MAC2STR(sta->addr),
 			   hapd->conf->ap_max_inactivity);
 		eloop_cancel_timeout(ap_handle_timer, hapd, sta);
 		eloop_register_timeout(hapd->conf->ap_max_inactivity, 0,
@@ -2627,12 +2873,23 @@ const char * hostapd_state_text(enum hostapd_iface_state s)
 void hostapd_set_state(struct hostapd_iface *iface, enum hostapd_iface_state s)
 {
 	wpa_printf(MSG_INFO, "%s: interface state %s->%s",
-		   iface->conf->bss[0]->iface, hostapd_state_text(iface->state),
-		   hostapd_state_text(s));
+		   iface->conf ? iface->conf->bss[0]->iface : "N/A",
+		   hostapd_state_text(iface->state), hostapd_state_text(s));
 	iface->state = s;
 }
 
 
+int hostapd_csa_in_progress(struct hostapd_iface *iface)
+{
+	unsigned int i;
+
+	for (i = 0; i < iface->num_bss; i++)
+		if (iface->bss[i]->csa_in_progress)
+			return 1;
+	return 0;
+}
+
+
 #ifdef NEED_AP_MLME
 
 static void free_beacon_data(struct beacon_data *beacon)
@@ -2744,9 +3001,9 @@ free_ap_params:
 
 
 /*
- * TODO: This flow currently supports only changing frequency within the
- * same hw_mode. Any other changes to MAC parameters or provided settings (even
- * width) are not supported.
+ * TODO: This flow currently supports only changing channel and width within
+ * the same hw_mode. Any other changes to MAC parameters or provided settings
+ * are not supported.
  */
 static int hostapd_change_config_freq(struct hostapd_data *hapd,
 				      struct hostapd_config *conf,
@@ -2765,15 +3022,44 @@ static int hostapd_change_config_freq(struct hostapd_data *hapd,
 		return -1;
 
 	/* if a pointer to old_params is provided we save previous state */
-	if (old_params) {
-		old_params->channel = conf->channel;
-		old_params->ht_enabled = conf->ieee80211n;
-		old_params->sec_channel_offset = conf->secondary_channel;
+	if (old_params &&
+	    hostapd_set_freq_params(old_params, conf->hw_mode,
+				    hostapd_hw_get_freq(hapd, conf->channel),
+				    conf->channel, conf->ieee80211n,
+				    conf->ieee80211ac,
+				    conf->secondary_channel,
+				    conf->vht_oper_chwidth,
+				    conf->vht_oper_centr_freq_seg0_idx,
+				    conf->vht_oper_centr_freq_seg1_idx,
+				    conf->vht_capab))
+		return -1;
+
+	switch (params->bandwidth) {
+	case 0:
+	case 20:
+	case 40:
+		conf->vht_oper_chwidth = VHT_CHANWIDTH_USE_HT;
+		break;
+	case 80:
+		if (params->center_freq2)
+			conf->vht_oper_chwidth = VHT_CHANWIDTH_80P80MHZ;
+		else
+			conf->vht_oper_chwidth = VHT_CHANWIDTH_80MHZ;
+		break;
+	case 160:
+		conf->vht_oper_chwidth = VHT_CHANWIDTH_160MHZ;
+		break;
+	default:
+		return -1;
 	}
 
 	conf->channel = channel;
 	conf->ieee80211n = params->ht_enabled;
 	conf->secondary_channel = params->sec_channel_offset;
+	ieee80211_freq_to_chan(params->center_freq1,
+			       &conf->vht_oper_centr_freq_seg0_idx);
+	ieee80211_freq_to_chan(params->center_freq2,
+			       &conf->vht_oper_centr_freq_seg1_idx);
 
 	/* TODO: maybe call here hostapd_config_check here? */
 
@@ -2787,11 +3073,43 @@ static int hostapd_fill_csa_settings(struct hostapd_data *hapd,
 	struct hostapd_iface *iface = hapd->iface;
 	struct hostapd_freq_params old_freq;
 	int ret;
+	u8 chan, vht_bandwidth;
 
 	os_memset(&old_freq, 0, sizeof(old_freq));
 	if (!iface || !iface->freq || hapd->csa_in_progress)
 		return -1;
 
+	switch (settings->freq_params.bandwidth) {
+	case 80:
+		if (settings->freq_params.center_freq2)
+			vht_bandwidth = VHT_CHANWIDTH_80P80MHZ;
+		else
+			vht_bandwidth = VHT_CHANWIDTH_80MHZ;
+		break;
+	case 160:
+		vht_bandwidth = VHT_CHANWIDTH_160MHZ;
+		break;
+	default:
+		vht_bandwidth = VHT_CHANWIDTH_USE_HT;
+		break;
+	}
+
+	if (ieee80211_freq_to_channel_ext(
+		    settings->freq_params.freq,
+		    settings->freq_params.sec_channel_offset,
+		    vht_bandwidth,
+		    &hapd->iface->cs_oper_class,
+		    &chan) == NUM_HOSTAPD_MODES) {
+		wpa_printf(MSG_DEBUG,
+			   "invalid frequency for channel switch (freq=%d, sec_channel_offset=%d, vht_enabled=%d)",
+			   settings->freq_params.freq,
+			   settings->freq_params.sec_channel_offset,
+			   settings->freq_params.vht_enabled);
+		return -1;
+	}
+
+	settings->freq_params.channel = chan;
+
 	ret = hostapd_change_config_freq(iface->bss[0], iface->conf,
 					 &settings->freq_params,
 					 &old_freq);
@@ -2818,8 +3136,10 @@ static int hostapd_fill_csa_settings(struct hostapd_data *hapd,
 		return ret;
 	}
 
-	settings->counter_offset_beacon = hapd->cs_c_off_beacon;
-	settings->counter_offset_presp = hapd->cs_c_off_proberesp;
+	settings->counter_offset_beacon[0] = hapd->cs_c_off_beacon;
+	settings->counter_offset_presp[0] = hapd->cs_c_off_proberesp;
+	settings->counter_offset_beacon[1] = hapd->cs_c_off_ecsa_beacon;
+	settings->counter_offset_presp[1] = hapd->cs_c_off_ecsa_proberesp;
 
 	return 0;
 }
@@ -2833,6 +3153,8 @@ void hostapd_cleanup_cs_params(struct hostapd_data *hapd)
 	hapd->cs_c_off_beacon = 0;
 	hapd->cs_c_off_proberesp = 0;
 	hapd->csa_in_progress = 0;
+	hapd->cs_c_off_ecsa_beacon = 0;
+	hapd->cs_c_off_ecsa_proberesp = 0;
 }
 
 
@@ -2920,6 +3242,8 @@ hostapd_switch_channel_fallback(struct hostapd_iface *iface,
 	hostapd_enable_iface(iface);
 }
 
+#endif /* NEED_AP_MLME */
+
 
 struct hostapd_data * hostapd_get_iface(struct hapd_interfaces *interfaces,
 					const char *ifname)
@@ -2940,8 +3264,6 @@ struct hostapd_data * hostapd_get_iface(struct hapd_interfaces *interfaces,
 	return NULL;
 }
 
-#endif /* NEED_AP_MLME */
-
 
 void hostapd_periodic_iface(struct hostapd_iface *iface)
 {
diff --git a/src/ap/hostapd.h b/src/ap/hostapd.h
index dcf51f00f78d3..dec46f692206c 100644
--- a/src/ap/hostapd.h
+++ b/src/ap/hostapd.h
@@ -41,7 +41,7 @@ struct hapd_interfaces {
 
 	size_t count;
 	int global_ctrl_sock;
-	struct wpa_ctrl_dst *global_ctrl_dst;
+	struct dl_list global_ctrl_dst;
 	char *global_iface_path;
 	char *global_iface_name;
 #ifndef CONFIG_NATIVE_WINDOWS
@@ -53,6 +53,7 @@ struct hapd_interfaces {
 #ifndef CONFIG_NO_VLAN
 	struct dynamic_iface *vlan_priv;
 #endif /* CONFIG_NO_VLAN */
+	int eloop_initialized;
 };
 
 enum hostapd_chan_status {
@@ -99,6 +100,16 @@ struct wps_stat {
 	u8 peer_addr[ETH_ALEN];
 };
 
+struct hostapd_neighbor_entry {
+	struct dl_list list;
+	u8 bssid[ETH_ALEN];
+	struct wpa_ssid_value ssid;
+	struct wpabuf *nr;
+	struct wpabuf *lci;
+	struct wpabuf *civic;
+	/* LCI update time */
+	struct os_time lci_date;
+};
 
 /**
  * struct hostapd_data - hostapd per-BSS data structure
@@ -138,7 +149,7 @@ struct hostapd_data {
 	void *msg_ctx_parent; /* parent interface ctx for wpa_msg() calls */
 
 	struct radius_client_data *radius;
-	u32 acct_session_id_hi, acct_session_id_lo;
+	u64 acct_session_id;
 	struct radius_das_data *radius_das;
 
 	struct iapp_data *iapp;
@@ -155,7 +166,7 @@ struct hostapd_data {
 	int tkip_countermeasures;
 
 	int ctrl_sock;
-	struct wpa_ctrl_dst *ctrl_dst;
+	struct dl_list ctrl_dst;
 
 	void *ssl_ctx;
 	void *eap_sim_db_priv;
@@ -228,6 +239,8 @@ struct hostapd_data {
 	unsigned int cs_c_off_beacon;
 	unsigned int cs_c_off_proberesp;
 	int csa_in_progress;
+	unsigned int cs_c_off_ecsa_beacon;
+	unsigned int cs_c_off_ecsa_proberesp;
 
 	/* BSS Load */
 	unsigned int bss_load_update_timeout;
@@ -256,9 +269,11 @@ struct hostapd_data {
 #ifdef CONFIG_MESH
 	int num_plinks;
 	int max_plinks;
-	void (*mesh_sta_free_cb)(struct sta_info *sta);
+	void (*mesh_sta_free_cb)(struct hostapd_data *hapd,
+				 struct sta_info *sta);
 	struct wpabuf *mesh_pending_auth;
 	struct os_reltime mesh_pending_auth_time;
+	u8 mesh_required_peer[ETH_ALEN];
 #endif /* CONFIG_MESH */
 
 #ifdef CONFIG_SQLITE
@@ -278,6 +293,17 @@ struct hostapd_data {
 
 	struct l2_packet_data *l2_test;
 #endif /* CONFIG_TESTING_OPTIONS */
+
+#ifdef CONFIG_MBO
+	unsigned int mbo_assoc_disallow;
+#endif /* CONFIG_MBO */
+
+	struct dl_list nr_db;
+
+	u8 lci_req_token;
+	u8 range_req_token;
+	unsigned int lci_req_active:1;
+	unsigned int range_req_active:1;
 };
 
 
@@ -285,6 +311,9 @@ struct hostapd_sta_info {
 	struct dl_list list;
 	u8 addr[ETH_ALEN];
 	struct os_reltime last_seen;
+#ifdef CONFIG_TAXONOMY
+	struct wpabuf *probe_ie_taxonomy;
+#endif /* CONFIG_TAXONOMY */
 };
 
 /**
@@ -327,6 +356,15 @@ struct hostapd_iface {
 	 */
 	unsigned int driver_ap_teardown:1;
 
+	/*
+	 * When set, indicates that this interface is part of list of
+	 * interfaces that need to be started together (synchronously).
+	 */
+	unsigned int need_to_start_in_sync:1;
+
+	/* Ready to start but waiting for other interfaces to become ready. */
+	unsigned int ready_to_start_in_sync:1;
+
 	int num_ap; /* number of entries in ap_list */
 	struct ap_info *ap_list; /* AP info list head */
 	struct ap_info *ap_hash[STA_HASH_SIZE];
@@ -402,6 +440,9 @@ struct hostapd_iface {
 	u64 last_channel_time_busy;
 	u8 channel_utilization;
 
+	/* eCSA IE will be added only if operating class is specified */
+	u8 cs_oper_class;
+
 	unsigned int dfs_cac_ms;
 	struct os_reltime dfs_cac_start;
 
@@ -433,6 +474,7 @@ int hostapd_setup_interface(struct hostapd_iface *iface);
 int hostapd_setup_interface_complete(struct hostapd_iface *iface, int err);
 void hostapd_interface_deinit(struct hostapd_iface *iface);
 void hostapd_interface_free(struct hostapd_iface *iface);
+struct hostapd_iface * hostapd_alloc_iface(void);
 struct hostapd_iface * hostapd_init(struct hapd_interfaces *interfaces,
 				    const char *config_file);
 struct hostapd_iface *
@@ -449,6 +491,7 @@ int hostapd_remove_iface(struct hapd_interfaces *ifaces, char *buf);
 void hostapd_channel_list_updated(struct hostapd_iface *iface, int initiator);
 void hostapd_set_state(struct hostapd_iface *iface, enum hostapd_iface_state s);
 const char * hostapd_state_text(enum hostapd_iface_state s);
+int hostapd_csa_in_progress(struct hostapd_iface *iface);
 int hostapd_switch_channel(struct hostapd_data *hapd,
 			   struct csa_settings *settings);
 void
@@ -478,6 +521,11 @@ int hostapd_probe_req_rx(struct hostapd_data *hapd, const u8 *sa, const u8 *da,
 			 int ssi_signal);
 void hostapd_event_ch_switch(struct hostapd_data *hapd, int freq, int ht,
 			     int offset, int width, int cf1, int cf2);
+struct survey_results;
+void hostapd_event_get_survey(struct hostapd_iface *iface,
+			      struct survey_results *survey_results);
+void hostapd_acs_channel_selected(struct hostapd_data *hapd,
+				  struct acs_selected_channels *acs_res);
 
 const struct hostapd_eap_user *
 hostapd_get_eap_user(struct hostapd_data *hapd, const u8 *identity,
diff --git a/src/ap/hw_features.c b/src/ap/hw_features.c
index fc8786dc311ca..16887acdfef49 100644
--- a/src/ap/hw_features.c
+++ b/src/ap/hw_features.c
@@ -329,6 +329,7 @@ static void ieee80211n_check_scan(struct hostapd_iface *iface)
 	res = ieee80211n_allowed_ht40_channel_pair(iface);
 	if (!res) {
 		iface->conf->secondary_channel = 0;
+		res = 1;
 		wpa_printf(MSG_INFO, "Fallback to 20 MHz");
 	}
 
@@ -472,8 +473,9 @@ static int ieee80211n_check_40mhz(struct hostapd_iface *iface)
 	struct wpa_driver_scan_params params;
 	int ret;
 
-	if (!iface->conf->secondary_channel)
-		return 0; /* HT40 not used */
+	/* Check that HT40 is used and PRI / SEC switch is allowed */
+	if (!iface->conf->secondary_channel || iface->conf->no_pri_sec_switch)
+		return 0;
 
 	hostapd_set_state(iface, HAPD_IFACE_HT_SCAN);
 	wpa_printf(MSG_DEBUG, "Scan for neighboring BSSes prior to enabling "
diff --git a/src/ap/iapp.c b/src/ap/iapp.c
index 99aa04dc3dd91..2556da30c82f3 100644
--- a/src/ap/iapp.c
+++ b/src/ap/iapp.c
@@ -34,11 +34,7 @@
 #include "utils/includes.h"
 #include <net/if.h>
 #include <sys/ioctl.h>
-#ifdef USE_KERNEL_HEADERS
-#include <linux/if_packet.h>
-#else /* USE_KERNEL_HEADERS */
 #include <netpacket/packet.h>
-#endif /* USE_KERNEL_HEADERS */
 
 #include "utils/common.h"
 #include "utils/eloop.h"
@@ -385,6 +381,7 @@ struct iapp_data * iapp_init(struct hostapd_data *hapd, const char *iface)
 	struct sockaddr_in *paddr, uaddr;
 	struct iapp_data *iapp;
 	struct ip_mreqn mreq;
+	int reuseaddr = 1;
 
 	iapp = os_zalloc(sizeof(*iapp));
 	if (iapp == NULL)
@@ -447,6 +444,18 @@ struct iapp_data * iapp_init(struct hostapd_data *hapd, const char *iface)
 	os_memset(&uaddr, 0, sizeof(uaddr));
 	uaddr.sin_family = AF_INET;
 	uaddr.sin_port = htons(IAPP_UDP_PORT);
+
+	if (setsockopt(iapp->udp_sock, SOL_SOCKET, SO_REUSEADDR, &reuseaddr,
+		       sizeof(reuseaddr)) < 0) {
+		wpa_printf(MSG_INFO,
+			   "iapp_init - setsockopt[UDP,SO_REUSEADDR]: %s",
+			   strerror(errno));
+		/*
+		 * Ignore this and try to continue. This is fine for single
+		 * BSS cases, but may fail if multiple BSSes enable IAPP.
+		 */
+	}
+
 	if (bind(iapp->udp_sock, (struct sockaddr *) &uaddr,
 		 sizeof(uaddr)) < 0) {
 		wpa_printf(MSG_INFO, "iapp_init - bind[UDP]: %s",
diff --git a/src/ap/ieee802_11.c b/src/ap/ieee802_11.c
index 7bb18c01d1a19..4e04169c73e69 100644
--- a/src/ap/ieee802_11.c
+++ b/src/ap/ieee802_11.c
@@ -42,6 +42,9 @@
 #include "hw_features.h"
 #include "ieee802_11.h"
 #include "dfs.h"
+#include "mbo_ap.h"
+#include "rrm.h"
+#include "taxonomy.h"
 
 
 u8 * hostapd_eid_supp_rates(struct hostapd_data *hapd, u8 *eid)
@@ -139,6 +142,7 @@ u16 hostapd_own_capab_info(struct hostapd_data *hapd)
 	int capab = WLAN_CAPABILITY_ESS;
 	int privacy;
 	int dfs;
+	int i;
 
 	/* Check if any of configured channels require DFS */
 	dfs = hostapd_is_dfs_required(hapd->iface);
@@ -186,8 +190,12 @@ u16 hostapd_own_capab_info(struct hostapd_data *hapd)
 	    (hapd->iconf->spectrum_mgmt_required || dfs))
 		capab |= WLAN_CAPABILITY_SPECTRUM_MGMT;
 
-	if (hapd->conf->radio_measurements)
-		capab |= IEEE80211_CAP_RRM;
+	for (i = 0; i < RRM_CAPABILITIES_IE_LEN; i++) {
+		if (hapd->conf->radio_measurements[i]) {
+			capab |= IEEE80211_CAP_RRM;
+			break;
+		}
+	}
 
 	return capab;
 }
@@ -207,16 +215,17 @@ static u16 auth_shared_key(struct hostapd_data *hapd, struct sta_info *sta,
 		if (!sta->challenge) {
 			/* Generate a pseudo-random challenge */
 			u8 key[8];
-			struct os_time now;
-			int r;
+
 			sta->challenge = os_zalloc(WLAN_AUTH_CHALLENGE_LEN);
 			if (sta->challenge == NULL)
 				return WLAN_STATUS_UNSPECIFIED_FAILURE;
 
-			os_get_time(&now);
-			r = os_random();
-			os_memcpy(key, &now.sec, 4);
-			os_memcpy(key + 4, &r, 4);
+			if (os_get_random(key, sizeof(key)) < 0) {
+				os_free(sta->challenge);
+				sta->challenge = NULL;
+				return WLAN_STATUS_UNSPECIFIED_FAILURE;
+			}
+
 			rc4_skip(key, sizeof(key), 0,
 				 sta->challenge, WLAN_AUTH_CHALLENGE_LEN);
 		}
@@ -250,19 +259,20 @@ static u16 auth_shared_key(struct hostapd_data *hapd, struct sta_info *sta,
 #endif /* CONFIG_NO_RC4 */
 
 
-static void send_auth_reply(struct hostapd_data *hapd,
-			    const u8 *dst, const u8 *bssid,
-			    u16 auth_alg, u16 auth_transaction, u16 resp,
-			    const u8 *ies, size_t ies_len)
+static int send_auth_reply(struct hostapd_data *hapd,
+			   const u8 *dst, const u8 *bssid,
+			   u16 auth_alg, u16 auth_transaction, u16 resp,
+			   const u8 *ies, size_t ies_len)
 {
 	struct ieee80211_mgmt *reply;
 	u8 *buf;
 	size_t rlen;
+	int reply_res = WLAN_STATUS_UNSPECIFIED_FAILURE;
 
 	rlen = IEEE80211_HDRLEN + sizeof(reply->u.auth) + ies_len;
 	buf = os_zalloc(rlen);
 	if (buf == NULL)
-		return;
+		return -1;
 
 	reply = (struct ieee80211_mgmt *) buf;
 	reply->frame_control = IEEE80211_FC(WLAN_FC_TYPE_MGMT,
@@ -283,9 +293,13 @@ static void send_auth_reply(struct hostapd_data *hapd,
 		   MAC2STR(dst), auth_alg, auth_transaction,
 		   resp, (unsigned long) ies_len);
 	if (hostapd_drv_send_mlme(hapd, reply, rlen, 0) < 0)
-		wpa_printf(MSG_INFO, "send_auth_reply: send");
+		wpa_printf(MSG_INFO, "send_auth_reply: send failed");
+	else
+		reply_res = WLAN_STATUS_SUCCESS;
 
 	os_free(buf);
+
+	return reply_res;
 }
 
 
@@ -296,17 +310,25 @@ static void handle_auth_ft_finish(void *ctx, const u8 *dst, const u8 *bssid,
 {
 	struct hostapd_data *hapd = ctx;
 	struct sta_info *sta;
+	int reply_res;
 
-	send_auth_reply(hapd, dst, bssid, WLAN_AUTH_FT, auth_transaction,
-			status, ies, ies_len);
-
-	if (status != WLAN_STATUS_SUCCESS)
-		return;
+	reply_res = send_auth_reply(hapd, dst, bssid, WLAN_AUTH_FT,
+				    auth_transaction, status, ies, ies_len);
 
 	sta = ap_get_sta(hapd, dst);
 	if (sta == NULL)
 		return;
 
+	if (sta->added_unassoc && (reply_res != WLAN_STATUS_SUCCESS ||
+				   status != WLAN_STATUS_SUCCESS)) {
+		hostapd_drv_sta_remove(hapd, sta->addr);
+		sta->added_unassoc = 0;
+		return;
+	}
+
+	if (status != WLAN_STATUS_SUCCESS)
+		return;
+
 	hostapd_logger(hapd, dst, HOSTAPD_MODULE_IEEE80211,
 		       HOSTAPD_LEVEL_DEBUG, "authentication OK (FT)");
 	sta->flags |= WLAN_STA_AUTH;
@@ -369,18 +391,19 @@ static int auth_sae_send_commit(struct hostapd_data *hapd,
 				const u8 *bssid, int update)
 {
 	struct wpabuf *data;
+	int reply_res;
 
 	data = auth_build_sae_commit(hapd, sta, update);
 	if (data == NULL)
 		return WLAN_STATUS_UNSPECIFIED_FAILURE;
 
-	send_auth_reply(hapd, sta->addr, bssid,
-			WLAN_AUTH_SAE, 1, WLAN_STATUS_SUCCESS,
-			wpabuf_head(data), wpabuf_len(data));
+	reply_res = send_auth_reply(hapd, sta->addr, bssid, WLAN_AUTH_SAE, 1,
+				    WLAN_STATUS_SUCCESS, wpabuf_head(data),
+				    wpabuf_len(data));
 
 	wpabuf_free(data);
 
-	return WLAN_STATUS_SUCCESS;
+	return reply_res;
 }
 
 
@@ -389,18 +412,19 @@ static int auth_sae_send_confirm(struct hostapd_data *hapd,
 				 const u8 *bssid)
 {
 	struct wpabuf *data;
+	int reply_res;
 
 	data = auth_build_sae_confirm(hapd, sta);
 	if (data == NULL)
 		return WLAN_STATUS_UNSPECIFIED_FAILURE;
 
-	send_auth_reply(hapd, sta->addr, bssid,
-			WLAN_AUTH_SAE, 2, WLAN_STATUS_SUCCESS,
-			wpabuf_head(data), wpabuf_len(data));
+	reply_res = send_auth_reply(hapd, sta->addr, bssid, WLAN_AUTH_SAE, 2,
+				    WLAN_STATUS_SUCCESS, wpabuf_head(data),
+				    wpabuf_len(data));
 
 	wpabuf_free(data);
 
-	return WLAN_STATUS_SUCCESS;
+	return reply_res;
 }
 
 
@@ -495,6 +519,9 @@ static void auth_sae_retransmit_timer(void *eloop_ctx, void *eloop_data)
 	if (sae_check_big_sync(sta))
 		return;
 	sta->sae->sync++;
+	wpa_printf(MSG_DEBUG, "SAE: Auth SAE retransmit timer for " MACSTR
+		   " (sync=%d state=%d)",
+		   MAC2STR(sta->addr), sta->sae->sync, sta->sae->state);
 
 	switch (sta->sae->state) {
 	case SAE_COMMITTED:
@@ -537,6 +564,18 @@ static void sae_set_retransmit_timer(struct hostapd_data *hapd,
 }
 
 
+void sae_accept_sta(struct hostapd_data *hapd, struct sta_info *sta)
+{
+	sta->flags |= WLAN_STA_AUTH;
+	sta->auth_alg = WLAN_AUTH_SAE;
+	mlme_authenticate_indication(hapd, sta);
+	wpa_auth_sm_event(sta->wpa_sm, WPA_AUTH);
+	sta->sae->state = SAE_ACCEPTED;
+	wpa_auth_pmksa_add_sae(hapd->wpa_auth, sta->addr,
+			       sta->sae->pmk, sta->sae->pmkid);
+}
+
+
 static int sae_sm_step(struct hostapd_data *hapd, struct sta_info *sta,
 		       const u8 *bssid, u8 auth_transaction)
 {
@@ -580,7 +619,7 @@ static int sae_sm_step(struct hostapd_data *hapd, struct sta_info *sta,
 				 * message now to get alternating sequence of
 				 * Authentication frames between the AP and STA.
 				 * Confirm will be sent in
-				 * Commited -> Confirmed/Accepted transition
+				 * Committed -> Confirmed/Accepted transition
 				 * when receiving Confirm from STA.
 				 */
 			}
@@ -659,13 +698,7 @@ static int sae_sm_step(struct hostapd_data *hapd, struct sta_info *sta,
 
 			sae_set_retransmit_timer(hapd, sta);
 		} else {
-			sta->flags |= WLAN_STA_AUTH;
-			sta->auth_alg = WLAN_AUTH_SAE;
-			mlme_authenticate_indication(hapd, sta);
-			wpa_auth_sm_event(sta->wpa_sm, WPA_AUTH);
-			sta->sae->state = SAE_ACCEPTED;
-			wpa_auth_pmksa_add_sae(hapd->wpa_auth, sta->addr,
-					       sta->sae->pmk);
+			sae_accept_sta(hapd, sta);
 		}
 		break;
 	case SAE_ACCEPTED:
@@ -674,6 +707,7 @@ static int sae_sm_step(struct hostapd_data *hapd, struct sta_info *sta,
 				   ") doing reauthentication",
 				   MAC2STR(sta->addr));
 			ap_free_sta(hapd, sta);
+			wpa_auth_pmksa_remove(hapd->wpa_auth, sta->addr);
 		} else {
 			if (sae_check_big_sync(sta))
 				return WLAN_STATUS_SUCCESS;
@@ -694,23 +728,73 @@ static int sae_sm_step(struct hostapd_data *hapd, struct sta_info *sta,
 }
 
 
+static void sae_pick_next_group(struct hostapd_data *hapd, struct sta_info *sta)
+{
+	struct sae_data *sae = sta->sae;
+	int i, *groups = hapd->conf->sae_groups;
+
+	if (sae->state != SAE_COMMITTED)
+		return;
+
+	wpa_printf(MSG_DEBUG, "SAE: Previously selected group: %d", sae->group);
+
+	for (i = 0; groups && groups[i] > 0; i++) {
+		if (sae->group == groups[i])
+			break;
+	}
+
+	if (!groups || groups[i] <= 0) {
+		wpa_printf(MSG_DEBUG,
+			   "SAE: Previously selected group not found from the current configuration");
+		return;
+	}
+
+	for (;;) {
+		i++;
+		if (groups[i] <= 0) {
+			wpa_printf(MSG_DEBUG,
+				   "SAE: No alternative group enabled");
+			return;
+		}
+
+		if (sae_set_group(sae, groups[i]) < 0)
+			continue;
+
+		break;
+	}
+	wpa_printf(MSG_DEBUG, "SAE: Selected new group: %d", groups[i]);
+}
+
+
 static void handle_auth_sae(struct hostapd_data *hapd, struct sta_info *sta,
 			    const struct ieee80211_mgmt *mgmt, size_t len,
 			    u16 auth_transaction, u16 status_code)
 {
-	u16 resp = WLAN_STATUS_SUCCESS;
+	int resp = WLAN_STATUS_SUCCESS;
 	struct wpabuf *data = NULL;
 
 	if (!sta->sae) {
-		if (auth_transaction != 1 || status_code != WLAN_STATUS_SUCCESS)
-			return;
+		if (auth_transaction != 1 ||
+		    status_code != WLAN_STATUS_SUCCESS) {
+			resp = -1;
+			goto remove_sta;
+		}
 		sta->sae = os_zalloc(sizeof(*sta->sae));
-		if (sta->sae == NULL)
-			return;
+		if (!sta->sae) {
+			resp = -1;
+			goto remove_sta;
+		}
 		sta->sae->state = SAE_NOTHING;
 		sta->sae->sync = 0;
 	}
 
+	if (sta->mesh_sae_pmksa_caching) {
+		wpa_printf(MSG_DEBUG,
+			   "SAE: Cancel use of mesh PMKSA caching because peer starts SAE authentication");
+		wpa_auth_pmksa_remove(hapd->wpa_auth, sta->addr);
+		sta->mesh_sae_pmksa_caching = 0;
+	}
+
 	if (auth_transaction == 1) {
 		const u8 *token = NULL, *pos, *end;
 		size_t token_len = 0;
@@ -746,7 +830,8 @@ static void handle_auth_sae(struct hostapd_data *hapd, struct sta_info *sta,
 			if (sta->sae->tmp->anti_clogging_token == NULL) {
 				wpa_printf(MSG_ERROR,
 					   "SAE: Failed to alloc for anti-clogging token");
-				return;
+				resp = WLAN_STATUS_UNSPECIFIED_FAILURE;
+				goto remove_sta;
 			}
 
 			/*
@@ -756,10 +841,11 @@ static void handle_auth_sae(struct hostapd_data *hapd, struct sta_info *sta,
 			 * Authentication frame, and the commit-scalar and
 			 * COMMIT-ELEMENT previously sent.
 			 */
-			if (auth_sae_send_commit(hapd, sta, mgmt->bssid, 0)) {
+			resp = auth_sae_send_commit(hapd, sta, mgmt->bssid, 0);
+			if (resp != WLAN_STATUS_SUCCESS) {
 				wpa_printf(MSG_ERROR,
 					   "SAE: Failed to send commit message");
-				return;
+				goto remove_sta;
 			}
 			sta->sae->state = SAE_COMMITTED;
 			sta->sae->sync = 0;
@@ -767,8 +853,18 @@ static void handle_auth_sae(struct hostapd_data *hapd, struct sta_info *sta,
 			return;
 		}
 
+		if ((hapd->conf->mesh & MESH_ENABLED) &&
+		    status_code ==
+		    WLAN_STATUS_FINITE_CYCLIC_GROUP_NOT_SUPPORTED &&
+		    sta->sae->tmp) {
+			wpa_printf(MSG_DEBUG,
+				   "SAE: Peer did not accept our SAE group");
+			sae_pick_next_group(hapd, sta);
+			goto remove_sta;
+		}
+
 		if (status_code != WLAN_STATUS_SUCCESS)
-			return;
+			goto remove_sta;
 
 		resp = sae_parse_commit(sta->sae, mgmt->u.auth.variable,
 					((const u8 *) mgmt) + len -
@@ -778,14 +874,15 @@ static void handle_auth_sae(struct hostapd_data *hapd, struct sta_info *sta,
 			wpa_printf(MSG_DEBUG,
 				   "SAE: Drop commit message from " MACSTR " due to reflection attack",
 				   MAC2STR(sta->addr));
-			return;
+			goto remove_sta;
 		}
 		if (token && check_sae_token(hapd, sta->addr, token, token_len)
 		    < 0) {
 			wpa_printf(MSG_DEBUG, "SAE: Drop commit message with "
 				   "incorrect token from " MACSTR,
 				   MAC2STR(sta->addr));
-			return;
+			resp = WLAN_STATUS_UNSPECIFIED_FAILURE;
+			goto remove_sta;
 		}
 
 		if (resp != WLAN_STATUS_SUCCESS)
@@ -810,7 +907,7 @@ static void handle_auth_sae(struct hostapd_data *hapd, struct sta_info *sta,
 			       "SAE authentication (RX confirm, status=%u)",
 			       status_code);
 		if (status_code != WLAN_STATUS_SUCCESS)
-			return;
+			goto remove_sta;
 		if (sta->sae->state >= SAE_CONFIRMED ||
 		    !(hapd->conf->mesh & MESH_ENABLED)) {
 			if (sae_check_confirm(sta->sae, mgmt->u.auth.variable,
@@ -827,7 +924,7 @@ static void handle_auth_sae(struct hostapd_data *hapd, struct sta_info *sta,
 			       "unexpected SAE authentication transaction %u (status=%u)",
 			       auth_transaction, status_code);
 		if (status_code != WLAN_STATUS_SUCCESS)
-			return;
+			goto remove_sta;
 		resp = WLAN_STATUS_UNKNOWN_AUTH_TRANSACTION;
 	}
 
@@ -838,6 +935,13 @@ reply:
 				data ? wpabuf_head(data) : (u8 *) "",
 				data ? wpabuf_len(data) : 0);
 	}
+
+remove_sta:
+	if (sta->added_unassoc && (resp != WLAN_STATUS_SUCCESS ||
+				   status_code != WLAN_STATUS_SUCCESS)) {
+		hostapd_drv_sta_remove(hapd, sta->addr);
+		sta->added_unassoc = 0;
+	}
 	wpabuf_free(data);
 }
 
@@ -882,11 +986,11 @@ static void handle_auth(struct hostapd_data *hapd,
 	u16 auth_alg, auth_transaction, status_code;
 	u16 resp = WLAN_STATUS_SUCCESS;
 	struct sta_info *sta = NULL;
-	int res;
+	int res, reply_res;
 	u16 fc;
 	const u8 *challenge = NULL;
 	u32 session_timeout, acct_interim_interval;
-	int vlan_id = 0;
+	struct vlan_description vlan_id;
 	struct hostapd_sta_wpa_psk_short *psk = NULL;
 	u8 resp_ies[2 + WLAN_AUTH_CHALLENGE_LEN];
 	size_t resp_ies_len = 0;
@@ -894,6 +998,8 @@ static void handle_auth(struct hostapd_data *hapd,
 	char *radius_cui = NULL;
 	u16 seq_ctrl;
 
+	os_memset(&vlan_id, 0, sizeof(vlan_id));
+
 	if (len < IEEE80211_HDRLEN + sizeof(mgmt->u.auth)) {
 		wpa_printf(MSG_INFO, "handle_auth - too short payload (len=%lu)",
 			   (unsigned long) len);
@@ -1067,13 +1173,22 @@ static void handle_auth(struct hostapd_data *hapd,
 				       seq_ctrl);
 			return;
 		}
+#ifdef CONFIG_MESH
+		if ((hapd->conf->mesh & MESH_ENABLED) &&
+		    sta->plink_state == PLINK_BLOCKED) {
+			wpa_printf(MSG_DEBUG, "Mesh peer " MACSTR
+				   " is blocked - drop Authentication frame",
+				   MAC2STR(mgmt->sa));
+			return;
+		}
+#endif /* CONFIG_MESH */
 	} else {
 #ifdef CONFIG_MESH
 		if (hapd->conf->mesh & MESH_ENABLED) {
 			/* if the mesh peer is not available, we don't do auth.
 			 */
 			wpa_printf(MSG_DEBUG, "Mesh peer " MACSTR
-				   " not yet known - drop Authentiation frame",
+				   " not yet known - drop Authentication frame",
 				   MAC2STR(mgmt->sa));
 			/*
 			 * Save a copy of the frame so that it can be processed
@@ -1095,19 +1210,23 @@ static void handle_auth(struct hostapd_data *hapd,
 	sta->last_seq_ctrl = seq_ctrl;
 	sta->last_subtype = WLAN_FC_STYPE_AUTH;
 
-	if (vlan_id > 0) {
-		if (!hostapd_vlan_id_valid(hapd->conf->vlan, vlan_id)) {
-			hostapd_logger(hapd, sta->addr, HOSTAPD_MODULE_RADIUS,
-				       HOSTAPD_LEVEL_INFO, "Invalid VLAN ID "
-				       "%d received from RADIUS server",
-				       vlan_id);
-			resp = WLAN_STATUS_UNSPECIFIED_FAILURE;
-			goto fail;
-		}
-		sta->vlan_id = vlan_id;
+	if (vlan_id.notempty &&
+	    !hostapd_vlan_valid(hapd->conf->vlan, &vlan_id)) {
 		hostapd_logger(hapd, sta->addr, HOSTAPD_MODULE_RADIUS,
-			       HOSTAPD_LEVEL_INFO, "VLAN ID %d", sta->vlan_id);
+			       HOSTAPD_LEVEL_INFO,
+			       "Invalid VLAN %d%s received from RADIUS server",
+			       vlan_id.untagged,
+			       vlan_id.tagged[0] ? "+" : "");
+		resp = WLAN_STATUS_UNSPECIFIED_FAILURE;
+		goto fail;
 	}
+	if (ap_sta_set_vlan(hapd, sta, &vlan_id) < 0) {
+		resp = WLAN_STATUS_UNSPECIFIED_FAILURE;
+		goto fail;
+	}
+	if (sta->vlan_id)
+		hostapd_logger(hapd, sta->addr, HOSTAPD_MODULE_RADIUS,
+			       HOSTAPD_LEVEL_INFO, "VLAN ID %d", sta->vlan_id);
 
 	hostapd_free_psk_list(sta->psk);
 	if (hapd->conf->wpa_psk_radius != PSK_RADIUS_IGNORED) {
@@ -1132,6 +1251,46 @@ static void handle_auth(struct hostapd_data *hapd,
 	else
 		ap_sta_no_session_timeout(hapd, sta);
 
+	/*
+	 * If the driver supports full AP client state, add a station to the
+	 * driver before sending authentication reply to make sure the driver
+	 * has resources, and not to go through the entire authentication and
+	 * association handshake, and fail it at the end.
+	 *
+	 * If this is not the first transaction, in a multi-step authentication
+	 * algorithm, the station already exists in the driver
+	 * (sta->added_unassoc = 1) so skip it.
+	 *
+	 * In mesh mode, the station was already added to the driver when the
+	 * NEW_PEER_CANDIDATE event is received.
+	 */
+	if (FULL_AP_CLIENT_STATE_SUPP(hapd->iface->drv_flags) &&
+	    !(hapd->conf->mesh & MESH_ENABLED) &&
+	    !(sta->added_unassoc)) {
+		/*
+		 * If a station that is already associated to the AP, is trying
+		 * to authenticate again, remove the STA entry, in order to make
+		 * sure the STA PS state gets cleared and configuration gets
+		 * updated. To handle this, station's added_unassoc flag is
+		 * cleared once the station has completed association.
+		 */
+		hostapd_drv_sta_remove(hapd, sta->addr);
+		sta->flags &= ~(WLAN_STA_ASSOC | WLAN_STA_AUTH |
+				WLAN_STA_AUTHORIZED);
+
+		if (hostapd_sta_add(hapd, sta->addr, 0, 0, NULL, 0, 0,
+				    NULL, NULL, sta->flags, 0, 0, 0, 0)) {
+			hostapd_logger(hapd, sta->addr,
+				       HOSTAPD_MODULE_IEEE80211,
+				       HOSTAPD_LEVEL_NOTICE,
+				       "Could not add STA to kernel driver");
+			resp = WLAN_STATUS_AP_UNABLE_TO_HANDLE_NEW_STA;
+			goto fail;
+		}
+
+		sta->added_unassoc = 1;
+	}
+
 	switch (auth_alg) {
 	case WLAN_AUTH_OPEN:
 		hostapd_logger(hapd, sta->addr, HOSTAPD_MODULE_IEEE80211,
@@ -1205,12 +1364,19 @@ static void handle_auth(struct hostapd_data *hapd,
 	os_free(radius_cui);
 	hostapd_free_psk_list(psk);
 
-	send_auth_reply(hapd, mgmt->sa, mgmt->bssid, auth_alg,
-			auth_transaction + 1, resp, resp_ies, resp_ies_len);
+	reply_res = send_auth_reply(hapd, mgmt->sa, mgmt->bssid, auth_alg,
+				    auth_transaction + 1, resp, resp_ies,
+				    resp_ies_len);
+
+	if (sta && sta->added_unassoc && (resp != WLAN_STATUS_SUCCESS ||
+					  reply_res != WLAN_STATUS_SUCCESS)) {
+		hostapd_drv_sta_remove(hapd, sta->addr);
+		sta->added_unassoc = 0;
+	}
 }
 
 
-static int hostapd_get_aid(struct hostapd_data *hapd, struct sta_info *sta)
+int hostapd_get_aid(struct hostapd_data *hapd, struct sta_info *sta)
 {
 	int i, j = 32, aid;
 
@@ -1220,6 +1386,9 @@ static int hostapd_get_aid(struct hostapd_data *hapd, struct sta_info *sta)
 		return 0;
 	}
 
+	if (TEST_FAIL())
+		return -1;
+
 	for (i = 0; i < AID_WORDS; i++) {
 		if (hapd->sta_aid[i] == (u32) -1)
 			continue;
@@ -1327,6 +1496,9 @@ static u16 check_ext_capab(struct hostapd_data *hapd, struct sta_info *sta,
 	}
 #endif /* CONFIG_INTERWORKING */
 
+	if (ext_capab_ie_len > 0)
+		sta->ecsa_supported = !!(ext_capab_ie[0] & BIT(2));
+
 	return WLAN_STATUS_SUCCESS;
 }
 
@@ -1617,6 +1789,27 @@ static u16 check_assoc_ies(struct hostapd_data *hapd, struct sta_info *sta,
 		sta->mb_ies = NULL;
 #endif /* CONFIG_FST */
 
+#ifdef CONFIG_MBO
+	mbo_ap_check_sta_assoc(hapd, sta, &elems);
+
+	if (hapd->conf->mbo_enabled && (hapd->conf->wpa & 2) &&
+	    elems.mbo && sta->cell_capa && !(sta->flags & WLAN_STA_MFP) &&
+	    hapd->conf->ieee80211w != NO_MGMT_FRAME_PROTECTION) {
+		wpa_printf(MSG_INFO,
+			   "MBO: Reject WPA2 association without PMF");
+		return WLAN_STATUS_UNSPECIFIED_FAILURE;
+	}
+#endif /* CONFIG_MBO */
+
+	ap_copy_sta_supp_op_classes(sta, elems.supp_op_classes,
+				    elems.supp_op_classes_len);
+
+	if ((sta->capability & WLAN_CAPABILITY_RADIO_MEASUREMENT) &&
+	    elems.rrm_enabled &&
+	    elems.rrm_enabled_len >= sizeof(sta->rrm_enabled_capa))
+		os_memcpy(sta->rrm_enabled_capa, elems.rrm_enabled,
+			  sizeof(sta->rrm_enabled_capa));
+
 	return WLAN_STATUS_SUCCESS;
 }
 
@@ -1643,9 +1836,66 @@ static void send_deauth(struct hostapd_data *hapd, const u8 *addr,
 }
 
 
-static void send_assoc_resp(struct hostapd_data *hapd, struct sta_info *sta,
-			    u16 status_code, int reassoc, const u8 *ies,
-			    size_t ies_len)
+static int add_associated_sta(struct hostapd_data *hapd,
+			      struct sta_info *sta)
+{
+	struct ieee80211_ht_capabilities ht_cap;
+	struct ieee80211_vht_capabilities vht_cap;
+
+	/*
+	 * Remove the STA entry to ensure the STA PS state gets cleared and
+	 * configuration gets updated. This is relevant for cases, such as
+	 * FT-over-the-DS, where a station re-associates back to the same AP but
+	 * skips the authentication flow, or if working with a driver that
+	 * does not support full AP client state.
+	 */
+	if (!sta->added_unassoc)
+		hostapd_drv_sta_remove(hapd, sta->addr);
+
+#ifdef CONFIG_IEEE80211N
+	if (sta->flags & WLAN_STA_HT)
+		hostapd_get_ht_capab(hapd, sta->ht_capabilities, &ht_cap);
+#endif /* CONFIG_IEEE80211N */
+#ifdef CONFIG_IEEE80211AC
+	if (sta->flags & WLAN_STA_VHT)
+		hostapd_get_vht_capab(hapd, sta->vht_capabilities, &vht_cap);
+#endif /* CONFIG_IEEE80211AC */
+
+	/*
+	 * Add the station with forced WLAN_STA_ASSOC flag. The sta->flags
+	 * will be set when the ACK frame for the (Re)Association Response frame
+	 * is processed (TX status driver event).
+	 */
+	if (hostapd_sta_add(hapd, sta->addr, sta->aid, sta->capability,
+			    sta->supported_rates, sta->supported_rates_len,
+			    sta->listen_interval,
+			    sta->flags & WLAN_STA_HT ? &ht_cap : NULL,
+			    sta->flags & WLAN_STA_VHT ? &vht_cap : NULL,
+			    sta->flags | WLAN_STA_ASSOC, sta->qosinfo,
+			    sta->vht_opmode, sta->p2p_ie ? 1 : 0,
+			    sta->added_unassoc)) {
+		hostapd_logger(hapd, sta->addr,
+			       HOSTAPD_MODULE_IEEE80211, HOSTAPD_LEVEL_NOTICE,
+			       "Could not %s STA to kernel driver",
+			       sta->added_unassoc ? "set" : "add");
+
+		if (sta->added_unassoc) {
+			hostapd_drv_sta_remove(hapd, sta->addr);
+			sta->added_unassoc = 0;
+		}
+
+		return -1;
+	}
+
+	sta->added_unassoc = 0;
+
+	return 0;
+}
+
+
+static u16 send_assoc_resp(struct hostapd_data *hapd, struct sta_info *sta,
+			   u16 status_code, int reassoc, const u8 *ies,
+			   size_t ies_len)
 {
 	int send_len;
 	u8 buf[sizeof(struct ieee80211_mgmt) + 1024];
@@ -1695,7 +1945,23 @@ static void send_assoc_resp(struct hostapd_data *hapd, struct sta_info *sta,
 
 #ifdef CONFIG_IEEE80211AC
 	if (hapd->iconf->ieee80211ac && !hapd->conf->disable_11ac) {
-		p = hostapd_eid_vht_capabilities(hapd, p);
+		u32 nsts = 0, sta_nsts;
+
+		if (hapd->conf->use_sta_nsts && sta->vht_capabilities) {
+			struct ieee80211_vht_capabilities *capa;
+
+			nsts = (hapd->iface->conf->vht_capab >>
+				VHT_CAP_BEAMFORMEE_STS_OFFSET) & 7;
+			capa = sta->vht_capabilities;
+			sta_nsts = (le_to_host32(capa->vht_capabilities_info) >>
+				    VHT_CAP_BEAMFORMEE_STS_OFFSET) & 7;
+
+			if (nsts < sta_nsts)
+				nsts = 0;
+			else
+				nsts = sta_nsts;
+		}
+		p = hostapd_eid_vht_capabilities(hapd, p, nsts);
 		p = hostapd_eid_vht_operation(hapd, p);
 	}
 #endif /* CONFIG_IEEE80211AC */
@@ -1734,7 +2000,7 @@ static void send_assoc_resp(struct hostapd_data *hapd, struct sta_info *sta,
 #endif /* CONFIG_WPS */
 
 #ifdef CONFIG_P2P
-	if (sta->p2p_ie) {
+	if (sta->p2p_ie && hapd->p2p_group) {
 		struct wpabuf *p2p_resp_ie;
 		enum p2p_status_code status;
 		switch (status_code) {
@@ -1763,11 +2029,25 @@ static void send_assoc_resp(struct hostapd_data *hapd, struct sta_info *sta,
 		p = hostapd_eid_p2p_manage(hapd, p);
 #endif /* CONFIG_P2P_MANAGER */
 
+	p = hostapd_eid_mbo(hapd, p, buf + sizeof(buf) - p);
+
+	if (hapd->conf->assocresp_elements &&
+	    (size_t) (buf + sizeof(buf) - p) >=
+	    wpabuf_len(hapd->conf->assocresp_elements)) {
+		os_memcpy(p, wpabuf_head(hapd->conf->assocresp_elements),
+			  wpabuf_len(hapd->conf->assocresp_elements));
+		p += wpabuf_len(hapd->conf->assocresp_elements);
+	}
+
 	send_len += p - reply->u.assoc_resp.variable;
 
-	if (hostapd_drv_send_mlme(hapd, reply, send_len, 0) < 0)
+	if (hostapd_drv_send_mlme(hapd, reply, send_len, 0) < 0) {
 		wpa_printf(MSG_INFO, "Failed to send assoc resp: %s",
 			   strerror(errno));
+		return WLAN_STATUS_UNSPECIFIED_FAILURE;
+	}
+
+	return WLAN_STATUS_SUCCESS;
 }
 
 
@@ -1776,7 +2056,7 @@ static void handle_assoc(struct hostapd_data *hapd,
 			 int reassoc)
 {
 	u16 capab_info, listen_interval, seq_ctrl, fc;
-	u16 resp = WLAN_STATUS_SUCCESS;
+	u16 resp = WLAN_STATUS_SUCCESS, reply_res;
 	const u8 *pos;
 	int left, i;
 	struct sta_info *sta;
@@ -1843,6 +2123,12 @@ static void handle_assoc(struct hostapd_data *hapd,
 		wpa_printf(MSG_DEBUG, "FT: Allow STA " MACSTR " to associate "
 			   "prior to authentication since it is using "
 			   "over-the-DS FT", MAC2STR(mgmt->sa));
+
+		/*
+		 * Mark station as authenticated, to avoid adding station
+		 * entry in the driver as associated and not authenticated
+		 */
+		sta->flags |= WLAN_STA_AUTH;
 	} else
 #endif /* CONFIG_IEEE80211R */
 	if (sta == NULL || (sta->flags & WLAN_STA_AUTH) == 0) {
@@ -1886,6 +2172,19 @@ static void handle_assoc(struct hostapd_data *hapd,
 		goto fail;
 	}
 
+#ifdef CONFIG_MBO
+	if (hapd->conf->mbo_enabled && hapd->mbo_assoc_disallow) {
+		resp = WLAN_STATUS_AP_UNABLE_TO_HANDLE_NEW_STA;
+		goto fail;
+	}
+#endif /* CONFIG_MBO */
+
+	/*
+	 * sta->capability is used in check_assoc_ies() for RRM enabled
+	 * capability element.
+	 */
+	sta->capability = capab_info;
+
 	/* followed by SSID and Supported rates; and HT capabilities if 802.11n
 	 * is used */
 	resp = check_assoc_ies(hapd, sta, pos, left, reassoc);
@@ -1899,7 +2198,6 @@ static void handle_assoc(struct hostapd_data *hapd,
 		goto fail;
 	}
 
-	sta->capability = capab_info;
 	sta->listen_interval = listen_interval;
 
 	if (hapd->iface->current_mode->mode == HOSTAPD_MODE_IEEE80211G)
@@ -1969,8 +2267,44 @@ static void handle_assoc(struct hostapd_data *hapd,
 	 * remove the STA immediately. */
 	sta->timeout_next = STA_NULLFUNC;
 
+#ifdef CONFIG_TAXONOMY
+	taxonomy_sta_info_assoc_req(hapd, sta, pos, left);
+#endif /* CONFIG_TAXONOMY */
+
  fail:
-	send_assoc_resp(hapd, sta, resp, reassoc, pos, left);
+	/*
+	 * In case of a successful response, add the station to the driver.
+	 * Otherwise, the kernel may ignore Data frames before we process the
+	 * ACK frame (TX status). In case of a failure, this station will be
+	 * removed.
+	 *
+	 * Note that this is not compliant with the IEEE 802.11 standard that
+	 * states that a non-AP station should transition into the
+	 * authenticated/associated state only after the station acknowledges
+	 * the (Re)Association Response frame. However, still do this as:
+	 *
+	 * 1. In case the station does not acknowledge the (Re)Association
+	 *    Response frame, it will be removed.
+	 * 2. Data frames will be dropped in the kernel until the station is
+	 *    set into authorized state, and there are no significant known
+	 *    issues with processing other non-Data Class 3 frames during this
+	 *    window.
+	 */
+	if (resp == WLAN_STATUS_SUCCESS && add_associated_sta(hapd, sta))
+		resp = WLAN_STATUS_AP_UNABLE_TO_HANDLE_NEW_STA;
+
+	reply_res = send_assoc_resp(hapd, sta, resp, reassoc, pos, left);
+
+	/*
+	 * Remove the station in case tranmission of a success response fails
+	 * (the STA was added associated to the driver) or if the station was
+	 * previously added unassociated.
+	 */
+	if ((reply_res != WLAN_STATUS_SUCCESS &&
+	     resp == WLAN_STATUS_SUCCESS) || sta->added_unassoc) {
+		hostapd_drv_sta_remove(hapd, sta->addr);
+		sta->added_unassoc = 0;
+	}
 }
 
 
@@ -2007,11 +2341,12 @@ static void handle_disassoc(struct hostapd_data *hapd,
 	/* Stop Accounting and IEEE 802.1X sessions, but leave the STA
 	 * authenticated. */
 	accounting_sta_stop(hapd, sta);
-	ieee802_1x_free_station(sta);
+	ieee802_1x_free_station(hapd, sta);
 	if (sta->ipaddr)
 		hostapd_drv_br_delete_ip_neigh(hapd, 4, (u8 *) &sta->ipaddr);
 	ap_sta_ip6addr_del(hapd, sta);
 	hostapd_drv_sta_remove(hapd, sta->addr);
+	sta->added_unassoc = 0;
 
 	if (sta->timeout_next == STA_NULLFUNC ||
 	    sta->timeout_next == STA_DISASSOC) {
@@ -2233,6 +2568,9 @@ static int handle_action(struct hostapd_data *hapd,
 				return 1;
 		}
 		break;
+	case WLAN_ACTION_RADIO_MEASUREMENT:
+		hostapd_handle_radio_measurement(hapd, (const u8 *) mgmt, len);
+		return 1;
 	}
 
 	hostapd_logger(hapd, mgmt->sa, HOSTAPD_MODULE_IEEE80211,
@@ -2240,8 +2578,9 @@ static int handle_action(struct hostapd_data *hapd,
 		       "handle_action - unknown action category %d or invalid "
 		       "frame",
 		       mgmt->u.action.category);
-	if (!(mgmt->da[0] & 0x01) && !(mgmt->u.action.category & 0x80) &&
-	    !(mgmt->sa[0] & 0x01)) {
+	if (!is_multicast_ether_addr(mgmt->da) &&
+	    !(mgmt->u.action.category & 0x80) &&
+	    !is_multicast_ether_addr(mgmt->sa)) {
 		struct ieee80211_mgmt *resp;
 
 		/*
@@ -2288,7 +2627,6 @@ int ieee802_11_mgmt(struct hostapd_data *hapd, const u8 *buf, size_t len,
 		    struct hostapd_frame_info *fi)
 {
 	struct ieee80211_mgmt *mgmt;
-	int broadcast;
 	u16 fc, stype;
 	int ret = 0;
 
@@ -2304,11 +2642,7 @@ int ieee802_11_mgmt(struct hostapd_data *hapd, const u8 *buf, size_t len,
 		return 1;
 	}
 
-	broadcast = mgmt->bssid[0] == 0xff && mgmt->bssid[1] == 0xff &&
-		mgmt->bssid[2] == 0xff && mgmt->bssid[3] == 0xff &&
-		mgmt->bssid[4] == 0xff && mgmt->bssid[5] == 0xff;
-
-	if (!broadcast &&
+	if (!is_broadcast_ether_addr(mgmt->bssid) &&
 #ifdef CONFIG_P2P
 	    /* Invitation responses can be sent with the peer MAC as BSSID */
 	    !((hapd->conf->p2p & P2P_GROUP_OWNER) &&
@@ -2388,28 +2722,28 @@ static void handle_auth_cb(struct hostapd_data *hapd,
 	u16 auth_alg, auth_transaction, status_code;
 	struct sta_info *sta;
 
+	sta = ap_get_sta(hapd, mgmt->da);
+	if (!sta) {
+		wpa_printf(MSG_INFO, "handle_auth_cb: STA " MACSTR " not found",
+			   MAC2STR(mgmt->da));
+		return;
+	}
+
+	auth_alg = le_to_host16(mgmt->u.auth.auth_alg);
+	auth_transaction = le_to_host16(mgmt->u.auth.auth_transaction);
+	status_code = le_to_host16(mgmt->u.auth.status_code);
+
 	if (!ok) {
 		hostapd_logger(hapd, mgmt->da, HOSTAPD_MODULE_IEEE80211,
 			       HOSTAPD_LEVEL_NOTICE,
 			       "did not acknowledge authentication response");
-		return;
+		goto fail;
 	}
 
 	if (len < IEEE80211_HDRLEN + sizeof(mgmt->u.auth)) {
 		wpa_printf(MSG_INFO, "handle_auth_cb - too short payload (len=%lu)",
 			   (unsigned long) len);
-		return;
-	}
-
-	auth_alg = le_to_host16(mgmt->u.auth.auth_alg);
-	auth_transaction = le_to_host16(mgmt->u.auth.auth_transaction);
-	status_code = le_to_host16(mgmt->u.auth.status_code);
-
-	sta = ap_get_sta(hapd, mgmt->da);
-	if (!sta) {
-		wpa_printf(MSG_INFO, "handle_auth_cb: STA " MACSTR " not found",
-			   MAC2STR(mgmt->da));
-		return;
+		goto fail;
 	}
 
 	if (status_code == WLAN_STATUS_SUCCESS &&
@@ -2418,6 +2752,15 @@ static void handle_auth_cb(struct hostapd_data *hapd,
 		hostapd_logger(hapd, sta->addr, HOSTAPD_MODULE_IEEE80211,
 			       HOSTAPD_LEVEL_INFO, "authenticated");
 		sta->flags |= WLAN_STA_AUTH;
+		if (sta->added_unassoc)
+			hostapd_set_sta_flags(hapd, sta);
+		return;
+	}
+
+fail:
+	if (status_code != WLAN_STATUS_SUCCESS && sta->added_unassoc) {
+		hostapd_drv_sta_remove(hapd, sta->addr);
+		sta->added_unassoc = 0;
 	}
 }
 
@@ -2453,15 +2796,6 @@ static void handle_assoc_cb(struct hostapd_data *hapd,
 	u16 status;
 	struct sta_info *sta;
 	int new_assoc = 1;
-	struct ieee80211_ht_capabilities ht_cap;
-	struct ieee80211_vht_capabilities vht_cap;
-
-	if (len < IEEE80211_HDRLEN + (reassoc ? sizeof(mgmt->u.reassoc_resp) :
-				      sizeof(mgmt->u.assoc_resp))) {
-		wpa_printf(MSG_INFO, "handle_assoc_cb(reassoc=%d) - too short payload (len=%lu)",
-			   reassoc, (unsigned long) len);
-		return;
-	}
 
 	sta = ap_get_sta(hapd, mgmt->da);
 	if (!sta) {
@@ -2470,11 +2804,12 @@ static void handle_assoc_cb(struct hostapd_data *hapd,
 		return;
 	}
 
-	if (!ok) {
-		hostapd_logger(hapd, mgmt->da, HOSTAPD_MODULE_IEEE80211,
-			       HOSTAPD_LEVEL_DEBUG,
-			       "did not acknowledge association response");
-		sta->flags &= ~WLAN_STA_ASSOC_REQ_OK;
+	if (len < IEEE80211_HDRLEN + (reassoc ? sizeof(mgmt->u.reassoc_resp) :
+				      sizeof(mgmt->u.assoc_resp))) {
+		wpa_printf(MSG_INFO,
+			   "handle_assoc_cb(reassoc=%d) - too short payload (len=%lu)",
+			   reassoc, (unsigned long) len);
+		hostapd_drv_sta_remove(hapd, sta->addr);
 		return;
 	}
 
@@ -2483,6 +2818,18 @@ static void handle_assoc_cb(struct hostapd_data *hapd,
 	else
 		status = le_to_host16(mgmt->u.assoc_resp.status_code);
 
+	if (!ok) {
+		hostapd_logger(hapd, mgmt->da, HOSTAPD_MODULE_IEEE80211,
+			       HOSTAPD_LEVEL_DEBUG,
+			       "did not acknowledge association response");
+		sta->flags &= ~WLAN_STA_ASSOC_REQ_OK;
+		/* The STA is added only in case of SUCCESS */
+		if (status == WLAN_STATUS_SUCCESS)
+			hostapd_drv_sta_remove(hapd, sta->addr);
+
+		return;
+	}
+
 	if (status != WLAN_STATUS_SUCCESS)
 		return;
 
@@ -2517,38 +2864,6 @@ static void handle_assoc_cb(struct hostapd_data *hapd,
 	sta->sa_query_timed_out = 0;
 #endif /* CONFIG_IEEE80211W */
 
-	/*
-	 * Remove the STA entry in order to make sure the STA PS state gets
-	 * cleared and configuration gets updated in case of reassociation back
-	 * to the same AP.
-	 */
-	hostapd_drv_sta_remove(hapd, sta->addr);
-
-#ifdef CONFIG_IEEE80211N
-	if (sta->flags & WLAN_STA_HT)
-		hostapd_get_ht_capab(hapd, sta->ht_capabilities, &ht_cap);
-#endif /* CONFIG_IEEE80211N */
-#ifdef CONFIG_IEEE80211AC
-	if (sta->flags & WLAN_STA_VHT)
-		hostapd_get_vht_capab(hapd, sta->vht_capabilities, &vht_cap);
-#endif /* CONFIG_IEEE80211AC */
-
-	if (hostapd_sta_add(hapd, sta->addr, sta->aid, sta->capability,
-			    sta->supported_rates, sta->supported_rates_len,
-			    sta->listen_interval,
-			    sta->flags & WLAN_STA_HT ? &ht_cap : NULL,
-			    sta->flags & WLAN_STA_VHT ? &vht_cap : NULL,
-			    sta->flags, sta->qosinfo, sta->vht_opmode)) {
-		hostapd_logger(hapd, sta->addr, HOSTAPD_MODULE_IEEE80211,
-			       HOSTAPD_LEVEL_NOTICE,
-			       "Could not add STA to kernel driver");
-
-		ap_sta_disconnect(hapd, sta, sta->addr,
-				  WLAN_REASON_DISASSOC_AP_BUSY);
-
-		return;
-	}
-
 	if (sta->flags & WLAN_STA_WDS) {
 		int ret;
 		char ifname_wds[IFNAMSIZ + 1];
@@ -2580,8 +2895,26 @@ static void handle_assoc_cb(struct hostapd_data *hapd,
 	else
 		wpa_auth_sm_event(sta->wpa_sm, WPA_ASSOC);
 	hapd->new_assoc_sta_cb(hapd, sta, !new_assoc);
-
 	ieee802_1x_notify_port_enabled(sta->eapol_sm, 1);
+
+	if (sta->pending_eapol_rx) {
+		struct os_reltime now, age;
+
+		os_get_reltime(&now);
+		os_reltime_sub(&now, &sta->pending_eapol_rx->rx_time, &age);
+		if (age.sec == 0 && age.usec < 200000) {
+			wpa_printf(MSG_DEBUG,
+				   "Process pending EAPOL frame that was received from " MACSTR " just before association notification",
+				   MAC2STR(sta->addr));
+			ieee802_1x_receive(
+				hapd, mgmt->da,
+				wpabuf_head(sta->pending_eapol_rx->buf),
+				wpabuf_len(sta->pending_eapol_rx->buf));
+		}
+		wpabuf_free(sta->pending_eapol_rx->buf);
+		os_free(sta->pending_eapol_rx);
+		sta->pending_eapol_rx = NULL;
+	}
 }
 
 
@@ -2590,7 +2923,7 @@ static void handle_deauth_cb(struct hostapd_data *hapd,
 			     size_t len, int ok)
 {
 	struct sta_info *sta;
-	if (mgmt->da[0] & 0x01)
+	if (is_multicast_ether_addr(mgmt->da))
 		return;
 	sta = ap_get_sta(hapd, mgmt->da);
 	if (!sta) {
@@ -2614,7 +2947,7 @@ static void handle_disassoc_cb(struct hostapd_data *hapd,
 			       size_t len, int ok)
 {
 	struct sta_info *sta;
-	if (mgmt->da[0] & 0x01)
+	if (is_multicast_ether_addr(mgmt->da))
 		return;
 	sta = ap_get_sta(hapd, mgmt->da);
 	if (!sta) {
@@ -2670,7 +3003,7 @@ void ieee802_11_mgmt_cb(struct hostapd_data *hapd, const u8 *buf, size_t len,
 		handle_assoc_cb(hapd, mgmt, len, 1, ok);
 		break;
 	case WLAN_FC_STYPE_PROBE_RESP:
-		wpa_printf(MSG_EXCESSIVE, "mgmt::proberesp cb");
+		wpa_printf(MSG_EXCESSIVE, "mgmt::proberesp cb ok=%d", ok);
 		break;
 	case WLAN_FC_STYPE_DEAUTH:
 		wpa_printf(MSG_DEBUG, "mgmt::deauth cb");
@@ -2681,7 +3014,7 @@ void ieee802_11_mgmt_cb(struct hostapd_data *hapd, const u8 *buf, size_t len,
 		handle_disassoc_cb(hapd, mgmt, len, ok);
 		break;
 	case WLAN_FC_STYPE_ACTION:
-		wpa_printf(MSG_DEBUG, "mgmt::action cb");
+		wpa_printf(MSG_DEBUG, "mgmt::action cb ok=%d", ok);
 		break;
 	default:
 		wpa_printf(MSG_INFO, "unknown mgmt cb frame subtype %d", stype);
@@ -2779,6 +3112,8 @@ void hostapd_client_poll_ok(struct hostapd_data *hapd, const u8 *addr)
 	}
 	if (sta == NULL)
 		return;
+	wpa_msg(hapd->msg_ctx, MSG_INFO, AP_STA_POLL_OK MACSTR,
+		MAC2STR(sta->addr));
 	if (!(sta->flags & WLAN_STA_PENDING_POLL))
 		return;
 
@@ -2817,7 +3152,7 @@ void ieee802_11_rx_from_unknown(struct hostapd_data *hapd, const u8 *src,
 
 	wpa_printf(MSG_DEBUG, "Data/PS-poll frame from not associated STA "
 		   MACSTR, MAC2STR(src));
-	if (src[0] & 0x01) {
+	if (is_multicast_ether_addr(src)) {
 		/* Broadcast bit set in SA?! Ignore the frame silently. */
 		return;
 	}
diff --git a/src/ap/ieee802_11.h b/src/ap/ieee802_11.h
index 44c1bff364ac4..0327dec2a2bc3 100644
--- a/src/ap/ieee802_11.h
+++ b/src/ap/ieee802_11.h
@@ -49,9 +49,13 @@ u8 * hostapd_eid_supp_rates(struct hostapd_data *hapd, u8 *eid);
 u8 * hostapd_eid_ext_supp_rates(struct hostapd_data *hapd, u8 *eid);
 u8 * hostapd_eid_ht_capabilities(struct hostapd_data *hapd, u8 *eid);
 u8 * hostapd_eid_ht_operation(struct hostapd_data *hapd, u8 *eid);
-u8 * hostapd_eid_vht_capabilities(struct hostapd_data *hapd, u8 *eid);
+u8 * hostapd_eid_secondary_channel(struct hostapd_data *hapd, u8 *eid);
+u8 * hostapd_eid_vht_capabilities(struct hostapd_data *hapd, u8 *eid, u32 nsts);
 u8 * hostapd_eid_vht_operation(struct hostapd_data *hapd, u8 *eid);
 u8 * hostapd_eid_vendor_vht(struct hostapd_data *hapd, u8 *eid);
+u8 * hostapd_eid_wb_chsw_wrapper(struct hostapd_data *hapd, u8 *eid);
+u8 * hostapd_eid_txpower_envelope(struct hostapd_data *hapd, u8 *eid);
+
 int hostapd_ht_operation_update(struct hostapd_iface *iface);
 void ieee802_11_send_sa_query_req(struct hostapd_data *hapd,
 				  const u8 *addr, const u8 *trans_id);
@@ -61,6 +65,7 @@ void hostapd_get_ht_capab(struct hostapd_data *hapd,
 void hostapd_get_vht_capab(struct hostapd_data *hapd,
 			   struct ieee80211_vht_capabilities *vht_cap,
 			   struct ieee80211_vht_capabilities *neg_vht_cap);
+int hostapd_get_aid(struct hostapd_data *hapd, struct sta_info *sta);
 u16 copy_sta_ht_capab(struct hostapd_data *hapd, struct sta_info *sta,
 		      const u8 *ht_capab);
 u16 copy_sta_vendor_vht(struct hostapd_data *hapd, struct sta_info *sta,
@@ -97,6 +102,7 @@ int auth_sae_init_committed(struct hostapd_data *hapd, struct sta_info *sta);
 #ifdef CONFIG_SAE
 void sae_clear_retransmit_timer(struct hostapd_data *hapd,
 				struct sta_info *sta);
+void sae_accept_sta(struct hostapd_data *hapd, struct sta_info *sta);
 #else /* CONFIG_SAE */
 static inline void sae_clear_retransmit_timer(struct hostapd_data *hapd,
 					      struct sta_info *sta)
@@ -104,4 +110,29 @@ static inline void sae_clear_retransmit_timer(struct hostapd_data *hapd,
 }
 #endif /* CONFIG_SAE */
 
+#ifdef CONFIG_MBO
+
+u8 * hostapd_eid_mbo(struct hostapd_data *hapd, u8 *eid, size_t len);
+
+u8 hostapd_mbo_ie_len(struct hostapd_data *hapd);
+
+#else /* CONFIG_MBO */
+
+static inline u8 * hostapd_eid_mbo(struct hostapd_data *hapd, u8 *eid,
+				   size_t len)
+{
+	return eid;
+}
+
+static inline u8 hostapd_mbo_ie_len(struct hostapd_data *hapd)
+{
+	return 0;
+}
+
+#endif /* CONFIG_MBO */
+
+void ap_copy_sta_supp_op_classes(struct sta_info *sta,
+				 const u8 *supp_op_classes,
+				 size_t supp_op_classes_len);
+
 #endif /* IEEE802_11_H */
diff --git a/src/ap/ieee802_11_auth.c b/src/ap/ieee802_11_auth.c
index 531a67da412c6..b8905373618db 100644
--- a/src/ap/ieee802_11_auth.c
+++ b/src/ap/ieee802_11_auth.c
@@ -15,7 +15,6 @@
 
 #include "utils/common.h"
 #include "utils/eloop.h"
-#include "crypto/sha1.h"
 #include "radius/radius.h"
 #include "radius/radius_client.h"
 #include "hostapd.h"
@@ -35,7 +34,7 @@ struct hostapd_cached_radius_acl {
 	struct hostapd_cached_radius_acl *next;
 	u32 session_timeout;
 	u32 acct_interim_interval;
-	int vlan_id;
+	struct vlan_description vlan_id;
 	struct hostapd_sta_wpa_psk_short *psk;
 	char *identity;
 	char *radius_cui;
@@ -77,29 +76,20 @@ static void hostapd_acl_cache_free(struct hostapd_cached_radius_acl *acl_cache)
 static void copy_psk_list(struct hostapd_sta_wpa_psk_short **psk,
 			  struct hostapd_sta_wpa_psk_short *src)
 {
-	struct hostapd_sta_wpa_psk_short **copy_to;
-	struct hostapd_sta_wpa_psk_short *copy_from;
-
-	/* Copy PSK linked list */
-	copy_to = psk;
-	copy_from = src;
-	while (copy_from && copy_to) {
-		*copy_to = os_zalloc(sizeof(struct hostapd_sta_wpa_psk_short));
-		if (*copy_to == NULL)
-			break;
-		os_memcpy(*copy_to, copy_from,
-			  sizeof(struct hostapd_sta_wpa_psk_short));
-		copy_from = copy_from->next;
-		copy_to = &((*copy_to)->next);
-	}
-	if (copy_to)
-		*copy_to = NULL;
+	if (!psk)
+		return;
+
+	if (src)
+		src->ref++;
+
+	*psk = src;
 }
 
 
 static int hostapd_acl_cache_get(struct hostapd_data *hapd, const u8 *addr,
 				 u32 *session_timeout,
-				 u32 *acct_interim_interval, int *vlan_id,
+				 u32 *acct_interim_interval,
+				 struct vlan_description *vlan_id,
 				 struct hostapd_sta_wpa_psk_short **psk,
 				 char **identity, char **radius_cui)
 {
@@ -165,7 +155,10 @@ static int hostapd_radius_acl_query(struct hostapd_data *hapd, const u8 *addr,
 	if (msg == NULL)
 		return -1;
 
-	radius_msg_make_authenticator(msg, addr, ETH_ALEN);
+	if (radius_msg_make_authenticator(msg) < 0) {
+		wpa_printf(MSG_INFO, "Could not make Request Authenticator");
+		goto fail;
+	}
 
 	os_snprintf(buf, sizeof(buf), RADIUS_ADDR_FORMAT, MAC2STR(addr));
 	if (!radius_msg_add_attr(msg, RADIUS_ATTR_USER_NAME, (u8 *) buf,
@@ -213,6 +206,33 @@ static int hostapd_radius_acl_query(struct hostapd_data *hapd, const u8 *addr,
 
 
 /**
+ * hostapd_check_acl - Check a specified STA against accept/deny ACLs
+ * @hapd: hostapd BSS data
+ * @addr: MAC address of the STA
+ * @vlan_id: Buffer for returning VLAN ID
+ * Returns: HOSTAPD_ACL_ACCEPT, HOSTAPD_ACL_REJECT, or HOSTAPD_ACL_PENDING
+ */
+int hostapd_check_acl(struct hostapd_data *hapd, const u8 *addr,
+		      struct vlan_description *vlan_id)
+{
+	if (hostapd_maclist_found(hapd->conf->accept_mac,
+				  hapd->conf->num_accept_mac, addr, vlan_id))
+		return HOSTAPD_ACL_ACCEPT;
+
+	if (hostapd_maclist_found(hapd->conf->deny_mac,
+				  hapd->conf->num_deny_mac, addr, vlan_id))
+		return HOSTAPD_ACL_REJECT;
+
+	if (hapd->conf->macaddr_acl == ACCEPT_UNLESS_DENIED)
+		return HOSTAPD_ACL_ACCEPT;
+	if (hapd->conf->macaddr_acl == DENY_UNLESS_ACCEPTED)
+		return HOSTAPD_ACL_REJECT;
+
+	return HOSTAPD_ACL_PENDING;
+}
+
+
+/**
  * hostapd_allowed_address - Check whether a specified STA can be authenticated
  * @hapd: hostapd BSS data
  * @addr: MAC address of the STA
@@ -231,16 +251,19 @@ static int hostapd_radius_acl_query(struct hostapd_data *hapd, const u8 *addr,
  */
 int hostapd_allowed_address(struct hostapd_data *hapd, const u8 *addr,
 			    const u8 *msg, size_t len, u32 *session_timeout,
-			    u32 *acct_interim_interval, int *vlan_id,
+			    u32 *acct_interim_interval,
+			    struct vlan_description *vlan_id,
 			    struct hostapd_sta_wpa_psk_short **psk,
 			    char **identity, char **radius_cui)
 {
+	int res;
+
 	if (session_timeout)
 		*session_timeout = 0;
 	if (acct_interim_interval)
 		*acct_interim_interval = 0;
 	if (vlan_id)
-		*vlan_id = 0;
+		os_memset(vlan_id, 0, sizeof(*vlan_id));
 	if (psk)
 		*psk = NULL;
 	if (identity)
@@ -248,18 +271,9 @@ int hostapd_allowed_address(struct hostapd_data *hapd, const u8 *addr,
 	if (radius_cui)
 		*radius_cui = NULL;
 
-	if (hostapd_maclist_found(hapd->conf->accept_mac,
-				  hapd->conf->num_accept_mac, addr, vlan_id))
-		return HOSTAPD_ACL_ACCEPT;
-
-	if (hostapd_maclist_found(hapd->conf->deny_mac,
-				  hapd->conf->num_deny_mac, addr, vlan_id))
-		return HOSTAPD_ACL_REJECT;
-
-	if (hapd->conf->macaddr_acl == ACCEPT_UNLESS_DENIED)
-		return HOSTAPD_ACL_ACCEPT;
-	if (hapd->conf->macaddr_acl == DENY_UNLESS_ACCEPTED)
-		return HOSTAPD_ACL_REJECT;
+	res = hostapd_check_acl(hapd, addr, vlan_id);
+	if (res != HOSTAPD_ACL_PENDING)
+		return res;
 
 	if (hapd->conf->macaddr_acl == USE_EXTERNAL_RADIUS_AUTH) {
 #ifdef CONFIG_NO_RADIUS
@@ -268,10 +282,9 @@ int hostapd_allowed_address(struct hostapd_data *hapd, const u8 *addr,
 		struct hostapd_acl_query_data *query;
 
 		/* Check whether ACL cache has an entry for this station */
-		int res = hostapd_acl_cache_get(hapd, addr, session_timeout,
-						acct_interim_interval,
-						vlan_id, psk,
-						identity, radius_cui);
+		res = hostapd_acl_cache_get(hapd, addr, session_timeout,
+					    acct_interim_interval, vlan_id, psk,
+					    identity, radius_cui);
 		if (res == HOSTAPD_ACL_ACCEPT ||
 		    res == HOSTAPD_ACL_ACCEPT_TIMEOUT)
 			return res;
@@ -419,7 +432,7 @@ static void decode_tunnel_passwords(struct hostapd_data *hapd,
 				    struct hostapd_cached_radius_acl *cache)
 {
 	int passphraselen;
-	char *passphrase, *strpassphrase;
+	char *passphrase;
 	size_t i;
 	struct hostapd_sta_wpa_psk_short *psk;
 
@@ -436,24 +449,42 @@ static void decode_tunnel_passwords(struct hostapd_data *hapd,
 		 */
 		if (passphrase == NULL)
 			break;
+
+		/*
+		 * Passphase should be 8..63 chars (to be hashed with SSID)
+		 * or 64 chars hex string (no separate hashing with SSID).
+		 */
+
+		if (passphraselen < MIN_PASSPHRASE_LEN ||
+		    passphraselen > MAX_PASSPHRASE_LEN + 1)
+			goto free_pass;
+
 		/*
 		 * passphrase does not contain the NULL termination.
 		 * Add it here as pbkdf2_sha1() requires it.
 		 */
-		strpassphrase = os_zalloc(passphraselen + 1);
 		psk = os_zalloc(sizeof(struct hostapd_sta_wpa_psk_short));
-		if (strpassphrase && psk) {
-			os_memcpy(strpassphrase, passphrase, passphraselen);
-			pbkdf2_sha1(strpassphrase,
-				    hapd->conf->ssid.ssid,
-				    hapd->conf->ssid.ssid_len, 4096,
-				    psk->psk, PMK_LEN);
+		if (psk) {
+			if ((passphraselen == MAX_PASSPHRASE_LEN + 1) &&
+			    (hexstr2bin(passphrase, psk->psk, PMK_LEN) < 0)) {
+				hostapd_logger(hapd, cache->addr,
+					       HOSTAPD_MODULE_RADIUS,
+					       HOSTAPD_LEVEL_WARNING,
+					       "invalid hex string (%d chars) in Tunnel-Password",
+					       passphraselen);
+				goto skip;
+			} else if (passphraselen <= MAX_PASSPHRASE_LEN) {
+				os_memcpy(psk->passphrase, passphrase,
+					  passphraselen);
+				psk->is_passphrase = 1;
+			}
 			psk->next = cache->psk;
 			cache->psk = psk;
 			psk = NULL;
 		}
-		os_free(strpassphrase);
+skip:
 		os_free(psk);
+free_pass:
 		os_free(passphrase);
 	}
 }
@@ -478,6 +509,7 @@ hostapd_acl_recv_radius(struct radius_msg *msg, struct radius_msg *req,
 	struct hostapd_acl_query_data *query, *prev;
 	struct hostapd_cached_radius_acl *cache;
 	struct radius_hdr *hdr = radius_msg_get_hdr(msg);
+	int *untagged, *tagged, *notempty;
 
 	query = hapd->acl_queries;
 	prev = NULL;
@@ -535,7 +567,12 @@ hostapd_acl_recv_radius(struct radius_msg *msg, struct radius_msg *req,
 			cache->acct_interim_interval = 0;
 		}
 
-		cache->vlan_id = radius_msg_get_vlanid(msg);
+		notempty = &cache->vlan_id.notempty;
+		untagged = &cache->vlan_id.untagged;
+		tagged = cache->vlan_id.tagged;
+		*notempty = !!radius_msg_get_vlanid(msg, untagged,
+						    MAX_NUM_TAGGED_VLAN,
+						    tagged);
 
 		decode_tunnel_passwords(hapd, shared_secret, shared_secret_len,
 					msg, req, cache);
@@ -558,17 +595,18 @@ hostapd_acl_recv_radius(struct radius_msg *msg, struct radius_msg *req,
 		    !cache->psk)
 			cache->accepted = HOSTAPD_ACL_REJECT;
 
-		if (cache->vlan_id &&
-		    !hostapd_vlan_id_valid(hapd->conf->vlan, cache->vlan_id)) {
+		if (cache->vlan_id.notempty &&
+		    !hostapd_vlan_valid(hapd->conf->vlan, &cache->vlan_id)) {
 			hostapd_logger(hapd, query->addr,
 				       HOSTAPD_MODULE_RADIUS,
 				       HOSTAPD_LEVEL_INFO,
-				       "Invalid VLAN ID %d received from RADIUS server",
-				       cache->vlan_id);
-			cache->vlan_id = 0;
+				       "Invalid VLAN %d%s received from RADIUS server",
+				       cache->vlan_id.untagged,
+				       cache->vlan_id.tagged[0] ? "+" : "");
+			os_memset(&cache->vlan_id, 0, sizeof(cache->vlan_id));
 		}
 		if (hapd->conf->ssid.dynamic_vlan == DYNAMIC_VLAN_REQUIRED &&
-		    !cache->vlan_id)
+		    !cache->vlan_id.notempty)
 			cache->accepted = HOSTAPD_ACL_REJECT;
 	} else
 		cache->accepted = HOSTAPD_ACL_REJECT;
@@ -640,6 +678,12 @@ void hostapd_acl_deinit(struct hostapd_data *hapd)
 
 void hostapd_free_psk_list(struct hostapd_sta_wpa_psk_short *psk)
 {
+	if (psk && psk->ref) {
+		/* This will be freed when the last reference is dropped. */
+		psk->ref--;
+		return;
+	}
+
 	while (psk) {
 		struct hostapd_sta_wpa_psk_short *prev = psk;
 		psk = psk->next;
diff --git a/src/ap/ieee802_11_auth.h b/src/ap/ieee802_11_auth.h
index b66f244b3ebc4..71f53b9612faf 100644
--- a/src/ap/ieee802_11_auth.h
+++ b/src/ap/ieee802_11_auth.h
@@ -16,9 +16,12 @@ enum {
 	HOSTAPD_ACL_ACCEPT_TIMEOUT = 3
 };
 
+int hostapd_check_acl(struct hostapd_data *hapd, const u8 *addr,
+		      struct vlan_description *vlan_id);
 int hostapd_allowed_address(struct hostapd_data *hapd, const u8 *addr,
 			    const u8 *msg, size_t len, u32 *session_timeout,
-			    u32 *acct_interim_interval, int *vlan_id,
+			    u32 *acct_interim_interval,
+			    struct vlan_description *vlan_id,
 			    struct hostapd_sta_wpa_psk_short **psk,
 			    char **identity, char **radius_cui);
 int hostapd_acl_init(struct hostapd_data *hapd);
diff --git a/src/ap/ieee802_11_ht.c b/src/ap/ieee802_11_ht.c
index 11fde2a263946..5eb1060a29657 100644
--- a/src/ap/ieee802_11_ht.c
+++ b/src/ap/ieee802_11_ht.c
@@ -108,6 +108,29 @@ u8 * hostapd_eid_ht_operation(struct hostapd_data *hapd, u8 *eid)
 }
 
 
+u8 * hostapd_eid_secondary_channel(struct hostapd_data *hapd, u8 *eid)
+{
+	u8 sec_ch;
+
+	if (!hapd->cs_freq_params.channel ||
+	    !hapd->cs_freq_params.sec_channel_offset)
+		return eid;
+
+	if (hapd->cs_freq_params.sec_channel_offset == -1)
+		sec_ch = HT_INFO_HT_PARAM_SECONDARY_CHNL_BELOW;
+	else if (hapd->cs_freq_params.sec_channel_offset == 1)
+		sec_ch = HT_INFO_HT_PARAM_SECONDARY_CHNL_ABOVE;
+	else
+		return eid;
+
+	*eid++ = WLAN_EID_SECONDARY_CHANNEL_OFFSET;
+	*eid++ = 1;
+	*eid++ = sec_ch;
+
+	return eid;
+}
+
+
 /*
 op_mode
 Set to 0 (HT pure) under the followign conditions
diff --git a/src/ap/ieee802_11_shared.c b/src/ap/ieee802_11_shared.c
index d462ac8bf9cde..259413bd12ffb 100644
--- a/src/ap/ieee802_11_shared.c
+++ b/src/ap/ieee802_11_shared.c
@@ -172,6 +172,8 @@ static void hostapd_ext_capab_byte(struct hostapd_data *hapd, u8 *pos, int idx)
 	case 0: /* Bits 0-7 */
 		if (hapd->iconf->obss_interval)
 			*pos |= 0x01; /* Bit 0 - Coexistence management */
+		if (hapd->iface->drv_flags & WPA_DRIVER_FLAGS_AP_CSA)
+			*pos |= 0x04; /* Bit 2 - Extended Channel Switching */
 		break;
 	case 1: /* Bits 8-15 */
 		if (hapd->conf->proxy_arp)
@@ -207,11 +209,21 @@ static void hostapd_ext_capab_byte(struct hostapd_data *hapd, u8 *pos, int idx)
 		if (hapd->conf->hs20)
 			*pos |= 0x40; /* Bit 46 - WNM-Notification */
 #endif /* CONFIG_HS20 */
+#ifdef CONFIG_MBO
+		if (hapd->conf->mbo_enabled)
+			*pos |= 0x40; /* Bit 46 - WNM-Notification */
+#endif /* CONFIG_MBO */
 		break;
 	case 6: /* Bits 48-55 */
 		if (hapd->conf->ssid.utf8_ssid)
 			*pos |= 0x01; /* Bit 48 - UTF-8 SSID */
 		break;
+	case 8: /* Bits 64-71 */
+		if (hapd->conf->ftm_responder)
+			*pos |= 0x40; /* Bit 70 - FTM responder */
+		if (hapd->conf->ftm_initiator)
+			*pos |= 0x80; /* Bit 71 - FTM initiator */
+		break;
 	}
 }
 
@@ -231,6 +243,9 @@ u8 * hostapd_eid_ext_capab(struct hostapd_data *hapd, u8 *eid)
 		len = 1;
 	if (len < 7 && hapd->conf->ssid.utf8_ssid)
 		len = 7;
+	if (len < 9 &&
+	    (hapd->conf->ftm_initiator || hapd->conf->ftm_responder))
+		len = 9;
 #ifdef CONFIG_WNM
 	if (len < 4)
 		len = 4;
@@ -239,6 +254,10 @@ u8 * hostapd_eid_ext_capab(struct hostapd_data *hapd, u8 *eid)
 	if (hapd->conf->hs20 && len < 6)
 		len = 6;
 #endif /* CONFIG_HS20 */
+#ifdef CONFIG_MBO
+	if (hapd->conf->mbo_enabled && len < 6)
+		len = 6;
+#endif /* CONFIG_MBO */
 	if (len < hapd->iface->extended_capa_len)
 		len = hapd->iface->extended_capa_len;
 	if (len == 0)
@@ -506,3 +525,62 @@ u8 * hostapd_eid_bss_max_idle_period(struct hostapd_data *hapd, u8 *eid)
 
 	return pos;
 }
+
+
+#ifdef CONFIG_MBO
+
+u8 * hostapd_eid_mbo(struct hostapd_data *hapd, u8 *eid, size_t len)
+{
+	u8 mbo[6], *mbo_pos = mbo;
+	u8 *pos = eid;
+
+	if (!hapd->conf->mbo_enabled)
+		return eid;
+
+	*mbo_pos++ = MBO_ATTR_ID_AP_CAPA_IND;
+	*mbo_pos++ = 1;
+	/* Not Cellular aware */
+	*mbo_pos++ = 0;
+
+	if (hapd->mbo_assoc_disallow) {
+		*mbo_pos++ = MBO_ATTR_ID_ASSOC_DISALLOW;
+		*mbo_pos++ = 1;
+		*mbo_pos++ = hapd->mbo_assoc_disallow;
+	}
+
+	pos += mbo_add_ie(pos, len, mbo, mbo_pos - mbo);
+
+	return pos;
+}
+
+
+u8 hostapd_mbo_ie_len(struct hostapd_data *hapd)
+{
+	if (!hapd->conf->mbo_enabled)
+		return 0;
+
+	/*
+	 * MBO IE header (6) + Capability Indication attribute (3) +
+	 * Association Disallowed attribute (3) = 12
+	 */
+	return 6 + 3 + (hapd->mbo_assoc_disallow ? 3 : 0);
+}
+
+#endif /* CONFIG_MBO */
+
+
+void ap_copy_sta_supp_op_classes(struct sta_info *sta,
+				 const u8 *supp_op_classes,
+				 size_t supp_op_classes_len)
+{
+	if (!supp_op_classes)
+		return;
+	os_free(sta->supp_op_classes);
+	sta->supp_op_classes = os_malloc(1 + supp_op_classes_len);
+	if (!sta->supp_op_classes)
+		return;
+
+	sta->supp_op_classes[0] = supp_op_classes_len;
+	os_memcpy(sta->supp_op_classes + 1, supp_op_classes,
+		  supp_op_classes_len);
+}
diff --git a/src/ap/ieee802_11_vht.c b/src/ap/ieee802_11_vht.c
index 5bf1b5d72002a..f30f63bc57094 100644
--- a/src/ap/ieee802_11_vht.c
+++ b/src/ap/ieee802_11_vht.c
@@ -17,9 +17,10 @@
 #include "sta_info.h"
 #include "beacon.h"
 #include "ieee802_11.h"
+#include "dfs.h"
 
 
-u8 * hostapd_eid_vht_capabilities(struct hostapd_data *hapd, u8 *eid)
+u8 * hostapd_eid_vht_capabilities(struct hostapd_data *hapd, u8 *eid, u32 nsts)
 {
 	struct ieee80211_vht_capabilities *cap;
 	struct hostapd_hw_modes *mode = hapd->iface->current_mode;
@@ -49,6 +50,18 @@ u8 * hostapd_eid_vht_capabilities(struct hostapd_data *hapd, u8 *eid)
 	cap->vht_capabilities_info = host_to_le32(
 		hapd->iface->conf->vht_capab);
 
+	if (nsts != 0) {
+		u32 hapd_nsts;
+
+		hapd_nsts = le_to_host32(cap->vht_capabilities_info);
+		hapd_nsts = (hapd_nsts >> VHT_CAP_BEAMFORMEE_STS_OFFSET) & 7;
+		cap->vht_capabilities_info &=
+			~(host_to_le32(hapd_nsts <<
+				       VHT_CAP_BEAMFORMEE_STS_OFFSET));
+		cap->vht_capabilities_info |=
+			host_to_le32(nsts << VHT_CAP_BEAMFORMEE_STS_OFFSET);
+	}
+
 	/* Supported MCS set comes from hw */
 	os_memcpy(&cap->vht_supported_mcs_set, mode->vht_mcs_set, 8);
 
@@ -80,6 +93,26 @@ u8 * hostapd_eid_vht_operation(struct hostapd_data *hapd, u8 *eid)
 		hapd->iconf->vht_oper_centr_freq_seg1_idx;
 
 	oper->vht_op_info_chwidth = hapd->iconf->vht_oper_chwidth;
+	if (hapd->iconf->vht_oper_chwidth == 2) {
+		/*
+		 * Convert 160 MHz channel width to new style as interop
+		 * workaround.
+		 */
+		oper->vht_op_info_chwidth = 1;
+		oper->vht_op_info_chan_center_freq_seg1_idx =
+			oper->vht_op_info_chan_center_freq_seg0_idx;
+		if (hapd->iconf->channel <
+		    hapd->iconf->vht_oper_centr_freq_seg0_idx)
+			oper->vht_op_info_chan_center_freq_seg0_idx -= 8;
+		else
+			oper->vht_op_info_chan_center_freq_seg0_idx += 8;
+	} else if (hapd->iconf->vht_oper_chwidth == 3) {
+		/*
+		 * Convert 80+80 MHz channel width to new style as interop
+		 * workaround.
+		 */
+		oper->vht_op_info_chwidth = 1;
+	}
 
 	/* VHT Basic MCS set comes from hw */
 	/* Hard code 1 stream, MCS0-7 is a min Basic VHT MCS rates */
@@ -131,6 +164,171 @@ static int check_valid_vht_mcs(struct hostapd_hw_modes *mode,
 }
 
 
+u8 * hostapd_eid_wb_chsw_wrapper(struct hostapd_data *hapd, u8 *eid)
+{
+	u8 bw, chan1, chan2 = 0;
+	int freq1;
+
+	if (!hapd->cs_freq_params.channel ||
+	    !hapd->cs_freq_params.vht_enabled)
+		return eid;
+
+	/* bandwidth: 0: 40, 1: 80, 2: 160, 3: 80+80 */
+	switch (hapd->cs_freq_params.bandwidth) {
+	case 40:
+		bw = 0;
+		break;
+	case 80:
+		/* check if it's 80+80 */
+		if (!hapd->cs_freq_params.center_freq2)
+			bw = 1;
+		else
+			bw = 3;
+		break;
+	case 160:
+		bw = 2;
+		break;
+	default:
+		/* not valid VHT bandwidth or not in CSA */
+		return eid;
+	}
+
+	freq1 = hapd->cs_freq_params.center_freq1 ?
+		hapd->cs_freq_params.center_freq1 :
+		hapd->cs_freq_params.freq;
+	if (ieee80211_freq_to_chan(freq1, &chan1) !=
+	    HOSTAPD_MODE_IEEE80211A)
+		return eid;
+
+	if (hapd->cs_freq_params.center_freq2 &&
+	    ieee80211_freq_to_chan(hapd->cs_freq_params.center_freq2,
+				   &chan2) != HOSTAPD_MODE_IEEE80211A)
+		return eid;
+
+	*eid++ = WLAN_EID_VHT_CHANNEL_SWITCH_WRAPPER;
+	*eid++ = 5; /* Length of Channel Switch Wrapper */
+	*eid++ = WLAN_EID_VHT_WIDE_BW_CHSWITCH;
+	*eid++ = 3; /* Length of Wide Bandwidth Channel Switch element */
+	*eid++ = bw; /* New Channel Width */
+	*eid++ = chan1; /* New Channel Center Frequency Segment 0 */
+	*eid++ = chan2; /* New Channel Center Frequency Segment 1 */
+
+	return eid;
+}
+
+
+u8 * hostapd_eid_txpower_envelope(struct hostapd_data *hapd, u8 *eid)
+{
+	struct hostapd_iface *iface = hapd->iface;
+	struct hostapd_config *iconf = iface->conf;
+	struct hostapd_hw_modes *mode = iface->current_mode;
+	struct hostapd_channel_data *chan;
+	int dfs, i;
+	u8 channel, tx_pwr_count, local_pwr_constraint;
+	int max_tx_power;
+	u8 tx_pwr;
+
+	if (!mode)
+		return eid;
+
+	if (ieee80211_freq_to_chan(iface->freq, &channel) == NUM_HOSTAPD_MODES)
+		return eid;
+
+	for (i = 0; i < mode->num_channels; i++) {
+		if (mode->channels[i].freq == iface->freq)
+			break;
+	}
+	if (i == mode->num_channels)
+		return eid;
+
+	switch (iface->conf->vht_oper_chwidth) {
+	case VHT_CHANWIDTH_USE_HT:
+		if (iconf->secondary_channel == 0) {
+			/* Max Transmit Power count = 0 (20 MHz) */
+			tx_pwr_count = 0;
+		} else {
+			/* Max Transmit Power count = 1 (20, 40 MHz) */
+			tx_pwr_count = 1;
+		}
+		break;
+	case VHT_CHANWIDTH_80MHZ:
+		/* Max Transmit Power count = 2 (20, 40, and 80 MHz) */
+		tx_pwr_count = 2;
+		break;
+	case VHT_CHANWIDTH_80P80MHZ:
+	case VHT_CHANWIDTH_160MHZ:
+		/* Max Transmit Power count = 3 (20, 40, 80, 160/80+80 MHz) */
+		tx_pwr_count = 3;
+		break;
+	default:
+		return eid;
+	}
+
+	/*
+	 * Below local_pwr_constraint logic is referred from
+	 * hostapd_eid_pwr_constraint.
+	 *
+	 * Check if DFS is required by regulatory.
+	 */
+	dfs = hostapd_is_dfs_required(hapd->iface);
+	if (dfs < 0)
+		dfs = 0;
+
+	/*
+	 * In order to meet regulations when TPC is not implemented using
+	 * a transmit power that is below the legal maximum (including any
+	 * mitigation factor) should help. In this case, indicate 3 dB below
+	 * maximum allowed transmit power.
+	 */
+	if (hapd->iconf->local_pwr_constraint == -1)
+		local_pwr_constraint = (dfs == 0) ? 0 : 3;
+	else
+		local_pwr_constraint = hapd->iconf->local_pwr_constraint;
+
+	/*
+	 * A STA that is not an AP shall use a transmit power less than or
+	 * equal to the local maximum transmit power level for the channel.
+	 * The local maximum transmit power can be calculated from the formula:
+	 * local max TX pwr = max TX pwr - local pwr constraint
+	 * Where max TX pwr is maximum transmit power level specified for
+	 * channel in Country element and local pwr constraint is specified
+	 * for channel in this Power Constraint element.
+	 */
+	chan = &mode->channels[i];
+	max_tx_power = chan->max_tx_power - local_pwr_constraint;
+
+	/*
+	 * Local Maximum Transmit power is encoded as two's complement
+	 * with a 0.5 dB step.
+	 */
+	max_tx_power *= 2; /* in 0.5 dB steps */
+	if (max_tx_power > 127) {
+		/* 63.5 has special meaning of 63.5 dBm or higher */
+		max_tx_power = 127;
+	}
+	if (max_tx_power < -128)
+		max_tx_power = -128;
+	if (max_tx_power < 0)
+		tx_pwr = 0x80 + max_tx_power + 128;
+	else
+		tx_pwr = max_tx_power;
+
+	*eid++ = WLAN_EID_VHT_TRANSMIT_POWER_ENVELOPE;
+	*eid++ = 2 + tx_pwr_count;
+
+	/*
+	 * Max Transmit Power count and
+	 * Max Transmit Power units = 0 (EIRP)
+	 */
+	*eid++ = tx_pwr_count;
+
+	for (i = 0; i <= tx_pwr_count; i++)
+		*eid++ = tx_pwr;
+
+	return eid;
+}
+
+
 u16 copy_sta_vht_capab(struct hostapd_data *hapd, struct sta_info *sta,
 		       const u8 *vht_capab)
 {
@@ -212,7 +410,7 @@ u8 * hostapd_eid_vendor_vht(struct hostapd_data *hapd, u8 *eid)
 	WPA_PUT_BE32(pos, (OUI_BROADCOM << 8) | VENDOR_VHT_TYPE);
 	pos += 4;
 	*pos++ = VENDOR_VHT_SUBTYPE;
-	pos = hostapd_eid_vht_capabilities(hapd, pos);
+	pos = hostapd_eid_vht_capabilities(hapd, pos, 0);
 	pos = hostapd_eid_vht_operation(hapd, pos);
 
 	return pos;
diff --git a/src/ap/ieee802_1x.c b/src/ap/ieee802_1x.c
index 0f2d428cf752a..80ff996948f9e 100644
--- a/src/ap/ieee802_1x.c
+++ b/src/ap/ieee802_1x.c
@@ -34,6 +34,9 @@
 #include "ieee802_1x.h"
 
 
+#ifdef CONFIG_HS20
+static void ieee802_1x_wnm_notif_send(void *eloop_ctx, void *timeout_ctx);
+#endif /* CONFIG_HS20 */
 static void ieee802_1x_finished(struct hostapd_data *hapd,
 				struct sta_info *sta, int success,
 				int remediation);
@@ -219,7 +222,7 @@ static void ieee802_1x_tx_key(struct hostapd_data *hapd, struct sta_info *sta)
 		   MAC2STR(sta->addr));
 
 #ifndef CONFIG_NO_VLAN
-	if (sta->vlan_id > 0 && sta->vlan_id <= MAX_VLAN_ID) {
+	if (sta->vlan_id > 0) {
 		wpa_printf(MSG_ERROR, "Using WEP with vlans is not supported.");
 		return;
 	}
@@ -402,7 +405,16 @@ static int add_common_radius_sta_attr(struct hostapd_data *hapd,
 	char buf[128];
 
 	if (!hostapd_config_get_radius_attr(req_attr,
+					    RADIUS_ATTR_SERVICE_TYPE) &&
+	    !radius_msg_add_attr_int32(msg, RADIUS_ATTR_SERVICE_TYPE,
+				       RADIUS_SERVICE_TYPE_FRAMED)) {
+		wpa_printf(MSG_ERROR, "Could not add Service-Type");
+		return -1;
+	}
+
+	if (!hostapd_config_get_radius_attr(req_attr,
 					    RADIUS_ATTR_NAS_PORT) &&
+	    sta->aid > 0 &&
 	    !radius_msg_add_attr_int32(msg, RADIUS_ATTR_NAS_PORT, sta->aid)) {
 		wpa_printf(MSG_ERROR, "Could not add NAS-Port");
 		return -1;
@@ -435,9 +447,9 @@ static int add_common_radius_sta_attr(struct hostapd_data *hapd,
 		return -1;
 	}
 
-	if (sta->acct_session_id_hi || sta->acct_session_id_lo) {
-		os_snprintf(buf, sizeof(buf), "%08X-%08X",
-			    sta->acct_session_id_hi, sta->acct_session_id_lo);
+	if (sta->acct_session_id) {
+		os_snprintf(buf, sizeof(buf), "%016llX",
+			    (unsigned long long) sta->acct_session_id);
 		if (!radius_msg_add_attr(msg, RADIUS_ATTR_ACCT_SESSION_ID,
 					 (u8 *) buf, os_strlen(buf))) {
 			wpa_printf(MSG_ERROR, "Could not add Acct-Session-Id");
@@ -445,6 +457,21 @@ static int add_common_radius_sta_attr(struct hostapd_data *hapd,
 		}
 	}
 
+	if ((hapd->conf->wpa & 2) &&
+	    !hapd->conf->disable_pmksa_caching &&
+	    sta->eapol_sm && sta->eapol_sm->acct_multi_session_id) {
+		os_snprintf(buf, sizeof(buf), "%016llX",
+			    (unsigned long long)
+			    sta->eapol_sm->acct_multi_session_id);
+		if (!radius_msg_add_attr(
+			    msg, RADIUS_ATTR_ACCT_MULTI_SESSION_ID,
+			    (u8 *) buf, os_strlen(buf))) {
+			wpa_printf(MSG_INFO,
+				   "Could not add Acct-Multi-Session-Id");
+			return -1;
+		}
+	}
+
 #ifdef CONFIG_IEEE80211R
 	if (hapd->conf->wpa && wpa_key_mgmt_ft(hapd->conf->wpa_key_mgmt) &&
 	    sta->wpa_sm &&
@@ -475,6 +502,7 @@ int add_common_radius_attr(struct hostapd_data *hapd,
 {
 	char buf[128];
 	struct hostapd_radius_attr *attr;
+	int len;
 
 	if (!hostapd_config_get_radius_attr(req_attr,
 					    RADIUS_ATTR_NAS_IP_ADDRESS) &&
@@ -506,15 +534,15 @@ int add_common_radius_attr(struct hostapd_data *hapd,
 		return -1;
 	}
 
-	os_snprintf(buf, sizeof(buf), RADIUS_802_1X_ADDR_FORMAT ":%s",
-		    MAC2STR(hapd->own_addr),
-		    wpa_ssid_txt(hapd->conf->ssid.ssid,
-				 hapd->conf->ssid.ssid_len));
-	buf[sizeof(buf) - 1] = '\0';
+	len = os_snprintf(buf, sizeof(buf), RADIUS_802_1X_ADDR_FORMAT ":",
+			  MAC2STR(hapd->own_addr));
+	os_memcpy(&buf[len], hapd->conf->ssid.ssid,
+		  hapd->conf->ssid.ssid_len);
+	len += hapd->conf->ssid.ssid_len;
 	if (!hostapd_config_get_radius_attr(req_attr,
 					    RADIUS_ATTR_CALLED_STATION_ID) &&
 	    !radius_msg_add_attr(msg, RADIUS_ATTR_CALLED_STATION_ID,
-				 (u8 *) buf, os_strlen(buf))) {
+				 (u8 *) buf, len)) {
 		wpa_printf(MSG_ERROR, "Could not add Called-Station-Id");
 		return -1;
 	}
@@ -583,7 +611,10 @@ static void ieee802_1x_encapsulate_radius(struct hostapd_data *hapd,
 		return;
 	}
 
-	radius_msg_make_authenticator(msg, (u8 *) sta, sizeof(*sta));
+	if (radius_msg_make_authenticator(msg) < 0) {
+		wpa_printf(MSG_INFO, "Could not make Request Authenticator");
+		goto fail;
+	}
 
 	if (sm->identity &&
 	    !radius_msg_add_attr(msg, RADIUS_ATTR_USER_NAME,
@@ -831,6 +862,29 @@ ieee802_1x_alloc_eapol_sm(struct hostapd_data *hapd, struct sta_info *sta)
 }
 
 
+static void ieee802_1x_save_eapol(struct sta_info *sta, const u8 *buf,
+				  size_t len)
+{
+	if (sta->pending_eapol_rx) {
+		wpabuf_free(sta->pending_eapol_rx->buf);
+	} else {
+		sta->pending_eapol_rx =
+			os_malloc(sizeof(*sta->pending_eapol_rx));
+		if (!sta->pending_eapol_rx)
+			return;
+	}
+
+	sta->pending_eapol_rx->buf = wpabuf_alloc_copy(buf, len);
+	if (!sta->pending_eapol_rx->buf) {
+		os_free(sta->pending_eapol_rx);
+		sta->pending_eapol_rx = NULL;
+		return;
+	}
+
+	os_get_reltime(&sta->pending_eapol_rx->rx_time);
+}
+
+
 /**
  * ieee802_1x_receive - Process the EAPOL frames from the Supplicant
  * @hapd: hostapd BSS data
@@ -861,6 +915,13 @@ void ieee802_1x_receive(struct hostapd_data *hapd, const u8 *sa, const u8 *buf,
 		     !(hapd->iface->drv_flags & WPA_DRIVER_FLAGS_WIRED))) {
 		wpa_printf(MSG_DEBUG, "IEEE 802.1X data frame from not "
 			   "associated/Pre-authenticating STA");
+
+		if (sta && (sta->flags & WLAN_STA_AUTH)) {
+			wpa_printf(MSG_DEBUG, "Saving EAPOL frame from " MACSTR
+				   " for later use", MAC2STR(sta->addr));
+			ieee802_1x_save_eapol(sta, buf, len);
+		}
+
 		return;
 	}
 
@@ -1047,7 +1108,7 @@ void ieee802_1x_new_station(struct hostapd_data *hapd, struct sta_info *sta)
 		 * Clear any possible EAPOL authenticator state to support
 		 * reassociation change from WPS to PSK.
 		 */
-		ieee802_1x_free_station(sta);
+		ieee802_1x_free_station(hapd, sta);
 		return;
 	}
 
@@ -1058,7 +1119,7 @@ void ieee802_1x_new_station(struct hostapd_data *hapd, struct sta_info *sta)
 		 * Clear any possible EAPOL authenticator state to support
 		 * reassociation change from WPA-EAP to PSK.
 		 */
-		ieee802_1x_free_station(sta);
+		ieee802_1x_free_station(hapd, sta);
 		return;
 	}
 
@@ -1106,6 +1167,7 @@ void ieee802_1x_new_station(struct hostapd_data *hapd, struct sta_info *sta)
 		sta->eapol_sm->be_auth_state = BE_AUTH_SUCCESS;
 		sta->eapol_sm->authSuccess = TRUE;
 		sta->eapol_sm->authFail = FALSE;
+		sta->eapol_sm->portValid = TRUE;
 		if (sta->eapol_sm->eap)
 			eap_sm_notify_cached(sta->eapol_sm->eap);
 		/* TODO: get vlan_id from R0KH using RRB message */
@@ -1128,7 +1190,7 @@ void ieee802_1x_new_station(struct hostapd_data *hapd, struct sta_info *sta)
 		sta->eapol_sm->authFail = FALSE;
 		if (sta->eapol_sm->eap)
 			eap_sm_notify_cached(sta->eapol_sm->eap);
-		pmksa_cache_to_eapol_data(pmksa, sta->eapol_sm);
+		pmksa_cache_to_eapol_data(hapd, pmksa, sta->eapol_sm);
 		ap_sta_bind_vlan(hapd, sta);
 	} else {
 		if (reassoc) {
@@ -1144,10 +1206,20 @@ void ieee802_1x_new_station(struct hostapd_data *hapd, struct sta_info *sta)
 }
 
 
-void ieee802_1x_free_station(struct sta_info *sta)
+void ieee802_1x_free_station(struct hostapd_data *hapd, struct sta_info *sta)
 {
 	struct eapol_state_machine *sm = sta->eapol_sm;
 
+#ifdef CONFIG_HS20
+	eloop_cancel_timeout(ieee802_1x_wnm_notif_send, hapd, sta);
+#endif /* CONFIG_HS20 */
+
+	if (sta->pending_eapol_rx) {
+		wpabuf_free(sta->pending_eapol_rx->buf);
+		os_free(sta->pending_eapol_rx);
+		sta->pending_eapol_rx = NULL;
+	}
+
 	if (sm == NULL)
 		return;
 
@@ -1156,10 +1228,8 @@ void ieee802_1x_free_station(struct sta_info *sta)
 #ifndef CONFIG_NO_RADIUS
 	radius_msg_free(sm->last_recv_radius);
 	radius_free_class(&sm->radius_class);
-	wpabuf_free(sm->radius_cui);
 #endif /* CONFIG_NO_RADIUS */
 
-	os_free(sm->identity);
 	eapol_auth_free(sm);
 }
 
@@ -1592,10 +1662,16 @@ ieee802_1x_receive_auth(struct radius_msg *msg, struct radius_msg *req,
 	struct hostapd_data *hapd = data;
 	struct sta_info *sta;
 	u32 session_timeout = 0, termination_action, acct_interim_interval;
-	int session_timeout_set, vlan_id = 0;
+	int session_timeout_set;
 	struct eapol_state_machine *sm;
 	int override_eapReq = 0;
 	struct radius_hdr *hdr = radius_msg_get_hdr(msg);
+	struct vlan_description vlan_desc;
+#ifndef CONFIG_NO_VLAN
+	int *untagged, *tagged, *notempty;
+#endif /* CONFIG_NO_VLAN */
+
+	os_memset(&vlan_desc, 0, sizeof(vlan_desc));
 
 	sm = ieee802_1x_search_radius_identifier(hapd, hdr->identifier);
 	if (sm == NULL) {
@@ -1659,27 +1735,32 @@ ieee802_1x_receive_auth(struct radius_msg *msg, struct radius_msg *req,
 
 	switch (hdr->code) {
 	case RADIUS_CODE_ACCESS_ACCEPT:
-		if (hapd->conf->ssid.dynamic_vlan == DYNAMIC_VLAN_DISABLED)
-			vlan_id = 0;
 #ifndef CONFIG_NO_VLAN
-		else
-			vlan_id = radius_msg_get_vlanid(msg);
-		if (vlan_id > 0 &&
-		    hostapd_vlan_id_valid(hapd->conf->vlan, vlan_id)) {
-			hostapd_logger(hapd, sta->addr,
-				       HOSTAPD_MODULE_RADIUS,
-				       HOSTAPD_LEVEL_INFO,
-				       "VLAN ID %d", vlan_id);
-		} else if (vlan_id > 0) {
+		if (hapd->conf->ssid.dynamic_vlan != DYNAMIC_VLAN_DISABLED) {
+			notempty = &vlan_desc.notempty;
+			untagged = &vlan_desc.untagged;
+			tagged = vlan_desc.tagged;
+			*notempty = !!radius_msg_get_vlanid(msg, untagged,
+							    MAX_NUM_TAGGED_VLAN,
+							    tagged);
+		}
+
+		if (vlan_desc.notempty &&
+		    !hostapd_vlan_valid(hapd->conf->vlan, &vlan_desc)) {
 			sta->eapol_sm->authFail = TRUE;
 			hostapd_logger(hapd, sta->addr,
 				       HOSTAPD_MODULE_RADIUS,
 				       HOSTAPD_LEVEL_INFO,
-				       "Invalid VLAN ID %d received from RADIUS server",
-				       vlan_id);
+				       "Invalid VLAN %d%s received from RADIUS server",
+				       vlan_desc.untagged,
+				       vlan_desc.tagged[0] ? "+" : "");
+			os_memset(&vlan_desc, 0, sizeof(vlan_desc));
+			ap_sta_set_vlan(hapd, sta, &vlan_desc);
 			break;
-		} else if (hapd->conf->ssid.dynamic_vlan ==
-			   DYNAMIC_VLAN_REQUIRED) {
+		}
+
+		if (hapd->conf->ssid.dynamic_vlan == DYNAMIC_VLAN_REQUIRED &&
+		    !vlan_desc.notempty) {
 			sta->eapol_sm->authFail = TRUE;
 			hostapd_logger(hapd, sta->addr,
 				       HOSTAPD_MODULE_IEEE8021X,
@@ -1690,7 +1771,18 @@ ieee802_1x_receive_auth(struct radius_msg *msg, struct radius_msg *req,
 		}
 #endif /* CONFIG_NO_VLAN */
 
-		sta->vlan_id = vlan_id;
+		if (ap_sta_set_vlan(hapd, sta, &vlan_desc) < 0)
+			break;
+
+#ifndef CONFIG_NO_VLAN
+		if (sta->vlan_id > 0) {
+			hostapd_logger(hapd, sta->addr,
+				       HOSTAPD_MODULE_RADIUS,
+				       HOSTAPD_LEVEL_INFO,
+				       "VLAN ID %d", sta->vlan_id);
+		}
+#endif /* CONFIG_NO_VLAN */
+
 		if ((sta->flags & WLAN_STA_ASSOC) &&
 		    ap_sta_bind_vlan(hapd, sta) < 0)
 			break;
@@ -1715,15 +1807,6 @@ ieee802_1x_receive_auth(struct radius_msg *msg, struct radius_msg *req,
 		ieee802_1x_check_hs20(hapd, sta, msg,
 				      session_timeout_set ?
 				      (int) session_timeout : -1);
-		if (sm->eap_if->eapKeyAvailable && !sta->remediation &&
-		    !sta->hs20_deauth_requested &&
-		    wpa_auth_pmksa_add(sta->wpa_sm, sm->eapol_key_crypt,
-				       session_timeout_set ?
-				       (int) session_timeout : -1, sm) == 0) {
-			hostapd_logger(hapd, sta->addr, HOSTAPD_MODULE_WPA,
-				       HOSTAPD_LEVEL_DEBUG,
-				       "Added PMKSA cache entry");
-		}
 		break;
 	case RADIUS_CODE_ACCESS_REJECT:
 		sm->eap_if->aaaFail = TRUE;
@@ -2190,7 +2273,7 @@ void ieee802_1x_deinit(struct hostapd_data *hapd)
 {
 	eloop_cancel_timeout(ieee802_1x_rekey, hapd, NULL);
 
-	if (hapd->driver != NULL &&
+	if (hapd->driver && hapd->drv_priv &&
 	    (hapd->conf->ieee802_1x || hapd->conf->wpa))
 		hostapd_set_drv_ieee8021x(hapd, hapd->conf->iface, 0);
 
@@ -2495,12 +2578,12 @@ int ieee802_1x_get_mib_sta(struct hostapd_data *hapd, struct sta_info *sta,
 			  /* TODO: dot1xAuthSessionOctetsTx */
 			  /* TODO: dot1xAuthSessionFramesRx */
 			  /* TODO: dot1xAuthSessionFramesTx */
-			  "dot1xAuthSessionId=%08X-%08X\n"
+			  "dot1xAuthSessionId=%016llX\n"
 			  "dot1xAuthSessionAuthenticMethod=%d\n"
 			  "dot1xAuthSessionTime=%u\n"
 			  "dot1xAuthSessionTerminateCause=999\n"
 			  "dot1xAuthSessionUserName=%s\n",
-			  sta->acct_session_id_hi, sta->acct_session_id_lo,
+			  (unsigned long long) sta->acct_session_id,
 			  (wpa_key_mgmt_wpa_ieee8021x(
 				   wpa_auth_sta_key_mgmt(sta->wpa_sm))) ?
 			  1 : 2,
@@ -2510,11 +2593,11 @@ int ieee802_1x_get_mib_sta(struct hostapd_data *hapd, struct sta_info *sta,
 		return len;
 	len += ret;
 
-	if (sm->acct_multi_session_id_hi) {
+	if (sm->acct_multi_session_id) {
 		ret = os_snprintf(buf + len, buflen - len,
-				  "authMultiSessionId=%08X+%08X\n",
-				  sm->acct_multi_session_id_hi,
-				  sm->acct_multi_session_id_lo);
+				  "authMultiSessionId=%016llX\n",
+				  (unsigned long long)
+				  sm->acct_multi_session_id);
 		if (os_snprintf_error(buflen - len, ret))
 			return len;
 		len += ret;
@@ -2535,6 +2618,34 @@ int ieee802_1x_get_mib_sta(struct hostapd_data *hapd, struct sta_info *sta,
 }
 
 
+#ifdef CONFIG_HS20
+static void ieee802_1x_wnm_notif_send(void *eloop_ctx, void *timeout_ctx)
+{
+	struct hostapd_data *hapd = eloop_ctx;
+	struct sta_info *sta = timeout_ctx;
+
+	if (sta->remediation) {
+		wpa_printf(MSG_DEBUG, "HS 2.0: Send WNM-Notification to "
+			   MACSTR " to indicate Subscription Remediation",
+			   MAC2STR(sta->addr));
+		hs20_send_wnm_notification(hapd, sta->addr,
+					   sta->remediation_method,
+					   sta->remediation_url);
+		os_free(sta->remediation_url);
+		sta->remediation_url = NULL;
+	}
+
+	if (sta->hs20_deauth_req) {
+		wpa_printf(MSG_DEBUG, "HS 2.0: Send WNM-Notification to "
+			   MACSTR " to indicate imminent deauthentication",
+			   MAC2STR(sta->addr));
+		hs20_send_wnm_notification_deauth_req(hapd, sta->addr,
+						      sta->hs20_deauth_req);
+	}
+}
+#endif /* CONFIG_HS20 */
+
+
 static void ieee802_1x_finished(struct hostapd_data *hapd,
 				struct sta_info *sta, int success,
 				int remediation)
@@ -2554,26 +2665,12 @@ static void ieee802_1x_finished(struct hostapd_data *hapd,
 		sta->remediation_method = 1; /* SOAP-XML SPP */
 	}
 
-	if (success) {
-		if (sta->remediation) {
-			wpa_printf(MSG_DEBUG, "HS 2.0: Send WNM-Notification "
-				   "to " MACSTR " to indicate Subscription "
-				   "Remediation",
-				   MAC2STR(sta->addr));
-			hs20_send_wnm_notification(hapd, sta->addr,
-						   sta->remediation_method,
-						   sta->remediation_url);
-			os_free(sta->remediation_url);
-			sta->remediation_url = NULL;
-		}
-
-		if (sta->hs20_deauth_req) {
-			wpa_printf(MSG_DEBUG, "HS 2.0: Send WNM-Notification "
-				   "to " MACSTR " to indicate imminent "
-				   "deauthentication", MAC2STR(sta->addr));
-			hs20_send_wnm_notification_deauth_req(
-				hapd, sta->addr, sta->hs20_deauth_req);
-		}
+	if (success && (sta->remediation || sta->hs20_deauth_req)) {
+		wpa_printf(MSG_DEBUG, "HS 2.0: Schedule WNM-Notification to "
+			   MACSTR " in 100 ms", MAC2STR(sta->addr));
+		eloop_cancel_timeout(ieee802_1x_wnm_notif_send, hapd, sta);
+		eloop_register_timeout(0, 100000, ieee802_1x_wnm_notif_send,
+				       hapd, sta);
 	}
 #endif /* CONFIG_HS20 */
 
@@ -2584,7 +2681,7 @@ static void ieee802_1x_finished(struct hostapd_data *hapd,
 		session_timeout = dot11RSNAConfigPMKLifetime;
 	if (success && key && len >= PMK_LEN && !sta->remediation &&
 	    !sta->hs20_deauth_requested &&
-	    wpa_auth_pmksa_add(sta->wpa_sm, key, session_timeout,
+	    wpa_auth_pmksa_add(sta->wpa_sm, key, len, session_timeout,
 			       sta->eapol_sm) == 0) {
 		hostapd_logger(hapd, sta->addr, HOSTAPD_MODULE_WPA,
 			       HOSTAPD_LEVEL_DEBUG,
diff --git a/src/ap/ieee802_1x.h b/src/ap/ieee802_1x.h
index 14d69556993c4..ec80199007b68 100644
--- a/src/ap/ieee802_1x.h
+++ b/src/ap/ieee802_1x.h
@@ -21,7 +21,7 @@ struct radius_msg;
 void ieee802_1x_receive(struct hostapd_data *hapd, const u8 *sa, const u8 *buf,
 			size_t len);
 void ieee802_1x_new_station(struct hostapd_data *hapd, struct sta_info *sta);
-void ieee802_1x_free_station(struct sta_info *sta);
+void ieee802_1x_free_station(struct hostapd_data *hapd, struct sta_info *sta);
 
 void ieee802_1x_abort_auth(struct hostapd_data *hapd, struct sta_info *sta);
 void ieee802_1x_set_sta_authorized(struct hostapd_data *hapd,
diff --git a/src/ap/mbo_ap.c b/src/ap/mbo_ap.c
new file mode 100644
index 0000000000000..43b0bf16934e7
--- /dev/null
+++ b/src/ap/mbo_ap.c
@@ -0,0 +1,244 @@
+/*
+ * hostapd - MBO
+ * Copyright (c) 2016, Qualcomm Atheros, Inc.
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ */
+
+#include "utils/includes.h"
+
+#include "utils/common.h"
+#include "common/ieee802_11_defs.h"
+#include "common/ieee802_11_common.h"
+#include "hostapd.h"
+#include "sta_info.h"
+#include "mbo_ap.h"
+
+
+void mbo_ap_sta_free(struct sta_info *sta)
+{
+	struct mbo_non_pref_chan_info *info, *prev;
+
+	info = sta->non_pref_chan;
+	sta->non_pref_chan = NULL;
+	while (info) {
+		prev = info;
+		info = info->next;
+		os_free(prev);
+	}
+}
+
+
+static void mbo_ap_parse_non_pref_chan(struct sta_info *sta,
+				       const u8 *buf, size_t len)
+{
+	struct mbo_non_pref_chan_info *info, *tmp;
+	char channels[200], *pos, *end;
+	size_t num_chan, i;
+	int ret;
+
+	if (len <= 3)
+		return; /* Not enough room for any channels */
+
+	num_chan = len - 3;
+	info = os_zalloc(sizeof(*info) + num_chan);
+	if (!info)
+		return;
+	info->op_class = buf[0];
+	info->pref = buf[len - 2];
+	info->reason_code = buf[len - 1];
+	info->num_channels = num_chan;
+	buf++;
+	os_memcpy(info->channels, buf, num_chan);
+	if (!sta->non_pref_chan) {
+		sta->non_pref_chan = info;
+	} else {
+		tmp = sta->non_pref_chan;
+		while (tmp->next)
+			tmp = tmp->next;
+		tmp->next = info;
+	}
+
+	pos = channels;
+	end = pos + sizeof(channels);
+	*pos = '\0';
+	for (i = 0; i < num_chan; i++) {
+		ret = os_snprintf(pos, end - pos, "%s%u",
+				  i == 0 ? "" : " ", buf[i]);
+		if (os_snprintf_error(end - pos, ret)) {
+			*pos = '\0';
+			break;
+		}
+		pos += ret;
+	}
+
+	wpa_printf(MSG_DEBUG, "MBO: STA " MACSTR
+		   " non-preferred channel list (op class %u, pref %u, reason code %u, channels %s)",
+		   MAC2STR(sta->addr), info->op_class, info->pref,
+		   info->reason_code, channels);
+}
+
+
+void mbo_ap_check_sta_assoc(struct hostapd_data *hapd, struct sta_info *sta,
+			    struct ieee802_11_elems *elems)
+{
+	const u8 *pos, *attr, *end;
+	size_t len;
+
+	if (!hapd->conf->mbo_enabled || !elems->mbo)
+		return;
+
+	pos = elems->mbo + 4;
+	len = elems->mbo_len - 4;
+	wpa_hexdump(MSG_DEBUG, "MBO: Association Request attributes", pos, len);
+
+	attr = get_ie(pos, len, MBO_ATTR_ID_CELL_DATA_CAPA);
+	if (attr && attr[1] >= 1)
+		sta->cell_capa = attr[2];
+
+	mbo_ap_sta_free(sta);
+	end = pos + len;
+	while (end - pos > 1) {
+		u8 ie_len = pos[1];
+
+		if (2 + ie_len > end - pos)
+			break;
+
+		if (pos[0] == MBO_ATTR_ID_NON_PREF_CHAN_REPORT)
+			mbo_ap_parse_non_pref_chan(sta, pos + 2, ie_len);
+		pos += 2 + pos[1];
+	}
+}
+
+
+int mbo_ap_get_info(struct sta_info *sta, char *buf, size_t buflen)
+{
+	char *pos = buf, *end = buf + buflen;
+	int ret;
+	struct mbo_non_pref_chan_info *info;
+	u8 i;
+	unsigned int count = 0;
+
+	if (!sta->cell_capa)
+		return 0;
+
+	ret = os_snprintf(pos, end - pos, "mbo_cell_capa=%u\n", sta->cell_capa);
+	if (os_snprintf_error(end - pos, ret))
+		return pos - buf;
+	pos += ret;
+
+	for (info = sta->non_pref_chan; info; info = info->next) {
+		char *pos2 = pos;
+
+		ret = os_snprintf(pos2, end - pos2,
+				  "non_pref_chan[%u]=%u:%u:%u:",
+				  count, info->op_class, info->pref,
+				  info->reason_code);
+		count++;
+		if (os_snprintf_error(end - pos2, ret))
+			break;
+		pos2 += ret;
+
+		for (i = 0; i < info->num_channels; i++) {
+			ret = os_snprintf(pos2, end - pos2, "%u%s",
+					  info->channels[i],
+					  i + 1 < info->num_channels ?
+					  "," : "");
+			if (os_snprintf_error(end - pos2, ret)) {
+				pos2 = NULL;
+				break;
+			}
+			pos2 += ret;
+		}
+
+		if (!pos2)
+			break;
+		ret = os_snprintf(pos2, end - pos2, "\n");
+		if (os_snprintf_error(end - pos2, ret))
+			break;
+		pos2 += ret;
+		pos = pos2;
+	}
+
+	return pos - buf;
+}
+
+
+static void mbo_ap_wnm_notif_req_cell_capa(struct sta_info *sta,
+					   const u8 *buf, size_t len)
+{
+	if (len < 1)
+		return;
+	wpa_printf(MSG_DEBUG, "MBO: STA " MACSTR
+		   " updated cellular data capability: %u",
+		   MAC2STR(sta->addr), buf[0]);
+	sta->cell_capa = buf[0];
+}
+
+
+static void mbo_ap_wnm_notif_req_elem(struct sta_info *sta, u8 type,
+				      const u8 *buf, size_t len,
+				      int *first_non_pref_chan)
+{
+	switch (type) {
+	case WFA_WNM_NOTIF_SUBELEM_NON_PREF_CHAN_REPORT:
+		if (*first_non_pref_chan) {
+			/*
+			 * Need to free the previously stored entries now to
+			 * allow the update to replace all entries.
+			 */
+			*first_non_pref_chan = 0;
+			mbo_ap_sta_free(sta);
+		}
+		mbo_ap_parse_non_pref_chan(sta, buf, len);
+		break;
+	case WFA_WNM_NOTIF_SUBELEM_CELL_DATA_CAPA:
+		mbo_ap_wnm_notif_req_cell_capa(sta, buf, len);
+		break;
+	default:
+		wpa_printf(MSG_DEBUG,
+			   "MBO: Ignore unknown WNM Notification WFA subelement %u",
+			   type);
+		break;
+	}
+}
+
+
+void mbo_ap_wnm_notification_req(struct hostapd_data *hapd, const u8 *addr,
+				 const u8 *buf, size_t len)
+{
+	const u8 *pos, *end;
+	u8 ie_len;
+	struct sta_info *sta;
+	int first_non_pref_chan = 1;
+
+	if (!hapd->conf->mbo_enabled)
+		return;
+
+	sta = ap_get_sta(hapd, addr);
+	if (!sta)
+		return;
+
+	pos = buf;
+	end = buf + len;
+
+	while (end - pos > 1) {
+		ie_len = pos[1];
+
+		if (2 + ie_len > end - pos)
+			break;
+
+		if (pos[0] == WLAN_EID_VENDOR_SPECIFIC &&
+		    ie_len >= 4 && WPA_GET_BE24(pos + 2) == OUI_WFA)
+			mbo_ap_wnm_notif_req_elem(sta, pos[5],
+						  pos + 6, ie_len - 4,
+						  &first_non_pref_chan);
+		else
+			wpa_printf(MSG_DEBUG,
+				   "MBO: Ignore unknown WNM Notification element %u (len=%u)",
+				   pos[0], pos[1]);
+
+		pos += 2 + pos[1];
+	}
+}
diff --git a/src/ap/mbo_ap.h b/src/ap/mbo_ap.h
new file mode 100644
index 0000000000000..9f37f2802f3bc
--- /dev/null
+++ b/src/ap/mbo_ap.h
@@ -0,0 +1,51 @@
+/*
+ * MBO related functions and structures
+ * Copyright (c) 2016, Qualcomm Atheros, Inc.
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ */
+
+#ifndef MBO_AP_H
+#define MBO_AP_H
+
+struct hostapd_data;
+struct sta_info;
+struct ieee802_11_elems;
+
+#ifdef CONFIG_MBO
+
+void mbo_ap_check_sta_assoc(struct hostapd_data *hapd, struct sta_info *sta,
+			    struct ieee802_11_elems *elems);
+int mbo_ap_get_info(struct sta_info *sta, char *buf, size_t buflen);
+void mbo_ap_wnm_notification_req(struct hostapd_data *hapd, const u8 *addr,
+				 const u8 *buf, size_t len);
+void mbo_ap_sta_free(struct sta_info *sta);
+
+#else /* CONFIG_MBO */
+
+static inline void mbo_ap_check_sta_assoc(struct hostapd_data *hapd,
+					  struct sta_info *sta,
+					  struct ieee802_11_elems *elems)
+{
+}
+
+static inline int mbo_ap_get_info(struct sta_info *sta, char *buf,
+				  size_t buflen)
+{
+	return 0;
+}
+
+static inline void mbo_ap_wnm_notification_req(struct hostapd_data *hapd,
+					       const u8 *addr,
+					       const u8 *buf, size_t len)
+{
+}
+
+static inline void mbo_ap_sta_free(struct sta_info *sta)
+{
+}
+
+#endif /* CONFIG_MBO */
+
+#endif /* MBO_AP_H */
diff --git a/src/ap/ndisc_snoop.c b/src/ap/ndisc_snoop.c
index 4a87721e2ecfc..3c086bfc7131b 100644
--- a/src/ap/ndisc_snoop.c
+++ b/src/ap/ndisc_snoop.c
@@ -17,6 +17,7 @@
 #include "ap_drv_ops.h"
 #include "list.h"
 #include "x_snoop.h"
+#include "ndisc_snoop.h"
 
 struct ip6addr {
 	struct in6_addr addr;
diff --git a/src/ap/neighbor_db.c b/src/ap/neighbor_db.c
new file mode 100644
index 0000000000000..a2efff6182868
--- /dev/null
+++ b/src/ap/neighbor_db.c
@@ -0,0 +1,133 @@
+/*
+ * hostapd / Neighboring APs DB
+ * Copyright(c) 2013 - 2016 Intel Mobile Communications GmbH.
+ * Copyright(c) 2011 - 2016 Intel Corporation. All rights reserved.
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ */
+
+#include "utils/includes.h"
+
+#include "utils/common.h"
+#include "hostapd.h"
+#include "neighbor_db.h"
+
+
+struct hostapd_neighbor_entry *
+hostapd_neighbor_get(struct hostapd_data *hapd, const u8 *bssid,
+		     const struct wpa_ssid_value *ssid)
+{
+	struct hostapd_neighbor_entry *nr;
+
+	dl_list_for_each(nr, &hapd->nr_db, struct hostapd_neighbor_entry,
+			 list) {
+		if (os_memcmp(bssid, nr->bssid, ETH_ALEN) == 0 &&
+		    (!ssid ||
+		     (ssid->ssid_len == nr->ssid.ssid_len &&
+		      os_memcmp(ssid->ssid, nr->ssid.ssid,
+				ssid->ssid_len) == 0)))
+			return nr;
+	}
+	return NULL;
+}
+
+
+static void hostapd_neighbor_clear_entry(struct hostapd_neighbor_entry *nr)
+{
+	wpabuf_free(nr->nr);
+	nr->nr = NULL;
+	wpabuf_free(nr->lci);
+	nr->lci = NULL;
+	wpabuf_free(nr->civic);
+	nr->civic = NULL;
+	os_memset(nr->bssid, 0, sizeof(nr->bssid));
+	os_memset(&nr->ssid, 0, sizeof(nr->ssid));
+}
+
+
+static struct hostapd_neighbor_entry *
+hostapd_neighbor_add(struct hostapd_data *hapd)
+{
+	struct hostapd_neighbor_entry *nr;
+
+	nr = os_zalloc(sizeof(struct hostapd_neighbor_entry));
+	if (!nr)
+		return NULL;
+
+	dl_list_add(&hapd->nr_db, &nr->list);
+
+	return nr;
+}
+
+
+int hostapd_neighbor_set(struct hostapd_data *hapd, const u8 *bssid,
+			 const struct wpa_ssid_value *ssid,
+			 const struct wpabuf *nr, const struct wpabuf *lci,
+			 const struct wpabuf *civic)
+{
+	struct hostapd_neighbor_entry *entry;
+
+	entry = hostapd_neighbor_get(hapd, bssid, ssid);
+	if (!entry)
+		entry = hostapd_neighbor_add(hapd);
+	if (!entry)
+		return -1;
+
+	hostapd_neighbor_clear_entry(entry);
+
+	os_memcpy(entry->bssid, bssid, ETH_ALEN);
+	os_memcpy(&entry->ssid, ssid, sizeof(entry->ssid));
+
+	entry->nr = wpabuf_dup(nr);
+	if (!entry->nr)
+		goto fail;
+
+	if (lci) {
+		entry->lci = wpabuf_dup(lci);
+		if (!entry->lci || os_get_time(&entry->lci_date))
+			goto fail;
+	}
+
+	if (civic) {
+		entry->civic = wpabuf_dup(civic);
+		if (!entry->civic)
+			goto fail;
+	}
+
+	return 0;
+
+fail:
+	hostapd_neighbor_remove(hapd, bssid, ssid);
+	return -1;
+}
+
+
+int hostapd_neighbor_remove(struct hostapd_data *hapd, const u8 *bssid,
+			    const struct wpa_ssid_value *ssid)
+{
+	struct hostapd_neighbor_entry *nr;
+
+	nr = hostapd_neighbor_get(hapd, bssid, ssid);
+	if (!nr)
+		return -1;
+
+	hostapd_neighbor_clear_entry(nr);
+	dl_list_del(&nr->list);
+	os_free(nr);
+
+	return 0;
+}
+
+
+void hostpad_free_neighbor_db(struct hostapd_data *hapd)
+{
+	struct hostapd_neighbor_entry *nr, *prev;
+
+	dl_list_for_each_safe(nr, prev, &hapd->nr_db,
+			      struct hostapd_neighbor_entry, list) {
+		hostapd_neighbor_clear_entry(nr);
+		dl_list_del(&nr->list);
+		os_free(nr);
+	}
+}
diff --git a/src/ap/neighbor_db.h b/src/ap/neighbor_db.h
new file mode 100644
index 0000000000000..c22e043c120ef
--- /dev/null
+++ b/src/ap/neighbor_db.h
@@ -0,0 +1,24 @@
+/*
+ * hostapd / Neighboring APs DB
+ * Copyright(c) 2013 - 2016 Intel Mobile Communications GmbH.
+ * Copyright(c) 2011 - 2016 Intel Corporation. All rights reserved.
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ */
+
+#ifndef NEIGHBOR_DB_H
+#define NEIGHBOR_DB_H
+
+struct hostapd_neighbor_entry *
+hostapd_neighbor_get(struct hostapd_data *hapd, const u8 *bssid,
+		     const struct wpa_ssid_value *ssid);
+int hostapd_neighbor_set(struct hostapd_data *hapd, const u8 *bssid,
+			 const struct wpa_ssid_value *ssid,
+			 const struct wpabuf *nr, const struct wpabuf *lci,
+			 const struct wpabuf *civic);
+int hostapd_neighbor_remove(struct hostapd_data *hapd, const u8 *bssid,
+			    const struct wpa_ssid_value *ssid);
+void hostpad_free_neighbor_db(struct hostapd_data *hapd);
+
+#endif /* NEIGHBOR_DB_H */
diff --git a/src/ap/pmksa_cache_auth.c b/src/ap/pmksa_cache_auth.c
index 877affe4eadcc..d610e7e5b0057 100644
--- a/src/ap/pmksa_cache_auth.c
+++ b/src/ap/pmksa_cache_auth.c
@@ -38,6 +38,7 @@ static void pmksa_cache_set_expiration(struct rsn_pmksa_cache *pmksa);
 
 static void _pmksa_cache_free_entry(struct rsn_pmksa_cache_entry *entry)
 {
+	os_free(entry->vlan_desc);
 	os_free(entry->identity);
 	wpabuf_free(entry->cui);
 #ifndef CONFIG_NO_RADIUS
@@ -91,6 +92,20 @@ void pmksa_cache_free_entry(struct rsn_pmksa_cache *pmksa,
 }
 
 
+/**
+ * pmksa_cache_auth_flush - Flush all PMKSA cache entries
+ * @pmksa: Pointer to PMKSA cache data from pmksa_cache_auth_init()
+ */
+void pmksa_cache_auth_flush(struct rsn_pmksa_cache *pmksa)
+{
+	while (pmksa->pmksa) {
+		wpa_printf(MSG_DEBUG, "RSN: Flush PMKSA cache entry for "
+			   MACSTR, MAC2STR(pmksa->pmksa->spa));
+		pmksa_cache_free_entry(pmksa, pmksa->pmksa);
+	}
+}
+
+
 static void pmksa_cache_expire(void *eloop_ctx, void *timeout_ctx)
 {
 	struct rsn_pmksa_cache *pmksa = eloop_ctx;
@@ -126,6 +141,8 @@ static void pmksa_cache_set_expiration(struct rsn_pmksa_cache *pmksa)
 static void pmksa_cache_from_eapol_data(struct rsn_pmksa_cache_entry *entry,
 					struct eapol_state_machine *eapol)
 {
+	struct vlan_description *vlan_desc;
+
 	if (eapol == NULL)
 		return;
 
@@ -146,14 +163,22 @@ static void pmksa_cache_from_eapol_data(struct rsn_pmksa_cache_entry *entry,
 #endif /* CONFIG_NO_RADIUS */
 
 	entry->eap_type_authsrv = eapol->eap_type_authsrv;
-	entry->vlan_id = ((struct sta_info *) eapol->sta)->vlan_id;
 
-	entry->acct_multi_session_id_hi = eapol->acct_multi_session_id_hi;
-	entry->acct_multi_session_id_lo = eapol->acct_multi_session_id_lo;
+	vlan_desc = ((struct sta_info *) eapol->sta)->vlan_desc;
+	if (vlan_desc && vlan_desc->notempty) {
+		entry->vlan_desc = os_zalloc(sizeof(struct vlan_description));
+		if (entry->vlan_desc)
+			*entry->vlan_desc = *vlan_desc;
+	} else {
+		entry->vlan_desc = NULL;
+	}
+
+	entry->acct_multi_session_id = eapol->acct_multi_session_id;
 }
 
 
-void pmksa_cache_to_eapol_data(struct rsn_pmksa_cache_entry *entry,
+void pmksa_cache_to_eapol_data(struct hostapd_data *hapd,
+			       struct rsn_pmksa_cache_entry *entry,
 			       struct eapol_state_machine *eapol)
 {
 	if (entry == NULL || eapol == NULL)
@@ -186,10 +211,11 @@ void pmksa_cache_to_eapol_data(struct rsn_pmksa_cache_entry *entry,
 	}
 
 	eapol->eap_type_authsrv = entry->eap_type_authsrv;
-	((struct sta_info *) eapol->sta)->vlan_id = entry->vlan_id;
+#ifndef CONFIG_NO_VLAN
+	ap_sta_set_vlan(hapd, eapol->sta, entry->vlan_desc);
+#endif /* CONFIG_NO_VLAN */
 
-	eapol->acct_multi_session_id_hi = entry->acct_multi_session_id_hi;
-	eapol->acct_multi_session_id_lo = entry->acct_multi_session_id_lo;
+	eapol->acct_multi_session_id = entry->acct_multi_session_id;
 }
 
 
@@ -234,6 +260,7 @@ static void pmksa_cache_link_entry(struct rsn_pmksa_cache *pmksa,
  * @pmksa: Pointer to PMKSA cache data from pmksa_cache_auth_init()
  * @pmk: The new pairwise master key
  * @pmk_len: PMK length in bytes, usually PMK_LEN (32)
+ * @pmkid: Calculated PMKID
  * @kck: Key confirmation key or %NULL if not yet derived
  * @kck_len: KCK length in bytes
  * @aa: Authenticator address
@@ -250,7 +277,7 @@ static void pmksa_cache_link_entry(struct rsn_pmksa_cache *pmksa,
  */
 struct rsn_pmksa_cache_entry *
 pmksa_cache_auth_add(struct rsn_pmksa_cache *pmksa,
-		     const u8 *pmk, size_t pmk_len,
+		     const u8 *pmk, size_t pmk_len, const u8 *pmkid,
 		     const u8 *kck, size_t kck_len,
 		     const u8 *aa, const u8 *spa, int session_timeout,
 		     struct eapol_state_machine *eapol, int akmp)
@@ -258,7 +285,7 @@ pmksa_cache_auth_add(struct rsn_pmksa_cache *pmksa,
 	struct rsn_pmksa_cache_entry *entry, *pos;
 	struct os_reltime now;
 
-	if (pmk_len > PMK_LEN)
+	if (pmk_len > PMK_LEN_MAX)
 		return NULL;
 
 	if (wpa_key_mgmt_suite_b(akmp) && !kck)
@@ -269,7 +296,9 @@ pmksa_cache_auth_add(struct rsn_pmksa_cache *pmksa,
 		return NULL;
 	os_memcpy(entry->pmk, pmk, pmk_len);
 	entry->pmk_len = pmk_len;
-	if (akmp == WPA_KEY_MGMT_IEEE8021X_SUITE_B_192)
+	if (pmkid)
+		os_memcpy(entry->pmkid, pmkid, PMKID_LEN);
+	else if (akmp == WPA_KEY_MGMT_IEEE8021X_SUITE_B_192)
 		rsn_pmkid_suite_b_192(kck, kck_len, aa, spa, entry->pmkid);
 	else if (wpa_key_mgmt_suite_b(akmp))
 		rsn_pmkid_suite_b(kck, kck_len, aa, spa, entry->pmkid);
@@ -337,7 +366,13 @@ pmksa_cache_add_okc(struct rsn_pmksa_cache *pmksa,
 	radius_copy_class(&entry->radius_class, &old_entry->radius_class);
 #endif /* CONFIG_NO_RADIUS */
 	entry->eap_type_authsrv = old_entry->eap_type_authsrv;
-	entry->vlan_id = old_entry->vlan_id;
+	if (old_entry->vlan_desc) {
+		entry->vlan_desc = os_zalloc(sizeof(struct vlan_description));
+		if (entry->vlan_desc)
+			*entry->vlan_desc = *old_entry->vlan_desc;
+	} else {
+		entry->vlan_desc = NULL;
+	}
 	entry->opportunistic = 1;
 
 	pmksa_cache_link_entry(pmksa, entry);
@@ -471,12 +506,11 @@ static int das_attr_match(struct rsn_pmksa_cache_entry *entry,
 	if (attr->acct_multi_session_id) {
 		char buf[20];
 
-		if (attr->acct_multi_session_id_len != 17)
+		if (attr->acct_multi_session_id_len != 16)
 			return 0;
-		os_snprintf(buf, sizeof(buf), "%08X+%08X",
-			    entry->acct_multi_session_id_hi,
-			    entry->acct_multi_session_id_lo);
-		if (os_memcmp(attr->acct_multi_session_id, buf, 17) != 0)
+		os_snprintf(buf, sizeof(buf), "%016llX",
+			    (unsigned long long) entry->acct_multi_session_id);
+		if (os_memcmp(attr->acct_multi_session_id, buf, 16) != 0)
 			return 0;
 		match++;
 	}
@@ -526,3 +560,48 @@ int pmksa_cache_auth_radius_das_disconnect(struct rsn_pmksa_cache *pmksa,
 
 	return found ? 0 : -1;
 }
+
+
+/**
+ * pmksa_cache_auth_list - Dump text list of entries in PMKSA cache
+ * @pmksa: Pointer to PMKSA cache data from pmksa_cache_auth_init()
+ * @buf: Buffer for the list
+ * @len: Length of the buffer
+ * Returns: Number of bytes written to buffer
+ *
+ * This function is used to generate a text format representation of the
+ * current PMKSA cache contents for the ctrl_iface PMKSA command.
+ */
+int pmksa_cache_auth_list(struct rsn_pmksa_cache *pmksa, char *buf, size_t len)
+{
+	int i, ret;
+	char *pos = buf;
+	struct rsn_pmksa_cache_entry *entry;
+	struct os_reltime now;
+
+	os_get_reltime(&now);
+	ret = os_snprintf(pos, buf + len - pos,
+			  "Index / SPA / PMKID / expiration (in seconds) / opportunistic\n");
+	if (os_snprintf_error(buf + len - pos, ret))
+		return pos - buf;
+	pos += ret;
+	i = 0;
+	entry = pmksa->pmksa;
+	while (entry) {
+		ret = os_snprintf(pos, buf + len - pos, "%d " MACSTR " ",
+				  i, MAC2STR(entry->spa));
+		if (os_snprintf_error(buf + len - pos, ret))
+			return pos - buf;
+		pos += ret;
+		pos += wpa_snprintf_hex(pos, buf + len - pos, entry->pmkid,
+					PMKID_LEN);
+		ret = os_snprintf(pos, buf + len - pos, " %d %d\n",
+				  (int) (entry->expiration - now.sec),
+				  entry->opportunistic);
+		if (os_snprintf_error(buf + len - pos, ret))
+			return pos - buf;
+		pos += ret;
+		entry = entry->next;
+	}
+	return pos - buf;
+}
diff --git a/src/ap/pmksa_cache_auth.h b/src/ap/pmksa_cache_auth.h
index 8b7be1291b53a..d8d9c5a25c0e4 100644
--- a/src/ap/pmksa_cache_auth.h
+++ b/src/ap/pmksa_cache_auth.h
@@ -17,7 +17,7 @@
 struct rsn_pmksa_cache_entry {
 	struct rsn_pmksa_cache_entry *next, *hnext;
 	u8 pmkid[PMKID_LEN];
-	u8 pmk[PMK_LEN];
+	u8 pmk[PMK_LEN_MAX];
 	size_t pmk_len;
 	os_time_t expiration;
 	int akmp; /* WPA_KEY_MGMT_* */
@@ -28,11 +28,10 @@ struct rsn_pmksa_cache_entry {
 	struct wpabuf *cui;
 	struct radius_class_data radius_class;
 	u8 eap_type_authsrv;
-	int vlan_id;
+	struct vlan_description *vlan_desc;
 	int opportunistic;
 
-	u32 acct_multi_session_id_hi;
-	u32 acct_multi_session_id_lo;
+	u64 acct_multi_session_id;
 };
 
 struct rsn_pmksa_cache;
@@ -49,7 +48,7 @@ struct rsn_pmksa_cache_entry * pmksa_cache_get_okc(
 	const u8 *pmkid);
 struct rsn_pmksa_cache_entry *
 pmksa_cache_auth_add(struct rsn_pmksa_cache *pmksa,
-		     const u8 *pmk, size_t pmk_len,
+		     const u8 *pmk, size_t pmk_len, const u8 *pmkid,
 		     const u8 *kck, size_t kck_len,
 		     const u8 *aa, const u8 *spa, int session_timeout,
 		     struct eapol_state_machine *eapol, int akmp);
@@ -57,11 +56,14 @@ struct rsn_pmksa_cache_entry *
 pmksa_cache_add_okc(struct rsn_pmksa_cache *pmksa,
 		    const struct rsn_pmksa_cache_entry *old_entry,
 		    const u8 *aa, const u8 *pmkid);
-void pmksa_cache_to_eapol_data(struct rsn_pmksa_cache_entry *entry,
+void pmksa_cache_to_eapol_data(struct hostapd_data *hapd,
+			       struct rsn_pmksa_cache_entry *entry,
 			       struct eapol_state_machine *eapol);
 void pmksa_cache_free_entry(struct rsn_pmksa_cache *pmksa,
 			    struct rsn_pmksa_cache_entry *entry);
 int pmksa_cache_auth_radius_das_disconnect(struct rsn_pmksa_cache *pmksa,
 					   struct radius_das_attrs *attr);
+int pmksa_cache_auth_list(struct rsn_pmksa_cache *pmksa, char *buf, size_t len);
+void pmksa_cache_auth_flush(struct rsn_pmksa_cache *pmksa);
 
 #endif /* PMKSA_CACHE_H */
diff --git a/src/ap/rrm.c b/src/ap/rrm.c
new file mode 100644
index 0000000000000..3569f955bcd27
--- /dev/null
+++ b/src/ap/rrm.c
@@ -0,0 +1,544 @@
+/*
+ * hostapd / Radio Measurement (RRM)
+ * Copyright(c) 2013 - 2016 Intel Mobile Communications GmbH.
+ * Copyright(c) 2011 - 2016 Intel Corporation. All rights reserved.
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ */
+
+#include "utils/includes.h"
+
+#include "utils/common.h"
+#include "hostapd.h"
+#include "ap_drv_ops.h"
+#include "sta_info.h"
+#include "eloop.h"
+#include "neighbor_db.h"
+#include "rrm.h"
+
+#define HOSTAPD_RRM_REQUEST_TIMEOUT 5
+
+
+static void hostapd_lci_rep_timeout_handler(void *eloop_data, void *user_ctx)
+{
+	struct hostapd_data *hapd = eloop_data;
+
+	wpa_printf(MSG_DEBUG, "RRM: LCI request (token %u) timed out",
+		   hapd->lci_req_token);
+	hapd->lci_req_active = 0;
+}
+
+
+static void hostapd_handle_lci_report(struct hostapd_data *hapd, u8 token,
+				      const u8 *pos, size_t len)
+{
+	if (!hapd->lci_req_active || hapd->lci_req_token != token) {
+		wpa_printf(MSG_DEBUG, "Unexpected LCI report, token %u", token);
+		return;
+	}
+
+	hapd->lci_req_active = 0;
+	eloop_cancel_timeout(hostapd_lci_rep_timeout_handler, hapd, NULL);
+	wpa_printf(MSG_DEBUG, "LCI report token %u len %zu", token, len);
+}
+
+
+static void hostapd_range_rep_timeout_handler(void *eloop_data, void *user_ctx)
+{
+	struct hostapd_data *hapd = eloop_data;
+
+	wpa_printf(MSG_DEBUG, "RRM: Range request (token %u) timed out",
+		   hapd->range_req_token);
+	hapd->range_req_active = 0;
+}
+
+
+static void hostapd_handle_range_report(struct hostapd_data *hapd, u8 token,
+					const u8 *pos, size_t len)
+{
+	if (!hapd->range_req_active || hapd->range_req_token != token) {
+		wpa_printf(MSG_DEBUG, "Unexpected range report, token %u",
+			   token);
+		return;
+	}
+
+	hapd->range_req_active = 0;
+	eloop_cancel_timeout(hostapd_range_rep_timeout_handler, hapd, NULL);
+	wpa_printf(MSG_DEBUG, "Range report token %u len %zu", token, len);
+}
+
+
+static void hostapd_handle_radio_msmt_report(struct hostapd_data *hapd,
+					     const u8 *buf, size_t len)
+{
+	const struct ieee80211_mgmt *mgmt = (const struct ieee80211_mgmt *) buf;
+	const u8 *pos, *ie, *end;
+	u8 token;
+
+	end = buf + len;
+	token = mgmt->u.action.u.rrm.dialog_token;
+	pos = mgmt->u.action.u.rrm.variable;
+
+	while ((ie = get_ie(pos, end - pos, WLAN_EID_MEASURE_REPORT))) {
+		if (ie[1] < 5) {
+			wpa_printf(MSG_DEBUG, "Bad Measurement Report element");
+			break;
+		}
+
+		wpa_printf(MSG_DEBUG, "Measurement report type %u", ie[4]);
+
+		switch (ie[4]) {
+		case MEASURE_TYPE_LCI:
+			hostapd_handle_lci_report(hapd, token, ie + 2, ie[1]);
+			break;
+		case MEASURE_TYPE_FTM_RANGE:
+			hostapd_handle_range_report(hapd, token, ie + 2, ie[1]);
+			break;
+		default:
+			wpa_printf(MSG_DEBUG,
+				   "Measurement report type %u is not supported",
+				   ie[4]);
+			break;
+		}
+
+		pos = ie + ie[1] + 2;
+	}
+}
+
+
+static u16 hostapd_parse_location_lci_req_age(const u8 *buf, size_t len)
+{
+	const u8 *subelem;
+
+	/* Range Request element + Location Subject + Maximum Age subelement */
+	if (len < 3 + 1 + 4)
+		return 0;
+
+	/* Subelements are arranged as IEs */
+	subelem = get_ie(buf + 4, len - 4, LCI_REQ_SUBELEM_MAX_AGE);
+	if (subelem && subelem[1] == 2)
+		return *(u16 *) (subelem + 2);
+
+	return 0;
+}
+
+
+static int hostapd_check_lci_age(struct hostapd_neighbor_entry *nr, u16 max_age)
+{
+	struct os_time curr, diff;
+	unsigned long diff_l;
+
+	if (!max_age)
+		return 0;
+
+	if (max_age == 0xffff)
+		return 1;
+
+	if (os_get_time(&curr))
+		return 0;
+
+	os_time_sub(&curr, &nr->lci_date, &diff);
+
+	/* avoid overflow */
+	if (diff.sec > 0xffff)
+		return 0;
+
+	/* LCI age is calculated in 10th of a second units. */
+	diff_l = diff.sec * 10 + diff.usec / 100000;
+
+	return max_age > diff_l;
+}
+
+
+static size_t hostapd_neighbor_report_len(struct wpabuf *buf,
+					  struct hostapd_neighbor_entry *nr,
+					  int send_lci, int send_civic)
+{
+	size_t len = 2 + wpabuf_len(nr->nr);
+
+	if (send_lci && nr->lci)
+		len += 2 + wpabuf_len(nr->lci);
+
+	if (send_civic && nr->civic)
+		len += 2 + wpabuf_len(nr->civic);
+
+	return len;
+}
+
+
+static void hostapd_send_nei_report_resp(struct hostapd_data *hapd,
+					 const u8 *addr, u8 dialog_token,
+					 struct wpa_ssid_value *ssid, u8 lci,
+					 u8 civic, u16 lci_max_age)
+{
+	struct hostapd_neighbor_entry *nr;
+	struct wpabuf *buf;
+	u8 *msmt_token;
+
+	/*
+	 * The number and length of the Neighbor Report elements in a Neighbor
+	 * Report frame is limited by the maximum allowed MMPDU size; + 3 bytes
+	 * of RRM header.
+	 */
+	buf = wpabuf_alloc(3 + IEEE80211_MAX_MMPDU_SIZE);
+	if (!buf)
+		return;
+
+	wpabuf_put_u8(buf, WLAN_ACTION_RADIO_MEASUREMENT);
+	wpabuf_put_u8(buf, WLAN_RRM_NEIGHBOR_REPORT_RESPONSE);
+	wpabuf_put_u8(buf, dialog_token);
+
+	dl_list_for_each(nr, &hapd->nr_db, struct hostapd_neighbor_entry,
+			 list) {
+		int send_lci;
+		size_t len;
+
+		if (ssid->ssid_len != nr->ssid.ssid_len ||
+		    os_memcmp(ssid->ssid, nr->ssid.ssid, ssid->ssid_len) != 0)
+			continue;
+
+		send_lci = (lci != 0) && hostapd_check_lci_age(nr, lci_max_age);
+		len = hostapd_neighbor_report_len(buf, nr, send_lci, civic);
+
+		if (len - 2 > 0xff) {
+			wpa_printf(MSG_DEBUG,
+				   "NR entry for " MACSTR " exceeds 0xFF bytes",
+				   MAC2STR(nr->bssid));
+			continue;
+		}
+
+		if (len > wpabuf_tailroom(buf))
+			break;
+
+		wpabuf_put_u8(buf, WLAN_EID_NEIGHBOR_REPORT);
+		wpabuf_put_u8(buf, len - 2);
+		wpabuf_put_buf(buf, nr->nr);
+
+		if (send_lci && nr->lci) {
+			wpabuf_put_u8(buf, WLAN_EID_MEASURE_REPORT);
+			wpabuf_put_u8(buf, wpabuf_len(nr->lci));
+			/*
+			 * Override measurement token - the first byte of the
+			 * Measurement Report element.
+			 */
+			msmt_token = wpabuf_put(buf, 0);
+			wpabuf_put_buf(buf, nr->lci);
+			*msmt_token = lci;
+		}
+
+		if (civic && nr->civic) {
+			wpabuf_put_u8(buf, WLAN_EID_MEASURE_REPORT);
+			wpabuf_put_u8(buf, wpabuf_len(nr->civic));
+			/*
+			 * Override measurement token - the first byte of the
+			 * Measurement Report element.
+			 */
+			msmt_token = wpabuf_put(buf, 0);
+			wpabuf_put_buf(buf, nr->civic);
+			*msmt_token = civic;
+		}
+	}
+
+	hostapd_drv_send_action(hapd, hapd->iface->freq, 0, addr,
+				wpabuf_head(buf), wpabuf_len(buf));
+	wpabuf_free(buf);
+}
+
+
+static void hostapd_handle_nei_report_req(struct hostapd_data *hapd,
+					  const u8 *buf, size_t len)
+{
+	const struct ieee80211_mgmt *mgmt = (const struct ieee80211_mgmt *) buf;
+	const u8 *pos, *ie, *end;
+	struct wpa_ssid_value ssid = {
+		.ssid_len = 0
+	};
+	u8 token;
+	u8 lci = 0, civic = 0; /* Measurement tokens */
+	u16 lci_max_age = 0;
+
+	if (!(hapd->conf->radio_measurements[0] &
+	      WLAN_RRM_CAPS_NEIGHBOR_REPORT))
+		return;
+
+	end = buf + len;
+
+	token = mgmt->u.action.u.rrm.dialog_token;
+	pos = mgmt->u.action.u.rrm.variable;
+	len = end - pos;
+
+	ie = get_ie(pos, len, WLAN_EID_SSID);
+	if (ie && ie[1] && ie[1] <= SSID_MAX_LEN) {
+		ssid.ssid_len = ie[1];
+		os_memcpy(ssid.ssid, ie + 2, ssid.ssid_len);
+	} else {
+		ssid.ssid_len = hapd->conf->ssid.ssid_len;
+		os_memcpy(ssid.ssid, hapd->conf->ssid.ssid, ssid.ssid_len);
+	}
+
+	while ((ie = get_ie(pos, len, WLAN_EID_MEASURE_REQUEST))) {
+		if (ie[1] < 3)
+			break;
+
+		wpa_printf(MSG_DEBUG,
+			   "Neighbor report request, measure type %u",
+			   ie[4]);
+
+		switch (ie[4]) { /* Measurement Type */
+		case MEASURE_TYPE_LCI:
+			lci = ie[2]; /* Measurement Token */
+			lci_max_age = hostapd_parse_location_lci_req_age(ie + 2,
+									 ie[1]);
+			break;
+		case MEASURE_TYPE_LOCATION_CIVIC:
+			civic = ie[2]; /* Measurement token */
+			break;
+		}
+
+		pos = ie + ie[1] + 2;
+		len = end - pos;
+	}
+
+	hostapd_send_nei_report_resp(hapd, mgmt->sa, token, &ssid, lci, civic,
+				     lci_max_age);
+}
+
+
+void hostapd_handle_radio_measurement(struct hostapd_data *hapd,
+				      const u8 *buf, size_t len)
+{
+	const struct ieee80211_mgmt *mgmt = (const struct ieee80211_mgmt *) buf;
+
+	/*
+	 * Check for enough bytes: header + (1B)Category + (1B)Action +
+	 * (1B)Dialog Token.
+	 */
+	if (len < IEEE80211_HDRLEN + 3)
+		return;
+
+	wpa_printf(MSG_DEBUG, "Radio measurement frame, action %u from " MACSTR,
+		   mgmt->u.action.u.rrm.action, MAC2STR(mgmt->sa));
+
+	switch (mgmt->u.action.u.rrm.action) {
+	case WLAN_RRM_RADIO_MEASUREMENT_REPORT:
+		hostapd_handle_radio_msmt_report(hapd, buf, len);
+		break;
+	case WLAN_RRM_NEIGHBOR_REPORT_REQUEST:
+		hostapd_handle_nei_report_req(hapd, buf, len);
+		break;
+	default:
+		wpa_printf(MSG_DEBUG, "RRM action %u is not supported",
+			   mgmt->u.action.u.rrm.action);
+		break;
+	}
+}
+
+
+int hostapd_send_lci_req(struct hostapd_data *hapd, const u8 *addr)
+{
+	struct wpabuf *buf;
+	struct sta_info *sta = ap_get_sta(hapd, addr);
+	int ret;
+
+	if (!sta) {
+		wpa_printf(MSG_INFO,
+			   "Request LCI: Destination address is not in station list");
+		return -1;
+	}
+
+	if (!(sta->flags & WLAN_STA_AUTHORIZED)) {
+		wpa_printf(MSG_INFO,
+			   "Request LCI: Destination address is not connected");
+		return -1;
+	}
+
+	if (!(sta->rrm_enabled_capa[1] & WLAN_RRM_CAPS_LCI_MEASUREMENT)) {
+		wpa_printf(MSG_INFO,
+			   "Request LCI: Station does not support LCI in RRM");
+		return -1;
+	}
+
+	if (hapd->lci_req_active) {
+		wpa_printf(MSG_DEBUG,
+			   "Request LCI: LCI request is already in process, overriding");
+		hapd->lci_req_active = 0;
+		eloop_cancel_timeout(hostapd_lci_rep_timeout_handler, hapd,
+				     NULL);
+	}
+
+	/* Measurement request (5) + Measurement element with LCI (10) */
+	buf = wpabuf_alloc(5 + 10);
+	if (!buf)
+		return -1;
+
+	hapd->lci_req_token++;
+	/* For wraparounds - the token must be nonzero */
+	if (!hapd->lci_req_token)
+		hapd->lci_req_token++;
+
+	wpabuf_put_u8(buf, WLAN_ACTION_RADIO_MEASUREMENT);
+	wpabuf_put_u8(buf, WLAN_RRM_RADIO_MEASUREMENT_REQUEST);
+	wpabuf_put_u8(buf, hapd->lci_req_token);
+	wpabuf_put_le16(buf, 0); /* Number of repetitions */
+
+	wpabuf_put_u8(buf, WLAN_EID_MEASURE_REQUEST);
+	wpabuf_put_u8(buf, 3 + 1 + 4);
+
+	wpabuf_put_u8(buf, 1); /* Measurement Token */
+	/*
+	 * Parallel and Enable bits are 0, Duration, Request, and Report are
+	 * reserved.
+	 */
+	wpabuf_put_u8(buf, 0);
+	wpabuf_put_u8(buf, MEASURE_TYPE_LCI);
+
+	wpabuf_put_u8(buf, LOCATION_SUBJECT_REMOTE);
+
+	wpabuf_put_u8(buf, LCI_REQ_SUBELEM_MAX_AGE);
+	wpabuf_put_u8(buf, 2);
+	wpabuf_put_le16(buf, 0xffff);
+
+	ret = hostapd_drv_send_action(hapd, hapd->iface->freq, 0, addr,
+				      wpabuf_head(buf), wpabuf_len(buf));
+	wpabuf_free(buf);
+	if (ret)
+		return ret;
+
+	hapd->lci_req_active = 1;
+
+	eloop_register_timeout(HOSTAPD_RRM_REQUEST_TIMEOUT, 0,
+			       hostapd_lci_rep_timeout_handler, hapd, NULL);
+
+	return 0;
+}
+
+
+int hostapd_send_range_req(struct hostapd_data *hapd, const u8 *addr,
+			   u16 random_interval, u8 min_ap,
+			   const u8 *responders, unsigned int n_responders)
+{
+	struct wpabuf *buf;
+	struct sta_info *sta;
+	u8 *len;
+	unsigned int i;
+	int ret;
+
+	wpa_printf(MSG_DEBUG, "Request range: dest addr " MACSTR
+		   " rand interval %u min AP %u n_responders %u", MAC2STR(addr),
+		   random_interval, min_ap, n_responders);
+
+	if (min_ap == 0 || min_ap > n_responders) {
+		wpa_printf(MSG_INFO, "Request range: Wrong min AP count");
+		return -1;
+	}
+
+	sta = ap_get_sta(hapd, addr);
+	if (!sta || !(sta->flags & WLAN_STA_AUTHORIZED)) {
+		wpa_printf(MSG_INFO,
+			   "Request range: Destination address is not connected");
+		return -1;
+	}
+
+	if (!(sta->rrm_enabled_capa[4] & WLAN_RRM_CAPS_FTM_RANGE_REPORT)) {
+		wpa_printf(MSG_ERROR,
+			   "Request range: Destination station does not support FTM range report in RRM");
+		return -1;
+	}
+
+	if (hapd->range_req_active) {
+		wpa_printf(MSG_DEBUG,
+			   "Request range: Range request is already in process; overriding");
+		hapd->range_req_active = 0;
+		eloop_register_timeout(HOSTAPD_RRM_REQUEST_TIMEOUT, 0,
+				       hostapd_range_rep_timeout_handler, hapd,
+				       NULL);
+	}
+
+	/* Action + measurement type + token + reps + EID + len = 7 */
+	buf = wpabuf_alloc(7 + 255);
+	if (!buf)
+		return -1;
+
+	hapd->range_req_token++;
+	if (!hapd->range_req_token) /* For wraparounds */
+		hapd->range_req_token++;
+
+	/* IEEE P802.11-REVmc/D5.0, 9.6.7.2 */
+	wpabuf_put_u8(buf, WLAN_ACTION_RADIO_MEASUREMENT);
+	wpabuf_put_u8(buf, WLAN_RRM_RADIO_MEASUREMENT_REQUEST);
+	wpabuf_put_u8(buf, hapd->range_req_token); /* Dialog Token */
+	wpabuf_put_le16(buf, 0); /* Number of Repetitions */
+
+	/* IEEE P802.11-REVmc/D5.0, 9.4.2.21 */
+	wpabuf_put_u8(buf, WLAN_EID_MEASURE_REQUEST);
+	len = wpabuf_put(buf, 1); /* Length will be set later */
+
+	wpabuf_put_u8(buf, 1); /* Measurement Token */
+	/*
+	 * Parallel and Enable bits are 0; Duration, Request, and Report are
+	 * reserved.
+	 */
+	wpabuf_put_u8(buf, 0); /* Measurement Request Mode */
+	wpabuf_put_u8(buf, MEASURE_TYPE_FTM_RANGE); /* Measurement Type */
+
+	/* IEEE P802.11-REVmc/D5.0, 9.4.2.21.19 */
+	wpabuf_put_le16(buf, random_interval); /* Randomization Interval */
+	wpabuf_put_u8(buf, min_ap); /* Minimum AP Count */
+
+	/* FTM Range Subelements */
+
+	/*
+	 * Taking the neighbor report part of the range request from neighbor
+	 * database instead of requesting the separate bits of data from the
+	 * user.
+	 */
+	for (i = 0; i < n_responders; i++) {
+		struct hostapd_neighbor_entry *nr;
+
+		nr = hostapd_neighbor_get(hapd, responders + ETH_ALEN * i,
+					  NULL);
+		if (!nr) {
+			wpa_printf(MSG_INFO, "Missing neighbor report for "
+				   MACSTR, MAC2STR(responders + ETH_ALEN * i));
+			wpabuf_free(buf);
+			return -1;
+		}
+
+		if (wpabuf_tailroom(buf) < 2 + wpabuf_len(nr->nr)) {
+			wpa_printf(MSG_ERROR, "Too long range request");
+			wpabuf_free(buf);
+			return -1;
+		}
+
+		wpabuf_put_u8(buf, WLAN_EID_NEIGHBOR_REPORT);
+		wpabuf_put_u8(buf, wpabuf_len(nr->nr));
+		wpabuf_put_buf(buf, nr->nr);
+	}
+
+	/* Action + measurement type + token + reps + EID + len = 7 */
+	*len = wpabuf_len(buf) - 7;
+
+	ret = hostapd_drv_send_action(hapd, hapd->iface->freq, 0, addr,
+				      wpabuf_head(buf), wpabuf_len(buf));
+	wpabuf_free(buf);
+	if (ret)
+		return ret;
+
+	hapd->range_req_active = 1;
+
+	eloop_register_timeout(HOSTAPD_RRM_REQUEST_TIMEOUT, 0,
+			       hostapd_range_rep_timeout_handler, hapd, NULL);
+
+	return 0;
+}
+
+
+void hostapd_clean_rrm(struct hostapd_data *hapd)
+{
+	hostpad_free_neighbor_db(hapd);
+	eloop_cancel_timeout(hostapd_lci_rep_timeout_handler, hapd, NULL);
+	hapd->lci_req_active = 0;
+	eloop_cancel_timeout(hostapd_range_rep_timeout_handler, hapd, NULL);
+	hapd->range_req_active = 0;
+}
diff --git a/src/ap/rrm.h b/src/ap/rrm.h
new file mode 100644
index 0000000000000..f07fd41ac0195
--- /dev/null
+++ b/src/ap/rrm.h
@@ -0,0 +1,28 @@
+/*
+ * hostapd / Radio Measurement (RRM)
+ * Copyright(c) 2013 - 2016 Intel Mobile Communications GmbH.
+ * Copyright(c) 2011 - 2016 Intel Corporation. All rights reserved.
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ */
+
+#ifndef RRM_H
+#define RRM_H
+
+/*
+ * Max measure request length is 255, -6 of the body we have 249 for the
+ * neighbor report elements. Each neighbor report element is at least 2 + 13
+ * bytes, so we can't have more than 16 responders in the request.
+ */
+#define RRM_RANGE_REQ_MAX_RESPONDERS 16
+
+void hostapd_handle_radio_measurement(struct hostapd_data *hapd,
+				      const u8 *buf, size_t len);
+int hostapd_send_lci_req(struct hostapd_data *hapd, const u8 *addr);
+int hostapd_send_range_req(struct hostapd_data *hapd, const u8 *addr,
+			   u16 random_interval, u8 min_ap,
+			   const u8 *responders, unsigned int n_responders);
+void hostapd_clean_rrm(struct hostapd_data *hapd);
+
+#endif /* RRM_H */
diff --git a/src/ap/sta_info.c b/src/ap/sta_info.c
index d64307ccfd085..f12d4088b1314 100644
--- a/src/ap/sta_info.c
+++ b/src/ap/sta_info.c
@@ -32,8 +32,10 @@
 #include "ap_drv_ops.h"
 #include "gas_serv.h"
 #include "wnm_ap.h"
+#include "mbo_ap.h"
 #include "ndisc_snoop.h"
 #include "sta_info.h"
+#include "vlan.h"
 
 static void ap_sta_remove_in_other_bss(struct hostapd_data *hapd,
 				       struct sta_info *sta);
@@ -169,21 +171,10 @@ void ap_free_sta(struct hostapd_data *hapd, struct sta_info *sta)
 	ap_sta_ip6addr_del(hapd, sta);
 
 	if (!hapd->iface->driver_ap_teardown &&
-	    !(sta->flags & WLAN_STA_PREAUTH))
+	    !(sta->flags & WLAN_STA_PREAUTH)) {
 		hostapd_drv_sta_remove(hapd, sta->addr);
-
-#ifndef CONFIG_NO_VLAN
-	if (sta->vlan_id_bound) {
-		/*
-		 * Need to remove the STA entry before potentially removing the
-		 * VLAN.
-		 */
-		if (hapd->iface->driver_ap_teardown &&
-		    !(sta->flags & WLAN_STA_PREAUTH))
-			hostapd_drv_sta_remove(hapd, sta->addr);
-		vlan_remove_dynamic(hapd, sta->vlan_id_bound);
+		sta->added_unassoc = 0;
 	}
-#endif /* CONFIG_NO_VLAN */
 
 	ap_sta_hash_del(hapd, sta);
 	ap_sta_list_del(hapd, sta);
@@ -231,6 +222,13 @@ void ap_free_sta(struct hostapd_data *hapd, struct sta_info *sta)
 		hapd->iface->num_sta_ht_20mhz--;
 	}
 
+#ifdef CONFIG_TAXONOMY
+	wpabuf_free(sta->probe_ie_taxonomy);
+	sta->probe_ie_taxonomy = NULL;
+	wpabuf_free(sta->assoc_ie_taxonomy);
+	sta->assoc_ie_taxonomy = NULL;
+#endif /* CONFIG_TAXONOMY */
+
 #ifdef CONFIG_IEEE80211N
 	ht40_intolerant_remove(hapd->iface, sta);
 #endif /* CONFIG_IEEE80211N */
@@ -251,7 +249,7 @@ void ap_free_sta(struct hostapd_data *hapd, struct sta_info *sta)
 
 #ifdef CONFIG_MESH
 	if (hapd->mesh_sta_free_cb)
-		hapd->mesh_sta_free_cb(sta);
+		hapd->mesh_sta_free_cb(hapd, sta);
 #endif /* CONFIG_MESH */
 
 	if (set_beacon)
@@ -262,11 +260,10 @@ void ap_free_sta(struct hostapd_data *hapd, struct sta_info *sta)
 	eloop_cancel_timeout(ap_handle_timer, hapd, sta);
 	eloop_cancel_timeout(ap_handle_session_timer, hapd, sta);
 	eloop_cancel_timeout(ap_handle_session_warning_timer, hapd, sta);
-	eloop_cancel_timeout(ap_sta_deauth_cb_timeout, hapd, sta);
-	eloop_cancel_timeout(ap_sta_disassoc_cb_timeout, hapd, sta);
+	ap_sta_clear_disconnect_timeouts(hapd, sta);
 	sae_clear_retransmit_timer(hapd, sta);
 
-	ieee802_1x_free_station(sta);
+	ieee802_1x_free_station(hapd, sta);
 	wpa_auth_sta_deinit(sta->wpa_sm);
 	rsn_preauth_free_station(hapd, sta);
 #ifndef CONFIG_NO_RADIUS
@@ -274,6 +271,28 @@ void ap_free_sta(struct hostapd_data *hapd, struct sta_info *sta)
 		radius_client_flush_auth(hapd->radius, sta->addr);
 #endif /* CONFIG_NO_RADIUS */
 
+#ifndef CONFIG_NO_VLAN
+	/*
+	 * sta->wpa_sm->group needs to be released before so that
+	 * vlan_remove_dynamic() can check that no stations are left on the
+	 * AP_VLAN netdev.
+	 */
+	if (sta->vlan_id)
+		vlan_remove_dynamic(hapd, sta->vlan_id);
+	if (sta->vlan_id_bound) {
+		/*
+		 * Need to remove the STA entry before potentially removing the
+		 * VLAN.
+		 */
+		if (hapd->iface->driver_ap_teardown &&
+		    !(sta->flags & WLAN_STA_PREAUTH)) {
+			hostapd_drv_sta_remove(hapd, sta->addr);
+			sta->added_unassoc = 0;
+		}
+		vlan_remove_dynamic(hapd, sta->vlan_id_bound);
+	}
+#endif /* CONFIG_NO_VLAN */
+
 	os_free(sta->challenge);
 
 #ifdef CONFIG_IEEE80211W
@@ -315,6 +334,9 @@ void ap_free_sta(struct hostapd_data *hapd, struct sta_info *sta)
 	os_free(sta->sae);
 #endif /* CONFIG_SAE */
 
+	mbo_ap_sta_free(sta);
+	os_free(sta->supp_op_classes);
+
 	os_free(sta);
 }
 
@@ -354,8 +376,8 @@ void ap_handle_timer(void *eloop_ctx, void *timeout_ctx)
 	unsigned long next_time = 0;
 	int reason;
 
-	wpa_printf(MSG_DEBUG, "%s: " MACSTR " flags=0x%x timeout_next=%d",
-		   __func__, MAC2STR(sta->addr), sta->flags,
+	wpa_printf(MSG_DEBUG, "%s: %s: " MACSTR " flags=0x%x timeout_next=%d",
+		   hapd->conf->iface, __func__, MAC2STR(sta->addr), sta->flags,
 		   sta->timeout_next);
 	if (sta->timeout_next == STA_REMOVE) {
 		hostapd_logger(hapd, sta->addr, HOSTAPD_MODULE_IEEE80211,
@@ -482,7 +504,7 @@ skip_poll:
 			sta->acct_terminate_cause =
 				RADIUS_ACCT_TERMINATE_CAUSE_IDLE_TIMEOUT;
 		accounting_sta_stop(hapd, sta);
-		ieee802_1x_free_station(sta);
+		ieee802_1x_free_station(hapd, sta);
 		hostapd_logger(hapd, sta->addr, HOSTAPD_MODULE_IEEE80211,
 			       HOSTAPD_LEVEL_INFO, "disassociated due to "
 			       "inactivity");
@@ -519,6 +541,8 @@ static void ap_handle_session_timer(void *eloop_ctx, void *timeout_ctx)
 	struct hostapd_data *hapd = eloop_ctx;
 	struct sta_info *sta = timeout_ctx;
 
+	wpa_printf(MSG_DEBUG, "%s: Session timer for STA " MACSTR,
+		   hapd->conf->iface, MAC2STR(sta->addr));
 	if (!(sta->flags & WLAN_STA_AUTH)) {
 		if (sta->flags & WLAN_STA_GAS) {
 			wpa_printf(MSG_DEBUG, "GAS: Remove temporary STA "
@@ -577,8 +601,8 @@ static void ap_handle_session_warning_timer(void *eloop_ctx, void *timeout_ctx)
 	struct hostapd_data *hapd = eloop_ctx;
 	struct sta_info *sta = timeout_ctx;
 
-	wpa_printf(MSG_DEBUG, "WNM: Session warning time reached for " MACSTR,
-		   MAC2STR(sta->addr));
+	wpa_printf(MSG_DEBUG, "%s: WNM: Session warning time reached for "
+		   MACSTR, hapd->conf->iface, MAC2STR(sta->addr));
 	if (sta->hs20_session_info_url == NULL)
 		return;
 
@@ -619,7 +643,10 @@ struct sta_info * ap_sta_add(struct hostapd_data *hapd, const u8 *addr)
 		return NULL;
 	}
 	sta->acct_interim_interval = hapd->conf->acct_interim_interval;
-	accounting_sta_get_id(hapd, sta);
+	if (accounting_sta_get_id(hapd, sta) < 0) {
+		os_free(sta);
+		return NULL;
+	}
 
 	if (!(hapd->iface->drv_flags & WPA_DRIVER_FLAGS_INACTIVITY_TIMER)) {
 		wpa_printf(MSG_DEBUG, "%s: register ap_handle_timer timeout "
@@ -640,6 +667,11 @@ struct sta_info * ap_sta_add(struct hostapd_data *hapd, const u8 *addr)
 	sta->last_seq_ctrl = WLAN_INVALID_MGMT_SEQ;
 	dl_list_init(&sta->ip6addr);
 
+#ifdef CONFIG_TAXONOMY
+	sta_track_claim_taxonomy_info(hapd->iface, addr,
+				      &sta->probe_ie_taxonomy);
+#endif /* CONFIG_TAXONOMY */
+
 	return sta;
 }
 
@@ -652,14 +684,16 @@ static int ap_sta_remove(struct hostapd_data *hapd, struct sta_info *sta)
 		hostapd_drv_br_delete_ip_neigh(hapd, 4, (u8 *) &sta->ipaddr);
 	ap_sta_ip6addr_del(hapd, sta);
 
-	wpa_printf(MSG_DEBUG, "Removing STA " MACSTR " from kernel driver",
-		   MAC2STR(sta->addr));
+	wpa_printf(MSG_DEBUG, "%s: Removing STA " MACSTR " from kernel driver",
+		   hapd->conf->iface, MAC2STR(sta->addr));
 	if (hostapd_drv_sta_remove(hapd, sta->addr) &&
 	    sta->flags & WLAN_STA_ASSOC) {
-		wpa_printf(MSG_DEBUG, "Could not remove station " MACSTR
-			   " from kernel driver.", MAC2STR(sta->addr));
+		wpa_printf(MSG_DEBUG, "%s: Could not remove station " MACSTR
+			   " from kernel driver",
+			   hapd->conf->iface, MAC2STR(sta->addr));
 		return -1;
 	}
+	sta->added_unassoc = 0;
 	return 0;
 }
 
@@ -683,6 +717,10 @@ static void ap_sta_remove_in_other_bss(struct hostapd_data *hapd,
 		if (!sta2)
 			continue;
 
+		wpa_printf(MSG_DEBUG, "%s: disconnect old STA " MACSTR
+			   " association from another BSS %s",
+			   hapd->conf->iface, MAC2STR(sta2->addr),
+			   bss->conf->iface);
 		ap_sta_disconnect(bss, sta2, sta2->addr,
 				  WLAN_REASON_PREV_AUTH_NOT_VALID);
 	}
@@ -694,6 +732,8 @@ static void ap_sta_disassoc_cb_timeout(void *eloop_ctx, void *timeout_ctx)
 	struct hostapd_data *hapd = eloop_ctx;
 	struct sta_info *sta = timeout_ctx;
 
+	wpa_printf(MSG_DEBUG, "%s: Disassociation callback for STA " MACSTR,
+		   hapd->conf->iface, MAC2STR(sta->addr));
 	ap_sta_remove(hapd, sta);
 	mlme_disassociate_indication(hapd, sta, sta->disassoc_reason);
 }
@@ -717,7 +757,7 @@ void ap_sta_disassociate(struct hostapd_data *hapd, struct sta_info *sta,
 	eloop_register_timeout(AP_MAX_INACTIVITY_AFTER_DISASSOC, 0,
 			       ap_handle_timer, hapd, sta);
 	accounting_sta_stop(hapd, sta);
-	ieee802_1x_free_station(sta);
+	ieee802_1x_free_station(hapd, sta);
 
 	sta->disassoc_reason = reason;
 	sta->flags |= WLAN_STA_PENDING_DISASSOC_CB;
@@ -733,6 +773,8 @@ static void ap_sta_deauth_cb_timeout(void *eloop_ctx, void *timeout_ctx)
 	struct hostapd_data *hapd = eloop_ctx;
 	struct sta_info *sta = timeout_ctx;
 
+	wpa_printf(MSG_DEBUG, "%s: Deauthentication callback for STA " MACSTR,
+		   hapd->conf->iface, MAC2STR(sta->addr));
 	ap_sta_remove(hapd, sta);
 	mlme_deauthenticate_indication(hapd, sta, sta->deauth_reason);
 }
@@ -756,7 +798,7 @@ void ap_sta_deauthenticate(struct hostapd_data *hapd, struct sta_info *sta,
 	eloop_register_timeout(AP_MAX_INACTIVITY_AFTER_DEAUTH, 0,
 			       ap_handle_timer, hapd, sta);
 	accounting_sta_stop(hapd, sta);
-	ieee802_1x_free_station(sta);
+	ieee802_1x_free_station(hapd, sta);
 
 	sta->deauth_reason = reason;
 	sta->flags |= WLAN_STA_PENDING_DEAUTH_CB;
@@ -784,6 +826,128 @@ int ap_sta_wps_cancel(struct hostapd_data *hapd,
 #endif /* CONFIG_WPS */
 
 
+static int ap_sta_get_free_vlan_id(struct hostapd_data *hapd)
+{
+	struct hostapd_vlan *vlan;
+	int vlan_id = MAX_VLAN_ID + 2;
+
+retry:
+	for (vlan = hapd->conf->vlan; vlan; vlan = vlan->next) {
+		if (vlan->vlan_id == vlan_id) {
+			vlan_id++;
+			goto retry;
+		}
+	}
+	return vlan_id;
+}
+
+
+int ap_sta_set_vlan(struct hostapd_data *hapd, struct sta_info *sta,
+		    struct vlan_description *vlan_desc)
+{
+	struct hostapd_vlan *vlan = NULL, *wildcard_vlan = NULL;
+	int old_vlan_id, vlan_id = 0, ret = 0;
+
+	if (hapd->conf->ssid.dynamic_vlan == DYNAMIC_VLAN_DISABLED)
+		vlan_desc = NULL;
+
+	/* Check if there is something to do */
+	if (hapd->conf->ssid.per_sta_vif && !sta->vlan_id) {
+		/* This sta is lacking its own vif */
+	} else if (hapd->conf->ssid.dynamic_vlan == DYNAMIC_VLAN_DISABLED &&
+		   !hapd->conf->ssid.per_sta_vif && sta->vlan_id) {
+		/* sta->vlan_id needs to be reset */
+	} else if (!vlan_compare(vlan_desc, sta->vlan_desc)) {
+		return 0; /* nothing to change */
+	}
+
+	/* Now the real VLAN changed or the STA just needs its own vif */
+	if (hapd->conf->ssid.per_sta_vif) {
+		/* Assign a new vif, always */
+		/* find a free vlan_id sufficiently big */
+		vlan_id = ap_sta_get_free_vlan_id(hapd);
+		/* Get wildcard VLAN */
+		for (vlan = hapd->conf->vlan; vlan; vlan = vlan->next) {
+			if (vlan->vlan_id == VLAN_ID_WILDCARD)
+				break;
+		}
+		if (!vlan) {
+			hostapd_logger(hapd, sta->addr,
+				       HOSTAPD_MODULE_IEEE80211,
+				       HOSTAPD_LEVEL_DEBUG,
+				       "per_sta_vif missing wildcard");
+			vlan_id = 0;
+			ret = -1;
+			goto done;
+		}
+	} else if (vlan_desc && vlan_desc->notempty) {
+		for (vlan = hapd->conf->vlan; vlan; vlan = vlan->next) {
+			if (!vlan_compare(&vlan->vlan_desc, vlan_desc))
+				break;
+			if (vlan->vlan_id == VLAN_ID_WILDCARD)
+				wildcard_vlan = vlan;
+		}
+		if (vlan) {
+			vlan_id = vlan->vlan_id;
+		} else if (wildcard_vlan) {
+			vlan = wildcard_vlan;
+			vlan_id = vlan_desc->untagged;
+			if (vlan_desc->tagged[0]) {
+				/* Tagged VLAN configuration */
+				vlan_id = ap_sta_get_free_vlan_id(hapd);
+			}
+		} else {
+			hostapd_logger(hapd, sta->addr,
+				       HOSTAPD_MODULE_IEEE80211,
+				       HOSTAPD_LEVEL_DEBUG,
+				       "missing vlan and wildcard for vlan=%d%s",
+				       vlan_desc->untagged,
+				       vlan_desc->tagged[0] ? "+" : "");
+			vlan_id = 0;
+			ret = -1;
+			goto done;
+		}
+	}
+
+	if (vlan && vlan->vlan_id == VLAN_ID_WILDCARD) {
+		vlan = vlan_add_dynamic(hapd, vlan, vlan_id, vlan_desc);
+		if (vlan == NULL) {
+			hostapd_logger(hapd, sta->addr,
+				       HOSTAPD_MODULE_IEEE80211,
+				       HOSTAPD_LEVEL_DEBUG,
+				       "could not add dynamic VLAN interface for vlan=%d%s",
+				       vlan_desc ? vlan_desc->untagged : -1,
+				       (vlan_desc && vlan_desc->tagged[0]) ?
+				       "+" : "");
+			vlan_id = 0;
+			ret = -1;
+			goto done;
+		}
+
+		hostapd_logger(hapd, sta->addr, HOSTAPD_MODULE_IEEE80211,
+			       HOSTAPD_LEVEL_DEBUG,
+			       "added new dynamic VLAN interface '%s'",
+			       vlan->ifname);
+	} else if (vlan && vlan->dynamic_vlan > 0) {
+		vlan->dynamic_vlan++;
+		hostapd_logger(hapd, sta->addr,
+			       HOSTAPD_MODULE_IEEE80211,
+			       HOSTAPD_LEVEL_DEBUG,
+			       "updated existing dynamic VLAN interface '%s'",
+			       vlan->ifname);
+	}
+done:
+	old_vlan_id = sta->vlan_id;
+	sta->vlan_id = vlan_id;
+	sta->vlan_desc = vlan ? &vlan->vlan_desc : NULL;
+
+	if (vlan_id != old_vlan_id && old_vlan_id)
+		vlan_remove_dynamic(hapd, old_vlan_id);
+
+	return ret;
+}
+
+
 int ap_sta_bind_vlan(struct hostapd_data *hapd, struct sta_info *sta)
 {
 #ifndef CONFIG_NO_VLAN
@@ -796,20 +960,11 @@ int ap_sta_bind_vlan(struct hostapd_data *hapd, struct sta_info *sta)
 	if (hapd->conf->ssid.vlan[0])
 		iface = hapd->conf->ssid.vlan;
 
-	if (hapd->conf->ssid.dynamic_vlan == DYNAMIC_VLAN_DISABLED)
-		sta->vlan_id = 0;
-	else if (sta->vlan_id > 0) {
-		struct hostapd_vlan *wildcard_vlan = NULL;
-		vlan = hapd->conf->vlan;
-		while (vlan) {
+	if (sta->vlan_id > 0) {
+		for (vlan = hapd->conf->vlan; vlan; vlan = vlan->next) {
 			if (vlan->vlan_id == sta->vlan_id)
 				break;
-			if (vlan->vlan_id == VLAN_ID_WILDCARD)
-				wildcard_vlan = vlan;
-			vlan = vlan->next;
 		}
-		if (!vlan)
-			vlan = wildcard_vlan;
 		if (vlan)
 			iface = vlan->ifname;
 	}
@@ -829,54 +984,13 @@ int ap_sta_bind_vlan(struct hostapd_data *hapd, struct sta_info *sta)
 			       sta->vlan_id);
 		ret = -1;
 		goto done;
-	} else if (sta->vlan_id > 0 && vlan->vlan_id == VLAN_ID_WILDCARD) {
-		vlan = vlan_add_dynamic(hapd, vlan, sta->vlan_id);
-		if (vlan == NULL) {
-			hostapd_logger(hapd, sta->addr,
-				       HOSTAPD_MODULE_IEEE80211,
-				       HOSTAPD_LEVEL_DEBUG, "could not add "
-				       "dynamic VLAN interface for vlan_id=%d",
-				       sta->vlan_id);
-			ret = -1;
-			goto done;
-		}
-
-		iface = vlan->ifname;
-		if (vlan_setup_encryption_dyn(hapd, iface) != 0) {
-			hostapd_logger(hapd, sta->addr,
-				       HOSTAPD_MODULE_IEEE80211,
-				       HOSTAPD_LEVEL_DEBUG, "could not "
-				       "configure encryption for dynamic VLAN "
-				       "interface for vlan_id=%d",
-				       sta->vlan_id);
-		}
-
-		hostapd_logger(hapd, sta->addr, HOSTAPD_MODULE_IEEE80211,
-			       HOSTAPD_LEVEL_DEBUG, "added new dynamic VLAN "
-			       "interface '%s'", iface);
-	} else if (vlan && vlan->vlan_id == sta->vlan_id) {
-		if (vlan->dynamic_vlan > 0) {
-			vlan->dynamic_vlan++;
-			hostapd_logger(hapd, sta->addr,
-				       HOSTAPD_MODULE_IEEE80211,
-				       HOSTAPD_LEVEL_DEBUG, "updated existing "
-				       "dynamic VLAN interface '%s'", iface);
-		}
-
-		/*
-		 * Update encryption configuration for statically generated
-		 * VLAN interface. This is only used for static WEP
-		 * configuration for the case where hostapd did not yet know
-		 * which keys are to be used when the interface was added.
-		 */
-		if (vlan_setup_encryption_dyn(hapd, iface) != 0) {
-			hostapd_logger(hapd, sta->addr,
-				       HOSTAPD_MODULE_IEEE80211,
-				       HOSTAPD_LEVEL_DEBUG, "could not "
-				       "configure encryption for VLAN "
-				       "interface for vlan_id=%d",
-				       sta->vlan_id);
-		}
+	} else if (vlan && vlan->dynamic_vlan > 0) {
+		vlan->dynamic_vlan++;
+		hostapd_logger(hapd, sta->addr,
+			       HOSTAPD_MODULE_IEEE80211,
+			       HOSTAPD_LEVEL_DEBUG,
+			       "updated existing dynamic VLAN interface '%s'",
+			       iface);
 	}
 
 	/* ref counters have been increased, so mark the station */
@@ -942,6 +1056,10 @@ static void ap_sa_query_timer(void *eloop_ctx, void *timeout_ctx)
 	unsigned int timeout, sec, usec;
 	u8 *trans_id, *nbuf;
 
+	wpa_printf(MSG_DEBUG, "%s: SA Query timer for STA " MACSTR
+		   " (count=%d)",
+		   hapd->conf->iface, MAC2STR(sta->addr), sta->sa_query_count);
+
 	if (sta->sa_query_count > 0 &&
 	    ap_check_sa_query_timeout(hapd, sta))
 		return;
@@ -1080,6 +1198,14 @@ void ap_sta_set_authorized(struct hostapd_data *hapd, struct sta_info *sta,
 void ap_sta_disconnect(struct hostapd_data *hapd, struct sta_info *sta,
 		       const u8 *addr, u16 reason)
 {
+	if (sta)
+		wpa_printf(MSG_DEBUG, "%s: %s STA " MACSTR " reason=%u",
+			   hapd->conf->iface, __func__, MAC2STR(sta->addr),
+			   reason);
+	else if (addr)
+		wpa_printf(MSG_DEBUG, "%s: %s addr " MACSTR " reason=%u",
+			   hapd->conf->iface, __func__, MAC2STR(addr),
+			   reason);
 
 	if (sta == NULL && addr)
 		sta = ap_get_sta(hapd, addr);
@@ -1093,10 +1219,10 @@ void ap_sta_disconnect(struct hostapd_data *hapd, struct sta_info *sta,
 	wpa_auth_sm_event(sta->wpa_sm, WPA_DEAUTH);
 	ieee802_1x_notify_port_enabled(sta->eapol_sm, 0);
 	sta->flags &= ~(WLAN_STA_AUTH | WLAN_STA_ASSOC);
-	wpa_printf(MSG_DEBUG, "%s: reschedule ap_handle_timer timeout "
+	wpa_printf(MSG_DEBUG, "%s: %s: reschedule ap_handle_timer timeout "
 		   "for " MACSTR " (%d seconds - "
 		   "AP_MAX_INACTIVITY_AFTER_DEAUTH)",
-		   __func__, MAC2STR(sta->addr),
+		   hapd->conf->iface, __func__, MAC2STR(sta->addr),
 		   AP_MAX_INACTIVITY_AFTER_DEAUTH);
 	eloop_cancel_timeout(ap_handle_timer, hapd, sta);
 	eloop_register_timeout(AP_MAX_INACTIVITY_AFTER_DEAUTH, 0,
@@ -1136,6 +1262,22 @@ void ap_sta_disassoc_cb(struct hostapd_data *hapd, struct sta_info *sta)
 }
 
 
+void ap_sta_clear_disconnect_timeouts(struct hostapd_data *hapd,
+				      struct sta_info *sta)
+{
+	if (eloop_cancel_timeout(ap_sta_deauth_cb_timeout, hapd, sta) > 0)
+		wpa_printf(MSG_DEBUG,
+			   "%s: Removed ap_sta_deauth_cb_timeout timeout for "
+			   MACSTR,
+			   hapd->conf->iface, MAC2STR(sta->addr));
+	if (eloop_cancel_timeout(ap_sta_disassoc_cb_timeout, hapd, sta) > 0)
+		wpa_printf(MSG_DEBUG,
+			   "%s: Removed ap_sta_disassoc_cb_timeout timeout for "
+			   MACSTR,
+			   hapd->conf->iface, MAC2STR(sta->addr));
+}
+
+
 int ap_sta_flags_txt(u32 flags, char *buf, size_t buflen)
 {
 	int res;
diff --git a/src/ap/sta_info.h b/src/ap/sta_info.h
index 420d64e5793bf..099de62d1a9ae 100644
--- a/src/ap/sta_info.h
+++ b/src/ap/sta_info.h
@@ -12,9 +12,11 @@
 #ifdef CONFIG_MESH
 /* needed for mesh_plink_state enum */
 #include "common/defs.h"
+#include "common/wpa_common.h"
 #endif /* CONFIG_MESH */
 
 #include "list.h"
+#include "vlan.h"
 
 /* STA flags */
 #define WLAN_STA_AUTH BIT(0)
@@ -45,6 +47,20 @@
 #define WLAN_SUPP_RATES_MAX 32
 
 
+struct mbo_non_pref_chan_info {
+	struct mbo_non_pref_chan_info *next;
+	u8 op_class;
+	u8 pref;
+	u8 reason_code;
+	u8 num_channels;
+	u8 channels[];
+};
+
+struct pending_eapol_rx {
+	struct wpabuf *buf;
+	struct os_reltime rx_time;
+};
+
 struct sta_info {
 	struct sta_info *next; /* next entry in sta list */
 	struct sta_info *hnext; /* next entry in hash table list */
@@ -63,13 +79,22 @@ struct sta_info {
 	enum mesh_plink_state plink_state;
 	u16 peer_lid;
 	u16 my_lid;
+	u16 peer_aid;
 	u16 mpm_close_reason;
 	int mpm_retries;
-	u8 my_nonce[32];
-	u8 peer_nonce[32];
+	u8 my_nonce[WPA_NONCE_LEN];
+	u8 peer_nonce[WPA_NONCE_LEN];
 	u8 aek[32];	/* SHA256 digest length */
-	u8 mtk[16];
-	u8 mgtk[16];
+	u8 mtk[WPA_TK_MAX_LEN];
+	size_t mtk_len;
+	u8 mgtk_rsc[6];
+	u8 mgtk_key_id;
+	u8 mgtk[WPA_TK_MAX_LEN];
+	size_t mgtk_len;
+	u8 igtk_rsc[6];
+	u8 igtk[WPA_TK_MAX_LEN];
+	size_t igtk_len;
+	u16 igtk_key_id;
 	u8 sae_auth_retry;
 #endif /* CONFIG_MESH */
 
@@ -86,6 +111,8 @@ struct sta_info {
 	unsigned int hs20_deauth_requested:1;
 	unsigned int session_timeout_set:1;
 	unsigned int radius_das_match:1;
+	unsigned int ecsa_supported:1;
+	unsigned int added_unassoc:1;
 
 	u16 auth_alg;
 
@@ -100,17 +127,20 @@ struct sta_info {
 	/* IEEE 802.1X related data */
 	struct eapol_state_machine *eapol_sm;
 
-	u32 acct_session_id_hi;
-	u32 acct_session_id_lo;
+	struct pending_eapol_rx *pending_eapol_rx;
+
+	u64 acct_session_id;
 	struct os_reltime acct_session_start;
 	int acct_session_started;
 	int acct_terminate_cause; /* Acct-Terminate-Cause */
 	int acct_interim_interval; /* Acct-Interim-Interval */
+	unsigned int acct_interim_errors;
 
-	unsigned long last_rx_bytes;
-	unsigned long last_tx_bytes;
-	u32 acct_input_gigawords; /* Acct-Input-Gigawords */
-	u32 acct_output_gigawords; /* Acct-Output-Gigawords */
+	/* For extending 32-bit driver counters to 64-bit counters */
+	u32 last_rx_bytes_hi;
+	u32 last_rx_bytes_lo;
+	u32 last_tx_bytes_hi;
+	u32 last_tx_bytes_lo;
 
 	u8 *challenge; /* IEEE 802.11 Shared Key Authentication Challenge */
 
@@ -118,6 +148,7 @@ struct sta_info {
 	struct rsn_preauth_interface *preauth_iface;
 
 	int vlan_id; /* 0: none, >0: VID */
+	struct vlan_description *vlan_desc;
 	int vlan_id_bound; /* updated by ap_sta_bind_vlan() */
 	 /* PSKs from RADIUS authentication server */
 	struct hostapd_sta_wpa_psk_short *psk;
@@ -161,6 +192,7 @@ struct sta_info {
 
 #ifdef CONFIG_SAE
 	struct sae_data *sae;
+	unsigned int mesh_sae_pmksa_caching:1;
 #endif /* CONFIG_SAE */
 
 	u32 session_timeout; /* valid only if session_timeout_set == 1 */
@@ -170,6 +202,22 @@ struct sta_info {
 	u16 last_seq_ctrl;
 	/* Last Authentication/(Re)Association Request/Action frame subtype */
 	u8 last_subtype;
+
+#ifdef CONFIG_MBO
+	u8 cell_capa; /* 0 = unknown (not an MBO STA); otherwise,
+		       * enum mbo_cellular_capa values */
+	struct mbo_non_pref_chan_info *non_pref_chan;
+#endif /* CONFIG_MBO */
+
+	u8 *supp_op_classes; /* Supported Operating Classes element, if
+			      * received, starting from the Length field */
+
+	u8 rrm_enabled_capa[5];
+
+#ifdef CONFIG_TAXONOMY
+	struct wpabuf *probe_ie_taxonomy;
+	struct wpabuf *assoc_ie_taxonomy;
+#endif /* CONFIG_TAXONOMY */
 };
 
 
@@ -180,7 +228,7 @@ struct sta_info {
  * AP_DISASSOC_DELAY seconds. Similarly, the station will be deauthenticated
  * after AP_DEAUTH_DELAY seconds has passed after disassociation. */
 #define AP_MAX_INACTIVITY (5 * 60)
-#define AP_DISASSOC_DELAY (1)
+#define AP_DISASSOC_DELAY (3)
 #define AP_DEAUTH_DELAY (1)
 /* Number of seconds to keep STA entry with Authenticated flag after it has
  * been disassociated. */
@@ -220,6 +268,8 @@ int ap_sta_wps_cancel(struct hostapd_data *hapd,
 		      struct sta_info *sta, void *ctx);
 #endif /* CONFIG_WPS */
 int ap_sta_bind_vlan(struct hostapd_data *hapd, struct sta_info *sta);
+int ap_sta_set_vlan(struct hostapd_data *hapd, struct sta_info *sta,
+		    struct vlan_description *vlan_desc);
 void ap_sta_start_sa_query(struct hostapd_data *hapd, struct sta_info *sta);
 void ap_sta_stop_sa_query(struct hostapd_data *hapd, struct sta_info *sta);
 int ap_check_sa_query_timeout(struct hostapd_data *hapd, struct sta_info *sta);
@@ -235,6 +285,8 @@ static inline int ap_sta_is_authorized(struct sta_info *sta)
 
 void ap_sta_deauth_cb(struct hostapd_data *hapd, struct sta_info *sta);
 void ap_sta_disassoc_cb(struct hostapd_data *hapd, struct sta_info *sta);
+void ap_sta_clear_disconnect_timeouts(struct hostapd_data *hapd,
+				      struct sta_info *sta);
 
 int ap_sta_flags_txt(u32 flags, char *buf, size_t buflen);
 
diff --git a/src/ap/taxonomy.c b/src/ap/taxonomy.c
new file mode 100644
index 0000000000000..cea8b726f47af
--- /dev/null
+++ b/src/ap/taxonomy.c
@@ -0,0 +1,291 @@
+/*
+ * hostapd / Client taxonomy
+ * Copyright (c) 2015 Google, Inc.
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ *
+ * Parse a series of IEs, as in Probe Request or (Re)Association Request frames,
+ * and render them to a descriptive string. The tag number of standard options
+ * is written to the string, while the vendor ID and subtag are written for
+ * vendor options.
+ *
+ * Example strings:
+ * 0,1,50,45,221(00904c,51)
+ * 0,1,33,36,48,45,221(00904c,51),221(0050f2,2)
+ */
+
+#include "utils/includes.h"
+
+#include "utils/common.h"
+#include "common/wpa_ctrl.h"
+#include "hostapd.h"
+#include "sta_info.h"
+
+
+/* Copy a string with no funny schtuff allowed; only alphanumerics. */
+static void no_mischief_strncpy(char *dst, const char *src, size_t n)
+{
+	size_t i;
+
+	for (i = 0; i < n; i++) {
+		unsigned char s = src[i];
+		int is_lower = s >= 'a' && s <= 'z';
+		int is_upper = s >= 'A' && s <= 'Z';
+		int is_digit = s >= '0' && s <= '9';
+
+		if (is_lower || is_upper || is_digit) {
+			/* TODO: if any manufacturer uses Unicode within the
+			 * WPS header, it will get mangled here. */
+			dst[i] = s;
+		} else {
+			/* Note that even spaces will be transformed to
+			 * underscores, so 'Nexus 7' will turn into 'Nexus_7'.
+			 * This is deliberate, to make the string easier to
+			 * parse. */
+			dst[i] = '_';
+		}
+	}
+}
+
+
+static int get_wps_name(char *name, size_t name_len,
+			const u8 *data, size_t data_len)
+{
+	/* Inside the WPS IE are a series of attributes, using two byte IDs
+	 * and two byte lengths. We're looking for the model name, if
+	 * present. */
+	while (data_len >= 4) {
+		u16 id, elen;
+
+		id = WPA_GET_BE16(data);
+		elen = WPA_GET_BE16(data + 2);
+		data += 4;
+		data_len -= 4;
+
+		if (elen > data_len)
+			return 0;
+
+		if (id == 0x1023) {
+			/* Model name, like 'Nexus 7' */
+			size_t n = (elen < name_len) ? elen : name_len;
+			no_mischief_strncpy(name, (const char *) data, n);
+			return n;
+		}
+
+		data += elen;
+		data_len -= elen;
+	}
+
+	return 0;
+}
+
+
+static void ie_to_string(char *fstr, size_t fstr_len, const struct wpabuf *ies)
+{
+	char *fpos = fstr;
+	char *fend = fstr + fstr_len;
+	char htcap[7 + 4 + 1]; /* ",htcap:" + %04hx + trailing NUL */
+	char htagg[7 + 2 + 1]; /* ",htagg:" + %02hx + trailing NUL */
+	char htmcs[7 + 8 + 1]; /* ",htmcs:" + %08x + trailing NUL */
+	char vhtcap[8 + 8 + 1]; /* ",vhtcap:" + %08x + trailing NUL */
+	char vhtrxmcs[10 + 8 + 1]; /* ",vhtrxmcs:" + %08x + trailing NUL */
+	char vhttxmcs[10 + 8 + 1]; /* ",vhttxmcs:" + %08x + trailing NUL */
+#define MAX_EXTCAP	254
+	char extcap[8 + 2 * MAX_EXTCAP + 1]; /* ",extcap:" + hex + trailing NUL
+					      */
+	char txpow[7 + 4 + 1]; /* ",txpow:" + %04hx + trailing NUL */
+#define WPS_NAME_LEN		32
+	char wps[WPS_NAME_LEN + 5 + 1]; /* room to prepend ",wps:" + trailing
+					 * NUL */
+	int num = 0;
+	const u8 *ie;
+	size_t ie_len;
+	int ret;
+
+	os_memset(htcap, 0, sizeof(htcap));
+	os_memset(htagg, 0, sizeof(htagg));
+	os_memset(htmcs, 0, sizeof(htmcs));
+	os_memset(vhtcap, 0, sizeof(vhtcap));
+	os_memset(vhtrxmcs, 0, sizeof(vhtrxmcs));
+	os_memset(vhttxmcs, 0, sizeof(vhttxmcs));
+	os_memset(extcap, 0, sizeof(extcap));
+	os_memset(txpow, 0, sizeof(txpow));
+	os_memset(wps, 0, sizeof(wps));
+	*fpos = '\0';
+
+	if (!ies)
+		return;
+	ie = wpabuf_head(ies);
+	ie_len = wpabuf_len(ies);
+
+	while (ie_len >= 2) {
+		u8 id, elen;
+		char *sep = (num++ == 0) ? "" : ",";
+
+		id = *ie++;
+		elen = *ie++;
+		ie_len -= 2;
+
+		if (elen > ie_len)
+			break;
+
+		if (id == WLAN_EID_VENDOR_SPECIFIC && elen >= 4) {
+			/* Vendor specific */
+			if (WPA_GET_BE32(ie) == WPS_IE_VENDOR_TYPE) {
+				/* WPS */
+				char model_name[WPS_NAME_LEN + 1];
+				const u8 *data = &ie[4];
+				size_t data_len = elen - 4;
+
+				os_memset(model_name, 0, sizeof(model_name));
+				if (get_wps_name(model_name, WPS_NAME_LEN, data,
+						 data_len)) {
+					os_snprintf(wps, sizeof(wps),
+						    ",wps:%s", model_name);
+				}
+			}
+
+			ret = os_snprintf(fpos, fend - fpos,
+					  "%s%d(%02x%02x%02x,%d)",
+					  sep, id, ie[0], ie[1], ie[2], ie[3]);
+		} else {
+			if (id == WLAN_EID_HT_CAP && elen >= 2) {
+				/* HT Capabilities (802.11n) */
+				os_snprintf(htcap, sizeof(htcap),
+					    ",htcap:%04hx",
+					    WPA_GET_LE16(ie));
+			}
+			if (id == WLAN_EID_HT_CAP && elen >= 3) {
+				/* HT Capabilities (802.11n), A-MPDU information
+				 */
+				os_snprintf(htagg, sizeof(htagg),
+					    ",htagg:%02hx", (u16) ie[2]);
+			}
+			if (id == WLAN_EID_HT_CAP && elen >= 7) {
+				/* HT Capabilities (802.11n), MCS information */
+				os_snprintf(htmcs, sizeof(htmcs),
+					    ",htmcs:%08hx",
+					    (u16) WPA_GET_LE32(ie + 3));
+			}
+			if (id == WLAN_EID_VHT_CAP && elen >= 4) {
+				/* VHT Capabilities (802.11ac) */
+				os_snprintf(vhtcap, sizeof(vhtcap),
+					    ",vhtcap:%08x",
+					    WPA_GET_LE32(ie));
+			}
+			if (id == WLAN_EID_VHT_CAP && elen >= 8) {
+				/* VHT Capabilities (802.11ac), RX MCS
+				 * information */
+				os_snprintf(vhtrxmcs, sizeof(vhtrxmcs),
+					    ",vhtrxmcs:%08x",
+					    WPA_GET_LE32(ie + 4));
+			}
+			if (id == WLAN_EID_VHT_CAP && elen >= 12) {
+				/* VHT Capabilities (802.11ac), TX MCS
+				 * information */
+				os_snprintf(vhttxmcs, sizeof(vhttxmcs),
+					    ",vhttxmcs:%08x",
+					    WPA_GET_LE32(ie + 8));
+			}
+			if (id == WLAN_EID_EXT_CAPAB) {
+				/* Extended Capabilities */
+				int i;
+				int len = (elen < MAX_EXTCAP) ? elen :
+					MAX_EXTCAP;
+				char *p = extcap;
+
+				p += os_snprintf(extcap, sizeof(extcap),
+						 ",extcap:");
+				for (i = 0; i < len; i++) {
+					int lim;
+
+					lim = sizeof(extcap) -
+						os_strlen(extcap);
+					if (lim <= 0)
+						break;
+					p += os_snprintf(p, lim, "%02x",
+							 *(ie + i));
+				}
+			}
+			if (id == WLAN_EID_PWR_CAPABILITY && elen == 2) {
+				/* TX Power */
+				os_snprintf(txpow, sizeof(txpow),
+					    ",txpow:%04hx",
+					    WPA_GET_LE16(ie));
+			}
+
+			ret = os_snprintf(fpos, fend - fpos, "%s%d", sep, id);
+		}
+		if (os_snprintf_error(fend - fpos, ret))
+			goto fail;
+		fpos += ret;
+
+		ie += elen;
+		ie_len -= elen;
+	}
+
+	ret = os_snprintf(fpos, fend - fpos, "%s%s%s%s%s%s%s%s%s",
+			  htcap, htagg, htmcs, vhtcap, vhtrxmcs, vhttxmcs,
+			  txpow, extcap, wps);
+	if (os_snprintf_error(fend - fpos, ret)) {
+	fail:
+		fstr[0] = '\0';
+	}
+}
+
+
+int retrieve_sta_taxonomy(const struct hostapd_data *hapd,
+			  struct sta_info *sta, char *buf, size_t buflen)
+{
+	int ret;
+	char *pos, *end;
+
+	if (!sta->probe_ie_taxonomy || !sta->assoc_ie_taxonomy)
+		return 0;
+
+	ret = os_snprintf(buf, buflen, "wifi4|probe:");
+	if (os_snprintf_error(buflen, ret))
+		return 0;
+	pos = buf + ret;
+	end = buf + buflen;
+
+	ie_to_string(pos, end - pos, sta->probe_ie_taxonomy);
+	pos = os_strchr(pos, '\0');
+	if (pos >= end)
+		return 0;
+	ret = os_snprintf(pos, end - pos, "|assoc:");
+	if (os_snprintf_error(end - pos, ret))
+		return 0;
+	pos += ret;
+	ie_to_string(pos, end - pos, sta->assoc_ie_taxonomy);
+	pos = os_strchr(pos, '\0');
+	return pos - buf;
+}
+
+
+void taxonomy_sta_info_probe_req(const struct hostapd_data *hapd,
+				 struct sta_info *sta,
+				 const u8 *ie, size_t ie_len)
+{
+	wpabuf_free(sta->probe_ie_taxonomy);
+	sta->probe_ie_taxonomy = wpabuf_alloc_copy(ie, ie_len);
+}
+
+
+void taxonomy_hostapd_sta_info_probe_req(const struct hostapd_data *hapd,
+					 struct hostapd_sta_info *info,
+					 const u8 *ie, size_t ie_len)
+{
+	wpabuf_free(info->probe_ie_taxonomy);
+	info->probe_ie_taxonomy = wpabuf_alloc_copy(ie, ie_len);
+}
+
+
+void taxonomy_sta_info_assoc_req(const struct hostapd_data *hapd,
+				 struct sta_info *sta,
+				 const u8 *ie, size_t ie_len)
+{
+	wpabuf_free(sta->assoc_ie_taxonomy);
+	sta->assoc_ie_taxonomy = wpabuf_alloc_copy(ie, ie_len);
+}
diff --git a/src/ap/taxonomy.h b/src/ap/taxonomy.h
new file mode 100644
index 0000000000000..80f245c77c82c
--- /dev/null
+++ b/src/ap/taxonomy.h
@@ -0,0 +1,24 @@
+/*
+ * hostapd / Station client taxonomy
+ * Copyright (c) 2015 Google, Inc.
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ */
+
+#ifndef TAXONOMY_H
+#define TAXONOMY_H
+
+void taxonomy_sta_info_probe_req(const struct hostapd_data *hapd,
+				 struct sta_info *sta,
+				 const u8 *ie, size_t ie_len);
+void taxonomy_hostapd_sta_info_probe_req(const struct hostapd_data *hapd,
+					 struct hostapd_sta_info *sta,
+					 const u8 *ie, size_t ie_len);
+void taxonomy_sta_info_assoc_req(const struct hostapd_data *hapd,
+				 struct sta_info *sta,
+				 const u8 *ie, size_t ie_len);
+int retrieve_sta_taxonomy(const struct hostapd_data *hapd,
+			  struct sta_info *sta, char *buf, size_t buflen);
+
+#endif /* TAXONOMY_H */
diff --git a/src/ap/vlan.c b/src/ap/vlan.c
new file mode 100644
index 0000000000000..b6f6bb1afe055
--- /dev/null
+++ b/src/ap/vlan.c
@@ -0,0 +1,34 @@
+/*
+ * hostapd / VLAN definition
+ * Copyright (c) 2016, Jouni Malinen <j@w1.fi>
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ */
+
+#include "utils/includes.h"
+
+#include "utils/common.h"
+#include "ap/vlan.h"
+
+/* compare the two arguments, NULL is treated as empty
+ * return zero iff they are equal
+ */
+int vlan_compare(struct vlan_description *a, struct vlan_description *b)
+{
+	int i;
+	const int a_empty = !a || !a->notempty;
+	const int b_empty = !b || !b->notempty;
+
+	if (a_empty && b_empty)
+		return 0;
+	if (a_empty || b_empty)
+		return 1;
+	if (a->untagged != b->untagged)
+		return 1;
+	for (i = 0; i < MAX_NUM_TAGGED_VLAN; i++) {
+		if (a->tagged[i] != b->tagged[i])
+			return 1;
+	}
+	return 0;
+}
diff --git a/src/ap/vlan.h b/src/ap/vlan.h
new file mode 100644
index 0000000000000..af84929decdc4
--- /dev/null
+++ b/src/ap/vlan.h
@@ -0,0 +1,30 @@
+/*
+ * hostapd / VLAN definition
+ * Copyright (c) 2015, Jouni Malinen <j@w1.fi>
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ */
+
+#ifndef VLAN_H
+#define VLAN_H
+
+#define MAX_NUM_TAGGED_VLAN 32
+
+struct vlan_description {
+	int notempty; /* 0 : no vlan information present, 1: else */
+	int untagged; /* >0 802.1q vid */
+	int tagged[MAX_NUM_TAGGED_VLAN]; /* first k items, ascending order */
+};
+
+#ifndef CONFIG_NO_VLAN
+int vlan_compare(struct vlan_description *a, struct vlan_description *b);
+#else /* CONFIG_NO_VLAN */
+static inline int
+vlan_compare(struct vlan_description *a, struct vlan_description *b)
+{
+	return 0;
+}
+#endif /* CONFIG_NO_VLAN */
+
+#endif /* VLAN_H */
diff --git a/src/ap/vlan_full.c b/src/ap/vlan_full.c
new file mode 100644
index 0000000000000..aa42335b96a19
--- /dev/null
+++ b/src/ap/vlan_full.c
@@ -0,0 +1,752 @@
+/*
+ * hostapd / VLAN initialization - full dynamic VLAN
+ * Copyright 2003, Instant802 Networks, Inc.
+ * Copyright 2005-2006, Devicescape Software, Inc.
+ * Copyright (c) 2009, Jouni Malinen <j@w1.fi>
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ */
+
+#include "utils/includes.h"
+#include <net/if.h>
+/* Avoid conflicts due to NetBSD net/if.h if_type define with driver.h */
+#undef if_type
+#include <sys/ioctl.h>
+
+#include "utils/common.h"
+#include "drivers/priv_netlink.h"
+#include "common/linux_bridge.h"
+#include "common/linux_vlan.h"
+#include "utils/eloop.h"
+#include "hostapd.h"
+#include "ap_config.h"
+#include "ap_drv_ops.h"
+#include "wpa_auth.h"
+#include "vlan_init.h"
+#include "vlan_util.h"
+
+
+struct full_dynamic_vlan {
+	int s; /* socket on which to listen for new/removed interfaces. */
+};
+
+#define DVLAN_CLEAN_BR         0x1
+#define DVLAN_CLEAN_VLAN       0x2
+#define DVLAN_CLEAN_VLAN_PORT  0x4
+
+struct dynamic_iface {
+	char ifname[IFNAMSIZ + 1];
+	int usage;
+	int clean;
+	struct dynamic_iface *next;
+};
+
+
+/* Increment ref counter for ifname and add clean flag.
+ * If not in list, add it only if some flags are given.
+ */
+static void dyn_iface_get(struct hostapd_data *hapd, const char *ifname,
+			  int clean)
+{
+	struct dynamic_iface *next, **dynamic_ifaces;
+	struct hapd_interfaces *interfaces;
+
+	interfaces = hapd->iface->interfaces;
+	dynamic_ifaces = &interfaces->vlan_priv;
+
+	for (next = *dynamic_ifaces; next; next = next->next) {
+		if (os_strcmp(ifname, next->ifname) == 0)
+			break;
+	}
+
+	if (next) {
+		next->usage++;
+		next->clean |= clean;
+		return;
+	}
+
+	if (!clean)
+		return;
+
+	next = os_zalloc(sizeof(*next));
+	if (!next)
+		return;
+	os_strlcpy(next->ifname, ifname, sizeof(next->ifname));
+	next->usage = 1;
+	next->clean = clean;
+	next->next = *dynamic_ifaces;
+	*dynamic_ifaces = next;
+}
+
+
+/* Decrement reference counter for given ifname.
+ * Return clean flag iff reference counter was decreased to zero, else zero
+ */
+static int dyn_iface_put(struct hostapd_data *hapd, const char *ifname)
+{
+	struct dynamic_iface *next, *prev = NULL, **dynamic_ifaces;
+	struct hapd_interfaces *interfaces;
+	int clean;
+
+	interfaces = hapd->iface->interfaces;
+	dynamic_ifaces = &interfaces->vlan_priv;
+
+	for (next = *dynamic_ifaces; next; next = next->next) {
+		if (os_strcmp(ifname, next->ifname) == 0)
+			break;
+		prev = next;
+	}
+
+	if (!next)
+		return 0;
+
+	next->usage--;
+	if (next->usage)
+		return 0;
+
+	if (prev)
+		prev->next = next->next;
+	else
+		*dynamic_ifaces = next->next;
+	clean = next->clean;
+	os_free(next);
+
+	return clean;
+}
+
+
+static int ifconfig_down(const char *if_name)
+{
+	wpa_printf(MSG_DEBUG, "VLAN: Set interface %s down", if_name);
+	return ifconfig_helper(if_name, 0);
+}
+
+
+/* This value should be 256 ONLY. If it is something else, then hostapd
+ * might crash!, as this value has been hard-coded in 2.4.x kernel
+ * bridging code.
+ */
+#define MAX_BR_PORTS      		256
+
+static int br_delif(const char *br_name, const char *if_name)
+{
+	int fd;
+	struct ifreq ifr;
+	unsigned long args[2];
+	int if_index;
+
+	wpa_printf(MSG_DEBUG, "VLAN: br_delif(%s, %s)", br_name, if_name);
+	if ((fd = socket(AF_INET, SOCK_STREAM, 0)) < 0) {
+		wpa_printf(MSG_ERROR, "VLAN: %s: socket(AF_INET,SOCK_STREAM) "
+			   "failed: %s", __func__, strerror(errno));
+		return -1;
+	}
+
+	if_index = if_nametoindex(if_name);
+
+	if (if_index == 0) {
+		wpa_printf(MSG_ERROR, "VLAN: %s: Failure determining "
+			   "interface index for '%s'",
+			   __func__, if_name);
+		close(fd);
+		return -1;
+	}
+
+	args[0] = BRCTL_DEL_IF;
+	args[1] = if_index;
+
+	os_strlcpy(ifr.ifr_name, br_name, sizeof(ifr.ifr_name));
+	ifr.ifr_data = (void *) args;
+
+	if (ioctl(fd, SIOCDEVPRIVATE, &ifr) < 0 && errno != EINVAL) {
+		/* No error if interface already removed. */
+		wpa_printf(MSG_ERROR, "VLAN: %s: ioctl[SIOCDEVPRIVATE,"
+			   "BRCTL_DEL_IF] failed for br_name=%s if_name=%s: "
+			   "%s", __func__, br_name, if_name, strerror(errno));
+		close(fd);
+		return -1;
+	}
+
+	close(fd);
+	return 0;
+}
+
+
+/*
+	Add interface 'if_name' to the bridge 'br_name'
+
+	returns -1 on error
+	returns 1 if the interface is already part of the bridge
+	returns 0 otherwise
+*/
+static int br_addif(const char *br_name, const char *if_name)
+{
+	int fd;
+	struct ifreq ifr;
+	unsigned long args[2];
+	int if_index;
+
+	wpa_printf(MSG_DEBUG, "VLAN: br_addif(%s, %s)", br_name, if_name);
+	if ((fd = socket(AF_INET, SOCK_STREAM, 0)) < 0) {
+		wpa_printf(MSG_ERROR, "VLAN: %s: socket(AF_INET,SOCK_STREAM) "
+			   "failed: %s", __func__, strerror(errno));
+		return -1;
+	}
+
+	if_index = if_nametoindex(if_name);
+
+	if (if_index == 0) {
+		wpa_printf(MSG_ERROR, "VLAN: %s: Failure determining "
+			   "interface index for '%s'",
+			   __func__, if_name);
+		close(fd);
+		return -1;
+	}
+
+	args[0] = BRCTL_ADD_IF;
+	args[1] = if_index;
+
+	os_strlcpy(ifr.ifr_name, br_name, sizeof(ifr.ifr_name));
+	ifr.ifr_data = (void *) args;
+
+	if (ioctl(fd, SIOCDEVPRIVATE, &ifr) < 0) {
+		if (errno == EBUSY) {
+			/* The interface is already added. */
+			close(fd);
+			return 1;
+		}
+
+		wpa_printf(MSG_ERROR, "VLAN: %s: ioctl[SIOCDEVPRIVATE,"
+			   "BRCTL_ADD_IF] failed for br_name=%s if_name=%s: "
+			   "%s", __func__, br_name, if_name, strerror(errno));
+		close(fd);
+		return -1;
+	}
+
+	close(fd);
+	return 0;
+}
+
+
+static int br_delbr(const char *br_name)
+{
+	int fd;
+	unsigned long arg[2];
+
+	wpa_printf(MSG_DEBUG, "VLAN: br_delbr(%s)", br_name);
+	if ((fd = socket(AF_INET, SOCK_STREAM, 0)) < 0) {
+		wpa_printf(MSG_ERROR, "VLAN: %s: socket(AF_INET,SOCK_STREAM) "
+			   "failed: %s", __func__, strerror(errno));
+		return -1;
+	}
+
+	arg[0] = BRCTL_DEL_BRIDGE;
+	arg[1] = (unsigned long) br_name;
+
+	if (ioctl(fd, SIOCGIFBR, arg) < 0 && errno != ENXIO) {
+		/* No error if bridge already removed. */
+		wpa_printf(MSG_ERROR, "VLAN: %s: BRCTL_DEL_BRIDGE failed for "
+			   "%s: %s", __func__, br_name, strerror(errno));
+		close(fd);
+		return -1;
+	}
+
+	close(fd);
+	return 0;
+}
+
+
+/*
+	Add a bridge with the name 'br_name'.
+
+	returns -1 on error
+	returns 1 if the bridge already exists
+	returns 0 otherwise
+*/
+static int br_addbr(const char *br_name)
+{
+	int fd;
+	unsigned long arg[4];
+	struct ifreq ifr;
+
+	wpa_printf(MSG_DEBUG, "VLAN: br_addbr(%s)", br_name);
+	if ((fd = socket(AF_INET, SOCK_STREAM, 0)) < 0) {
+		wpa_printf(MSG_ERROR, "VLAN: %s: socket(AF_INET,SOCK_STREAM) "
+			   "failed: %s", __func__, strerror(errno));
+		return -1;
+	}
+
+	arg[0] = BRCTL_ADD_BRIDGE;
+	arg[1] = (unsigned long) br_name;
+
+	if (ioctl(fd, SIOCGIFBR, arg) < 0) {
+ 		if (errno == EEXIST) {
+			/* The bridge is already added. */
+			close(fd);
+			return 1;
+		} else {
+			wpa_printf(MSG_ERROR, "VLAN: %s: BRCTL_ADD_BRIDGE "
+				   "failed for %s: %s",
+				   __func__, br_name, strerror(errno));
+			close(fd);
+			return -1;
+		}
+	}
+
+	/* Decrease forwarding delay to avoid EAPOL timeouts. */
+	os_memset(&ifr, 0, sizeof(ifr));
+	os_strlcpy(ifr.ifr_name, br_name, IFNAMSIZ);
+	arg[0] = BRCTL_SET_BRIDGE_FORWARD_DELAY;
+	arg[1] = 1;
+	arg[2] = 0;
+	arg[3] = 0;
+	ifr.ifr_data = (char *) &arg;
+	if (ioctl(fd, SIOCDEVPRIVATE, &ifr) < 0) {
+		wpa_printf(MSG_ERROR, "VLAN: %s: "
+			   "BRCTL_SET_BRIDGE_FORWARD_DELAY (1 sec) failed for "
+			   "%s: %s", __func__, br_name, strerror(errno));
+		/* Continue anyway */
+	}
+
+	close(fd);
+	return 0;
+}
+
+
+static int br_getnumports(const char *br_name)
+{
+	int fd;
+	int i;
+	int port_cnt = 0;
+	unsigned long arg[4];
+	int ifindices[MAX_BR_PORTS];
+	struct ifreq ifr;
+
+	if ((fd = socket(AF_INET, SOCK_STREAM, 0)) < 0) {
+		wpa_printf(MSG_ERROR, "VLAN: %s: socket(AF_INET,SOCK_STREAM) "
+			   "failed: %s", __func__, strerror(errno));
+		return -1;
+	}
+
+	arg[0] = BRCTL_GET_PORT_LIST;
+	arg[1] = (unsigned long) ifindices;
+	arg[2] = MAX_BR_PORTS;
+	arg[3] = 0;
+
+	os_memset(ifindices, 0, sizeof(ifindices));
+	os_strlcpy(ifr.ifr_name, br_name, sizeof(ifr.ifr_name));
+	ifr.ifr_data = (void *) arg;
+
+	if (ioctl(fd, SIOCDEVPRIVATE, &ifr) < 0) {
+		wpa_printf(MSG_ERROR, "VLAN: %s: BRCTL_GET_PORT_LIST "
+			   "failed for %s: %s",
+			   __func__, br_name, strerror(errno));
+		close(fd);
+		return -1;
+	}
+
+	for (i = 1; i < MAX_BR_PORTS; i++) {
+		if (ifindices[i] > 0) {
+			port_cnt++;
+		}
+	}
+
+	close(fd);
+	return port_cnt;
+}
+
+
+static void vlan_newlink_tagged(int vlan_naming, const char *tagged_interface,
+				const char *br_name, int vid,
+				struct hostapd_data *hapd)
+{
+	char vlan_ifname[IFNAMSIZ];
+	int clean;
+
+	if (vlan_naming == DYNAMIC_VLAN_NAMING_WITH_DEVICE)
+		os_snprintf(vlan_ifname, sizeof(vlan_ifname), "%s.%d",
+			    tagged_interface, vid);
+	else
+		os_snprintf(vlan_ifname, sizeof(vlan_ifname), "vlan%d", vid);
+
+	clean = 0;
+	ifconfig_up(tagged_interface);
+	if (!vlan_add(tagged_interface, vid, vlan_ifname))
+		clean |= DVLAN_CLEAN_VLAN;
+
+	if (!br_addif(br_name, vlan_ifname))
+		clean |= DVLAN_CLEAN_VLAN_PORT;
+
+	dyn_iface_get(hapd, vlan_ifname, clean);
+
+	ifconfig_up(vlan_ifname);
+}
+
+
+static void vlan_bridge_name(char *br_name, struct hostapd_data *hapd, int vid)
+{
+	char *tagged_interface = hapd->conf->ssid.vlan_tagged_interface;
+
+	if (hapd->conf->vlan_bridge[0]) {
+		os_snprintf(br_name, IFNAMSIZ, "%s%d",
+			    hapd->conf->vlan_bridge, vid);
+	} else if (tagged_interface) {
+		os_snprintf(br_name, IFNAMSIZ, "br%s.%d",
+			    tagged_interface, vid);
+	} else {
+		os_snprintf(br_name, IFNAMSIZ, "brvlan%d", vid);
+	}
+}
+
+
+static void vlan_get_bridge(const char *br_name, struct hostapd_data *hapd,
+			    int vid)
+{
+	char *tagged_interface = hapd->conf->ssid.vlan_tagged_interface;
+	int vlan_naming = hapd->conf->ssid.vlan_naming;
+
+	dyn_iface_get(hapd, br_name, br_addbr(br_name) ? 0 : DVLAN_CLEAN_BR);
+
+	ifconfig_up(br_name);
+
+	if (tagged_interface)
+		vlan_newlink_tagged(vlan_naming, tagged_interface, br_name,
+				    vid, hapd);
+}
+
+
+void vlan_newlink(const char *ifname, struct hostapd_data *hapd)
+{
+	char br_name[IFNAMSIZ];
+	struct hostapd_vlan *vlan;
+	int untagged, *tagged, i, notempty;
+
+	wpa_printf(MSG_DEBUG, "VLAN: vlan_newlink(%s)", ifname);
+
+	for (vlan = hapd->conf->vlan; vlan; vlan = vlan->next) {
+		if (vlan->configured ||
+		    os_strcmp(ifname, vlan->ifname) != 0)
+			continue;
+		break;
+	}
+	if (!vlan)
+		return;
+
+	vlan->configured = 1;
+
+	notempty = vlan->vlan_desc.notempty;
+	untagged = vlan->vlan_desc.untagged;
+	tagged = vlan->vlan_desc.tagged;
+
+	if (!notempty) {
+		/* Non-VLAN STA */
+		if (hapd->conf->bridge[0] &&
+		    !br_addif(hapd->conf->bridge, ifname))
+			vlan->clean |= DVLAN_CLEAN_WLAN_PORT;
+	} else if (untagged > 0 && untagged <= MAX_VLAN_ID) {
+		vlan_bridge_name(br_name, hapd, untagged);
+
+		vlan_get_bridge(br_name, hapd, untagged);
+
+		if (!br_addif(br_name, ifname))
+			vlan->clean |= DVLAN_CLEAN_WLAN_PORT;
+	}
+
+	for (i = 0; i < MAX_NUM_TAGGED_VLAN && tagged[i]; i++) {
+		if (tagged[i] == untagged ||
+		    tagged[i] <= 0 || tagged[i] > MAX_VLAN_ID ||
+		    (i > 0 && tagged[i] == tagged[i - 1]))
+			continue;
+		vlan_bridge_name(br_name, hapd, tagged[i]);
+		vlan_get_bridge(br_name, hapd, tagged[i]);
+		vlan_newlink_tagged(DYNAMIC_VLAN_NAMING_WITH_DEVICE,
+				    ifname, br_name, tagged[i], hapd);
+	}
+
+	ifconfig_up(ifname);
+}
+
+
+static void vlan_dellink_tagged(int vlan_naming, const char *tagged_interface,
+				const char *br_name, int vid,
+				struct hostapd_data *hapd)
+{
+	char vlan_ifname[IFNAMSIZ];
+	int clean;
+
+	if (vlan_naming == DYNAMIC_VLAN_NAMING_WITH_DEVICE)
+		os_snprintf(vlan_ifname, sizeof(vlan_ifname), "%s.%d",
+			    tagged_interface, vid);
+	else
+		os_snprintf(vlan_ifname, sizeof(vlan_ifname), "vlan%d", vid);
+
+	clean = dyn_iface_put(hapd, vlan_ifname);
+
+	if (clean & DVLAN_CLEAN_VLAN_PORT)
+		br_delif(br_name, vlan_ifname);
+
+	if (clean & DVLAN_CLEAN_VLAN) {
+		ifconfig_down(vlan_ifname);
+		vlan_rem(vlan_ifname);
+	}
+}
+
+
+static void vlan_put_bridge(const char *br_name, struct hostapd_data *hapd,
+			    int vid)
+{
+	int clean;
+	char *tagged_interface = hapd->conf->ssid.vlan_tagged_interface;
+	int vlan_naming = hapd->conf->ssid.vlan_naming;
+
+	if (tagged_interface)
+		vlan_dellink_tagged(vlan_naming, tagged_interface, br_name,
+				    vid, hapd);
+
+	clean = dyn_iface_put(hapd, br_name);
+	if ((clean & DVLAN_CLEAN_BR) && br_getnumports(br_name) == 0) {
+		ifconfig_down(br_name);
+		br_delbr(br_name);
+	}
+}
+
+
+void vlan_dellink(const char *ifname, struct hostapd_data *hapd)
+{
+	struct hostapd_vlan *first, *prev, *vlan = hapd->conf->vlan;
+
+	wpa_printf(MSG_DEBUG, "VLAN: vlan_dellink(%s)", ifname);
+
+	first = prev = vlan;
+
+	while (vlan) {
+		if (os_strcmp(ifname, vlan->ifname) != 0) {
+			prev = vlan;
+			vlan = vlan->next;
+			continue;
+		}
+		break;
+	}
+	if (!vlan)
+		return;
+
+	if (vlan->configured) {
+		int notempty = vlan->vlan_desc.notempty;
+		int untagged = vlan->vlan_desc.untagged;
+		int *tagged = vlan->vlan_desc.tagged;
+		char br_name[IFNAMSIZ];
+		int i;
+
+		for (i = 0; i < MAX_NUM_TAGGED_VLAN && tagged[i]; i++) {
+			if (tagged[i] == untagged ||
+			    tagged[i] <= 0 || tagged[i] > MAX_VLAN_ID ||
+			    (i > 0 && tagged[i] == tagged[i - 1]))
+				continue;
+			vlan_bridge_name(br_name, hapd, tagged[i]);
+			vlan_dellink_tagged(DYNAMIC_VLAN_NAMING_WITH_DEVICE,
+					    ifname, br_name, tagged[i], hapd);
+			vlan_put_bridge(br_name, hapd, tagged[i]);
+		}
+
+		if (!notempty) {
+			/* Non-VLAN STA */
+			if (hapd->conf->bridge[0] &&
+			    (vlan->clean & DVLAN_CLEAN_WLAN_PORT))
+				br_delif(hapd->conf->bridge, ifname);
+		} else if (untagged > 0 && untagged <= MAX_VLAN_ID) {
+			vlan_bridge_name(br_name, hapd, untagged);
+
+			if (vlan->clean & DVLAN_CLEAN_WLAN_PORT)
+				br_delif(br_name, vlan->ifname);
+
+			vlan_put_bridge(br_name, hapd, untagged);
+		}
+	}
+
+	/*
+	 * Ensure this VLAN interface is actually removed even if
+	 * NEWLINK message is only received later.
+	 */
+	if (if_nametoindex(vlan->ifname) && vlan_if_remove(hapd, vlan))
+		wpa_printf(MSG_ERROR,
+			   "VLAN: Could not remove VLAN iface: %s: %s",
+			   vlan->ifname, strerror(errno));
+
+	if (vlan == first)
+		hapd->conf->vlan = vlan->next;
+	else
+		prev->next = vlan->next;
+
+	os_free(vlan);
+}
+
+
+static void
+vlan_read_ifnames(struct nlmsghdr *h, size_t len, int del,
+		  struct hostapd_data *hapd)
+{
+	struct ifinfomsg *ifi;
+	int attrlen, nlmsg_len, rta_len;
+	struct rtattr *attr;
+	char ifname[IFNAMSIZ + 1];
+
+	if (len < sizeof(*ifi))
+		return;
+
+	ifi = NLMSG_DATA(h);
+
+	nlmsg_len = NLMSG_ALIGN(sizeof(struct ifinfomsg));
+
+	attrlen = h->nlmsg_len - nlmsg_len;
+	if (attrlen < 0)
+		return;
+
+	attr = (struct rtattr *) (((char *) ifi) + nlmsg_len);
+
+	os_memset(ifname, 0, sizeof(ifname));
+	rta_len = RTA_ALIGN(sizeof(struct rtattr));
+	while (RTA_OK(attr, attrlen)) {
+		if (attr->rta_type == IFLA_IFNAME) {
+			int n = attr->rta_len - rta_len;
+			if (n < 0)
+				break;
+
+			if ((size_t) n >= sizeof(ifname))
+				n = sizeof(ifname) - 1;
+			os_memcpy(ifname, ((char *) attr) + rta_len, n);
+
+		}
+
+		attr = RTA_NEXT(attr, attrlen);
+	}
+
+	if (!ifname[0])
+		return;
+	if (del && if_nametoindex(ifname)) {
+		 /* interface still exists, race condition ->
+		  * iface has just been recreated */
+		return;
+	}
+
+	wpa_printf(MSG_DEBUG,
+		   "VLAN: RTM_%sLINK: ifi_index=%d ifname=%s ifi_family=%d ifi_flags=0x%x (%s%s%s%s)",
+		   del ? "DEL" : "NEW",
+		   ifi->ifi_index, ifname, ifi->ifi_family, ifi->ifi_flags,
+		   (ifi->ifi_flags & IFF_UP) ? "[UP]" : "",
+		   (ifi->ifi_flags & IFF_RUNNING) ? "[RUNNING]" : "",
+		   (ifi->ifi_flags & IFF_LOWER_UP) ? "[LOWER_UP]" : "",
+		   (ifi->ifi_flags & IFF_DORMANT) ? "[DORMANT]" : "");
+
+	if (del)
+		vlan_dellink(ifname, hapd);
+	else
+		vlan_newlink(ifname, hapd);
+}
+
+
+static void vlan_event_receive(int sock, void *eloop_ctx, void *sock_ctx)
+{
+	char buf[8192];
+	int left;
+	struct sockaddr_nl from;
+	socklen_t fromlen;
+	struct nlmsghdr *h;
+	struct hostapd_data *hapd = eloop_ctx;
+
+	fromlen = sizeof(from);
+	left = recvfrom(sock, buf, sizeof(buf), MSG_DONTWAIT,
+			(struct sockaddr *) &from, &fromlen);
+	if (left < 0) {
+		if (errno != EINTR && errno != EAGAIN)
+			wpa_printf(MSG_ERROR, "VLAN: %s: recvfrom failed: %s",
+				   __func__, strerror(errno));
+		return;
+	}
+
+	h = (struct nlmsghdr *) buf;
+	while (NLMSG_OK(h, left)) {
+		int len, plen;
+
+		len = h->nlmsg_len;
+		plen = len - sizeof(*h);
+		if (len > left || plen < 0) {
+			wpa_printf(MSG_DEBUG, "VLAN: Malformed netlink "
+				   "message: len=%d left=%d plen=%d",
+				   len, left, plen);
+			break;
+		}
+
+		switch (h->nlmsg_type) {
+		case RTM_NEWLINK:
+			vlan_read_ifnames(h, plen, 0, hapd);
+			break;
+		case RTM_DELLINK:
+			vlan_read_ifnames(h, plen, 1, hapd);
+			break;
+		}
+
+		h = NLMSG_NEXT(h, left);
+	}
+
+	if (left > 0) {
+		wpa_printf(MSG_DEBUG, "VLAN: %s: %d extra bytes in the end of "
+			   "netlink message", __func__, left);
+	}
+}
+
+
+struct full_dynamic_vlan *
+full_dynamic_vlan_init(struct hostapd_data *hapd)
+{
+	struct sockaddr_nl local;
+	struct full_dynamic_vlan *priv;
+
+	priv = os_zalloc(sizeof(*priv));
+	if (priv == NULL)
+		return NULL;
+
+	vlan_set_name_type(hapd->conf->ssid.vlan_naming ==
+			   DYNAMIC_VLAN_NAMING_WITH_DEVICE ?
+			   VLAN_NAME_TYPE_RAW_PLUS_VID_NO_PAD :
+			   VLAN_NAME_TYPE_PLUS_VID_NO_PAD);
+
+	priv->s = socket(PF_NETLINK, SOCK_RAW, NETLINK_ROUTE);
+	if (priv->s < 0) {
+		wpa_printf(MSG_ERROR, "VLAN: %s: socket(PF_NETLINK,SOCK_RAW,"
+			   "NETLINK_ROUTE) failed: %s",
+			   __func__, strerror(errno));
+		os_free(priv);
+		return NULL;
+	}
+
+	os_memset(&local, 0, sizeof(local));
+	local.nl_family = AF_NETLINK;
+	local.nl_groups = RTMGRP_LINK;
+	if (bind(priv->s, (struct sockaddr *) &local, sizeof(local)) < 0) {
+		wpa_printf(MSG_ERROR, "VLAN: %s: bind(netlink) failed: %s",
+			   __func__, strerror(errno));
+		close(priv->s);
+		os_free(priv);
+		return NULL;
+	}
+
+	if (eloop_register_read_sock(priv->s, vlan_event_receive, hapd, NULL))
+	{
+		close(priv->s);
+		os_free(priv);
+		return NULL;
+	}
+
+	return priv;
+}
+
+
+void full_dynamic_vlan_deinit(struct full_dynamic_vlan *priv)
+{
+	if (priv == NULL)
+		return;
+	eloop_unregister_read_sock(priv->s);
+	close(priv->s);
+	os_free(priv);
+}
diff --git a/src/ap/vlan_ifconfig.c b/src/ap/vlan_ifconfig.c
new file mode 100644
index 0000000000000..ef953a5c4c95a
--- /dev/null
+++ b/src/ap/vlan_ifconfig.c
@@ -0,0 +1,69 @@
+/*
+ * hostapd / VLAN ifconfig helpers
+ * Copyright 2003, Instant802 Networks, Inc.
+ * Copyright 2005-2006, Devicescape Software, Inc.
+ * Copyright (c) 2009, Jouni Malinen <j@w1.fi>
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ */
+
+#include "utils/includes.h"
+#include <net/if.h>
+#include <sys/ioctl.h>
+
+#include "utils/common.h"
+#include "vlan_util.h"
+
+
+int ifconfig_helper(const char *if_name, int up)
+{
+	int fd;
+	struct ifreq ifr;
+
+	if ((fd = socket(AF_INET, SOCK_STREAM, 0)) < 0) {
+		wpa_printf(MSG_ERROR, "VLAN: %s: socket(AF_INET,SOCK_STREAM) "
+			   "failed: %s", __func__, strerror(errno));
+		return -1;
+	}
+
+	os_memset(&ifr, 0, sizeof(ifr));
+	os_strlcpy(ifr.ifr_name, if_name, IFNAMSIZ);
+
+	if (ioctl(fd, SIOCGIFFLAGS, &ifr) != 0) {
+		wpa_printf(MSG_ERROR, "VLAN: %s: ioctl(SIOCGIFFLAGS) failed "
+			   "for interface %s: %s",
+			   __func__, if_name, strerror(errno));
+		close(fd);
+		return -1;
+	}
+
+	if (up)
+		ifr.ifr_flags |= IFF_UP;
+	else
+		ifr.ifr_flags &= ~IFF_UP;
+
+	if (ioctl(fd, SIOCSIFFLAGS, &ifr) != 0) {
+		wpa_printf(MSG_ERROR, "VLAN: %s: ioctl(SIOCSIFFLAGS) failed "
+			   "for interface %s (up=%d): %s",
+			   __func__, if_name, up, strerror(errno));
+		close(fd);
+		return -1;
+	}
+
+	close(fd);
+	return 0;
+}
+
+
+int ifconfig_up(const char *if_name)
+{
+	wpa_printf(MSG_DEBUG, "VLAN: Set interface %s up", if_name);
+	return ifconfig_helper(if_name, 1);
+}
+
+
+int iface_exists(const char *ifname)
+{
+	return if_nametoindex(ifname);
+}
diff --git a/src/ap/vlan_init.c b/src/ap/vlan_init.c
index fd1c8ddacee62..31e4fc6b396a1 100644
--- a/src/ap/vlan_init.c
+++ b/src/ap/vlan_init.c
@@ -9,902 +9,72 @@
  */
 
 #include "utils/includes.h"
-#ifdef CONFIG_FULL_DYNAMIC_VLAN
-#include <net/if.h>
-#include <sys/ioctl.h>
-#include <linux/sockios.h>
-#include <linux/if_vlan.h>
-#include <linux/if_bridge.h>
-#endif /* CONFIG_FULL_DYNAMIC_VLAN */
 
 #include "utils/common.h"
 #include "hostapd.h"
 #include "ap_config.h"
 #include "ap_drv_ops.h"
+#include "wpa_auth.h"
 #include "vlan_init.h"
 #include "vlan_util.h"
 
 
-#ifdef CONFIG_FULL_DYNAMIC_VLAN
-
-#include "drivers/priv_netlink.h"
-#include "utils/eloop.h"
-
-
-struct full_dynamic_vlan {
-	int s; /* socket on which to listen for new/removed interfaces. */
-};
-
-#define DVLAN_CLEAN_BR         0x1
-#define DVLAN_CLEAN_VLAN       0x2
-#define DVLAN_CLEAN_VLAN_PORT  0x4
-
-struct dynamic_iface {
-	char ifname[IFNAMSIZ + 1];
-	int usage;
-	int clean;
-	struct dynamic_iface *next;
-};
-
-
-/* Increment ref counter for ifname and add clean flag.
- * If not in list, add it only if some flags are given.
- */
-static void dyn_iface_get(struct hostapd_data *hapd, const char *ifname,
-			  int clean)
-{
-	struct dynamic_iface *next, **dynamic_ifaces;
-	struct hapd_interfaces *interfaces;
-
-	interfaces = hapd->iface->interfaces;
-	dynamic_ifaces = &interfaces->vlan_priv;
-
-	for (next = *dynamic_ifaces; next; next = next->next) {
-		if (os_strcmp(ifname, next->ifname) == 0)
-			break;
-	}
-
-	if (next) {
-		next->usage++;
-		next->clean |= clean;
-		return;
-	}
-
-	if (!clean)
-		return;
-
-	next = os_zalloc(sizeof(*next));
-	if (!next)
-		return;
-	os_strlcpy(next->ifname, ifname, sizeof(next->ifname));
-	next->usage = 1;
-	next->clean = clean;
-	next->next = *dynamic_ifaces;
-	*dynamic_ifaces = next;
-}
-
-
-/* Decrement reference counter for given ifname.
- * Return clean flag iff reference counter was decreased to zero, else zero
- */
-static int dyn_iface_put(struct hostapd_data *hapd, const char *ifname)
-{
-	struct dynamic_iface *next, *prev = NULL, **dynamic_ifaces;
-	struct hapd_interfaces *interfaces;
-	int clean;
-
-	interfaces = hapd->iface->interfaces;
-	dynamic_ifaces = &interfaces->vlan_priv;
-
-	for (next = *dynamic_ifaces; next; next = next->next) {
-		if (os_strcmp(ifname, next->ifname) == 0)
-			break;
-		prev = next;
-	}
-
-	if (!next)
-		return 0;
-
-	next->usage--;
-	if (next->usage)
-		return 0;
-
-	if (prev)
-		prev->next = next->next;
-	else
-		*dynamic_ifaces = next->next;
-	clean = next->clean;
-	os_free(next);
-
-	return clean;
-}
-
-
-static int ifconfig_helper(const char *if_name, int up)
-{
-	int fd;
-	struct ifreq ifr;
-
-	if ((fd = socket(AF_INET, SOCK_STREAM, 0)) < 0) {
-		wpa_printf(MSG_ERROR, "VLAN: %s: socket(AF_INET,SOCK_STREAM) "
-			   "failed: %s", __func__, strerror(errno));
-		return -1;
-	}
-
-	os_memset(&ifr, 0, sizeof(ifr));
-	os_strlcpy(ifr.ifr_name, if_name, IFNAMSIZ);
-
-	if (ioctl(fd, SIOCGIFFLAGS, &ifr) != 0) {
-		wpa_printf(MSG_ERROR, "VLAN: %s: ioctl(SIOCGIFFLAGS) failed "
-			   "for interface %s: %s",
-			   __func__, if_name, strerror(errno));
-		close(fd);
-		return -1;
-	}
-
-	if (up)
-		ifr.ifr_flags |= IFF_UP;
-	else
-		ifr.ifr_flags &= ~IFF_UP;
-
-	if (ioctl(fd, SIOCSIFFLAGS, &ifr) != 0) {
-		wpa_printf(MSG_ERROR, "VLAN: %s: ioctl(SIOCSIFFLAGS) failed "
-			   "for interface %s (up=%d): %s",
-			   __func__, if_name, up, strerror(errno));
-		close(fd);
-		return -1;
-	}
-
-	close(fd);
-	return 0;
-}
-
-
-static int ifconfig_up(const char *if_name)
-{
-	wpa_printf(MSG_DEBUG, "VLAN: Set interface %s up", if_name);
-	return ifconfig_helper(if_name, 1);
-}
-
-
-static int ifconfig_down(const char *if_name)
-{
-	wpa_printf(MSG_DEBUG, "VLAN: Set interface %s down", if_name);
-	return ifconfig_helper(if_name, 0);
-}
-
-
-/*
- * These are only available in recent linux headers (without the leading
- * underscore).
- */
-#define _GET_VLAN_REALDEV_NAME_CMD	8
-#define _GET_VLAN_VID_CMD		9
-
-/* This value should be 256 ONLY. If it is something else, then hostapd
- * might crash!, as this value has been hard-coded in 2.4.x kernel
- * bridging code.
- */
-#define MAX_BR_PORTS      		256
-
-static int br_delif(const char *br_name, const char *if_name)
-{
-	int fd;
-	struct ifreq ifr;
-	unsigned long args[2];
-	int if_index;
-
-	wpa_printf(MSG_DEBUG, "VLAN: br_delif(%s, %s)", br_name, if_name);
-	if ((fd = socket(AF_INET, SOCK_STREAM, 0)) < 0) {
-		wpa_printf(MSG_ERROR, "VLAN: %s: socket(AF_INET,SOCK_STREAM) "
-			   "failed: %s", __func__, strerror(errno));
-		return -1;
-	}
-
-	if_index = if_nametoindex(if_name);
-
-	if (if_index == 0) {
-		wpa_printf(MSG_ERROR, "VLAN: %s: Failure determining "
-			   "interface index for '%s'",
-			   __func__, if_name);
-		close(fd);
-		return -1;
-	}
-
-	args[0] = BRCTL_DEL_IF;
-	args[1] = if_index;
-
-	os_strlcpy(ifr.ifr_name, br_name, sizeof(ifr.ifr_name));
-	ifr.ifr_data = (__caddr_t) args;
-
-	if (ioctl(fd, SIOCDEVPRIVATE, &ifr) < 0 && errno != EINVAL) {
-		/* No error if interface already removed. */
-		wpa_printf(MSG_ERROR, "VLAN: %s: ioctl[SIOCDEVPRIVATE,"
-			   "BRCTL_DEL_IF] failed for br_name=%s if_name=%s: "
-			   "%s", __func__, br_name, if_name, strerror(errno));
-		close(fd);
-		return -1;
-	}
-
-	close(fd);
-	return 0;
-}
-
-
-/*
-	Add interface 'if_name' to the bridge 'br_name'
-
-	returns -1 on error
-	returns 1 if the interface is already part of the bridge
-	returns 0 otherwise
-*/
-static int br_addif(const char *br_name, const char *if_name)
-{
-	int fd;
-	struct ifreq ifr;
-	unsigned long args[2];
-	int if_index;
-
-	wpa_printf(MSG_DEBUG, "VLAN: br_addif(%s, %s)", br_name, if_name);
-	if ((fd = socket(AF_INET, SOCK_STREAM, 0)) < 0) {
-		wpa_printf(MSG_ERROR, "VLAN: %s: socket(AF_INET,SOCK_STREAM) "
-			   "failed: %s", __func__, strerror(errno));
-		return -1;
-	}
-
-	if_index = if_nametoindex(if_name);
-
-	if (if_index == 0) {
-		wpa_printf(MSG_ERROR, "VLAN: %s: Failure determining "
-			   "interface index for '%s'",
-			   __func__, if_name);
-		close(fd);
-		return -1;
-	}
-
-	args[0] = BRCTL_ADD_IF;
-	args[1] = if_index;
-
-	os_strlcpy(ifr.ifr_name, br_name, sizeof(ifr.ifr_name));
-	ifr.ifr_data = (__caddr_t) args;
-
-	if (ioctl(fd, SIOCDEVPRIVATE, &ifr) < 0) {
-		if (errno == EBUSY) {
-			/* The interface is already added. */
-			close(fd);
-			return 1;
-		}
-
-		wpa_printf(MSG_ERROR, "VLAN: %s: ioctl[SIOCDEVPRIVATE,"
-			   "BRCTL_ADD_IF] failed for br_name=%s if_name=%s: "
-			   "%s", __func__, br_name, if_name, strerror(errno));
-		close(fd);
-		return -1;
-	}
-
-	close(fd);
-	return 0;
-}
-
-
-static int br_delbr(const char *br_name)
-{
-	int fd;
-	unsigned long arg[2];
-
-	wpa_printf(MSG_DEBUG, "VLAN: br_delbr(%s)", br_name);
-	if ((fd = socket(AF_INET, SOCK_STREAM, 0)) < 0) {
-		wpa_printf(MSG_ERROR, "VLAN: %s: socket(AF_INET,SOCK_STREAM) "
-			   "failed: %s", __func__, strerror(errno));
-		return -1;
-	}
-
-	arg[0] = BRCTL_DEL_BRIDGE;
-	arg[1] = (unsigned long) br_name;
-
-	if (ioctl(fd, SIOCGIFBR, arg) < 0 && errno != ENXIO) {
-		/* No error if bridge already removed. */
-		wpa_printf(MSG_ERROR, "VLAN: %s: BRCTL_DEL_BRIDGE failed for "
-			   "%s: %s", __func__, br_name, strerror(errno));
-		close(fd);
-		return -1;
-	}
-
-	close(fd);
-	return 0;
-}
-
-
-/*
-	Add a bridge with the name 'br_name'.
-
-	returns -1 on error
-	returns 1 if the bridge already exists
-	returns 0 otherwise
-*/
-static int br_addbr(const char *br_name)
-{
-	int fd;
-	unsigned long arg[4];
-	struct ifreq ifr;
-
-	wpa_printf(MSG_DEBUG, "VLAN: br_addbr(%s)", br_name);
-	if ((fd = socket(AF_INET, SOCK_STREAM, 0)) < 0) {
-		wpa_printf(MSG_ERROR, "VLAN: %s: socket(AF_INET,SOCK_STREAM) "
-			   "failed: %s", __func__, strerror(errno));
-		return -1;
-	}
-
-	arg[0] = BRCTL_ADD_BRIDGE;
-	arg[1] = (unsigned long) br_name;
-
-	if (ioctl(fd, SIOCGIFBR, arg) < 0) {
- 		if (errno == EEXIST) {
-			/* The bridge is already added. */
-			close(fd);
-			return 1;
-		} else {
-			wpa_printf(MSG_ERROR, "VLAN: %s: BRCTL_ADD_BRIDGE "
-				   "failed for %s: %s",
-				   __func__, br_name, strerror(errno));
-			close(fd);
-			return -1;
-		}
-	}
-
-	/* Decrease forwarding delay to avoid EAPOL timeouts. */
-	os_memset(&ifr, 0, sizeof(ifr));
-	os_strlcpy(ifr.ifr_name, br_name, IFNAMSIZ);
-	arg[0] = BRCTL_SET_BRIDGE_FORWARD_DELAY;
-	arg[1] = 1;
-	arg[2] = 0;
-	arg[3] = 0;
-	ifr.ifr_data = (char *) &arg;
-	if (ioctl(fd, SIOCDEVPRIVATE, &ifr) < 0) {
-		wpa_printf(MSG_ERROR, "VLAN: %s: "
-			   "BRCTL_SET_BRIDGE_FORWARD_DELAY (1 sec) failed for "
-			   "%s: %s", __func__, br_name, strerror(errno));
-		/* Continue anyway */
-	}
-
-	close(fd);
-	return 0;
-}
-
-
-static int br_getnumports(const char *br_name)
-{
-	int fd;
-	int i;
-	int port_cnt = 0;
-	unsigned long arg[4];
-	int ifindices[MAX_BR_PORTS];
-	struct ifreq ifr;
-
-	if ((fd = socket(AF_INET, SOCK_STREAM, 0)) < 0) {
-		wpa_printf(MSG_ERROR, "VLAN: %s: socket(AF_INET,SOCK_STREAM) "
-			   "failed: %s", __func__, strerror(errno));
-		return -1;
-	}
-
-	arg[0] = BRCTL_GET_PORT_LIST;
-	arg[1] = (unsigned long) ifindices;
-	arg[2] = MAX_BR_PORTS;
-	arg[3] = 0;
-
-	os_memset(ifindices, 0, sizeof(ifindices));
-	os_strlcpy(ifr.ifr_name, br_name, sizeof(ifr.ifr_name));
-	ifr.ifr_data = (__caddr_t) arg;
-
-	if (ioctl(fd, SIOCDEVPRIVATE, &ifr) < 0) {
-		wpa_printf(MSG_ERROR, "VLAN: %s: BRCTL_GET_PORT_LIST "
-			   "failed for %s: %s",
-			   __func__, br_name, strerror(errno));
-		close(fd);
-		return -1;
-	}
-
-	for (i = 1; i < MAX_BR_PORTS; i++) {
-		if (ifindices[i] > 0) {
-			port_cnt++;
-		}
-	}
-
-	close(fd);
-	return port_cnt;
-}
-
-
-#ifndef CONFIG_VLAN_NETLINK
-
-int vlan_rem(const char *if_name)
-{
-	int fd;
-	struct vlan_ioctl_args if_request;
-
-	wpa_printf(MSG_DEBUG, "VLAN: vlan_rem(%s)", if_name);
-	if ((os_strlen(if_name) + 1) > sizeof(if_request.device1)) {
-		wpa_printf(MSG_ERROR, "VLAN: Interface name too long: '%s'",
-			   if_name);
-		return -1;
-	}
-
-	if ((fd = socket(AF_INET, SOCK_STREAM, 0)) < 0) {
-		wpa_printf(MSG_ERROR, "VLAN: %s: socket(AF_INET,SOCK_STREAM) "
-			   "failed: %s", __func__, strerror(errno));
-		return -1;
-	}
-
-	os_memset(&if_request, 0, sizeof(if_request));
-
-	os_strlcpy(if_request.device1, if_name, sizeof(if_request.device1));
-	if_request.cmd = DEL_VLAN_CMD;
-
-	if (ioctl(fd, SIOCSIFVLAN, &if_request) < 0) {
-		wpa_printf(MSG_ERROR, "VLAN: %s: DEL_VLAN_CMD failed for %s: "
-			   "%s", __func__, if_name, strerror(errno));
-		close(fd);
-		return -1;
-	}
-
-	close(fd);
-	return 0;
-}
-
-
-/*
-	Add a vlan interface with VLAN ID 'vid' and tagged interface
-	'if_name'.
-
-	returns -1 on error
-	returns 1 if the interface already exists
-	returns 0 otherwise
-*/
-int vlan_add(const char *if_name, int vid, const char *vlan_if_name)
-{
-	int fd;
-	struct vlan_ioctl_args if_request;
-
-	wpa_printf(MSG_DEBUG, "VLAN: vlan_add(if_name=%s, vid=%d)",
-		   if_name, vid);
-	ifconfig_up(if_name);
-
-	if ((os_strlen(if_name) + 1) > sizeof(if_request.device1)) {
-		wpa_printf(MSG_ERROR, "VLAN: Interface name too long: '%s'",
-			   if_name);
-		return -1;
-	}
-
-	if ((fd = socket(AF_INET, SOCK_STREAM, 0)) < 0) {
-		wpa_printf(MSG_ERROR, "VLAN: %s: socket(AF_INET,SOCK_STREAM) "
-			   "failed: %s", __func__, strerror(errno));
-		return -1;
-	}
-
-	os_memset(&if_request, 0, sizeof(if_request));
-
-	/* Determine if a suitable vlan device already exists. */
-
-	os_snprintf(if_request.device1, sizeof(if_request.device1), "vlan%d",
-		    vid);
-
-	if_request.cmd = _GET_VLAN_VID_CMD;
-
-	if (ioctl(fd, SIOCSIFVLAN, &if_request) == 0) {
-
-		if (if_request.u.VID == vid) {
-			if_request.cmd = _GET_VLAN_REALDEV_NAME_CMD;
-
-			if (ioctl(fd, SIOCSIFVLAN, &if_request) == 0 &&
-			    os_strncmp(if_request.u.device2, if_name,
-				       sizeof(if_request.u.device2)) == 0) {
-				close(fd);
-				wpa_printf(MSG_DEBUG, "VLAN: vlan_add: "
-					   "if_name %s exists already",
-					   if_request.device1);
-				return 1;
-			}
-		}
-	}
-
-	/* A suitable vlan device does not already exist, add one. */
-
-	os_memset(&if_request, 0, sizeof(if_request));
-	os_strlcpy(if_request.device1, if_name, sizeof(if_request.device1));
-	if_request.u.VID = vid;
-	if_request.cmd = ADD_VLAN_CMD;
-
-	if (ioctl(fd, SIOCSIFVLAN, &if_request) < 0) {
-		wpa_printf(MSG_ERROR, "VLAN: %s: ADD_VLAN_CMD failed for %s: "
-			   "%s",
-			   __func__, if_request.device1, strerror(errno));
-		close(fd);
-		return -1;
-	}
-
-	close(fd);
-	return 0;
-}
-
-
-static int vlan_set_name_type(unsigned int name_type)
+static int vlan_if_add(struct hostapd_data *hapd, struct hostapd_vlan *vlan,
+		       int existsok)
 {
-	int fd;
-	struct vlan_ioctl_args if_request;
+	int ret, i;
 
-	wpa_printf(MSG_DEBUG, "VLAN: vlan_set_name_type(name_type=%u)",
-		   name_type);
-	if ((fd = socket(AF_INET, SOCK_STREAM, 0)) < 0) {
-		wpa_printf(MSG_ERROR, "VLAN: %s: socket(AF_INET,SOCK_STREAM) "
-			   "failed: %s", __func__, strerror(errno));
+	for (i = 0; i < NUM_WEP_KEYS; i++) {
+		if (!hapd->conf->ssid.wep.key[i])
+			continue;
+		wpa_printf(MSG_ERROR,
+			   "VLAN: Refusing to set up VLAN iface %s with WEP",
+			   vlan->ifname);
 		return -1;
 	}
 
-	os_memset(&if_request, 0, sizeof(if_request));
-
-	if_request.u.name_type = name_type;
-	if_request.cmd = SET_VLAN_NAME_TYPE_CMD;
-	if (ioctl(fd, SIOCSIFVLAN, &if_request) < 0) {
-		wpa_printf(MSG_ERROR, "VLAN: %s: SET_VLAN_NAME_TYPE_CMD "
-			   "name_type=%u failed: %s",
-			   __func__, name_type, strerror(errno));
-		close(fd);
+	if (!iface_exists(vlan->ifname))
+		ret = hostapd_vlan_if_add(hapd, vlan->ifname);
+	else if (!existsok)
 		return -1;
-	}
-
-	close(fd);
-	return 0;
-}
-
-#endif /* CONFIG_VLAN_NETLINK */
-
-
-static void vlan_newlink(char *ifname, struct hostapd_data *hapd)
-{
-	char vlan_ifname[IFNAMSIZ];
-	char br_name[IFNAMSIZ];
-	struct hostapd_vlan *vlan = hapd->conf->vlan;
-	char *tagged_interface = hapd->conf->ssid.vlan_tagged_interface;
-	int vlan_naming = hapd->conf->ssid.vlan_naming;
-	int clean;
-
-	wpa_printf(MSG_DEBUG, "VLAN: vlan_newlink(%s)", ifname);
-
-	while (vlan) {
-		if (os_strcmp(ifname, vlan->ifname) == 0 && !vlan->configured) {
-			vlan->configured = 1;
-
-			if (hapd->conf->vlan_bridge[0]) {
-				os_snprintf(br_name, sizeof(br_name), "%s%d",
-					    hapd->conf->vlan_bridge,
-					    vlan->vlan_id);
-			} else if (tagged_interface) {
-				os_snprintf(br_name, sizeof(br_name),
-				            "br%s.%d", tagged_interface,
-					    vlan->vlan_id);
-			} else {
-				os_snprintf(br_name, sizeof(br_name),
-				            "brvlan%d", vlan->vlan_id);
-			}
-
-			dyn_iface_get(hapd, br_name,
-				      br_addbr(br_name) ? 0 : DVLAN_CLEAN_BR);
-
-			ifconfig_up(br_name);
-
-			if (tagged_interface) {
-				if (vlan_naming ==
-				    DYNAMIC_VLAN_NAMING_WITH_DEVICE)
-					os_snprintf(vlan_ifname,
-						    sizeof(vlan_ifname),
-						    "%s.%d", tagged_interface,
-						    vlan->vlan_id);
-				else
-					os_snprintf(vlan_ifname,
-						    sizeof(vlan_ifname),
-						    "vlan%d", vlan->vlan_id);
-
-				clean = 0;
-				ifconfig_up(tagged_interface);
-				if (!vlan_add(tagged_interface, vlan->vlan_id,
-					      vlan_ifname))
-					clean |= DVLAN_CLEAN_VLAN;
-
-				if (!br_addif(br_name, vlan_ifname))
-					clean |= DVLAN_CLEAN_VLAN_PORT;
-
-				dyn_iface_get(hapd, vlan_ifname, clean);
-
-				ifconfig_up(vlan_ifname);
-			}
-
-			if (!br_addif(br_name, ifname))
-				vlan->clean |= DVLAN_CLEAN_WLAN_PORT;
-
-			ifconfig_up(ifname);
-
-			break;
-		}
-		vlan = vlan->next;
-	}
-}
-
-
-static void vlan_dellink(char *ifname, struct hostapd_data *hapd)
-{
-	char vlan_ifname[IFNAMSIZ];
-	char br_name[IFNAMSIZ];
-	struct hostapd_vlan *first, *prev, *vlan = hapd->conf->vlan;
-	char *tagged_interface = hapd->conf->ssid.vlan_tagged_interface;
-	int vlan_naming = hapd->conf->ssid.vlan_naming;
-	int clean;
-
-	wpa_printf(MSG_DEBUG, "VLAN: vlan_dellink(%s)", ifname);
-
-	first = prev = vlan;
-
-	while (vlan) {
-		if (os_strcmp(ifname, vlan->ifname) == 0 &&
-		    vlan->configured) {
-			if (hapd->conf->vlan_bridge[0]) {
-				os_snprintf(br_name, sizeof(br_name), "%s%d",
-					    hapd->conf->vlan_bridge,
-					    vlan->vlan_id);
-			} else if (tagged_interface) {
-				os_snprintf(br_name, sizeof(br_name),
-				            "br%s.%d", tagged_interface,
-					    vlan->vlan_id);
-			} else {
-				os_snprintf(br_name, sizeof(br_name),
-				            "brvlan%d", vlan->vlan_id);
-			}
-
-			if (vlan->clean & DVLAN_CLEAN_WLAN_PORT)
-				br_delif(br_name, vlan->ifname);
-
-			if (tagged_interface) {
-				if (vlan_naming ==
-				    DYNAMIC_VLAN_NAMING_WITH_DEVICE)
-					os_snprintf(vlan_ifname,
-						    sizeof(vlan_ifname),
-						    "%s.%d", tagged_interface,
-						    vlan->vlan_id);
-				else
-					os_snprintf(vlan_ifname,
-						    sizeof(vlan_ifname),
-						    "vlan%d", vlan->vlan_id);
-
-				clean = dyn_iface_put(hapd, vlan_ifname);
-
-				if (clean & DVLAN_CLEAN_VLAN_PORT)
-					br_delif(br_name, vlan_ifname);
-
-				if (clean & DVLAN_CLEAN_VLAN) {
-					ifconfig_down(vlan_ifname);
-					vlan_rem(vlan_ifname);
-				}
-			}
-
-			clean = dyn_iface_put(hapd, br_name);
-			if ((clean & DVLAN_CLEAN_BR) &&
-			    br_getnumports(br_name) == 0) {
-				ifconfig_down(br_name);
-				br_delbr(br_name);
-			}
-		}
-
-		if (os_strcmp(ifname, vlan->ifname) == 0) {
-			if (vlan == first) {
-				hapd->conf->vlan = vlan->next;
-			} else {
-				prev->next = vlan->next;
-			}
-			os_free(vlan);
-
-			break;
-		}
-		prev = vlan;
-		vlan = vlan->next;
-	}
-}
-
-
-static void
-vlan_read_ifnames(struct nlmsghdr *h, size_t len, int del,
-		  struct hostapd_data *hapd)
-{
-	struct ifinfomsg *ifi;
-	int attrlen, nlmsg_len, rta_len;
-	struct rtattr *attr;
-	char ifname[IFNAMSIZ + 1];
-
-	if (len < sizeof(*ifi))
-		return;
-
-	ifi = NLMSG_DATA(h);
-
-	nlmsg_len = NLMSG_ALIGN(sizeof(struct ifinfomsg));
-
-	attrlen = h->nlmsg_len - nlmsg_len;
-	if (attrlen < 0)
-		return;
-
-	attr = (struct rtattr *) (((char *) ifi) + nlmsg_len);
-
-	os_memset(ifname, 0, sizeof(ifname));
-	rta_len = RTA_ALIGN(sizeof(struct rtattr));
-	while (RTA_OK(attr, attrlen)) {
-		if (attr->rta_type == IFLA_IFNAME) {
-			int n = attr->rta_len - rta_len;
-			if (n < 0)
-				break;
-
-			if ((size_t) n >= sizeof(ifname))
-				n = sizeof(ifname) - 1;
-			os_memcpy(ifname, ((char *) attr) + rta_len, n);
-
-		}
-
-		attr = RTA_NEXT(attr, attrlen);
-	}
-
-	if (!ifname[0])
-		return;
-	if (del && if_nametoindex(ifname)) {
-		 /* interface still exists, race condition ->
-		  * iface has just been recreated */
-		return;
-	}
-
-	wpa_printf(MSG_DEBUG,
-		   "VLAN: RTM_%sLINK: ifi_index=%d ifname=%s ifi_family=%d ifi_flags=0x%x (%s%s%s%s)",
-		   del ? "DEL" : "NEW",
-		   ifi->ifi_index, ifname, ifi->ifi_family, ifi->ifi_flags,
-		   (ifi->ifi_flags & IFF_UP) ? "[UP]" : "",
-		   (ifi->ifi_flags & IFF_RUNNING) ? "[RUNNING]" : "",
-		   (ifi->ifi_flags & IFF_LOWER_UP) ? "[LOWER_UP]" : "",
-		   (ifi->ifi_flags & IFF_DORMANT) ? "[DORMANT]" : "");
-
-	if (del)
-		vlan_dellink(ifname, hapd);
 	else
-		vlan_newlink(ifname, hapd);
-}
-
-
-static void vlan_event_receive(int sock, void *eloop_ctx, void *sock_ctx)
-{
-	char buf[8192];
-	int left;
-	struct sockaddr_nl from;
-	socklen_t fromlen;
-	struct nlmsghdr *h;
-	struct hostapd_data *hapd = eloop_ctx;
-
-	fromlen = sizeof(from);
-	left = recvfrom(sock, buf, sizeof(buf), MSG_DONTWAIT,
-			(struct sockaddr *) &from, &fromlen);
-	if (left < 0) {
-		if (errno != EINTR && errno != EAGAIN)
-			wpa_printf(MSG_ERROR, "VLAN: %s: recvfrom failed: %s",
-				   __func__, strerror(errno));
-		return;
-	}
-
-	h = (struct nlmsghdr *) buf;
-	while (NLMSG_OK(h, left)) {
-		int len, plen;
-
-		len = h->nlmsg_len;
-		plen = len - sizeof(*h);
-		if (len > left || plen < 0) {
-			wpa_printf(MSG_DEBUG, "VLAN: Malformed netlink "
-				   "message: len=%d left=%d plen=%d",
-				   len, left, plen);
-			break;
-		}
-
-		switch (h->nlmsg_type) {
-		case RTM_NEWLINK:
-			vlan_read_ifnames(h, plen, 0, hapd);
-			break;
-		case RTM_DELLINK:
-			vlan_read_ifnames(h, plen, 1, hapd);
-			break;
-		}
+		ret = 0;
 
-		h = NLMSG_NEXT(h, left);
-	}
+	if (ret)
+		return ret;
 
-	if (left > 0) {
-		wpa_printf(MSG_DEBUG, "VLAN: %s: %d extra bytes in the end of "
-			   "netlink message", __func__, left);
-	}
-}
+	ifconfig_up(vlan->ifname); /* else wpa group will fail fatal */
 
+	if (hapd->wpa_auth)
+		ret = wpa_auth_ensure_group(hapd->wpa_auth, vlan->vlan_id);
 
-static struct full_dynamic_vlan *
-full_dynamic_vlan_init(struct hostapd_data *hapd)
-{
-	struct sockaddr_nl local;
-	struct full_dynamic_vlan *priv;
+	if (ret == 0)
+		return ret;
 
-	priv = os_zalloc(sizeof(*priv));
-	if (priv == NULL)
-		return NULL;
+	wpa_printf(MSG_ERROR, "WPA initialization for VLAN %d failed (%d)",
+		   vlan->vlan_id, ret);
+	if (wpa_auth_release_group(hapd->wpa_auth, vlan->vlan_id))
+		wpa_printf(MSG_ERROR, "WPA deinit of %s failed", vlan->ifname);
 
-#ifndef CONFIG_VLAN_NETLINK
-	vlan_set_name_type(hapd->conf->ssid.vlan_naming ==
-			   DYNAMIC_VLAN_NAMING_WITH_DEVICE ?
-			   VLAN_NAME_TYPE_RAW_PLUS_VID_NO_PAD :
-			   VLAN_NAME_TYPE_PLUS_VID_NO_PAD);
-#endif /* CONFIG_VLAN_NETLINK */
+	/* group state machine setup failed */
+	if (hostapd_vlan_if_remove(hapd, vlan->ifname))
+		wpa_printf(MSG_ERROR, "Removal of %s failed", vlan->ifname);
 
-	priv->s = socket(PF_NETLINK, SOCK_RAW, NETLINK_ROUTE);
-	if (priv->s < 0) {
-		wpa_printf(MSG_ERROR, "VLAN: %s: socket(PF_NETLINK,SOCK_RAW,"
-			   "NETLINK_ROUTE) failed: %s",
-			   __func__, strerror(errno));
-		os_free(priv);
-		return NULL;
-	}
-
-	os_memset(&local, 0, sizeof(local));
-	local.nl_family = AF_NETLINK;
-	local.nl_groups = RTMGRP_LINK;
-	if (bind(priv->s, (struct sockaddr *) &local, sizeof(local)) < 0) {
-		wpa_printf(MSG_ERROR, "VLAN: %s: bind(netlink) failed: %s",
-			   __func__, strerror(errno));
-		close(priv->s);
-		os_free(priv);
-		return NULL;
-	}
-
-	if (eloop_register_read_sock(priv->s, vlan_event_receive, hapd, NULL))
-	{
-		close(priv->s);
-		os_free(priv);
-		return NULL;
-	}
-
-	return priv;
-}
-
-
-static void full_dynamic_vlan_deinit(struct full_dynamic_vlan *priv)
-{
-	if (priv == NULL)
-		return;
-	eloop_unregister_read_sock(priv->s);
-	close(priv->s);
-	os_free(priv);
+	return ret;
 }
-#endif /* CONFIG_FULL_DYNAMIC_VLAN */
 
 
-int vlan_setup_encryption_dyn(struct hostapd_data *hapd, const char *dyn_vlan)
+int vlan_if_remove(struct hostapd_data *hapd, struct hostapd_vlan *vlan)
 {
-        int i;
+	int ret;
 
-        if (dyn_vlan == NULL)
-		return 0;
+	ret = wpa_auth_release_group(hapd->wpa_auth, vlan->vlan_id);
+	if (ret)
+		wpa_printf(MSG_ERROR,
+			   "WPA deinitialization for VLAN %d failed (%d)",
+			   vlan->vlan_id, ret);
 
-	/* Static WEP keys are set here; IEEE 802.1X and WPA uses their own
-	 * functions for setting up dynamic broadcast keys. */
-	for (i = 0; i < 4; i++) {
-		if (hapd->conf->ssid.wep.key[i] &&
-		    hostapd_drv_set_key(dyn_vlan, hapd, WPA_ALG_WEP, NULL, i,
-					i == hapd->conf->ssid.wep.idx, NULL, 0,
-					hapd->conf->ssid.wep.key[i],
-					hapd->conf->ssid.wep.len[i]))
-		{
-			wpa_printf(MSG_ERROR, "VLAN: Could not set WEP "
-				   "encryption for dynamic VLAN");
-			return -1;
-		}
-	}
-
-	return 0;
+	return hostapd_vlan_if_remove(hapd, vlan->ifname);
 }
 
 
@@ -913,17 +83,14 @@ static int vlan_dynamic_add(struct hostapd_data *hapd,
 {
 	while (vlan) {
 		if (vlan->vlan_id != VLAN_ID_WILDCARD) {
-			if (hostapd_vlan_if_add(hapd, vlan->ifname)) {
-				if (errno != EEXIST) {
-					wpa_printf(MSG_ERROR, "VLAN: Could "
-						   "not add VLAN %s: %s",
-						   vlan->ifname,
-						   strerror(errno));
-					return -1;
-				}
+			if (vlan_if_add(hapd, vlan, 1)) {
+				wpa_printf(MSG_ERROR,
+					   "VLAN: Could not add VLAN %s: %s",
+					   vlan->ifname, strerror(errno));
+				return -1;
 			}
 #ifdef CONFIG_FULL_DYNAMIC_VLAN
-			ifconfig_up(vlan->ifname);
+			vlan_newlink(vlan->ifname, hapd);
 #endif /* CONFIG_FULL_DYNAMIC_VLAN */
 		}
 
@@ -942,15 +109,17 @@ static void vlan_dynamic_remove(struct hostapd_data *hapd,
 	while (vlan) {
 		next = vlan->next;
 
+#ifdef CONFIG_FULL_DYNAMIC_VLAN
+		/* vlan_dellink() takes care of cleanup and interface removal */
+		if (vlan->vlan_id != VLAN_ID_WILDCARD)
+			vlan_dellink(vlan->ifname, hapd);
+#else /* CONFIG_FULL_DYNAMIC_VLAN */
 		if (vlan->vlan_id != VLAN_ID_WILDCARD &&
-		    hostapd_vlan_if_remove(hapd, vlan->ifname)) {
+		    vlan_if_remove(hapd, vlan)) {
 			wpa_printf(MSG_ERROR, "VLAN: Could not remove VLAN "
 				   "iface: %s: %s",
 				   vlan->ifname, strerror(errno));
 		}
-#ifdef CONFIG_FULL_DYNAMIC_VLAN
-		if (vlan->clean)
-			vlan_dellink(vlan->ifname, hapd);
 #endif /* CONFIG_FULL_DYNAMIC_VLAN */
 
 		vlan = next;
@@ -964,7 +133,8 @@ int vlan_init(struct hostapd_data *hapd)
 	hapd->full_dynamic_vlan = full_dynamic_vlan_init(hapd);
 #endif /* CONFIG_FULL_DYNAMIC_VLAN */
 
-	if (hapd->conf->ssid.dynamic_vlan != DYNAMIC_VLAN_DISABLED &&
+	if ((hapd->conf->ssid.dynamic_vlan != DYNAMIC_VLAN_DISABLED ||
+	     hapd->conf->ssid.per_sta_vif) &&
 	    !hapd->conf->vlan) {
 		/* dynamic vlans enabled but no (or empty) vlan_file given */
 		struct hostapd_vlan *vlan;
@@ -1002,50 +172,45 @@ void vlan_deinit(struct hostapd_data *hapd)
 
 struct hostapd_vlan * vlan_add_dynamic(struct hostapd_data *hapd,
 				       struct hostapd_vlan *vlan,
-				       int vlan_id)
+				       int vlan_id,
+				       struct vlan_description *vlan_desc)
 {
-	struct hostapd_vlan *n = NULL;
-	char *ifname, *pos;
+	struct hostapd_vlan *n;
+	char ifname[IFNAMSIZ + 1], *pos;
 
-	if (vlan == NULL || vlan_id <= 0 || vlan_id > MAX_VLAN_ID ||
-	    vlan->vlan_id != VLAN_ID_WILDCARD)
+	if (vlan == NULL || vlan->vlan_id != VLAN_ID_WILDCARD)
 		return NULL;
 
 	wpa_printf(MSG_DEBUG, "VLAN: %s(vlan_id=%d ifname=%s)",
 		   __func__, vlan_id, vlan->ifname);
-	ifname = os_strdup(vlan->ifname);
-	if (ifname == NULL)
-		return NULL;
+	os_strlcpy(ifname, vlan->ifname, sizeof(ifname));
 	pos = os_strchr(ifname, '#');
 	if (pos == NULL)
-		goto free_ifname;
+		return NULL;
 	*pos++ = '\0';
 
 	n = os_zalloc(sizeof(*n));
 	if (n == NULL)
-		goto free_ifname;
+		return NULL;
 
 	n->vlan_id = vlan_id;
+	if (vlan_desc)
+		n->vlan_desc = *vlan_desc;
 	n->dynamic_vlan = 1;
 
 	os_snprintf(n->ifname, sizeof(n->ifname), "%s%d%s", ifname, vlan_id,
 		    pos);
 
-	if (hostapd_vlan_if_add(hapd, n->ifname)) {
-		os_free(n);
-		n = NULL;
-		goto free_ifname;
-	}
-
 	n->next = hapd->conf->vlan;
 	hapd->conf->vlan = n;
 
-#ifdef CONFIG_FULL_DYNAMIC_VLAN
-	ifconfig_up(n->ifname);
-#endif /* CONFIG_FULL_DYNAMIC_VLAN */
+	/* hapd->conf->vlan needs this new VLAN here for WPA setup */
+	if (vlan_if_add(hapd, n, 0)) {
+		hapd->conf->vlan = n->next;
+		os_free(n);
+		n = NULL;
+	}
 
-free_ifname:
-	os_free(ifname);
 	return n;
 }
 
@@ -1054,7 +219,7 @@ int vlan_remove_dynamic(struct hostapd_data *hapd, int vlan_id)
 {
 	struct hostapd_vlan *vlan;
 
-	if (vlan_id <= 0 || vlan_id > MAX_VLAN_ID)
+	if (vlan_id <= 0)
 		return 1;
 
 	wpa_printf(MSG_DEBUG, "VLAN: %s(ifname=%s vlan_id=%d)",
@@ -1073,7 +238,7 @@ int vlan_remove_dynamic(struct hostapd_data *hapd, int vlan_id)
 		return 1;
 
 	if (vlan->dynamic_vlan == 0) {
-		hostapd_vlan_if_remove(hapd, vlan->ifname);
+		vlan_if_remove(hapd, vlan);
 #ifdef CONFIG_FULL_DYNAMIC_VLAN
 		vlan_dellink(vlan->ifname, hapd);
 #endif /* CONFIG_FULL_DYNAMIC_VLAN */
diff --git a/src/ap/vlan_init.h b/src/ap/vlan_init.h
index fc39443e5d34b..d17c82c326ab6 100644
--- a/src/ap/vlan_init.h
+++ b/src/ap/vlan_init.h
@@ -15,10 +15,9 @@ int vlan_init(struct hostapd_data *hapd);
 void vlan_deinit(struct hostapd_data *hapd);
 struct hostapd_vlan * vlan_add_dynamic(struct hostapd_data *hapd,
 				       struct hostapd_vlan *vlan,
-				       int vlan_id);
+				       int vlan_id,
+				       struct vlan_description *vlan_desc);
 int vlan_remove_dynamic(struct hostapd_data *hapd, int vlan_id);
-int vlan_setup_encryption_dyn(struct hostapd_data *hapd,
-			      const char *dyn_vlan);
 #else /* CONFIG_NO_VLAN */
 static inline int vlan_init(struct hostapd_data *hapd)
 {
@@ -29,9 +28,9 @@ static inline void vlan_deinit(struct hostapd_data *hapd)
 {
 }
 
-static inline struct hostapd_vlan * vlan_add_dynamic(struct hostapd_data *hapd,
-						     struct hostapd_vlan *vlan,
-						     int vlan_id)
+static inline struct hostapd_vlan *
+vlan_add_dynamic(struct hostapd_data *hapd, struct hostapd_vlan *vlan,
+		 int vlan_id, struct vlan_description *vlan_desc)
 {
 	return NULL;
 }
@@ -40,12 +39,6 @@ static inline int vlan_remove_dynamic(struct hostapd_data *hapd, int vlan_id)
 {
 	return -1;
 }
-
-static inline int vlan_setup_encryption_dyn(struct hostapd_data *hapd,
-					    const char *dyn_vlan)
-{
-	return -1;
-}
 #endif /* CONFIG_NO_VLAN */
 
 #endif /* VLAN_INIT_H */
diff --git a/src/ap/vlan_ioctl.c b/src/ap/vlan_ioctl.c
new file mode 100644
index 0000000000000..987b612e1d9f8
--- /dev/null
+++ b/src/ap/vlan_ioctl.c
@@ -0,0 +1,155 @@
+/*
+ * hostapd / VLAN ioctl API
+ * Copyright 2003, Instant802 Networks, Inc.
+ * Copyright 2005-2006, Devicescape Software, Inc.
+ * Copyright (c) 2009, Jouni Malinen <j@w1.fi>
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ */
+
+#include "utils/includes.h"
+#include <sys/ioctl.h>
+
+#include "utils/common.h"
+#include "common/linux_vlan.h"
+#include "vlan_util.h"
+
+
+int vlan_rem(const char *if_name)
+{
+	int fd;
+	struct vlan_ioctl_args if_request;
+
+	wpa_printf(MSG_DEBUG, "VLAN: vlan_rem(%s)", if_name);
+	if ((os_strlen(if_name) + 1) > sizeof(if_request.device1)) {
+		wpa_printf(MSG_ERROR, "VLAN: Interface name too long: '%s'",
+			   if_name);
+		return -1;
+	}
+
+	if ((fd = socket(AF_INET, SOCK_STREAM, 0)) < 0) {
+		wpa_printf(MSG_ERROR, "VLAN: %s: socket(AF_INET,SOCK_STREAM) "
+			   "failed: %s", __func__, strerror(errno));
+		return -1;
+	}
+
+	os_memset(&if_request, 0, sizeof(if_request));
+
+	os_strlcpy(if_request.device1, if_name, sizeof(if_request.device1));
+	if_request.cmd = DEL_VLAN_CMD;
+
+	if (ioctl(fd, SIOCSIFVLAN, &if_request) < 0) {
+		wpa_printf(MSG_ERROR, "VLAN: %s: DEL_VLAN_CMD failed for %s: "
+			   "%s", __func__, if_name, strerror(errno));
+		close(fd);
+		return -1;
+	}
+
+	close(fd);
+	return 0;
+}
+
+
+/*
+	Add a vlan interface with VLAN ID 'vid' and tagged interface
+	'if_name'.
+
+	returns -1 on error
+	returns 1 if the interface already exists
+	returns 0 otherwise
+*/
+int vlan_add(const char *if_name, int vid, const char *vlan_if_name)
+{
+	int fd;
+	struct vlan_ioctl_args if_request;
+
+	wpa_printf(MSG_DEBUG, "VLAN: vlan_add(if_name=%s, vid=%d)",
+		   if_name, vid);
+	ifconfig_up(if_name);
+
+	if ((os_strlen(if_name) + 1) > sizeof(if_request.device1)) {
+		wpa_printf(MSG_ERROR, "VLAN: Interface name too long: '%s'",
+			   if_name);
+		return -1;
+	}
+
+	if ((fd = socket(AF_INET, SOCK_STREAM, 0)) < 0) {
+		wpa_printf(MSG_ERROR, "VLAN: %s: socket(AF_INET,SOCK_STREAM) "
+			   "failed: %s", __func__, strerror(errno));
+		return -1;
+	}
+
+	os_memset(&if_request, 0, sizeof(if_request));
+
+	/* Determine if a suitable vlan device already exists. */
+
+	os_snprintf(if_request.device1, sizeof(if_request.device1), "vlan%d",
+		    vid);
+
+	if_request.cmd = GET_VLAN_VID_CMD;
+
+	if (ioctl(fd, SIOCSIFVLAN, &if_request) == 0 &&
+	    if_request.u.VID == vid) {
+		if_request.cmd = GET_VLAN_REALDEV_NAME_CMD;
+
+		if (ioctl(fd, SIOCSIFVLAN, &if_request) == 0 &&
+		    os_strncmp(if_request.u.device2, if_name,
+			       sizeof(if_request.u.device2)) == 0) {
+			close(fd);
+			wpa_printf(MSG_DEBUG,
+				   "VLAN: vlan_add: if_name %s exists already",
+				   if_request.device1);
+			return 1;
+		}
+	}
+
+	/* A suitable vlan device does not already exist, add one. */
+
+	os_memset(&if_request, 0, sizeof(if_request));
+	os_strlcpy(if_request.device1, if_name, sizeof(if_request.device1));
+	if_request.u.VID = vid;
+	if_request.cmd = ADD_VLAN_CMD;
+
+	if (ioctl(fd, SIOCSIFVLAN, &if_request) < 0) {
+		wpa_printf(MSG_ERROR,
+			   "VLAN: %s: ADD_VLAN_CMD failed for %s: %s",
+			   __func__, if_request.device1, strerror(errno));
+		close(fd);
+		return -1;
+	}
+
+	close(fd);
+	return 0;
+}
+
+
+int vlan_set_name_type(unsigned int name_type)
+{
+	int fd;
+	struct vlan_ioctl_args if_request;
+
+	wpa_printf(MSG_DEBUG, "VLAN: vlan_set_name_type(name_type=%u)",
+		   name_type);
+	if ((fd = socket(AF_INET, SOCK_STREAM, 0)) < 0) {
+		wpa_printf(MSG_ERROR,
+			   "VLAN: %s: socket(AF_INET,SOCK_STREAM) failed: %s",
+			   __func__, strerror(errno));
+		return -1;
+	}
+
+	os_memset(&if_request, 0, sizeof(if_request));
+
+	if_request.u.name_type = name_type;
+	if_request.cmd = SET_VLAN_NAME_TYPE_CMD;
+	if (ioctl(fd, SIOCSIFVLAN, &if_request) < 0) {
+		wpa_printf(MSG_ERROR,
+			   "VLAN: %s: SET_VLAN_NAME_TYPE_CMD name_type=%u failed: %s",
+			   __func__, name_type, strerror(errno));
+		close(fd);
+		return -1;
+	}
+
+	close(fd);
+	return 0;
+}
diff --git a/src/ap/vlan_util.c b/src/ap/vlan_util.c
index d4e0efb9b0242..56d1d3d123e87 100644
--- a/src/ap/vlan_util.c
+++ b/src/ap/vlan_util.c
@@ -7,18 +7,10 @@
  */
 
 #include "utils/includes.h"
-#include <sys/ioctl.h>
-#include <linux/sockios.h>
-#include <linux/if_vlan.h>
-#include <netlink/genl/genl.h>
-#include <netlink/genl/family.h>
-#include <netlink/genl/ctrl.h>
 #include <netlink/route/link.h>
 #include <netlink/route/link/vlan.h>
 
 #include "utils/common.h"
-#include "utils/eloop.h"
-#include "hostapd.h"
 #include "vlan_util.h"
 
 /*
@@ -33,7 +25,6 @@ int vlan_add(const char *if_name, int vid, const char *vlan_if_name)
 {
 	int err, ret = -1;
 	struct nl_sock *handle = NULL;
-	struct nl_cache *cache = NULL;
 	struct rtnl_link *rlink = NULL;
 	int if_idx = 0;
 
@@ -65,22 +56,19 @@ int vlan_add(const char *if_name, int vid, const char *vlan_if_name)
 		goto vlan_add_error;
 	}
 
-	err = rtnl_link_alloc_cache(handle, AF_UNSPEC, &cache);
+	err = rtnl_link_get_kernel(handle, 0, if_name, &rlink);
 	if (err < 0) {
-		cache = NULL;
-		wpa_printf(MSG_ERROR, "VLAN: failed to alloc cache: %s",
-			   nl_geterror(err));
-		goto vlan_add_error;
-	}
-
-	if (!(if_idx = rtnl_link_name2i(cache, if_name))) {
 		/* link does not exist */
 		wpa_printf(MSG_ERROR, "VLAN: interface %s does not exist",
 			   if_name);
 		goto vlan_add_error;
 	}
+	if_idx = rtnl_link_get_ifindex(rlink);
+	rtnl_link_put(rlink);
+	rlink = NULL;
 
-	if ((rlink = rtnl_link_get_by_name(cache, vlan_if_name))) {
+	err = rtnl_link_get_kernel(handle, 0, vlan_if_name, &rlink);
+	if (err >= 0) {
 		/* link does exist */
 		rtnl_link_put(rlink);
 		rlink = NULL;
@@ -127,8 +115,6 @@ int vlan_add(const char *if_name, int vid, const char *vlan_if_name)
 vlan_add_error:
 	if (rlink)
 		rtnl_link_put(rlink);
-	if (cache)
-		nl_cache_free(cache);
 	if (handle)
 		nl_socket_free(handle);
 	return ret;
@@ -139,7 +125,6 @@ int vlan_rem(const char *if_name)
 {
 	int err, ret = -1;
 	struct nl_sock *handle = NULL;
-	struct nl_cache *cache = NULL;
 	struct rtnl_link *rlink = NULL;
 
 	wpa_printf(MSG_DEBUG, "VLAN: vlan_rem(if_name=%s)", if_name);
@@ -157,15 +142,8 @@ int vlan_rem(const char *if_name)
 		goto vlan_rem_error;
 	}
 
-	err = rtnl_link_alloc_cache(handle, AF_UNSPEC, &cache);
+	err = rtnl_link_get_kernel(handle, 0, if_name, &rlink);
 	if (err < 0) {
-		cache = NULL;
-		wpa_printf(MSG_ERROR, "VLAN: failed to alloc cache: %s",
-			   nl_geterror(err));
-		goto vlan_rem_error;
-	}
-
-	if (!(rlink = rtnl_link_get_by_name(cache, if_name))) {
 		/* link does not exist */
 		wpa_printf(MSG_ERROR, "VLAN: interface %s does not exists",
 			   if_name);
@@ -184,9 +162,13 @@ int vlan_rem(const char *if_name)
 vlan_rem_error:
 	if (rlink)
 		rtnl_link_put(rlink);
-	if (cache)
-		nl_cache_free(cache);
 	if (handle)
 		nl_socket_free(handle);
 	return ret;
 }
+
+
+int vlan_set_name_type(unsigned int name_type)
+{
+	return 0;
+}
diff --git a/src/ap/vlan_util.h b/src/ap/vlan_util.h
index bef5a16f6c909..244685975c0be 100644
--- a/src/ap/vlan_util.h
+++ b/src/ap/vlan_util.h
@@ -1,5 +1,5 @@
 /*
- * hostapd / VLAN netlink api
+ * hostapd / VLAN netlink/ioctl api
  * Copyright (c) 2012, Michael Braun <michael-dev@fami-braun.de>
  *
  * This software may be distributed under the terms of the BSD license.
@@ -9,7 +9,23 @@
 #ifndef VLAN_UTIL_H
 #define VLAN_UTIL_H
 
+struct hostapd_data;
+struct hostapd_vlan;
+struct full_dynamic_vlan;
+
 int vlan_add(const char *if_name, int vid, const char *vlan_if_name);
 int vlan_rem(const char *if_name);
+int vlan_set_name_type(unsigned int name_type);
+
+int ifconfig_helper(const char *if_name, int up);
+int ifconfig_up(const char *if_name);
+int iface_exists(const char *ifname);
+int vlan_if_remove(struct hostapd_data *hapd, struct hostapd_vlan *vlan);
+
+struct full_dynamic_vlan *
+full_dynamic_vlan_init(struct hostapd_data *hapd);
+void full_dynamic_vlan_deinit(struct full_dynamic_vlan *priv);
+void vlan_newlink(const char *ifname, struct hostapd_data *hapd);
+void vlan_dellink(const char *ifname, struct hostapd_data *hapd);
 
 #endif /* VLAN_UTIL_H */
diff --git a/src/ap/wnm_ap.c b/src/ap/wnm_ap.c
index 4c8bc10083c4e..41d50cebfbe0a 100644
--- a/src/ap/wnm_ap.c
+++ b/src/ap/wnm_ap.c
@@ -17,6 +17,7 @@
 #include "ap/ap_config.h"
 #include "ap/ap_drv_ops.h"
 #include "ap/wpa_auth.h"
+#include "mbo_ap.h"
 #include "wnm_ap.h"
 
 #define MAX_TFS_IE_LEN  1024
@@ -94,6 +95,7 @@ static int ieee802_11_send_wnmsleep_resp(struct hostapd_data *hapd,
 	if (mgmt == NULL) {
 		wpa_printf(MSG_DEBUG, "MLME: Failed to allocate buffer for "
 			   "WNM-Sleep Response action frame");
+		os_free(wnmtfs_ie);
 		return -1;
 	}
 	os_memcpy(mgmt->da, addr, ETH_ALEN);
@@ -376,6 +378,29 @@ static void ieee802_11_rx_bss_trans_mgmt_resp(struct hostapd_data *hapd,
 }
 
 
+static void ieee802_11_rx_wnm_notification_req(struct hostapd_data *hapd,
+					       const u8 *addr, const u8 *buf,
+					       size_t len)
+{
+	u8 dialog_token, type;
+
+	if (len < 2)
+		return;
+	dialog_token = *buf++;
+	type = *buf++;
+	len -= 2;
+
+	wpa_printf(MSG_DEBUG,
+		   "WNM: Received WNM Notification Request frame from "
+		   MACSTR " (dialog_token=%u type=%u)",
+		   MAC2STR(addr), dialog_token, type);
+	wpa_hexdump(MSG_MSGDUMP, "WNM: Notification Request subelements",
+		    buf, len);
+	if (type == WLAN_EID_VENDOR_SPECIFIC)
+		mbo_ap_wnm_notification_req(hapd, addr, buf, len);
+}
+
+
 int ieee802_11_rx_wnm_action_ap(struct hostapd_data *hapd,
 				const struct ieee80211_mgmt *mgmt, size_t len)
 {
@@ -402,6 +427,10 @@ int ieee802_11_rx_wnm_action_ap(struct hostapd_data *hapd,
 	case WNM_SLEEP_MODE_REQ:
 		ieee802_11_rx_wnmsleep_req(hapd, mgmt->sa, payload, plen);
 		return 0;
+	case WNM_NOTIFICATION_REQ:
+		ieee802_11_rx_wnm_notification_req(hapd, mgmt->sa, payload,
+						   plen);
+		return 0;
 	}
 
 	wpa_printf(MSG_DEBUG, "WNM: Unsupported WNM Action %u from " MACSTR,
@@ -527,7 +556,8 @@ int wnm_send_ess_disassoc_imminent(struct hostapd_data *hapd,
 int wnm_send_bss_tm_req(struct hostapd_data *hapd, struct sta_info *sta,
 			u8 req_mode, int disassoc_timer, u8 valid_int,
 			const u8 *bss_term_dur, const char *url,
-			const u8 *nei_rep, size_t nei_rep_len)
+			const u8 *nei_rep, size_t nei_rep_len,
+			const u8 *mbo_attrs, size_t mbo_len)
 {
 	u8 *buf, *pos;
 	struct ieee80211_mgmt *mgmt;
@@ -536,7 +566,7 @@ int wnm_send_bss_tm_req(struct hostapd_data *hapd, struct sta_info *sta,
 	wpa_printf(MSG_DEBUG, "WNM: Send BSS Transition Management Request to "
 		   MACSTR " req_mode=0x%x disassoc_timer=%d valid_int=0x%x",
 		   MAC2STR(sta->addr), req_mode, disassoc_timer, valid_int);
-	buf = os_zalloc(1000 + nei_rep_len);
+	buf = os_zalloc(1000 + nei_rep_len + mbo_len);
 	if (buf == NULL)
 		return -1;
 	mgmt = (struct ieee80211_mgmt *) buf;
@@ -579,6 +609,11 @@ int wnm_send_bss_tm_req(struct hostapd_data *hapd, struct sta_info *sta,
 		pos += nei_rep_len;
 	}
 
+	if (mbo_len > 0) {
+		pos += mbo_add_ie(pos, buf + sizeof(buf) - pos, mbo_attrs,
+				  mbo_len);
+	}
+
 	if (hostapd_drv_send_mlme(hapd, buf, pos - buf, 0) < 0) {
 		wpa_printf(MSG_DEBUG,
 			   "Failed to send BSS Transition Management Request frame");
diff --git a/src/ap/wnm_ap.h b/src/ap/wnm_ap.h
index 7789307209c99..a44eadb85e555 100644
--- a/src/ap/wnm_ap.h
+++ b/src/ap/wnm_ap.h
@@ -21,6 +21,7 @@ int wnm_send_ess_disassoc_imminent(struct hostapd_data *hapd,
 int wnm_send_bss_tm_req(struct hostapd_data *hapd, struct sta_info *sta,
 			u8 req_mode, int disassoc_timer, u8 valid_int,
 			const u8 *bss_term_dur, const char *url,
-			const u8 *nei_rep, size_t nei_rep_len);
+			const u8 *nei_rep, size_t nei_rep_len,
+			const u8 *mbo_attrs, size_t mbo_len);
 
 #endif /* WNM_AP_H */
diff --git a/src/ap/wpa_auth.c b/src/ap/wpa_auth.c
index 2760a3f3a00e5..358708648977e 100644
--- a/src/ap/wpa_auth.c
+++ b/src/ap/wpa_auth.c
@@ -44,7 +44,8 @@ static int wpa_gtk_update(struct wpa_authenticator *wpa_auth,
 static int wpa_group_config_group_keys(struct wpa_authenticator *wpa_auth,
 				       struct wpa_group *group);
 static int wpa_derive_ptk(struct wpa_state_machine *sm, const u8 *snonce,
-			  const u8 *pmk, struct wpa_ptk *ptk);
+			  const u8 *pmk, unsigned int pmk_len,
+			  struct wpa_ptk *ptk);
 static void wpa_group_free(struct wpa_authenticator *wpa_auth,
 			   struct wpa_group *group);
 static void wpa_group_get(struct wpa_authenticator *wpa_auth,
@@ -827,6 +828,7 @@ static int wpa_try_alt_snonce(struct wpa_state_machine *sm, u8 *data,
 	struct wpa_ptk PTK;
 	int ok = 0;
 	const u8 *pmk = NULL;
+	unsigned int pmk_len;
 
 	for (;;) {
 		if (wpa_key_mgmt_wpa_psk(sm->wpa_key_mgmt)) {
@@ -834,10 +836,13 @@ static int wpa_try_alt_snonce(struct wpa_state_machine *sm, u8 *data,
 					       sm->p2p_dev_addr, pmk);
 			if (pmk == NULL)
 				break;
-		} else
+			pmk_len = PMK_LEN;
+		} else {
 			pmk = sm->PMK;
+			pmk_len = sm->pmk_len;
+		}
 
-		wpa_derive_ptk(sm, sm->alt_SNonce, pmk, &PTK);
+		wpa_derive_ptk(sm, sm->alt_SNonce, pmk, pmk_len, &PTK);
 
 		if (wpa_verify_key_mic(sm->wpa_key_mgmt, &PTK, data, data_len)
 		    == 0) {
@@ -1904,11 +1909,27 @@ SM_STATE(WPA_PTK, INITPMK)
 #endif /* CONFIG_IEEE80211R */
 	if (sm->pmksa) {
 		wpa_printf(MSG_DEBUG, "WPA: PMK from PMKSA cache");
-		os_memcpy(sm->PMK, sm->pmksa->pmk, PMK_LEN);
+		os_memcpy(sm->PMK, sm->pmksa->pmk, sm->pmksa->pmk_len);
+		sm->pmk_len = sm->pmksa->pmk_len;
 	} else if (wpa_auth_get_msk(sm->wpa_auth, sm->addr, msk, &len) == 0) {
+		unsigned int pmk_len;
+
+		if (sm->wpa_key_mgmt & WPA_KEY_MGMT_IEEE8021X_SUITE_B_192)
+			pmk_len = PMK_LEN_SUITE_B_192;
+		else
+			pmk_len = PMK_LEN;
 		wpa_printf(MSG_DEBUG, "WPA: PMK from EAPOL state machine "
-			   "(len=%lu)", (unsigned long) len);
-		os_memcpy(sm->PMK, msk, PMK_LEN);
+			   "(MSK len=%lu PMK len=%u)", (unsigned long) len,
+			   pmk_len);
+		if (len < pmk_len) {
+			wpa_printf(MSG_DEBUG,
+				   "WPA: MSK not long enough (%u) to create PMK (%u)",
+				   (unsigned int) len, (unsigned int) pmk_len);
+			sm->Disconnect = TRUE;
+			return;
+		}
+		os_memcpy(sm->PMK, msk, pmk_len);
+		sm->pmk_len = pmk_len;
 #ifdef CONFIG_IEEE80211R
 		if (len >= 2 * PMK_LEN) {
 			os_memcpy(sm->xxkey, msk + PMK_LEN, PMK_LEN);
@@ -1943,6 +1964,7 @@ SM_STATE(WPA_PTK, INITPSK)
 	psk = wpa_auth_get_psk(sm->wpa_auth, sm->addr, sm->p2p_dev_addr, NULL);
 	if (psk) {
 		os_memcpy(sm->PMK, psk, PMK_LEN);
+		sm->pmk_len = PMK_LEN;
 #ifdef CONFIG_IEEE80211R
 		os_memcpy(sm->xxkey, psk, PMK_LEN);
 		sm->xxkey_len = PMK_LEN;
@@ -1994,7 +2016,7 @@ SM_STATE(WPA_PTK, PTKSTART)
 			 * Calculate PMKID since no PMKSA cache entry was
 			 * available with pre-calculated PMKID.
 			 */
-			rsn_pmkid(sm->PMK, PMK_LEN, sm->wpa_auth->addr,
+			rsn_pmkid(sm->PMK, sm->pmk_len, sm->wpa_auth->addr,
 				  sm->addr, &pmkid[2 + RSN_SELECTOR_LEN],
 				  wpa_key_mgmt_sha256(sm->wpa_key_mgmt));
 		}
@@ -2006,14 +2028,15 @@ SM_STATE(WPA_PTK, PTKSTART)
 
 
 static int wpa_derive_ptk(struct wpa_state_machine *sm, const u8 *snonce,
-			  const u8 *pmk, struct wpa_ptk *ptk)
+			  const u8 *pmk, unsigned int pmk_len,
+			  struct wpa_ptk *ptk)
 {
 #ifdef CONFIG_IEEE80211R
 	if (wpa_key_mgmt_ft(sm->wpa_key_mgmt))
 		return wpa_auth_derive_ptk_ft(sm, pmk, ptk);
 #endif /* CONFIG_IEEE80211R */
 
-	return wpa_pmk_to_ptk(pmk, PMK_LEN, "Pairwise key expansion",
+	return wpa_pmk_to_ptk(pmk, pmk_len, "Pairwise key expansion",
 			      sm->wpa_auth->addr, sm->addr, sm->ANonce, snonce,
 			      ptk, sm->wpa_key_mgmt, sm->pairwise);
 }
@@ -2024,6 +2047,7 @@ SM_STATE(WPA_PTK, PTKCALCNEGOTIATING)
 	struct wpa_ptk PTK;
 	int ok = 0, psk_found = 0;
 	const u8 *pmk = NULL;
+	unsigned int pmk_len;
 
 	SM_ENTRY_MA(WPA_PTK, PTKCALCNEGOTIATING, wpa_ptk);
 	sm->EAPOLKeyReceived = FALSE;
@@ -2039,10 +2063,13 @@ SM_STATE(WPA_PTK, PTKCALCNEGOTIATING)
 			if (pmk == NULL)
 				break;
 			psk_found = 1;
-		} else
+			pmk_len = PMK_LEN;
+		} else {
 			pmk = sm->PMK;
+			pmk_len = sm->pmk_len;
+		}
 
-		wpa_derive_ptk(sm, sm->SNonce, pmk, &PTK);
+		wpa_derive_ptk(sm, sm->SNonce, pmk, pmk_len, &PTK);
 
 		if (wpa_verify_key_mic(sm->wpa_key_mgmt, &PTK,
 				       sm->last_rx_eapol_key,
@@ -2092,6 +2119,7 @@ SM_STATE(WPA_PTK, PTKCALCNEGOTIATING)
 		 * state machine data based on whatever PSK was selected here.
 		 */
 		os_memcpy(sm->PMK, pmk, PMK_LEN);
+		sm->pmk_len = PMK_LEN;
 	}
 
 	sm->MICVerified = TRUE;
@@ -2270,14 +2298,19 @@ SM_STATE(WPA_PTK, PTKINITNEGOTIATING)
 	pos += wpa_ie_len;
 #ifdef CONFIG_IEEE80211R
 	if (wpa_key_mgmt_ft(sm->wpa_key_mgmt)) {
-		int res = wpa_insert_pmkid(kde, pos - kde, sm->pmk_r1_name);
+		int res;
+		size_t elen;
+
+		elen = pos - kde;
+		res = wpa_insert_pmkid(kde, &elen, sm->pmk_r1_name);
 		if (res < 0) {
 			wpa_printf(MSG_ERROR, "FT: Failed to insert "
 				   "PMKR1Name into RSN IE in EAPOL-Key data");
 			os_free(kde);
 			return;
 		}
-		pos += res;
+		pos -= wpa_ie_len;
+		pos += elen;
 	}
 #endif /* CONFIG_IEEE80211R */
 	if (gtk) {
@@ -2295,10 +2328,18 @@ SM_STATE(WPA_PTK, PTKINITNEGOTIATING)
 		struct wpa_auth_config *conf;
 
 		conf = &sm->wpa_auth->conf;
-		res = wpa_write_ftie(conf, conf->r0_key_holder,
-				     conf->r0_key_holder_len,
-				     NULL, NULL, pos, kde + kde_len - pos,
-				     NULL, 0);
+		if (sm->assoc_resp_ftie &&
+		    kde + kde_len - pos >= 2 + sm->assoc_resp_ftie[1]) {
+			os_memcpy(pos, sm->assoc_resp_ftie,
+				  2 + sm->assoc_resp_ftie[1]);
+			res = 2 + sm->assoc_resp_ftie[1];
+		} else {
+			res = wpa_write_ftie(conf, conf->r0_key_holder,
+					     conf->r0_key_holder_len,
+					     NULL, NULL, pos,
+					     kde + kde_len - pos,
+					     NULL, 0);
+		}
 		if (res < 0) {
 			wpa_printf(MSG_ERROR, "FT: Failed to insert FTIE "
 				   "into EAPOL-Key Key Data");
@@ -3243,13 +3284,21 @@ const u8 * wpa_auth_get_wpa_ie(struct wpa_authenticator *wpa_auth, size_t *len)
 
 
 int wpa_auth_pmksa_add(struct wpa_state_machine *sm, const u8 *pmk,
+		       unsigned int pmk_len,
 		       int session_timeout, struct eapol_state_machine *eapol)
 {
 	if (sm == NULL || sm->wpa != WPA_VERSION_WPA2 ||
 	    sm->wpa_auth->conf.disable_pmksa_caching)
 		return -1;
 
-	if (pmksa_cache_auth_add(sm->wpa_auth->pmksa, pmk, PMK_LEN,
+	if (sm->wpa_key_mgmt & WPA_KEY_MGMT_IEEE8021X_SUITE_B_192) {
+		if (pmk_len > PMK_LEN_SUITE_B_192)
+			pmk_len = PMK_LEN_SUITE_B_192;
+	} else if (pmk_len > PMK_LEN) {
+		pmk_len = PMK_LEN;
+	}
+
+	if (pmksa_cache_auth_add(sm->wpa_auth->pmksa, pmk, pmk_len, NULL,
 				 sm->PTK.kck, sm->PTK.kck_len,
 				 sm->wpa_auth->addr, sm->addr, session_timeout,
 				 eapol, sm->wpa_key_mgmt))
@@ -3267,7 +3316,7 @@ int wpa_auth_pmksa_add_preauth(struct wpa_authenticator *wpa_auth,
 	if (wpa_auth == NULL)
 		return -1;
 
-	if (pmksa_cache_auth_add(wpa_auth->pmksa, pmk, len,
+	if (pmksa_cache_auth_add(wpa_auth->pmksa, pmk, len, NULL,
 				 NULL, 0,
 				 wpa_auth->addr,
 				 sta_addr, session_timeout, eapol,
@@ -3279,12 +3328,12 @@ int wpa_auth_pmksa_add_preauth(struct wpa_authenticator *wpa_auth,
 
 
 int wpa_auth_pmksa_add_sae(struct wpa_authenticator *wpa_auth, const u8 *addr,
-			   const u8 *pmk)
+			   const u8 *pmk, const u8 *pmkid)
 {
 	if (wpa_auth->conf.disable_pmksa_caching)
 		return -1;
 
-	if (pmksa_cache_auth_add(wpa_auth->pmksa, pmk, PMK_LEN,
+	if (pmksa_cache_auth_add(wpa_auth->pmksa, pmk, PMK_LEN, pmkid,
 				 NULL, 0,
 				 wpa_auth->addr, addr, 0, NULL,
 				 WPA_KEY_MGMT_SAE))
@@ -3310,6 +3359,46 @@ void wpa_auth_pmksa_remove(struct wpa_authenticator *wpa_auth,
 }
 
 
+int wpa_auth_pmksa_list(struct wpa_authenticator *wpa_auth, char *buf,
+			size_t len)
+{
+	if (!wpa_auth || !wpa_auth->pmksa)
+		return 0;
+	return pmksa_cache_auth_list(wpa_auth->pmksa, buf, len);
+}
+
+
+void wpa_auth_pmksa_flush(struct wpa_authenticator *wpa_auth)
+{
+	if (wpa_auth && wpa_auth->pmksa)
+		pmksa_cache_auth_flush(wpa_auth->pmksa);
+}
+
+
+struct rsn_pmksa_cache_entry *
+wpa_auth_pmksa_get(struct wpa_authenticator *wpa_auth, const u8 *sta_addr)
+{
+	if (!wpa_auth || !wpa_auth->pmksa)
+		return NULL;
+	return pmksa_cache_auth_get(wpa_auth->pmksa, sta_addr, NULL);
+}
+
+
+void wpa_auth_pmksa_set_to_sm(struct rsn_pmksa_cache_entry *pmksa,
+			      struct wpa_state_machine *sm,
+			      struct wpa_authenticator *wpa_auth,
+			      u8 *pmkid, u8 *pmk)
+{
+	if (!sm)
+		return;
+
+	sm->pmksa = pmksa;
+	os_memcpy(pmk, pmksa->pmk, PMK_LEN);
+	os_memcpy(pmkid, pmksa->pmkid, PMKID_LEN);
+	os_memcpy(wpa_auth->dot11RSNAPMKIDUsed, pmksa->pmkid, PMKID_LEN);
+}
+
+
 /*
  * Remove and free the group from wpa_authenticator. This is triggered by a
  * callback to make sure nobody is currently iterating the group list while it
@@ -3388,6 +3477,98 @@ wpa_auth_add_group(struct wpa_authenticator *wpa_auth, int vlan_id)
 }
 
 
+/*
+ * Enforce that the group state machine for the VLAN is running, increase
+ * reference counter as interface is up. References might have been increased
+ * even if a negative value is returned.
+ * Returns: -1 on error (group missing, group already failed); otherwise, 0
+ */
+int wpa_auth_ensure_group(struct wpa_authenticator *wpa_auth, int vlan_id)
+{
+	struct wpa_group *group;
+
+	if (wpa_auth == NULL)
+		return 0;
+
+	group = wpa_auth->group;
+	while (group) {
+		if (group->vlan_id == vlan_id)
+			break;
+		group = group->next;
+	}
+
+	if (group == NULL) {
+		group = wpa_auth_add_group(wpa_auth, vlan_id);
+		if (group == NULL)
+			return -1;
+	}
+
+	wpa_printf(MSG_DEBUG,
+		   "WPA: Ensure group state machine running for VLAN ID %d",
+		   vlan_id);
+
+	wpa_group_get(wpa_auth, group);
+	group->num_setup_iface++;
+
+	if (group->wpa_group_state == WPA_GROUP_FATAL_FAILURE)
+		return -1;
+
+	return 0;
+}
+
+
+/*
+ * Decrease reference counter, expected to be zero afterwards.
+ * returns: -1 on error (group not found, group in fail state)
+ *          -2 if wpa_group is still referenced
+ *           0 else
+ */
+int wpa_auth_release_group(struct wpa_authenticator *wpa_auth, int vlan_id)
+{
+	struct wpa_group *group;
+	int ret = 0;
+
+	if (wpa_auth == NULL)
+		return 0;
+
+	group = wpa_auth->group;
+	while (group) {
+		if (group->vlan_id == vlan_id)
+			break;
+		group = group->next;
+	}
+
+	if (group == NULL)
+		return -1;
+
+	wpa_printf(MSG_DEBUG,
+		   "WPA: Try stopping group state machine for VLAN ID %d",
+		   vlan_id);
+
+	if (group->num_setup_iface <= 0) {
+		wpa_printf(MSG_ERROR,
+			   "WPA: wpa_auth_release_group called more often than wpa_auth_ensure_group for VLAN ID %d, skipping.",
+			   vlan_id);
+		return -1;
+	}
+	group->num_setup_iface--;
+
+	if (group->wpa_group_state == WPA_GROUP_FATAL_FAILURE)
+		ret = -1;
+
+	if (group->references > 1) {
+		wpa_printf(MSG_DEBUG,
+			   "WPA: Cannot stop group state machine for VLAN ID %d as references are still hold",
+			   vlan_id);
+		ret = -2;
+	}
+
+	wpa_group_put(wpa_auth, group);
+
+	return ret;
+}
+
+
 int wpa_auth_sta_set_vlan(struct wpa_state_machine *sm, int vlan_id)
 {
 	struct wpa_group *group;
diff --git a/src/ap/wpa_auth.h b/src/ap/wpa_auth.h
index fd04f169433af..0de8d976e3f92 100644
--- a/src/ap/wpa_auth.h
+++ b/src/ap/wpa_auth.h
@@ -42,10 +42,11 @@ struct ft_rrb_frame {
 #define FT_PACKET_R0KH_R1KH_RESP 201
 #define FT_PACKET_R0KH_R1KH_PUSH 202
 
-#define FT_R0KH_R1KH_PULL_DATA_LEN 44
-#define FT_R0KH_R1KH_RESP_DATA_LEN 76
-#define FT_R0KH_R1KH_PUSH_DATA_LEN 88
 #define FT_R0KH_R1KH_PULL_NONCE_LEN 16
+#define FT_R0KH_R1KH_PULL_DATA_LEN (FT_R0KH_R1KH_PULL_NONCE_LEN + \
+				    WPA_PMK_NAME_LEN + FT_R1KH_ID_LEN + \
+				    ETH_ALEN)
+#define FT_R0KH_R1KH_PULL_PAD_LEN ((8 - FT_R0KH_R1KH_PULL_DATA_LEN % 8) % 8)
 
 struct ft_r0kh_r1kh_pull_frame {
 	u8 frame_type; /* RSN_REMOTE_FRAME_TYPE_FT_RRB */
@@ -57,14 +58,18 @@ struct ft_r0kh_r1kh_pull_frame {
 	u8 pmk_r0_name[WPA_PMK_NAME_LEN];
 	u8 r1kh_id[FT_R1KH_ID_LEN];
 	u8 s1kh_id[ETH_ALEN];
-	u8 pad[4]; /* 8-octet boundary for AES key wrap */
+	u8 pad[FT_R0KH_R1KH_PULL_PAD_LEN]; /* 8-octet boundary for AES block */
 	u8 key_wrap_extra[8];
 } STRUCT_PACKED;
 
+#define FT_R0KH_R1KH_RESP_DATA_LEN (FT_R0KH_R1KH_PULL_NONCE_LEN + \
+				    FT_R1KH_ID_LEN + ETH_ALEN + PMK_LEN + \
+				    WPA_PMK_NAME_LEN + 2)
+#define FT_R0KH_R1KH_RESP_PAD_LEN ((8 - FT_R0KH_R1KH_RESP_DATA_LEN % 8) % 8)
 struct ft_r0kh_r1kh_resp_frame {
 	u8 frame_type; /* RSN_REMOTE_FRAME_TYPE_FT_RRB */
 	u8 packet_type; /* FT_PACKET_R0KH_R1KH_RESP */
-	le16 data_length; /* little endian length of data (76) */
+	le16 data_length; /* little endian length of data (78) */
 	u8 ap_address[ETH_ALEN];
 
 	u8 nonce[FT_R0KH_R1KH_PULL_NONCE_LEN]; /* copied from pull */
@@ -73,14 +78,18 @@ struct ft_r0kh_r1kh_resp_frame {
 	u8 pmk_r1[PMK_LEN];
 	u8 pmk_r1_name[WPA_PMK_NAME_LEN];
 	le16 pairwise;
-	u8 pad[2]; /* 8-octet boundary for AES key wrap */
+	u8 pad[FT_R0KH_R1KH_RESP_PAD_LEN]; /* 8-octet boundary for AES block */
 	u8 key_wrap_extra[8];
 } STRUCT_PACKED;
 
+#define FT_R0KH_R1KH_PUSH_DATA_LEN (4 + FT_R1KH_ID_LEN + ETH_ALEN + \
+				    WPA_PMK_NAME_LEN + PMK_LEN + \
+				    WPA_PMK_NAME_LEN + 2)
+#define FT_R0KH_R1KH_PUSH_PAD_LEN ((8 - FT_R0KH_R1KH_PUSH_DATA_LEN % 8) % 8)
 struct ft_r0kh_r1kh_push_frame {
 	u8 frame_type; /* RSN_REMOTE_FRAME_TYPE_FT_RRB */
 	u8 packet_type; /* FT_PACKET_R0KH_R1KH_PUSH */
-	le16 data_length; /* little endian length of data (88) */
+	le16 data_length; /* little endian length of data (82) */
 	u8 ap_address[ETH_ALEN];
 
 	/* Encrypted with AES key-wrap */
@@ -92,7 +101,7 @@ struct ft_r0kh_r1kh_push_frame {
 	u8 pmk_r1[PMK_LEN];
 	u8 pmk_r1_name[WPA_PMK_NAME_LEN];
 	le16 pairwise;
-	u8 pad[6]; /* 8-octet boundary for AES key wrap */
+	u8 pad[FT_R0KH_R1KH_PUSH_PAD_LEN]; /* 8-octet boundary for AES block */
 	u8 key_wrap_extra[8];
 } STRUCT_PACKED;
 
@@ -279,15 +288,25 @@ void wpa_auth_sta_local_mic_failure_report(struct wpa_state_machine *sm);
 const u8 * wpa_auth_get_wpa_ie(struct wpa_authenticator *wpa_auth,
 			       size_t *len);
 int wpa_auth_pmksa_add(struct wpa_state_machine *sm, const u8 *pmk,
+		       unsigned int pmk_len,
 		       int session_timeout, struct eapol_state_machine *eapol);
 int wpa_auth_pmksa_add_preauth(struct wpa_authenticator *wpa_auth,
 			       const u8 *pmk, size_t len, const u8 *sta_addr,
 			       int session_timeout,
 			       struct eapol_state_machine *eapol);
 int wpa_auth_pmksa_add_sae(struct wpa_authenticator *wpa_auth, const u8 *addr,
-			   const u8 *pmk);
+			   const u8 *pmk, const u8 *pmkid);
 void wpa_auth_pmksa_remove(struct wpa_authenticator *wpa_auth,
 			   const u8 *sta_addr);
+int wpa_auth_pmksa_list(struct wpa_authenticator *wpa_auth, char *buf,
+			size_t len);
+void wpa_auth_pmksa_flush(struct wpa_authenticator *wpa_auth);
+struct rsn_pmksa_cache_entry *
+wpa_auth_pmksa_get(struct wpa_authenticator *wpa_auth, const u8 *sta_addr);
+void wpa_auth_pmksa_set_to_sm(struct rsn_pmksa_cache_entry *pmksa,
+			      struct wpa_state_machine *sm,
+			      struct wpa_authenticator *wpa_auth,
+			      u8 *pmkid, u8 *pmk);
 int wpa_auth_sta_set_vlan(struct wpa_state_machine *sm, int vlan_id);
 void wpa_auth_eapol_key_tx_status(struct wpa_authenticator *wpa_auth,
 				  struct wpa_state_machine *sm, int ack);
@@ -325,4 +344,7 @@ int wpa_auth_radius_das_disconnect_pmksa(struct wpa_authenticator *wpa_auth,
 					 struct radius_das_attrs *attr);
 void wpa_auth_reconfig_group_keys(struct wpa_authenticator *wpa_auth);
 
+int wpa_auth_ensure_group(struct wpa_authenticator *wpa_auth, int vlan_id);
+int wpa_auth_release_group(struct wpa_authenticator *wpa_auth, int vlan_id);
+
 #endif /* WPA_AUTH_H */
diff --git a/src/ap/wpa_auth_ft.c b/src/ap/wpa_auth_ft.c
index eeaffbf635166..42242a54a2cbf 100644
--- a/src/ap/wpa_auth_ft.c
+++ b/src/ap/wpa_auth_ft.c
@@ -720,11 +720,6 @@ u8 * wpa_sm_write_assoc_resp_ies(struct wpa_state_machine *sm, u8 *pos,
 	ftie_len = res;
 	pos += res;
 
-	os_free(sm->assoc_resp_ftie);
-	sm->assoc_resp_ftie = os_malloc(ftie_len);
-	if (sm->assoc_resp_ftie)
-		os_memcpy(sm->assoc_resp_ftie, ftie, ftie_len);
-
 	_ftie = (struct rsn_ftie *) (ftie + 2);
 	if (auth_alg == WLAN_AUTH_FT)
 		_ftie->mic_control[1] = 3; /* Information element count */
@@ -750,6 +745,11 @@ u8 * wpa_sm_write_assoc_resp_ies(struct wpa_state_machine *sm, u8 *pos,
 		       _ftie->mic) < 0)
 		wpa_printf(MSG_DEBUG, "FT: Failed to calculate MIC");
 
+	os_free(sm->assoc_resp_ftie);
+	sm->assoc_resp_ftie = os_malloc(ftie_len);
+	if (sm->assoc_resp_ftie)
+		os_memcpy(sm->assoc_resp_ftie, ftie, ftie_len);
+
 	return pos;
 }
 
diff --git a/src/ap/wpa_auth_glue.c b/src/ap/wpa_auth_glue.c
index f98cc50599e37..21424147e443e 100644
--- a/src/ap/wpa_auth_glue.c
+++ b/src/ap/wpa_auth_glue.c
@@ -12,6 +12,7 @@
 #include "common/ieee802_11_defs.h"
 #include "common/sae.h"
 #include "common/wpa_ctrl.h"
+#include "crypto/sha1.h"
 #include "eapol_auth/eapol_auth_sm.h"
 #include "eapol_auth/eapol_auth_sm_i.h"
 #include "eap_server/eap.h"
@@ -246,6 +247,13 @@ static const u8 * hostapd_wpa_auth_get_psk(void *ctx, const u8 *addr,
 		struct hostapd_sta_wpa_psk_short *pos;
 		psk = sta->psk->psk;
 		for (pos = sta->psk; pos; pos = pos->next) {
+			if (pos->is_passphrase) {
+				pbkdf2_sha1(pos->passphrase,
+					    hapd->conf->ssid.ssid,
+					    hapd->conf->ssid.ssid_len, 4096,
+					    pos->psk, PMK_LEN);
+				pos->is_passphrase = 0;
+			}
 			if (pos->psk == prev_psk) {
 				psk = pos->next ? pos->next->psk : NULL;
 				break;
@@ -413,6 +421,8 @@ static int hostapd_wpa_auth_ft_iter(struct hostapd_iface *iface, void *ctx)
 		hapd = iface->bss[j];
 		if (hapd == idata->src_hapd)
 			continue;
+		if (!hapd->wpa_auth)
+			continue;
 		if (os_memcmp(hapd->own_addr, idata->dst, ETH_ALEN) == 0) {
 			wpa_printf(MSG_DEBUG, "FT: Send RRB data directly to "
 				   "locally managed BSS " MACSTR "@%s -> "
@@ -563,6 +573,9 @@ static void hostapd_rrb_receive(void *ctx, const u8 *src_addr, const u8 *buf,
 	ethhdr = (struct l2_ethhdr *) buf;
 	wpa_printf(MSG_DEBUG, "FT: RRB received packet " MACSTR " -> "
 		   MACSTR, MAC2STR(ethhdr->h_source), MAC2STR(ethhdr->h_dest));
+	if (!is_multicast_ether_addr(ethhdr->h_dest) &&
+	    os_memcmp(hapd->own_addr, ethhdr->h_dest, ETH_ALEN) != 0)
+		return;
 	wpa_ft_rrb_rx(hapd->wpa_auth, ethhdr->h_source, buf + sizeof(*ethhdr),
 		      len - sizeof(*ethhdr));
 }
@@ -637,7 +650,7 @@ int hostapd_setup_wpa(struct hostapd_data *hapd)
 	}
 
 #ifdef CONFIG_IEEE80211R
-	if (!hostapd_drv_none(hapd) && hapd->conf->ft_over_ds &&
+	if (!hostapd_drv_none(hapd) &&
 	    wpa_key_mgmt_ft(hapd->conf->wpa_key_mgmt)) {
 		hapd->l2 = l2_packet_init(hapd->conf->bridge[0] ?
 					  hapd->conf->bridge :
@@ -674,13 +687,14 @@ void hostapd_deinit_wpa(struct hostapd_data *hapd)
 		wpa_deinit(hapd->wpa_auth);
 		hapd->wpa_auth = NULL;
 
-		if (hostapd_set_privacy(hapd, 0)) {
+		if (hapd->drv_priv && hostapd_set_privacy(hapd, 0)) {
 			wpa_printf(MSG_DEBUG, "Could not disable "
 				   "PrivacyInvoked for interface %s",
 				   hapd->conf->iface);
 		}
 
-		if (hostapd_set_generic_elem(hapd, (u8 *) "", 0)) {
+		if (hapd->drv_priv &&
+		    hostapd_set_generic_elem(hapd, (u8 *) "", 0)) {
 			wpa_printf(MSG_DEBUG, "Could not remove generic "
 				   "information element from interface %s",
 				   hapd->conf->iface);
diff --git a/src/ap/wpa_auth_i.h b/src/ap/wpa_auth_i.h
index 57b098f2ed72a..72b7eb37a3a7a 100644
--- a/src/ap/wpa_auth_i.h
+++ b/src/ap/wpa_auth_i.h
@@ -60,7 +60,8 @@ struct wpa_state_machine {
 	u8 SNonce[WPA_NONCE_LEN];
 	u8 alt_SNonce[WPA_NONCE_LEN];
 	u8 alt_replay_counter[WPA_REPLAY_COUNTER_LEN];
-	u8 PMK[PMK_LEN];
+	u8 PMK[PMK_LEN_MAX];
+	unsigned int pmk_len;
 	struct wpa_ptk PTK;
 	Boolean PTK_valid;
 	Boolean pairwise_set;
@@ -171,6 +172,7 @@ struct wpa_group {
 #endif /* CONFIG_IEEE80211W */
 	/* Number of references except those in struct wpa_group->next */
 	unsigned int references;
+	unsigned int num_setup_iface;
 };
 
 
diff --git a/src/ap/wpa_auth_ie.c b/src/ap/wpa_auth_ie.c
index eafb828b8d60e..f79783b91929b 100644
--- a/src/ap/wpa_auth_ie.c
+++ b/src/ap/wpa_auth_ie.c
@@ -251,7 +251,7 @@ int wpa_write_rsn_ie(struct wpa_auth_config *conf, u8 *buf, size_t len,
 	pos += 2;
 
 	if (pmkid) {
-		if (pos + 2 + PMKID_LEN > buf + len)
+		if (2 + PMKID_LEN > buf + len - pos)
 			return -1;
 		/* PMKID Count */
 		WPA_PUT_LE16(pos, 1);
@@ -263,7 +263,7 @@ int wpa_write_rsn_ie(struct wpa_auth_config *conf, u8 *buf, size_t len,
 #ifdef CONFIG_IEEE80211W
 	if (conf->ieee80211w != NO_MGMT_FRAME_PROTECTION &&
 	    conf->group_mgmt_cipher != WPA_CIPHER_AES_128_CMAC) {
-		if (pos + 2 + 4 > buf + len)
+		if (2 + 4 > buf + len - pos)
 			return -1;
 		if (pmkid == NULL) {
 			/* PMKID Count */
@@ -712,11 +712,14 @@ int wpa_validate_wpa_ie(struct wpa_authenticator *wpa_auth,
 		}
 	}
 	if (sm->pmksa && pmkid) {
+		struct vlan_description *vlan;
+
+		vlan = sm->pmksa->vlan_desc;
 		wpa_auth_vlogger(wpa_auth, sm->addr, LOGGER_DEBUG,
-				 "PMKID found from PMKSA cache "
-				 "eap_type=%d vlan_id=%d",
+				 "PMKID found from PMKSA cache eap_type=%d vlan=%d%s",
 				 sm->pmksa->eap_type_authsrv,
-				 sm->pmksa->vlan_id);
+				 vlan ? vlan->untagged : 0,
+				 (vlan && vlan->tagged[0]) ? "+" : "");
 		os_memcpy(wpa_auth->dot11RSNAPMKIDUsed, pmkid, PMKID_LEN);
 	}
 
@@ -791,7 +794,7 @@ static int wpa_parse_generic(const u8 *pos, const u8 *end,
 		return 0;
 	}
 
-	if (pos + 1 + RSN_SELECTOR_LEN < end &&
+	if (1 + RSN_SELECTOR_LEN < end - pos &&
 	    pos[1] >= RSN_SELECTOR_LEN + PMKID_LEN &&
 	    RSN_SELECTOR_GET(pos + 2) == RSN_KEY_DATA_PMKID) {
 		ie->pmkid = pos + 2 + RSN_SELECTOR_LEN;
@@ -887,13 +890,13 @@ int wpa_parse_kde_ies(const u8 *buf, size_t len, struct wpa_eapol_ie_parse *ie)
 	int ret = 0;
 
 	os_memset(ie, 0, sizeof(*ie));
-	for (pos = buf, end = pos + len; pos + 1 < end; pos += 2 + pos[1]) {
+	for (pos = buf, end = pos + len; end - pos > 1; pos += 2 + pos[1]) {
 		if (pos[0] == 0xdd &&
 		    ((pos == buf + len - 1) || pos[1] == 0)) {
 			/* Ignore padding */
 			break;
 		}
-		if (pos + 2 + pos[1] > end) {
+		if (2 + pos[1] > end - pos) {
 			wpa_printf(MSG_DEBUG, "WPA: EAPOL-Key Key Data "
 				   "underflow (ie=%d len=%d pos=%d)",
 				   pos[0], pos[1], (int) (pos - buf));
diff --git a/src/ap/wps_hostapd.c b/src/ap/wps_hostapd.c
index cde31e60e03b7..95b40da0f6bb4 100644
--- a/src/ap/wps_hostapd.c
+++ b/src/ap/wps_hostapd.c
@@ -1,6 +1,6 @@
 /*
  * hostapd / WPS integration
- * Copyright (c) 2008-2012, Jouni Malinen <j@w1.fi>
+ * Copyright (c) 2008-2016, Jouni Malinen <j@w1.fi>
  *
  * This software may be distributed under the terms of the BSD license.
  * See README for more details.
@@ -269,12 +269,6 @@ static void hostapd_wps_enrollee_seen_cb(void *ctx, const u8 *addr,
 }
 
 
-static int str_starts(const char *str, const char *start)
-{
-	return os_strncmp(str, start, os_strlen(start)) == 0;
-}
-
-
 static void wps_reload_config(void *eloop_data, void *user_ctx)
 {
 	struct hostapd_iface *iface = eloop_data;
@@ -445,6 +439,8 @@ static int hapd_wps_cred_cb(struct hostapd_data *hapd, void *ctx)
 	os_memcpy(hapd->wps->ssid, cred->ssid, cred->ssid_len);
 	hapd->wps->ssid_len = cred->ssid_len;
 	hapd->wps->encr_types = cred->encr_type;
+	hapd->wps->encr_types_rsn = cred->encr_type;
+	hapd->wps->encr_types_wpa = cred->encr_type;
 	hapd->wps->auth_types = cred->auth_type;
 	hapd->wps->ap_encr_type = cred->encr_type;
 	hapd->wps->ap_auth_type = cred->auth_type;
@@ -872,7 +868,8 @@ static void hostapd_wps_clear_ies(struct hostapd_data *hapd, int deinit_only)
 	hapd->wps_probe_resp_ie = NULL;
 
 	if (deinit_only) {
-		hostapd_reset_ap_wps_ie(hapd);
+		if (hapd->drv_priv)
+			hostapd_reset_ap_wps_ie(hapd);
 		return;
 	}
 
@@ -1067,10 +1064,14 @@ int hostapd_init_wps(struct hostapd_data *hapd,
 		if (conf->wpa_key_mgmt & WPA_KEY_MGMT_IEEE8021X)
 			wps->auth_types |= WPS_AUTH_WPA2;
 
-		if (conf->rsn_pairwise & (WPA_CIPHER_CCMP | WPA_CIPHER_GCMP))
+		if (conf->rsn_pairwise & (WPA_CIPHER_CCMP | WPA_CIPHER_GCMP)) {
 			wps->encr_types |= WPS_ENCR_AES;
-		if (conf->rsn_pairwise & WPA_CIPHER_TKIP)
+			wps->encr_types_rsn |= WPS_ENCR_AES;
+		}
+		if (conf->rsn_pairwise & WPA_CIPHER_TKIP) {
 			wps->encr_types |= WPS_ENCR_TKIP;
+			wps->encr_types_rsn |= WPS_ENCR_TKIP;
+		}
 	}
 
 	if (conf->wpa & WPA_PROTO_WPA) {
@@ -1079,10 +1080,14 @@ int hostapd_init_wps(struct hostapd_data *hapd,
 		if (conf->wpa_key_mgmt & WPA_KEY_MGMT_IEEE8021X)
 			wps->auth_types |= WPS_AUTH_WPA;
 
-		if (conf->wpa_pairwise & WPA_CIPHER_CCMP)
+		if (conf->wpa_pairwise & WPA_CIPHER_CCMP) {
 			wps->encr_types |= WPS_ENCR_AES;
-		if (conf->wpa_pairwise & WPA_CIPHER_TKIP)
+			wps->encr_types_wpa |= WPS_ENCR_AES;
+		}
+		if (conf->wpa_pairwise & WPA_CIPHER_TKIP) {
 			wps->encr_types |= WPS_ENCR_TKIP;
+			wps->encr_types_wpa |= WPS_ENCR_TKIP;
+		}
 	}
 
 	if (conf->ssid.security_policy == SECURITY_PLAINTEXT) {
@@ -1122,6 +1127,8 @@ int hostapd_init_wps(struct hostapd_data *hapd,
 		/* Override parameters to enable security by default */
 		wps->auth_types = WPS_AUTH_WPA2PSK | WPS_AUTH_WPAPSK;
 		wps->encr_types = WPS_ENCR_AES | WPS_ENCR_TKIP;
+		wps->encr_types_rsn = WPS_ENCR_AES | WPS_ENCR_TKIP;
+		wps->encr_types_wpa = WPS_ENCR_AES | WPS_ENCR_TKIP;
 	}
 
 	wps->ap_settings = conf->ap_settings;
@@ -1614,7 +1621,8 @@ const char * hostapd_wps_ap_pin_random(struct hostapd_data *hapd, int timeout)
 	unsigned int pin;
 	struct wps_ap_pin_data data;
 
-	pin = wps_generate_pin();
+	if (wps_generate_pin(&pin) < 0)
+		return NULL;
 	os_snprintf(data.pin_txt, sizeof(data.pin_txt), "%08u", pin);
 	data.timeout = timeout;
 	hostapd_wps_for_each(hapd, wps_ap_pin_set, &data);
diff --git a/src/common/cli.c b/src/common/cli.c
new file mode 100644
index 0000000000000..b583d1cd575d9
--- /dev/null
+++ b/src/common/cli.c
@@ -0,0 +1,267 @@
+/*
+ * Common hostapd/wpa_supplicant command line interface functions
+ * Copyright (c) 2004-2016, Jouni Malinen <j@w1.fi>
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ */
+
+#include "includes.h"
+
+#include "utils/common.h"
+#include "common/cli.h"
+
+
+const char *const cli_license =
+"This software may be distributed under the terms of the BSD license.\n"
+"See README for more details.\n";
+
+const char *const cli_full_license =
+"This software may be distributed under the terms of the BSD license.\n"
+"\n"
+"Redistribution and use in source and binary forms, with or without\n"
+"modification, are permitted provided that the following conditions are\n"
+"met:\n"
+"\n"
+"1. Redistributions of source code must retain the above copyright\n"
+"   notice, this list of conditions and the following disclaimer.\n"
+"\n"
+"2. Redistributions in binary form must reproduce the above copyright\n"
+"   notice, this list of conditions and the following disclaimer in the\n"
+"   documentation and/or other materials provided with the distribution.\n"
+"\n"
+"3. Neither the name(s) of the above-listed copyright holder(s) nor the\n"
+"   names of its contributors may be used to endorse or promote products\n"
+"   derived from this software without specific prior written permission.\n"
+"\n"
+"THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS\n"
+"\"AS IS\" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT\n"
+"LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR\n"
+"A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT\n"
+"OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,\n"
+"SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT\n"
+"LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,\n"
+"DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY\n"
+"THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT\n"
+"(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE\n"
+"OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.\n"
+"\n";
+
+
+void cli_txt_list_free(struct cli_txt_entry *e)
+{
+	dl_list_del(&e->list);
+	os_free(e->txt);
+	os_free(e);
+}
+
+
+void cli_txt_list_flush(struct dl_list *list)
+{
+	struct cli_txt_entry *e;
+
+	while ((e = dl_list_first(list, struct cli_txt_entry, list)))
+		cli_txt_list_free(e);
+}
+
+
+struct cli_txt_entry * cli_txt_list_get(struct dl_list *txt_list,
+					const char *txt)
+{
+	struct cli_txt_entry *e;
+
+	dl_list_for_each(e, txt_list, struct cli_txt_entry, list) {
+		if (os_strcmp(e->txt, txt) == 0)
+			return e;
+	}
+	return NULL;
+}
+
+
+void cli_txt_list_del(struct dl_list *txt_list, const char *txt)
+{
+	struct cli_txt_entry *e;
+
+	e = cli_txt_list_get(txt_list, txt);
+	if (e)
+		cli_txt_list_free(e);
+}
+
+
+void cli_txt_list_del_addr(struct dl_list *txt_list, const char *txt)
+{
+	u8 addr[ETH_ALEN];
+	char buf[18];
+
+	if (hwaddr_aton(txt, addr) < 0)
+		return;
+	os_snprintf(buf, sizeof(buf), MACSTR, MAC2STR(addr));
+	cli_txt_list_del(txt_list, buf);
+}
+
+
+void cli_txt_list_del_word(struct dl_list *txt_list, const char *txt,
+			   int separator)
+{
+	const char *end;
+	char *buf;
+
+	end = os_strchr(txt, separator);
+	if (end == NULL)
+		end = txt + os_strlen(txt);
+	buf = dup_binstr(txt, end - txt);
+	if (buf == NULL)
+		return;
+	cli_txt_list_del(txt_list, buf);
+	os_free(buf);
+}
+
+
+int cli_txt_list_add(struct dl_list *txt_list, const char *txt)
+{
+	struct cli_txt_entry *e;
+
+	e = cli_txt_list_get(txt_list, txt);
+	if (e)
+		return 0;
+	e = os_zalloc(sizeof(*e));
+	if (e == NULL)
+		return -1;
+	e->txt = os_strdup(txt);
+	if (e->txt == NULL) {
+		os_free(e);
+		return -1;
+	}
+	dl_list_add(txt_list, &e->list);
+	return 0;
+}
+
+
+int cli_txt_list_add_addr(struct dl_list *txt_list, const char *txt)
+{
+	u8 addr[ETH_ALEN];
+	char buf[18];
+
+	if (hwaddr_aton(txt, addr) < 0)
+		return -1;
+	os_snprintf(buf, sizeof(buf), MACSTR, MAC2STR(addr));
+	return cli_txt_list_add(txt_list, buf);
+}
+
+
+int cli_txt_list_add_word(struct dl_list *txt_list, const char *txt,
+			  int separator)
+{
+	const char *end;
+	char *buf;
+	int ret;
+
+	end = os_strchr(txt, separator);
+	if (end == NULL)
+		end = txt + os_strlen(txt);
+	buf = dup_binstr(txt, end - txt);
+	if (buf == NULL)
+		return -1;
+	ret = cli_txt_list_add(txt_list, buf);
+	os_free(buf);
+	return ret;
+}
+
+
+char ** cli_txt_list_array(struct dl_list *txt_list)
+{
+	unsigned int i, count = dl_list_len(txt_list);
+	char **res;
+	struct cli_txt_entry *e;
+
+	res = os_calloc(count + 1, sizeof(char *));
+	if (res == NULL)
+		return NULL;
+
+	i = 0;
+	dl_list_for_each(e, txt_list, struct cli_txt_entry, list) {
+		res[i] = os_strdup(e->txt);
+		if (res[i] == NULL)
+			break;
+		i++;
+	}
+
+	return res;
+}
+
+
+int get_cmd_arg_num(const char *str, int pos)
+{
+	int arg = 0, i;
+
+	for (i = 0; i <= pos; i++) {
+		if (str[i] != ' ') {
+			arg++;
+			while (i <= pos && str[i] != ' ')
+				i++;
+		}
+	}
+
+	if (arg > 0)
+		arg--;
+	return arg;
+}
+
+
+int write_cmd(char *buf, size_t buflen, const char *cmd, int argc, char *argv[])
+{
+	int i, res;
+	char *pos, *end;
+
+	pos = buf;
+	end = buf + buflen;
+
+	res = os_snprintf(pos, end - pos, "%s", cmd);
+	if (os_snprintf_error(end - pos, res))
+		goto fail;
+	pos += res;
+
+	for (i = 0; i < argc; i++) {
+		res = os_snprintf(pos, end - pos, " %s", argv[i]);
+		if (os_snprintf_error(end - pos, res))
+			goto fail;
+		pos += res;
+	}
+
+	buf[buflen - 1] = '\0';
+	return 0;
+
+fail:
+	printf("Too long command\n");
+	return -1;
+}
+
+
+int tokenize_cmd(char *cmd, char *argv[])
+{
+	char *pos;
+	int argc = 0;
+
+	pos = cmd;
+	for (;;) {
+		while (*pos == ' ')
+			pos++;
+		if (*pos == '\0')
+			break;
+		argv[argc] = pos;
+		argc++;
+		if (argc == max_args)
+			break;
+		if (*pos == '"') {
+			char *pos2 = os_strrchr(pos, '"');
+			if (pos2)
+				pos = pos2 + 1;
+		}
+		while (*pos != '\0' && *pos != ' ')
+			pos++;
+		if (*pos == ' ')
+			*pos++ = '\0';
+	}
+
+	return argc;
+}
diff --git a/src/common/cli.h b/src/common/cli.h
new file mode 100644
index 0000000000000..41ef329696ea9
--- /dev/null
+++ b/src/common/cli.h
@@ -0,0 +1,47 @@
+/*
+ * Common hostapd/wpa_supplicant command line interface functionality
+ * Copyright (c) 2004-2016, Jouni Malinen <j@w1.fi>
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ */
+
+#ifndef CLI_H
+#define CLI_H
+
+#include "utils/list.h"
+
+extern const char *const cli_license;
+extern const char *const cli_full_license;
+
+struct cli_txt_entry {
+	struct dl_list list;
+	char *txt;
+};
+
+void cli_txt_list_free(struct cli_txt_entry *e);
+void cli_txt_list_flush(struct dl_list *list);
+
+struct cli_txt_entry *
+cli_txt_list_get(struct dl_list *txt_list, const char *txt);
+
+void cli_txt_list_del(struct dl_list *txt_list, const char *txt);
+void cli_txt_list_del_addr(struct dl_list *txt_list, const char *txt);
+void cli_txt_list_del_word(struct dl_list *txt_list, const char *txt,
+			   int separator);
+
+int cli_txt_list_add(struct dl_list *txt_list, const char *txt);
+int cli_txt_list_add_addr(struct dl_list *txt_list, const char *txt);
+int cli_txt_list_add_word(struct dl_list *txt_list, const char *txt,
+			  int separator);
+
+char ** cli_txt_list_array(struct dl_list *txt_list);
+
+int get_cmd_arg_num(const char *str, int pos);
+int write_cmd(char *buf, size_t buflen, const char *cmd, int argc,
+	      char *argv[]);
+
+#define max_args 10
+int tokenize_cmd(char *cmd, char *argv[]);
+
+#endif /* CLI_H */
diff --git a/src/common/common_module_tests.c b/src/common/common_module_tests.c
index d69448bd3800c..e0769c08e764a 100644
--- a/src/common/common_module_tests.c
+++ b/src/common/common_module_tests.c
@@ -9,6 +9,7 @@
 #include "utils/includes.h"
 
 #include "utils/common.h"
+#include "utils/module_tests.h"
 #include "ieee802_11_common.h"
 #include "ieee802_11_defs.h"
 #include "gas.h"
diff --git a/src/common/ctrl_iface_common.c b/src/common/ctrl_iface_common.c
new file mode 100644
index 0000000000000..ebbe6ffdb385b
--- /dev/null
+++ b/src/common/ctrl_iface_common.c
@@ -0,0 +1,173 @@
+/*
+ * Common hostapd/wpa_supplicant ctrl iface code.
+ * Copyright (c) 2002-2013, Jouni Malinen <j@w1.fi>
+ * Copyright (c) 2015, Qualcomm Atheros, Inc.
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ */
+
+#include "utils/includes.h"
+#include <netdb.h>
+#include <sys/un.h>
+
+#include "utils/common.h"
+#include "ctrl_iface_common.h"
+
+static int sockaddr_compare(struct sockaddr_storage *a, socklen_t a_len,
+			    struct sockaddr_storage *b, socklen_t b_len)
+{
+	if (a->ss_family != b->ss_family)
+		return 1;
+
+	switch (a->ss_family) {
+#ifdef CONFIG_CTRL_IFACE_UDP
+	case AF_INET:
+	{
+		struct sockaddr_in *in_a, *in_b;
+
+		in_a = (struct sockaddr_in *) a;
+		in_b = (struct sockaddr_in *) b;
+
+		if (in_a->sin_port != in_b->sin_port)
+			return 1;
+		if (in_a->sin_addr.s_addr != in_b->sin_addr.s_addr)
+			return 1;
+		break;
+	}
+	case AF_INET6:
+	{
+		struct sockaddr_in6 *in6_a, *in6_b;
+
+		in6_a = (struct sockaddr_in6 *) a;
+		in6_b = (struct sockaddr_in6 *) b;
+
+		if (in6_a->sin6_port != in6_b->sin6_port)
+			return 1;
+		if (os_memcmp(&in6_a->sin6_addr, &in6_b->sin6_addr,
+			      sizeof(in6_a->sin6_addr)) != 0)
+			return 1;
+		break;
+	}
+#endif /* CONFIG_CTRL_IFACE_UDP */
+#ifdef CONFIG_CTRL_IFACE_UNIX
+	case AF_UNIX:
+	{
+		struct sockaddr_un *u_a, *u_b;
+
+		u_a = (struct sockaddr_un *) a;
+		u_b = (struct sockaddr_un *) b;
+
+		if (a_len != b_len ||
+		    os_memcmp(u_a->sun_path, u_b->sun_path,
+			      a_len - offsetof(struct sockaddr_un, sun_path))
+		    != 0)
+			return 1;
+		break;
+	}
+#endif /* CONFIG_CTRL_IFACE_UNIX */
+	default:
+		return 1;
+	}
+
+	return 0;
+}
+
+
+void sockaddr_print(int level, const char *msg, struct sockaddr_storage *sock,
+		    socklen_t socklen)
+{
+	switch (sock->ss_family) {
+#ifdef CONFIG_CTRL_IFACE_UDP
+	case AF_INET:
+	case AF_INET6:
+	{
+		char host[NI_MAXHOST] = { 0 };
+		char service[NI_MAXSERV] = { 0 };
+
+		getnameinfo((struct sockaddr *) sock, socklen,
+			    host, sizeof(host),
+			    service, sizeof(service),
+			    NI_NUMERICHOST);
+
+		wpa_printf(level, "%s %s:%s", msg, host, service);
+		break;
+	}
+#endif /* CONFIG_CTRL_IFACE_UDP */
+#ifdef CONFIG_CTRL_IFACE_UNIX
+	case AF_UNIX:
+	{
+		char addr_txt[200];
+
+		printf_encode(addr_txt, sizeof(addr_txt),
+			      (u8 *) ((struct sockaddr_un *) sock)->sun_path,
+			      socklen - offsetof(struct sockaddr_un, sun_path));
+		wpa_printf(level, "%s %s", msg, addr_txt);
+		break;
+	}
+#endif /* CONFIG_CTRL_IFACE_UNIX */
+	default:
+		wpa_printf(level, "%s", msg);
+		break;
+	}
+}
+
+
+int ctrl_iface_attach(struct dl_list *ctrl_dst, struct sockaddr_storage *from,
+		      socklen_t fromlen)
+{
+	struct wpa_ctrl_dst *dst;
+
+	dst = os_zalloc(sizeof(*dst));
+	if (dst == NULL)
+		return -1;
+	os_memcpy(&dst->addr, from, fromlen);
+	dst->addrlen = fromlen;
+	dst->debug_level = MSG_INFO;
+	dl_list_add(ctrl_dst, &dst->list);
+
+	sockaddr_print(MSG_DEBUG, "CTRL_IFACE monitor attached", from, fromlen);
+	return 0;
+}
+
+
+int ctrl_iface_detach(struct dl_list *ctrl_dst, struct sockaddr_storage *from,
+		      socklen_t fromlen)
+{
+	struct wpa_ctrl_dst *dst;
+
+	dl_list_for_each(dst, ctrl_dst, struct wpa_ctrl_dst, list) {
+		if (!sockaddr_compare(from, fromlen,
+				      &dst->addr, dst->addrlen)) {
+			sockaddr_print(MSG_DEBUG, "CTRL_IFACE monitor detached",
+				       from, fromlen);
+			dl_list_del(&dst->list);
+			os_free(dst);
+			return 0;
+		}
+	}
+
+	return -1;
+}
+
+
+int ctrl_iface_level(struct dl_list *ctrl_dst, struct sockaddr_storage *from,
+		     socklen_t fromlen, const char *level)
+{
+	struct wpa_ctrl_dst *dst;
+
+	wpa_printf(MSG_DEBUG, "CTRL_IFACE LEVEL %s", level);
+
+	dl_list_for_each(dst, ctrl_dst, struct wpa_ctrl_dst, list) {
+		if (!sockaddr_compare(from, fromlen,
+				      &dst->addr, dst->addrlen)) {
+			sockaddr_print(MSG_DEBUG,
+				       "CTRL_IFACE changed monitor level",
+				       from, fromlen);
+			dst->debug_level = atoi(level);
+			return 0;
+		}
+	}
+
+	return -1;
+}
diff --git a/src/common/ctrl_iface_common.h b/src/common/ctrl_iface_common.h
new file mode 100644
index 0000000000000..0b6e3e740291d
--- /dev/null
+++ b/src/common/ctrl_iface_common.h
@@ -0,0 +1,38 @@
+/*
+ * Common hostapd/wpa_supplicant ctrl iface code.
+ * Copyright (c) 2002-2013, Jouni Malinen <j@w1.fi>
+ * Copyright (c) 2015, Qualcomm Atheros, Inc.
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ */
+#ifndef CONTROL_IFACE_COMMON_H
+#define CONTROL_IFACE_COMMON_H
+
+#include "utils/list.h"
+
+/**
+ * struct wpa_ctrl_dst - Data structure of control interface monitors
+ *
+ * This structure is used to store information about registered control
+ * interface monitors into struct wpa_supplicant.
+ */
+struct wpa_ctrl_dst {
+	struct dl_list list;
+	struct sockaddr_storage addr;
+	socklen_t addrlen;
+	int debug_level;
+	int errors;
+};
+
+void sockaddr_print(int level, const char *msg, struct sockaddr_storage *sock,
+		    socklen_t socklen);
+
+int ctrl_iface_attach(struct dl_list *ctrl_dst, struct sockaddr_storage *from,
+		       socklen_t fromlen);
+int ctrl_iface_detach(struct dl_list *ctrl_dst, struct sockaddr_storage *from,
+		      socklen_t fromlen);
+int ctrl_iface_level(struct dl_list *ctrl_dst, struct sockaddr_storage *from,
+		     socklen_t fromlen, const char *level);
+
+#endif /* CONTROL_IFACE_COMMON_H */
diff --git a/src/common/defs.h b/src/common/defs.h
index 6aea3751a2bc9..4f567945942e5 100644
--- a/src/common/defs.h
+++ b/src/common/defs.h
@@ -312,6 +312,7 @@ enum wpa_ctrl_req_type {
 	WPA_CTRL_REQ_EAP_PASSPHRASE,
 	WPA_CTRL_REQ_SIM,
 	WPA_CTRL_REQ_PSK_PASSPHRASE,
+	WPA_CTRL_REQ_EXT_CERT_CHECK,
 	NUM_WPA_CTRL_REQS
 };
 
@@ -319,13 +320,13 @@ enum wpa_ctrl_req_type {
 #define EAP_MAX_METHODS 8
 
 enum mesh_plink_state {
-	PLINK_LISTEN = 1,
-	PLINK_OPEN_SENT,
-	PLINK_OPEN_RCVD,
+	PLINK_IDLE = 1,
+	PLINK_OPN_SNT,
+	PLINK_OPN_RCVD,
 	PLINK_CNF_RCVD,
 	PLINK_ESTAB,
 	PLINK_HOLDING,
-	PLINK_BLOCKED,
+	PLINK_BLOCKED, /* not defined in the IEEE 802.11 standard */
 };
 
 enum set_band {
@@ -334,4 +335,10 @@ enum set_band {
 	WPA_SETBAND_2G
 };
 
+enum wpa_radio_work_band {
+	BAND_2_4_GHZ = BIT(0),
+	BAND_5_GHZ = BIT(1),
+	BAND_60_GHZ = BIT(2),
+};
+
 #endif /* DEFS_H */
diff --git a/src/common/eapol_common.h b/src/common/eapol_common.h
index 6958661f78b56..d773348b42c5b 100644
--- a/src/common/eapol_common.h
+++ b/src/common/eapol_common.h
@@ -25,7 +25,7 @@ struct ieee802_1x_hdr {
 struct ieee8023_hdr {
 	u8 dest[ETH_ALEN];
 	u8 src[ETH_ALEN];
-	u16 ethertype;
+	be16 ethertype;
 } STRUCT_PACKED;
 
 #ifdef _MSC_VER
diff --git a/src/common/ieee802_11_common.c b/src/common/ieee802_11_common.c
index d07a316a79298..b6bc449bf7dcd 100644
--- a/src/common/ieee802_11_common.c
+++ b/src/common/ieee802_11_common.c
@@ -115,6 +115,11 @@ static int ieee802_11_parse_vendor_specific(const u8 *pos, size_t elen,
 			elems->osen = pos;
 			elems->osen_len = elen;
 			break;
+		case MBO_OUI_TYPE:
+			/* MBO-OCE */
+			elems->mbo = pos;
+			elems->mbo_len = elen;
+			break;
 		default:
 			wpa_printf(MSG_MSGDUMP, "Unknown WFA "
 				   "information element ignored "
@@ -366,6 +371,14 @@ ParseRes ieee802_11_parse_elems(const u8 *start, size_t len,
 			elems->mb_ies.ies[elems->mb_ies.nof_ies].ie_len = elen;
 			elems->mb_ies.nof_ies++;
 			break;
+		case WLAN_EID_SUPPORTED_OPERATING_CLASSES:
+			elems->supp_op_classes = pos;
+			elems->supp_op_classes_len = elen;
+			break;
+		case WLAN_EID_RRM_ENABLED_CAPABILITIES:
+			elems->rrm_enabled = pos;
+			elems->rrm_enabled_len = elen;
+			break;
 		default:
 			unknown++;
 			if (!show_errors)
@@ -398,8 +411,8 @@ int ieee802_11_ie_count(const u8 *ies, size_t ies_len)
 	pos = ies;
 	end = ies + ies_len;
 
-	while (pos + 2 <= end) {
-		if (pos + 2 + pos[1] > end)
+	while (end - pos >= 2) {
+		if (2 + pos[1] > end - pos)
 			break;
 		count++;
 		pos += 2 + pos[1];
@@ -419,8 +432,8 @@ struct wpabuf * ieee802_11_vendor_ie_concat(const u8 *ies, size_t ies_len,
 	end = ies + ies_len;
 	ie = NULL;
 
-	while (pos + 1 < end) {
-		if (pos + 2 + pos[1] > end)
+	while (end - pos > 1) {
+		if (2 + pos[1] > end - pos)
 			return NULL;
 		if (pos[0] == WLAN_EID_VENDOR_SPECIFIC && pos[1] >= 4 &&
 		    WPA_GET_BE32(&pos[2]) == oui_type) {
@@ -441,8 +454,8 @@ struct wpabuf * ieee802_11_vendor_ie_concat(const u8 *ies, size_t ies_len,
 	 * There may be multiple vendor IEs in the message, so need to
 	 * concatenate their data fields.
 	 */
-	while (pos + 1 < end) {
-		if (pos + 2 + pos[1] > end)
+	while (end - pos > 1) {
+		if (2 + pos[1] > end - pos)
 			break;
 		if (pos[0] == WLAN_EID_VENDOR_SPECIFIC && pos[1] >= 4 &&
 		    WPA_GET_BE32(&pos[2]) == oui_type)
@@ -570,7 +583,8 @@ enum hostapd_hw_mode ieee80211_freq_to_chan(int freq, u8 *channel)
 {
 	u8 op_class;
 
-	return ieee80211_freq_to_channel_ext(freq, 0, 0, &op_class, channel);
+	return ieee80211_freq_to_channel_ext(freq, 0, VHT_CHANWIDTH_USE_HT,
+					     &op_class, channel);
 }
 
 
@@ -579,7 +593,7 @@ enum hostapd_hw_mode ieee80211_freq_to_chan(int freq, u8 *channel)
  * for HT40 and VHT. DFS channels are not covered.
  * @freq: Frequency (MHz) to convert
  * @sec_channel: 0 = non-HT40, 1 = sec. channel above, -1 = sec. channel below
- * @vht: 0 - non-VHT, 1 - 80 MHz
+ * @vht: VHT channel width (VHT_CHANWIDTH_*)
  * @op_class: Buffer for returning operating class
  * @channel: Buffer for returning channel number
  * Returns: hw_mode on success, NUM_HOSTAPD_MODES on failure
@@ -588,6 +602,8 @@ enum hostapd_hw_mode ieee80211_freq_to_channel_ext(unsigned int freq,
 						   int sec_channel, int vht,
 						   u8 *op_class, u8 *channel)
 {
+	u8 vht_opclass;
+
 	/* TODO: more operating classes */
 
 	if (sec_channel > 1 || sec_channel < -1)
@@ -631,17 +647,32 @@ enum hostapd_hw_mode ieee80211_freq_to_channel_ext(unsigned int freq,
 		return HOSTAPD_MODE_IEEE80211A;
 	}
 
+	switch (vht) {
+	case VHT_CHANWIDTH_80MHZ:
+		vht_opclass = 128;
+		break;
+	case VHT_CHANWIDTH_160MHZ:
+		vht_opclass = 129;
+		break;
+	case VHT_CHANWIDTH_80P80MHZ:
+		vht_opclass = 130;
+		break;
+	default:
+		vht_opclass = 0;
+		break;
+	}
+
 	/* 5 GHz, channels 36..48 */
 	if (freq >= 5180 && freq <= 5240) {
 		if ((freq - 5000) % 5)
 			return NUM_HOSTAPD_MODES;
 
-		if (sec_channel == 1)
+		if (vht_opclass)
+			*op_class = vht_opclass;
+		else if (sec_channel == 1)
 			*op_class = 116;
 		else if (sec_channel == -1)
 			*op_class = 117;
-		else if (vht)
-			*op_class = 128;
 		else
 			*op_class = 115;
 
@@ -650,31 +681,40 @@ enum hostapd_hw_mode ieee80211_freq_to_channel_ext(unsigned int freq,
 		return HOSTAPD_MODE_IEEE80211A;
 	}
 
-	/* 5 GHz, channels 149..161 */
-	if (freq >= 5745 && freq <= 5805) {
+	/* 5 GHz, channels 149..169 */
+	if (freq >= 5745 && freq <= 5845) {
 		if ((freq - 5000) % 5)
 			return NUM_HOSTAPD_MODES;
 
-		if (sec_channel == 1)
+		if (vht_opclass)
+			*op_class = vht_opclass;
+		else if (sec_channel == 1)
 			*op_class = 126;
 		else if (sec_channel == -1)
 			*op_class = 127;
-		else if (vht)
-			*op_class = 128;
-		else
+		else if (freq <= 5805)
 			*op_class = 124;
+		else
+			*op_class = 125;
 
 		*channel = (freq - 5000) / 5;
 
 		return HOSTAPD_MODE_IEEE80211A;
 	}
 
-	/* 5 GHz, channels 149..169 */
-	if (freq >= 5745 && freq <= 5845) {
+	/* 5 GHz, channels 100..140 */
+	if (freq >= 5000 && freq <= 5700) {
 		if ((freq - 5000) % 5)
 			return NUM_HOSTAPD_MODES;
 
-		*op_class = 125;
+		if (vht_opclass)
+			*op_class = vht_opclass;
+		else if (sec_channel == 1)
+			*op_class = 122;
+		else if (sec_channel == -1)
+			*op_class = 123;
+		else
+			*op_class = 121;
 
 		*channel = (freq - 5000) / 5;
 
@@ -1145,3 +1185,135 @@ struct wpabuf * mb_ies_by_info(struct mb_ies_info *info)
 
 	return mb_ies;
 }
+
+
+const struct oper_class_map global_op_class[] = {
+	{ HOSTAPD_MODE_IEEE80211G, 81, 1, 13, 1, BW20, P2P_SUPP },
+	{ HOSTAPD_MODE_IEEE80211G, 82, 14, 14, 1, BW20, NO_P2P_SUPP },
+
+	/* Do not enable HT40 on 2.4 GHz for P2P use for now */
+	{ HOSTAPD_MODE_IEEE80211G, 83, 1, 9, 1, BW40PLUS, NO_P2P_SUPP },
+	{ HOSTAPD_MODE_IEEE80211G, 84, 5, 13, 1, BW40MINUS, NO_P2P_SUPP },
+
+	{ HOSTAPD_MODE_IEEE80211A, 115, 36, 48, 4, BW20, P2P_SUPP },
+	{ HOSTAPD_MODE_IEEE80211A, 116, 36, 44, 8, BW40PLUS, P2P_SUPP },
+	{ HOSTAPD_MODE_IEEE80211A, 117, 40, 48, 8, BW40MINUS, P2P_SUPP },
+	{ HOSTAPD_MODE_IEEE80211A, 118, 52, 64, 4, BW20, NO_P2P_SUPP },
+	{ HOSTAPD_MODE_IEEE80211A, 119, 52, 60, 8, BW40PLUS, NO_P2P_SUPP },
+	{ HOSTAPD_MODE_IEEE80211A, 120, 56, 64, 8, BW40MINUS, NO_P2P_SUPP },
+	{ HOSTAPD_MODE_IEEE80211A, 121, 100, 140, 4, BW20, NO_P2P_SUPP },
+	{ HOSTAPD_MODE_IEEE80211A, 122, 100, 132, 8, BW40PLUS, NO_P2P_SUPP },
+	{ HOSTAPD_MODE_IEEE80211A, 123, 104, 136, 8, BW40MINUS, NO_P2P_SUPP },
+	{ HOSTAPD_MODE_IEEE80211A, 124, 149, 161, 4, BW20, P2P_SUPP },
+	{ HOSTAPD_MODE_IEEE80211A, 125, 149, 169, 4, BW20, P2P_SUPP },
+	{ HOSTAPD_MODE_IEEE80211A, 126, 149, 157, 8, BW40PLUS, P2P_SUPP },
+	{ HOSTAPD_MODE_IEEE80211A, 127, 153, 161, 8, BW40MINUS, P2P_SUPP },
+
+	/*
+	 * IEEE P802.11ac/D7.0 Table E-4 actually talks about channel center
+	 * frequency index 42, 58, 106, 122, 138, 155 with channel spacing of
+	 * 80 MHz, but currently use the following definition for simplicity
+	 * (these center frequencies are not actual channels, which makes
+	 * wpas_p2p_allow_channel() fail). wpas_p2p_verify_80mhz() should take
+	 * care of removing invalid channels.
+	 */
+	{ HOSTAPD_MODE_IEEE80211A, 128, 36, 161, 4, BW80, P2P_SUPP },
+	{ HOSTAPD_MODE_IEEE80211A, 129, 50, 114, 16, BW160, P2P_SUPP },
+	{ HOSTAPD_MODE_IEEE80211A, 130, 36, 161, 4, BW80P80, P2P_SUPP },
+	{ HOSTAPD_MODE_IEEE80211AD, 180, 1, 4, 1, BW2160, P2P_SUPP },
+	{ -1, 0, 0, 0, 0, BW20, NO_P2P_SUPP }
+};
+
+
+static enum phy_type ieee80211_phy_type_by_freq(int freq)
+{
+	enum hostapd_hw_mode hw_mode;
+	u8 channel;
+
+	hw_mode = ieee80211_freq_to_chan(freq, &channel);
+
+	switch (hw_mode) {
+	case HOSTAPD_MODE_IEEE80211A:
+		return PHY_TYPE_OFDM;
+	case HOSTAPD_MODE_IEEE80211B:
+		return PHY_TYPE_HRDSSS;
+	case HOSTAPD_MODE_IEEE80211G:
+		return PHY_TYPE_ERP;
+	case HOSTAPD_MODE_IEEE80211AD:
+		return PHY_TYPE_DMG;
+	default:
+		return PHY_TYPE_UNSPECIFIED;
+	};
+}
+
+
+/* ieee80211_get_phy_type - Derive the phy type by freq and bandwidth */
+enum phy_type ieee80211_get_phy_type(int freq, int ht, int vht)
+{
+	if (vht)
+		return PHY_TYPE_VHT;
+	if (ht)
+		return PHY_TYPE_HT;
+
+	return ieee80211_phy_type_by_freq(freq);
+}
+
+
+size_t global_op_class_size = ARRAY_SIZE(global_op_class);
+
+
+/**
+ * get_ie - Fetch a specified information element from IEs buffer
+ * @ies: Information elements buffer
+ * @len: Information elements buffer length
+ * @eid: Information element identifier (WLAN_EID_*)
+ * Returns: Pointer to the information element (id field) or %NULL if not found
+ *
+ * This function returns the first matching information element in the IEs
+ * buffer or %NULL in case the element is not found.
+ */
+const u8 * get_ie(const u8 *ies, size_t len, u8 eid)
+{
+	const u8 *end;
+
+	if (!ies)
+		return NULL;
+
+	end = ies + len;
+
+	while (end - ies > 1) {
+		if (2 + ies[1] > end - ies)
+			break;
+
+		if (ies[0] == eid)
+			return ies;
+
+		ies += 2 + ies[1];
+	}
+
+	return NULL;
+}
+
+
+size_t mbo_add_ie(u8 *buf, size_t len, const u8 *attr, size_t attr_len)
+{
+	/*
+	 * MBO IE requires 6 bytes without the attributes: EID (1), length (1),
+	 * OUI (3), OUI type (1).
+	 */
+	if (len < 6 + attr_len) {
+		wpa_printf(MSG_DEBUG,
+			   "MBO: Not enough room in buffer for MBO IE: buf len = %zu, attr_len = %zu",
+			   len, attr_len);
+		return 0;
+	}
+
+	*buf++ = WLAN_EID_VENDOR_SPECIFIC;
+	*buf++ = attr_len + 4;
+	WPA_PUT_BE24(buf, OUI_WFA);
+	buf += 3;
+	*buf++ = MBO_OUI_TYPE;
+	os_memcpy(buf, attr, attr_len);
+
+	return 6 + attr_len;
+}
diff --git a/src/common/ieee802_11_common.h b/src/common/ieee802_11_common.h
index 55ce0223d9235..42f39096f86ca 100644
--- a/src/common/ieee802_11_common.h
+++ b/src/common/ieee802_11_common.h
@@ -9,6 +9,8 @@
 #ifndef IEEE802_11_COMMON_H
 #define IEEE802_11_COMMON_H
 
+#include "defs.h"
+
 #define MAX_NOF_MB_IES_SUPPORTED 5
 
 struct mb_ies_info {
@@ -56,9 +58,12 @@ struct ieee802_11_elems {
 	const u8 *bss_max_idle_period;
 	const u8 *ssid_list;
 	const u8 *osen;
+	const u8 *mbo;
 	const u8 *ampe;
 	const u8 *mic;
 	const u8 *pref_freq_list;
+	const u8 *supp_op_classes;
+	const u8 *rrm_enabled;
 
 	u8 ssid_len;
 	u8 supp_rates_len;
@@ -85,9 +90,13 @@ struct ieee802_11_elems {
 	u8 ext_capab_len;
 	u8 ssid_list_len;
 	u8 osen_len;
+	u8 mbo_len;
 	u8 ampe_len;
 	u8 mic_len;
 	u8 pref_freq_list_len;
+	u8 supp_op_classes_len;
+	u8 rrm_enabled_len;
+
 	struct mb_ies_info mb_ies;
 };
 
@@ -118,6 +127,7 @@ enum hostapd_hw_mode ieee80211_freq_to_channel_ext(unsigned int freq,
 						   int sec_channel, int vht,
 						   u8 *op_class, u8 *channel);
 int ieee80211_is_dfs(int freq);
+enum phy_type ieee80211_get_phy_type(int freq, int ht, int vht);
 
 int supp_rates_11b_only(struct ieee802_11_elems *elems);
 int mb_ies_info_by_ies(struct mb_ies_info *info, const u8 *ies_buf,
@@ -125,4 +135,22 @@ int mb_ies_info_by_ies(struct mb_ies_info *info, const u8 *ies_buf,
 struct wpabuf * mb_ies_by_info(struct mb_ies_info *info);
 
 const char * fc2str(u16 fc);
+
+struct oper_class_map {
+	enum hostapd_hw_mode mode;
+	u8 op_class;
+	u8 min_chan;
+	u8 max_chan;
+	u8 inc;
+	enum { BW20, BW40PLUS, BW40MINUS, BW80, BW2160, BW160, BW80P80 } bw;
+	enum { P2P_SUPP, NO_P2P_SUPP } p2p;
+};
+
+extern const struct oper_class_map global_op_class[];
+extern size_t global_op_class_size;
+
+const u8 * get_ie(const u8 *ies, size_t len, u8 eid);
+
+size_t mbo_add_ie(u8 *buf, size_t len, const u8 *attr, size_t attr_len);
+
 #endif /* IEEE802_11_COMMON_H */
diff --git a/src/common/ieee802_11_defs.h b/src/common/ieee802_11_defs.h
index 44530ce3cee6a..d453aec790add 100644
--- a/src/common/ieee802_11_defs.h
+++ b/src/common/ieee802_11_defs.h
@@ -94,8 +94,13 @@
 #define WLAN_CAPABILITY_PBCC BIT(6)
 #define WLAN_CAPABILITY_CHANNEL_AGILITY BIT(7)
 #define WLAN_CAPABILITY_SPECTRUM_MGMT BIT(8)
+#define WLAN_CAPABILITY_QOS BIT(9)
 #define WLAN_CAPABILITY_SHORT_SLOT_TIME BIT(10)
+#define WLAN_CAPABILITY_APSD BIT(11)
+#define WLAN_CAPABILITY_RADIO_MEASUREMENT BIT(12)
 #define WLAN_CAPABILITY_DSSS_OFDM BIT(13)
+#define WLAN_CAPABILITY_DELAYED_BLOCK_ACK BIT(14)
+#define WLAN_CAPABILITY_IMM_BLOCK_ACK BIT(15)
 
 /* Status codes (IEEE 802.11-2007, 7.3.1.9, Table 7-23) */
 #define WLAN_STATUS_SUCCESS 0
@@ -247,6 +252,7 @@
 #define WLAN_EID_TIMEOUT_INTERVAL 56
 #define WLAN_EID_RIC_DATA 57
 #define WLAN_EID_SUPPORTED_OPERATING_CLASSES 59
+#define WLAN_EID_EXT_CHANSWITCH_ANN 60
 #define WLAN_EID_HT_OPERATION 61
 #define WLAN_EID_SECONDARY_CHANNEL_OFFSET 62
 #define WLAN_EID_WAPI 68
@@ -360,6 +366,16 @@
 /* byte 1 (out of 5) */
 #define WLAN_RRM_CAPS_LINK_MEASUREMENT BIT(0)
 #define WLAN_RRM_CAPS_NEIGHBOR_REPORT BIT(1)
+/* byte 2 (out of 5) */
+#define WLAN_RRM_CAPS_LCI_MEASUREMENT BIT(4)
+/* byte 5 (out of 5) */
+#define WLAN_RRM_CAPS_FTM_RANGE_REPORT BIT(2)
+
+/*
+ * IEEE P802.11-REVmc/D5.0, 9.4.2.21.19 (Fine Timing Measurement Range
+ * request) - Minimum AP count
+ */
+#define WLAN_RRM_RANGE_REQ_MAX_MIN_AP 15
 
 /* Timeout Interval Type */
 #define WLAN_TIMEOUT_REASSOC_DEADLINE 1
@@ -407,7 +423,12 @@ enum anqp_info_id {
 	ANQP_AP_LOCATION_PUBLIC_URI = 267,
 	ANQP_DOMAIN_NAME = 268,
 	ANQP_EMERGENCY_ALERT_URI = 269,
+	ANQP_TDLS_CAPABILITY = 270,
 	ANQP_EMERGENCY_NAI = 271,
+	ANQP_NEIGHBOR_REPORT = 272,
+	ANQP_VENUE_URL = 277,
+	ANQP_ADVICE_OF_CHARGE = 278,
+	ANQP_LOCAL_CONTENT = 279,
 	ANQP_VENDOR_SPECIFIC = 56797
 };
 
@@ -442,6 +463,48 @@ enum nai_realm_eap_cred_type {
 	NAI_REALM_CRED_TYPE_VENDOR_SPECIFIC = 10
 };
 
+/*
+ * IEEE P802.11-REVmc/D5.0 Table 9-81 - Measurement type definitions for
+ * measurement requests
+ */
+enum measure_type {
+	MEASURE_TYPE_BASIC = 0,
+	MEASURE_TYPE_CCA = 1,
+	MEASURE_TYPE_RPI_HIST = 2,
+	MEASURE_TYPE_CHANNEL_LOAD = 3,
+	MEASURE_TYPE_NOISE_HIST = 4,
+	MEASURE_TYPE_BEACON = 5,
+	MEASURE_TYPE_FRAME = 6,
+	MEASURE_TYPE_STA_STATISTICS = 7,
+	MEASURE_TYPE_LCI = 8,
+	MEASURE_TYPE_TRANSMIT_STREAM = 9,
+	MEASURE_TYPE_MULTICAST_DIAG = 10,
+	MEASURE_TYPE_LOCATION_CIVIC = 11,
+	MEASURE_TYPE_LOCATION_ID = 12,
+	MEASURE_TYPE_DIRECTIONAL_CHAN_QUALITY = 13,
+	MEASURE_TYPE_DIRECTIONAL_MEASURE = 14,
+	MEASURE_TYPE_DIRECTIONAL_STATS = 15,
+	MEASURE_TYPE_FTM_RANGE = 16,
+	MEASURE_TYPE_MEASURE_PAUSE = 255,
+};
+
+/* IEEE Std 802.11-2012 Table 8-71 - Location subject definition */
+enum location_subject {
+	LOCATION_SUBJECT_LOCAL = 0,
+	LOCATION_SUBJECT_REMOTE = 1,
+	LOCATION_SUBJECT_3RD_PARTY = 2,
+};
+
+/*
+ * IEEE P802.11-REVmc/D5.0 Table 9-94 - Optional subelement IDs for LCI request
+ */
+enum lci_req_subelem {
+	LCI_REQ_SUBELEM_AZIMUTH_REQ = 1,
+	LCI_REQ_SUBELEM_ORIGINATOR_MAC_ADDR = 2,
+	LCI_REQ_SUBELEM_TARGET_MAC_ADDR = 3,
+	LCI_REQ_SUBELEM_MAX_AGE = 4,
+};
+
 #ifdef _MSC_VER
 #pragma pack(push, 1)
 #endif /* _MSC_VER */
@@ -516,10 +579,7 @@ struct ieee80211_mgmt {
 			 * FH Params, DS Params, CF Params, IBSS Params, TIM */
 			u8 variable[];
 		} STRUCT_PACKED beacon;
-		struct {
-			/* only variable items: SSID, Supported rates */
-			u8 variable[0];
-		} STRUCT_PACKED probe_req;
+		/* probe_req: only variable items: SSID, Supported rates */
 		struct {
 			u8 timestamp[8];
 			le16 beacon_int;
@@ -625,12 +685,19 @@ struct ieee80211_mgmt {
 					u8 action;
 					u8 variable[];
 				} STRUCT_PACKED fst_action;
+				struct {
+					u8 action;
+					u8 dialog_token;
+					u8 variable[];
+				} STRUCT_PACKED rrm;
 			} u;
 		} STRUCT_PACKED action;
 	} u;
 } STRUCT_PACKED;
 
 
+#define IEEE80211_MAX_MMPDU_SIZE 2304
+
 /* Rx MCS bitmask is in the first 77 bits of supported_mcs_set */
 #define IEEE80211_HT_MCS_MASK_LEN 10
 
@@ -690,9 +757,14 @@ struct ieee80211_ampe_ie {
 	u8 selected_pairwise_suite[4];
 	u8 local_nonce[32];
 	u8 peer_nonce[32];
-	u8 mgtk[16];
-	u8 key_rsc[8];
-	u8 key_expiration[4];
+	/* Followed by
+	 * Key Replay Counter[8] (optional)
+	 *	(only in Mesh Group Key Inform/Acknowledge frames)
+	 * GTKdata[variable] (optional)
+	 *	(MGTK[variable] || Key RSC[8] || GTKExpirationTime[4])
+	 * IGTKdata[variable] (optional)
+	 *	(Key ID[2], IPN[6], IGTK[variable] in IGTK KDE format)
+	 */
 } STRUCT_PACKED;
 
 #ifdef _MSC_VER
@@ -879,6 +951,8 @@ struct ieee80211_ampe_ie {
 #define WFD_OUI_TYPE 10
 #define HS20_IE_VENDOR_TYPE 0x506f9a10
 #define OSEN_IE_VENDOR_TYPE 0x506f9a12
+#define MBO_IE_VENDOR_TYPE 0x506f9a16
+#define MBO_OUI_TYPE 22
 
 #define WMM_OUI_TYPE 2
 #define WMM_OUI_SUBTYPE_INFORMATION_ELEMENT 0
@@ -1021,6 +1095,95 @@ enum wmm_ac {
 #define HS20_DEAUTH_REASON_CODE_BSS 0
 #define HS20_DEAUTH_REASON_CODE_ESS 1
 
+/* MBO v0.0_r19, 4.2: MBO Attributes */
+/* Table 4-5: MBO Attributes */
+enum mbo_attr_id {
+	MBO_ATTR_ID_AP_CAPA_IND = 1,
+	MBO_ATTR_ID_NON_PREF_CHAN_REPORT = 2,
+	MBO_ATTR_ID_CELL_DATA_CAPA = 3,
+	MBO_ATTR_ID_ASSOC_DISALLOW = 4,
+	MBO_ATTR_ID_CELL_DATA_PREF = 5,
+	MBO_ATTR_ID_TRANSITION_REASON = 6,
+	MBO_ATTR_ID_TRANSITION_REJECT_REASON = 7,
+	MBO_ATTR_ID_ASSOC_RETRY_DELAY = 8,
+};
+
+/* MBO v0.0_r19, 4.2.1: MBO AP Capability Indication Attribute */
+/* Table 4-7: MBO AP Capability Indication Field Values */
+#define MBO_AP_CAPA_CELL_AWARE BIT(6)
+
+/* MBO v0.0_r19, 4.2.2: Non-preferred Channel Report Attribute */
+/* Table 4-10: Reason Code Field Values */
+enum mbo_non_pref_chan_reason {
+	MBO_NON_PREF_CHAN_REASON_UNSPECIFIED = 0,
+	MBO_NON_PREF_CHAN_REASON_RSSI = 1,
+	MBO_NON_PREF_CHAN_REASON_EXT_INTERFERENCE = 2,
+	MBO_NON_PREF_CHAN_REASON_INT_INTERFERENCE = 3,
+};
+
+/* MBO v0.0_r19, 4.2.3: Cellular Data Capabilities Attribute */
+/* Table 4-13: Cellular Data Connectivity Field */
+enum mbo_cellular_capa {
+	MBO_CELL_CAPA_AVAILABLE = 1,
+	MBO_CELL_CAPA_NOT_AVAILABLE = 2,
+	MBO_CELL_CAPA_NOT_SUPPORTED = 3,
+};
+
+/* MBO v0.0_r19, 4.2.4: Association Disallowed Attribute */
+/* Table 4-15: Reason Code Field Values */
+enum mbo_assoc_disallow_reason {
+	MBO_ASSOC_DISALLOW_REASON_UNSPECIFIED = 1,
+	MBO_ASSOC_DISALLOW_REASON_MAX_STA = 2,
+	MBO_ASSOC_DISALLOW_REASON_AIR_INTERFERENCE = 3,
+	MBO_ASSOC_DISALLOW_REASON_AUTH_SERVER_OVERLOAD = 4,
+	MBO_ASSOC_DISALLOW_REASON_LOW_RSSI = 5,
+};
+
+/* MBO v0.0_r19, 4.2.5: Cellular Data Connection Preference Attribute */
+/* Table 4-17: Cellular Preference Field Values */
+enum mbo_cell_pref {
+	MBO_CELL_PREF_EXCLUDED = 0,
+	MBO_CELL_PREF_NO_USE = 1,
+	MBO_CELL_PREF_USE = 255
+};
+
+/* MBO v0.0_r19, 4.2.6: Transition Reason Code Attribute */
+/* Table 4-19: Transition Reason Code Field Values */
+enum mbo_transition_reason {
+	MBO_TRANSITION_REASON_UNSPECIFIED = 0,
+	MBO_TRANSITION_REASON_FRAME_LOSS = 1,
+	MBO_TRANSITION_REASON_DELAY = 2,
+	MBO_TRANSITION_REASON_BANDWIDTH = 3,
+	MBO_TRANSITION_REASON_LOAD_BALANCE = 4,
+	MBO_TRANSITION_REASON_RSSI = 5,
+	MBO_TRANSITION_REASON_RETRANSMISSIONS = 6,
+	MBO_TRANSITION_REASON_INTERFERENCE = 7,
+	MBO_TRANSITION_REASON_GRAY_ZONE = 8,
+	MBO_TRANSITION_REASON_PREMIUM_AP = 9,
+};
+
+/* MBO v0.0_r19, 4.2.7: Transition Rejection Reason Code Attribute */
+/* Table 4-21: Transition Rejection Reason Code Field Values */
+enum mbo_transition_reject_reason {
+	MBO_TRANSITION_REJECT_REASON_UNSPECIFIED = 0,
+	MBO_TRANSITION_REJECT_REASON_FRAME_LOSS = 1,
+	MBO_TRANSITION_REJECT_REASON_DELAY = 2,
+	MBO_TRANSITION_REJECT_REASON_QOS_CAPACITY = 3,
+	MBO_TRANSITION_REJECT_REASON_RSSI = 4,
+	MBO_TRANSITION_REJECT_REASON_INTERFERENCE = 5,
+	MBO_TRANSITION_REJECT_REASON_SERVICES = 6,
+};
+
+/* MBO v0.0_r19, 4.4: WNM-Notification vendor subelements */
+enum wfa_wnm_notif_subelem_id {
+	WFA_WNM_NOTIF_SUBELEM_NON_PREF_CHAN_REPORT = 2,
+	WFA_WNM_NOTIF_SUBELEM_CELL_DATA_CAPA = 3,
+};
+
+/* MBO v0.0_r25, 4.3: MBO ANQP-elements */
+#define MBO_ANQP_OUI_TYPE 0x12
+#define MBO_ANQP_SUBTYPE_CELL_CONN_PREF 1
+
 /* Wi-Fi Direct (P2P) */
 
 #define P2P_OUI_TYPE 9
@@ -1178,6 +1341,14 @@ enum wifi_display_subelem {
 #define MESH_PATH_PROTOCOL_VENDOR	255
 #define MESH_PATH_METRIC_AIRTIME	1
 #define MESH_PATH_METRIC_VENDOR		255
+/* IEEE 802.11s - Mesh Capability */
+#define MESH_CAP_ACCEPT_ADDITIONAL_PEER	BIT(0)
+#define MESH_CAP_MCCA_SUPPORTED		BIT(1)
+#define MESH_CAP_MCCA_ENABLED		BIT(2)
+#define MESH_CAP_FORWARDING		BIT(3)
+#define MESH_CAP_MBCA_ENABLED		BIT(4)
+#define MESH_CAP_TBTT_ADJUSTING		BIT(5)
+#define MESH_CAP_MESH_PS_LEVEL		BIT(6)
 
 enum plink_action_field {
 	PLINK_OPEN = 1,
@@ -1280,14 +1451,25 @@ enum bss_trans_mgmt_status_code {
 	WNM_BSS_TM_REJECT_LEAVING_ESS = 8
 };
 
+/*
+ * IEEE P802.11-REVmc/D5.0 Table 9-150 - Optional subelement IDs for
+ * neighbor report
+ */
 #define WNM_NEIGHBOR_TSF                         1
 #define WNM_NEIGHBOR_CONDENSED_COUNTRY_STRING    2
 #define WNM_NEIGHBOR_BSS_TRANSITION_CANDIDATE    3
 #define WNM_NEIGHBOR_BSS_TERMINATION_DURATION    4
 #define WNM_NEIGHBOR_BEARING                     5
+#define WNM_NEIGHBOR_WIDE_BW_CHAN                6
+#define WNM_NEIGHBOR_MEASUREMENT_REPORT         39
+#define WNM_NEIGHBOR_HT_CAPAB                   45
+#define WNM_NEIGHBOR_HT_OPER                    61
+#define WNM_NEIGHBOR_SEC_CHAN_OFFSET            62
 #define WNM_NEIGHBOR_MEASUREMENT_PILOT          66
 #define WNM_NEIGHBOR_RRM_ENABLED_CAPABILITIES   70
 #define WNM_NEIGHBOR_MULTIPLE_BSSID             71
+#define WNM_NEIGHBOR_VHT_CAPAB                 191
+#define WNM_NEIGHBOR_VHT_OPER                  192
 
 /* QoS action */
 enum qos_action {
@@ -1356,6 +1538,8 @@ struct tpc_report {
 	u8 link_margin;
 } STRUCT_PACKED;
 
+#define RRM_CAPABILITIES_IE_LEN 5
+
 /* IEEE Std 802.11-2012, 8.5.7.4 - Link Measurement Request frame format */
 struct rrm_link_measurement_request {
 	u8 dialog_token;
@@ -1375,8 +1559,6 @@ struct rrm_link_measurement_report {
 	u8 variable[0];
 } STRUCT_PACKED;
 
-#define SSID_MAX_LEN 32
-
 /* IEEE Std 802.11ad-2012 - Multi-band element */
 struct multi_band_ie {
 	u8 eid; /* WLAN_EID_MULTI_BAND */
@@ -1433,4 +1615,49 @@ enum fst_action {
 	FST_ACTION_ON_CHANNEL_TUNNEL = 5,
 };
 
+/* IEEE Std 802.11ac-2013, Annex C - dot11PHYType */
+enum phy_type {
+	PHY_TYPE_UNSPECIFIED = 0,
+	PHY_TYPE_FHSS = 1,
+	PHY_TYPE_DSSS = 2,
+	PHY_TYPE_IRBASEBAND = 3,
+	PHY_TYPE_OFDM = 4,
+	PHY_TYPE_HRDSSS = 5,
+	PHY_TYPE_ERP = 6,
+	PHY_TYPE_HT = 7,
+	PHY_TYPE_DMG = 8,
+	PHY_TYPE_VHT = 9,
+};
+
+/* IEEE P802.11-REVmc/D5.0, 9.4.2.37 - Neighbor Report element */
+/* BSSID Information Field */
+#define NEI_REP_BSSID_INFO_AP_NOT_REACH BIT(0)
+#define NEI_REP_BSSID_INFO_AP_UNKNOWN_REACH BIT(1)
+#define NEI_REP_BSSID_INFO_AP_REACHABLE (BIT(0) | BIT(1))
+#define NEI_REP_BSSID_INFO_SECURITY BIT(2)
+#define NEI_REP_BSSID_INFO_KEY_SCOPE BIT(3)
+#define NEI_REP_BSSID_INFO_SPECTRUM_MGMT BIT(4)
+#define NEI_REP_BSSID_INFO_QOS BIT(5)
+#define NEI_REP_BSSID_INFO_APSD BIT(6)
+#define NEI_REP_BSSID_INFO_RM BIT(7)
+#define NEI_REP_BSSID_INFO_DELAYED_BA BIT(8)
+#define NEI_REP_BSSID_INFO_IMM_BA BIT(9)
+#define NEI_REP_BSSID_INFO_MOBILITY_DOMAIN BIT(10)
+#define NEI_REP_BSSID_INFO_HT BIT(11)
+#define NEI_REP_BSSID_INFO_VHT BIT(12)
+#define NEI_REP_BSSID_INFO_FTM BIT(13)
+
+/*
+ * IEEE P802.11-REVmc/D5.0 Table 9-152 - HT/VHT Operation Information
+ * subfields.
+ * Note: These definitions are not the same as other VHT_CHANWIDTH_*.
+ */
+enum nr_chan_width {
+	NR_CHAN_WIDTH_20 = 0,
+	NR_CHAN_WIDTH_40 = 1,
+	NR_CHAN_WIDTH_80 = 2,
+	NR_CHAN_WIDTH_160 = 3,
+	NR_CHAN_WIDTH_80P80 = 4,
+};
+
 #endif /* IEEE802_11_DEFS_H */
diff --git a/src/common/ieee802_1x_defs.h b/src/common/ieee802_1x_defs.h
index cc88caa8d2f33..a0c1d1bfafc4c 100644
--- a/src/common/ieee802_1x_defs.h
+++ b/src/common/ieee802_1x_defs.h
@@ -10,7 +10,7 @@
 #define IEEE802_1X_DEFS_H
 
 #define CS_ID_LEN		8
-#define CS_ID_GCM_AES_128	{0x00, 0x80, 0x02, 0x00, 0x01, 0x00, 0x00, 0x01}
+#define CS_ID_GCM_AES_128	0x0080020001000001ULL
 #define CS_NAME_GCM_AES_128	"GCM-AES-128"
 
 enum macsec_policy {
diff --git a/src/common/linux_bridge.h b/src/common/linux_bridge.h
new file mode 100644
index 0000000000000..7b768464fb542
--- /dev/null
+++ b/src/common/linux_bridge.h
@@ -0,0 +1,24 @@
+/*
+ * Linux bridge configuration kernel interface
+ * Copyright (c) 2016, Jouni Malinen <j@w1.fi>
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ */
+
+#ifndef LINUX_BRIDGE_H
+#define LINUX_BRIDGE_H
+
+/* This interface is defined in linux/if_bridge.h */
+
+#define BRCTL_GET_VERSION 0
+#define BRCTL_GET_BRIDGES 1
+#define BRCTL_ADD_BRIDGE 2
+#define BRCTL_DEL_BRIDGE 3
+#define BRCTL_ADD_IF 4
+#define BRCTL_DEL_IF 5
+#define BRCTL_GET_BRIDGE_INFO 6
+#define BRCTL_GET_PORT_LIST 7
+#define BRCTL_SET_BRIDGE_FORWARD_DELAY 8
+
+#endif /* LINUX_BRIDGE_H */
diff --git a/src/common/linux_vlan.h b/src/common/linux_vlan.h
new file mode 100644
index 0000000000000..8a1dd6e466406
--- /dev/null
+++ b/src/common/linux_vlan.h
@@ -0,0 +1,52 @@
+/*
+ * Linux VLAN configuration kernel interface
+ * Copyright (c) 2016, Jouni Malinen <j@w1.fi>
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ */
+
+#ifndef LINUX_VLAN_H
+#define LINUX_VLAN_H
+
+/* This ioctl is defined in linux/sockios.h */
+
+#ifndef SIOCSIFVLAN
+#define SIOCSIFVLAN 0x8983
+#endif /* SIOCSIFVLAN */
+
+/* This interface is defined in linux/if_vlan.h */
+
+#define ADD_VLAN_CMD 0
+#define DEL_VLAN_CMD 1
+#define SET_VLAN_INGRESS_PRIORITY_CMD 2
+#define SET_VLAN_EGRESS_PRIORITY_CMD 3
+#define GET_VLAN_INGRESS_PRIORITY_CMD 4
+#define GET_VLAN_EGRESS_PRIORITY_CMD 5
+#define SET_VLAN_NAME_TYPE_CMD 6
+#define SET_VLAN_FLAG_CMD 7
+#define GET_VLAN_REALDEV_NAME_CMD 8
+#define GET_VLAN_VID_CMD 9
+
+#define VLAN_NAME_TYPE_PLUS_VID 0
+#define VLAN_NAME_TYPE_RAW_PLUS_VID 1
+#define VLAN_NAME_TYPE_PLUS_VID_NO_PAD 2
+#define VLAN_NAME_TYPE_RAW_PLUS_VID_NO_PAD 3
+
+struct vlan_ioctl_args {
+	int cmd;
+	char device1[24];
+
+	union {
+		char device2[24];
+		int VID;
+		unsigned int skb_priority;
+		unsigned int name_type;
+		unsigned int bind_type;
+		unsigned int flag;
+	} u;
+
+	short vlan_qos;
+};
+
+#endif /* LINUX_VLAN_H */
diff --git a/src/common/qca-vendor.h b/src/common/qca-vendor.h
index 28985f5194e21..adaec890b58de 100644
--- a/src/common/qca-vendor.h
+++ b/src/common/qca-vendor.h
@@ -89,6 +89,102 @@ enum qca_radiotap_vendor_ids {
  * @QCA_NL80211_VENDOR_SUBCMD_DFS_OFFLOAD_RADAR_DETECTED: Event used by driver,
  *	which supports DFS offloading, to indicate a radar pattern has been
  *	detected. The channel is now unusable.
+ *
+ * @QCA_NL80211_VENDOR_SUBCMD_P2P_LISTEN_OFFLOAD_START: Command used to
+ *	start the P2P Listen offload function in device and pass the listen
+ *	channel, period, interval, count, device types, and vendor specific
+ *	information elements to the device driver and firmware.
+ *	Uses the attributes defines in
+ *	enum qca_wlan_vendor_attr_p2p_listen_offload.
+ *
+ * @QCA_NL80211_VENDOR_SUBCMD_P2P_LISTEN_OFFLOAD_STOP: Command/event used to
+ *	indicate stop request/response of the P2P Listen offload function in
+ *	device. As an event, it indicates either the feature stopped after it
+ *	was already running or feature has actually failed to start. Uses the
+ *	attributes defines in enum qca_wlan_vendor_attr_p2p_listen_offload.
+ *
+ * @QCA_NL80211_VENDOR_SUBCMD_SAP_CONDITIONAL_CHAN_SWITCH: After AP starts
+ *	beaconing, this sub command provides the driver, the frequencies on the
+ *	5 GHz band to check for any radar activity. Driver selects one channel
+ *	from this priority list provided through
+ *	@QCA_WLAN_VENDOR_ATTR_SAP_CONDITIONAL_CHAN_SWITCH_FREQ_LIST and starts
+ *	to check for radar activity on it. If no radar activity is detected
+ *	during the channel availability check period, driver internally switches
+ *	to the selected frequency of operation. If the frequency is zero, driver
+ *	internally selects a channel. The status of this conditional switch is
+ *	indicated through an event using the same sub command through
+ *	@QCA_WLAN_VENDOR_ATTR_SAP_CONDITIONAL_CHAN_SWITCH_STATUS. Attributes are
+ *	listed in qca_wlan_vendor_attr_sap_conditional_chan_switch.
+ *
+ * @QCA_NL80211_VENDOR_SUBCMD_GPIO_CONFIG_COMMAND: Set GPIO pins. This uses the
+ *	attributes defined in enum qca_wlan_gpio_attr.
+ *
+ * @QCA_NL80211_VENDOR_SUBCMD_GET_HW_CAPABILITY: Fetch hardware capabilities.
+ *	This uses @QCA_WLAN_VENDOR_ATTR_GET_HW_CAPABILITY to indicate which
+ *	capabilities are to be fetched and other
+ *	enum qca_wlan_vendor_attr_get_hw_capability attributes to return the
+ *	requested capabilities.
+ *
+ * @QCA_NL80211_VENDOR_SUBCMD_LL_STATS_EXT: Link layer statistics extension.
+ *	enum qca_wlan_vendor_attr_ll_stats_ext attributes are used with this
+ *	command and event.
+ *
+ * @QCA_NL80211_VENDOR_SUBCMD_LOC_GET_CAPA: Get capabilities for
+ *	indoor location features. Capabilities are reported in
+ *	QCA_WLAN_VENDOR_ATTR_LOC_CAPA.
+ *
+ * @QCA_NL80211_VENDOR_SUBCMD_FTM_START_SESSION: Start an FTM
+ *	(fine timing measurement) session with one or more peers.
+ *	Specify Session cookie in QCA_WLAN_VENDOR_ATTR_FTM_SESSION_COOKIE and
+ *	peer information in QCA_WLAN_VENDOR_ATTR_FTM_MEAS_PEERS.
+ *	On success, 0 or more QCA_NL80211_VENDOR_SUBCMD_FTM_MEAS_RESULT
+ *	events will be reported, followed by
+ *	QCA_NL80211_VENDOR_SUBCMD_FTM_SESSION_DONE event to indicate
+ *	end of session.
+ *	Refer to IEEE P802.11-REVmc/D7.0, 11.24.6
+ *
+ * @QCA_NL80211_VENDOR_SUBCMD_FTM_ABORT_SESSION: Abort a running session.
+ *	A QCA_NL80211_VENDOR_SUBCMD_FTM_SESSION_DONE will be reported with
+ *	status code indicating session was aborted.
+ *
+ * @QCA_NL80211_VENDOR_SUBCMD_FTM_MEAS_RESULT: Event with measurement
+ *	results for one peer. Results are reported in
+ *	QCA_WLAN_VENDOR_ATTR_FTM_MEAS_PEER_RESULTS.
+ *
+ * @QCA_NL80211_VENDOR_SUBCMD_FTM_SESSION_DONE: Event triggered when
+ *	FTM session is finished, either successfully or aborted by
+ *	request.
+ *
+ * @QCA_NL80211_VENDOR_SUBCMD_FTM_CFG_RESPONDER: Configure FTM responder
+ *	mode. QCA_WLAN_VENDOR_ATTR_FTM_RESPONDER_ENABLE specifies whether
+ *	to enable or disable the responder. LCI/LCR reports can be
+ *	configured with QCA_WLAN_VENDOR_ATTR_FTM_LCI and
+ *	QCA_WLAN_VENDOR_ATTR_FTM_LCR. Can be called multiple
+ *	times to update the LCI/LCR reports.
+ *
+ * @QCA_NL80211_VENDOR_SUBCMD_AOA_MEAS: Perform a standalone AOA (angle of
+ *	arrival) measurement with a single peer. Specify peer MAC address in
+ *	QCA_WLAN_VENDOR_ATTR_MAC_ADDR and measurement type in
+ *	QCA_WLAN_VENDOR_ATTR_AOA_TYPE. Measurement result is reported in
+ *	QCA_NL80211_VENDOR_SUBCMD_AOA_MEAS_RESULT event.
+ *
+ * @QCA_NL80211_VENDOR_SUBCMD_AOA_ABORT_MEAS: Abort an AOA measurement. Specify
+ *	peer MAC address in QCA_WLAN_VENDOR_ATTR_MAC_ADDR.
+ *
+ * @QCA_NL80211_VENDOR_SUBCMD_AOA_MEAS_RESULT: Event that reports
+ *	the AOA measurement result.
+ *	Peer MAC address reported in QCA_WLAN_VENDOR_ATTR_MAC_ADDR.
+ *	success/failure status is reported in
+ *	QCA_WLAN_VENDOR_ATTR_LOC_SESSION_STATUS.
+ *	Measurement data is reported in QCA_WLAN_VENDOR_ATTR_AOA_MEAS_RESULT.
+ *	The antenna array(s) used in the measurement are reported in
+ *	QCA_WLAN_VENDOR_ATTR_LOC_ANTENNA_ARRAY_MASK.
+ *
+ * @QCA_NL80211_VENDOR_SUBCMD_ENCRYPTION_TEST: Encrypt/decrypt the given
+ *	data as per the given parameters.
+ *
+ * @QCA_NL80211_VENDOR_SUBCMD_GET_CHAIN_RSSI: Get antenna RSSI value for a
+ *	specific chain.
  */
 enum qca_nl80211_vendor_subcmds {
 	QCA_NL80211_VENDOR_SUBCMD_UNSPEC = 0,
@@ -140,7 +236,11 @@ enum qca_nl80211_vendor_subcmds {
 	QCA_NL80211_VENDOR_SUBCMD_DFS_OFFLOAD_CAC_ABORTED = 58,
 	QCA_NL80211_VENDOR_SUBCMD_DFS_OFFLOAD_CAC_NOP_FINISHED = 59,
 	QCA_NL80211_VENDOR_SUBCMD_DFS_OFFLOAD_RADAR_DETECTED = 60,
-	/* 61-90 - reserved for QCA */
+	/* 61-73 - reserved for QCA */
+	/* Wi-Fi configuration subcommands */
+	QCA_NL80211_VENDOR_SUBCMD_SET_WIFI_CONFIGURATION = 74,
+	QCA_NL80211_VENDOR_SUBCMD_GET_WIFI_CONFIGURATION = 75,
+	/* 76-90 - reserved for QCA */
 	QCA_NL80211_VENDOR_SUBCMD_DATA_OFFLOAD = 91,
 	QCA_NL80211_VENDOR_SUBCMD_OCB_SET_CONFIG = 92,
 	QCA_NL80211_VENDOR_SUBCMD_OCB_SET_UTC_TIME = 93,
@@ -156,6 +256,35 @@ enum qca_nl80211_vendor_subcmds {
 	QCA_NL80211_VENDOR_SUBCMD_GET_PREFERRED_FREQ_LIST = 103,
 	QCA_NL80211_VENDOR_SUBCMD_SET_PROBABLE_OPER_CHANNEL = 104,
 	QCA_NL80211_VENDOR_SUBCMD_SETBAND = 105,
+	QCA_NL80211_VENDOR_SUBCMD_TRIGGER_SCAN = 106,
+	QCA_NL80211_VENDOR_SUBCMD_SCAN_DONE = 107,
+	QCA_NL80211_VENDOR_SUBCMD_OTA_TEST = 108,
+	QCA_NL80211_VENDOR_SUBCMD_SET_TXPOWER_SCALE = 109,
+	/* 110..114 - reserved for QCA */
+	QCA_NL80211_VENDOR_SUBCMD_SET_TXPOWER_DECR_DB = 115,
+	/* 116..117 - reserved for QCA */
+	QCA_NL80211_VENDOR_SUBCMD_SET_SAP_CONFIG = 118,
+	QCA_NL80211_VENDOR_SUBCMD_TSF = 119,
+	QCA_NL80211_VENDOR_SUBCMD_WISA = 120,
+	/* 121 - reserved for QCA */
+	QCA_NL80211_VENDOR_SUBCMD_P2P_LISTEN_OFFLOAD_START = 122,
+	QCA_NL80211_VENDOR_SUBCMD_P2P_LISTEN_OFFLOAD_STOP = 123,
+	QCA_NL80211_VENDOR_SUBCMD_SAP_CONDITIONAL_CHAN_SWITCH = 124,
+	QCA_NL80211_VENDOR_SUBCMD_GPIO_CONFIG_COMMAND = 125,
+	QCA_NL80211_VENDOR_SUBCMD_GET_HW_CAPABILITY = 126,
+	QCA_NL80211_VENDOR_SUBCMD_LL_STATS_EXT = 127,
+	/* FTM/indoor location subcommands */
+	QCA_NL80211_VENDOR_SUBCMD_LOC_GET_CAPA = 128,
+	QCA_NL80211_VENDOR_SUBCMD_FTM_START_SESSION = 129,
+	QCA_NL80211_VENDOR_SUBCMD_FTM_ABORT_SESSION = 130,
+	QCA_NL80211_VENDOR_SUBCMD_FTM_MEAS_RESULT = 131,
+	QCA_NL80211_VENDOR_SUBCMD_FTM_SESSION_DONE = 132,
+	QCA_NL80211_VENDOR_SUBCMD_FTM_CFG_RESPONDER = 133,
+	QCA_NL80211_VENDOR_SUBCMD_AOA_MEAS = 134,
+	QCA_NL80211_VENDOR_SUBCMD_AOA_ABORT_MEAS = 135,
+	QCA_NL80211_VENDOR_SUBCMD_AOA_MEAS_RESULT = 136,
+	QCA_NL80211_VENDOR_SUBCMD_ENCRYPTION_TEST = 137,
+	QCA_NL80211_VENDOR_SUBCMD_GET_CHAIN_RSSI = 138,
 };
 
 
@@ -185,6 +314,84 @@ enum qca_wlan_vendor_attr {
 	QCA_WLAN_VENDOR_ATTR_MAX_CONCURRENT_CHANNELS_5_0_BAND = 11,
 	/* Unsigned 32-bit value from enum qca_set_band. */
 	QCA_WLAN_VENDOR_ATTR_SETBAND_VALUE = 12,
+	/* Dummy (NOP) attribute for 64 bit padding */
+	QCA_WLAN_VENDOR_ATTR_PAD = 13,
+	/* Unique FTM session cookie (Unsigned 64 bit). Specified in
+	 * QCA_NL80211_VENDOR_SUBCMD_FTM_START_SESSION. Reported in
+	 * the session in QCA_NL80211_VENDOR_SUBCMD_FTM_MEAS_RESULT and
+	 * QCA_NL80211_VENDOR_SUBCMD_FTM_SESSION_DONE.
+	 */
+	QCA_WLAN_VENDOR_ATTR_FTM_SESSION_COOKIE = 14,
+	/* Indoor location capabilities, returned by
+	 * QCA_NL80211_VENDOR_SUBCMD_LOC_GET_CAPA.
+	 * see enum qca_wlan_vendor_attr_loc_capa.
+	 */
+	QCA_WLAN_VENDOR_ATTR_LOC_CAPA = 15,
+	/* Array of nested attributes containing information about each peer
+	 * in FTM measurement session. See enum qca_wlan_vendor_attr_peer_info
+	 * for supported attributes for each peer.
+	 */
+	QCA_WLAN_VENDOR_ATTR_FTM_MEAS_PEERS = 16,
+	/* Array of nested attributes containing measurement results for
+	 * one or more peers, reported by the
+	 * QCA_NL80211_VENDOR_SUBCMD_FTM_MEAS_RESULT event.
+	 * See enum qca_wlan_vendor_attr_peer_result for list of supported
+	 * attributes.
+	 */
+	QCA_WLAN_VENDOR_ATTR_FTM_MEAS_PEER_RESULTS = 17,
+	/* Flag attribute for enabling or disabling responder functionality. */
+	QCA_WLAN_VENDOR_ATTR_FTM_RESPONDER_ENABLE = 18,
+	/* Used in the QCA_NL80211_VENDOR_SUBCMD_FTM_CFG_RESPONDER
+	 * command to specify the LCI report that will be sent by
+	 * the responder during a measurement exchange. The format is
+	 * defined in IEEE P802.11-REVmc/D7.0, 9.4.2.22.10.
+	 */
+	QCA_WLAN_VENDOR_ATTR_FTM_LCI = 19,
+	/* Used in the QCA_NL80211_VENDOR_SUBCMD_FTM_CFG_RESPONDER
+	 * command to specify the location civic report that will
+	 * be sent by the responder during a measurement exchange.
+	 * The format is defined in IEEE P802.11-REVmc/D7.0, 9.4.2.22.13.
+	 */
+	QCA_WLAN_VENDOR_ATTR_FTM_LCR = 20,
+	/* Session/measurement completion status code,
+	 * reported in QCA_NL80211_VENDOR_SUBCMD_FTM_SESSION_DONE and
+	 * QCA_NL80211_VENDOR_SUBCMD_AOA_MEAS_RESULT
+	 * see enum qca_vendor_attr_loc_session_status.
+	 */
+	QCA_WLAN_VENDOR_ATTR_LOC_SESSION_STATUS = 21,
+	/* Initial dialog token used by responder (0 if not specified),
+	 * unsigned 8 bit value.
+	 */
+	QCA_WLAN_VENDOR_ATTR_FTM_INITIAL_TOKEN = 22,
+	/* AOA measurement type. Requested in QCA_NL80211_VENDOR_SUBCMD_AOA_MEAS
+	 * and optionally in QCA_NL80211_VENDOR_SUBCMD_FTM_START_SESSION if
+	 * AOA measurements are needed as part of an FTM session.
+	 * Reported by QCA_NL80211_VENDOR_SUBCMD_AOA_MEAS_RESULT. See
+	 * enum qca_wlan_vendor_attr_aoa_type.
+	 */
+	QCA_WLAN_VENDOR_ATTR_AOA_TYPE = 23,
+	/* A bit mask (unsigned 32 bit value) of antenna arrays used
+	 * by indoor location measurements. Refers to the antenna
+	 * arrays described by QCA_VENDOR_ATTR_LOC_CAPA_ANTENNA_ARRAYS.
+	 */
+	QCA_WLAN_VENDOR_ATTR_LOC_ANTENNA_ARRAY_MASK = 24,
+	/* AOA measurement data. Its contents depends on the AOA measurement
+	 * type and antenna array mask:
+	 * QCA_WLAN_VENDOR_ATTR_AOA_TYPE_TOP_CIR_PHASE: array of U16 values,
+	 * phase of the strongest CIR path for each antenna in the measured
+	 * array(s).
+	 * QCA_WLAN_VENDOR_ATTR_AOA_TYPE_TOP_CIR_PHASE_AMP: array of 2 U16
+	 * values, phase and amplitude of the strongest CIR path for each
+	 * antenna in the measured array(s).
+	 */
+	QCA_WLAN_VENDOR_ATTR_AOA_MEAS_RESULT = 25,
+	/* Used in QCA_NL80211_VENDOR_SUBCMD_GET_CHAIN_RSSI command
+	 * to specify the chain number (unsigned 32 bit value) to inquire
+	 * the corresponding antenna RSSI value */
+	QCA_WLAN_VENDOR_ATTR_CHAIN_INDEX = 26,
+	/* Used in QCA_NL80211_VENDOR_SUBCMD_GET_CHAIN_RSSI command
+	 * to report the specific antenna RSSI value (unsigned 32 bit value) */
+	QCA_WLAN_VENDOR_ATTR_CHAIN_RSSI = 27,
 	/* keep last */
 	QCA_WLAN_VENDOR_ATTR_AFTER_LAST,
 	QCA_WLAN_VENDOR_ATTR_MAX	= QCA_WLAN_VENDOR_ATTR_AFTER_LAST - 1,
@@ -205,12 +412,50 @@ enum qca_wlan_vendor_attr_roam_auth {
 	QCA_WLAN_VENDOR_ATTR_ROAM_AUTH_KEY_REPLAY_CTR,
 	QCA_WLAN_VENDOR_ATTR_ROAM_AUTH_PTK_KCK,
 	QCA_WLAN_VENDOR_ATTR_ROAM_AUTH_PTK_KEK,
+	QCA_WLAN_VENDOR_ATTR_ROAM_AUTH_SUBNET_STATUS,
 	/* keep last */
 	QCA_WLAN_VENDOR_ATTR_ROAM_AUTH_AFTER_LAST,
 	QCA_WLAN_VENDOR_ATTR_ROAM_AUTH_MAX =
 	QCA_WLAN_VENDOR_ATTR_ROAM_AUTH_AFTER_LAST - 1
 };
 
+enum qca_wlan_vendor_attr_p2p_listen_offload {
+	QCA_WLAN_VENDOR_ATTR_P2P_LISTEN_OFFLOAD_INVALID = 0,
+	/* A 32-bit unsigned value; the P2P listen frequency (MHz); must be one
+	 * of the social channels.
+	 */
+	QCA_WLAN_VENDOR_ATTR_P2P_LISTEN_OFFLOAD_CHANNEL,
+	/* A 32-bit unsigned value; the P2P listen offload period (ms).
+	 */
+	QCA_WLAN_VENDOR_ATTR_P2P_LISTEN_OFFLOAD_PERIOD,
+	/* A 32-bit unsigned value; the P2P listen interval duration (ms).
+	 */
+	QCA_WLAN_VENDOR_ATTR_P2P_LISTEN_OFFLOAD_INTERVAL,
+	/* A 32-bit unsigned value; number of interval times the firmware needs
+	 * to run the offloaded P2P listen operation before it stops.
+	 */
+	QCA_WLAN_VENDOR_ATTR_P2P_LISTEN_OFFLOAD_COUNT,
+	/* An array of arbitrary binary data with one or more 8-byte values.
+	 * The device types include both primary and secondary device types.
+	 */
+	QCA_WLAN_VENDOR_ATTR_P2P_LISTEN_OFFLOAD_DEVICE_TYPES,
+	/* An array of unsigned 8-bit characters; vendor information elements.
+	 */
+	QCA_WLAN_VENDOR_ATTR_P2P_LISTEN_OFFLOAD_VENDOR_IE,
+	/* A 32-bit unsigned value; a control flag to indicate whether listen
+	 * results need to be flushed to wpa_supplicant.
+	 */
+	QCA_WLAN_VENDOR_ATTR_P2P_LISTEN_OFFLOAD_CTRL_FLAG,
+	/* A 8-bit unsigned value; reason code for P2P listen offload stop
+	 * event.
+	 */
+	QCA_WLAN_VENDOR_ATTR_P2P_LISTEN_OFFLOAD_STOP_REASON,
+	/* keep last */
+	QCA_WLAN_VENDOR_ATTR_P2P_LISTEN_OFFLOAD_AFTER_LAST,
+	QCA_WLAN_VENDOR_ATTR_P2P_LISTEN_OFFLOAD_MAX =
+	QCA_WLAN_VENDOR_ATTR_P2P_LISTEN_OFFLOAD_AFTER_LAST - 1
+};
+
 enum qca_wlan_vendor_attr_acs_offload {
 	QCA_WLAN_VENDOR_ATTR_ACS_CHANNEL_INVALID = 0,
 	QCA_WLAN_VENDOR_ATTR_ACS_PRIMARY_CHANNEL,
@@ -247,11 +492,21 @@ enum qca_wlan_vendor_acs_hw_mode {
  *	after roaming, rather than having the user space wpa_supplicant do it.
  * @QCA_WLAN_VENDOR_FEATURE_SUPPORT_HW_MODE_ANY: Device supports automatic
  *	band selection based on channel selection results.
+ * @QCA_WLAN_VENDOR_FEATURE_OFFCHANNEL_SIMULTANEOUS: Device supports
+ * 	simultaneous off-channel operations.
+ * @QCA_WLAN_VENDOR_FEATURE_P2P_LISTEN_OFFLOAD: Device supports P2P
+ *	Listen offload; a mechanism where the station's firmware takes care of
+ *	responding to incoming Probe Request frames received from other P2P
+ *	Devices whilst in Listen state, rather than having the user space
+ *	wpa_supplicant do it. Information from received P2P requests are
+ *	forwarded from firmware to host whenever the host processor wakes up.
  * @NUM_QCA_WLAN_VENDOR_FEATURES: Number of assigned feature bits
  */
 enum qca_wlan_vendor_features {
 	QCA_WLAN_VENDOR_FEATURE_KEY_MGMT_OFFLOAD	= 0,
 	QCA_WLAN_VENDOR_FEATURE_SUPPORT_HW_MODE_ANY     = 1,
+	QCA_WLAN_VENDOR_FEATURE_OFFCHANNEL_SIMULTANEOUS = 2,
+	QCA_WLAN_VENDOR_FEATURE_P2P_LISTEN_OFFLOAD	= 3,
 	NUM_QCA_WLAN_VENDOR_FEATURES /* keep last */
 };
 
@@ -324,6 +579,67 @@ enum qca_set_band {
 	QCA_SETBAND_2G,
 };
 
+/**
+ * enum qca_access_policy - Access control policy
+ *
+ * Access control policy is applied on the configured IE
+ * (QCA_WLAN_VENDOR_ATTR_CONFIG_ACCESS_POLICY_IE).
+ * To be set with QCA_WLAN_VENDOR_ATTR_CONFIG_ACCESS_POLICY.
+ *
+ * @QCA_ACCESS_POLICY_ACCEPT_UNLESS_LISTED: Deny Wi-Fi connections which match
+ *	the specific configuration (IE) set, i.e., allow all the
+ *	connections which do not match the configuration.
+ * @QCA_ACCESS_POLICY_DENY_UNLESS_LISTED: Accept Wi-Fi connections which match
+ *	the specific configuration (IE) set, i.e., deny all the
+ *	connections which do not match the configuration.
+ */
+enum qca_access_policy {
+	QCA_ACCESS_POLICY_ACCEPT_UNLESS_LISTED,
+	QCA_ACCESS_POLICY_DENY_UNLESS_LISTED,
+};
+
+/**
+ * enum qca_vendor_attr_get_tsf: Vendor attributes for TSF capture
+ * @QCA_WLAN_VENDOR_ATTR_TSF_CMD: enum qca_tsf_operation (u32)
+ * @QCA_WLAN_VENDOR_ATTR_TSF_TIMER_VALUE: Unsigned 64 bit TSF timer value
+ * @QCA_WLAN_VENDOR_ATTR_TSF_SOC_TIMER_VALUE: Unsigned 64 bit Synchronized
+ *	SOC timer value at TSF capture
+ */
+enum qca_vendor_attr_tsf_cmd {
+	QCA_WLAN_VENDOR_ATTR_TSF_INVALID = 0,
+	QCA_WLAN_VENDOR_ATTR_TSF_CMD,
+	QCA_WLAN_VENDOR_ATTR_TSF_TIMER_VALUE,
+	QCA_WLAN_VENDOR_ATTR_TSF_SOC_TIMER_VALUE,
+	QCA_WLAN_VENDOR_ATTR_TSF_AFTER_LAST,
+	QCA_WLAN_VENDOR_ATTR_TSF_MAX =
+	QCA_WLAN_VENDOR_ATTR_TSF_AFTER_LAST - 1
+};
+
+/**
+ * enum qca_tsf_operation: TSF driver commands
+ * @QCA_TSF_CAPTURE: Initiate TSF Capture
+ * @QCA_TSF_GET: Get TSF capture value
+ * @QCA_TSF_SYNC_GET: Initiate TSF capture and return with captured value
+ */
+enum qca_tsf_cmd {
+	QCA_TSF_CAPTURE,
+	QCA_TSF_GET,
+	QCA_TSF_SYNC_GET,
+};
+
+/**
+ * enum qca_vendor_attr_wisa_cmd
+ * @QCA_WLAN_VENDOR_ATTR_WISA_MODE: WISA mode value (u32)
+ * WISA setup vendor commands
+ */
+enum qca_vendor_attr_wisa_cmd {
+	QCA_WLAN_VENDOR_ATTR_WISA_INVALID = 0,
+	QCA_WLAN_VENDOR_ATTR_WISA_MODE,
+	QCA_WLAN_VENDOR_ATTR_WISA_AFTER_LAST,
+	QCA_WLAN_VENDOR_ATTR_WISA_MAX =
+	QCA_WLAN_VENDOR_ATTR_WISA_AFTER_LAST - 1
+};
+
 /* IEEE 802.11 Vendor Specific elements */
 
 /**
@@ -349,9 +665,926 @@ enum qca_set_band {
  *
  *	This vendor element may be included in GO Negotiation Request, P2P
  *	Invitation Request, and Provision Discovery Request frames.
+ *
+ * @QCA_VENDOR_ELEM_HE_CAPAB: HE Capabilities element.
+ *	This element can be used for pre-standard publication testing of HE
+ *	before P802.11ax draft assigns the element ID. The payload of this
+ *	vendor specific element is defined by the latest P802.11ax draft.
+ *	Please note that the draft is still work in progress and this element
+ *	payload is subject to change.
+ *
+ * @QCA_VENDOR_ELEM_HE_OPER: HE Operation element.
+ *	This element can be used for pre-standard publication testing of HE
+ *	before P802.11ax draft assigns the element ID. The payload of this
+ *	vendor specific element is defined by the latest P802.11ax draft.
+ *	Please note that the draft is still work in progress and this element
+ *	payload is subject to change.
  */
 enum qca_vendor_element_id {
 	QCA_VENDOR_ELEM_P2P_PREF_CHAN_LIST = 0,
+	QCA_VENDOR_ELEM_HE_CAPAB = 1,
+	QCA_VENDOR_ELEM_HE_OPER = 2,
+};
+
+/**
+ * enum qca_wlan_vendor_attr_scan - Specifies vendor scan attributes
+ *
+ * @QCA_WLAN_VENDOR_ATTR_SCAN_IE: IEs that should be included as part of scan
+ * @QCA_WLAN_VENDOR_ATTR_SCAN_FREQUENCIES: Nested unsigned 32-bit attributes
+ *	with frequencies to be scanned (in MHz)
+ * @QCA_WLAN_VENDOR_ATTR_SCAN_SSIDS: Nested attribute with SSIDs to be scanned
+ * @QCA_WLAN_VENDOR_ATTR_SCAN_SUPP_RATES: Nested array attribute of supported
+ *	rates to be included
+ * @QCA_WLAN_VENDOR_ATTR_SCAN_TX_NO_CCK_RATE: flag used to send probe requests
+ * 	at non CCK rate in 2GHz band
+ * @QCA_WLAN_VENDOR_ATTR_SCAN_FLAGS: Unsigned 32-bit scan flags
+ * @QCA_WLAN_VENDOR_ATTR_SCAN_COOKIE: Unsigned 64-bit cookie provided by the
+ * 	driver for the specific scan request
+ * @QCA_WLAN_VENDOR_ATTR_SCAN_STATUS: Unsigned 8-bit status of the scan
+ * 	request decoded as in enum scan_status
+ * @QCA_WLAN_VENDOR_ATTR_SCAN_MAC: 6-byte MAC address to use when randomisation
+ * 	scan flag is set
+ * @QCA_WLAN_VENDOR_ATTR_SCAN_MAC_MASK: 6-byte MAC address mask to be used with
+ * 	randomisation
+ */
+enum qca_wlan_vendor_attr_scan {
+	QCA_WLAN_VENDOR_ATTR_SCAN_INVALID_PARAM = 0,
+	QCA_WLAN_VENDOR_ATTR_SCAN_IE,
+	QCA_WLAN_VENDOR_ATTR_SCAN_FREQUENCIES,
+	QCA_WLAN_VENDOR_ATTR_SCAN_SSIDS,
+	QCA_WLAN_VENDOR_ATTR_SCAN_SUPP_RATES,
+	QCA_WLAN_VENDOR_ATTR_SCAN_TX_NO_CCK_RATE,
+	QCA_WLAN_VENDOR_ATTR_SCAN_FLAGS,
+	QCA_WLAN_VENDOR_ATTR_SCAN_COOKIE,
+	QCA_WLAN_VENDOR_ATTR_SCAN_STATUS,
+	QCA_WLAN_VENDOR_ATTR_SCAN_MAC,
+	QCA_WLAN_VENDOR_ATTR_SCAN_MAC_MASK,
+	QCA_WLAN_VENDOR_ATTR_SCAN_AFTER_LAST,
+	QCA_WLAN_VENDOR_ATTR_SCAN_MAX =
+	QCA_WLAN_VENDOR_ATTR_SCAN_AFTER_LAST - 1
+};
+
+/**
+ * enum scan_status - Specifies the valid values the vendor scan attribute
+ * 	QCA_WLAN_VENDOR_ATTR_SCAN_STATUS can take
+ *
+ * @VENDOR_SCAN_STATUS_NEW_RESULTS: implies the vendor scan is successful with
+ * 	new scan results
+ * @VENDOR_SCAN_STATUS_ABORTED: implies the vendor scan was aborted in-between
+ */
+enum scan_status {
+	VENDOR_SCAN_STATUS_NEW_RESULTS,
+	VENDOR_SCAN_STATUS_ABORTED,
+	VENDOR_SCAN_STATUS_MAX,
+};
+
+/**
+ * enum qca_vendor_attr_ota_test - Specifies the values for vendor
+ *                       command QCA_NL80211_VENDOR_SUBCMD_OTA_TEST
+ * @QCA_WLAN_VENDOR_ATTR_OTA_TEST_ENABLE: enable ota test
+ */
+enum qca_vendor_attr_ota_test {
+	QCA_WLAN_VENDOR_ATTR_OTA_TEST_INVALID,
+	/* 8-bit unsigned value to indicate if OTA test is enabled */
+	QCA_WLAN_VENDOR_ATTR_OTA_TEST_ENABLE,
+	/* keep last */
+	QCA_WLAN_VENDOR_ATTR_OTA_TEST_AFTER_LAST,
+	QCA_WLAN_VENDOR_ATTR_OTA_TEST_MAX =
+	QCA_WLAN_VENDOR_ATTR_OTA_TEST_AFTER_LAST - 1
+};
+
+/**
+ * enum qca_vendor_attr_txpower_scale - vendor sub commands index
+ *
+ * @QCA_WLAN_VENDOR_ATTR_TXPOWER_SCALE: scaling value
+ */
+enum qca_vendor_attr_txpower_scale {
+	QCA_WLAN_VENDOR_ATTR_TXPOWER_SCALE_INVALID,
+	/* 8-bit unsigned value to indicate the scaling of tx power */
+	QCA_WLAN_VENDOR_ATTR_TXPOWER_SCALE,
+	/* keep last */
+	QCA_WLAN_VENDOR_ATTR_TXPOWER_SCALE_AFTER_LAST,
+	QCA_WLAN_VENDOR_ATTR_TXPOWER_SCALE_MAX =
+	QCA_WLAN_VENDOR_ATTR_TXPOWER_SCALE_AFTER_LAST - 1
+};
+
+/**
+ * enum qca_vendor_attr_txpower_decr_db - Attributes for TX power decrease
+ *
+ * These attributes are used with QCA_NL80211_VENDOR_SUBCMD_SET_TXPOWER_DECR_DB.
+ */
+enum qca_vendor_attr_txpower_decr_db {
+	QCA_WLAN_VENDOR_ATTR_TXPOWER_DECR_DB_INVALID,
+	/* 8-bit unsigned value to indicate the reduction of TX power in dB for
+	 * a virtual interface. */
+	QCA_WLAN_VENDOR_ATTR_TXPOWER_DECR_DB,
+	/* keep last */
+	QCA_WLAN_VENDOR_ATTR_TXPOWER_DECR_DB_AFTER_LAST,
+	QCA_WLAN_VENDOR_ATTR_TXPOWER_DECR_DB_MAX =
+	QCA_WLAN_VENDOR_ATTR_TXPOWER_DECR_DB_AFTER_LAST - 1
+};
+
+/* Attributes for data used by
+ * QCA_NL80211_VENDOR_SUBCMD_SET_WIFI_CONFIGURATION and
+ * QCA_NL80211_VENDOR_SUBCMD_GET_WIFI_CONFIGURATION subcommands.
+ */
+enum qca_wlan_vendor_attr_config {
+	QCA_WLAN_VENDOR_ATTR_CONFIG_INVALID = 0,
+	/* Unsigned 32-bit value to set the DTIM period.
+	 * Whether the wifi chipset wakes at every dtim beacon or a multiple of
+	 * the DTIM period. If DTIM is set to 3, the STA shall wake up every 3
+	 * DTIM beacons.
+	 */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_DYNAMIC_DTIM = 1,
+	/* Unsigned 32-bit value to set the wifi_iface stats averaging factor
+	 * used to calculate statistics like average the TSF offset or average
+	 * number of frame leaked.
+	 * For instance, upon Beacon frame reception:
+	 * current_avg = ((beacon_TSF - TBTT) * factor + previous_avg * (0x10000 - factor) ) / 0x10000
+	 * For instance, when evaluating leaky APs:
+	 * current_avg = ((num frame received within guard time) * factor + previous_avg * (0x10000 - factor)) / 0x10000
+	 */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_STATS_AVG_FACTOR = 2,
+	/* Unsigned 32-bit value to configure guard time, i.e., when
+	 * implementing IEEE power management based on frame control PM bit, how
+	 * long the driver waits before shutting down the radio and after
+	 * receiving an ACK frame for a Data frame with PM bit set.
+	 */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_GUARD_TIME = 3,
+	/* Unsigned 32-bit value to change the FTM capability dynamically */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_FINE_TIME_MEASUREMENT = 4,
+	/* Unsigned 16-bit value to configure maximum TX rate dynamically */
+	QCA_WLAN_VENDOR_ATTR_CONF_TX_RATE = 5,
+	/* Unsigned 32-bit value to configure the number of continuous
+	 * Beacon Miss which shall be used by the firmware to penalize
+	 * the RSSI.
+	 */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_PENALIZE_AFTER_NCONS_BEACON_MISS = 6,
+	/* Unsigned 8-bit value to configure the channel avoidance indication
+	 * behavior. Firmware to send only one indication and ignore duplicate
+	 * indications when set to avoid multiple Apps wakeups.
+	 */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_CHANNEL_AVOIDANCE_IND = 7,
+	/* 8-bit unsigned value to configure the maximum TX MPDU for
+	 * aggregation. */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_TX_MPDU_AGGREGATION = 8,
+	/* 8-bit unsigned value to configure the maximum RX MPDU for
+	 * aggregation. */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_RX_MPDU_AGGREGATION = 9,
+	/* 8-bit unsigned value to configure the Non aggregrate/11g sw
+	 * retry threshold (0 disable, 31 max). */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_NON_AGG_RETRY = 10,
+	/* 8-bit unsigned value to configure the aggregrate sw
+	 * retry threshold (0 disable, 31 max). */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_AGG_RETRY = 11,
+	/* 8-bit unsigned value to configure the MGMT frame
+	 * retry threshold (0 disable, 31 max). */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_MGMT_RETRY = 12,
+	/* 8-bit unsigned value to configure the CTRL frame
+	 * retry threshold (0 disable, 31 max). */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_CTRL_RETRY = 13,
+	/* 8-bit unsigned value to configure the propagation delay for
+	 * 2G/5G band (0~63, units in us) */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_PROPAGATION_DELAY = 14,
+	/* Unsigned 32-bit value to configure the number of unicast TX fail
+	 * packet count. The peer is disconnected once this threshold is
+	 * reached. */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_TX_FAIL_COUNT = 15,
+	/* Attribute used to set scan default IEs to the driver.
+	 *
+	 * These IEs can be used by scan operations that will be initiated by
+	 * the driver/firmware.
+	 *
+	 * For further scan requests coming to the driver, these IEs should be
+	 * merged with the IEs received along with scan request coming to the
+	 * driver. If a particular IE is present in the scan default IEs but not
+	 * present in the scan request, then that IE should be added to the IEs
+	 * sent in the Probe Request frames for that scan request. */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_SCAN_DEFAULT_IES = 16,
+	/* Unsigned 32-bit attribute for generic commands */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_GENERIC_COMMAND = 17,
+	/* Unsigned 32-bit value attribute for generic commands */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_GENERIC_VALUE = 18,
+	/* Unsigned 32-bit data attribute for generic command response */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_GENERIC_DATA = 19,
+	/* Unsigned 32-bit length attribute for
+	 * QCA_WLAN_VENDOR_ATTR_CONFIG_GENERIC_DATA */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_GENERIC_LENGTH = 20,
+	/* Unsigned 32-bit flags attribute for
+	 * QCA_WLAN_VENDOR_ATTR_CONFIG_GENERIC_DATA */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_GENERIC_FLAGS = 21,
+	/* Unsigned 32-bit, defining the access policy.
+	 * See enum qca_access_policy. Used with
+	 * QCA_WLAN_VENDOR_ATTR_CONFIG_ACCESS_POLICY_IE_LIST. */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_ACCESS_POLICY = 22,
+	/* Sets the list of full set of IEs for which a specific access policy
+	 * has to be applied. Used along with
+	 * QCA_WLAN_VENDOR_ATTR_CONFIG_ACCESS_POLICY to control the access.
+	 * Zero length payload can be used to clear this access constraint. */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_ACCESS_POLICY_IE_LIST = 23,
+	/* Unsigned 32-bit, specifies the interface index (netdev) for which the
+	 * corresponding configurations are applied. If the interface index is
+	 * not specified, the configurations are attributed to the respective
+	 * wiphy. */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_IFINDEX = 24,
+	/* 8-bit unsigned value to trigger QPower: 1-Enable, 0-Disable */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_QPOWER = 25,
+	/* 8-bit unsigned value to configure the driver and below layers to
+	 * ignore the assoc disallowed set by APs while connecting
+	 * 1-Ignore, 0-Don't ignore */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_IGNORE_ASSOC_DISALLOWED = 26,
+	/* 32-bit unsigned value to trigger antenna diversity features:
+	 * 1-Enable, 0-Disable */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_ANT_DIV_ENA = 27,
+	/* 32-bit unsigned value to configure specific chain antenna */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_ANT_DIV_CHAIN = 28,
+	/* 32-bit unsigned value to trigger cycle selftest
+	 * 1-Enable, 0-Disable */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_ANT_DIV_SELFTEST = 29,
+	/* 32-bit unsigned to configure the cycle time of selftest
+	 * the unit is micro-second */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_ANT_DIV_SELFTEST_INTVL = 30,
+
+	/* keep last */
+	QCA_WLAN_VENDOR_ATTR_CONFIG_AFTER_LAST,
+	QCA_WLAN_VENDOR_ATTR_CONFIG_MAX =
+	QCA_WLAN_VENDOR_ATTR_CONFIG_AFTER_LAST - 1,
+};
+
+/**
+ * enum qca_wlan_vendor_attr_sap_config - Parameters for AP configuration
+ */
+enum qca_wlan_vendor_attr_sap_config {
+	QCA_WLAN_VENDOR_ATTR_SAP_CONFIG_INVALID = 0,
+	/* 1 - reserved for QCA */
+	/* List of frequencies on which AP is expected to operate.
+	 * This is irrespective of ACS configuration. This list is a priority
+	 * based one and is looked for before the AP is created to ensure the
+	 * best concurrency sessions (avoid MCC and use DBS/SCC) co-exist in
+	 * the system.
+	 */
+	QCA_WLAN_VENDOR_ATTR_SAP_MANDATORY_FREQUENCY_LIST = 2,
+
+	QCA_WLAN_VENDOR_ATTR_SAP_CONFIG_AFTER_LAST,
+	QCA_WLAN_VENDOR_ATTR_SAP_CONFIG_MAX =
+	QCA_WLAN_VENDOR_ATTR_SAP_CONFIG_AFTER_LAST - 1,
+};
+
+/**
+ * enum qca_wlan_vendor_attr_sap_conditional_chan_switch - Parameters for AP
+ *					conditional channel switch
+ */
+enum qca_wlan_vendor_attr_sap_conditional_chan_switch {
+	QCA_WLAN_VENDOR_ATTR_SAP_CONDITIONAL_CHAN_SWITCH_INVALID = 0,
+	/* Priority based frequency list (an array of u32 values in host byte
+	 * order) */
+	QCA_WLAN_VENDOR_ATTR_SAP_CONDITIONAL_CHAN_SWITCH_FREQ_LIST = 1,
+	/* Status of the conditional switch (u32).
+	 * 0: Success, Non-zero: Failure
+	 */
+	QCA_WLAN_VENDOR_ATTR_SAP_CONDITIONAL_CHAN_SWITCH_STATUS = 2,
+
+	QCA_WLAN_VENDOR_ATTR_SAP_CONDITIONAL_CHAN_SWITCH_AFTER_LAST,
+	QCA_WLAN_VENDOR_ATTR_SAP_CONDITIONAL_CHAN_SWITCH_MAX =
+	QCA_WLAN_VENDOR_ATTR_SAP_CONDITIONAL_CHAN_SWITCH_AFTER_LAST - 1,
+};
+
+/**
+ * enum qca_wlan_gpio_attr - Parameters for GPIO configuration
+ */
+enum qca_wlan_gpio_attr {
+	QCA_WLAN_VENDOR_ATTR_GPIO_PARAM_INVALID = 0,
+	/* Unsigned 32-bit attribute for GPIO command */
+	QCA_WLAN_VENDOR_ATTR_GPIO_PARAM_COMMAND,
+	/* Unsigned 32-bit attribute for GPIO PIN number to configure */
+	QCA_WLAN_VENDOR_ATTR_GPIO_PARAM_PINNUM,
+	/* Unsigned 32-bit attribute for GPIO value to configure */
+	QCA_WLAN_VENDOR_ATTR_GPIO_PARAM_VALUE,
+	/* Unsigned 32-bit attribute for GPIO pull type */
+	QCA_WLAN_VENDOR_ATTR_GPIO_PARAM_PULL_TYPE,
+	/* Unsigned 32-bit attribute for GPIO interrupt mode */
+	QCA_WLAN_VENDOR_ATTR_GPIO_PARAM_INTR_MODE,
+
+	/* keep last */
+	QCA_WLAN_VENDOR_ATTR_GPIO_PARAM_LAST,
+	QCA_WLAN_VENDOR_ATTR_GPIO_PARAM_MAX =
+	QCA_WLAN_VENDOR_ATTR_GPIO_PARAM_LAST - 1
+};
+
+/**
+ * enum qca_wlan_vendor_attr_get_hw_capability - Wi-Fi hardware capability
+ */
+enum qca_wlan_vendor_attr_get_hw_capability {
+	QCA_WLAN_VENDOR_ATTR_HW_CAPABILITY_INVALID,
+	/* Antenna isolation
+	 * An attribute used in the response.
+	 * The content of this attribute is encoded in a byte array. Each byte
+	 * value is an antenna isolation value. The array length is the number
+	 * of antennas.
+	 */
+	QCA_WLAN_VENDOR_ATTR_ANTENNA_ISOLATION,
+	/* Request HW capability
+	 * An attribute used in the request.
+	 * The content of this attribute is a u32 array for one or more of
+	 * hardware capabilities (attribute IDs) that are being requested. Each
+	 * u32 value has a value from this
+	 * enum qca_wlan_vendor_attr_get_hw_capability
+	 * identifying which capabilities are requested.
+	 */
+	QCA_WLAN_VENDOR_ATTR_GET_HW_CAPABILITY,
+
+	/* keep last */
+	QCA_WLAN_VENDOR_ATTR_HW_CAPABILITY_AFTER_LAST,
+	QCA_WLAN_VENDOR_ATTR_HW_CAPABILITY_MAX =
+	QCA_WLAN_VENDOR_ATTR_HW_CAPABILITY_AFTER_LAST - 1,
+};
+
+/**
+ * enum qca_wlan_vendor_attr_ll_stats_ext - Attributes for MAC layer monitoring
+ *    offload which is an extension for LL_STATS.
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_CFG_PERIOD: Monitoring period. Unit in ms.
+ *    If MAC counters do not exceed the threshold, FW will report monitored
+ *    link layer counters periodically as this setting. The first report is
+ *    always triggered by this timer.
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_CFG_THRESHOLD: It is a percentage (1-99).
+ *    For each MAC layer counter, FW holds two copies. One is the current value.
+ *    The other is the last report. Once a current counter's increment is larger
+ *    than the threshold, FW will indicate that counter to host even if the
+ *    monitoring timer does not expire.
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_PEER_PS_CHG: Peer STA power state change
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TID: TID of MSDU
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_NUM_MSDU: Count of MSDU with the same
+ *    failure code.
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_STATUS: TX failure code
+ *    1: TX packet discarded
+ *    2: No ACK
+ *    3: Postpone
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_PEER_MAC_ADDRESS: peer MAC address
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_PEER_PS_STATE: Peer STA current state
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_GLOBAL: Global threshold.
+ *    Threshold for all monitored parameters. If per counter dedicated threshold
+ *    is not enabled, this threshold will take effect.
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_EVENT_MODE: Indicate what triggers this
+ *    event, PERORID_TIMEOUT == 1, THRESH_EXCEED == 0.
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_IFACE_ID: interface ID
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_PEER_ID: peer ID
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_BITMAP: bitmap for TX counters
+ *    Bit0: TX counter unit in MSDU
+ *    Bit1: TX counter unit in MPDU
+ *    Bit2: TX counter unit in PPDU
+ *    Bit3: TX counter unit in byte
+ *    Bit4: Dropped MSDUs
+ *    Bit5: Dropped Bytes
+ *    Bit6: MPDU retry counter
+ *    Bit7: MPDU failure counter
+ *    Bit8: PPDU failure counter
+ *    Bit9: MPDU aggregation counter
+ *    Bit10: MCS counter for ACKed MPDUs
+ *    Bit11: MCS counter for Failed MPDUs
+ *    Bit12: TX Delay counter
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_BITMAP: bitmap for RX counters
+ *    Bit0: MAC RX counter unit in MPDU
+ *    Bit1: MAC RX counter unit in byte
+ *    Bit2: PHY RX counter unit in PPDU
+ *    Bit3: PHY RX counter unit in byte
+ *    Bit4: Disorder counter
+ *    Bit5: Retry counter
+ *    Bit6: Duplication counter
+ *    Bit7: Discard counter
+ *    Bit8: MPDU aggregation size counter
+ *    Bit9: MCS counter
+ *    Bit10: Peer STA power state change (wake to sleep) counter
+ *    Bit11: Peer STA power save counter, total time in PS mode
+ *    Bit12: Probe request counter
+ *    Bit13: Other management frames counter
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_CCA_BSS_BITMAP: bitmap for CCA
+ *    Bit0: Idle time
+ *    Bit1: TX time
+ *    Bit2: time RX in current bss
+ *    Bit3: Out of current bss time
+ *    Bit4: Wireless medium busy time
+ *    Bit5: RX in bad condition time
+ *    Bit6: TX in bad condition time
+ *    Bit7: time wlan card not available
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_SIGNAL_BITMAP: bitmap for signal
+ *    Bit0: Per channel SNR counter
+ *    Bit1: Per channel noise floor counter
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_PEER_NUM: number of peers
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_CHANNEL_NUM: number of channels
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_PEER_AC_RX_NUM: number of RX stats
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_CCA_BSS: per channel BSS CCA stats
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_PEER: container for per PEER stats
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_MSDU: Number of total TX MSDUs
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_MPDU: Number of total TX MPDUs
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_PPDU: Number of total TX PPDUs
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_BYTES: bytes of TX data
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_DROP: Number of dropped TX packets
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_DROP_BYTES: Bytes dropped
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_RETRY: waiting time without an ACK
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_NO_ACK: number of MPDU not-ACKed
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_NO_BACK: number of PPDU not-ACKed
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_AGGR_NUM:
+ *    aggregation stats buffer length
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_SUCC_MCS_NUM: length of mcs stats
+ *    buffer for ACKed MPDUs.
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_FAIL_MCS_NUM: length of mcs stats
+ *    buffer for failed MPDUs.
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_DELAY_ARRAY_SIZE:
+ *    length of delay stats array.
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_AGGR: TX aggregation stats
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_SUCC_MCS: MCS stats for ACKed MPDUs
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_FAIL_MCS: MCS stats for failed MPDUs
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_DELAY: tx delay stats
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_MPDU: MPDUs received
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_MPDU_BYTES: bytes received
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_PPDU: PPDU received
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_PPDU_BYTES: PPDU bytes received
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_MPDU_LOST: packets lost
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_MPDU_RETRY: number of RX packets
+ *    flagged as retransmissions
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_MPDU_DUP: number of RX packets
+ *    flagged as duplicated
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_MPDU_DISCARD: number of RX
+ *    packets discarded
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_AGGR_NUM: length of RX aggregation
+ *    stats buffer.
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_MCS_NUM: length of RX mcs
+ *    stats buffer.
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_MCS: RX mcs stats buffer
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_AGGR: aggregation stats buffer
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_PEER_PS_TIMES: times STAs go to sleep
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_PEER_PS_DURATION: STAs' total sleep time
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_PROBE_REQ: number of probe
+ *    requests received
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_MGMT: number of other mgmt
+ *    frames received
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_IDLE_TIME: Percentage of idle time
+ *    there is no TX, nor RX, nor interference.
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_TIME: percentage of time
+ *    transmitting packets.
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_TIME: percentage of time
+ *    for receiving.
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_BUSY: percentage of time
+ *    interference detected.
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_BAD: percentage of time
+ *    receiving packets with errors.
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_BAD: percentage of time
+ *    TX no-ACK.
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_NO_AVAIL: percentage of time
+ *    the chip is unable to work in normal conditions.
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_IN_BSS_TIME: percentage of time
+ *    receiving packets in current BSS.
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_OUT_BSS_TIME: percentage of time
+ *    receiving packets not in current BSS.
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_PEER_ANT_NUM: number of antennas
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_PEER_SIGNAL:
+ *    This is a container for per antenna signal stats.
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_ANT_SNR: per antenna SNR value
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_ANT_NF: per antenna NF value
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_IFACE_RSSI_BEACON: RSSI of beacon
+ * @QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_IFACE_SNR_BEACON: SNR of beacon
+ */
+enum qca_wlan_vendor_attr_ll_stats_ext {
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_INVALID = 0,
+
+	/* Attributes for configurations */
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_CFG_PERIOD,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_CFG_THRESHOLD,
+
+	/* Peer STA power state change */
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_PEER_PS_CHG,
+
+	/* TX failure event */
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TID,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_NUM_MSDU,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_STATUS,
+
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_PEER_PS_STATE,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_PEER_MAC_ADDRESS,
+
+	/* MAC counters */
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_GLOBAL,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_EVENT_MODE,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_IFACE_ID,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_PEER_ID,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_BITMAP,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_BITMAP,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_CCA_BSS_BITMAP,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_SIGNAL_BITMAP,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_PEER_NUM,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_CHANNEL_NUM,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_CCA_BSS,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_PEER,
+
+	/* Sub-attributes for PEER_AC_TX */
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_MSDU,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_MPDU,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_PPDU,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_BYTES,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_DROP,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_DROP_BYTES,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_RETRY,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_NO_ACK,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_NO_BACK,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_AGGR_NUM,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_SUCC_MCS_NUM,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_FAIL_MCS_NUM,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_AGGR,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_SUCC_MCS,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_FAIL_MCS,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_DELAY_ARRAY_SIZE,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_DELAY,
+
+	/* Sub-attributes for PEER_AC_RX */
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_MPDU,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_MPDU_BYTES,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_PPDU,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_PPDU_BYTES,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_MPDU_LOST,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_MPDU_RETRY,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_MPDU_DUP,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_MPDU_DISCARD,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_AGGR_NUM,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_MCS_NUM,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_MCS,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_AGGR,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_PEER_PS_TIMES,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_PEER_PS_DURATION,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_PROBE_REQ,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_MGMT,
+
+	/* Sub-attributes for CCA_BSS */
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_IDLE_TIME,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_TIME,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_TIME,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_BUSY,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_RX_BAD,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_TX_BAD,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_NO_AVAIL,
+
+	/* sub-attribute for BSS_RX_TIME */
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_IN_BSS_TIME,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_OUT_BSS_TIME,
+
+	/* Sub-attributes for PEER_SIGNAL */
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_PEER_ANT_NUM,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_PEER_SIGNAL,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_ANT_SNR,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_ANT_NF,
+
+	/* Sub-attributes for IFACE_BSS */
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_IFACE_RSSI_BEACON,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_IFACE_SNR_BEACON,
+
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_LAST,
+	QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_MAX =
+		QCA_WLAN_VENDOR_ATTR_LL_STATS_EXT_LAST - 1
+};
+
+/* Attributes for FTM commands and events */
+
+/**
+ * enum qca_wlan_vendor_attr_loc_capa - Indoor location capabilities
+ *
+ * @QCA_WLAN_VENDOR_ATTR_LOC_CAPA_FLAGS: Various flags. See
+ *	enum qca_wlan_vendor_attr_loc_capa_flags.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_CAPA_MAX_NUM_SESSIONS: Maximum number
+ *	of measurement sessions that can run concurrently.
+ *	Default is one session (no session concurrency).
+ * @QCA_WLAN_VENDOR_ATTR_FTM_CAPA_MAX_NUM_PEERS: The total number of unique
+ *	peers that are supported in running sessions. For example,
+ *	if the value is 8 and maximum number of sessions is 2, you can
+ *	have one session with 8 unique peers, or 2 sessions with 4 unique
+ *	peers each, and so on.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_CAPA_MAX_NUM_BURSTS_EXP: Maximum number
+ *	of bursts per peer, as an exponent (2^value). Default is 0,
+ *	meaning no multi-burst support.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_CAPA_MAX_MEAS_PER_BURST: Maximum number
+ *	of measurement exchanges allowed in a single burst.
+ * @QCA_WLAN_VENDOR_ATTR_AOA_CAPA_SUPPORTED_TYPES: Supported AOA measurement
+ *	types. A bit mask (unsigned 32 bit value), each bit corresponds
+ *	to an AOA type as defined by enum qca_vendor_attr_aoa_type.
+ */
+enum qca_wlan_vendor_attr_loc_capa {
+	QCA_WLAN_VENDOR_ATTR_LOC_CAPA_INVALID,
+	QCA_WLAN_VENDOR_ATTR_LOC_CAPA_FLAGS,
+	QCA_WLAN_VENDOR_ATTR_FTM_CAPA_MAX_NUM_SESSIONS,
+	QCA_WLAN_VENDOR_ATTR_FTM_CAPA_MAX_NUM_PEERS,
+	QCA_WLAN_VENDOR_ATTR_FTM_CAPA_MAX_NUM_BURSTS_EXP,
+	QCA_WLAN_VENDOR_ATTR_FTM_CAPA_MAX_MEAS_PER_BURST,
+	QCA_WLAN_VENDOR_ATTR_AOA_CAPA_SUPPORTED_TYPES,
+	/* keep last */
+	QCA_WLAN_VENDOR_ATTR_LOC_CAPA_AFTER_LAST,
+	QCA_WLAN_VENDOR_ATTR_LOC_CAPA_MAX =
+	QCA_WLAN_VENDOR_ATTR_LOC_CAPA_AFTER_LAST - 1,
+};
+
+/**
+ * enum qca_wlan_vendor_attr_loc_capa_flags: Indoor location capability flags
+ *
+ * @QCA_WLAN_VENDOR_ATTR_LOC_CAPA_FLAG_FTM_RESPONDER: Set if driver
+ *	can be configured as an FTM responder (for example, an AP that
+ *	services FTM requests). QCA_NL80211_VENDOR_SUBCMD_FTM_CFG_RESPONDER
+ *	will be supported if set.
+ * @QCA_WLAN_VENDOR_ATTR_LOC_CAPA_FLAG_FTM_INITIATOR: Set if driver
+ *	can run FTM sessions. QCA_NL80211_VENDOR_SUBCMD_FTM_START_SESSION
+ *	will be supported if set.
+* @QCA_WLAN_VENDOR_ATTR_LOC_CAPA_FLAG_ASAP: Set if FTM responder
+ *	supports immediate (ASAP) response.
+ * @QCA_WLAN_VENDOR_ATTR_LOC_CAPA_FLAG_AOA: Set if driver supports standalone
+ *	AOA measurement using QCA_NL80211_VENDOR_SUBCMD_AOA_MEAS.
+ * @QCA_WLAN_VENDOR_ATTR_LOC_CAPA_FLAG_AOA_IN_FTM: Set if driver supports
+ *	requesting AOA measurements as part of an FTM session.
+ */
+enum qca_wlan_vendor_attr_loc_capa_flags {
+	QCA_WLAN_VENDOR_ATTR_LOC_CAPA_FLAG_FTM_RESPONDER = 1 << 0,
+	QCA_WLAN_VENDOR_ATTR_LOC_CAPA_FLAG_FTM_INITIATOR = 1 << 1,
+	QCA_WLAN_VENDOR_ATTR_LOC_CAPA_FLAG_ASAP = 1 << 2,
+	QCA_WLAN_VENDOR_ATTR_LOC_CAPA_FLAG_AOA = 1 << 3,
+	QCA_WLAN_VENDOR_ATTR_LOC_CAPA_FLAG_AOA_IN_FTM = 1 << 4,
+};
+
+/**
+ * enum qca_wlan_vendor_attr_ftm_peer_info: Information about
+ *	a single peer in a measurement session.
+ *
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PEER_MAC_ADDR: The MAC address of the peer.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PEER_MEAS_FLAGS: Various flags related
+ *	to measurement. See enum qca_wlan_vendor_attr_ftm_peer_meas_flags.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PEER_MEAS_PARAMS: Nested attribute of
+ *	FTM measurement parameters, as specified by IEEE P802.11-REVmc/D7.0
+ *	9.4.2.167. See enum qca_wlan_vendor_attr_ftm_meas_param for
+ *	list of supported attributes.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PEER_SECURE_TOKEN_ID: Initial token ID for
+ *	secure measurement.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PEER_AOA_BURST_PERIOD: Request AOA
+ *	measurement every <value> bursts. If 0 or not specified,
+ *	AOA measurements will be disabled for this peer.
+ */
+enum qca_wlan_vendor_attr_ftm_peer_info {
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_INVALID,
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_MAC_ADDR,
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_MEAS_FLAGS,
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_MEAS_PARAMS,
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_SECURE_TOKEN_ID,
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_AOA_BURST_PERIOD,
+	/* keep last */
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_AFTER_LAST,
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_MAX =
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_AFTER_LAST - 1,
+};
+
+/**
+ * enum qca_wlan_vendor_attr_ftm_peer_meas_flags: Measurement request flags,
+ *	per-peer
+ *
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PEER_MEAS_FLAG_ASAP: If set, request
+ *	immediate (ASAP) response from peer.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PEER_MEAS_FLAG_LCI: If set, request
+ *	LCI report from peer. The LCI report includes the absolute
+ *	location of the peer in "official" coordinates (similar to GPS).
+ *	See IEEE P802.11-REVmc/D7.0, 11.24.6.7 for more information.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PEER_MEAS_FLAG_LCR: If set, request
+ *	Location civic report from peer. The LCR includes the location
+ *	of the peer in free-form format. See IEEE P802.11-REVmc/D7.0,
+ *	11.24.6.7 for more information.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PEER_MEAS_FLAG_SECURE: If set,
+ *	request a secure measurement.
+ *	QCA_WLAN_VENDOR_ATTR_FTM_PEER_SECURE_TOKEN_ID must also be provided.
+ */
+enum qca_wlan_vendor_attr_ftm_peer_meas_flags {
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_MEAS_FLAG_ASAP	= 1 << 0,
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_MEAS_FLAG_LCI	= 1 << 1,
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_MEAS_FLAG_LCR	= 1 << 2,
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_MEAS_FLAG_SECURE	= 1 << 3,
+};
+
+/**
+ * enum qca_wlan_vendor_attr_ftm_meas_param: Measurement parameters
+ *
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PARAM_MEAS_PER_BURST: Number of measurements
+ *	to perform in a single burst.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PARAM_NUM_BURSTS_EXP: Number of bursts to
+ *	perform, specified as an exponent (2^value).
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PARAM_BURST_DURATION: Duration of burst
+ *	instance, as specified in IEEE P802.11-REVmc/D7.0, 9.4.2.167.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PARAM_BURST_PERIOD: Time between bursts,
+ *	as specified in IEEE P802.11-REVmc/D7.0, 9.4.2.167. Must
+ *	be larger than QCA_WLAN_VENDOR_ATTR_FTM_PARAM_BURST_DURATION.
+ */
+enum qca_wlan_vendor_attr_ftm_meas_param {
+	QCA_WLAN_VENDOR_ATTR_FTM_PARAM_INVALID,
+	QCA_WLAN_VENDOR_ATTR_FTM_PARAM_MEAS_PER_BURST,
+	QCA_WLAN_VENDOR_ATTR_FTM_PARAM_NUM_BURSTS_EXP,
+	QCA_WLAN_VENDOR_ATTR_FTM_PARAM_BURST_DURATION,
+	QCA_WLAN_VENDOR_ATTR_FTM_PARAM_BURST_PERIOD,
+	/* keep last */
+	QCA_WLAN_VENDOR_ATTR_FTM_PARAM_AFTER_LAST,
+	QCA_WLAN_VENDOR_ATTR_FTM_PARAM_MAX =
+	QCA_WLAN_VENDOR_ATTR_FTM_PARAM_AFTER_LAST - 1,
+};
+
+/**
+ * enum qca_wlan_vendor_attr_ftm_peer_result: Per-peer results
+ *
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_MAC_ADDR: MAC address of the reported
+ *	 peer.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_STATUS: Status of measurement
+ *	request for this peer.
+ *	See enum qca_wlan_vendor_attr_ftm_peer_result_status.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_FLAGS: Various flags related
+ *	to measurement results for this peer.
+ *	See enum qca_wlan_vendor_attr_ftm_peer_result_flags.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_VALUE_SECONDS: Specified when
+ *	request failed and peer requested not to send an additional request
+ *	for this number of seconds.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_LCI: LCI report when received
+ *	from peer. In the format specified by IEEE P802.11-REVmc/D7.0,
+ *	9.4.2.22.10.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_LCR: Location civic report when
+ *	received from peer. In the format specified by IEEE P802.11-REVmc/D7.0,
+ *	9.4.2.22.13.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_MEAS_PARAMS: Reported when peer
+ *	overridden some measurement request parameters. See
+ *	enum qca_wlan_vendor_attr_ftm_meas_param.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_AOA_MEAS: AOA measurement
+ *	for this peer. Same contents as @QCA_WLAN_VENDOR_ATTR_AOA_MEAS_RESULT.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_MEAS: Array of measurement
+ *	results. Each entry is a nested attribute defined
+ *	by enum qca_wlan_vendor_attr_ftm_meas.
+ */
+enum qca_wlan_vendor_attr_ftm_peer_result {
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_INVALID,
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_MAC_ADDR,
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_STATUS,
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_FLAGS,
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_VALUE_SECONDS,
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_LCI,
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_LCR,
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_MEAS_PARAMS,
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_AOA_MEAS,
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_MEAS,
+	/* keep last */
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_AFTER_LAST,
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_MAX =
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_AFTER_LAST - 1,
+};
+
+/**
+ * enum qca_wlan_vendor_attr_ftm_peer_result_status
+ *
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_STATUS_OK: Request sent ok and results
+ *	will be provided. Peer may have overridden some measurement parameters,
+ *	in which case overridden parameters will be report by
+ *	QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_MEAS_PARAM attribute.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_STATUS_INCAPABLE: Peer is incapable
+ *	of performing the measurement request. No more results will be sent
+ *	for this peer in this session.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_STATUS_FAILED: Peer reported request
+ *	failed, and requested not to send an additional request for number
+ *	of seconds specified by QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_VALUE_SECONDS
+ *	attribute.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_STATUS_INVALID: Request validation
+ *	failed. Request was not sent over the air.
+ */
+enum qca_wlan_vendor_attr_ftm_peer_result_status {
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_STATUS_OK,
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_STATUS_INCAPABLE,
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_STATUS_FAILED,
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_STATUS_INVALID,
+};
+
+/**
+ * enum qca_wlan_vendor_attr_ftm_peer_result_flags: Various flags
+ *  for measurement result, per-peer
+ *
+ * @QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_FLAG_DONE: If set,
+ *	measurement completed for this peer. No more results will be reported
+ *	for this peer in this session.
+ */
+enum qca_wlan_vendor_attr_ftm_peer_result_flags {
+	QCA_WLAN_VENDOR_ATTR_FTM_PEER_RES_FLAG_DONE = 1 << 0,
+};
+
+/**
+ * enum qca_vendor_attr_loc_session_status: Session completion status code
+ *
+ * @QCA_WLAN_VENDOR_ATTR_LOC_SESSION_STATUS_OK: Session completed
+ *	successfully.
+ * @QCA_WLAN_VENDOR_ATTR_LOC_SESSION_STATUS_ABORTED: Session aborted
+ *	by request.
+ * @QCA_WLAN_VENDOR_ATTR_LOC_SESSION_STATUS_INVALID: Session request
+ *	was invalid and was not started.
+ * @QCA_WLAN_VENDOR_ATTR_LOC_SESSION_STATUS_FAILED: Session had an error
+ *	and did not complete normally (for example out of resources).
+ */
+enum qca_vendor_attr_loc_session_status {
+	QCA_WLAN_VENDOR_ATTR_LOC_SESSION_STATUS_OK,
+	QCA_WLAN_VENDOR_ATTR_LOC_SESSION_STATUS_ABORTED,
+	QCA_WLAN_VENDOR_ATTR_LOC_SESSION_STATUS_INVALID,
+	QCA_WLAN_VENDOR_ATTR_LOC_SESSION_STATUS_FAILED,
+};
+
+/**
+ * enum qca_wlan_vendor_attr_ftm_meas: Single measurement data
+ *
+ * @QCA_WLAN_VENDOR_ATTR_FTM_MEAS_T1: Time of departure (TOD) of FTM packet as
+ *	recorded by responder, in picoseconds.
+ *	See IEEE P802.11-REVmc/D7.0, 11.24.6.4 for more information.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_MEAS_T2: Time of arrival (TOA) of FTM packet at
+ *	initiator, in picoseconds.
+ *	See IEEE P802.11-REVmc/D7.0, 11.24.6.4 for more information.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_MEAS_T3: TOD of ACK packet as recorded by
+ *	initiator, in picoseconds.
+ *	See IEEE P802.11-REVmc/D7.0, 11.24.6.4 for more information.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_MEAS_T4: TOA of ACK packet at
+ *	responder, in picoseconds.
+ *	See IEEE P802.11-REVmc/D7.0, 11.24.6.4 for more information.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_MEAS_RSSI: RSSI (signal level) as recorded
+ *	during this measurement exchange. Optional and will be provided if
+ *	the hardware can measure it.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_MEAS_TOD_ERR: TOD error reported by
+ *	responder. Not always provided.
+ *	See IEEE P802.11-REVmc/D7.0, 9.6.8.33 for more information.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_MEAS_TOA_ERR: TOA error reported by
+ *	responder. Not always provided.
+ *	See IEEE P802.11-REVmc/D7.0, 9.6.8.33 for more information.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_MEAS_INITIATOR_TOD_ERR: TOD error measured by
+ *	initiator. Not always provided.
+ *	See IEEE P802.11-REVmc/D7.0, 9.6.8.33 for more information.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_MEAS_INITIATOR_TOA_ERR: TOA error measured by
+ *	initiator. Not always provided.
+ *	See IEEE P802.11-REVmc/D7.0, 9.6.8.33 for more information.
+ * @QCA_WLAN_VENDOR_ATTR_FTM_MEAS_PAD: Dummy attribute for padding.
+ */
+enum qca_wlan_vendor_attr_ftm_meas {
+	QCA_WLAN_VENDOR_ATTR_FTM_MEAS_INVALID,
+	QCA_WLAN_VENDOR_ATTR_FTM_MEAS_T1,
+	QCA_WLAN_VENDOR_ATTR_FTM_MEAS_T2,
+	QCA_WLAN_VENDOR_ATTR_FTM_MEAS_T3,
+	QCA_WLAN_VENDOR_ATTR_FTM_MEAS_T4,
+	QCA_WLAN_VENDOR_ATTR_FTM_MEAS_RSSI,
+	QCA_WLAN_VENDOR_ATTR_FTM_MEAS_TOD_ERR,
+	QCA_WLAN_VENDOR_ATTR_FTM_MEAS_TOA_ERR,
+	QCA_WLAN_VENDOR_ATTR_FTM_MEAS_INITIATOR_TOD_ERR,
+	QCA_WLAN_VENDOR_ATTR_FTM_MEAS_INITIATOR_TOA_ERR,
+	QCA_WLAN_VENDOR_ATTR_FTM_MEAS_PAD,
+	/* keep last */
+	QCA_WLAN_VENDOR_ATTR_FTM_MEAS_AFTER_LAST,
+	QCA_WLAN_VENDOR_ATTR_FTM_MEAS_MAX =
+	QCA_WLAN_VENDOR_ATTR_FTM_MEAS_AFTER_LAST - 1,
+};
+
+/**
+ * enum qca_wlan_vendor_attr_aoa_type - AOA measurement type
+ *
+ * @QCA_WLAN_VENDOR_ATTR_AOA_TYPE_TOP_CIR_PHASE: Phase of the strongest
+ *	CIR (channel impulse response) path for each antenna.
+ * @QCA_WLAN_VENDOR_ATTR_AOA_TYPE_TOP_CIR_PHASE_AMP: Phase and amplitude
+ *	of the strongest CIR path for each antenna.
+ */
+enum qca_wlan_vendor_attr_aoa_type {
+	QCA_WLAN_VENDOR_ATTR_AOA_TYPE_TOP_CIR_PHASE,
+	QCA_WLAN_VENDOR_ATTR_AOA_TYPE_TOP_CIR_PHASE_AMP,
+	QCA_WLAN_VENDOR_ATTR_AOA_TYPE_MAX
+};
+
+/**
+ * enum qca_wlan_vendor_attr_encryption_test - Attributes to
+ * validate encryption engine
+ *
+ * @QCA_WLAN_VENDOR_ATTR_ENCRYPTION_TEST_NEEDS_DECRYPTION: Flag attribute.
+ *	This will be included if the request is for decryption; if not included,
+ *	the request is treated as a request for encryption by default.
+ * @QCA_WLAN_VENDOR_ATTR_ENCRYPTION_TEST_CIPHER: Unsigned 32-bit value
+ *	indicating the key cipher suite. Takes same values as
+ *	NL80211_ATTR_KEY_CIPHER.
+ * @QCA_WLAN_VENDOR_ATTR_ENCRYPTION_TEST_KEYID: Unsigned 8-bit value
+ *	Key Id to be used for encryption
+ * @QCA_WLAN_VENDOR_ATTR_ENCRYPTION_TEST_TK: Array of 8-bit values.
+ *	Key (TK) to be used for encryption/decryption
+ * @QCA_WLAN_VENDOR_ATTR_ENCRYPTION_TEST_PN: Array of 8-bit values.
+ *	Packet number to be specified for encryption/decryption
+ *	6 bytes for TKIP/CCMP/GCMP.
+ * @QCA_WLAN_VENDOR_ATTR_ENCRYPTION_TEST_DATA: Array of 8-bit values
+ *	representing the 802.11 packet (header + payload + FCS) that
+ *	needs to be encrypted/decrypted.
+ *	Encrypted/decrypted response from the driver will also be sent
+ *	to userspace with the same attribute.
+ */
+enum qca_wlan_vendor_attr_encryption_test {
+	QCA_WLAN_VENDOR_ATTR_ENCRYPTION_TEST_INVALID = 0,
+	QCA_WLAN_VENDOR_ATTR_ENCRYPTION_TEST_NEEDS_DECRYPTION,
+	QCA_WLAN_VENDOR_ATTR_ENCRYPTION_TEST_CIPHER,
+	QCA_WLAN_VENDOR_ATTR_ENCRYPTION_TEST_KEYID,
+	QCA_WLAN_VENDOR_ATTR_ENCRYPTION_TEST_TK,
+	QCA_WLAN_VENDOR_ATTR_ENCRYPTION_TEST_PN,
+	QCA_WLAN_VENDOR_ATTR_ENCRYPTION_TEST_DATA,
+
+	/* keep last */
+	QCA_WLAN_VENDOR_ATTR_ENCRYPTION_TEST_AFTER_LAST,
+	QCA_WLAN_VENDOR_ATTR_ENCRYPTION_TEST_MAX =
+	QCA_WLAN_VENDOR_ATTR_ENCRYPTION_TEST_AFTER_LAST - 1
 };
 
 #endif /* QCA_VENDOR_H */
diff --git a/src/common/sae.c b/src/common/sae.c
index 503fa1d7b9a96..9f70f036ba763 100644
--- a/src/common/sae.c
+++ b/src/common/sae.c
@@ -1,6 +1,6 @@
 /*
  * Simultaneous authentication of equals
- * Copyright (c) 2012-2015, Jouni Malinen <j@w1.fi>
+ * Copyright (c) 2012-2016, Jouni Malinen <j@w1.fi>
  *
  * This software may be distributed under the terms of the BSD license.
  * See README for more details.
@@ -275,8 +275,9 @@ static int sae_test_pwd_seed_ecc(struct sae_data *sae, const u8 *pwd_seed,
 
 	/* pwd-value = KDF-z(pwd-seed, "SAE Hunting and Pecking", p) */
 	bits = crypto_ec_prime_len_bits(sae->tmp->ec);
-	sha256_prf_bits(pwd_seed, SHA256_MAC_LEN, "SAE Hunting and Pecking",
-			prime, sae->tmp->prime_len, pwd_value, bits);
+	if (sha256_prf_bits(pwd_seed, SHA256_MAC_LEN, "SAE Hunting and Pecking",
+			    prime, sae->tmp->prime_len, pwd_value, bits) < 0)
+		return -1;
 	if (bits % 8)
 		buf_shift_right(pwd_value, sizeof(pwd_value), 8 - bits % 8);
 	wpa_hexdump_key(MSG_DEBUG, "SAE: pwd-value",
@@ -318,11 +319,10 @@ static int sae_test_pwd_seed_ffc(struct sae_data *sae, const u8 *pwd_seed,
 	wpa_hexdump_key(MSG_DEBUG, "SAE: pwd-seed", pwd_seed, SHA256_MAC_LEN);
 
 	/* pwd-value = KDF-z(pwd-seed, "SAE Hunting and Pecking", p) */
-	sha256_prf_bits(pwd_seed, SHA256_MAC_LEN, "SAE Hunting and Pecking",
-			sae->tmp->dh->prime, sae->tmp->prime_len, pwd_value,
-			bits);
-	if (bits % 8)
-		buf_shift_right(pwd_value, sizeof(pwd_value), 8 - bits % 8);
+	if (sha256_prf_bits(pwd_seed, SHA256_MAC_LEN, "SAE Hunting and Pecking",
+			    sae->tmp->dh->prime, sae->tmp->prime_len, pwd_value,
+			    bits) < 0)
+		return -1;
 	wpa_hexdump_key(MSG_DEBUG, "SAE: pwd-value", pwd_value,
 			sae->tmp->prime_len);
 
@@ -811,11 +811,13 @@ static int sae_derive_keys(struct sae_data *sae, const u8 *k)
 	crypto_bignum_mod(tmp, sae->tmp->order, tmp);
 	crypto_bignum_to_bin(tmp, val, sizeof(val), sae->tmp->prime_len);
 	wpa_hexdump(MSG_DEBUG, "SAE: PMKID", val, SAE_PMKID_LEN);
-	sha256_prf(keyseed, sizeof(keyseed), "SAE KCK and PMK",
-		   val, sae->tmp->prime_len, keys, sizeof(keys));
+	if (sha256_prf(keyseed, sizeof(keyseed), "SAE KCK and PMK",
+		       val, sae->tmp->prime_len, keys, sizeof(keys)) < 0)
+		goto fail;
 	os_memset(keyseed, 0, sizeof(keyseed));
 	os_memcpy(sae->tmp->kck, keys, SAE_KCK_LEN);
 	os_memcpy(sae->pmk, keys + SAE_KCK_LEN, SAE_PMK_LEN);
+	os_memcpy(sae->pmkid, val, SAE_PMKID_LEN);
 	os_memset(keys, 0, sizeof(keys));
 	wpa_hexdump_key(MSG_DEBUG, "SAE: KCK", sae->tmp->kck, SAE_KCK_LEN);
 	wpa_hexdump_key(MSG_DEBUG, "SAE: PMK", sae->pmk, SAE_PMK_LEN);
@@ -923,7 +925,7 @@ static void sae_parse_commit_token(struct sae_data *sae, const u8 **pos,
 				   const u8 *end, const u8 **token,
 				   size_t *token_len)
 {
-	if (*pos + (sae->tmp->ec ? 3 : 2) * sae->tmp->prime_len < end) {
+	if ((sae->tmp->ec ? 3 : 2) * sae->tmp->prime_len < end - *pos) {
 		size_t tlen = end - (*pos + (sae->tmp->ec ? 3 : 2) *
 				     sae->tmp->prime_len);
 		wpa_hexdump(MSG_DEBUG, "SAE: Anti-Clogging Token", *pos, tlen);
@@ -946,7 +948,7 @@ static u16 sae_parse_commit_scalar(struct sae_data *sae, const u8 **pos,
 {
 	struct crypto_bignum *peer_scalar;
 
-	if (*pos + sae->tmp->prime_len > end) {
+	if (sae->tmp->prime_len > end - *pos) {
 		wpa_printf(MSG_DEBUG, "SAE: Not enough data for scalar");
 		return WLAN_STATUS_UNSPECIFIED_FAILURE;
 	}
@@ -994,7 +996,7 @@ static u16 sae_parse_commit_element_ecc(struct sae_data *sae, const u8 *pos,
 {
 	u8 prime[SAE_MAX_ECC_PRIME_LEN];
 
-	if (pos + 2 * sae->tmp->prime_len > end) {
+	if (2 * sae->tmp->prime_len > end - pos) {
 		wpa_printf(MSG_DEBUG, "SAE: Not enough data for "
 			   "commit-element");
 		return WLAN_STATUS_UNSPECIFIED_FAILURE;
@@ -1040,7 +1042,7 @@ static u16 sae_parse_commit_element_ffc(struct sae_data *sae, const u8 *pos,
 	struct crypto_bignum *res, *one;
 	const u8 one_bin[1] = { 0x01 };
 
-	if (pos + sae->tmp->prime_len > end) {
+	if (sae->tmp->prime_len > end - pos) {
 		wpa_printf(MSG_DEBUG, "SAE: Not enough data for "
 			   "commit-element");
 		return WLAN_STATUS_UNSPECIFIED_FAILURE;
@@ -1098,7 +1100,7 @@ u16 sae_parse_commit(struct sae_data *sae, const u8 *data, size_t len,
 	u16 res;
 
 	/* Check Finite Cyclic Group */
-	if (pos + 2 > end)
+	if (end - pos < 2)
 		return WLAN_STATUS_UNSPECIFIED_FAILURE;
 	res = sae_group_allowed(sae, allowed_groups, WPA_GET_LE16(pos));
 	if (res != WLAN_STATUS_SUCCESS)
diff --git a/src/common/sae.h b/src/common/sae.h
index c07026cd497cc..a4270bc22d14a 100644
--- a/src/common/sae.h
+++ b/src/common/sae.h
@@ -45,6 +45,7 @@ struct sae_data {
 	enum { SAE_NOTHING, SAE_COMMITTED, SAE_CONFIRMED, SAE_ACCEPTED } state;
 	u16 send_confirm;
 	u8 pmk[SAE_PMK_LEN];
+	u8 pmkid[SAE_PMKID_LEN];
 	struct crypto_bignum *peer_commit_scalar;
 	int group;
 	int sync;
diff --git a/src/common/version.h b/src/common/version.h
index a5cc5b7b5bccb..75e5c6e006cce 100644
--- a/src/common/version.h
+++ b/src/common/version.h
@@ -5,6 +5,10 @@
 #define VERSION_STR_POSTFIX ""
 #endif /* VERSION_STR_POSTFIX */
 
-#define VERSION_STR "2.5" VERSION_STR_POSTFIX
+#ifndef GIT_VERSION_STR_POSTFIX
+#define GIT_VERSION_STR_POSTFIX ""
+#endif /* GIT_VERSION_STR_POSTFIX */
+
+#define VERSION_STR "2.6" VERSION_STR_POSTFIX GIT_VERSION_STR_POSTFIX
 
 #endif /* VERSION_H */
diff --git a/src/common/wpa_common.c b/src/common/wpa_common.c
index e9d4248d72d45..299b8bbee031a 100644
--- a/src/common/wpa_common.c
+++ b/src/common/wpa_common.c
@@ -292,38 +292,47 @@ static int wpa_ft_parse_ftie(const u8 *ie, size_t ie_len,
 	pos = ie + sizeof(struct rsn_ftie);
 	end = ie + ie_len;
 
-	while (pos + 2 <= end && pos + 2 + pos[1] <= end) {
-		switch (pos[0]) {
+	while (end - pos >= 2) {
+		u8 id, len;
+
+		id = *pos++;
+		len = *pos++;
+		if (len > end - pos)
+			break;
+
+		switch (id) {
 		case FTIE_SUBELEM_R1KH_ID:
-			if (pos[1] != FT_R1KH_ID_LEN) {
-				wpa_printf(MSG_DEBUG, "FT: Invalid R1KH-ID "
-					   "length in FTIE: %d", pos[1]);
+			if (len != FT_R1KH_ID_LEN) {
+				wpa_printf(MSG_DEBUG,
+					   "FT: Invalid R1KH-ID length in FTIE: %d",
+					   len);
 				return -1;
 			}
-			parse->r1kh_id = pos + 2;
+			parse->r1kh_id = pos;
 			break;
 		case FTIE_SUBELEM_GTK:
-			parse->gtk = pos + 2;
-			parse->gtk_len = pos[1];
+			parse->gtk = pos;
+			parse->gtk_len = len;
 			break;
 		case FTIE_SUBELEM_R0KH_ID:
-			if (pos[1] < 1 || pos[1] > FT_R0KH_ID_MAX_LEN) {
-				wpa_printf(MSG_DEBUG, "FT: Invalid R0KH-ID "
-					   "length in FTIE: %d", pos[1]);
+			if (len < 1 || len > FT_R0KH_ID_MAX_LEN) {
+				wpa_printf(MSG_DEBUG,
+					   "FT: Invalid R0KH-ID length in FTIE: %d",
+					   len);
 				return -1;
 			}
-			parse->r0kh_id = pos + 2;
-			parse->r0kh_id_len = pos[1];
+			parse->r0kh_id = pos;
+			parse->r0kh_id_len = len;
 			break;
 #ifdef CONFIG_IEEE80211W
 		case FTIE_SUBELEM_IGTK:
-			parse->igtk = pos + 2;
-			parse->igtk_len = pos[1];
+			parse->igtk = pos;
+			parse->igtk_len = len;
 			break;
 #endif /* CONFIG_IEEE80211W */
 		}
 
-		pos += 2 + pos[1];
+		pos += len;
 	}
 
 	return 0;
@@ -345,11 +354,18 @@ int wpa_ft_parse_ies(const u8 *ies, size_t ies_len,
 
 	pos = ies;
 	end = ies + ies_len;
-	while (pos + 2 <= end && pos + 2 + pos[1] <= end) {
-		switch (pos[0]) {
+	while (end - pos >= 2) {
+		u8 id, len;
+
+		id = *pos++;
+		len = *pos++;
+		if (len > end - pos)
+			break;
+
+		switch (id) {
 		case WLAN_EID_RSN:
-			parse->rsn = pos + 2;
-			parse->rsn_len = pos[1];
+			parse->rsn = pos;
+			parse->rsn_len = len;
 			ret = wpa_parse_wpa_ie_rsn(parse->rsn - 2,
 						   parse->rsn_len + 2,
 						   &data);
@@ -362,32 +378,32 @@ int wpa_ft_parse_ies(const u8 *ies, size_t ies_len,
 				parse->rsn_pmkid = data.pmkid;
 			break;
 		case WLAN_EID_MOBILITY_DOMAIN:
-			if (pos[1] < sizeof(struct rsn_mdie))
+			if (len < sizeof(struct rsn_mdie))
 				return -1;
-			parse->mdie = pos + 2;
-			parse->mdie_len = pos[1];
+			parse->mdie = pos;
+			parse->mdie_len = len;
 			break;
 		case WLAN_EID_FAST_BSS_TRANSITION:
-			if (pos[1] < sizeof(*ftie))
+			if (len < sizeof(*ftie))
 				return -1;
-			ftie = (const struct rsn_ftie *) (pos + 2);
+			ftie = (const struct rsn_ftie *) pos;
 			prot_ie_count = ftie->mic_control[1];
-			if (wpa_ft_parse_ftie(pos + 2, pos[1], parse) < 0)
+			if (wpa_ft_parse_ftie(pos, len, parse) < 0)
 				return -1;
 			break;
 		case WLAN_EID_TIMEOUT_INTERVAL:
-			if (pos[1] != 5)
+			if (len != 5)
 				break;
-			parse->tie = pos + 2;
-			parse->tie_len = pos[1];
+			parse->tie = pos;
+			parse->tie_len = len;
 			break;
 		case WLAN_EID_RIC_DATA:
 			if (parse->ric == NULL)
-				parse->ric = pos;
+				parse->ric = pos - 2;
 			break;
 		}
 
-		pos += 2 + pos[1];
+		pos += len;
 	}
 
 	if (prot_ie_count == 0)
@@ -416,13 +432,15 @@ int wpa_ft_parse_ies(const u8 *ies, size_t ies_len,
 	}
 
 	/* Determine the end of the RIC IE(s) */
-	pos = parse->ric;
-	while (pos && pos + 2 <= end && pos + 2 + pos[1] <= end &&
-	       prot_ie_count) {
-		prot_ie_count--;
-		pos += 2 + pos[1];
+	if (parse->ric) {
+		pos = parse->ric;
+		while (end - pos >= 2 && 2 + pos[1] <= end - pos &&
+		       prot_ie_count) {
+			prot_ie_count--;
+			pos += 2 + pos[1];
+		}
+		parse->ric_len = pos - parse->ric;
 	}
-	parse->ric_len = pos - parse->ric;
 	if (prot_ie_count) {
 		wpa_printf(MSG_DEBUG, "FT: %d protected IEs missing from "
 			   "frame", (int) prot_ie_count);
@@ -582,8 +600,10 @@ int wpa_parse_wpa_ie_rsn(const u8 *rsn_ie, size_t rsn_ie_len,
 	if (left >= RSN_SELECTOR_LEN) {
 		data->group_cipher = rsn_selector_to_bitfield(pos);
 		if (!wpa_cipher_valid_group(data->group_cipher)) {
-			wpa_printf(MSG_DEBUG, "%s: invalid group cipher 0x%x",
-				   __func__, data->group_cipher);
+			wpa_printf(MSG_DEBUG,
+				   "%s: invalid group cipher 0x%x (%08x)",
+				   __func__, data->group_cipher,
+				   WPA_GET_BE32(pos));
 			return -1;
 		}
 		pos += RSN_SELECTOR_LEN;
@@ -671,9 +691,10 @@ int wpa_parse_wpa_ie_rsn(const u8 *rsn_ie, size_t rsn_ie_len,
 	if (left >= 4) {
 		data->mgmt_group_cipher = rsn_selector_to_bitfield(pos);
 		if (!wpa_cipher_valid_mgmt_group(data->mgmt_group_cipher)) {
-			wpa_printf(MSG_DEBUG, "%s: Unsupported management "
-				   "group cipher 0x%x", __func__,
-				   data->mgmt_group_cipher);
+			wpa_printf(MSG_DEBUG,
+				   "%s: Unsupported management group cipher 0x%x (%08x)",
+				   __func__, data->mgmt_group_cipher,
+				   WPA_GET_BE32(pos));
 			return -10;
 		}
 		pos += RSN_SELECTOR_LEN;
@@ -1163,6 +1184,8 @@ const char * wpa_key_mgmt_txt(int key_mgmt, int proto)
 			"WPA2-PSK" : "WPA-PSK";
 	case WPA_KEY_MGMT_NONE:
 		return "NONE";
+	case WPA_KEY_MGMT_WPA_NONE:
+		return "WPA-NONE";
 	case WPA_KEY_MGMT_IEEE8021X_NO_WPA:
 		return "IEEE 802.1X (no WPA)";
 #ifdef CONFIG_IEEE80211R
@@ -1261,13 +1284,13 @@ int wpa_compare_rsn_ie(int ft_initial_assoc,
 
 
 #ifdef CONFIG_IEEE80211R
-int wpa_insert_pmkid(u8 *ies, size_t ies_len, const u8 *pmkid)
+int wpa_insert_pmkid(u8 *ies, size_t *ies_len, const u8 *pmkid)
 {
 	u8 *start, *end, *rpos, *rend;
 	int added = 0;
 
 	start = ies;
-	end = ies + ies_len;
+	end = ies + *ies_len;
 
 	while (start < end) {
 		if (*start == WLAN_EID_RSN)
@@ -1320,11 +1343,29 @@ int wpa_insert_pmkid(u8 *ies, size_t ies_len, const u8 *pmkid)
 		added += 2 + PMKID_LEN;
 		start[1] += 2 + PMKID_LEN;
 	} else {
-		/* PMKID-Count was included; use it */
-		if (WPA_GET_LE16(rpos) != 0) {
-			wpa_printf(MSG_ERROR, "FT: Unexpected PMKID "
-				   "in RSN IE in EAPOL-Key data");
+		u16 num_pmkid;
+
+		if (rend - rpos < 2)
 			return -1;
+		num_pmkid = WPA_GET_LE16(rpos);
+		/* PMKID-Count was included; use it */
+		if (num_pmkid != 0) {
+			u8 *after;
+
+			if (num_pmkid * PMKID_LEN > rend - rpos - 2)
+				return -1;
+			/*
+			 * PMKID may have been included in RSN IE in
+			 * (Re)Association Request frame, so remove the old
+			 * PMKID(s) first before adding the new one.
+			 */
+			wpa_printf(MSG_DEBUG,
+				   "FT: Remove %u old PMKID(s) from RSN IE",
+				   num_pmkid);
+			after = rpos + 2 + num_pmkid * PMKID_LEN;
+			os_memmove(rpos + 2, after, rend - after);
+			start[1] -= num_pmkid * PMKID_LEN;
+			added -= num_pmkid * PMKID_LEN;
 		}
 		WPA_PUT_LE16(rpos, 1);
 		rpos += 2;
@@ -1337,7 +1378,9 @@ int wpa_insert_pmkid(u8 *ies, size_t ies_len, const u8 *pmkid)
 	wpa_hexdump(MSG_DEBUG, "FT: RSN IE after modification "
 		    "(PMKID inserted)", start, 2 + start[1]);
 
-	return added;
+	*ies_len += added;
+
+	return 0;
 }
 #endif /* CONFIG_IEEE80211R */
 
diff --git a/src/common/wpa_common.h b/src/common/wpa_common.h
index c08f6514ab573..af1d0f0c6efbc 100644
--- a/src/common/wpa_common.h
+++ b/src/common/wpa_common.h
@@ -12,6 +12,8 @@
 /* IEEE 802.11i */
 #define PMKID_LEN 16
 #define PMK_LEN 32
+#define PMK_LEN_SUITE_B_192 48
+#define PMK_LEN_MAX 48
 #define WPA_REPLAY_COUNTER_LEN 8
 #define WPA_NONCE_LEN 32
 #define WPA_KEY_RSC_LEN 8
@@ -407,7 +409,7 @@ u32 wpa_akm_to_suite(int akm);
 int wpa_compare_rsn_ie(int ft_initial_assoc,
 		       const u8 *ie1, size_t ie1len,
 		       const u8 *ie2, size_t ie2len);
-int wpa_insert_pmkid(u8 *ies, size_t ies_len, const u8 *pmkid);
+int wpa_insert_pmkid(u8 *ies, size_t *ies_len, const u8 *pmkid);
 
 struct wpa_ft_ies {
 	const u8 *mdie;
diff --git a/src/common/wpa_ctrl.c b/src/common/wpa_ctrl.c
index 5733aa605d18c..623c2a768e43d 100644
--- a/src/common/wpa_ctrl.c
+++ b/src/common/wpa_ctrl.c
@@ -532,6 +532,8 @@ retry_send:
 		FD_ZERO(&rfds);
 		FD_SET(ctrl->s, &rfds);
 		res = select(ctrl->s + 1, &rfds, NULL, NULL, &tv);
+		if (res < 0 && errno == EINTR)
+			continue;
 		if (res < 0)
 			return res;
 		if (FD_ISSET(ctrl->s, &rfds)) {
diff --git a/src/common/wpa_ctrl.h b/src/common/wpa_ctrl.h
index 3de46823588b8..4dcba81dc1a44 100644
--- a/src/common/wpa_ctrl.h
+++ b/src/common/wpa_ctrl.h
@@ -76,6 +76,21 @@ extern "C" {
 #define WPA_EVENT_SIGNAL_CHANGE "CTRL-EVENT-SIGNAL-CHANGE "
 /** Regulatory domain channel */
 #define WPA_EVENT_REGDOM_CHANGE "CTRL-EVENT-REGDOM-CHANGE "
+/** Channel switch (followed by freq=<MHz> and other channel parameters) */
+#define WPA_EVENT_CHANNEL_SWITCH "CTRL-EVENT-CHANNEL-SWITCH "
+
+/** IP subnet status change notification
+ *
+ * When using an offloaded roaming mechanism where driver/firmware takes care
+ * of roaming and IP subnet validation checks post-roaming, this event can
+ * indicate whether IP subnet has changed.
+ *
+ * The event has a status=<0/1/2> parameter where
+ * 0 = unknown
+ * 1 = IP subnet unchanged (can continue to use the old IP address)
+ * 2 = IP subnet changed (need to get a new IP address)
+ */
+#define WPA_EVENT_SUBNET_STATUS_UPDATE "CTRL-EVENT-SUBNET-STATUS-UPDATE "
 
 /** RSN IBSS 4-way handshakes completed with specified peer */
 #define IBSS_RSN_COMPLETED "IBSS-RSN-COMPLETED "
@@ -174,6 +189,7 @@ extern "C" {
 #define P2P_EVENT_SERV_ASP_RESP "P2P-SERV-ASP-RESP "
 #define P2P_EVENT_INVITATION_RECEIVED "P2P-INVITATION-RECEIVED "
 #define P2P_EVENT_INVITATION_RESULT "P2P-INVITATION-RESULT "
+#define P2P_EVENT_INVITATION_ACCEPTED "P2P-INVITATION-ACCEPTED "
 #define P2P_EVENT_FIND_STOPPED "P2P-FIND-STOPPED "
 #define P2P_EVENT_PERSISTENT_PSK_FAIL "P2P-PERSISTENT-PSK-FAIL id="
 #define P2P_EVENT_PRESENCE_RESPONSE "P2P-PRESENCE-RESPONSE "
@@ -212,6 +228,11 @@ extern "C" {
 /* parameters: <addr> <result> */
 #define ANQP_QUERY_DONE "ANQP-QUERY-DONE "
 
+#define RX_ANQP "RX-ANQP "
+#define RX_HS20_ANQP "RX-HS20-ANQP "
+#define RX_HS20_ANQP_ICON "RX-HS20-ANQP-ICON "
+#define RX_HS20_ICON "RX-HS20-ICON "
+
 #define HS20_SUBSCRIPTION_REMEDIATION "HS20-SUBSCRIPTION-REMEDIATION "
 #define HS20_DEAUTH_IMMINENT_NOTICE "HS20-DEAUTH-IMMINENT-NOTICE "
 
@@ -232,6 +253,7 @@ extern "C" {
 #define AP_STA_CONNECTED "AP-STA-CONNECTED "
 #define AP_STA_DISCONNECTED "AP-STA-DISCONNECTED "
 #define AP_STA_POSSIBLE_PSK_MISMATCH "AP-STA-POSSIBLE-PSK-MISMATCH "
+#define AP_STA_POLL_OK "AP-STA-POLL-OK "
 
 #define AP_REJECTED_MAX_STA "AP-REJECTED-MAX-STA "
 #define AP_REJECTED_BLOCKED_STA "AP-REJECTED-BLOCKED-STA "
@@ -254,9 +276,18 @@ extern "C" {
 
 #define AP_CSA_FINISHED "AP-CSA-FINISHED "
 
+#define P2P_EVENT_LISTEN_OFFLOAD_STOP "P2P-LISTEN-OFFLOAD-STOPPED "
+#define P2P_LISTEN_OFFLOAD_STOP_REASON "P2P-LISTEN-OFFLOAD-STOP-REASON "
+
 /* BSS Transition Management Response frame received */
 #define BSS_TM_RESP "BSS-TM-RESP "
 
+/* MBO IE with cellular data connection preference received */
+#define MBO_CELL_PREFERENCE "MBO-CELL-PREFERENCE "
+
+/* BSS Transition Management Request received with MBO transition reason */
+#define MBO_TRANSITION_REASON "MBO-TRANSITION-REASON "
+
 /* BSS command information masks */
 
 #define WPA_BSS_MASK_ALL		0xFFFDFFFF
@@ -300,6 +331,7 @@ enum wpa_vendor_elem_frame {
 	VENDOR_ELEM_P2P_ASSOC_REQ = 11,
 	VENDOR_ELEM_P2P_ASSOC_RESP = 12,
 	VENDOR_ELEM_ASSOC_REQ = 13,
+	VENDOR_ELEM_PROBE_REQ = 14,
 	NUM_VENDOR_ELEM_FRAMES
 };
 
diff --git a/src/common/wpa_helpers.c b/src/common/wpa_helpers.c
index 28913b9139aaa..f1594213f97f5 100644
--- a/src/common/wpa_helpers.c
+++ b/src/common/wpa_helpers.c
@@ -172,7 +172,8 @@ int get_wpa_status(const char *ifname, const char *field, char *obuf,
 	if (ctrl == NULL)
 		return -1;
 	len = sizeof(buf);
-	if (wpa_ctrl_request(ctrl, "STATUS", 6, buf, &len, NULL) < 0) {
+	if (wpa_ctrl_request(ctrl, "STATUS-NO_EVENTS", 16, buf, &len,
+			     NULL) < 0) {
 		wpa_ctrl_close(ctrl);
 		return -1;
 	}
diff --git a/src/crypto/Makefile b/src/crypto/Makefile
index 3e90350c103ee..d181e723134eb 100644
--- a/src/crypto/Makefile
+++ b/src/crypto/Makefile
@@ -47,7 +47,9 @@ LIB_OBJS= \
 	sha256.o \
 	sha256-prf.o \
 	sha256-tlsprf.o \
-	sha256-internal.o
+	sha256-internal.o \
+	sha384-internal.o \
+	sha512-internal.o
 
 LIB_OBJS += crypto_internal.o
 LIB_OBJS += crypto_internal-cipher.o
diff --git a/src/crypto/aes-cbc.c b/src/crypto/aes-cbc.c
index 2833cfcc840d9..0835f2cfb77ec 100644
--- a/src/crypto/aes-cbc.c
+++ b/src/crypto/aes-cbc.c
@@ -28,6 +28,9 @@ int aes_128_cbc_encrypt(const u8 *key, const u8 *iv, u8 *data, size_t data_len)
 	u8 *pos = data;
 	int i, j, blocks;
 
+	if (TEST_FAIL())
+		return -1;
+
 	ctx = aes_encrypt_init(key, 16);
 	if (ctx == NULL)
 		return -1;
@@ -61,6 +64,9 @@ int aes_128_cbc_decrypt(const u8 *key, const u8 *iv, u8 *data, size_t data_len)
 	u8 *pos = data;
 	int i, j, blocks;
 
+	if (TEST_FAIL())
+		return -1;
+
 	ctx = aes_decrypt_init(key, 16);
 	if (ctx == NULL)
 		return -1;
diff --git a/src/crypto/aes-omac1.c b/src/crypto/aes-omac1.c
index 375db5735be33..8642516340c69 100644
--- a/src/crypto/aes-omac1.c
+++ b/src/crypto/aes-omac1.c
@@ -48,6 +48,9 @@ int omac1_aes_vector(const u8 *key, size_t key_len, size_t num_elem,
 	const u8 *pos, *end;
 	size_t i, e, left, total_len;
 
+	if (TEST_FAIL())
+		return -1;
+
 	ctx = aes_encrypt_init(key, key_len);
 	if (ctx == NULL)
 		return -1;
diff --git a/src/crypto/crypto.h b/src/crypto/crypto.h
index 534c4bd786543..bdc3ba6f37e0d 100644
--- a/src/crypto/crypto.h
+++ b/src/crypto/crypto.h
@@ -80,6 +80,28 @@ int sha256_vector(size_t num_elem, const u8 *addr[], const size_t *len,
 		  u8 *mac);
 
 /**
+ * sha384_vector - SHA384 hash for data vector
+ * @num_elem: Number of elements in the data vector
+ * @addr: Pointers to the data areas
+ * @len: Lengths of the data blocks
+ * @mac: Buffer for the hash
+ * Returns: 0 on success, -1 on failure
+ */
+int sha384_vector(size_t num_elem, const u8 *addr[], const size_t *len,
+		  u8 *mac);
+
+/**
+ * sha512_vector - SHA512 hash for data vector
+ * @num_elem: Number of elements in the data vector
+ * @addr: Pointers to the data areas
+ * @len: Lengths of the data blocks
+ * @mac: Buffer for the hash
+ * Returns: 0 on success, -1 on failure
+ */
+int sha512_vector(size_t num_elem, const u8 *addr[], const size_t *len,
+		  u8 *mac);
+
+/**
  * des_encrypt - Encrypt one block with DES
  * @clear: 8 octets (in)
  * @key: 7 octets (in) (no parity bits included)
@@ -135,7 +157,8 @@ void aes_decrypt_deinit(void *ctx);
 enum crypto_hash_alg {
 	CRYPTO_HASH_ALG_MD5, CRYPTO_HASH_ALG_SHA1,
 	CRYPTO_HASH_ALG_HMAC_MD5, CRYPTO_HASH_ALG_HMAC_SHA1,
-	CRYPTO_HASH_ALG_SHA256, CRYPTO_HASH_ALG_HMAC_SHA256
+	CRYPTO_HASH_ALG_SHA256, CRYPTO_HASH_ALG_HMAC_SHA256,
+	CRYPTO_HASH_ALG_SHA384, CRYPTO_HASH_ALG_SHA512
 };
 
 struct crypto_hash;
diff --git a/src/crypto/crypto_internal.c b/src/crypto/crypto_internal.c
index f3602dac346ea..d391f48ab5b18 100644
--- a/src/crypto/crypto_internal.c
+++ b/src/crypto/crypto_internal.c
@@ -11,6 +11,8 @@
 #include "common.h"
 #include "crypto.h"
 #include "sha256_i.h"
+#include "sha384_i.h"
+#include "sha512_i.h"
 #include "sha1_i.h"
 #include "md5_i.h"
 
@@ -22,6 +24,12 @@ struct crypto_hash {
 #ifdef CONFIG_SHA256
 		struct sha256_state sha256;
 #endif /* CONFIG_SHA256 */
+#ifdef CONFIG_INTERNAL_SHA384
+		struct sha384_state sha384;
+#endif /* CONFIG_INTERNAL_SHA384 */
+#ifdef CONFIG_INTERNAL_SHA512
+		struct sha512_state sha512;
+#endif /* CONFIG_INTERNAL_SHA512 */
 	} u;
 	u8 key[64];
 	size_t key_len;
@@ -54,6 +62,16 @@ struct crypto_hash * crypto_hash_init(enum crypto_hash_alg alg, const u8 *key,
 		sha256_init(&ctx->u.sha256);
 		break;
 #endif /* CONFIG_SHA256 */
+#ifdef CONFIG_INTERNAL_SHA384
+	case CRYPTO_HASH_ALG_SHA384:
+		sha384_init(&ctx->u.sha384);
+		break;
+#endif /* CONFIG_INTERNAL_SHA384 */
+#ifdef CONFIG_INTERNAL_SHA512
+	case CRYPTO_HASH_ALG_SHA512:
+		sha512_init(&ctx->u.sha512);
+		break;
+#endif /* CONFIG_INTERNAL_SHA512 */
 	case CRYPTO_HASH_ALG_HMAC_MD5:
 		if (key_len > sizeof(k_pad)) {
 			MD5Init(&ctx->u.md5);
@@ -142,6 +160,16 @@ void crypto_hash_update(struct crypto_hash *ctx, const u8 *data, size_t len)
 		sha256_process(&ctx->u.sha256, data, len);
 		break;
 #endif /* CONFIG_SHA256 */
+#ifdef CONFIG_INTERNAL_SHA384
+	case CRYPTO_HASH_ALG_SHA384:
+		sha384_process(&ctx->u.sha384, data, len);
+		break;
+#endif /* CONFIG_INTERNAL_SHA384 */
+#ifdef CONFIG_INTERNAL_SHA512
+	case CRYPTO_HASH_ALG_SHA512:
+		sha512_process(&ctx->u.sha512, data, len);
+		break;
+#endif /* CONFIG_INTERNAL_SHA512 */
 	default:
 		break;
 	}
@@ -191,6 +219,28 @@ int crypto_hash_finish(struct crypto_hash *ctx, u8 *mac, size_t *len)
 		sha256_done(&ctx->u.sha256, mac);
 		break;
 #endif /* CONFIG_SHA256 */
+#ifdef CONFIG_INTERNAL_SHA384
+	case CRYPTO_HASH_ALG_SHA384:
+		if (*len < 48) {
+			*len = 48;
+			os_free(ctx);
+			return -1;
+		}
+		*len = 48;
+		sha384_done(&ctx->u.sha384, mac);
+		break;
+#endif /* CONFIG_INTERNAL_SHA384 */
+#ifdef CONFIG_INTERNAL_SHA512
+	case CRYPTO_HASH_ALG_SHA512:
+		if (*len < 64) {
+			*len = 64;
+			os_free(ctx);
+			return -1;
+		}
+		*len = 64;
+		sha512_done(&ctx->u.sha512, mac);
+		break;
+#endif /* CONFIG_INTERNAL_SHA512 */
 	case CRYPTO_HASH_ALG_HMAC_MD5:
 		if (*len < 16) {
 			*len = 16;
diff --git a/src/crypto/crypto_module_tests.c b/src/crypto/crypto_module_tests.c
index 581005df3e39e..ffd23942e32d7 100644
--- a/src/crypto/crypto_module_tests.c
+++ b/src/crypto/crypto_module_tests.c
@@ -9,6 +9,7 @@
 #include "utils/includes.h"
 
 #include "utils/common.h"
+#include "utils/module_tests.h"
 #include "crypto/aes_siv.h"
 #include "crypto/aes_wrap.h"
 #include "crypto/aes.h"
@@ -1266,7 +1267,7 @@ static int test_sha1(void)
 }
 
 
-const struct {
+static const struct {
 	char *data;
 	u8 hash[32];
 } tests[] = {
@@ -1290,7 +1291,7 @@ const struct {
 	}
 };
 
-const struct hmac_test {
+static const struct hmac_test {
 	u8 key[80];
 	size_t key_len;
 	u8 data[128];
@@ -1503,6 +1504,7 @@ static int test_sha256(void)
 	const u8 *addr[2];
 	size_t len[2];
 	int errors = 0;
+	u8 *key;
 
 	for (i = 0; i < ARRAY_SIZE(tests); i++) {
 		wpa_printf(MSG_INFO, "SHA256 test case %d:", i + 1);
@@ -1573,12 +1575,66 @@ static int test_sha256(void)
 		   hash, sizeof(hash));
 	/* TODO: add proper test case for this */
 
+	key = os_malloc(8161);
+	if (key) {
+#ifdef CONFIG_HMAC_SHA256_KDF
+		int res;
+
+		res = hmac_sha256_kdf((u8 *) "secret", 6, "label",
+				      (u8 *) "seed", 4, key, 8160);
+		if (res) {
+			wpa_printf(MSG_INFO,
+				   "Unexpected hmac_sha256_kdf(outlen=8160) failure");
+			errors++;
+		}
+
+		res = hmac_sha256_kdf((u8 *) "secret", 6, "label",
+				      (u8 *) "seed", 4, key, 8161);
+		if (res == 0) {
+			wpa_printf(MSG_INFO,
+				   "Unexpected hmac_sha256_kdf(outlen=8161) success");
+			errors++;
+		}
+#endif /* CONFIG_HMAC_SHA256_KDF */
+
+		os_free(key);
+	}
+
 	if (!errors)
 		wpa_printf(MSG_INFO, "SHA256 test cases passed");
 	return errors;
 }
 
 
+static int test_fips186_2_prf(void)
+{
+	/* http://csrc.nist.gov/encryption/dss/Examples-1024bit.pdf */
+	u8 xkey[] = {
+		0xbd, 0x02, 0x9b, 0xbe, 0x7f, 0x51, 0x96, 0x0b,
+		0xcf, 0x9e, 0xdb, 0x2b, 0x61, 0xf0, 0x6f, 0x0f,
+		0xeb, 0x5a, 0x38, 0xb6
+	};
+	u8 w[] = {
+		0x20, 0x70, 0xb3, 0x22, 0x3d, 0xba, 0x37, 0x2f,
+		0xde, 0x1c, 0x0f, 0xfc, 0x7b, 0x2e, 0x3b, 0x49,
+		0x8b, 0x26, 0x06, 0x14, 0x3c, 0x6c, 0x18, 0xba,
+		0xcb, 0x0f, 0x6c, 0x55, 0xba, 0xbb, 0x13, 0x78,
+		0x8e, 0x20, 0xd7, 0x37, 0xa3, 0x27, 0x51, 0x16
+	};
+	u8 buf[40];
+
+	wpa_printf(MSG_INFO,
+		   "Testing EAP-SIM PRF (FIPS 186-2 + change notice 1)");
+	if (fips186_2_prf(xkey, sizeof(xkey), buf, sizeof(buf)) < 0 ||
+	    os_memcmp(w, buf, sizeof(w)) != 0) {
+		wpa_printf(MSG_INFO, "fips186_2_prf failed");
+		return 1;
+	}
+
+	return 0;
+}
+
+
 static int test_ms_funcs(void)
 {
 #ifndef CONFIG_FIPS
@@ -1695,6 +1751,7 @@ int crypto_module_tests(void)
 	    test_md5() ||
 	    test_sha1() ||
 	    test_sha256() ||
+	    test_fips186_2_prf() ||
 	    test_ms_funcs())
 		ret = -1;
 
diff --git a/src/crypto/crypto_openssl.c b/src/crypto/crypto_openssl.c
index 6cff75c64ae5a..19e0e2be87be3 100644
--- a/src/crypto/crypto_openssl.c
+++ b/src/crypto/crypto_openssl.c
@@ -29,11 +29,61 @@
 #include "sha1.h"
 #include "sha256.h"
 #include "sha384.h"
+#include "md5.h"
+#include "aes_wrap.h"
 #include "crypto.h"
 
+#if OPENSSL_VERSION_NUMBER < 0x10100000L || defined(LIBRESSL_VERSION_NUMBER)
+/* Compatibility wrappers for older versions. */
+
+static HMAC_CTX * HMAC_CTX_new(void)
+{
+	HMAC_CTX *ctx;
+
+	ctx = os_zalloc(sizeof(*ctx));
+	if (ctx)
+		HMAC_CTX_init(ctx);
+	return ctx;
+}
+
+
+static void HMAC_CTX_free(HMAC_CTX *ctx)
+{
+	if (!ctx)
+		return;
+	HMAC_CTX_cleanup(ctx);
+	bin_clear_free(ctx, sizeof(*ctx));
+}
+
+
+static EVP_MD_CTX * EVP_MD_CTX_new(void)
+{
+	EVP_MD_CTX *ctx;
+
+	ctx = os_zalloc(sizeof(*ctx));
+	if (ctx)
+		EVP_MD_CTX_init(ctx);
+	return ctx;
+}
+
+
+static void EVP_MD_CTX_free(EVP_MD_CTX *ctx)
+{
+	if (!ctx)
+		return;
+	EVP_MD_CTX_cleanup(ctx);
+	bin_clear_free(ctx, sizeof(*ctx));
+}
+
+#endif /* OpenSSL version < 1.1.0 */
+
 static BIGNUM * get_group5_prime(void)
 {
-#ifdef OPENSSL_IS_BORINGSSL
+#if OPENSSL_VERSION_NUMBER >= 0x10100000L && !defined(LIBRESSL_VERSION_NUMBER)
+	return BN_get_rfc3526_prime_1536(NULL);
+#elif !defined(OPENSSL_IS_BORINGSSL)
+	return get_rfc3526_prime_1536(NULL);
+#else
 	static const unsigned char RFC3526_PRIME_1536[] = {
 		0xFF,0xFF,0xFF,0xFF,0xFF,0xFF,0xFF,0xFF,0xC9,0x0F,0xDA,0xA2,
 		0x21,0x68,0xC2,0x34,0xC4,0xC6,0x62,0x8B,0x80,0xDC,0x1C,0xD1,
@@ -53,9 +103,7 @@ static BIGNUM * get_group5_prime(void)
 		0xCA,0x23,0x73,0x27,0xFF,0xFF,0xFF,0xFF,0xFF,0xFF,0xFF,0xFF,
 	};
         return BN_bin2bn(RFC3526_PRIME_1536, sizeof(RFC3526_PRIME_1536), NULL);
-#else /* OPENSSL_IS_BORINGSSL */
-	return get_rfc3526_prime_1536(NULL);
-#endif /* OPENSSL_IS_BORINGSSL */
+#endif
 }
 
 #ifdef OPENSSL_NO_SHA256
@@ -65,29 +113,38 @@ static BIGNUM * get_group5_prime(void)
 static int openssl_digest_vector(const EVP_MD *type, size_t num_elem,
 				 const u8 *addr[], const size_t *len, u8 *mac)
 {
-	EVP_MD_CTX ctx;
+	EVP_MD_CTX *ctx;
 	size_t i;
 	unsigned int mac_len;
 
-	EVP_MD_CTX_init(&ctx);
-	if (!EVP_DigestInit_ex(&ctx, type, NULL)) {
+	if (TEST_FAIL())
+		return -1;
+
+	ctx = EVP_MD_CTX_new();
+	if (!ctx)
+		return -1;
+	if (!EVP_DigestInit_ex(ctx, type, NULL)) {
 		wpa_printf(MSG_ERROR, "OpenSSL: EVP_DigestInit_ex failed: %s",
 			   ERR_error_string(ERR_get_error(), NULL));
+		EVP_MD_CTX_free(ctx);
 		return -1;
 	}
 	for (i = 0; i < num_elem; i++) {
-		if (!EVP_DigestUpdate(&ctx, addr[i], len[i])) {
+		if (!EVP_DigestUpdate(ctx, addr[i], len[i])) {
 			wpa_printf(MSG_ERROR, "OpenSSL: EVP_DigestUpdate "
 				   "failed: %s",
 				   ERR_error_string(ERR_get_error(), NULL));
+			EVP_MD_CTX_free(ctx);
 			return -1;
 		}
 	}
-	if (!EVP_DigestFinal(&ctx, mac, &mac_len)) {
+	if (!EVP_DigestFinal(ctx, mac, &mac_len)) {
 		wpa_printf(MSG_ERROR, "OpenSSL: EVP_DigestFinal failed: %s",
 			   ERR_error_string(ERR_get_error(), NULL));
+		EVP_MD_CTX_free(ctx);
 		return -1;
 	}
+	EVP_MD_CTX_free(ctx);
 
 	return 0;
 }
@@ -129,32 +186,34 @@ int rc4_skip(const u8 *key, size_t keylen, size_t skip,
 #ifdef OPENSSL_NO_RC4
 	return -1;
 #else /* OPENSSL_NO_RC4 */
-	EVP_CIPHER_CTX ctx;
+	EVP_CIPHER_CTX *ctx;
 	int outl;
 	int res = -1;
 	unsigned char skip_buf[16];
 
-	EVP_CIPHER_CTX_init(&ctx);
-	if (!EVP_CIPHER_CTX_set_padding(&ctx, 0) ||
-	    !EVP_CipherInit_ex(&ctx, EVP_rc4(), NULL, NULL, NULL, 1) ||
-	    !EVP_CIPHER_CTX_set_key_length(&ctx, keylen) ||
-	    !EVP_CipherInit_ex(&ctx, NULL, NULL, key, NULL, 1))
+	ctx = EVP_CIPHER_CTX_new();
+	if (!ctx ||
+	    !EVP_CIPHER_CTX_set_padding(ctx, 0) ||
+	    !EVP_CipherInit_ex(ctx, EVP_rc4(), NULL, NULL, NULL, 1) ||
+	    !EVP_CIPHER_CTX_set_key_length(ctx, keylen) ||
+	    !EVP_CipherInit_ex(ctx, NULL, NULL, key, NULL, 1))
 		goto out;
 
 	while (skip >= sizeof(skip_buf)) {
 		size_t len = skip;
 		if (len > sizeof(skip_buf))
 			len = sizeof(skip_buf);
-		if (!EVP_CipherUpdate(&ctx, skip_buf, &outl, skip_buf, len))
+		if (!EVP_CipherUpdate(ctx, skip_buf, &outl, skip_buf, len))
 			goto out;
 		skip -= len;
 	}
 
-	if (EVP_CipherUpdate(&ctx, data, &outl, data, data_len))
+	if (EVP_CipherUpdate(ctx, data, &outl, data, data_len))
 		res = 0;
 
 out:
-	EVP_CIPHER_CTX_cleanup(&ctx);
+	if (ctx)
+		EVP_CIPHER_CTX_free(ctx);
 	return res;
 #endif /* OPENSSL_NO_RC4 */
 }
@@ -206,14 +265,16 @@ void * aes_encrypt_init(const u8 *key, size_t len)
 	EVP_CIPHER_CTX *ctx;
 	const EVP_CIPHER *type;
 
+	if (TEST_FAIL())
+		return NULL;
+
 	type = aes_get_evp_cipher(len);
 	if (type == NULL)
 		return NULL;
 
-	ctx = os_malloc(sizeof(*ctx));
+	ctx = EVP_CIPHER_CTX_new();
 	if (ctx == NULL)
 		return NULL;
-	EVP_CIPHER_CTX_init(ctx);
 	if (EVP_EncryptInit_ex(ctx, type, NULL, key, NULL) != 1) {
 		os_free(ctx);
 		return NULL;
@@ -247,8 +308,7 @@ void aes_encrypt_deinit(void *ctx)
 		wpa_printf(MSG_ERROR, "OpenSSL: Unexpected padding length %d "
 			   "in AES encrypt", len);
 	}
-	EVP_CIPHER_CTX_cleanup(c);
-	bin_clear_free(c, sizeof(*c));
+	EVP_CIPHER_CTX_free(c);
 }
 
 
@@ -257,16 +317,18 @@ void * aes_decrypt_init(const u8 *key, size_t len)
 	EVP_CIPHER_CTX *ctx;
 	const EVP_CIPHER *type;
 
+	if (TEST_FAIL())
+		return NULL;
+
 	type = aes_get_evp_cipher(len);
 	if (type == NULL)
 		return NULL;
 
-	ctx = os_malloc(sizeof(*ctx));
+	ctx = EVP_CIPHER_CTX_new();
 	if (ctx == NULL)
 		return NULL;
-	EVP_CIPHER_CTX_init(ctx);
 	if (EVP_DecryptInit_ex(ctx, type, NULL, key, NULL) != 1) {
-		os_free(ctx);
+		EVP_CIPHER_CTX_free(ctx);
 		return NULL;
 	}
 	EVP_CIPHER_CTX_set_padding(ctx, 0);
@@ -298,8 +360,7 @@ void aes_decrypt_deinit(void *ctx)
 		wpa_printf(MSG_ERROR, "OpenSSL: Unexpected padding length %d "
 			   "in AES decrypt", len);
 	}
-	EVP_CIPHER_CTX_cleanup(c);
-	bin_clear_free(c, sizeof(*c));
+	EVP_CIPHER_CTX_free(c);
 }
 
 
@@ -338,51 +399,56 @@ int aes_unwrap(const u8 *kek, size_t kek_len, int n, const u8 *cipher,
 
 int aes_128_cbc_encrypt(const u8 *key, const u8 *iv, u8 *data, size_t data_len)
 {
-	EVP_CIPHER_CTX ctx;
+	EVP_CIPHER_CTX *ctx;
 	int clen, len;
 	u8 buf[16];
+	int res = -1;
 
-	EVP_CIPHER_CTX_init(&ctx);
-	if (EVP_EncryptInit_ex(&ctx, EVP_aes_128_cbc(), NULL, key, iv) != 1)
+	if (TEST_FAIL())
 		return -1;
-	EVP_CIPHER_CTX_set_padding(&ctx, 0);
 
-	clen = data_len;
-	if (EVP_EncryptUpdate(&ctx, data, &clen, data, data_len) != 1 ||
-	    clen != (int) data_len)
+	ctx = EVP_CIPHER_CTX_new();
+	if (!ctx)
 		return -1;
-
+	clen = data_len;
 	len = sizeof(buf);
-	if (EVP_EncryptFinal_ex(&ctx, buf, &len) != 1 || len != 0)
-		return -1;
-	EVP_CIPHER_CTX_cleanup(&ctx);
+	if (EVP_EncryptInit_ex(ctx, EVP_aes_128_cbc(), NULL, key, iv) == 1 &&
+	    EVP_CIPHER_CTX_set_padding(ctx, 0) == 1 &&
+	    EVP_EncryptUpdate(ctx, data, &clen, data, data_len) == 1 &&
+	    clen == (int) data_len &&
+	    EVP_EncryptFinal_ex(ctx, buf, &len) == 1 && len == 0)
+		res = 0;
+	EVP_CIPHER_CTX_free(ctx);
 
-	return 0;
+	return res;
 }
 
 
 int aes_128_cbc_decrypt(const u8 *key, const u8 *iv, u8 *data, size_t data_len)
 {
-	EVP_CIPHER_CTX ctx;
+	EVP_CIPHER_CTX *ctx;
 	int plen, len;
 	u8 buf[16];
+	int res = -1;
 
-	EVP_CIPHER_CTX_init(&ctx);
-	if (EVP_DecryptInit_ex(&ctx, EVP_aes_128_cbc(), NULL, key, iv) != 1)
+	if (TEST_FAIL())
 		return -1;
-	EVP_CIPHER_CTX_set_padding(&ctx, 0);
 
-	plen = data_len;
-	if (EVP_DecryptUpdate(&ctx, data, &plen, data, data_len) != 1 ||
-	    plen != (int) data_len)
+	ctx = EVP_CIPHER_CTX_new();
+	if (!ctx)
 		return -1;
-
+	plen = data_len;
 	len = sizeof(buf);
-	if (EVP_DecryptFinal_ex(&ctx, buf, &len) != 1 || len != 0)
-		return -1;
-	EVP_CIPHER_CTX_cleanup(&ctx);
+	if (EVP_DecryptInit_ex(ctx, EVP_aes_128_cbc(), NULL, key, iv) == 1 &&
+	    EVP_CIPHER_CTX_set_padding(ctx, 0) == 1 &&
+	    EVP_DecryptUpdate(ctx, data, &plen, data, data_len) == 1 &&
+	    plen == (int) data_len &&
+	    EVP_DecryptFinal_ex(ctx, buf, &len) == 1 && len == 0)
+		res = 0;
+	EVP_CIPHER_CTX_free(ctx);
+
+	return res;
 
-	return 0;
 }
 
 
@@ -425,8 +491,8 @@ error:
 
 
 struct crypto_cipher {
-	EVP_CIPHER_CTX enc;
-	EVP_CIPHER_CTX dec;
+	EVP_CIPHER_CTX *enc;
+	EVP_CIPHER_CTX *dec;
 };
 
 
@@ -487,23 +553,25 @@ struct crypto_cipher * crypto_cipher_init(enum crypto_cipher_alg alg,
 		return NULL;
 	}
 
-	EVP_CIPHER_CTX_init(&ctx->enc);
-	EVP_CIPHER_CTX_set_padding(&ctx->enc, 0);
-	if (!EVP_EncryptInit_ex(&ctx->enc, cipher, NULL, NULL, NULL) ||
-	    !EVP_CIPHER_CTX_set_key_length(&ctx->enc, key_len) ||
-	    !EVP_EncryptInit_ex(&ctx->enc, NULL, NULL, key, iv)) {
-		EVP_CIPHER_CTX_cleanup(&ctx->enc);
+	if (!(ctx->enc = EVP_CIPHER_CTX_new()) ||
+	    !EVP_CIPHER_CTX_set_padding(ctx->enc, 0) ||
+	    !EVP_EncryptInit_ex(ctx->enc, cipher, NULL, NULL, NULL) ||
+	    !EVP_CIPHER_CTX_set_key_length(ctx->enc, key_len) ||
+	    !EVP_EncryptInit_ex(ctx->enc, NULL, NULL, key, iv)) {
+		if (ctx->enc)
+			EVP_CIPHER_CTX_free(ctx->enc);
 		os_free(ctx);
 		return NULL;
 	}
 
-	EVP_CIPHER_CTX_init(&ctx->dec);
-	EVP_CIPHER_CTX_set_padding(&ctx->dec, 0);
-	if (!EVP_DecryptInit_ex(&ctx->dec, cipher, NULL, NULL, NULL) ||
-	    !EVP_CIPHER_CTX_set_key_length(&ctx->dec, key_len) ||
-	    !EVP_DecryptInit_ex(&ctx->dec, NULL, NULL, key, iv)) {
-		EVP_CIPHER_CTX_cleanup(&ctx->enc);
-		EVP_CIPHER_CTX_cleanup(&ctx->dec);
+	if (!(ctx->dec = EVP_CIPHER_CTX_new()) ||
+	    !EVP_CIPHER_CTX_set_padding(ctx->dec, 0) ||
+	    !EVP_DecryptInit_ex(ctx->dec, cipher, NULL, NULL, NULL) ||
+	    !EVP_CIPHER_CTX_set_key_length(ctx->dec, key_len) ||
+	    !EVP_DecryptInit_ex(ctx->dec, NULL, NULL, key, iv)) {
+		EVP_CIPHER_CTX_free(ctx->enc);
+		if (ctx->dec)
+			EVP_CIPHER_CTX_free(ctx->dec);
 		os_free(ctx);
 		return NULL;
 	}
@@ -516,7 +584,7 @@ int crypto_cipher_encrypt(struct crypto_cipher *ctx, const u8 *plain,
 			  u8 *crypt, size_t len)
 {
 	int outl;
-	if (!EVP_EncryptUpdate(&ctx->enc, crypt, &outl, plain, len))
+	if (!EVP_EncryptUpdate(ctx->enc, crypt, &outl, plain, len))
 		return -1;
 	return 0;
 }
@@ -527,7 +595,7 @@ int crypto_cipher_decrypt(struct crypto_cipher *ctx, const u8 *crypt,
 {
 	int outl;
 	outl = len;
-	if (!EVP_DecryptUpdate(&ctx->dec, plain, &outl, crypt, len))
+	if (!EVP_DecryptUpdate(ctx->dec, plain, &outl, crypt, len))
 		return -1;
 	return 0;
 }
@@ -535,19 +603,21 @@ int crypto_cipher_decrypt(struct crypto_cipher *ctx, const u8 *crypt,
 
 void crypto_cipher_deinit(struct crypto_cipher *ctx)
 {
-	EVP_CIPHER_CTX_cleanup(&ctx->enc);
-	EVP_CIPHER_CTX_cleanup(&ctx->dec);
+	EVP_CIPHER_CTX_free(ctx->enc);
+	EVP_CIPHER_CTX_free(ctx->dec);
 	os_free(ctx);
 }
 
 
 void * dh5_init(struct wpabuf **priv, struct wpabuf **publ)
 {
+#if OPENSSL_VERSION_NUMBER < 0x10100000L
 	DH *dh;
 	struct wpabuf *pubkey = NULL, *privkey = NULL;
 	size_t publen, privlen;
 
 	*priv = NULL;
+	wpabuf_free(*publ);
 	*publ = NULL;
 
 	dh = DH_new();
@@ -586,11 +656,63 @@ err:
 	wpabuf_clear_free(privkey);
 	DH_free(dh);
 	return NULL;
+#else
+	DH *dh;
+	struct wpabuf *pubkey = NULL, *privkey = NULL;
+	size_t publen, privlen;
+	BIGNUM *p = NULL, *g;
+	const BIGNUM *priv_key = NULL, *pub_key = NULL;
+
+	*priv = NULL;
+	wpabuf_free(*publ);
+	*publ = NULL;
+
+	dh = DH_new();
+	if (dh == NULL)
+		return NULL;
+
+	g = BN_new();
+	p = get_group5_prime();
+	if (!g || BN_set_word(g, 2) != 1 || !p ||
+	    DH_set0_pqg(dh, p, NULL, g) != 1)
+		goto err;
+	p = NULL;
+	g = NULL;
+
+	if (DH_generate_key(dh) != 1)
+		goto err;
+
+	DH_get0_key(dh, &pub_key, &priv_key);
+	publen = BN_num_bytes(pub_key);
+	pubkey = wpabuf_alloc(publen);
+	if (!pubkey)
+		goto err;
+	privlen = BN_num_bytes(priv_key);
+	privkey = wpabuf_alloc(privlen);
+	if (!privkey)
+		goto err;
+
+	BN_bn2bin(pub_key, wpabuf_put(pubkey, publen));
+	BN_bn2bin(priv_key, wpabuf_put(privkey, privlen));
+
+	*priv = privkey;
+	*publ = pubkey;
+	return dh;
+
+err:
+	BN_free(p);
+	BN_free(g);
+	wpabuf_clear_free(pubkey);
+	wpabuf_clear_free(privkey);
+	DH_free(dh);
+	return NULL;
+#endif
 }
 
 
 void * dh5_init_fixed(const struct wpabuf *priv, const struct wpabuf *publ)
 {
+#if OPENSSL_VERSION_NUMBER < 0x10100000L
 	DH *dh;
 
 	dh = DH_new();
@@ -621,6 +743,42 @@ void * dh5_init_fixed(const struct wpabuf *priv, const struct wpabuf *publ)
 err:
 	DH_free(dh);
 	return NULL;
+#else
+	DH *dh;
+	BIGNUM *p = NULL, *g, *priv_key = NULL, *pub_key = NULL;
+
+	dh = DH_new();
+	if (dh == NULL)
+		return NULL;
+
+	g = BN_new();
+	p = get_group5_prime();
+	if (!g || BN_set_word(g, 2) != 1 || !p ||
+	    DH_set0_pqg(dh, p, NULL, g) != 1)
+		goto err;
+	p = NULL;
+	g = NULL;
+
+	priv_key = BN_bin2bn(wpabuf_head(priv), wpabuf_len(priv), NULL);
+	pub_key = BN_bin2bn(wpabuf_head(publ), wpabuf_len(publ), NULL);
+	if (!priv_key || !pub_key || DH_set0_key(dh, pub_key, priv_key) != 1)
+		goto err;
+	pub_key = NULL;
+	priv_key = NULL;
+
+	if (DH_generate_key(dh) != 1)
+		goto err;
+
+	return dh;
+
+err:
+	BN_free(p);
+	BN_free(g);
+	BN_free(pub_key);
+	BN_clear_free(priv_key);
+	DH_free(dh);
+	return NULL;
+#endif
 }
 
 
@@ -672,7 +830,7 @@ void dh5_free(void *ctx)
 
 
 struct crypto_hash {
-	HMAC_CTX ctx;
+	HMAC_CTX *ctx;
 };
 
 
@@ -707,16 +865,17 @@ struct crypto_hash * crypto_hash_init(enum crypto_hash_alg alg, const u8 *key,
 	ctx = os_zalloc(sizeof(*ctx));
 	if (ctx == NULL)
 		return NULL;
-	HMAC_CTX_init(&ctx->ctx);
+	ctx->ctx = HMAC_CTX_new();
+	if (!ctx->ctx) {
+		os_free(ctx);
+		return NULL;
+	}
 
-#if OPENSSL_VERSION_NUMBER < 0x00909000
-	HMAC_Init_ex(&ctx->ctx, key, key_len, md, NULL);
-#else /* openssl < 0.9.9 */
-	if (HMAC_Init_ex(&ctx->ctx, key, key_len, md, NULL) != 1) {
+	if (HMAC_Init_ex(ctx->ctx, key, key_len, md, NULL) != 1) {
+		HMAC_CTX_free(ctx->ctx);
 		bin_clear_free(ctx, sizeof(*ctx));
 		return NULL;
 	}
-#endif /* openssl < 0.9.9 */
 
 	return ctx;
 }
@@ -726,7 +885,7 @@ void crypto_hash_update(struct crypto_hash *ctx, const u8 *data, size_t len)
 {
 	if (ctx == NULL)
 		return;
-	HMAC_Update(&ctx->ctx, data, len);
+	HMAC_Update(ctx->ctx, data, len);
 }
 
 
@@ -739,18 +898,14 @@ int crypto_hash_finish(struct crypto_hash *ctx, u8 *mac, size_t *len)
 		return -2;
 
 	if (mac == NULL || len == NULL) {
+		HMAC_CTX_free(ctx->ctx);
 		bin_clear_free(ctx, sizeof(*ctx));
 		return 0;
 	}
 
 	mdlen = *len;
-#if OPENSSL_VERSION_NUMBER < 0x00909000
-	HMAC_Final(&ctx->ctx, mac, &mdlen);
-	res = 1;
-#else /* openssl < 0.9.9 */
-	res = HMAC_Final(&ctx->ctx, mac, &mdlen);
-#endif /* openssl < 0.9.9 */
-	HMAC_CTX_cleanup(&ctx->ctx);
+	res = HMAC_Final(ctx->ctx, mac, &mdlen);
+	HMAC_CTX_free(ctx->ctx);
 	bin_clear_free(ctx, sizeof(*ctx));
 
 	if (res == 1) {
@@ -767,28 +922,26 @@ static int openssl_hmac_vector(const EVP_MD *type, const u8 *key,
 			       const u8 *addr[], const size_t *len, u8 *mac,
 			       unsigned int mdlen)
 {
-	HMAC_CTX ctx;
+	HMAC_CTX *ctx;
 	size_t i;
 	int res;
 
-	HMAC_CTX_init(&ctx);
-#if OPENSSL_VERSION_NUMBER < 0x00909000
-	HMAC_Init_ex(&ctx, key, key_len, type, NULL);
-#else /* openssl < 0.9.9 */
-	if (HMAC_Init_ex(&ctx, key, key_len, type, NULL) != 1)
+	if (TEST_FAIL())
 		return -1;
-#endif /* openssl < 0.9.9 */
+
+	ctx = HMAC_CTX_new();
+	if (!ctx)
+		return -1;
+	res = HMAC_Init_ex(ctx, key, key_len, type, NULL);
+	if (res != 1)
+		goto done;
 
 	for (i = 0; i < num_elem; i++)
-		HMAC_Update(&ctx, addr[i], len[i]);
+		HMAC_Update(ctx, addr[i], len[i]);
 
-#if OPENSSL_VERSION_NUMBER < 0x00909000
-	HMAC_Final(&ctx, mac, &mdlen);
-	res = 1;
-#else /* openssl < 0.9.9 */
-	res = HMAC_Final(&ctx, mac, &mdlen);
-#endif /* openssl < 0.9.9 */
-	HMAC_CTX_cleanup(&ctx);
+	res = HMAC_Final(ctx, mac, &mdlen);
+done:
+	HMAC_CTX_free(ctx);
 
 	return res == 1 ? 0 : -1;
 }
@@ -892,6 +1045,9 @@ int omac1_aes_vector(const u8 *key, size_t key_len, size_t num_elem,
 	int ret = -1;
 	size_t outlen, i;
 
+	if (TEST_FAIL())
+		return -1;
+
 	ctx = CMAC_CTX_new();
 	if (ctx == NULL)
 		return -1;
@@ -941,13 +1097,20 @@ int omac1_aes_256(const u8 *key, const u8 *data, size_t data_len, u8 *mac)
 
 struct crypto_bignum * crypto_bignum_init(void)
 {
+	if (TEST_FAIL())
+		return NULL;
 	return (struct crypto_bignum *) BN_new();
 }
 
 
 struct crypto_bignum * crypto_bignum_init_set(const u8 *buf, size_t len)
 {
-	BIGNUM *bn = BN_bin2bn(buf, len, NULL);
+	BIGNUM *bn;
+
+	if (TEST_FAIL())
+		return NULL;
+
+	bn = BN_bin2bn(buf, len, NULL);
 	return (struct crypto_bignum *) bn;
 }
 
@@ -966,6 +1129,9 @@ int crypto_bignum_to_bin(const struct crypto_bignum *a,
 {
 	int num_bytes, offset;
 
+	if (TEST_FAIL())
+		return -1;
+
 	if (padlen > buflen)
 		return -1;
 
@@ -1019,6 +1185,9 @@ int crypto_bignum_exptmod(const struct crypto_bignum *a,
 	int res;
 	BN_CTX *bnctx;
 
+	if (TEST_FAIL())
+		return -1;
+
 	bnctx = BN_CTX_new();
 	if (bnctx == NULL)
 		return -1;
@@ -1037,6 +1206,8 @@ int crypto_bignum_inverse(const struct crypto_bignum *a,
 	BIGNUM *res;
 	BN_CTX *bnctx;
 
+	if (TEST_FAIL())
+		return -1;
 	bnctx = BN_CTX_new();
 	if (bnctx == NULL)
 		return -1;
@@ -1052,6 +1223,8 @@ int crypto_bignum_sub(const struct crypto_bignum *a,
 		      const struct crypto_bignum *b,
 		      struct crypto_bignum *c)
 {
+	if (TEST_FAIL())
+		return -1;
 	return BN_sub((BIGNUM *) c, (const BIGNUM *) a, (const BIGNUM *) b) ?
 		0 : -1;
 }
@@ -1065,6 +1238,9 @@ int crypto_bignum_div(const struct crypto_bignum *a,
 
 	BN_CTX *bnctx;
 
+	if (TEST_FAIL())
+		return -1;
+
 	bnctx = BN_CTX_new();
 	if (bnctx == NULL)
 		return -1;
@@ -1085,6 +1261,9 @@ int crypto_bignum_mulmod(const struct crypto_bignum *a,
 
 	BN_CTX *bnctx;
 
+	if (TEST_FAIL())
+		return -1;
+
 	bnctx = BN_CTX_new();
 	if (bnctx == NULL)
 		return -1;
@@ -1128,6 +1307,9 @@ int crypto_bignum_legendre(const struct crypto_bignum *a,
 	BIGNUM *exp = NULL, *tmp = NULL;
 	int res = -2;
 
+	if (TEST_FAIL())
+		return -2;
+
 	bnctx = BN_CTX_new();
 	if (bnctx == NULL)
 		return -2;
@@ -1252,6 +1434,8 @@ void crypto_ec_deinit(struct crypto_ec *e)
 
 struct crypto_ec_point * crypto_ec_point_init(struct crypto_ec *e)
 {
+	if (TEST_FAIL())
+		return NULL;
 	if (e == NULL)
 		return NULL;
 	return (struct crypto_ec_point *) EC_POINT_new(e->group);
@@ -1298,6 +1482,9 @@ int crypto_ec_point_to_bin(struct crypto_ec *e,
 	int ret = -1;
 	int len = BN_num_bytes(e->prime);
 
+	if (TEST_FAIL())
+		return -1;
+
 	x_bn = BN_new();
 	y_bn = BN_new();
 
@@ -1328,6 +1515,9 @@ struct crypto_ec_point * crypto_ec_point_from_bin(struct crypto_ec *e,
 	EC_POINT *elem;
 	int len = BN_num_bytes(e->prime);
 
+	if (TEST_FAIL())
+		return NULL;
+
 	x = BN_bin2bn(val, len, NULL);
 	y = BN_bin2bn(val + len, len, NULL);
 	elem = EC_POINT_new(e->group);
@@ -1355,6 +1545,8 @@ int crypto_ec_point_add(struct crypto_ec *e, const struct crypto_ec_point *a,
 			const struct crypto_ec_point *b,
 			struct crypto_ec_point *c)
 {
+	if (TEST_FAIL())
+		return -1;
 	return EC_POINT_add(e->group, (EC_POINT *) c, (const EC_POINT *) a,
 			    (const EC_POINT *) b, e->bnctx) ? 0 : -1;
 }
@@ -1364,6 +1556,8 @@ int crypto_ec_point_mul(struct crypto_ec *e, const struct crypto_ec_point *p,
 			const struct crypto_bignum *b,
 			struct crypto_ec_point *res)
 {
+	if (TEST_FAIL())
+		return -1;
 	return EC_POINT_mul(e->group, (EC_POINT *) res, NULL,
 			    (const EC_POINT *) p, (const BIGNUM *) b, e->bnctx)
 		? 0 : -1;
@@ -1372,6 +1566,8 @@ int crypto_ec_point_mul(struct crypto_ec *e, const struct crypto_ec_point *p,
 
 int crypto_ec_point_invert(struct crypto_ec *e, struct crypto_ec_point *p)
 {
+	if (TEST_FAIL())
+		return -1;
 	return EC_POINT_invert(e->group, (EC_POINT *) p, e->bnctx) ? 0 : -1;
 }
 
@@ -1380,6 +1576,8 @@ int crypto_ec_point_solve_y_coord(struct crypto_ec *e,
 				  struct crypto_ec_point *p,
 				  const struct crypto_bignum *x, int y_bit)
 {
+	if (TEST_FAIL())
+		return -1;
 	if (!EC_POINT_set_compressed_coordinates_GFp(e->group, (EC_POINT *) p,
 						     (const BIGNUM *) x, y_bit,
 						     e->bnctx) ||
@@ -1395,6 +1593,9 @@ crypto_ec_point_compute_y_sqr(struct crypto_ec *e,
 {
 	BIGNUM *tmp, *tmp2, *y_sqr = NULL;
 
+	if (TEST_FAIL())
+		return NULL;
+
 	tmp = BN_new();
 	tmp2 = BN_new();
 
diff --git a/src/crypto/dh_group5.c b/src/crypto/dh_group5.c
index ccdbfc8129583..425c848acb832 100644
--- a/src/crypto/dh_group5.c
+++ b/src/crypto/dh_group5.c
@@ -15,6 +15,7 @@
 
 void * dh5_init(struct wpabuf **priv, struct wpabuf **publ)
 {
+	wpabuf_free(*publ);
 	*publ = dh_init(dh_groups_get(5), priv);
 	if (*publ == NULL)
 		return NULL;
diff --git a/src/crypto/dh_groups.c b/src/crypto/dh_groups.c
index 3aeb2bbc60af3..7912361ff8c6f 100644
--- a/src/crypto/dh_groups.c
+++ b/src/crypto/dh_groups.c
@@ -1218,14 +1218,19 @@ struct wpabuf * dh_init(const struct dh_group *dh, struct wpabuf **priv)
 
 	pv_len = dh->prime_len;
 	pv = wpabuf_alloc(pv_len);
-	if (pv == NULL)
+	if (pv == NULL) {
+		wpabuf_clear_free(*priv);
+		*priv = NULL;
 		return NULL;
+	}
 	if (crypto_mod_exp(dh->generator, dh->generator_len,
 			   wpabuf_head(*priv), wpabuf_len(*priv),
 			   dh->prime, dh->prime_len, wpabuf_mhead(pv),
 			   &pv_len) < 0) {
 		wpabuf_clear_free(pv);
 		wpa_printf(MSG_INFO, "DH: crypto_mod_exp failed");
+		wpabuf_clear_free(*priv);
+		*priv = NULL;
 		return NULL;
 	}
 	wpabuf_put(pv, pv_len);
diff --git a/src/crypto/fips_prf_openssl.c b/src/crypto/fips_prf_openssl.c
index fb03efcd4ffc2..4697e041093a8 100644
--- a/src/crypto/fips_prf_openssl.c
+++ b/src/crypto/fips_prf_openssl.c
@@ -17,6 +17,19 @@ static void sha1_transform(u32 *state, const u8 data[64])
 {
 	SHA_CTX context;
 	os_memset(&context, 0, sizeof(context));
+#if defined(OPENSSL_IS_BORINGSSL) && !defined(ANDROID)
+	context.h[0] = state[0];
+	context.h[1] = state[1];
+	context.h[2] = state[2];
+	context.h[3] = state[3];
+	context.h[4] = state[4];
+	SHA1_Transform(&context, data);
+	state[0] = context.h[0];
+	state[1] = context.h[1];
+	state[2] = context.h[2];
+	state[3] = context.h[3];
+	state[4] = context.h[4];
+#else
 	context.h0 = state[0];
 	context.h1 = state[1];
 	context.h2 = state[2];
@@ -28,6 +41,7 @@ static void sha1_transform(u32 *state, const u8 data[64])
 	state[2] = context.h2;
 	state[3] = context.h3;
 	state[4] = context.h4;
+#endif
 }
 
 
@@ -62,12 +76,11 @@ int fips186_2_prf(const u8 *seed, size_t seed_len, u8 *x, size_t xlen)
 			/* w_i = G(t, XVAL) */
 			os_memcpy(_t, t, 20);
 			sha1_transform(_t, xkey);
-			_t[0] = host_to_be32(_t[0]);
-			_t[1] = host_to_be32(_t[1]);
-			_t[2] = host_to_be32(_t[2]);
-			_t[3] = host_to_be32(_t[3]);
-			_t[4] = host_to_be32(_t[4]);
-			os_memcpy(xpos, _t, 20);
+			WPA_PUT_BE32(xpos, _t[0]);
+			WPA_PUT_BE32(xpos + 4, _t[1]);
+			WPA_PUT_BE32(xpos + 8, _t[2]);
+			WPA_PUT_BE32(xpos + 12, _t[3]);
+			WPA_PUT_BE32(xpos + 16, _t[4]);
 
 			/* XKEY = (1 + XKEY + w_i) mod 2^b */
 			carry = 1;
diff --git a/src/crypto/md4-internal.c b/src/crypto/md4-internal.c
index cd5e6ca8cc883..d9c737a2970b6 100644
--- a/src/crypto/md4-internal.c
+++ b/src/crypto/md4-internal.c
@@ -31,6 +31,9 @@ int md4_vector(size_t num_elem, const u8 *addr[], const size_t *len, u8 *mac)
 	MD4_CTX ctx;
 	size_t i;
 
+	if (TEST_FAIL())
+		return -1;
+
 	MD4Init(&ctx);
 	for (i = 0; i < num_elem; i++)
 		MD4Update(&ctx, addr[i], len[i]);
diff --git a/src/crypto/md5-internal.c b/src/crypto/md5-internal.c
index f0a2a5d3a5afa..944698a6328b6 100644
--- a/src/crypto/md5-internal.c
+++ b/src/crypto/md5-internal.c
@@ -33,6 +33,9 @@ int md5_vector(size_t num_elem, const u8 *addr[], const size_t *len, u8 *mac)
 	MD5_CTX ctx;
 	size_t i;
 
+	if (TEST_FAIL())
+		return -1;
+
 	MD5Init(&ctx);
 	for (i = 0; i < num_elem; i++)
 		MD5Update(&ctx, addr[i], len[i]);
diff --git a/src/crypto/ms_funcs.c b/src/crypto/ms_funcs.c
index 053d203cb65bb..d0d6a96af2bc2 100644
--- a/src/crypto/ms_funcs.c
+++ b/src/crypto/ms_funcs.c
@@ -48,7 +48,7 @@ static int utf8_to_ucs2(const u8 *utf8_string, size_t utf8_string_len,
 				WPA_PUT_LE16(ucs2_buffer + j,
 					     ((c & 0x1F) << 6) | (c2 & 0x3F));
 				j += 2;
-			} else if (i == utf8_string_len ||
+			} else if (i == utf8_string_len - 1 ||
 				   j >= ucs2_buffer_size - 1) {
 				/* incomplete surrogate */
 				return -1;
diff --git a/src/crypto/sha1-internal.c b/src/crypto/sha1-internal.c
index 24bc3ffe1759b..ffcba66af652f 100644
--- a/src/crypto/sha1-internal.c
+++ b/src/crypto/sha1-internal.c
@@ -33,6 +33,9 @@ int sha1_vector(size_t num_elem, const u8 *addr[], const size_t *len, u8 *mac)
 	SHA1_CTX ctx;
 	size_t i;
 
+	if (TEST_FAIL())
+		return -1;
+
 	SHA1Init(&ctx);
 	for (i = 0; i < num_elem; i++)
 		SHA1Update(&ctx, addr[i], len[i]);
@@ -294,7 +297,6 @@ void SHA1Final(unsigned char digest[20], SHA1_CTX* context)
 			 255);
 	}
 	/* Wipe variables */
-	i = 0;
 	os_memset(context->buffer, 0, 64);
 	os_memset(context->state, 0, 20);
 	os_memset(context->count, 0, 8);
diff --git a/src/crypto/sha256-internal.c b/src/crypto/sha256-internal.c
index 35299b0524bd9..86a548ee472d1 100644
--- a/src/crypto/sha256-internal.c
+++ b/src/crypto/sha256-internal.c
@@ -28,6 +28,9 @@ int sha256_vector(size_t num_elem, const u8 *addr[], const size_t *len,
 	struct sha256_state ctx;
 	size_t i;
 
+	if (TEST_FAIL())
+		return -1;
+
 	sha256_init(&ctx);
 	for (i = 0; i < num_elem; i++)
 		if (sha256_process(&ctx, addr[i], len[i]))
diff --git a/src/crypto/sha256-prf.c b/src/crypto/sha256-prf.c
index 79791c06cf0bb..722cad6bdeb4d 100644
--- a/src/crypto/sha256-prf.c
+++ b/src/crypto/sha256-prf.c
@@ -1,6 +1,6 @@
 /*
  * SHA256-based PRF (IEEE 802.11r)
- * Copyright (c) 2003-2013, Jouni Malinen <j@w1.fi>
+ * Copyright (c) 2003-2016, Jouni Malinen <j@w1.fi>
  *
  * This software may be distributed under the terms of the BSD license.
  * See README for more details.
@@ -22,14 +22,16 @@
  * @data_len: Length of the data
  * @buf: Buffer for the generated pseudo-random key
  * @buf_len: Number of bytes of key to generate
+ * Returns: 0 on success, -1 on failure
  *
  * This function is used to derive new, cryptographically separate keys from a
  * given key.
  */
-void sha256_prf(const u8 *key, size_t key_len, const char *label,
+int sha256_prf(const u8 *key, size_t key_len, const char *label,
 		const u8 *data, size_t data_len, u8 *buf, size_t buf_len)
 {
-	sha256_prf_bits(key, key_len, label, data, data_len, buf, buf_len * 8);
+	return sha256_prf_bits(key, key_len, label, data, data_len, buf,
+			       buf_len * 8);
 }
 
 
@@ -42,15 +44,16 @@ void sha256_prf(const u8 *key, size_t key_len, const char *label,
  * @data_len: Length of the data
  * @buf: Buffer for the generated pseudo-random key
  * @buf_len: Number of bits of key to generate
+ * Returns: 0 on success, -1 on failure
  *
  * This function is used to derive new, cryptographically separate keys from a
  * given key. If the requested buf_len is not divisible by eight, the least
  * significant 1-7 bits of the last octet in the output are not part of the
  * requested output.
  */
-void sha256_prf_bits(const u8 *key, size_t key_len, const char *label,
-		     const u8 *data, size_t data_len, u8 *buf,
-		     size_t buf_len_bits)
+int sha256_prf_bits(const u8 *key, size_t key_len, const char *label,
+		    const u8 *data, size_t data_len, u8 *buf,
+		    size_t buf_len_bits)
 {
 	u16 counter = 1;
 	size_t pos, plen;
@@ -75,11 +78,14 @@ void sha256_prf_bits(const u8 *key, size_t key_len, const char *label,
 		plen = buf_len - pos;
 		WPA_PUT_LE16(counter_le, counter);
 		if (plen >= SHA256_MAC_LEN) {
-			hmac_sha256_vector(key, key_len, 4, addr, len,
-					   &buf[pos]);
+			if (hmac_sha256_vector(key, key_len, 4, addr, len,
+					       &buf[pos]) < 0)
+				return -1;
 			pos += SHA256_MAC_LEN;
 		} else {
-			hmac_sha256_vector(key, key_len, 4, addr, len, hash);
+			if (hmac_sha256_vector(key, key_len, 4, addr, len,
+					       hash) < 0)
+				return -1;
 			os_memcpy(&buf[pos], hash, plen);
 			pos += plen;
 			break;
@@ -97,4 +103,6 @@ void sha256_prf_bits(const u8 *key, size_t key_len, const char *label,
 	}
 
 	os_memset(hash, 0, sizeof(hash));
+
+	return 0;
 }
diff --git a/src/crypto/sha256.h b/src/crypto/sha256.h
index b15f51158f326..5219022edd7d6 100644
--- a/src/crypto/sha256.h
+++ b/src/crypto/sha256.h
@@ -1,6 +1,6 @@
 /*
  * SHA256 hash implementation and interface functions
- * Copyright (c) 2003-2014, Jouni Malinen <j@w1.fi>
+ * Copyright (c) 2003-2016, Jouni Malinen <j@w1.fi>
  *
  * This software may be distributed under the terms of the BSD license.
  * See README for more details.
@@ -15,11 +15,11 @@ int hmac_sha256_vector(const u8 *key, size_t key_len, size_t num_elem,
 		       const u8 *addr[], const size_t *len, u8 *mac);
 int hmac_sha256(const u8 *key, size_t key_len, const u8 *data,
 		size_t data_len, u8 *mac);
-void sha256_prf(const u8 *key, size_t key_len, const char *label,
-	      const u8 *data, size_t data_len, u8 *buf, size_t buf_len);
-void sha256_prf_bits(const u8 *key, size_t key_len, const char *label,
-		     const u8 *data, size_t data_len, u8 *buf,
-		     size_t buf_len_bits);
+int sha256_prf(const u8 *key, size_t key_len, const char *label,
+	       const u8 *data, size_t data_len, u8 *buf, size_t buf_len);
+int sha256_prf_bits(const u8 *key, size_t key_len, const char *label,
+		    const u8 *data, size_t data_len, u8 *buf,
+		    size_t buf_len_bits);
 void tls_prf_sha256(const u8 *secret, size_t secret_len,
 		    const char *label, const u8 *seed, size_t seed_len,
 		    u8 *out, size_t outlen);
diff --git a/src/crypto/sha384-internal.c b/src/crypto/sha384-internal.c
new file mode 100644
index 0000000000000..646f72979c2a6
--- /dev/null
+++ b/src/crypto/sha384-internal.c
@@ -0,0 +1,92 @@
+/*
+ * SHA-384 hash implementation and interface functions
+ * Copyright (c) 2015, Pali Rohár <pali.rohar@gmail.com>
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ */
+
+#include "includes.h"
+
+#include "common.h"
+#include "sha384_i.h"
+#include "crypto.h"
+
+
+/**
+ * sha384_vector - SHA384 hash for data vector
+ * @num_elem: Number of elements in the data vector
+ * @addr: Pointers to the data areas
+ * @len: Lengths of the data blocks
+ * @mac: Buffer for the hash
+ * Returns: 0 on success, -1 of failure
+ */
+int sha384_vector(size_t num_elem, const u8 *addr[], const size_t *len,
+		  u8 *mac)
+{
+	struct sha384_state ctx;
+	size_t i;
+
+	sha384_init(&ctx);
+	for (i = 0; i < num_elem; i++)
+		if (sha384_process(&ctx, addr[i], len[i]))
+			return -1;
+	if (sha384_done(&ctx, mac))
+		return -1;
+	return 0;
+}
+
+
+/* ===== start - public domain SHA384 implementation ===== */
+
+/* This is based on SHA384 implementation in LibTomCrypt that was released into
+ * public domain by Tom St Denis. */
+
+#define CONST64(n) n ## ULL
+
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+void sha384_init(struct sha384_state *md)
+{
+	md->curlen = 0;
+	md->length = 0;
+	md->state[0] = CONST64(0xcbbb9d5dc1059ed8);
+	md->state[1] = CONST64(0x629a292a367cd507);
+	md->state[2] = CONST64(0x9159015a3070dd17);
+	md->state[3] = CONST64(0x152fecd8f70e5939);
+	md->state[4] = CONST64(0x67332667ffc00b31);
+	md->state[5] = CONST64(0x8eb44a8768581511);
+	md->state[6] = CONST64(0xdb0c2e0d64f98fa7);
+	md->state[7] = CONST64(0x47b5481dbefa4fa4);
+}
+
+int sha384_process(struct sha384_state *md, const unsigned char *in,
+		   unsigned long inlen)
+{
+	return sha512_process(md, in, inlen);
+}
+
+/**
+   Terminate the hash to get the digest
+   @param md  The hash state
+   @param out [out] The destination of the hash (48 bytes)
+   @return CRYPT_OK if successful
+*/
+int sha384_done(struct sha384_state *md, unsigned char *out)
+{
+	unsigned char buf[64];
+
+	if (md->curlen >= sizeof(md->buf))
+		return -1;
+
+	if (sha512_done(md, buf) != 0)
+		return -1;
+
+	os_memcpy(out, buf, 48);
+	return 0;
+}
+
+/* ===== end - public domain SHA384 implementation ===== */
diff --git a/src/crypto/sha384_i.h b/src/crypto/sha384_i.h
new file mode 100644
index 0000000000000..a00253ff2cd0e
--- /dev/null
+++ b/src/crypto/sha384_i.h
@@ -0,0 +1,23 @@
+/*
+ * SHA-384 internal definitions
+ * Copyright (c) 2015, Pali Rohár <pali.rohar@gmail.com>
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ */
+
+#ifndef SHA384_I_H
+#define SHA384_I_H
+
+#include "sha512_i.h"
+
+#define SHA384_BLOCK_SIZE SHA512_BLOCK_SIZE
+
+#define sha384_state sha512_state
+
+void sha384_init(struct sha384_state *md);
+int sha384_process(struct sha384_state *md, const unsigned char *in,
+		   unsigned long inlen);
+int sha384_done(struct sha384_state *md, unsigned char *out);
+
+#endif /* SHA384_I_H */
diff --git a/src/crypto/sha512-internal.c b/src/crypto/sha512-internal.c
new file mode 100644
index 0000000000000..76c4fe750b65f
--- /dev/null
+++ b/src/crypto/sha512-internal.c
@@ -0,0 +1,264 @@
+/*
+ * SHA-512 hash implementation and interface functions
+ * Copyright (c) 2015, Pali Rohár <pali.rohar@gmail.com>
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ */
+
+#include "includes.h"
+
+#include "common.h"
+#include "sha512_i.h"
+#include "crypto.h"
+
+
+/**
+ * sha512_vector - SHA512 hash for data vector
+ * @num_elem: Number of elements in the data vector
+ * @addr: Pointers to the data areas
+ * @len: Lengths of the data blocks
+ * @mac: Buffer for the hash
+ * Returns: 0 on success, -1 of failure
+ */
+int sha512_vector(size_t num_elem, const u8 *addr[], const size_t *len,
+		  u8 *mac)
+{
+	struct sha512_state ctx;
+	size_t i;
+
+	sha512_init(&ctx);
+	for (i = 0; i < num_elem; i++)
+		if (sha512_process(&ctx, addr[i], len[i]))
+			return -1;
+	if (sha512_done(&ctx, mac))
+		return -1;
+	return 0;
+}
+
+
+/* ===== start - public domain SHA512 implementation ===== */
+
+/* This is based on SHA512 implementation in LibTomCrypt that was released into
+ * public domain by Tom St Denis. */
+
+#define CONST64(n) n ## ULL
+
+/* the K array */
+static const u64 K[80] = {
+	CONST64(0x428a2f98d728ae22), CONST64(0x7137449123ef65cd),
+	CONST64(0xb5c0fbcfec4d3b2f), CONST64(0xe9b5dba58189dbbc),
+	CONST64(0x3956c25bf348b538), CONST64(0x59f111f1b605d019),
+	CONST64(0x923f82a4af194f9b), CONST64(0xab1c5ed5da6d8118),
+	CONST64(0xd807aa98a3030242), CONST64(0x12835b0145706fbe),
+	CONST64(0x243185be4ee4b28c), CONST64(0x550c7dc3d5ffb4e2),
+	CONST64(0x72be5d74f27b896f), CONST64(0x80deb1fe3b1696b1),
+	CONST64(0x9bdc06a725c71235), CONST64(0xc19bf174cf692694),
+	CONST64(0xe49b69c19ef14ad2), CONST64(0xefbe4786384f25e3),
+	CONST64(0x0fc19dc68b8cd5b5), CONST64(0x240ca1cc77ac9c65),
+	CONST64(0x2de92c6f592b0275), CONST64(0x4a7484aa6ea6e483),
+	CONST64(0x5cb0a9dcbd41fbd4), CONST64(0x76f988da831153b5),
+	CONST64(0x983e5152ee66dfab), CONST64(0xa831c66d2db43210),
+	CONST64(0xb00327c898fb213f), CONST64(0xbf597fc7beef0ee4),
+	CONST64(0xc6e00bf33da88fc2), CONST64(0xd5a79147930aa725),
+	CONST64(0x06ca6351e003826f), CONST64(0x142929670a0e6e70),
+	CONST64(0x27b70a8546d22ffc), CONST64(0x2e1b21385c26c926),
+	CONST64(0x4d2c6dfc5ac42aed), CONST64(0x53380d139d95b3df),
+	CONST64(0x650a73548baf63de), CONST64(0x766a0abb3c77b2a8),
+	CONST64(0x81c2c92e47edaee6), CONST64(0x92722c851482353b),
+	CONST64(0xa2bfe8a14cf10364), CONST64(0xa81a664bbc423001),
+	CONST64(0xc24b8b70d0f89791), CONST64(0xc76c51a30654be30),
+	CONST64(0xd192e819d6ef5218), CONST64(0xd69906245565a910),
+	CONST64(0xf40e35855771202a), CONST64(0x106aa07032bbd1b8),
+	CONST64(0x19a4c116b8d2d0c8), CONST64(0x1e376c085141ab53),
+	CONST64(0x2748774cdf8eeb99), CONST64(0x34b0bcb5e19b48a8),
+	CONST64(0x391c0cb3c5c95a63), CONST64(0x4ed8aa4ae3418acb),
+	CONST64(0x5b9cca4f7763e373), CONST64(0x682e6ff3d6b2b8a3),
+	CONST64(0x748f82ee5defb2fc), CONST64(0x78a5636f43172f60),
+	CONST64(0x84c87814a1f0ab72), CONST64(0x8cc702081a6439ec),
+	CONST64(0x90befffa23631e28), CONST64(0xa4506cebde82bde9),
+	CONST64(0xbef9a3f7b2c67915), CONST64(0xc67178f2e372532b),
+	CONST64(0xca273eceea26619c), CONST64(0xd186b8c721c0c207),
+	CONST64(0xeada7dd6cde0eb1e), CONST64(0xf57d4f7fee6ed178),
+	CONST64(0x06f067aa72176fba), CONST64(0x0a637dc5a2c898a6),
+	CONST64(0x113f9804bef90dae), CONST64(0x1b710b35131c471b),
+	CONST64(0x28db77f523047d84), CONST64(0x32caab7b40c72493),
+	CONST64(0x3c9ebe0a15c9bebc), CONST64(0x431d67c49c100d4c),
+	CONST64(0x4cc5d4becb3e42b6), CONST64(0x597f299cfc657e2a),
+	CONST64(0x5fcb6fab3ad6faec), CONST64(0x6c44198c4a475817)
+};
+
+/* Various logical functions */
+#define Ch(x,y,z)       (z ^ (x & (y ^ z)))
+#define Maj(x,y,z)      (((x | y) & z) | (x & y))
+#define S(x, n)         ROR64c(x, n)
+#define R(x, n)         (((x) & CONST64(0xFFFFFFFFFFFFFFFF)) >> ((u64) n))
+#define Sigma0(x)       (S(x, 28) ^ S(x, 34) ^ S(x, 39))
+#define Sigma1(x)       (S(x, 14) ^ S(x, 18) ^ S(x, 41))
+#define Gamma0(x)       (S(x, 1) ^ S(x, 8) ^ R(x, 7))
+#define Gamma1(x)       (S(x, 19) ^ S(x, 61) ^ R(x, 6))
+#ifndef MIN
+#define MIN(x, y) (((x) < (y)) ? (x) : (y))
+#endif
+
+#define ROR64c(x, y) \
+    ( ((((x) & CONST64(0xFFFFFFFFFFFFFFFF)) >> ((u64) (y) & CONST64(63))) | \
+      ((x) << ((u64) (64 - ((y) & CONST64(63)))))) & \
+      CONST64(0xFFFFFFFFFFFFFFFF))
+
+/* compress 1024-bits */
+static int sha512_compress(struct sha512_state *md, unsigned char *buf)
+{
+	u64 S[8], W[80], t0, t1;
+	int i;
+
+	/* copy state into S */
+	for (i = 0; i < 8; i++) {
+		S[i] = md->state[i];
+	}
+
+	/* copy the state into 1024-bits into W[0..15] */
+	for (i = 0; i < 16; i++)
+		W[i] = WPA_GET_BE64(buf + (8 * i));
+
+	/* fill W[16..79] */
+	for (i = 16; i < 80; i++) {
+		W[i] = Gamma1(W[i - 2]) + W[i - 7] + Gamma0(W[i - 15]) +
+			W[i - 16];
+	}
+
+	/* Compress */
+	for (i = 0; i < 80; i++) {
+		t0 = S[7] + Sigma1(S[4]) + Ch(S[4], S[5], S[6]) + K[i] + W[i];
+		t1 = Sigma0(S[0]) + Maj(S[0], S[1], S[2]);
+		S[7] = S[6];
+		S[6] = S[5];
+		S[5] = S[4];
+		S[4] = S[3] + t0;
+		S[3] = S[2];
+		S[2] = S[1];
+		S[1] = S[0];
+		S[0] = t0 + t1;
+	}
+
+	/* feedback */
+	for (i = 0; i < 8; i++) {
+		md->state[i] = md->state[i] + S[i];
+	}
+
+	return 0;
+}
+
+
+/**
+   Initialize the hash state
+   @param md   The hash state you wish to initialize
+   @return CRYPT_OK if successful
+*/
+void sha512_init(struct sha512_state *md)
+{
+	md->curlen = 0;
+	md->length = 0;
+	md->state[0] = CONST64(0x6a09e667f3bcc908);
+	md->state[1] = CONST64(0xbb67ae8584caa73b);
+	md->state[2] = CONST64(0x3c6ef372fe94f82b);
+	md->state[3] = CONST64(0xa54ff53a5f1d36f1);
+	md->state[4] = CONST64(0x510e527fade682d1);
+	md->state[5] = CONST64(0x9b05688c2b3e6c1f);
+	md->state[6] = CONST64(0x1f83d9abfb41bd6b);
+	md->state[7] = CONST64(0x5be0cd19137e2179);
+}
+
+
+/**
+   Process a block of memory though the hash
+   @param md     The hash state
+   @param in     The data to hash
+   @param inlen  The length of the data (octets)
+   @return CRYPT_OK if successful
+*/
+int sha512_process(struct sha512_state *md, const unsigned char *in,
+		   unsigned long inlen)
+{
+	unsigned long n;
+
+	if (md->curlen >= sizeof(md->buf))
+		return -1;
+
+	while (inlen > 0) {
+		if (md->curlen == 0 && inlen >= SHA512_BLOCK_SIZE) {
+			if (sha512_compress(md, (unsigned char *) in) < 0)
+				return -1;
+			md->length += SHA512_BLOCK_SIZE * 8;
+			in += SHA512_BLOCK_SIZE;
+			inlen -= SHA512_BLOCK_SIZE;
+		} else {
+			n = MIN(inlen, (SHA512_BLOCK_SIZE - md->curlen));
+			os_memcpy(md->buf + md->curlen, in, n);
+			md->curlen += n;
+			in += n;
+			inlen -= n;
+			if (md->curlen == SHA512_BLOCK_SIZE) {
+				if (sha512_compress(md, md->buf) < 0)
+					return -1;
+				md->length += 8 * SHA512_BLOCK_SIZE;
+				md->curlen = 0;
+			}
+		}
+	}
+
+	return 0;
+}
+
+
+/**
+   Terminate the hash to get the digest
+   @param md  The hash state
+   @param out [out] The destination of the hash (64 bytes)
+   @return CRYPT_OK if successful
+*/
+int sha512_done(struct sha512_state *md, unsigned char *out)
+{
+	int i;
+
+	if (md->curlen >= sizeof(md->buf))
+		return -1;
+
+	/* increase the length of the message */
+	md->length += md->curlen * CONST64(8);
+
+	/* append the '1' bit */
+	md->buf[md->curlen++] = (unsigned char) 0x80;
+
+	/* if the length is currently above 112 bytes we append zeros
+	 * then compress.  Then we can fall back to padding zeros and length
+	 * encoding like normal.
+	 */
+	if (md->curlen > 112) {
+		while (md->curlen < 128) {
+			md->buf[md->curlen++] = (unsigned char) 0;
+		}
+		sha512_compress(md, md->buf);
+		md->curlen = 0;
+	}
+
+	/* pad up to 120 bytes of zeroes
+	 * note: that from 112 to 120 is the 64 MSB of the length.  We assume
+	 * that you won't hash > 2^64 bits of data... :-)
+	 */
+	while (md->curlen < 120) {
+		md->buf[md->curlen++] = (unsigned char) 0;
+	}
+
+	/* store length */
+	WPA_PUT_BE64(md->buf + 120, md->length);
+	sha512_compress(md, md->buf);
+
+	/* copy output */
+	for (i = 0; i < 8; i++)
+		WPA_PUT_BE64(out + (8 * i), md->state[i]);
+
+	return 0;
+}
+
+/* ===== end - public domain SHA512 implementation ===== */
diff --git a/src/crypto/sha512_i.h b/src/crypto/sha512_i.h
new file mode 100644
index 0000000000000..108958911ef14
--- /dev/null
+++ b/src/crypto/sha512_i.h
@@ -0,0 +1,25 @@
+/*
+ * SHA-512 internal definitions
+ * Copyright (c) 2015, Pali Rohár <pali.rohar@gmail.com>
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ */
+
+#ifndef SHA512_I_H
+#define SHA512_I_H
+
+#define SHA512_BLOCK_SIZE 128
+
+struct sha512_state {
+	u64 length, state[8];
+	u32 curlen;
+	u8 buf[SHA512_BLOCK_SIZE];
+};
+
+void sha512_init(struct sha512_state *md);
+int sha512_process(struct sha512_state *md, const unsigned char *in,
+		   unsigned long inlen);
+int sha512_done(struct sha512_state *md, unsigned char *out);
+
+#endif /* SHA512_I_H */
diff --git a/src/crypto/tls.h b/src/crypto/tls.h
index 2e562339cc5c0..11d504a97fc05 100644
--- a/src/crypto/tls.h
+++ b/src/crypto/tls.h
@@ -95,6 +95,8 @@ struct tls_config {
 #define TLS_CONN_DISABLE_TLSv1_2 BIT(6)
 #define TLS_CONN_EAP_FAST BIT(7)
 #define TLS_CONN_DISABLE_TLSv1_0 BIT(8)
+#define TLS_CONN_EXT_CERT_CHECK BIT(9)
+#define TLS_CONN_REQUIRE_OCSP_ALL BIT(10)
 
 /**
  * struct tls_connection_params - Parameters for TLS connection
@@ -139,6 +141,9 @@ struct tls_config {
  * @flags: Parameter options (TLS_CONN_*)
  * @ocsp_stapling_response: DER encoded file with cached OCSP stapling response
  *	or %NULL if OCSP is not enabled
+ * @ocsp_stapling_response_multi: DER encoded file with cached OCSP stapling
+ *	response list (OCSPResponseList for ocsp_multi in RFC 6961) or %NULL if
+ *	ocsp_multi is not enabled
  *
  * TLS connection parameters to be configured with tls_connection_set_params()
  * and tls_global_set_params().
@@ -179,6 +184,7 @@ struct tls_connection_params {
 
 	unsigned int flags;
 	const char *ocsp_stapling_response;
+	const char *ocsp_stapling_response_multi;
 };
 
 
@@ -330,29 +336,36 @@ int __must_check tls_connection_get_random(void *tls_ctx,
 					 struct tls_random *data);
 
 /**
- * tls_connection_prf - Use TLS-PRF to derive keying material
+ * tls_connection_export_key - Derive keying material from a TLS connection
  * @tls_ctx: TLS context data from tls_init()
  * @conn: Connection context data from tls_connection_init()
  * @label: Label (e.g., description of the key) for PRF
- * @server_random_first: seed is 0 = client_random|server_random,
- * 1 = server_random|client_random
- * @skip_keyblock: Skip TLS key block from the beginning of PRF output
  * @out: Buffer for output data from TLS-PRF
  * @out_len: Length of the output buffer
  * Returns: 0 on success, -1 on failure
  *
- * tls_connection_prf() is required so that further keying material can be
- * derived from the master secret. Example implementation of this function is in
- * tls_prf_sha1_md5() when it is called with seed set to
- * client_random|server_random (or server_random|client_random). For TLSv1.2 and
- * newer, a different PRF is needed, though.
+ * Exports keying material using the mechanism described in RFC 5705.
  */
-int __must_check  tls_connection_prf(void *tls_ctx,
-				     struct tls_connection *conn,
-				     const char *label,
-				     int server_random_first,
-				     int skip_keyblock,
-				     u8 *out, size_t out_len);
+int __must_check tls_connection_export_key(void *tls_ctx,
+					   struct tls_connection *conn,
+					   const char *label,
+					   u8 *out, size_t out_len);
+
+/**
+ * tls_connection_get_eap_fast_key - Derive key material for EAP-FAST
+ * @tls_ctx: TLS context data from tls_init()
+ * @conn: Connection context data from tls_connection_init()
+ * @out: Buffer for output data from TLS-PRF
+ * @out_len: Length of the output buffer
+ * Returns: 0 on success, -1 on failure
+ *
+ * Exports key material after the normal TLS key block for use with
+ * EAP-FAST. Most callers will want tls_connection_export_key(), but EAP-FAST
+ * uses a different legacy mechanism.
+ */
+int __must_check tls_connection_get_eap_fast_key(void *tls_ctx,
+						 struct tls_connection *conn,
+						 u8 *out, size_t out_len);
 
 /**
  * tls_connection_handshake - Process TLS handshake (client side)
@@ -455,7 +468,9 @@ enum {
 	TLS_CIPHER_RC4_SHA /* 0x0005 */,
 	TLS_CIPHER_AES128_SHA /* 0x002f */,
 	TLS_CIPHER_RSA_DHE_AES128_SHA /* 0x0031 */,
-	TLS_CIPHER_ANON_DH_AES128_SHA /* 0x0034 */
+	TLS_CIPHER_ANON_DH_AES128_SHA /* 0x0034 */,
+	TLS_CIPHER_RSA_DHE_AES256_SHA /* 0x0039 */,
+	TLS_CIPHER_AES256_SHA /* 0x0035 */,
 };
 
 /**
diff --git a/src/crypto/tls_gnutls.c b/src/crypto/tls_gnutls.c
index f994379b16b22..200f0eda931af 100644
--- a/src/crypto/tls_gnutls.c
+++ b/src/crypto/tls_gnutls.c
@@ -37,6 +37,8 @@ struct tls_global {
 			 union tls_event_data *data);
 	void *cb_ctx;
 	int cert_in_cb;
+
+	char *ocsp_stapling_response;
 };
 
 struct tls_connection {
@@ -133,6 +135,7 @@ void tls_deinit(void *ssl_ctx)
 		if (global->params_set)
 			gnutls_certificate_free_credentials(global->xcred);
 		os_free(global->session_data);
+		os_free(global->ocsp_stapling_response);
 		os_free(global);
 	}
 
@@ -347,6 +350,18 @@ int tls_connection_set_params(void *tls_ctx, struct tls_connection *conn,
 	if (conn == NULL || params == NULL)
 		return -1;
 
+	if (params->flags & TLS_CONN_REQUIRE_OCSP_ALL) {
+		wpa_printf(MSG_INFO,
+			   "GnuTLS: ocsp=3 not supported");
+		return -1;
+	}
+
+	if (params->flags & TLS_CONN_EXT_CERT_CHECK) {
+		wpa_printf(MSG_INFO,
+			   "GnuTLS: tls_ext_cert_check=1 not supported");
+		return -1;
+	}
+
 	if (params->subject_match) {
 		wpa_printf(MSG_INFO, "GnuTLS: subject_match not supported");
 		return -1;
@@ -596,6 +611,44 @@ int tls_connection_set_params(void *tls_ctx, struct tls_connection *conn,
 }
 
 
+#if GNUTLS_VERSION_NUMBER >= 0x030103
+static int server_ocsp_status_req(gnutls_session_t session, void *ptr,
+				  gnutls_datum_t *resp)
+{
+	struct tls_global *global = ptr;
+	char *cached;
+	size_t len;
+
+	if (!global->ocsp_stapling_response) {
+		wpa_printf(MSG_DEBUG, "GnuTLS: OCSP status callback - no response configured");
+		return GNUTLS_E_NO_CERTIFICATE_STATUS;
+	}
+
+	cached = os_readfile(global->ocsp_stapling_response, &len);
+	if (!cached) {
+		wpa_printf(MSG_DEBUG,
+			   "GnuTLS: OCSP status callback - could not read response file (%s)",
+			   global->ocsp_stapling_response);
+		return GNUTLS_E_NO_CERTIFICATE_STATUS;
+	}
+
+	wpa_printf(MSG_DEBUG,
+		   "GnuTLS: OCSP status callback - send cached response");
+	resp->data = gnutls_malloc(len);
+	if (!resp->data) {
+		os_free(resp);
+		return GNUTLS_E_MEMORY_ERROR;
+	}
+
+	os_memcpy(resp->data, cached, len);
+	resp->size = len;
+	os_free(cached);
+
+	return GNUTLS_E_SUCCESS;
+}
+#endif /* 3.1.3 */
+
+
 int tls_global_set_params(void *tls_ctx,
 			  const struct tls_connection_params *params)
 {
@@ -690,6 +743,17 @@ int tls_global_set_params(void *tls_ctx,
 		}
 	}
 
+#if GNUTLS_VERSION_NUMBER >= 0x030103
+	os_free(global->ocsp_stapling_response);
+	if (params->ocsp_stapling_response)
+		global->ocsp_stapling_response =
+			os_strdup(params->ocsp_stapling_response);
+	else
+		global->ocsp_stapling_response = NULL;
+	gnutls_certificate_set_ocsp_status_request_function(
+		global->xcred, server_ocsp_status_req, global);
+#endif /* 3.1.3 */
+
 	global->params_set = 1;
 
 	return 0;
@@ -746,15 +810,22 @@ int tls_connection_get_random(void *ssl_ctx, struct tls_connection *conn,
 }
 
 
-int tls_connection_prf(void *tls_ctx, struct tls_connection *conn,
-		       const char *label, int server_random_first,
-		       int skip_keyblock, u8 *out, size_t out_len)
+int tls_connection_export_key(void *tls_ctx, struct tls_connection *conn,
+			      const char *label, u8 *out, size_t out_len)
 {
-	if (conn == NULL || conn->session == NULL || skip_keyblock)
+	if (conn == NULL || conn->session == NULL)
 		return -1;
 
 	return gnutls_prf(conn->session, os_strlen(label), label,
-			  server_random_first, 0, NULL, out_len, (char *) out);
+			  0 /* client_random first */, 0, NULL, out_len,
+			  (char *) out);
+}
+
+
+int tls_connection_get_eap_fast_key(void *tls_ctx, struct tls_connection *conn,
+				    u8 *out, size_t out_len)
+{
+	return -1;
 }
 
 
diff --git a/src/crypto/tls_internal.c b/src/crypto/tls_internal.c
index 704751d308fcf..c7cb5ded331f2 100644
--- a/src/crypto/tls_internal.c
+++ b/src/crypto/tls_internal.c
@@ -23,6 +23,11 @@ struct tls_global {
 	int server;
 	struct tlsv1_credentials *server_cred;
 	int check_crl;
+
+	void (*event_cb)(void *ctx, enum tls_event ev,
+			 union tls_event_data *data);
+	void *cb_ctx;
+	int cert_in_cb;
 };
 
 struct tls_connection {
@@ -51,6 +56,11 @@ void * tls_init(const struct tls_config *conf)
 	global = os_zalloc(sizeof(*global));
 	if (global == NULL)
 		return NULL;
+	if (conf) {
+		global->event_cb = conf->event_cb;
+		global->cb_ctx = conf->cb_ctx;
+		global->cert_in_cb = conf->cert_in_cb;
+	}
 
 	return global;
 }
@@ -64,10 +74,12 @@ void tls_deinit(void *ssl_ctx)
 		tlsv1_client_global_deinit();
 #endif /* CONFIG_TLS_INTERNAL_CLIENT */
 #ifdef CONFIG_TLS_INTERNAL_SERVER
-		tlsv1_cred_free(global->server_cred);
 		tlsv1_server_global_deinit();
 #endif /* CONFIG_TLS_INTERNAL_SERVER */
 	}
+#ifdef CONFIG_TLS_INTERNAL_SERVER
+	tlsv1_cred_free(global->server_cred);
+#endif /* CONFIG_TLS_INTERNAL_SERVER */
 	os_free(global);
 }
 
@@ -95,6 +107,8 @@ struct tls_connection * tls_connection_init(void *tls_ctx)
 			os_free(conn);
 			return NULL;
 		}
+		tlsv1_client_set_cb(conn->client, global->event_cb,
+				    global->cb_ctx, global->cert_in_cb);
 	}
 #endif /* CONFIG_TLS_INTERNAL_CLIENT */
 #ifdef CONFIG_TLS_INTERNAL_SERVER
@@ -186,6 +200,12 @@ int tls_connection_set_params(void *tls_ctx, struct tls_connection *conn,
 	if (conn->client == NULL)
 		return -1;
 
+	if (params->flags & TLS_CONN_EXT_CERT_CHECK) {
+		wpa_printf(MSG_INFO,
+			   "TLS: tls_ext_cert_check=1 not supported");
+		return -1;
+	}
+
 	cred = tlsv1_cred_alloc();
 	if (cred == NULL)
 		return -1;
@@ -259,8 +279,7 @@ int tls_connection_set_params(void *tls_ctx, struct tls_connection *conn,
 		return -1;
 	}
 
-	tlsv1_client_set_time_checks(
-		conn->client, !(params->flags & TLS_CONN_DISABLE_TIME_CHECKS));
+	tlsv1_client_set_flags(conn->client, params->flags);
 
 	return 0;
 #else /* CONFIG_TLS_INTERNAL_CLIENT */
@@ -312,6 +331,13 @@ int tls_global_set_params(void *tls_ctx,
 		return -1;
 	}
 
+	if (params->ocsp_stapling_response)
+		cred->ocsp_stapling_response =
+			os_strdup(params->ocsp_stapling_response);
+	if (params->ocsp_stapling_response_multi)
+		cred->ocsp_stapling_response_multi =
+			os_strdup(params->ocsp_stapling_response_multi);
+
 	return 0;
 #else /* CONFIG_TLS_INTERNAL_SERVER */
 	return -1;
@@ -368,9 +394,9 @@ static int tls_get_keyblock_size(struct tls_connection *conn)
 }
 
 
-int tls_connection_prf(void *tls_ctx, struct tls_connection *conn,
-		       const char *label, int server_random_first,
-		       int skip_keyblock, u8 *out, size_t out_len)
+static int tls_connection_prf(void *tls_ctx, struct tls_connection *conn,
+			      const char *label, int server_random_first,
+			      int skip_keyblock, u8 *out, size_t out_len)
 {
 	int ret = -1, skip = 0;
 	u8 *tmp_out = NULL;
@@ -390,14 +416,14 @@ int tls_connection_prf(void *tls_ctx, struct tls_connection *conn,
 	if (conn->client) {
 		ret = tlsv1_client_prf(conn->client, label,
 				       server_random_first,
-				       _out, out_len);
+				       _out, skip + out_len);
 	}
 #endif /* CONFIG_TLS_INTERNAL_CLIENT */
 #ifdef CONFIG_TLS_INTERNAL_SERVER
 	if (conn->server) {
 		ret = tlsv1_server_prf(conn->server, label,
 				       server_random_first,
-				       _out, out_len);
+				       _out, skip + out_len);
 	}
 #endif /* CONFIG_TLS_INTERNAL_SERVER */
 	if (ret == 0 && skip_keyblock)
@@ -408,6 +434,21 @@ int tls_connection_prf(void *tls_ctx, struct tls_connection *conn,
 }
 
 
+int tls_connection_export_key(void *tls_ctx, struct tls_connection *conn,
+			      const char *label, u8 *out, size_t out_len)
+{
+	return tls_connection_prf(tls_ctx, conn, label, 0, 0, out, out_len);
+}
+
+
+int tls_connection_get_eap_fast_key(void *tls_ctx, struct tls_connection *conn,
+				    u8 *out, size_t out_len)
+{
+	return tls_connection_prf(tls_ctx, conn, "key expansion", 1, 1, out,
+				  out_len);
+}
+
+
 struct wpabuf * tls_connection_handshake(void *tls_ctx,
 					 struct tls_connection *conn,
 					 const struct wpabuf *in_data,
@@ -621,7 +662,12 @@ int tls_connection_set_cipher_list(void *tls_ctx, struct tls_connection *conn,
 int tls_get_version(void *ssl_ctx, struct tls_connection *conn,
 		    char *buf, size_t buflen)
 {
-	/* TODO */
+	if (conn == NULL)
+		return -1;
+#ifdef CONFIG_TLS_INTERNAL_CLIENT
+	if (conn->client)
+		return tlsv1_client_get_version(conn->client, buf, buflen);
+#endif /* CONFIG_TLS_INTERNAL_CLIENT */
 	return -1;
 }
 
diff --git a/src/crypto/tls_none.c b/src/crypto/tls_none.c
index ae392ad8aa0f5..dd5681e9ca3c3 100644
--- a/src/crypto/tls_none.c
+++ b/src/crypto/tls_none.c
@@ -86,9 +86,15 @@ int tls_connection_get_random(void *tls_ctx, struct tls_connection *conn,
 }
 
 
-int tls_connection_prf(void *tls_ctx, struct tls_connection *conn,
-		       const char *label, int server_random_first,
-		       int skip_keyblock, u8 *out, size_t out_len)
+int tls_connection_export_key(void *tls_ctx, struct tls_connection *conn,
+			      const char *label, u8 *out, size_t out_len)
+{
+	return -1;
+}
+
+
+int tls_connection_get_eap_fast_key(void *tls_ctx, struct tls_connection *conn,
+				    u8 *out, size_t out_len)
 {
 	return -1;
 }
diff --git a/src/crypto/tls_openssl.c b/src/crypto/tls_openssl.c
index 8b7b47bc256d5..23ac64b48cd9b 100644
--- a/src/crypto/tls_openssl.c
+++ b/src/crypto/tls_openssl.c
@@ -18,6 +18,7 @@
 
 #include <openssl/ssl.h>
 #include <openssl/err.h>
+#include <openssl/opensslv.h>
 #include <openssl/pkcs12.h>
 #include <openssl/x509v3.h>
 #ifndef OPENSSL_NO_ENGINE
@@ -35,12 +36,12 @@
 #include "sha1.h"
 #include "sha256.h"
 #include "tls.h"
+#include "tls_openssl.h"
 
-#if OPENSSL_VERSION_NUMBER < 0x10000000L
-/* ERR_remove_thread_state replaces ERR_remove_state and the latter is
- * deprecated. However, OpenSSL 0.9.8 doesn't include
- * ERR_remove_thread_state. */
-#define ERR_remove_thread_state(tid) ERR_remove_state(0)
+#if !defined(CONFIG_FIPS) &&                             \
+    (defined(EAP_FAST) || defined(EAP_FAST_DYNAMIC) ||   \
+     defined(EAP_SERVER_FAST))
+#define OPENSSL_NEED_EAP_FAST_PRF
 #endif
 
 #if defined(OPENSSL_IS_BORINGSSL)
@@ -57,6 +58,51 @@ typedef int stack_index_t;
 #endif /* OPENSSL_NO_TLSEXT */
 #endif /* SSL_set_tlsext_status_type */
 
+#if (OPENSSL_VERSION_NUMBER < 0x10100000L || \
+     defined(LIBRESSL_VERSION_NUMBER)) &&    \
+    !defined(BORINGSSL_API_VERSION)
+/*
+ * SSL_get_client_random() and SSL_get_server_random() were added in OpenSSL
+ * 1.1.0 and newer BoringSSL revisions. Provide compatibility wrappers for
+ * older versions.
+ */
+
+static size_t SSL_get_client_random(const SSL *ssl, unsigned char *out,
+				    size_t outlen)
+{
+	if (!ssl->s3 || outlen < SSL3_RANDOM_SIZE)
+		return 0;
+	os_memcpy(out, ssl->s3->client_random, SSL3_RANDOM_SIZE);
+	return SSL3_RANDOM_SIZE;
+}
+
+
+static size_t SSL_get_server_random(const SSL *ssl, unsigned char *out,
+				    size_t outlen)
+{
+	if (!ssl->s3 || outlen < SSL3_RANDOM_SIZE)
+		return 0;
+	os_memcpy(out, ssl->s3->server_random, SSL3_RANDOM_SIZE);
+	return SSL3_RANDOM_SIZE;
+}
+
+
+#ifdef OPENSSL_NEED_EAP_FAST_PRF
+static size_t SSL_SESSION_get_master_key(const SSL_SESSION *session,
+					 unsigned char *out, size_t outlen)
+{
+	if (!session || session->master_key_length < 0 ||
+	    (size_t) session->master_key_length > outlen)
+		return 0;
+	if ((size_t) session->master_key_length < outlen)
+		outlen = session->master_key_length;
+	os_memcpy(out, session->master_key, outlen);
+	return outlen;
+}
+#endif /* OPENSSL_NEED_EAP_FAST_PRF */
+
+#endif
+
 #ifdef ANDROID
 #include <openssl/pem.h>
 #include <keystore/keystore_get.h>
@@ -71,6 +117,66 @@ static BIO * BIO_from_keystore(const char *key)
 	free(value);
 	return bio;
 }
+
+
+static int tls_add_ca_from_keystore(X509_STORE *ctx, const char *key_alias)
+{
+	BIO *bio = BIO_from_keystore(key_alias);
+	STACK_OF(X509_INFO) *stack = NULL;
+	stack_index_t i;
+
+	if (bio) {
+		stack = PEM_X509_INFO_read_bio(bio, NULL, NULL, NULL);
+		BIO_free(bio);
+	}
+
+	if (!stack) {
+		wpa_printf(MSG_WARNING, "TLS: Failed to parse certificate: %s",
+			   key_alias);
+		return -1;
+	}
+
+	for (i = 0; i < sk_X509_INFO_num(stack); ++i) {
+		X509_INFO *info = sk_X509_INFO_value(stack, i);
+
+		if (info->x509)
+			X509_STORE_add_cert(ctx, info->x509);
+		if (info->crl)
+			X509_STORE_add_crl(ctx, info->crl);
+	}
+
+	sk_X509_INFO_pop_free(stack, X509_INFO_free);
+
+	return 0;
+}
+
+
+static int tls_add_ca_from_keystore_encoded(X509_STORE *ctx,
+					    const char *encoded_key_alias)
+{
+	int rc = -1;
+	int len = os_strlen(encoded_key_alias);
+	unsigned char *decoded_alias;
+
+	if (len & 1) {
+		wpa_printf(MSG_WARNING, "Invalid hex-encoded alias: %s",
+			   encoded_key_alias);
+		return rc;
+	}
+
+	decoded_alias = os_malloc(len / 2 + 1);
+	if (decoded_alias) {
+		if (!hexstr2bin(encoded_key_alias, decoded_alias, len / 2)) {
+			decoded_alias[len / 2] = '\0';
+			rc = tls_add_ca_from_keystore(
+				ctx, (const char *) decoded_alias);
+		}
+		os_free(decoded_alias);
+	}
+
+	return rc;
+}
+
 #endif /* ANDROID */
 
 static int tls_openssl_ref_count = 0;
@@ -97,7 +203,7 @@ struct tls_connection {
 	SSL_CTX *ssl_ctx;
 	SSL *ssl;
 	BIO *ssl_in, *ssl_out;
-#ifndef OPENSSL_NO_ENGINE
+#if defined(ANDROID) || !defined(OPENSSL_NO_ENGINE)
 	ENGINE *engine;        /* functional reference to the engine */
 	EVP_PKEY *private_key; /* the private key if using engine */
 #endif /* OPENSSL_NO_ENGINE */
@@ -125,10 +231,8 @@ struct tls_connection {
 	X509 *peer_issuer;
 	X509 *peer_issuer_issuer;
 
-#if OPENSSL_VERSION_NUMBER >= 0x10100000L
 	unsigned char client_random[SSL3_RANDOM_SIZE];
 	unsigned char server_random[SSL3_RANDOM_SIZE];
-#endif
 };
 
 
@@ -526,7 +630,8 @@ static int tls_cryptoapi_ca_cert(SSL_CTX *ssl_ctx, SSL *ssl, const char *name)
 		wpa_printf(MSG_DEBUG, "OpenSSL: Loaded CA certificate for "
 			   "system certificate store: subject='%s'", buf);
 
-		if (!X509_STORE_add_cert(ssl_ctx->cert_store, cert)) {
+		if (!X509_STORE_add_cert(SSL_CTX_get_cert_store(ssl_ctx),
+					 cert)) {
 			tls_show_errors(MSG_WARNING, __func__,
 					"Failed to add ca_cert to OpenSSL "
 					"certificate store");
@@ -624,10 +729,16 @@ static int tls_engine_load_dynamic_generic(const char *pre[],
 
 	engine = ENGINE_by_id(id);
 	if (engine) {
-		ENGINE_free(engine);
 		wpa_printf(MSG_DEBUG, "ENGINE: engine '%s' is already "
 			   "available", id);
-		return 0;
+		/*
+		 * If it was auto-loaded by ENGINE_by_id() we might still
+		 * need to tell it which PKCS#11 module to use in legacy
+		 * (non-p11-kit) environments. Do so now; even if it was
+		 * properly initialised before, setting it again will be
+		 * harmless.
+		 */
+		goto found;
 	}
 	ERR_clear_error();
 
@@ -664,7 +775,7 @@ static int tls_engine_load_dynamic_generic(const char *pre[],
 			   id, ERR_error_string(ERR_get_error(), NULL));
 		return -1;
 	}
-
+ found:
 	while (post && post[0]) {
 		wpa_printf(MSG_DEBUG, "ENGINE: '%s' '%s'", post[0], post[1]);
 		if (ENGINE_ctrl_cmd_string(engine, post[0], post[1], 0) == 0) {
@@ -808,6 +919,7 @@ void * tls_init(const struct tls_config *conf)
 		}
 #endif /* OPENSSL_FIPS */
 #endif /* CONFIG_FIPS */
+#if OPENSSL_VERSION_NUMBER < 0x10100000L
 		SSL_load_error_strings();
 		SSL_library_init();
 #ifndef OPENSSL_NO_SHA256
@@ -829,6 +941,7 @@ void * tls_init(const struct tls_config *conf)
 #endif /* OPENSSL_NO_RC2 */
 		PKCS12_PBE_add();
 #endif  /* PKCS12_FUNCS */
+#endif /* < 1.1.0 */
 	} else {
 		context = tls_context_new(conf);
 		if (context == NULL)
@@ -849,6 +962,7 @@ void * tls_init(const struct tls_config *conf)
 			os_free(tls_global);
 			tls_global = NULL;
 		}
+		os_free(data);
 		return NULL;
 	}
 	data->ssl = ssl;
@@ -929,6 +1043,7 @@ void tls_deinit(void *ssl_ctx)
 
 	tls_openssl_ref_count--;
 	if (tls_openssl_ref_count == 0) {
+#if OPENSSL_VERSION_NUMBER < 0x10100000L
 #ifndef OPENSSL_NO_ENGINE
 		ENGINE_cleanup();
 #endif /* OPENSSL_NO_ENGINE */
@@ -936,6 +1051,7 @@ void tls_deinit(void *ssl_ctx)
 		ERR_remove_thread_state(NULL);
 		ERR_free_strings();
 		EVP_cleanup();
+#endif /* < 1.1.0 */
 		os_free(tls_global->ocsp_stapling_response);
 		tls_global->ocsp_stapling_response = NULL;
 		os_free(tls_global);
@@ -967,10 +1083,32 @@ static int tls_is_pin_error(unsigned int err)
 #endif /* OPENSSL_NO_ENGINE */
 
 
+#ifdef ANDROID
+/* EVP_PKEY_from_keystore comes from system/security/keystore-engine. */
+EVP_PKEY * EVP_PKEY_from_keystore(const char *key_id);
+#endif /* ANDROID */
+
 static int tls_engine_init(struct tls_connection *conn, const char *engine_id,
 			   const char *pin, const char *key_id,
 			   const char *cert_id, const char *ca_cert_id)
 {
+#if defined(ANDROID) && defined(OPENSSL_IS_BORINGSSL)
+#if !defined(OPENSSL_NO_ENGINE)
+#error "This code depends on OPENSSL_NO_ENGINE being defined by BoringSSL."
+#endif
+	if (!key_id)
+		return TLS_SET_PARAMS_ENGINE_PRV_INIT_FAILED;
+	conn->engine = NULL;
+	conn->private_key = EVP_PKEY_from_keystore(key_id);
+	if (!conn->private_key) {
+		wpa_printf(MSG_ERROR,
+			   "ENGINE: cannot load private key with id '%s' [%s]",
+			   key_id,
+			   ERR_error_string(ERR_get_error(), NULL));
+		return TLS_SET_PARAMS_ENGINE_PRV_INIT_FAILED;
+	}
+#endif /* ANDROID && OPENSSL_IS_BORINGSSL */
+
 #ifndef OPENSSL_NO_ENGINE
 	int ret = -1;
 	if (engine_id == NULL) {
@@ -1068,17 +1206,19 @@ err:
 
 static void tls_engine_deinit(struct tls_connection *conn)
 {
-#ifndef OPENSSL_NO_ENGINE
+#if defined(ANDROID) || !defined(OPENSSL_NO_ENGINE)
 	wpa_printf(MSG_DEBUG, "ENGINE: engine deinit");
 	if (conn->private_key) {
 		EVP_PKEY_free(conn->private_key);
 		conn->private_key = NULL;
 	}
 	if (conn->engine) {
+#if !defined(OPENSSL_IS_BORINGSSL)
 		ENGINE_finish(conn->engine);
+#endif /* !OPENSSL_IS_BORINGSSL */
 		conn->engine = NULL;
 	}
-#endif /* OPENSSL_NO_ENGINE */
+#endif /* ANDROID || !OPENSSL_NO_ENGINE */
 }
 
 
@@ -1097,14 +1237,83 @@ int tls_get_errors(void *ssl_ctx)
 }
 
 
+static const char * openssl_content_type(int content_type)
+{
+	switch (content_type) {
+	case 20:
+		return "change cipher spec";
+	case 21:
+		return "alert";
+	case 22:
+		return "handshake";
+	case 23:
+		return "application data";
+	case 24:
+		return "heartbeat";
+	case 256:
+		return "TLS header info"; /* pseudo content type */
+	default:
+		return "?";
+	}
+}
+
+
+static const char * openssl_handshake_type(int content_type, const u8 *buf,
+					   size_t len)
+{
+	if (content_type != 22 || !buf || len == 0)
+		return "";
+	switch (buf[0]) {
+	case 0:
+		return "hello request";
+	case 1:
+		return "client hello";
+	case 2:
+		return "server hello";
+	case 4:
+		return "new session ticket";
+	case 11:
+		return "certificate";
+	case 12:
+		return "server key exchange";
+	case 13:
+		return "certificate request";
+	case 14:
+		return "server hello done";
+	case 15:
+		return "certificate verify";
+	case 16:
+		return "client key exchange";
+	case 20:
+		return "finished";
+	case 21:
+		return "certificate url";
+	case 22:
+		return "certificate status";
+	default:
+		return "?";
+	}
+}
+
+
 static void tls_msg_cb(int write_p, int version, int content_type,
 		       const void *buf, size_t len, SSL *ssl, void *arg)
 {
 	struct tls_connection *conn = arg;
 	const u8 *pos = buf;
 
-	wpa_printf(MSG_DEBUG, "OpenSSL: %s ver=0x%x content_type=%d",
-		   write_p ? "TX" : "RX", version, content_type);
+	if (write_p == 2) {
+		wpa_printf(MSG_DEBUG,
+			   "OpenSSL: session ver=0x%x content_type=%d",
+			   version, content_type);
+		wpa_hexdump_key(MSG_MSGDUMP, "OpenSSL: Data", buf, len);
+		return;
+	}
+
+	wpa_printf(MSG_DEBUG, "OpenSSL: %s ver=0x%x content_type=%d (%s/%s)",
+		   write_p ? "TX" : "RX", version, content_type,
+		   openssl_content_type(content_type),
+		   openssl_handshake_type(content_type, buf, len));
 	wpa_hexdump_key(MSG_MSGDUMP, "OpenSSL: Message", buf, len);
 	if (content_type == 24 && len >= 3 && pos[0] == 1) {
 		size_t payload_len = WPA_GET_BE16(pos + 1);
@@ -1234,6 +1443,8 @@ static int tls_match_altsubject_component(X509 *cert, int type,
 			found++;
 	}
 
+	sk_GENERAL_NAME_pop_free(ext, GENERAL_NAME_free);
+
 	return found;
 }
 
@@ -1346,9 +1557,11 @@ static int tls_match_suffix(X509 *cert, const char *match, int full)
 		    1) {
 			wpa_printf(MSG_DEBUG, "TLS: %s in dNSName found",
 				   full ? "Match" : "Suffix match");
+			sk_GENERAL_NAME_pop_free(ext, GENERAL_NAME_free);
 			return 1;
 		}
 	}
+	sk_GENERAL_NAME_pop_free(ext, GENERAL_NAME_free);
 
 	if (dns_name) {
 		wpa_printf(MSG_DEBUG, "TLS: None of the dNSName(s) matched");
@@ -1489,7 +1702,8 @@ static void openssl_tls_cert_event(struct tls_connection *conn,
 		return;
 
 	os_memset(&ev, 0, sizeof(ev));
-	if (conn->cert_probe || context->cert_in_cb) {
+	if (conn->cert_probe || (conn->flags & TLS_CONN_EXT_CERT_CHECK) ||
+	    context->cert_in_cb) {
 		cert = get_x509_cert(err_cert);
 		ev.peer_cert.cert = cert;
 	}
@@ -1544,6 +1758,7 @@ static void openssl_tls_cert_event(struct tls_connection *conn,
 		pos += gen->d.ia5->length;
 		*pos = '\0';
 	}
+	sk_GENERAL_NAME_pop_free(ext, GENERAL_NAME_free);
 
 	for (alt = 0; alt < num_altsubject; alt++)
 		ev.peer_cert.altsubject[alt] = altsubject[alt];
@@ -1701,7 +1916,33 @@ static int tls_verify_cb(int preverify_ok, X509_STORE_CTX *x509_ctx)
 				       TLS_FAIL_SERVER_CHAIN_PROBE);
 	}
 
-	if (preverify_ok && context->event_cb != NULL)
+#ifdef OPENSSL_IS_BORINGSSL
+	if (depth == 0 && (conn->flags & TLS_CONN_REQUEST_OCSP) &&
+	    preverify_ok) {
+		enum ocsp_result res;
+
+		res = check_ocsp_resp(conn->ssl_ctx, conn->ssl, err_cert,
+				      conn->peer_issuer,
+				      conn->peer_issuer_issuer);
+		if (res == OCSP_REVOKED) {
+			preverify_ok = 0;
+			openssl_tls_fail_event(conn, err_cert, err, depth, buf,
+					       "certificate revoked",
+					       TLS_FAIL_REVOKED);
+			if (err == X509_V_OK)
+				X509_STORE_CTX_set_error(
+					x509_ctx, X509_V_ERR_CERT_REVOKED);
+		} else if (res != OCSP_GOOD &&
+			   (conn->flags & TLS_CONN_REQUIRE_OCSP)) {
+			preverify_ok = 0;
+			openssl_tls_fail_event(conn, err_cert, err, depth, buf,
+					       "bad certificate status response",
+					       TLS_FAIL_UNSPECIFIED);
+		}
+	}
+#endif /* OPENSSL_IS_BORINGSSL */
+
+	if (depth == 0 && preverify_ok && context->event_cb != NULL)
 		context->event_cb(context->cb_ctx,
 				  TLS_CERT_CHAIN_SUCCESS, NULL);
 
@@ -1837,30 +2078,40 @@ static int tls_connection_ca_cert(struct tls_data *data,
 	}
 
 #ifdef ANDROID
+	/* Single alias */
 	if (ca_cert && os_strncmp("keystore://", ca_cert, 11) == 0) {
-		BIO *bio = BIO_from_keystore(&ca_cert[11]);
-		STACK_OF(X509_INFO) *stack = NULL;
-		stack_index_t i;
-
-		if (bio) {
-			stack = PEM_X509_INFO_read_bio(bio, NULL, NULL, NULL);
-			BIO_free(bio);
-		}
-		if (!stack)
+		if (tls_add_ca_from_keystore(SSL_CTX_get_cert_store(ssl_ctx),
+					     &ca_cert[11]) < 0)
 			return -1;
+		SSL_set_verify(conn->ssl, SSL_VERIFY_PEER, tls_verify_cb);
+		return 0;
+	}
 
-		for (i = 0; i < sk_X509_INFO_num(stack); ++i) {
-			X509_INFO *info = sk_X509_INFO_value(stack, i);
-			if (info->x509) {
-				X509_STORE_add_cert(ssl_ctx->cert_store,
-						    info->x509);
-			}
-			if (info->crl) {
-				X509_STORE_add_crl(ssl_ctx->cert_store,
-						   info->crl);
+	/* Multiple aliases separated by space */
+	if (ca_cert && os_strncmp("keystores://", ca_cert, 12) == 0) {
+		char *aliases = os_strdup(&ca_cert[12]);
+		const char *delim = " ";
+		int rc = 0;
+		char *savedptr;
+		char *alias;
+
+		if (!aliases)
+			return -1;
+		alias = strtok_r(aliases, delim, &savedptr);
+		for (; alias; alias = strtok_r(NULL, delim, &savedptr)) {
+			if (tls_add_ca_from_keystore_encoded(
+				    SSL_CTX_get_cert_store(ssl_ctx), alias)) {
+				wpa_printf(MSG_WARNING,
+					   "OpenSSL: %s - Failed to add ca_cert %s from keystore",
+					   __func__, alias);
+				rc = -1;
+				break;
 			}
 		}
-		sk_X509_INFO_pop_free(stack, X509_INFO_free);
+		os_free(aliases);
+		if (rc)
+			return rc;
+
 		SSL_set_verify(conn->ssl, SSL_VERIFY_PEER, tls_verify_cb);
 		return 0;
 	}
@@ -2082,6 +2333,17 @@ static int tls_connection_client_cert(struct tls_connection *conn,
 	if (client_cert == NULL && client_cert_blob == NULL)
 		return 0;
 
+#ifdef PKCS12_FUNCS
+#if OPENSSL_VERSION_NUMBER < 0x10002000L
+	/*
+	 * Clear previously set extra chain certificates, if any, from PKCS#12
+	 * processing in tls_parse_pkcs12() to allow OpenSSL to build a new
+	 * chain properly.
+	 */
+	SSL_CTX_clear_extra_chain_certs(conn->ssl_ctx);
+#endif /* OPENSSL_VERSION_NUMBER < 0x10002000L */
+#endif /* PKCS12_FUNCS */
+
 	if (client_cert_blob &&
 	    SSL_use_certificate_ASN1(conn->ssl, (u8 *) client_cert_blob,
 				     client_cert_blob_len) == 1) {
@@ -2229,28 +2491,42 @@ static int tls_parse_pkcs12(struct tls_data *data, SSL *ssl, PKCS12 *p12,
 	}
 
 	if (certs) {
-#if OPENSSL_VERSION_NUMBER >= 0x10002000L
-		SSL_clear_chain_certs(ssl);
+#if OPENSSL_VERSION_NUMBER >= 0x10002000L && !defined(LIBRESSL_VERSION_NUMBER)
+		if (ssl)
+			SSL_clear_chain_certs(ssl);
+		else
+			SSL_CTX_clear_chain_certs(data->ssl);
 		while ((cert = sk_X509_pop(certs)) != NULL) {
 			X509_NAME_oneline(X509_get_subject_name(cert), buf,
 					  sizeof(buf));
 			wpa_printf(MSG_DEBUG, "TLS: additional certificate"
 				   " from PKCS12: subject='%s'", buf);
-			if (SSL_add1_chain_cert(ssl, cert) != 1) {
+			if ((ssl && SSL_add1_chain_cert(ssl, cert) != 1) ||
+			    (!ssl && SSL_CTX_add1_chain_cert(data->ssl,
+							     cert) != 1)) {
 				tls_show_errors(MSG_DEBUG, __func__,
 						"Failed to add additional certificate");
 				res = -1;
+				X509_free(cert);
 				break;
 			}
+			X509_free(cert);
 		}
 		if (!res) {
 			/* Try to continue anyway */
 		}
-		sk_X509_free(certs);
+		sk_X509_pop_free(certs, X509_free);
 #ifndef OPENSSL_IS_BORINGSSL
-		res = SSL_build_cert_chain(ssl,
-					   SSL_BUILD_CHAIN_FLAG_CHECK |
-					   SSL_BUILD_CHAIN_FLAG_IGNORE_ERROR);
+		if (ssl)
+			res = SSL_build_cert_chain(
+				ssl,
+				SSL_BUILD_CHAIN_FLAG_CHECK |
+				SSL_BUILD_CHAIN_FLAG_IGNORE_ERROR);
+		else
+			res = SSL_CTX_build_cert_chain(
+				data->ssl,
+				SSL_BUILD_CHAIN_FLAG_CHECK |
+				SSL_BUILD_CHAIN_FLAG_IGNORE_ERROR);
 		if (!res) {
 			tls_show_errors(MSG_DEBUG, __func__,
 					"Failed to build certificate chain");
@@ -2265,9 +2541,7 @@ static int tls_parse_pkcs12(struct tls_data *data, SSL *ssl, PKCS12 *p12,
 		 */
 		res = 0;
 #else /* OPENSSL_VERSION_NUMBER >= 0x10002000L */
-#if OPENSSL_VERSION_NUMBER >= 0x10001000L
 		SSL_CTX_clear_extra_chain_certs(data->ssl);
-#endif /* OPENSSL_VERSION_NUMBER >= 0x10001000L */
 		while ((cert = sk_X509_pop(certs)) != NULL) {
 			X509_NAME_oneline(X509_get_subject_name(cert), buf,
 					  sizeof(buf));
@@ -2279,11 +2553,12 @@ static int tls_parse_pkcs12(struct tls_data *data, SSL *ssl, PKCS12 *p12,
 			 */
 			if (SSL_CTX_add_extra_chain_cert(data->ssl, cert) != 1)
 			{
+				X509_free(cert);
 				res = -1;
 				break;
 			}
 		}
-		sk_X509_free(certs);
+		sk_X509_pop_free(certs, X509_free);
 #endif /* OPENSSL_VERSION_NUMBER >= 0x10002000L */
 	}
 
@@ -2463,7 +2738,7 @@ static int tls_connection_engine_ca_cert(struct tls_data *data,
 
 static int tls_connection_engine_private_key(struct tls_connection *conn)
 {
-#ifndef OPENSSL_NO_ENGINE
+#if defined(ANDROID) || !defined(OPENSSL_NO_ENGINE)
 	if (SSL_use_PrivateKey(conn->ssl, conn->private_key) != 1) {
 		tls_show_errors(MSG_ERROR, __func__,
 				"ENGINE: cannot use private key for TLS");
@@ -2812,16 +3087,6 @@ int tls_connection_get_random(void *ssl_ctx, struct tls_connection *conn,
 	if (conn == NULL || keys == NULL)
 		return -1;
 	ssl = conn->ssl;
-#if OPENSSL_VERSION_NUMBER < 0x10100000L
-	if (ssl == NULL || ssl->s3 == NULL || ssl->session == NULL)
-		return -1;
-
-	os_memset(keys, 0, sizeof(*keys));
-	keys->client_random = ssl->s3->client_random;
-	keys->client_random_len = SSL3_RANDOM_SIZE;
-	keys->server_random = ssl->s3->server_random;
-	keys->server_random_len = SSL3_RANDOM_SIZE;
-#else
 	if (ssl == NULL)
 		return -1;
 
@@ -2832,16 +3097,15 @@ int tls_connection_get_random(void *ssl_ctx, struct tls_connection *conn,
 	keys->server_random = conn->server_random;
 	keys->server_random_len = SSL_get_server_random(
 		ssl, conn->server_random, sizeof(conn->server_random));
-#endif
 
 	return 0;
 }
 
 
-#ifndef CONFIG_FIPS
+#ifdef OPENSSL_NEED_EAP_FAST_PRF
 static int openssl_get_keyblock_size(SSL *ssl)
 {
-#if OPENSSL_VERSION_NUMBER < 0x10100000L
+#if OPENSSL_VERSION_NUMBER < 0x10100000L || defined(LIBRESSL_VERSION_NUMBER)
 	const EVP_CIPHER *c;
 	const EVP_MD *h;
 	int md_size;
@@ -2851,17 +3115,11 @@ static int openssl_get_keyblock_size(SSL *ssl)
 		return -1;
 
 	c = ssl->enc_read_ctx->cipher;
-#if OPENSSL_VERSION_NUMBER >= 0x00909000L
 	h = EVP_MD_CTX_md(ssl->read_hash);
-#else
-	h = ssl->read_hash;
-#endif
 	if (h)
 		md_size = EVP_MD_size(h);
-#if OPENSSL_VERSION_NUMBER >= 0x10000000L
 	else if (ssl->s3)
 		md_size = ssl->s3->tmp.new_mac_secret_size;
-#endif
 	else
 		return -1;
 
@@ -2899,86 +3157,24 @@ static int openssl_get_keyblock_size(SSL *ssl)
 		    EVP_CIPHER_iv_length(c));
 #endif
 }
-#endif /* CONFIG_FIPS */
+#endif /* OPENSSL_NEED_EAP_FAST_PRF */
 
 
-static int openssl_tls_prf(struct tls_connection *conn,
-			   const char *label, int server_random_first,
-			   int skip_keyblock, u8 *out, size_t out_len)
+int tls_connection_export_key(void *tls_ctx, struct tls_connection *conn,
+			      const char *label, u8 *out, size_t out_len)
 {
-#ifdef CONFIG_FIPS
-	wpa_printf(MSG_ERROR, "OpenSSL: TLS keys cannot be exported in FIPS "
-		   "mode");
-	return -1;
-#else /* CONFIG_FIPS */
-#if OPENSSL_VERSION_NUMBER < 0x10100000L
-	SSL *ssl;
-	u8 *rnd;
-	int ret = -1;
-	int skip = 0;
-	u8 *tmp_out = NULL;
-	u8 *_out = out;
-	const char *ver;
-
-	/*
-	 * TLS library did not support key generation, so get the needed TLS
-	 * session parameters and use an internal implementation of TLS PRF to
-	 * derive the key.
-	 */
-
-	if (conn == NULL)
-		return -1;
-	ssl = conn->ssl;
-	if (ssl == NULL || ssl->s3 == NULL || ssl->session == NULL ||
-	    ssl->session->master_key_length <= 0)
-		return -1;
-	ver = SSL_get_version(ssl);
-
-	if (skip_keyblock) {
-		skip = openssl_get_keyblock_size(ssl);
-		if (skip < 0)
-			return -1;
-		tmp_out = os_malloc(skip + out_len);
-		if (!tmp_out)
-			return -1;
-		_out = tmp_out;
-	}
-
-	rnd = os_malloc(2 * SSL3_RANDOM_SIZE);
-	if (!rnd) {
-		os_free(tmp_out);
+	if (!conn ||
+	    SSL_export_keying_material(conn->ssl, out, out_len, label,
+				       os_strlen(label), NULL, 0, 0) != 1)
 		return -1;
-	}
-
-	if (server_random_first) {
-		os_memcpy(rnd, ssl->s3->server_random, SSL3_RANDOM_SIZE);
-		os_memcpy(rnd + SSL3_RANDOM_SIZE, ssl->s3->client_random,
-			SSL3_RANDOM_SIZE);
-	} else {
-		os_memcpy(rnd, ssl->s3->client_random, SSL3_RANDOM_SIZE);
-		os_memcpy(rnd + SSL3_RANDOM_SIZE, ssl->s3->server_random,
-			SSL3_RANDOM_SIZE);
-	}
+	return 0;
+}
 
-	if (os_strcmp(ver, "TLSv1.2") == 0) {
-		tls_prf_sha256(ssl->session->master_key,
-			       ssl->session->master_key_length,
-			       label, rnd, 2 * SSL3_RANDOM_SIZE,
-			       _out, skip + out_len);
-		ret = 0;
-	} else if (tls_prf_sha1_md5(ssl->session->master_key,
-				    ssl->session->master_key_length,
-				    label, rnd, 2 * SSL3_RANDOM_SIZE,
-				    _out, skip + out_len) == 0) {
-		ret = 0;
-	}
-	os_free(rnd);
-	if (ret == 0 && skip_keyblock)
-		os_memcpy(out, _out + skip, out_len);
-	bin_clear_free(tmp_out, skip);
 
-	return ret;
-#else
+int tls_connection_get_eap_fast_key(void *tls_ctx, struct tls_connection *conn,
+				    u8 *out, size_t out_len)
+{
+#ifdef OPENSSL_NEED_EAP_FAST_PRF
 	SSL *ssl;
 	SSL_SESSION *sess;
 	u8 *rnd;
@@ -2993,9 +3189,9 @@ static int openssl_tls_prf(struct tls_connection *conn,
 	const char *ver;
 
 	/*
-	 * TLS library did not support key generation, so get the needed TLS
-	 * session parameters and use an internal implementation of TLS PRF to
-	 * derive the key.
+	 * TLS library did not support EAP-FAST key generation, so get the
+	 * needed TLS session parameters and use an internal implementation of
+	 * TLS PRF to derive the key.
 	 */
 
 	if (conn == NULL)
@@ -3008,15 +3204,13 @@ static int openssl_tls_prf(struct tls_connection *conn,
 	if (!ver || !sess)
 		return -1;
 
-	if (skip_keyblock) {
-		skip = openssl_get_keyblock_size(ssl);
-		if (skip < 0)
-			return -1;
-		tmp_out = os_malloc(skip + out_len);
-		if (!tmp_out)
-			return -1;
-		_out = tmp_out;
-	}
+	skip = openssl_get_keyblock_size(ssl);
+	if (skip < 0)
+		return -1;
+	tmp_out = os_malloc(skip + out_len);
+	if (!tmp_out)
+		return -1;
+	_out = tmp_out;
 
 	rnd = os_malloc(2 * SSL3_RANDOM_SIZE);
 	if (!rnd) {
@@ -3029,59 +3223,31 @@ static int openssl_tls_prf(struct tls_connection *conn,
 	master_key_len = SSL_SESSION_get_master_key(sess, master_key,
 						    sizeof(master_key));
 
-	if (server_random_first) {
-		os_memcpy(rnd, server_random, SSL3_RANDOM_SIZE);
-		os_memcpy(rnd + SSL3_RANDOM_SIZE, client_random,
-			  SSL3_RANDOM_SIZE);
-	} else {
-		os_memcpy(rnd, client_random, SSL3_RANDOM_SIZE);
-		os_memcpy(rnd + SSL3_RANDOM_SIZE, server_random,
-			  SSL3_RANDOM_SIZE);
-	}
+	os_memcpy(rnd, server_random, SSL3_RANDOM_SIZE);
+	os_memcpy(rnd + SSL3_RANDOM_SIZE, client_random, SSL3_RANDOM_SIZE);
 
 	if (os_strcmp(ver, "TLSv1.2") == 0) {
 		tls_prf_sha256(master_key, master_key_len,
-			       label, rnd, 2 * SSL3_RANDOM_SIZE,
+			       "key expansion", rnd, 2 * SSL3_RANDOM_SIZE,
 			       _out, skip + out_len);
 		ret = 0;
 	} else if (tls_prf_sha1_md5(master_key, master_key_len,
-				    label, rnd, 2 * SSL3_RANDOM_SIZE,
+				    "key expansion", rnd, 2 * SSL3_RANDOM_SIZE,
 				    _out, skip + out_len) == 0) {
 		ret = 0;
 	}
 	os_memset(master_key, 0, sizeof(master_key));
 	os_free(rnd);
-	if (ret == 0 && skip_keyblock)
+	if (ret == 0)
 		os_memcpy(out, _out + skip, out_len);
 	bin_clear_free(tmp_out, skip);
 
 	return ret;
-#endif
-#endif /* CONFIG_FIPS */
-}
-
-
-int tls_connection_prf(void *tls_ctx, struct tls_connection *conn,
-		       const char *label, int server_random_first,
-		       int skip_keyblock, u8 *out, size_t out_len)
-{
-#if OPENSSL_VERSION_NUMBER >= 0x10001000L
-	SSL *ssl;
-	if (conn == NULL)
-		return -1;
-	if (server_random_first || skip_keyblock)
-		return openssl_tls_prf(conn, label,
-				       server_random_first, skip_keyblock,
-				       out, out_len);
-	ssl = conn->ssl;
-	if (SSL_export_keying_material(ssl, out, out_len, label,
-				       os_strlen(label), NULL, 0, 0) == 1) {
-		wpa_printf(MSG_DEBUG, "OpenSSL: Using internal PRF");
-		return 0;
-	}
-#endif
-	return openssl_tls_prf(conn, label, server_random_first,
-			       skip_keyblock, out, out_len);
+#else /* OPENSSL_NEED_EAP_FAST_PRF */
+	wpa_printf(MSG_ERROR,
+		   "OpenSSL: EAP-FAST keys cannot be exported in FIPS mode");
+	return -1;
+#endif /* OPENSSL_NEED_EAP_FAST_PRF */
 }
 
 
@@ -3340,18 +3506,14 @@ struct wpabuf * tls_connection_decrypt(void *tls_ctx,
 
 int tls_connection_resumed(void *ssl_ctx, struct tls_connection *conn)
 {
-#if OPENSSL_VERSION_NUMBER >= 0x10001000L
 	return conn ? SSL_cache_hit(conn->ssl) : 0;
-#else
-	return conn ? conn->ssl->hit : 0;
-#endif
 }
 
 
 int tls_connection_set_cipher_list(void *tls_ctx, struct tls_connection *conn,
 				   u8 *ciphers)
 {
-	char buf[100], *pos, *end;
+	char buf[500], *pos, *end;
 	u8 *c;
 	int ret;
 
@@ -3379,6 +3541,12 @@ int tls_connection_set_cipher_list(void *tls_ctx, struct tls_connection *conn,
 		case TLS_CIPHER_ANON_DH_AES128_SHA:
 			suite = "ADH-AES128-SHA";
 			break;
+		case TLS_CIPHER_RSA_DHE_AES256_SHA:
+			suite = "DHE-RSA-AES256-SHA";
+			break;
+		case TLS_CIPHER_AES256_SHA:
+			suite = "AES256-SHA";
+			break;
 		default:
 			wpa_printf(MSG_DEBUG, "TLS: Unsupported "
 				   "cipher selection: %d", *c);
@@ -3394,7 +3562,7 @@ int tls_connection_set_cipher_list(void *tls_ctx, struct tls_connection *conn,
 
 	wpa_printf(MSG_DEBUG, "OpenSSL: cipher suites: %s", buf + 1);
 
-#if OPENSSL_VERSION_NUMBER >= 0x10100000L
+#if OPENSSL_VERSION_NUMBER >= 0x10100000L && !defined(LIBRESSL_VERSION_NUMBER)
 #if defined(EAP_FAST) || defined(EAP_FAST_DYNAMIC) || defined(EAP_SERVER_FAST)
 	if (os_strstr(buf, ":ADH-")) {
 		/*
@@ -3687,10 +3855,12 @@ static int ocsp_resp_cb(SSL *s, void *arg)
 		wpa_printf(MSG_INFO, "OpenSSL: Could not find current server certificate from OCSP response%s",
 			   (conn->flags & TLS_CONN_REQUIRE_OCSP) ? "" :
 			   " (OCSP not required)");
+		OCSP_CERTID_free(id);
 		OCSP_BASICRESP_free(basic);
 		OCSP_RESPONSE_free(rsp);
 		return (conn->flags & TLS_CONN_REQUIRE_OCSP) ? 0 : 1;
 	}
+	OCSP_CERTID_free(id);
 
 	if (!OCSP_check_validity(this_update, next_update, 5 * 60, -1)) {
 		tls_show_errors(MSG_INFO, __func__,
@@ -3769,6 +3939,12 @@ int tls_connection_set_params(void *tls_ctx, struct tls_connection *conn,
 	if (conn == NULL)
 		return -1;
 
+	if (params->flags & TLS_CONN_REQUIRE_OCSP_ALL) {
+		wpa_printf(MSG_INFO,
+			   "OpenSSL: ocsp=3 not supported");
+		return -1;
+	}
+
 	/*
 	 * If the engine isn't explicitly configured, and any of the
 	 * cert/key fields are actually PKCS#11 URIs, then automatically
@@ -3879,6 +4055,11 @@ int tls_connection_set_params(void *tls_ctx, struct tls_connection *conn,
 
 	tls_set_conn_flags(conn->ssl, params->flags);
 
+#ifdef OPENSSL_IS_BORINGSSL
+	if (params->flags & TLS_CONN_REQUEST_OCSP) {
+		SSL_enable_ocsp_stapling(conn->ssl);
+	}
+#else /* OPENSSL_IS_BORINGSSL */
 #ifdef HAVE_OCSP
 	if (params->flags & TLS_CONN_REQUEST_OCSP) {
 		SSL_CTX *ssl_ctx = data->ssl;
@@ -3897,6 +4078,7 @@ int tls_connection_set_params(void *tls_ctx, struct tls_connection *conn,
 			   "OpenSSL: No OCSP support included - allow optional OCSP case to continue");
 	}
 #endif /* HAVE_OCSP */
+#endif /* OPENSSL_IS_BORINGSSL */
 
 	conn->flags = params->flags;
 
@@ -3964,7 +4146,7 @@ int tls_global_set_params(void *tls_ctx,
  * commented out unless explicitly needed for EAP-FAST in order to be able to
  * build this file with unmodified openssl. */
 
-#ifdef OPENSSL_IS_BORINGSSL
+#if (defined(OPENSSL_IS_BORINGSSL) || OPENSSL_VERSION_NUMBER >= 0x10100000L) && !defined(LIBRESSL_VERSION_NUMBER)
 static int tls_sess_sec_cb(SSL *s, void *secret, int *secret_len,
 			   STACK_OF(SSL_CIPHER) *peer_ciphers,
 			   const SSL_CIPHER **cipher, void *arg)
@@ -3977,7 +4159,7 @@ static int tls_sess_sec_cb(SSL *s, void *secret, int *secret_len,
 	struct tls_connection *conn = arg;
 	int ret;
 
-#if OPENSSL_VERSION_NUMBER < 0x10100000L
+#if OPENSSL_VERSION_NUMBER < 0x10100000L || defined(LIBRESSL_VERSION_NUMBER)
 	if (conn == NULL || conn->session_ticket_cb == NULL)
 		return 0;
 
@@ -4072,9 +4254,15 @@ int tls_connection_set_session_ticket_cb(void *tls_ctx,
 
 int tls_get_library_version(char *buf, size_t buf_len)
 {
+#if OPENSSL_VERSION_NUMBER >= 0x10100000L && !defined(LIBRESSL_VERSION_NUMBER)
+	return os_snprintf(buf, buf_len, "OpenSSL build=%s run=%s",
+			   OPENSSL_VERSION_TEXT,
+			   OpenSSL_version(OPENSSL_VERSION));
+#else
 	return os_snprintf(buf, buf_len, "OpenSSL build=%s run=%s",
 			   OPENSSL_VERSION_TEXT,
 			   SSLeay_version(SSLEAY_VERSION));
+#endif
 }
 
 
diff --git a/src/crypto/tls_openssl.h b/src/crypto/tls_openssl.h
new file mode 100644
index 0000000000000..2a62d5c5d0198
--- /dev/null
+++ b/src/crypto/tls_openssl.h
@@ -0,0 +1,19 @@
+/*
+ * SSL/TLS interface functions for OpenSSL
+ * Copyright (c) 2004-2015, Jouni Malinen <j@w1.fi>
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ */
+
+#ifndef TLS_OPENSSL_H
+#define TLS_OPENSSL_H
+
+enum ocsp_result {
+	OCSP_GOOD, OCSP_REVOKED, OCSP_NO_RESPONSE, OCSP_INVALID
+};
+
+enum ocsp_result check_ocsp_resp(SSL_CTX *ssl_ctx, SSL *ssl, X509 *cert,
+				 X509 *issuer, X509 *issuer_issuer);
+
+#endif /* TLS_OPENSSL_H */
diff --git a/src/crypto/tls_openssl_ocsp.c b/src/crypto/tls_openssl_ocsp.c
new file mode 100644
index 0000000000000..8b37b34e78901
--- /dev/null
+++ b/src/crypto/tls_openssl_ocsp.c
@@ -0,0 +1,846 @@
+/*
+ * SSL/TLS interface functions for OpenSSL - BoringSSL OCSP
+ * Copyright (c) 2004-2015, Jouni Malinen <j@w1.fi>
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ */
+
+#include "includes.h"
+
+#include <openssl/ssl.h>
+#include <openssl/err.h>
+#include <openssl/x509v3.h>
+#ifdef OPENSSL_IS_BORINGSSL
+#include <openssl/asn1.h>
+#include <openssl/asn1t.h>
+#endif /* OPENSSL_IS_BORINGSSL */
+
+#include "common.h"
+#include "tls_openssl.h"
+
+
+#ifdef OPENSSL_IS_BORINGSSL
+
+static void tls_show_errors(int level, const char *func, const char *txt)
+{
+	unsigned long err;
+
+	wpa_printf(level, "OpenSSL: %s - %s %s",
+		   func, txt, ERR_error_string(ERR_get_error(), NULL));
+
+	while ((err = ERR_get_error())) {
+		wpa_printf(MSG_INFO, "OpenSSL: pending error: %s",
+			   ERR_error_string(err, NULL));
+	}
+}
+
+
+/*
+ * CertID ::= SEQUENCE {
+ *     hashAlgorithm      AlgorithmIdentifier,
+ *     issuerNameHash     OCTET STRING, -- Hash of Issuer's DN
+ *     issuerKeyHash      OCTET STRING, -- Hash of Issuer's public key
+ *     serialNumber       CertificateSerialNumber }
+ */
+typedef struct {
+	X509_ALGOR *hashAlgorithm;
+	ASN1_OCTET_STRING *issuerNameHash;
+	ASN1_OCTET_STRING *issuerKeyHash;
+	ASN1_INTEGER *serialNumber;
+} CertID;
+
+/*
+ * ResponseBytes ::=       SEQUENCE {
+ *     responseType   OBJECT IDENTIFIER,
+ *     response       OCTET STRING }
+ */
+typedef struct {
+	ASN1_OBJECT *responseType;
+	ASN1_OCTET_STRING *response;
+} ResponseBytes;
+
+/*
+ * OCSPResponse ::= SEQUENCE {
+ *    responseStatus         OCSPResponseStatus,
+ *    responseBytes          [0] EXPLICIT ResponseBytes OPTIONAL }
+ */
+typedef struct {
+	ASN1_ENUMERATED *responseStatus;
+	ResponseBytes *responseBytes;
+} OCSPResponse;
+
+ASN1_SEQUENCE(ResponseBytes) = {
+	ASN1_SIMPLE(ResponseBytes, responseType, ASN1_OBJECT),
+	ASN1_SIMPLE(ResponseBytes, response, ASN1_OCTET_STRING)
+} ASN1_SEQUENCE_END(ResponseBytes);
+
+ASN1_SEQUENCE(OCSPResponse) = {
+	ASN1_SIMPLE(OCSPResponse, responseStatus, ASN1_ENUMERATED),
+	ASN1_EXP_OPT(OCSPResponse, responseBytes, ResponseBytes, 0)
+} ASN1_SEQUENCE_END(OCSPResponse);
+
+IMPLEMENT_ASN1_FUNCTIONS(OCSPResponse);
+
+/*
+ * ResponderID ::= CHOICE {
+ *    byName               [1] Name,
+ *    byKey                [2] KeyHash }
+ */
+typedef struct {
+	int type;
+	union {
+		X509_NAME *byName;
+		ASN1_OCTET_STRING *byKey;
+	} value;
+} ResponderID;
+
+/*
+ * RevokedInfo ::= SEQUENCE {
+ *     revocationTime              GeneralizedTime,
+ *     revocationReason    [0]     EXPLICIT CRLReason OPTIONAL }
+ */
+typedef struct {
+	ASN1_GENERALIZEDTIME *revocationTime;
+	ASN1_ENUMERATED *revocationReason;
+} RevokedInfo;
+
+/*
+ * CertStatus ::= CHOICE {
+ *     good        [0]     IMPLICIT NULL,
+ *     revoked     [1]     IMPLICIT RevokedInfo,
+ *     unknown     [2]     IMPLICIT UnknownInfo }
+ */
+typedef struct {
+	int type;
+	union {
+		ASN1_NULL *good;
+		RevokedInfo *revoked;
+		ASN1_NULL *unknown;
+	} value;
+} CertStatus;
+
+/*
+ * SingleResponse ::= SEQUENCE {
+ *    certID                       CertID,
+ *    certStatus                   CertStatus,
+ *    thisUpdate                   GeneralizedTime,
+ *    nextUpdate         [0]       EXPLICIT GeneralizedTime OPTIONAL,
+ *    singleExtensions   [1]       EXPLICIT Extensions OPTIONAL }
+ */
+typedef struct {
+	CertID *certID;
+	CertStatus *certStatus;
+	ASN1_GENERALIZEDTIME *thisUpdate;
+	ASN1_GENERALIZEDTIME *nextUpdate;
+	STACK_OF(X509_EXTENSION) *singleExtensions;
+} SingleResponse;
+
+/*
+ * ResponseData ::= SEQUENCE {
+ *   version              [0] EXPLICIT Version DEFAULT v1,
+ *   responderID              ResponderID,
+ *   producedAt               GeneralizedTime,
+ *   responses                SEQUENCE OF SingleResponse,
+ *   responseExtensions   [1] EXPLICIT Extensions OPTIONAL }
+ */
+typedef struct {
+	ASN1_INTEGER *version;
+	ResponderID *responderID;
+	ASN1_GENERALIZEDTIME *producedAt;
+	STACK_OF(SingleResponse) *responses;
+	STACK_OF(X509_EXTENSION) *responseExtensions;
+} ResponseData;
+
+/*
+ * BasicOCSPResponse       ::= SEQUENCE {
+ *   tbsResponseData      ResponseData,
+ *   signatureAlgorithm   AlgorithmIdentifier,
+ *   signature            BIT STRING,
+ *   certs                [0] EXPLICIT SEQUENCE OF Certificate OPTIONAL }
+ */
+typedef struct {
+	ResponseData *tbsResponseData;
+	X509_ALGOR *signatureAlgorithm;
+	ASN1_BIT_STRING *signature;
+	STACK_OF(X509) *certs;
+} BasicOCSPResponse;
+
+ASN1_SEQUENCE(CertID) = {
+	ASN1_SIMPLE(CertID, hashAlgorithm, X509_ALGOR),
+	ASN1_SIMPLE(CertID, issuerNameHash, ASN1_OCTET_STRING),
+	ASN1_SIMPLE(CertID, issuerKeyHash, ASN1_OCTET_STRING),
+	ASN1_SIMPLE(CertID, serialNumber, ASN1_INTEGER)
+} ASN1_SEQUENCE_END(CertID);
+
+ASN1_CHOICE(ResponderID) = {
+	ASN1_EXP(ResponderID, value.byName, X509_NAME, 1),
+	ASN1_EXP(ResponderID, value.byKey, ASN1_OCTET_STRING, 2)
+} ASN1_CHOICE_END(ResponderID);
+
+ASN1_SEQUENCE(RevokedInfo) = {
+	ASN1_SIMPLE(RevokedInfo, revocationTime, ASN1_GENERALIZEDTIME),
+	ASN1_EXP_OPT(RevokedInfo, revocationReason, ASN1_ENUMERATED, 0)
+} ASN1_SEQUENCE_END(RevokedInfo);
+
+ASN1_CHOICE(CertStatus) = {
+	ASN1_IMP(CertStatus, value.good, ASN1_NULL, 0),
+	ASN1_IMP(CertStatus, value.revoked, RevokedInfo, 1),
+	ASN1_IMP(CertStatus, value.unknown, ASN1_NULL, 2)
+} ASN1_CHOICE_END(CertStatus);
+
+ASN1_SEQUENCE(SingleResponse) = {
+	ASN1_SIMPLE(SingleResponse, certID, CertID),
+	ASN1_SIMPLE(SingleResponse, certStatus, CertStatus),
+	ASN1_SIMPLE(SingleResponse, thisUpdate, ASN1_GENERALIZEDTIME),
+	ASN1_EXP_OPT(SingleResponse, nextUpdate, ASN1_GENERALIZEDTIME, 0),
+	ASN1_EXP_SEQUENCE_OF_OPT(SingleResponse, singleExtensions,
+				 X509_EXTENSION, 1)
+} ASN1_SEQUENCE_END(SingleResponse);
+
+ASN1_SEQUENCE(ResponseData) = {
+	ASN1_EXP_OPT(ResponseData, version, ASN1_INTEGER, 0),
+	ASN1_SIMPLE(ResponseData, responderID, ResponderID),
+	ASN1_SIMPLE(ResponseData, producedAt, ASN1_GENERALIZEDTIME),
+	ASN1_SEQUENCE_OF(ResponseData, responses, SingleResponse),
+	ASN1_EXP_SEQUENCE_OF_OPT(ResponseData, responseExtensions,
+				 X509_EXTENSION, 1)
+} ASN1_SEQUENCE_END(ResponseData);
+
+ASN1_SEQUENCE(BasicOCSPResponse) = {
+	ASN1_SIMPLE(BasicOCSPResponse, tbsResponseData, ResponseData),
+	ASN1_SIMPLE(BasicOCSPResponse, signatureAlgorithm, X509_ALGOR),
+	ASN1_SIMPLE(BasicOCSPResponse, signature, ASN1_BIT_STRING),
+	ASN1_EXP_SEQUENCE_OF_OPT(BasicOCSPResponse, certs, X509, 0)
+} ASN1_SEQUENCE_END(BasicOCSPResponse);
+
+IMPLEMENT_ASN1_FUNCTIONS(BasicOCSPResponse);
+
+#define sk_SingleResponse_num(sk) \
+sk_num(CHECKED_CAST(_STACK *, STACK_OF(SingleResponse) *, sk))
+
+#define sk_SingleResponse_value(sk, i) \
+	((SingleResponse *)						\
+	 sk_value(CHECKED_CAST(_STACK *, STACK_OF(SingleResponse) *, sk), (i)))
+
+
+static char * mem_bio_to_str(BIO *out)
+{
+	char *txt;
+	size_t rlen;
+	int res;
+
+	rlen = BIO_ctrl_pending(out);
+	txt = os_malloc(rlen + 1);
+	if (!txt) {
+		BIO_free(out);
+		return NULL;
+	}
+
+	res = BIO_read(out, txt, rlen);
+	BIO_free(out);
+	if (res < 0) {
+		os_free(txt);
+		return NULL;
+	}
+
+	txt[res] = '\0';
+	return txt;
+}
+
+
+static char * generalizedtime_str(ASN1_GENERALIZEDTIME *t)
+{
+	BIO *out;
+
+	out = BIO_new(BIO_s_mem());
+	if (!out)
+		return NULL;
+
+	if (!ASN1_GENERALIZEDTIME_print(out, t)) {
+		BIO_free(out);
+		return NULL;
+	}
+
+	return mem_bio_to_str(out);
+}
+
+
+static char * responderid_str(ResponderID *rid)
+{
+	BIO *out;
+
+	out = BIO_new(BIO_s_mem());
+	if (!out)
+		return NULL;
+
+	switch (rid->type) {
+	case 0:
+		X509_NAME_print_ex(out, rid->value.byName, 0, XN_FLAG_ONELINE);
+		break;
+	case 1:
+		i2a_ASN1_STRING(out, rid->value.byKey, V_ASN1_OCTET_STRING);
+		break;
+	default:
+		BIO_free(out);
+		return NULL;
+	}
+
+	return mem_bio_to_str(out);
+}
+
+
+static char * octet_string_str(ASN1_OCTET_STRING *o)
+{
+	BIO *out;
+
+	out = BIO_new(BIO_s_mem());
+	if (!out)
+		return NULL;
+
+	i2a_ASN1_STRING(out, o, V_ASN1_OCTET_STRING);
+	return mem_bio_to_str(out);
+}
+
+
+static char * integer_str(ASN1_INTEGER *i)
+{
+	BIO *out;
+
+	out = BIO_new(BIO_s_mem());
+	if (!out)
+		return NULL;
+
+	i2a_ASN1_INTEGER(out, i);
+	return mem_bio_to_str(out);
+}
+
+
+static char * algor_str(X509_ALGOR *alg)
+{
+	BIO *out;
+
+	out = BIO_new(BIO_s_mem());
+	if (!out)
+		return NULL;
+
+	i2a_ASN1_OBJECT(out, alg->algorithm);
+	return mem_bio_to_str(out);
+}
+
+
+static char * extensions_str(const char *title, STACK_OF(X509_EXTENSION) *ext)
+{
+	BIO *out;
+
+	if (!ext)
+		return NULL;
+
+	out = BIO_new(BIO_s_mem());
+	if (!out)
+		return NULL;
+
+	if (!X509V3_extensions_print(out, title, ext, 0, 0)) {
+		BIO_free(out);
+		return NULL;
+	}
+	return mem_bio_to_str(out);
+}
+
+
+static int ocsp_resp_valid(ASN1_GENERALIZEDTIME *thisupd,
+			   ASN1_GENERALIZEDTIME *nextupd)
+{
+	time_t now, tmp;
+
+	if (!ASN1_GENERALIZEDTIME_check(thisupd)) {
+		wpa_printf(MSG_DEBUG,
+			   "OpenSSL: Invalid OCSP response thisUpdate");
+		return 0;
+	}
+
+	time(&now);
+	tmp = now + 5 * 60; /* allow five minute clock difference */
+	if (X509_cmp_time(thisupd, &tmp) > 0) {
+		wpa_printf(MSG_DEBUG, "OpenSSL: OCSP response not yet valid");
+		return 0;
+	}
+
+	if (!nextupd)
+		return 1; /* OK - no limit on response age */
+
+	if (!ASN1_GENERALIZEDTIME_check(nextupd)) {
+		wpa_printf(MSG_DEBUG,
+			   "OpenSSL: Invalid OCSP response nextUpdate");
+		return 0;
+	}
+
+	tmp = now - 5 * 60; /* allow five minute clock difference */
+	if (X509_cmp_time(nextupd, &tmp) < 0) {
+		wpa_printf(MSG_DEBUG, "OpenSSL: OCSP response expired");
+		return 0;
+	}
+
+	if (ASN1_STRING_cmp(nextupd, thisupd) < 0) {
+		wpa_printf(MSG_DEBUG,
+			   "OpenSSL: OCSP response nextUpdate before thisUpdate");
+		return 0;
+	}
+
+	/* Both thisUpdate and nextUpdate are valid */
+	return -1;
+}
+
+
+static int issuer_match(X509 *cert, X509 *issuer, CertID *certid)
+{
+	X509_NAME *iname;
+	ASN1_BIT_STRING *ikey;
+	const EVP_MD *dgst;
+	unsigned int len;
+	unsigned char md[EVP_MAX_MD_SIZE];
+	ASN1_OCTET_STRING *hash;
+	char *txt;
+
+	dgst = EVP_get_digestbyobj(certid->hashAlgorithm->algorithm);
+	if (!dgst) {
+		wpa_printf(MSG_DEBUG,
+			   "OpenSSL: Could not find matching hash algorithm for OCSP");
+		return -1;
+	}
+
+	iname = X509_get_issuer_name(cert);
+	if (!X509_NAME_digest(iname, dgst, md, &len))
+		return -1;
+	hash = ASN1_OCTET_STRING_new();
+	if (!hash)
+		return -1;
+	if (!ASN1_OCTET_STRING_set(hash, md, len)) {
+		ASN1_OCTET_STRING_free(hash);
+		return -1;
+	}
+
+	txt = octet_string_str(hash);
+	if (txt) {
+		wpa_printf(MSG_DEBUG, "OpenSSL: calculated issuerNameHash: %s",
+			   txt);
+		os_free(txt);
+	}
+
+	if (ASN1_OCTET_STRING_cmp(certid->issuerNameHash, hash)) {
+		ASN1_OCTET_STRING_free(hash);
+		return -1;
+	}
+
+	ikey = X509_get0_pubkey_bitstr(issuer);
+	if (!ikey ||
+	    !EVP_Digest(ikey->data, ikey->length, md, &len, dgst, NULL) ||
+	    !ASN1_OCTET_STRING_set(hash, md, len)) {
+		ASN1_OCTET_STRING_free(hash);
+		return -1;
+	}
+
+	txt = octet_string_str(hash);
+	if (txt) {
+		wpa_printf(MSG_DEBUG, "OpenSSL: calculated issuerKeyHash: %s",
+			   txt);
+		os_free(txt);
+	}
+
+	if (ASN1_OCTET_STRING_cmp(certid->issuerKeyHash, hash)) {
+		ASN1_OCTET_STRING_free(hash);
+		return -1;
+	}
+
+	ASN1_OCTET_STRING_free(hash);
+	return 0;
+}
+
+
+static X509 * ocsp_find_signer(STACK_OF(X509) *certs, ResponderID *rid)
+{
+	unsigned int i;
+	unsigned char hash[SHA_DIGEST_LENGTH];
+
+	if (rid->type == 0) {
+		/* byName */
+		return X509_find_by_subject(certs, rid->value.byName);
+	}
+
+	/* byKey */
+	if (rid->value.byKey->length != SHA_DIGEST_LENGTH)
+		return NULL;
+	for (i = 0; i < sk_X509_num(certs); i++) {
+		X509 *x = sk_X509_value(certs, i);
+
+		X509_pubkey_digest(x, EVP_sha1(), hash, NULL);
+		if (os_memcmp(rid->value.byKey->data, hash,
+			      SHA_DIGEST_LENGTH) == 0)
+			return x;
+	}
+
+	return NULL;
+}
+
+
+enum ocsp_result check_ocsp_resp(SSL_CTX *ssl_ctx, SSL *ssl, X509 *cert,
+				 X509 *issuer, X509 *issuer_issuer)
+{
+	const uint8_t *resp_data;
+	size_t resp_len;
+	OCSPResponse *resp;
+	int status;
+	ResponseBytes *bytes;
+	const u8 *basic_data;
+	size_t basic_len;
+	BasicOCSPResponse *basic;
+	ResponseData *rd;
+	char *txt;
+	int i, num;
+	unsigned int j, num_resp;
+	SingleResponse *matching_resp = NULL, *cmp_sresp;
+	enum ocsp_result result = OCSP_INVALID;
+	X509_STORE *store;
+	STACK_OF(X509) *untrusted = NULL, *certs = NULL, *chain = NULL;
+	X509_STORE_CTX ctx;
+	X509 *signer, *tmp_cert;
+	int signer_trusted = 0;
+	EVP_PKEY *skey;
+	int ret;
+	char buf[256];
+
+	txt = integer_str(X509_get_serialNumber(cert));
+	if (txt) {
+		wpa_printf(MSG_DEBUG,
+			   "OpenSSL: Searching OCSP response for peer certificate serialNumber: %s", txt);
+		os_free(txt);
+	}
+
+	SSL_get0_ocsp_response(ssl, &resp_data, &resp_len);
+	if (resp_data == NULL || resp_len == 0) {
+		wpa_printf(MSG_DEBUG, "OpenSSL: No OCSP response received");
+		return OCSP_NO_RESPONSE;
+	}
+
+	wpa_hexdump(MSG_DEBUG, "OpenSSL: OCSP response", resp_data, resp_len);
+
+	resp = d2i_OCSPResponse(NULL, &resp_data, resp_len);
+	if (!resp) {
+		wpa_printf(MSG_INFO, "OpenSSL: Failed to parse OCSPResponse");
+		return OCSP_INVALID;
+	}
+
+	status = ASN1_ENUMERATED_get(resp->responseStatus);
+	if (status != 0) {
+		wpa_printf(MSG_INFO, "OpenSSL: OCSP responder error %d",
+			   status);
+		return OCSP_INVALID;
+	}
+
+	bytes = resp->responseBytes;
+
+	if (!bytes ||
+	    OBJ_obj2nid(bytes->responseType) != NID_id_pkix_OCSP_basic) {
+		wpa_printf(MSG_INFO,
+			   "OpenSSL: Could not find BasicOCSPResponse");
+		return OCSP_INVALID;
+	}
+
+	basic_data = ASN1_STRING_data(bytes->response);
+	basic_len = ASN1_STRING_length(bytes->response);
+	wpa_hexdump(MSG_DEBUG, "OpenSSL: BasicOCSPResponse",
+		    basic_data, basic_len);
+
+	basic = d2i_BasicOCSPResponse(NULL, &basic_data, basic_len);
+	if (!basic) {
+		wpa_printf(MSG_INFO,
+			   "OpenSSL: Could not parse BasicOCSPResponse");
+		OCSPResponse_free(resp);
+		return OCSP_INVALID;
+	}
+
+	rd = basic->tbsResponseData;
+
+	if (basic->certs) {
+		untrusted = sk_X509_dup(basic->certs);
+		if (!untrusted)
+			goto fail;
+
+		num = sk_X509_num(basic->certs);
+		for (i = 0; i < num; i++) {
+			X509 *extra_cert;
+
+			extra_cert = sk_X509_value(basic->certs, i);
+			X509_NAME_oneline(X509_get_subject_name(extra_cert),
+					  buf, sizeof(buf));
+			wpa_printf(MSG_DEBUG,
+				   "OpenSSL: BasicOCSPResponse cert %s", buf);
+
+			if (!sk_X509_push(untrusted, extra_cert)) {
+				wpa_printf(MSG_DEBUG,
+					   "OpenSSL: Could not add certificate to the untrusted stack");
+			}
+		}
+	}
+
+	store = SSL_CTX_get_cert_store(ssl_ctx);
+	if (issuer) {
+		if (X509_STORE_add_cert(store, issuer) != 1) {
+			tls_show_errors(MSG_INFO, __func__,
+					"OpenSSL: Could not add issuer to certificate store");
+		}
+		certs = sk_X509_new_null();
+		if (certs) {
+			tmp_cert = X509_dup(issuer);
+			if (tmp_cert && !sk_X509_push(certs, tmp_cert)) {
+				tls_show_errors(
+					MSG_INFO, __func__,
+					"OpenSSL: Could not add issuer to OCSP responder trust store");
+				X509_free(tmp_cert);
+				sk_X509_free(certs);
+				certs = NULL;
+			}
+			if (certs && issuer_issuer) {
+				tmp_cert = X509_dup(issuer_issuer);
+				if (tmp_cert &&
+				    !sk_X509_push(certs, tmp_cert)) {
+					tls_show_errors(
+						MSG_INFO, __func__,
+						"OpenSSL: Could not add issuer's issuer to OCSP responder trust store");
+					X509_free(tmp_cert);
+				}
+			}
+		}
+	}
+
+	signer = ocsp_find_signer(certs, rd->responderID);
+	if (!signer)
+		signer = ocsp_find_signer(untrusted, rd->responderID);
+	else
+		signer_trusted = 1;
+	if (!signer) {
+		wpa_printf(MSG_DEBUG,
+			   "OpenSSL: Could not find OCSP signer certificate");
+		goto fail;
+	}
+
+	skey = X509_get_pubkey(signer);
+	if (!skey) {
+		wpa_printf(MSG_DEBUG,
+			   "OpenSSL: Could not get OCSP signer public key");
+		goto fail;
+	}
+	if (ASN1_item_verify(ASN1_ITEM_rptr(ResponseData),
+			     basic->signatureAlgorithm, basic->signature,
+			     basic->tbsResponseData, skey) <= 0) {
+		wpa_printf(MSG_DEBUG,
+			   "OpenSSL: BasicOCSPResponse signature is invalid");
+		goto fail;
+	}
+
+	X509_NAME_oneline(X509_get_subject_name(signer), buf, sizeof(buf));
+	wpa_printf(MSG_DEBUG,
+		   "OpenSSL: Found OCSP signer certificate %s and verified BasicOCSPResponse signature",
+		   buf);
+
+	if (!X509_STORE_CTX_init(&ctx, store, signer, untrusted))
+		goto fail;
+	X509_STORE_CTX_set_purpose(&ctx, X509_PURPOSE_OCSP_HELPER);
+	ret = X509_verify_cert(&ctx);
+	chain = X509_STORE_CTX_get1_chain(&ctx);
+	X509_STORE_CTX_cleanup(&ctx);
+	if (ret <= 0) {
+		wpa_printf(MSG_DEBUG,
+			   "OpenSSL: Could not validate OCSP signer certificate");
+		goto fail;
+	}
+
+	if (!chain || sk_X509_num(chain) <= 0) {
+		wpa_printf(MSG_DEBUG, "OpenSSL: No OCSP signer chain found");
+		goto fail;
+	}
+
+	if (!signer_trusted) {
+		X509_check_purpose(signer, -1, 0);
+		if ((signer->ex_flags & EXFLAG_XKUSAGE) &&
+		    (signer->ex_xkusage & XKU_OCSP_SIGN)) {
+			wpa_printf(MSG_DEBUG,
+				   "OpenSSL: OCSP signer certificate delegation OK");
+		} else {
+			tmp_cert = sk_X509_value(chain, sk_X509_num(chain) - 1);
+			if (X509_check_trust(tmp_cert, NID_OCSP_sign, 0) !=
+			    X509_TRUST_TRUSTED) {
+				wpa_printf(MSG_DEBUG,
+					   "OpenSSL: OCSP signer certificate not trusted");
+				result = OCSP_NO_RESPONSE;
+				goto fail;
+			}
+		}
+	}
+
+	wpa_printf(MSG_DEBUG, "OpenSSL: OCSP version: %lu",
+		   ASN1_INTEGER_get(rd->version));
+
+	txt = responderid_str(rd->responderID);
+	if (txt) {
+		wpa_printf(MSG_DEBUG, "OpenSSL: OCSP responderID: %s",
+			   txt);
+		os_free(txt);
+	}
+
+	txt = generalizedtime_str(rd->producedAt);
+	if (txt) {
+		wpa_printf(MSG_DEBUG, "OpenSSL: OCSP producedAt: %s",
+			   txt);
+		os_free(txt);
+	}
+
+	num_resp = sk_SingleResponse_num(rd->responses);
+	if (num_resp == 0) {
+		wpa_printf(MSG_DEBUG,
+			   "OpenSSL: No OCSP SingleResponse within BasicOCSPResponse");
+		result = OCSP_NO_RESPONSE;
+		goto fail;
+	}
+	cmp_sresp = sk_SingleResponse_value(rd->responses, 0);
+	for (j = 0; j < num_resp; j++) {
+		SingleResponse *sresp;
+		CertID *cid1, *cid2;
+
+		sresp = sk_SingleResponse_value(rd->responses, j);
+		wpa_printf(MSG_DEBUG, "OpenSSL: OCSP SingleResponse %u/%u",
+			   j + 1, num_resp);
+
+		txt = algor_str(sresp->certID->hashAlgorithm);
+		if (txt) {
+			wpa_printf(MSG_DEBUG,
+				   "OpenSSL: certID hashAlgorithm: %s", txt);
+			os_free(txt);
+		}
+
+		txt = octet_string_str(sresp->certID->issuerNameHash);
+		if (txt) {
+			wpa_printf(MSG_DEBUG,
+				   "OpenSSL: certID issuerNameHash: %s", txt);
+			os_free(txt);
+		}
+
+		txt = octet_string_str(sresp->certID->issuerKeyHash);
+		if (txt) {
+			wpa_printf(MSG_DEBUG,
+				   "OpenSSL: certID issuerKeyHash: %s", txt);
+			os_free(txt);
+		}
+
+		txt = integer_str(sresp->certID->serialNumber);
+		if (txt) {
+			wpa_printf(MSG_DEBUG,
+				   "OpenSSL: certID serialNumber: %s", txt);
+			os_free(txt);
+		}
+
+		switch (sresp->certStatus->type) {
+		case 0:
+			wpa_printf(MSG_DEBUG, "OpenSSL: certStatus: good");
+			break;
+		case 1:
+			wpa_printf(MSG_DEBUG, "OpenSSL: certStatus: revoked");
+			break;
+		default:
+			wpa_printf(MSG_DEBUG, "OpenSSL: certStatus: unknown");
+			break;
+		}
+
+		txt = generalizedtime_str(sresp->thisUpdate);
+		if (txt) {
+			wpa_printf(MSG_DEBUG, "OpenSSL: thisUpdate: %s", txt);
+			os_free(txt);
+		}
+
+		if (sresp->nextUpdate) {
+			txt = generalizedtime_str(sresp->nextUpdate);
+			if (txt) {
+				wpa_printf(MSG_DEBUG, "OpenSSL: nextUpdate: %s",
+					   txt);
+				os_free(txt);
+			}
+		}
+
+		txt = extensions_str("singleExtensions",
+				     sresp->singleExtensions);
+		if (txt) {
+			wpa_printf(MSG_DEBUG, "OpenSSL: %s", txt);
+			os_free(txt);
+		}
+
+		cid1 = cmp_sresp->certID;
+		cid2 = sresp->certID;
+		if (j > 0 &&
+		    (OBJ_cmp(cid1->hashAlgorithm->algorithm,
+			     cid2->hashAlgorithm->algorithm) != 0 ||
+		     ASN1_OCTET_STRING_cmp(cid1->issuerNameHash,
+					   cid2->issuerNameHash) != 0 ||
+		     ASN1_OCTET_STRING_cmp(cid1->issuerKeyHash,
+					   cid2->issuerKeyHash) != 0)) {
+			wpa_printf(MSG_DEBUG,
+				   "OpenSSL: Different OCSP response issuer information between SingleResponse values within BasicOCSPResponse");
+			goto fail;
+		}
+
+		if (!matching_resp && issuer &&
+		    ASN1_INTEGER_cmp(sresp->certID->serialNumber,
+				     X509_get_serialNumber(cert)) == 0 &&
+		    issuer_match(cert, issuer, sresp->certID) == 0) {
+			wpa_printf(MSG_DEBUG,
+				   "OpenSSL: This response matches peer certificate");
+			matching_resp = sresp;
+		}
+	}
+
+	txt = extensions_str("responseExtensions", rd->responseExtensions);
+	if (txt) {
+		wpa_printf(MSG_DEBUG, "OpenSSL: %s", txt);
+		os_free(txt);
+	}
+
+	if (!matching_resp) {
+		wpa_printf(MSG_DEBUG,
+			   "OpenSSL: Could not find OCSP response that matches the peer certificate");
+		result = OCSP_NO_RESPONSE;
+		goto fail;
+	}
+
+	if (!ocsp_resp_valid(matching_resp->thisUpdate,
+			     matching_resp->nextUpdate)) {
+		wpa_printf(MSG_DEBUG,
+			   "OpenSSL: OCSP response not valid at this time");
+		goto fail;
+	}
+
+	if (matching_resp->certStatus->type == 1) {
+		wpa_printf(MSG_DEBUG,
+			   "OpenSSL: OCSP response indicated that the peer certificate has been revoked");
+		result = OCSP_REVOKED;
+		goto fail;
+	}
+
+	if (matching_resp->certStatus->type != 0) {
+		wpa_printf(MSG_DEBUG,
+			   "OpenSSL: OCSP response did not indicate good status");
+		result = OCSP_NO_RESPONSE;
+		goto fail;
+	}
+
+	/* OCSP response indicated the certificate is good. */
+	result = OCSP_GOOD;
+fail:
+	sk_X509_pop_free(chain, X509_free);
+	sk_X509_free(untrusted);
+	sk_X509_pop_free(certs, X509_free);
+	BasicOCSPResponse_free(basic);
+	OCSPResponse_free(resp);
+
+	return result;
+}
+
+#endif /* OPENSSL_IS_BORINGSSL */
diff --git a/src/drivers/driver.h b/src/drivers/driver.h
index 3cdab5a7a87d6..a449cc9347352 100644
--- a/src/drivers/driver.h
+++ b/src/drivers/driver.h
@@ -45,6 +45,22 @@
 #define HOSTAPD_CHAN_INDOOR_ONLY 0x00010000
 #define HOSTAPD_CHAN_GO_CONCURRENT 0x00020000
 
+#define HOSTAPD_CHAN_VHT_10_150 0x00100000
+#define HOSTAPD_CHAN_VHT_30_130 0x00200000
+#define HOSTAPD_CHAN_VHT_50_110 0x00400000
+#define HOSTAPD_CHAN_VHT_70_90  0x00800000
+#define HOSTAPD_CHAN_VHT_90_70  0x01000000
+#define HOSTAPD_CHAN_VHT_110_50 0x02000000
+#define HOSTAPD_CHAN_VHT_130_30 0x04000000
+#define HOSTAPD_CHAN_VHT_150_10 0x08000000
+
+/* Filter gratuitous ARP */
+#define WPA_DATA_FRAME_FILTER_FLAG_ARP BIT(0)
+/* Filter unsolicited Neighbor Advertisement */
+#define WPA_DATA_FRAME_FILTER_FLAG_NA BIT(1)
+/* Filter unicast IP packets encrypted using the GTK */
+#define WPA_DATA_FRAME_FILTER_FLAG_GTK BIT(2)
+
 /**
  * enum reg_change_initiator - Regulatory change initiator
  */
@@ -284,6 +300,18 @@ struct wpa_interface_info {
 #define WPAS_MAX_SCAN_SSIDS 16
 
 /**
+ * struct wpa_driver_scan_ssid - SSIDs to scan for
+ * @ssid - specific SSID to scan for (ProbeReq)
+ *	%NULL or zero-length SSID is used to indicate active scan
+ *	with wildcard SSID.
+ * @ssid_len - Length of the SSID in octets
+ */
+struct wpa_driver_scan_ssid {
+	const u8 *ssid;
+	size_t ssid_len;
+};
+
+/**
  * struct wpa_driver_scan_params - Scan parameters
  * Data for struct wpa_driver_ops::scan2().
  */
@@ -291,18 +319,7 @@ struct wpa_driver_scan_params {
 	/**
 	 * ssids - SSIDs to scan for
 	 */
-	struct wpa_driver_scan_ssid {
-		/**
-		 * ssid - specific SSID to scan for (ProbeReq)
-		 * %NULL or zero-length SSID is used to indicate active scan
-		 * with wildcard SSID.
-		 */
-		const u8 *ssid;
-		/**
-		 * ssid_len: Length of the SSID in octets
-		 */
-		size_t ssid_len;
-	} ssids[WPAS_MAX_SCAN_SSIDS];
+	struct wpa_driver_scan_ssid ssids[WPAS_MAX_SCAN_SSIDS];
 
 	/**
 	 * num_ssids - Number of entries in ssids array
@@ -407,6 +424,37 @@ struct wpa_driver_scan_params {
 	 */
 	const u8 *mac_addr_mask;
 
+	/**
+	 * sched_scan_plans - Scan plans for scheduled scan
+	 *
+	 * Each scan plan consists of the number of iterations to scan and the
+	 * interval between scans. When a scan plan finishes (i.e., it was run
+	 * for the specified number of iterations), the next scan plan is
+	 * executed. The scan plans are executed in the order they appear in
+	 * the array (lower index first). The last scan plan will run infinitely
+	 * (until requested to stop), thus must not specify the number of
+	 * iterations. All other scan plans must specify the number of
+	 * iterations.
+	 */
+	struct sched_scan_plan {
+		 u32 interval; /* In seconds */
+		 u32 iterations; /* Zero to run infinitely */
+	 } *sched_scan_plans;
+
+	/**
+	 * sched_scan_plans_num - Number of scan plans in sched_scan_plans array
+	 */
+	 unsigned int sched_scan_plans_num;
+
+	/**
+	 * bssid - Specific BSSID to scan for
+	 *
+	 * This optional parameter can be used to replace the default wildcard
+	 * BSSID with a specific BSSID to scan for if results are needed from
+	 * only a single BSS.
+	 */
+	const u8 *bssid;
+
 	/*
 	 * NOTE: Whenever adding new parameters here, please make sure
 	 * wpa_scan_clone_params() and wpa_scan_free_params() get updated with
@@ -828,6 +876,12 @@ struct wpa_driver_associate_params {
 	 * RRM (Radio Resource Measurements)
 	 */
 	int rrm_used;
+
+	/**
+	 * pbss - If set, connect to a PCP in a PBSS. Otherwise, connect to an
+	 * AP as usual. Valid for DMG network only.
+	 */
+	int pbss;
 };
 
 enum hide_ssid {
@@ -1055,16 +1109,28 @@ struct wpa_driver_ap_params {
 	 * reenable - Whether this is to re-enable beaconing
 	 */
 	int reenable;
+
+	/**
+	 * pbss - Whether to start a PCP (in PBSS) instead of an AP in
+	 * infrastructure BSS. Valid only for DMG network.
+	 */
+	int pbss;
 };
 
 struct wpa_driver_mesh_bss_params {
-#define WPA_DRIVER_MESH_CONF_FLAG_AUTO_PLINKS	0x00000001
+#define WPA_DRIVER_MESH_CONF_FLAG_AUTO_PLINKS		0x00000001
+#define WPA_DRIVER_MESH_CONF_FLAG_PEER_LINK_TIMEOUT	0x00000002
+#define WPA_DRIVER_MESH_CONF_FLAG_MAX_PEER_LINKS	0x00000004
+#define WPA_DRIVER_MESH_CONF_FLAG_HT_OP_MODE		0x00000008
 	/*
 	 * TODO: Other mesh configuration parameters would go here.
 	 * See NL80211_MESHCONF_* for all the mesh config parameters.
 	 */
 	unsigned int flags;
+	int auto_plinks;
 	int peer_link_timeout;
+	int max_peer_links;
+	u16 ht_opmode;
 };
 
 struct wpa_driver_mesh_join_params {
@@ -1075,7 +1141,7 @@ struct wpa_driver_mesh_join_params {
 	int ie_len;
 	struct hostapd_freq_params freq;
 	int beacon_int;
-	int max_peer_links;
+	int dtim_period;
 	struct wpa_driver_mesh_bss_params conf;
 #define WPA_DRIVER_MESH_FLAG_USER_MPM	0x00000001
 #define WPA_DRIVER_MESH_FLAG_DRIVER_MPM	0x00000002
@@ -1214,8 +1280,17 @@ struct wpa_driver_capa {
 #define WPA_DRIVER_FLAGS_VHT_IBSS		0x0000002000000000ULL
 /** Driver supports automatic band selection */
 #define WPA_DRIVER_FLAGS_SUPPORT_HW_MODE_ANY	0x0000004000000000ULL
+/** Driver supports simultaneous off-channel operations */
+#define WPA_DRIVER_FLAGS_OFFCHANNEL_SIMULTANEOUS	0x0000008000000000ULL
+/** Driver supports full AP client state */
+#define WPA_DRIVER_FLAGS_FULL_AP_CLIENT_STATE	0x0000010000000000ULL
+/** Driver supports P2P Listen offload */
+#define WPA_DRIVER_FLAGS_P2P_LISTEN_OFFLOAD     0x0000020000000000ULL
 	u64 flags;
 
+#define FULL_AP_CLIENT_STATE_SUPP(drv_flags) \
+	(drv_flags & WPA_DRIVER_FLAGS_FULL_AP_CLIENT_STATE)
+
 #define WPA_DRIVER_SMPS_MODE_STATIC			0x00000001
 #define WPA_DRIVER_SMPS_MODE_DYNAMIC			0x00000002
 	unsigned int smps_modes;
@@ -1231,6 +1306,15 @@ struct wpa_driver_capa {
 	/** Maximum number of supported active probe SSIDs for sched_scan */
 	int max_sched_scan_ssids;
 
+	/** Maximum number of supported scan plans for scheduled scan */
+	unsigned int max_sched_scan_plans;
+
+	/** Maximum interval in a scan plan. In seconds */
+	u32 max_sched_scan_plan_interval;
+
+	/** Maximum number of iterations in a single scan plan */
+	u32 max_sched_scan_plan_iterations;
+
 	/** Whether sched_scan (offloaded scanning) is supported */
 	int sched_scan_supported;
 
@@ -1296,6 +1380,12 @@ struct wpa_driver_capa {
  * offset, namely the 6th byte in the Action frame body.
  */
 #define WPA_DRIVER_FLAGS_TX_POWER_INSERTION		0x00000008
+/**
+ * Driver supports RRM. With this support, the driver will accept to use RRM in
+ * (Re)Association Request frames, without supporting quiet period.
+ */
+#define WPA_DRIVER_FLAGS_SUPPORT_RRM			0x00000010
+
 	u32 rrm_flags;
 
 	/* Driver concurrency capabilities */
@@ -1304,13 +1394,18 @@ struct wpa_driver_capa {
 	unsigned int max_conc_chan_2_4;
 	/* Maximum number of concurrent channels on 5 GHz */
 	unsigned int max_conc_chan_5_0;
+
+	/* Maximum number of supported CSA counters */
+	u16 max_csa_counters;
 };
 
 
 struct hostapd_data;
 
 struct hostap_sta_driver_data {
-	unsigned long rx_packets, tx_packets, rx_bytes, tx_bytes;
+	unsigned long rx_packets, tx_packets;
+	unsigned long long rx_bytes, tx_bytes;
+	int bytes_64bit; /* whether 64-bit byte counters are supported */
 	unsigned long current_tx_rate;
 	unsigned long inactive_msec;
 	unsigned long flags;
@@ -1336,6 +1431,7 @@ struct hostapd_sta_add_params {
 	u32 flags_mask; /* unset bits in flags */
 #ifdef CONFIG_MESH
 	enum mesh_plink_state plink_state;
+	u16 peer_aid;
 #endif /* CONFIG_MESH */
 	int set; /* Set STA parameters instead of add */
 	u8 qosinfo;
@@ -1345,6 +1441,7 @@ struct hostapd_sta_add_params {
 	size_t supp_channels_len;
 	const u8 *supp_oper_classes;
 	size_t supp_oper_classes_len;
+	int support_p2p_ps;
 };
 
 struct mac_address {
@@ -1450,6 +1547,7 @@ struct wpa_bss_params {
 #define WPA_STA_MFP BIT(3)
 #define WPA_STA_TDLS_PEER BIT(4)
 #define WPA_STA_AUTHENTICATED BIT(5)
+#define WPA_STA_ASSOCIATED BIT(6)
 
 enum tdls_oper {
 	TDLS_DISCOVERY_REQ,
@@ -1554,8 +1652,8 @@ struct csa_settings {
 	struct beacon_data beacon_csa;
 	struct beacon_data beacon_after;
 
-	u16 counter_offset_beacon;
-	u16 counter_offset_presp;
+	u16 counter_offset_beacon[2];
+	u16 counter_offset_presp[2];
 };
 
 /* TDLS peer capabilities for send_tdls_mgmt() */
@@ -1883,6 +1981,14 @@ struct wpa_driver_ops {
 	void (*poll)(void *priv);
 
 	/**
+	 * get_ifindex - Get interface index
+	 * @priv: private driver interface data
+	 *
+	 * Returns: Interface index
+	 */
+	unsigned int (*get_ifindex)(void *priv);
+
+	/**
 	 * get_ifname - Get interface name
 	 * @priv: private driver interface data
 	 *
@@ -1960,10 +2066,13 @@ struct wpa_driver_ops {
 	 * @noack: Do not wait for this frame to be acked (disable retries)
 	 * @freq: Frequency (in MHz) to send the frame on, or 0 to let the
 	 * driver decide
+	 * @csa_offs: Array of CSA offsets or %NULL
+	 * @csa_offs_len: Number of elements in csa_offs
 	 * Returns: 0 on success, -1 on failure
 	 */
 	int (*send_mlme)(void *priv, const u8 *data, size_t data_len,
-			 int noack, unsigned int freq);
+			 int noack, unsigned int freq, const u16 *csa_offs,
+			 size_t csa_offs_len);
 
 	/**
 	 * update_ft_ies - Update FT (IEEE 802.11r) IEs
@@ -2013,6 +2122,7 @@ struct wpa_driver_ops {
 
 	/**
 	 * global_init - Global driver initialization
+	 * @ctx: wpa_global pointer
 	 * Returns: Pointer to private data (global), %NULL on failure
 	 *
 	 * This optional function is called to initialize the driver wrapper
@@ -2022,7 +2132,7 @@ struct wpa_driver_ops {
 	 * use init2() function instead of init() to get the pointer to global
 	 * data available to per-interface initializer.
 	 */
-	void * (*global_init)(void);
+	void * (*global_init)(void *ctx);
 
 	/**
 	 * global_deinit - Global driver deinitialization
@@ -2308,12 +2418,17 @@ struct wpa_driver_ops {
 	 * @params: Station parameters
 	 * Returns: 0 on success, -1 on failure
 	 *
-	 * This function is used to add a station entry to the driver once the
-	 * station has completed association. This is only used if the driver
+	 * This function is used to add or set (params->set 1) a station
+	 * entry in the driver. Adding STA entries is used only if the driver
 	 * does not take care of association processing.
 	 *
-	 * With TDLS, this function is also used to add or set (params->set 1)
-	 * TDLS peer entries.
+	 * With drivers that don't support full AP client state, this function
+	 * is used to add a station entry to the driver once the station has
+	 * completed association.
+	 *
+	 * With TDLS, this function is used to add or set (params->set 1)
+	 * TDLS peer entries (even with drivers that do not support full AP
+	 * client state).
 	 */
 	int (*sta_add)(void *priv, struct hostapd_sta_add_params *params);
 
@@ -2399,12 +2514,13 @@ struct wpa_driver_ops {
 	 *	change interface address)
 	 * @bridge: Bridge interface to use or %NULL if no bridge configured
 	 * @use_existing: Whether to allow existing interface to be used
+	 * @setup_ap: Whether to setup AP for %WPA_IF_AP_BSS interfaces
 	 * Returns: 0 on success, -1 on failure
 	 */
 	int (*if_add)(void *priv, enum wpa_driver_if_type type,
 		      const char *ifname, const u8 *addr, void *bss_ctx,
 		      void **drv_priv, char *force_ifname, u8 *if_addr,
-		      const char *bridge, int use_existing);
+		      const char *bridge, int use_existing, int setup_ap);
 
 	/**
 	 * if_remove - Remove a virtual interface
@@ -2986,7 +3102,6 @@ struct wpa_driver_ops {
 	 * sched_scan - Request the driver to initiate scheduled scan
 	 * @priv: Private driver interface data
 	 * @params: Scan parameters
-	 * @interval: Interval between scan cycles in milliseconds
 	 * Returns: 0 on success, -1 on failure
 	 *
 	 * This operation should be used for scheduled scan offload to
@@ -2997,8 +3112,7 @@ struct wpa_driver_ops {
 	 * and if not provided or if it returns -1, we fall back to
 	 * normal host-scheduled scans.
 	 */
-	int (*sched_scan)(void *priv, struct wpa_driver_scan_params *params,
-			  u32 interval);
+	int (*sched_scan)(void *priv, struct wpa_driver_scan_params *params);
 
 	/**
 	 * stop_sched_scan - Request the driver to stop a scheduled scan
@@ -3203,11 +3317,9 @@ struct wpa_driver_ops {
 	 * set_current_cipher_suite - Set current cipher suite
 	 * @priv: Private driver interface data
 	 * @cs: EUI64 identifier
-	 * @cs_len: Length of the cs buffer in octets
 	 * Returns: 0 on success, -1 on failure (or if not supported)
 	 */
-	int (*set_current_cipher_suite)(void *priv, const u8 *cs,
-					size_t cs_len);
+	int (*set_current_cipher_suite)(void *priv, u64 cs);
 
 	/**
 	 * enable_controlled_port - Set controlled port status
@@ -3439,6 +3551,78 @@ struct wpa_driver_ops {
 	 * on. Local device is assuming P2P Client role.
 	 */
 	int (*set_prob_oper_freq)(void *priv, unsigned int freq);
+
+	/**
+	 * abort_scan - Request the driver to abort an ongoing scan
+	 * @priv: Private driver interface data
+	 * Returns 0 on success, -1 on failure
+	 */
+	int (*abort_scan)(void *priv);
+
+	/**
+	 * configure_data_frame_filters - Request to configure frame filters
+	 * @priv: Private driver interface data
+	 * @filter_flags: The type of frames to filter (bitfield of
+	 * WPA_DATA_FRAME_FILTER_FLAG_*)
+	 * Returns: 0 on success or -1 on failure
+	 */
+	int (*configure_data_frame_filters)(void *priv, u32 filter_flags);
+
+	/**
+	 * get_ext_capab - Get extended capabilities for the specified interface
+	 * @priv: Private driver interface data
+	 * @type: Interface type for which to get extended capabilities
+	 * @ext_capab: Extended capabilities fetched
+	 * @ext_capab_mask: Extended capabilities mask
+	 * @ext_capab_len: Length of the extended capabilities
+	 * Returns: 0 on success or -1 on failure
+	 */
+	int (*get_ext_capab)(void *priv, enum wpa_driver_if_type type,
+			     const u8 **ext_capab, const u8 **ext_capab_mask,
+			     unsigned int *ext_capab_len);
+
+	/**
+	 * p2p_lo_start - Start offloading P2P listen to device
+	 * @priv: Private driver interface data
+	 * @freq: Listening frequency (MHz) for P2P listen
+	 * @period: Length of the listen operation in milliseconds
+	 * @interval: Interval for running the listen operation in milliseconds
+	 * @count: Number of times to run the listen operation
+	 * @device_types: Device primary and secondary types
+	 * @dev_types_len: Number of bytes for device_types
+	 * @ies: P2P IE and WSC IE for Probe Response frames
+	 * @ies_len: Length of ies in bytes
+	 * Returns: 0 on success or -1 on failure
+	 */
+	int (*p2p_lo_start)(void *priv, unsigned int freq,
+			    unsigned int period, unsigned int interval,
+			    unsigned int count,
+			    const u8 *device_types, size_t dev_types_len,
+			    const u8 *ies, size_t ies_len);
+
+	/**
+	 * p2p_lo_stop - Stop P2P listen offload
+	 * @priv: Private driver interface data
+	 * Returns: 0 on success or -1 on failure
+	 */
+	int (*p2p_lo_stop)(void *priv);
+
+	/**
+	 * set_default_scan_ies - Set default scan IEs
+	 * @priv: Private driver interface data
+	 * @ies: Scan default IEs buffer
+	 * @ies_len: Length of IEs in bytes
+	 * Returns: 0 on success or -1 on failure
+	 *
+	 * The driver can use these by default when there are no scan IEs coming
+	 * in the subsequent scan requests. Also in case of one or more of IEs
+	 * given in set_default_scan_ies() are missing in the subsequent scan
+	 * request, the driver should merge the missing scan IEs in the scan
+	 * request from the IEs set by set_default_scan_ies() in the Probe
+	 * Request frames sent.
+	 */
+	int (*set_default_scan_ies)(void *priv, const u8 *ies, size_t ies_len);
+
 };
 
 
@@ -3923,6 +4107,11 @@ enum wpa_event_type {
 	 * on a DFS frequency by a driver that supports DFS Offload.
 	 */
 	EVENT_DFS_CAC_STARTED,
+
+	/**
+	 * EVENT_P2P_LO_STOP - Notify that P2P listen offload is stopped
+	 */
+	EVENT_P2P_LO_STOP,
 };
 
 
@@ -4098,6 +4287,12 @@ union wpa_event_data {
 		 * ptk_kek_len - The length of ptk_kek
 		 */
 		size_t ptk_kek_len;
+
+		/**
+		 * subnet_status - The subnet status:
+		 * 0 = unknown, 1 = unchanged, 2 = changed
+		 */
+		u8 subnet_status;
 	} assoc_info;
 
 	/**
@@ -4174,6 +4369,7 @@ union wpa_event_data {
 	 * struct interface_status - Data for EVENT_INTERFACE_STATUS
 	 */
 	struct interface_status {
+		unsigned int ifindex;
 		char ifname[100];
 		enum {
 			EVENT_INTERFACE_ADDED, EVENT_INTERFACE_REMOVED
@@ -4301,6 +4497,12 @@ union wpa_event_data {
 		 * status_code - Status Code from (Re)association Response
 		 */
 		u16 status_code;
+
+		/**
+		 * timed_out - Whether failure is due to timeout (etc.) rather
+		 * than explicit rejection response from the AP.
+		 */
+		int timed_out;
 	} assoc_reject;
 
 	struct timeout_event {
@@ -4381,6 +4583,9 @@ union wpa_event_data {
 	 * @ssids: Scanned SSIDs (%NULL or zero-length SSID indicates wildcard
 	 *	SSID)
 	 * @num_ssids: Number of entries in ssids array
+	 * @external_scan: Whether the scan info is for an external scan
+	 * @nl_scan_event: 1 if the source of this scan event is a normal scan,
+	 * 	0 if the source of the scan event is a vendor scan
 	 */
 	struct scan_info {
 		int aborted;
@@ -4388,6 +4593,8 @@ union wpa_event_data {
 		size_t num_freqs;
 		struct wpa_driver_scan_ssid ssids[WPAS_MAX_SCAN_SSIDS];
 		size_t num_ssids;
+		int external_scan;
+		int nl_scan_event;
 	} scan_info;
 
 	/**
@@ -4630,6 +4837,27 @@ union wpa_event_data {
 		u16 ch_width;
 		enum hostapd_hw_mode hw_mode;
 	} acs_selected_channels;
+
+	/**
+	 * struct p2p_lo_stop - Reason code for P2P Listen offload stop event
+	 * @reason_code: Reason for stopping offload
+	 *	P2P_LO_STOPPED_REASON_COMPLETE: Listen offload finished as
+	 *	scheduled.
+	 *	P2P_LO_STOPPED_REASON_RECV_STOP_CMD: Host requested offload to
+	 *	be stopped.
+	 *	P2P_LO_STOPPED_REASON_INVALID_PARAM: Invalid listen offload
+	 *	parameters.
+	 *	P2P_LO_STOPPED_REASON_NOT_SUPPORTED: Listen offload not
+	 *	supported by device.
+	 */
+	struct p2p_lo_stop {
+		enum {
+			P2P_LO_STOPPED_REASON_COMPLETE = 0,
+			P2P_LO_STOPPED_REASON_RECV_STOP_CMD,
+			P2P_LO_STOPPED_REASON_INVALID_PARAM,
+			P2P_LO_STOPPED_REASON_NOT_SUPPORTED,
+		} reason_code;
+	} p2p_lo_stop;
 };
 
 /**
@@ -4645,6 +4873,18 @@ union wpa_event_data {
 void wpa_supplicant_event(void *ctx, enum wpa_event_type event,
 			  union wpa_event_data *data);
 
+/**
+ * wpa_supplicant_event_global - Report a driver event for wpa_supplicant
+ * @ctx: Context pointer (wpa_s); this is the ctx variable registered
+ *	with struct wpa_driver_ops::init()
+ * @event: event type (defined above)
+ * @data: possible extra data for the event
+ *
+ * Same as wpa_supplicant_event(), but we search for the interface in
+ * wpa_global.
+ */
+void wpa_supplicant_event_global(void *ctx, enum wpa_event_type event,
+				 union wpa_event_data *data);
 
 /*
  * The following inline functions are provided for convenience to simplify
@@ -4697,8 +4937,52 @@ int vht_supported(const struct hostapd_hw_modes *mode);
 struct wowlan_triggers *
 wpa_get_wowlan_triggers(const char *wowlan_triggers,
 			const struct wpa_driver_capa *capa);
+/* Convert driver flag to string */
+const char * driver_flag_to_string(u64 flag);
 
 /* NULL terminated array of linked in driver wrappers */
 extern const struct wpa_driver_ops *const wpa_drivers[];
 
+
+/* Available drivers */
+
+#ifdef CONFIG_DRIVER_WEXT
+extern const struct wpa_driver_ops wpa_driver_wext_ops; /* driver_wext.c */
+#endif /* CONFIG_DRIVER_WEXT */
+#ifdef CONFIG_DRIVER_NL80211
+/* driver_nl80211.c */
+extern const struct wpa_driver_ops wpa_driver_nl80211_ops;
+#endif /* CONFIG_DRIVER_NL80211 */
+#ifdef CONFIG_DRIVER_HOSTAP
+extern const struct wpa_driver_ops wpa_driver_hostap_ops; /* driver_hostap.c */
+#endif /* CONFIG_DRIVER_HOSTAP */
+#ifdef CONFIG_DRIVER_BSD
+extern const struct wpa_driver_ops wpa_driver_bsd_ops; /* driver_bsd.c */
+#endif /* CONFIG_DRIVER_BSD */
+#ifdef CONFIG_DRIVER_OPENBSD
+/* driver_openbsd.c */
+extern const struct wpa_driver_ops wpa_driver_openbsd_ops;
+#endif /* CONFIG_DRIVER_OPENBSD */
+#ifdef CONFIG_DRIVER_NDIS
+extern struct wpa_driver_ops wpa_driver_ndis_ops; /* driver_ndis.c */
+#endif /* CONFIG_DRIVER_NDIS */
+#ifdef CONFIG_DRIVER_WIRED
+extern const struct wpa_driver_ops wpa_driver_wired_ops; /* driver_wired.c */
+#endif /* CONFIG_DRIVER_WIRED */
+#ifdef CONFIG_DRIVER_MACSEC_QCA
+/* driver_macsec_qca.c */
+extern const struct wpa_driver_ops wpa_driver_macsec_qca_ops;
+#endif /* CONFIG_DRIVER_MACSEC_QCA */
+#ifdef CONFIG_DRIVER_ROBOSWITCH
+/* driver_roboswitch.c */
+extern const struct wpa_driver_ops wpa_driver_roboswitch_ops;
+#endif /* CONFIG_DRIVER_ROBOSWITCH */
+#ifdef CONFIG_DRIVER_ATHEROS
+/* driver_atheros.c */
+extern const struct wpa_driver_ops wpa_driver_atheros_ops;
+#endif /* CONFIG_DRIVER_ATHEROS */
+#ifdef CONFIG_DRIVER_NONE
+extern const struct wpa_driver_ops wpa_driver_none_ops; /* driver_none.c */
+#endif /* CONFIG_DRIVER_NONE */
+
 #endif /* DRIVER_H */
diff --git a/src/drivers/driver_atheros.c b/src/drivers/driver_atheros.c
index ef140934973af..a88345fc92f8f 100644
--- a/src/drivers/driver_atheros.c
+++ b/src/drivers/driver_atheros.c
@@ -189,13 +189,13 @@ set80211priv(struct atheros_driver_data *drv, int op, void *data, int len)
 	    op == IEEE80211_IOCTL_FILTERFRAME)
 		do_inline = 0;
 
-	memset(&iwr, 0, sizeof(iwr));
+	os_memset(&iwr, 0, sizeof(iwr));
 	os_strlcpy(iwr.ifr_name, drv->iface, IFNAMSIZ);
 	if (do_inline) {
 		/*
 		 * Argument data fits inline; put it there.
 		 */
-		memcpy(iwr.u.name, data, len);
+		os_memcpy(iwr.u.name, data, len);
 	} else {
 		/*
 		 * Argument data too big for inline transfer; setup a
@@ -222,10 +222,10 @@ set80211param(struct atheros_driver_data *drv, int op, int arg)
 {
 	struct iwreq iwr;
 
-	memset(&iwr, 0, sizeof(iwr));
+	os_memset(&iwr, 0, sizeof(iwr));
 	os_strlcpy(iwr.ifr_name, drv->iface, IFNAMSIZ);
 	iwr.u.mode = op;
-	memcpy(iwr.u.name+sizeof(__u32), &arg, sizeof(arg));
+	os_memcpy(iwr.u.name + sizeof(__u32), &arg, sizeof(arg));
 
 	if (ioctl(drv->ioctl_sock, IEEE80211_IOCTL_SETPARAM, &iwr) < 0) {
 		wpa_printf(MSG_INFO,
@@ -244,9 +244,9 @@ ether_sprintf(const u8 *addr)
 	static char buf[sizeof(MACSTR)];
 
 	if (addr != NULL)
-		snprintf(buf, sizeof(buf), MACSTR, MAC2STR(addr));
+		os_snprintf(buf, sizeof(buf), MACSTR, MAC2STR(addr));
 	else
-		snprintf(buf, sizeof(buf), MACSTR, 0,0,0,0,0,0);
+		os_snprintf(buf, sizeof(buf), MACSTR, 0, 0, 0, 0, 0, 0);
 	return buf;
 }
 #endif /* CONFIG_NO_STDOUT_DEBUG */
@@ -422,7 +422,7 @@ atheros_set_sta_authorized(void *priv, const u8 *addr, int authorized)
 	else
 		mlme.im_op = IEEE80211_MLME_UNAUTHORIZE;
 	mlme.im_reason = 0;
-	memcpy(mlme.im_macaddr, addr, IEEE80211_ADDR_LEN);
+	os_memcpy(mlme.im_macaddr, addr, IEEE80211_ADDR_LEN);
 	ret = set80211priv(drv, IEEE80211_IOCTL_SETMLME, &mlme, sizeof(mlme));
 	if (ret < 0) {
 		wpa_printf(MSG_DEBUG, "%s: Failed to %sauthorize STA " MACSTR,
@@ -455,9 +455,9 @@ atheros_del_key(void *priv, const u8 *addr, int key_idx)
 	wpa_printf(MSG_DEBUG, "%s: addr=%s key_idx=%d",
 		   __func__, ether_sprintf(addr), key_idx);
 
-	memset(&wk, 0, sizeof(wk));
+	os_memset(&wk, 0, sizeof(wk));
 	if (addr != NULL) {
-		memcpy(wk.idk_macaddr, addr, IEEE80211_ADDR_LEN);
+		os_memcpy(wk.idk_macaddr, addr, IEEE80211_ADDR_LEN);
 		wk.idk_keyix = (u8) IEEE80211_KEYIX_NONE;
 	} else {
 		wk.idk_keyix = key_idx;
@@ -538,20 +538,20 @@ atheros_set_key(const char *ifname, void *priv, enum wpa_alg alg,
 		return -3;
 	}
 
-	memset(&wk, 0, sizeof(wk));
+	os_memset(&wk, 0, sizeof(wk));
 	wk.ik_type = cipher;
 	wk.ik_flags = IEEE80211_KEY_RECV | IEEE80211_KEY_XMIT;
 	if (addr == NULL || is_broadcast_ether_addr(addr)) {
-		memset(wk.ik_macaddr, 0xff, IEEE80211_ADDR_LEN);
+		os_memset(wk.ik_macaddr, 0xff, IEEE80211_ADDR_LEN);
 		wk.ik_keyix = key_idx;
 		if (set_tx)
 			wk.ik_flags |= IEEE80211_KEY_DEFAULT;
 	} else {
-		memcpy(wk.ik_macaddr, addr, IEEE80211_ADDR_LEN);
+		os_memcpy(wk.ik_macaddr, addr, IEEE80211_ADDR_LEN);
 		wk.ik_keyix = IEEE80211_KEYIX_NONE;
 	}
 	wk.ik_keylen = key_len;
-	memcpy(wk.ik_keydata, key, key_len);
+	os_memcpy(wk.ik_keydata, key, key_len);
 
 	ret = set80211priv(drv, IEEE80211_IOCTL_SETKEY, &wk, sizeof(wk));
 	if (ret < 0) {
@@ -575,11 +575,11 @@ atheros_get_seqnum(const char *ifname, void *priv, const u8 *addr, int idx,
 	wpa_printf(MSG_DEBUG, "%s: addr=%s idx=%d",
 		   __func__, ether_sprintf(addr), idx);
 
-	memset(&wk, 0, sizeof(wk));
+	os_memset(&wk, 0, sizeof(wk));
 	if (addr == NULL)
-		memset(wk.ik_macaddr, 0xff, IEEE80211_ADDR_LEN);
+		os_memset(wk.ik_macaddr, 0xff, IEEE80211_ADDR_LEN);
 	else
-		memcpy(wk.ik_macaddr, addr, IEEE80211_ADDR_LEN);
+		os_memcpy(wk.ik_macaddr, addr, IEEE80211_ADDR_LEN);
 	wk.ik_keyix = idx;
 
 	if (set80211priv(drv, IEEE80211_IOCTL_GETKEY, &wk, sizeof(wk))) {
@@ -600,13 +600,13 @@ atheros_get_seqnum(const char *ifname, void *priv, const u8 *addr, int idx,
 #define WPA_KEY_RSC_LEN 8
 #endif
 		u8 tmp[WPA_KEY_RSC_LEN];
-		memcpy(tmp, &wk.ik_keytsc, sizeof(wk.ik_keytsc));
+		os_memcpy(tmp, &wk.ik_keytsc, sizeof(wk.ik_keytsc));
 		for (i = 0; i < WPA_KEY_RSC_LEN; i++) {
 			seq[i] = tmp[WPA_KEY_RSC_LEN - i - 1];
 		}
 	}
 #else /* WORDS_BIGENDIAN */
-	memcpy(seq, &wk.ik_keytsc, sizeof(wk.ik_keytsc));
+	os_memcpy(seq, &wk.ik_keytsc, sizeof(wk.ik_keytsc));
 #endif /* WORDS_BIGENDIAN */
 	return 0;
 }
@@ -616,7 +616,7 @@ static int
 atheros_flush(void *priv)
 {
 	u8 allsta[IEEE80211_ADDR_LEN];
-	memset(allsta, 0xff, IEEE80211_ADDR_LEN);
+	os_memset(allsta, 0xff, IEEE80211_ADDR_LEN);
 	return atheros_sta_deauth(priv, NULL, allsta,
 				  IEEE80211_REASON_AUTH_LEAVE);
 }
@@ -629,19 +629,19 @@ atheros_read_sta_driver_data(void *priv, struct hostap_sta_driver_data *data,
 	struct atheros_driver_data *drv = priv;
 	struct ieee80211req_sta_stats stats;
 
-	memset(data, 0, sizeof(*data));
+	os_memset(data, 0, sizeof(*data));
 
 	/*
 	 * Fetch statistics for station from the system.
 	 */
-	memset(&stats, 0, sizeof(stats));
-	memcpy(stats.is_u.macaddr, addr, IEEE80211_ADDR_LEN);
+	os_memset(&stats, 0, sizeof(stats));
+	os_memcpy(stats.is_u.macaddr, addr, IEEE80211_ADDR_LEN);
 	if (set80211priv(drv, IEEE80211_IOCTL_STA_STATS,
 			 &stats, sizeof(stats))) {
 		wpa_printf(MSG_DEBUG, "%s: Failed to fetch STA stats (addr "
 			   MACSTR ")", __func__, MAC2STR(addr));
-		if (memcmp(addr, drv->acct_mac, ETH_ALEN) == 0) {
-			memcpy(data, &drv->acct_data, sizeof(*data));
+		if (os_memcmp(addr, drv->acct_mac, ETH_ALEN) == 0) {
+			os_memcpy(data, &drv->acct_data, sizeof(*data));
 			return 0;
 		}
 
@@ -668,7 +668,7 @@ atheros_sta_clear_stats(void *priv, const u8 *addr)
 	wpa_printf(MSG_DEBUG, "%s: addr=%s", __func__, ether_sprintf(addr));
 
 	mlme.im_op = IEEE80211_MLME_CLEAR_STATS;
-	memcpy(mlme.im_macaddr, addr, IEEE80211_ADDR_LEN);
+	os_memcpy(mlme.im_macaddr, addr, IEEE80211_ADDR_LEN);
 	ret = set80211priv(drv, IEEE80211_IOCTL_SETMLME, &mlme,
 			   sizeof(mlme));
 	if (ret < 0) {
@@ -744,7 +744,7 @@ atheros_sta_deauth(void *priv, const u8 *own_addr, const u8 *addr,
 
 	mlme.im_op = IEEE80211_MLME_DEAUTH;
 	mlme.im_reason = reason_code;
-	memcpy(mlme.im_macaddr, addr, IEEE80211_ADDR_LEN);
+	os_memcpy(mlme.im_macaddr, addr, IEEE80211_ADDR_LEN);
 	ret = set80211priv(drv, IEEE80211_IOCTL_SETMLME, &mlme, sizeof(mlme));
 	if (ret < 0) {
 		wpa_printf(MSG_DEBUG, "%s: Failed to deauth STA (addr " MACSTR
@@ -768,7 +768,7 @@ atheros_sta_disassoc(void *priv, const u8 *own_addr, const u8 *addr,
 
 	mlme.im_op = IEEE80211_MLME_DISASSOC;
 	mlme.im_reason = reason_code;
-	memcpy(mlme.im_macaddr, addr, IEEE80211_ADDR_LEN);
+	os_memcpy(mlme.im_macaddr, addr, IEEE80211_ADDR_LEN);
 	ret = set80211priv(drv, IEEE80211_IOCTL_SETMLME, &mlme, sizeof(mlme));
 	if (ret < 0) {
 		wpa_printf(MSG_DEBUG, "%s: Failed to disassoc STA (addr "
@@ -794,7 +794,7 @@ static int atheros_set_qos_map(void *ctx, const u8 *qos_map_set,
 		wpa_printf(MSG_ERROR, "Invalid QoS Map");
 		return -1;
 	} else {
-		memset(&req, 0, sizeof(struct ieee80211req_athdbg));
+		os_memset(&req, 0, sizeof(struct ieee80211req_athdbg));
 		req.cmd = IEEE80211_DBGREQ_SETQOSMAPCONF;
 		os_memset(&iwr, 0, sizeof(iwr));
 		os_strlcpy(iwr.ifr_name, drv->iface, sizeof(iwr.ifr_name));
@@ -855,20 +855,29 @@ static void atheros_raw_receive(void *ctx, const u8 *src_addr, const u8 *buf,
 		   (int) len);
 
 	if (stype == WLAN_FC_STYPE_PROBE_REQ) {
-		if (len < IEEE80211_HDRLEN + sizeof(mgmt->u.probe_req))
+		if (len < IEEE80211_HDRLEN)
 			return;
 
 		os_memset(&event, 0, sizeof(event));
 		event.rx_probe_req.sa = mgmt->sa;
 		event.rx_probe_req.da = mgmt->da;
 		event.rx_probe_req.bssid = mgmt->bssid;
-		event.rx_probe_req.ie = mgmt->u.probe_req.variable;
-		event.rx_probe_req.ie_len =
-			len - (IEEE80211_HDRLEN + sizeof(mgmt->u.probe_req));
+		event.rx_probe_req.ie = buf + IEEE80211_HDRLEN;
+		event.rx_probe_req.ie_len = len - IEEE80211_HDRLEN;
 		wpa_supplicant_event(drv->hapd, EVENT_RX_PROBE_REQ, &event);
 		return;
 	}
 
+	if (stype == WLAN_FC_STYPE_ACTION &&
+	    (os_memcmp(drv->own_addr, mgmt->bssid, ETH_ALEN) == 0 ||
+	     is_broadcast_ether_addr(mgmt->bssid))) {
+		os_memset(&event, 0, sizeof(event));
+		event.rx_mgmt.frame = buf;
+		event.rx_mgmt.frame_len = len;
+		wpa_supplicant_event(drv->hapd, EVENT_RX_MGMT, &event);
+		return;
+	}
+
 	if (os_memcmp(drv->own_addr, mgmt->bssid, ETH_ALEN) != 0) {
 		wpa_printf(MSG_DEBUG, "%s: BSSID does not match - ignore",
 			   __func__);
@@ -890,12 +899,6 @@ static void atheros_raw_receive(void *ctx, const u8 *src_addr, const u8 *buf,
 		iebuf = mgmt->u.reassoc_req.variable;
 		drv_event_assoc(drv->hapd, mgmt->sa, iebuf, ielen, 1);
 		break;
-	case WLAN_FC_STYPE_ACTION:
-		os_memset(&event, 0, sizeof(event));
-		event.rx_mgmt.frame = buf;
-		event.rx_mgmt.frame_len = len;
-		wpa_supplicant_event(drv->hapd, EVENT_RX_MGMT, &event);
-		break;
 	case WLAN_FC_STYPE_AUTH:
 		if (len < IEEE80211_HDRLEN + sizeof(mgmt->u.auth))
 			break;
@@ -1120,8 +1123,8 @@ atheros_new_sta(struct atheros_driver_data *drv, u8 addr[IEEE80211_ADDR_LEN])
 	/*
 	 * Fetch negotiated WPA/RSN parameters from the system.
 	 */
-	memset(&ie, 0, sizeof(ie));
-	memcpy(ie.wpa_macaddr, addr, IEEE80211_ADDR_LEN);
+	os_memset(&ie, 0, sizeof(ie));
+	os_memcpy(ie.wpa_macaddr, addr, IEEE80211_ADDR_LEN);
 	if (set80211priv(drv, IEEE80211_IOCTL_GETWPAIE, &ie, sizeof(ie))) {
 		/*
 		 * See ATH_WPS_IE comment in the beginning of the file for a
@@ -1171,10 +1174,10 @@ atheros_new_sta(struct atheros_driver_data *drv, u8 addr[IEEE80211_ADDR_LEN])
 no_ie:
 	drv_event_assoc(hapd, addr, iebuf, ielen, 0);
 
-	if (memcmp(addr, drv->acct_mac, ETH_ALEN) == 0) {
+	if (os_memcmp(addr, drv->acct_mac, ETH_ALEN) == 0) {
 		/* Cached accounting data is not valid anymore. */
-		memset(drv->acct_mac, 0, ETH_ALEN);
-		memset(&drv->acct_data, 0, sizeof(drv->acct_data));
+		os_memset(drv->acct_mac, 0, ETH_ALEN);
+		os_memset(&drv->acct_data, 0, sizeof(drv->acct_data));
 	}
 }
 
@@ -1185,10 +1188,10 @@ atheros_wireless_event_wireless_custom(struct atheros_driver_data *drv,
 #define MGMT_FRAM_TAG_SIZE 30 /* hardcoded in driver */
 	wpa_printf(MSG_DEBUG, "Custom wireless event: '%s'", custom);
 
-	if (strncmp(custom, "MLME-MICHAELMICFAILURE.indication", 33) == 0) {
+	if (os_strncmp(custom, "MLME-MICHAELMICFAILURE.indication", 33) == 0) {
 		char *pos;
 		u8 addr[ETH_ALEN];
-		pos = strstr(custom, "addr=");
+		pos = os_strstr(custom, "addr=");
 		if (pos == NULL) {
 			wpa_printf(MSG_DEBUG,
 				   "MLME-MICHAELMICFAILURE.indication "
@@ -1212,33 +1215,33 @@ atheros_wireless_event_wireless_custom(struct atheros_driver_data *drv,
 		char *key, *value;
 		u32 val;
 		key = custom;
-		while ((key = strchr(key, '\n')) != NULL) {
+		while ((key = os_strchr(key, '\n')) != NULL) {
 			key++;
-			value = strchr(key, '=');
+			value = os_strchr(key, '=');
 			if (value == NULL)
 				continue;
 			*value++ = '\0';
 			val = strtoul(value, NULL, 10);
-			if (strcmp(key, "mac") == 0)
+			if (os_strcmp(key, "mac") == 0)
 				hwaddr_aton(value, drv->acct_mac);
-			else if (strcmp(key, "rx_packets") == 0)
+			else if (os_strcmp(key, "rx_packets") == 0)
 				drv->acct_data.rx_packets = val;
-			else if (strcmp(key, "tx_packets") == 0)
+			else if (os_strcmp(key, "tx_packets") == 0)
 				drv->acct_data.tx_packets = val;
-			else if (strcmp(key, "rx_bytes") == 0)
+			else if (os_strcmp(key, "rx_bytes") == 0)
 				drv->acct_data.rx_bytes = val;
-			else if (strcmp(key, "tx_bytes") == 0)
+			else if (os_strcmp(key, "tx_bytes") == 0)
 				drv->acct_data.tx_bytes = val;
 			key = value;
 		}
 #ifdef CONFIG_WPS
-	} else if (strncmp(custom, "PUSH-BUTTON.indication", 22) == 0) {
+	} else if (os_strncmp(custom, "PUSH-BUTTON.indication", 22) == 0) {
 		/* Some atheros kernels send push button as a wireless event */
 		/* PROBLEM! this event is received for ALL BSSs ...
 		 * so all are enabled for WPS... ugh.
 		 */
 		wpa_supplicant_event(drv->hapd, EVENT_WPS_BUTTON_PUSHED, NULL);
-	} else if (strncmp(custom, "Manage.prob_req ", 16) == 0) {
+	} else if (os_strncmp(custom, "Manage.prob_req ", 16) == 0) {
 		/*
 		 * Atheros driver uses a hack to pass Probe Request frames as a
 		 * binary data in the custom wireless event. The old way (using
@@ -1246,7 +1249,7 @@ atheros_wireless_event_wireless_custom(struct atheros_driver_data *drv,
 		 * Format: "Manage.prob_req <frame len>" | zero padding | frame
 		 */
 		int len = atoi(custom + 16);
-		if (len < 0 || custom + MGMT_FRAM_TAG_SIZE + len > end) {
+		if (len < 0 || MGMT_FRAM_TAG_SIZE + len > end - custom) {
 			wpa_printf(MSG_DEBUG, "Invalid Manage.prob_req event "
 				   "length %d", len);
 			return;
@@ -1255,11 +1258,11 @@ atheros_wireless_event_wireless_custom(struct atheros_driver_data *drv,
 				    (u8 *) custom + MGMT_FRAM_TAG_SIZE, len);
 #endif /* CONFIG_WPS */
 #if defined(CONFIG_IEEE80211R) || defined(CONFIG_IEEE80211W)
-	} else if (strncmp(custom, "Manage.assoc_req ", 17) == 0) {
+	} else if (os_strncmp(custom, "Manage.assoc_req ", 17) == 0) {
 		/* Format: "Manage.assoc_req <frame len>" | zero padding |
 		 * frame */
 		int len = atoi(custom + 17);
-		if (len < 0 || custom + MGMT_FRAM_TAG_SIZE + len > end) {
+		if (len < 0 || MGMT_FRAM_TAG_SIZE + len > end - custom) {
 			wpa_printf(MSG_DEBUG,
 				   "Invalid Manage.assoc_req event length %d",
 				   len);
@@ -1267,11 +1270,11 @@ atheros_wireless_event_wireless_custom(struct atheros_driver_data *drv,
 		}
 		atheros_raw_receive(drv, NULL,
 				    (u8 *) custom + MGMT_FRAM_TAG_SIZE, len);
-		} else if (strncmp(custom, "Manage.auth ", 12) == 0) {
+		} else if (os_strncmp(custom, "Manage.auth ", 12) == 0) {
 		/* Format: "Manage.auth <frame len>" | zero padding | frame */
 		int len = atoi(custom + 12);
 			if (len < 0 ||
-			    custom + MGMT_FRAM_TAG_SIZE + len > end) {
+			    MGMT_FRAM_TAG_SIZE + len > end - custom) {
 			wpa_printf(MSG_DEBUG,
 				   "Invalid Manage.auth event length %d", len);
 			return;
@@ -1280,11 +1283,11 @@ atheros_wireless_event_wireless_custom(struct atheros_driver_data *drv,
 				    (u8 *) custom + MGMT_FRAM_TAG_SIZE, len);
 #endif /* CONFIG_IEEE80211W || CONFIG_IEEE80211R */
 #ifdef ATHEROS_USE_RAW_RECEIVE
-		} else if (strncmp(custom, "Manage.action ", 14) == 0) {
+		} else if (os_strncmp(custom, "Manage.action ", 14) == 0) {
 		/* Format: "Manage.assoc_req <frame len>" | zero padding | frame
 		 */
 		int len = atoi(custom + 14);
-		if (len < 0 || custom + MGMT_FRAM_TAG_SIZE + len > end) {
+		if (len < 0 || MGMT_FRAM_TAG_SIZE + len > end - custom) {
 			wpa_printf(MSG_DEBUG,
 				   "Invalid Manage.action event length %d",
 				   len);
@@ -1384,7 +1387,7 @@ atheros_wireless_event_atheros_custom(struct atheros_driver_data *drv,
 
 static void
 atheros_wireless_event_wireless(struct atheros_driver_data *drv,
-				char *data, int len)
+				char *data, unsigned int len)
 {
 	struct iw_event iwe_buf, *iwe = &iwe_buf;
 	char *pos, *end, *custom, *buf;
@@ -1392,13 +1395,13 @@ atheros_wireless_event_wireless(struct atheros_driver_data *drv,
 	pos = data;
 	end = data + len;
 
-	while (pos + IW_EV_LCP_LEN <= end) {
+	while ((size_t) (end - pos) >= IW_EV_LCP_LEN) {
 		/* Event data may be unaligned, so make a local, aligned copy
 		 * before processing. */
-		memcpy(&iwe_buf, pos, IW_EV_LCP_LEN);
+		os_memcpy(&iwe_buf, pos, IW_EV_LCP_LEN);
 		wpa_printf(MSG_MSGDUMP, "Wireless event: cmd=0x%x len=%d",
 			   iwe->cmd, iwe->len);
-		if (iwe->len <= IW_EV_LCP_LEN)
+		if (iwe->len <= IW_EV_LCP_LEN || iwe->len > end - pos)
 			return;
 
 		custom = pos + IW_EV_POINT_LEN;
@@ -1409,10 +1412,10 @@ atheros_wireless_event_wireless(struct atheros_driver_data *drv,
 			/* WE-19 removed the pointer from struct iw_point */
 			char *dpos = (char *) &iwe_buf.u.data.length;
 			int dlen = dpos - (char *) &iwe_buf;
-			memcpy(dpos, pos + IW_EV_LCP_LEN,
-			       sizeof(struct iw_event) - dlen);
+			os_memcpy(dpos, pos + IW_EV_LCP_LEN,
+				  sizeof(struct iw_event) - dlen);
 		} else {
-			memcpy(&iwe_buf, pos, sizeof(struct iw_event));
+			os_memcpy(&iwe_buf, pos, sizeof(struct iw_event));
 			custom += IW_EV_POINT_OFF;
 		}
 
@@ -1430,12 +1433,12 @@ atheros_wireless_event_wireless(struct atheros_driver_data *drv,
 			 * just like IWEVCUSTOM.
 			 */
 		case IWEVCUSTOM:
-			if (custom + iwe->u.data.length > end)
+			if (iwe->u.data.length > end - custom)
 				return;
-			buf = malloc(iwe->u.data.length + 1);
+			buf = os_malloc(iwe->u.data.length + 1);
 			if (buf == NULL)
 				return;		/* XXX */
-			memcpy(buf, custom, iwe->u.data.length);
+			os_memcpy(buf, custom, iwe->u.data.length);
 			buf[iwe->u.data.length] = '\0';
 
 			if (iwe->u.data.flags != 0) {
@@ -1446,7 +1449,7 @@ atheros_wireless_event_wireless(struct atheros_driver_data *drv,
 				atheros_wireless_event_wireless_custom(
 					drv, buf, buf + iwe->u.data.length);
 			}
-			free(buf);
+			os_free(buf);
 			break;
 		}
 
@@ -1500,7 +1503,7 @@ atheros_get_we_version(struct atheros_driver_data *drv)
 	if (range == NULL)
 		return -1;
 
-	memset(&iwr, 0, sizeof(iwr));
+	os_memset(&iwr, 0, sizeof(iwr));
 	os_strlcpy(iwr.ifr_name, drv->iface, IFNAMSIZ);
 	iwr.u.data.pointer = (caddr_t) range;
 	iwr.u.data.length = buflen;
@@ -1569,7 +1572,7 @@ atheros_send_eapol(void *priv, const u8 *addr, const u8 *data, size_t data_len,
 	 */
 	len = data_len + sizeof(struct l2_ethhdr);
 	if (len > sizeof(buf)) {
-		bp = malloc(len);
+		bp = os_malloc(len);
 		if (bp == NULL) {
 			wpa_printf(MSG_INFO,
 				   "EAPOL frame discarded, cannot malloc temp buffer of size %lu!",
@@ -1578,17 +1581,17 @@ atheros_send_eapol(void *priv, const u8 *addr, const u8 *data, size_t data_len,
 		}
 	}
 	eth = (struct l2_ethhdr *) bp;
-	memcpy(eth->h_dest, addr, ETH_ALEN);
-	memcpy(eth->h_source, own_addr, ETH_ALEN);
+	os_memcpy(eth->h_dest, addr, ETH_ALEN);
+	os_memcpy(eth->h_source, own_addr, ETH_ALEN);
 	eth->h_proto = host_to_be16(ETH_P_EAPOL);
-	memcpy(eth+1, data, data_len);
+	os_memcpy(eth + 1, data, data_len);
 
 	wpa_hexdump(MSG_MSGDUMP, "TX EAPOL", bp, len);
 
 	status = l2_packet_send(drv->sock_xmit, addr, ETH_P_EAPOL, bp, len);
 
 	if (bp != buf)
-		free(bp);
+		os_free(bp);
 	return status;
 }
 
@@ -1622,9 +1625,9 @@ atheros_init(struct hostapd_data *hapd, struct wpa_init_params *params)
 			   strerror(errno));
 		goto bad;
 	}
-	memcpy(drv->iface, params->ifname, sizeof(drv->iface));
+	os_memcpy(drv->iface, params->ifname, sizeof(drv->iface));
 
-	memset(&ifr, 0, sizeof(ifr));
+	os_memset(&ifr, 0, sizeof(ifr));
 	os_strlcpy(ifr.ifr_name, drv->iface, sizeof(ifr.ifr_name));
 	if (ioctl(drv->ioctl_sock, SIOCGIFINDEX, &ifr) != 0) {
 		wpa_printf(MSG_ERROR, "ioctl(SIOCGIFINDEX): %s",
@@ -1658,7 +1661,7 @@ atheros_init(struct hostapd_data *hapd, struct wpa_init_params *params)
 	} else
 		drv->sock_recv = drv->sock_xmit;
 
-	memset(&iwr, 0, sizeof(iwr));
+	os_memset(&iwr, 0, sizeof(iwr));
 	os_strlcpy(iwr.ifr_name, drv->iface, IFNAMSIZ);
 
 	iwr.u.mode = IW_MODE_MASTER;
@@ -1704,10 +1707,10 @@ atheros_deinit(void *priv)
 	atheros_reset_appfilter(drv);
 
 	if (drv->wpa_ie || drv->wps_beacon_ie || drv->wps_probe_resp_ie) {
+		atheros_set_opt_ie(priv, NULL, 0);
 		wpabuf_free(drv->wpa_ie);
 		wpabuf_free(drv->wps_beacon_ie);
 		wpabuf_free(drv->wps_probe_resp_ie);
-		atheros_set_opt_ie(priv, NULL, 0);
 	}
 	netlink_deinit(drv->netlink);
 	(void) linux_set_iface_flags(drv->ioctl_sock, drv->iface, 0);
@@ -1728,7 +1731,7 @@ atheros_set_ssid(void *priv, const u8 *buf, int len)
 	struct atheros_driver_data *drv = priv;
 	struct iwreq iwr;
 
-	memset(&iwr, 0, sizeof(iwr));
+	os_memset(&iwr, 0, sizeof(iwr));
 	os_strlcpy(iwr.ifr_name, drv->iface, IFNAMSIZ);
 	iwr.u.essid.flags = 1; /* SSID active */
 	iwr.u.essid.pointer = (caddr_t) buf;
@@ -1749,7 +1752,7 @@ atheros_get_ssid(void *priv, u8 *buf, int len)
 	struct iwreq iwr;
 	int ret = 0;
 
-	memset(&iwr, 0, sizeof(iwr));
+	os_memset(&iwr, 0, sizeof(iwr));
 	os_strlcpy(iwr.ifr_name, drv->iface, IFNAMSIZ);
 	iwr.u.essid.pointer = (caddr_t) buf;
 	iwr.u.essid.length = (len > IW_ESSID_MAX_SIZE) ?
@@ -1848,7 +1851,8 @@ static int atheros_set_ap(void *priv, struct wpa_driver_ap_params *params)
 #if defined(CONFIG_IEEE80211R) || defined(CONFIG_IEEE80211W)
 
 static int atheros_send_mgmt(void *priv, const u8 *frm, size_t data_len,
-			     int noack, unsigned int freq)
+			     int noack, unsigned int freq,
+			     const u16 *csa_offs, size_t csa_offs_len)
 {
 	struct atheros_driver_data *drv = priv;
 	u8 buf[1510];
@@ -1859,7 +1863,7 @@ static int atheros_send_mgmt(void *priv, const u8 *frm, size_t data_len,
 	wpa_printf(MSG_DEBUG, "%s frmlen = %lu " MACSTR, __func__,
 		   (unsigned long) data_len, MAC2STR(mgmt->da));
 	mgmt_frm = (struct ieee80211req_mgmtbuf *) buf;
-	memcpy(mgmt_frm->macaddr, (u8 *)mgmt->da, IEEE80211_ADDR_LEN);
+	os_memcpy(mgmt_frm->macaddr, (u8 *)mgmt->da, IEEE80211_ADDR_LEN);
 	mgmt_frm->buflen = data_len;
 	if (&mgmt_frm->buf[0] + data_len > buf + sizeof(buf)) {
 		wpa_printf(MSG_INFO, "atheros: Too long frame for "
diff --git a/src/drivers/driver_bsd.c b/src/drivers/driver_bsd.c
index bab1f031d24cd..2afd7df9637db 100644
--- a/src/drivers/driver_bsd.c
+++ b/src/drivers/driver_bsd.c
@@ -47,14 +47,25 @@
 
 #include "l2_packet/l2_packet.h"
 
+struct bsd_driver_global {
+	void		*ctx;
+	int		sock;			/* socket for 802.11 ioctls */
+	int		route;			/* routing socket for events */
+	char		*event_buf;
+	size_t		event_buf_len;
+	struct dl_list	ifaces;			/* list of interfaces */
+};
+
 struct bsd_driver_data {
+	struct dl_list	list;
+	struct bsd_driver_global *global;
 	struct hostapd_data *hapd;	/* back pointer */
 
-	int	sock;			/* open socket for 802.11 ioctls */
 	struct l2_packet_data *sock_xmit;/* raw packet xmit socket */
-	int	route;			/* routing socket for events */
 	char	ifname[IFNAMSIZ+1];	/* interface name */
+	int	flags;
 	unsigned int ifindex;		/* interface index */
+	int	if_removed;		/* has the interface been removed? */
 	void	*ctx;
 	struct wpa_driver_capa capa;	/* driver capability */
 	int	is_ap;			/* Access point mode */
@@ -62,18 +73,47 @@ struct bsd_driver_data {
 	int	prev_privacy;	/* privacy state to restore on deinit */
 	int	prev_wpa;	/* wpa state to restore on deinit */
 	enum ieee80211_opmode opmode;	/* operation mode */
-	char	*event_buf;
-	size_t	event_buf_len;
 };
 
 /* Generic functions for hostapd and wpa_supplicant */
 
+static struct bsd_driver_data *
+bsd_get_drvindex(void *priv, unsigned int ifindex)
+{
+	struct bsd_driver_global *global = priv;
+	struct bsd_driver_data *drv;
+
+	dl_list_for_each(drv, &global->ifaces, struct bsd_driver_data, list) {
+		if (drv->ifindex == ifindex)
+			return drv;
+	}
+	return NULL;
+}
+
+#ifndef HOSTAPD
+static struct bsd_driver_data *
+bsd_get_drvname(void *priv, const char *ifname)
+{
+	struct bsd_driver_global *global = priv;
+	struct bsd_driver_data *drv;
+
+	dl_list_for_each(drv, &global->ifaces, struct bsd_driver_data, list) {
+		if (os_strcmp(drv->ifname, ifname) == 0)
+			return drv;
+	}
+	return NULL;
+}
+#endif /* HOSTAPD */
+
 static int
 bsd_set80211(void *priv, int op, int val, const void *arg, int arg_len)
 {
 	struct bsd_driver_data *drv = priv;
 	struct ieee80211req ireq;
 
+	if (drv->ifindex == 0 || drv->if_removed)
+		return -1;
+
 	os_memset(&ireq, 0, sizeof(ireq));
 	os_strlcpy(ireq.i_name, drv->ifname, sizeof(ireq.i_name));
 	ireq.i_type = op;
@@ -81,7 +121,7 @@ bsd_set80211(void *priv, int op, int val, const void *arg, int arg_len)
 	ireq.i_data = (void *) arg;
 	ireq.i_len = arg_len;
 
-	if (ioctl(drv->sock, SIOCS80211, &ireq) < 0) {
+	if (ioctl(drv->global->sock, SIOCS80211, &ireq) < 0) {
 		wpa_printf(MSG_ERROR, "ioctl[SIOCS80211, op=%u, val=%u, "
 			   "arg_len=%u]: %s", op, val, arg_len,
 			   strerror(errno));
@@ -102,7 +142,7 @@ bsd_get80211(void *priv, struct ieee80211req *ireq, int op, void *arg,
 	ireq->i_len = arg_len;
 	ireq->i_data = arg;
 
-	if (ioctl(drv->sock, SIOCG80211, ireq) < 0) {
+	if (ioctl(drv->global->sock, SIOCG80211, ireq) < 0) {
 		wpa_printf(MSG_ERROR, "ioctl[SIOCS80211, op=%u, "
 			   "arg_len=%u]: %s", op, arg_len, strerror(errno));
 		return -1;
@@ -143,7 +183,7 @@ bsd_get_ssid(void *priv, u8 *ssid, int len)
 	os_memset(&ifr, 0, sizeof(ifr));
 	os_strlcpy(ifr.ifr_name, drv->ifname, sizeof(ifr.ifr_name));
 	ifr.ifr_data = (void *)&nwid;
-	if (ioctl(drv->sock, SIOCG80211NWID, &ifr) < 0 ||
+	if (ioctl(drv->global->sock, SIOCG80211NWID, &ifr) < 0 ||
 	    nwid.i_len > IEEE80211_NWID_LEN)
 		return -1;
 	os_memcpy(ssid, nwid.i_nwid, nwid.i_len);
@@ -166,7 +206,7 @@ bsd_set_ssid(void *priv, const u8 *ssid, int ssid_len)
 	os_memset(&ifr, 0, sizeof(ifr));
 	os_strlcpy(ifr.ifr_name, drv->ifname, sizeof(ifr.ifr_name));
 	ifr.ifr_data = (void *)&nwid;
-	return ioctl(drv->sock, SIOCS80211NWID, &ifr);
+	return ioctl(drv->global->sock, SIOCS80211NWID, &ifr);
 #else
 	return set80211var(drv, IEEE80211_IOC_SSID, ssid, ssid_len);
 #endif
@@ -181,7 +221,7 @@ bsd_get_if_media(void *priv)
 	os_memset(&ifmr, 0, sizeof(ifmr));
 	os_strlcpy(ifmr.ifm_name, drv->ifname, sizeof(ifmr.ifm_name));
 
-	if (ioctl(drv->sock, SIOCGIFMEDIA, &ifmr) < 0) {
+	if (ioctl(drv->global->sock, SIOCGIFMEDIA, &ifmr) < 0) {
 		wpa_printf(MSG_ERROR, "%s: SIOCGIFMEDIA %s", __func__,
 			   strerror(errno));
 		return -1;
@@ -200,7 +240,7 @@ bsd_set_if_media(void *priv, int media)
 	os_strlcpy(ifr.ifr_name, drv->ifname, sizeof(ifr.ifr_name));
 	ifr.ifr_media = media;
 
-	if (ioctl(drv->sock, SIOCSIFMEDIA, &ifr) < 0) {
+	if (ioctl(drv->global->sock, SIOCSIFMEDIA, &ifr) < 0) {
 		wpa_printf(MSG_ERROR, "%s: SIOCSIFMEDIA %s", __func__,
 			   strerror(errno));
 		return -1;
@@ -263,11 +303,12 @@ bsd_ctrl_iface(void *priv, int enable)
 	os_memset(&ifr, 0, sizeof(ifr));
 	os_strlcpy(ifr.ifr_name, drv->ifname, sizeof(ifr.ifr_name));
 
-	if (ioctl(drv->sock, SIOCGIFFLAGS, &ifr) < 0) {
+	if (ioctl(drv->global->sock, SIOCGIFFLAGS, &ifr) < 0) {
 		wpa_printf(MSG_ERROR, "ioctl[SIOCGIFFLAGS]: %s",
 			   strerror(errno));
 		return -1;
 	}
+	drv->flags = ifr.ifr_flags;
 
 	if (enable) {
 		if (ifr.ifr_flags & IFF_UP)
@@ -279,12 +320,13 @@ bsd_ctrl_iface(void *priv, int enable)
 		ifr.ifr_flags &= ~IFF_UP;
 	}
 
-	if (ioctl(drv->sock, SIOCSIFFLAGS, &ifr) < 0) {
+	if (ioctl(drv->global->sock, SIOCSIFFLAGS, &ifr) < 0) {
 		wpa_printf(MSG_ERROR, "ioctl[SIOCSIFFLAGS]: %s",
 			   strerror(errno));
 		return -1;
 	}
 
+	drv->flags = ifr.ifr_flags;
 	return 0;
 }
 
@@ -576,7 +618,7 @@ bsd_set_freq(void *priv, struct hostapd_freq_params *freq)
 	os_memset(&creq, 0, sizeof(creq));
 	os_strlcpy(creq.i_name, drv->ifname, sizeof(creq.i_name));
 	creq.i_channel = (u_int16_t)channel;
-	return ioctl(drv->sock, SIOCS80211CHANNEL, &creq);
+	return ioctl(drv->global->sock, SIOCS80211CHANNEL, &creq);
 #else /* SIOCS80211CHANNEL */
 	return set80211param(priv, IEEE80211_IOC_CHANNEL, channel);
 #endif /* SIOCS80211CHANNEL */
@@ -730,7 +772,8 @@ bsd_sta_disassoc(void *priv, const u8 *own_addr, const u8 *addr,
 static void
 bsd_wireless_event_receive(int sock, void *ctx, void *sock_ctx)
 {
-	struct bsd_driver_data *drv = ctx;
+	struct bsd_driver_global *global = sock_ctx;
+	struct bsd_driver_data *drv;
 	struct if_announcemsghdr *ifan;
 	struct rt_msghdr *rtm;
 	struct ieee80211_michael_event *mic;
@@ -739,7 +782,7 @@ bsd_wireless_event_receive(int sock, void *ctx, void *sock_ctx)
 	int n;
 	union wpa_event_data data;
 
-	n = read(sock, drv->event_buf, drv->event_buf_len);
+	n = read(sock, global->event_buf, global->event_buf_len);
 	if (n < 0) {
 		if (errno != EINTR && errno != EAGAIN)
 			wpa_printf(MSG_ERROR, "%s read() failed: %s",
@@ -747,15 +790,18 @@ bsd_wireless_event_receive(int sock, void *ctx, void *sock_ctx)
 		return;
 	}
 
-	rtm = (struct rt_msghdr *) drv->event_buf;
+	rtm = (struct rt_msghdr *) global->event_buf;
 	if (rtm->rtm_version != RTM_VERSION) {
 		wpa_printf(MSG_DEBUG, "Invalid routing message version=%d",
 			   rtm->rtm_version);
 		return;
 	}
-	ifan = (struct if_announcemsghdr *) rtm;
 	switch (rtm->rtm_type) {
 	case RTM_IEEE80211:
+		ifan = (struct if_announcemsghdr *) rtm;
+		drv = bsd_get_drvindex(global, ifan->ifan_index);
+		if (drv == NULL)
+			return;
 		switch (ifan->ifan_what) {
 		case RTM_IEEE80211_ASSOC:
 		case RTM_IEEE80211_REASSOC:
@@ -811,21 +857,15 @@ bsd_init(struct hostapd_data *hapd, struct wpa_init_params *params)
 		return NULL;
 	}
 
-	drv->event_buf_len = rtbuf_len();
-
-	drv->event_buf = os_malloc(drv->event_buf_len);
-	if (drv->event_buf == NULL) {
-		wpa_printf(MSG_ERROR, "%s: os_malloc() failed", __func__);
+	drv->ifindex = if_nametoindex(params->ifname);
+	if (drv->ifindex == 0) {
+		wpa_printf(MSG_DEBUG, "%s: interface %s does not exist",
+			   __func__, params->ifname);
 		goto bad;
 	}
 
 	drv->hapd = hapd;
-	drv->sock = socket(PF_INET, SOCK_DGRAM, 0);
-	if (drv->sock < 0) {
-		wpa_printf(MSG_ERROR, "socket[PF_INET,SOCK_DGRAM]: %s",
-			   strerror(errno));
-		goto bad;
-	}
+	drv->global = params->global_priv;
 	os_strlcpy(drv->ifname, params->ifname, sizeof(drv->ifname));
 
 	drv->sock_xmit = l2_packet_init(drv->ifname, NULL, ETH_P_EAPOL,
@@ -839,28 +879,18 @@ bsd_init(struct hostapd_data *hapd, struct wpa_init_params *params)
 	if (bsd_ctrl_iface(drv, 0) < 0)
 		goto bad;
 
-	drv->route = socket(PF_ROUTE, SOCK_RAW, 0);
-	if (drv->route < 0) {
-		wpa_printf(MSG_ERROR, "socket(PF_ROUTE,SOCK_RAW): %s",
-			   strerror(errno));
-		goto bad;
-	}
-	eloop_register_read_sock(drv->route, bsd_wireless_event_receive, drv,
-				 NULL);
-
 	if (bsd_set_mediaopt(drv, IFM_OMASK, IFM_IEEE80211_HOSTAP) < 0) {
 		wpa_printf(MSG_ERROR, "%s: failed to set operation mode",
 			   __func__);
 		goto bad;
 	}
 
+	dl_list_add(&drv->global->ifaces, &drv->list);
+
 	return drv;
 bad:
 	if (drv->sock_xmit != NULL)
 		l2_packet_deinit(drv->sock_xmit);
-	if (drv->sock >= 0)
-		close(drv->sock);
-	os_free(drv->event_buf);
 	os_free(drv);
 	return NULL;
 }
@@ -871,16 +901,10 @@ bsd_deinit(void *priv)
 {
 	struct bsd_driver_data *drv = priv;
 
-	if (drv->route >= 0) {
-		eloop_unregister_read_sock(drv->route);
-		close(drv->route);
-	}
-	bsd_ctrl_iface(drv, 0);
-	if (drv->sock >= 0)
-		close(drv->sock);
+	if (drv->ifindex != 0)
+		bsd_ctrl_iface(drv, 0);
 	if (drv->sock_xmit != NULL)
 		l2_packet_deinit(drv->sock_xmit);
-	os_free(drv->event_buf);
 	os_free(drv);
 }
 
@@ -932,7 +956,7 @@ wpa_driver_bsd_get_bssid(void *priv, u8 *bssid)
 	struct ieee80211_bssid bs;
 
 	os_strlcpy(bs.i_name, drv->ifname, sizeof(bs.i_name));
-	if (ioctl(drv->sock, SIOCG80211BSSID, &bs) < 0)
+	if (ioctl(drv->global->sock, SIOCG80211BSSID, &bs) < 0)
 		return -1;
 	os_memcpy(bssid, bs.i_bssid, sizeof(bs.i_bssid));
 	return 0;
@@ -966,7 +990,7 @@ wpa_driver_bsd_set_wpa_internal(void *priv, int wpa, int privacy)
 	int ret = 0;
 
 	wpa_printf(MSG_DEBUG, "%s: wpa=%d privacy=%d",
-		__FUNCTION__, wpa, privacy);
+		__func__, wpa, privacy);
 
 	if (!wpa && wpa_driver_bsd_set_wpa_ie(priv, NULL, 0) < 0)
 		ret = -1;
@@ -981,7 +1005,7 @@ wpa_driver_bsd_set_wpa_internal(void *priv, int wpa, int privacy)
 static int
 wpa_driver_bsd_set_wpa(void *priv, int enabled)
 {
-	wpa_printf(MSG_DEBUG, "%s: enabled=%d", __FUNCTION__, enabled);
+	wpa_printf(MSG_DEBUG, "%s: enabled=%d", __func__, enabled);
 
 	return wpa_driver_bsd_set_wpa_internal(priv, enabled ? 3 : 0, enabled);
 }
@@ -1186,7 +1210,8 @@ wpa_driver_bsd_scan(void *priv, struct wpa_driver_scan_params *params)
 static void
 wpa_driver_bsd_event_receive(int sock, void *ctx, void *sock_ctx)
 {
-	struct bsd_driver_data *drv = sock_ctx;
+	struct bsd_driver_global *global = sock_ctx;
+	struct bsd_driver_data *drv;
 	struct if_announcemsghdr *ifan;
 	struct if_msghdr *ifm;
 	struct rt_msghdr *rtm;
@@ -1196,7 +1221,7 @@ wpa_driver_bsd_event_receive(int sock, void *ctx, void *sock_ctx)
 	struct ieee80211_join_event *join;
 	int n;
 
-	n = read(sock, drv->event_buf, drv->event_buf_len);
+	n = read(sock, global->event_buf, global->event_buf_len);
 	if (n < 0) {
 		if (errno != EINTR && errno != EAGAIN)
 			wpa_printf(MSG_ERROR, "%s read() failed: %s",
@@ -1204,7 +1229,7 @@ wpa_driver_bsd_event_receive(int sock, void *ctx, void *sock_ctx)
 		return;
 	}
 
-	rtm = (struct rt_msghdr *) drv->event_buf;
+	rtm = (struct rt_msghdr *) global->event_buf;
 	if (rtm->rtm_version != RTM_VERSION) {
 		wpa_printf(MSG_DEBUG, "Invalid routing message version=%d",
 			   rtm->rtm_version);
@@ -1214,53 +1239,79 @@ wpa_driver_bsd_event_receive(int sock, void *ctx, void *sock_ctx)
 	switch (rtm->rtm_type) {
 	case RTM_IFANNOUNCE:
 		ifan = (struct if_announcemsghdr *) rtm;
-		if (ifan->ifan_index != drv->ifindex)
-			break;
-		os_strlcpy(event.interface_status.ifname, drv->ifname,
-			   sizeof(event.interface_status.ifname));
 		switch (ifan->ifan_what) {
 		case IFAN_DEPARTURE:
+			drv = bsd_get_drvindex(global, ifan->ifan_index);
+			if (drv)
+				drv->if_removed = 1;
 			event.interface_status.ievent = EVENT_INTERFACE_REMOVED;
+			break;
+		case IFAN_ARRIVAL:
+			drv = bsd_get_drvname(global, ifan->ifan_name);
+			if (drv) {
+				drv->ifindex = ifan->ifan_index;
+				drv->if_removed = 0;
+			}
+			event.interface_status.ievent = EVENT_INTERFACE_ADDED;
+			break;
 		default:
+			wpa_printf(MSG_DEBUG, "RTM_IFANNOUNCE: unknown action");
 			return;
 		}
 		wpa_printf(MSG_DEBUG, "RTM_IFANNOUNCE: Interface '%s' %s",
-			   event.interface_status.ifname,
+			   ifan->ifan_name,
 			   ifan->ifan_what == IFAN_DEPARTURE ?
 				"removed" : "added");
-		wpa_supplicant_event(ctx, EVENT_INTERFACE_STATUS, &event);
+		os_strlcpy(event.interface_status.ifname, ifan->ifan_name,
+			   sizeof(event.interface_status.ifname));
+		if (drv) {
+			wpa_supplicant_event(drv->ctx, EVENT_INTERFACE_STATUS,
+					     &event);
+			/*
+			 * Set ifindex to zero after sending the event as the
+			 * event might query the driver to ensure a match.
+			 */
+			if (ifan->ifan_what == IFAN_DEPARTURE)
+				drv->ifindex = 0;
+		} else {
+			wpa_supplicant_event_global(global->ctx,
+						    EVENT_INTERFACE_STATUS,
+						    &event);
+		}
 		break;
 	case RTM_IEEE80211:
 		ifan = (struct if_announcemsghdr *) rtm;
-		if (ifan->ifan_index != drv->ifindex)
-			break;
+		drv = bsd_get_drvindex(global, ifan->ifan_index);
+		if (drv == NULL)
+			return;
 		switch (ifan->ifan_what) {
 		case RTM_IEEE80211_ASSOC:
 		case RTM_IEEE80211_REASSOC:
 			if (drv->is_ap)
 				break;
-			wpa_supplicant_event(ctx, EVENT_ASSOC, NULL);
+			wpa_supplicant_event(drv->ctx, EVENT_ASSOC, NULL);
 			break;
 		case RTM_IEEE80211_DISASSOC:
 			if (drv->is_ap)
 				break;
-			wpa_supplicant_event(ctx, EVENT_DISASSOC, NULL);
+			wpa_supplicant_event(drv->ctx, EVENT_DISASSOC, NULL);
 			break;
 		case RTM_IEEE80211_SCAN:
 			if (drv->is_ap)
 				break;
-			wpa_supplicant_event(ctx, EVENT_SCAN_RESULTS, NULL);
+			wpa_supplicant_event(drv->ctx, EVENT_SCAN_RESULTS,
+					     NULL);
 			break;
 		case RTM_IEEE80211_LEAVE:
 			leave = (struct ieee80211_leave_event *) &ifan[1];
-			drv_event_disassoc(ctx, leave->iev_addr);
+			drv_event_disassoc(drv->ctx, leave->iev_addr);
 			break;
 		case RTM_IEEE80211_JOIN:
 #ifdef RTM_IEEE80211_REJOIN
 		case RTM_IEEE80211_REJOIN:
 #endif
 			join = (struct ieee80211_join_event *) &ifan[1];
-			bsd_new_sta(drv, ctx, join->iev_addr);
+			bsd_new_sta(drv, drv->ctx, join->iev_addr);
 			break;
 		case RTM_IEEE80211_REPLAY:
 			/* ignore */
@@ -1275,23 +1326,30 @@ wpa_driver_bsd_event_receive(int sock, void *ctx, void *sock_ctx)
 			os_memset(&event, 0, sizeof(event));
 			event.michael_mic_failure.unicast =
 				!IEEE80211_IS_MULTICAST(mic->iev_dst);
-			wpa_supplicant_event(ctx, EVENT_MICHAEL_MIC_FAILURE,
-				&event);
+			wpa_supplicant_event(drv->ctx,
+					     EVENT_MICHAEL_MIC_FAILURE, &event);
 			break;
 		}
 		break;
 	case RTM_IFINFO:
 		ifm = (struct if_msghdr *) rtm;
-		if (ifm->ifm_index != drv->ifindex)
-			break;
-		if ((rtm->rtm_flags & RTF_UP) == 0) {
-			os_strlcpy(event.interface_status.ifname, drv->ifname,
-				   sizeof(event.interface_status.ifname));
-			event.interface_status.ievent = EVENT_INTERFACE_REMOVED;
+		drv = bsd_get_drvindex(global, ifm->ifm_index);
+		if (drv == NULL)
+			return;
+		if ((ifm->ifm_flags & IFF_UP) == 0 &&
+		    (drv->flags & IFF_UP) != 0) {
 			wpa_printf(MSG_DEBUG, "RTM_IFINFO: Interface '%s' DOWN",
-				   event.interface_status.ifname);
-			wpa_supplicant_event(ctx, EVENT_INTERFACE_STATUS, &event);
+				   drv->ifname);
+			wpa_supplicant_event(drv->ctx, EVENT_INTERFACE_DISABLED,
+					     NULL);
+		} else if ((ifm->ifm_flags & IFF_UP) != 0 &&
+		    (drv->flags & IFF_UP) == 0) {
+			wpa_printf(MSG_DEBUG, "RTM_IFINFO: Interface '%s' UP",
+				   drv->ifname);
+			wpa_supplicant_event(drv->ctx, EVENT_INTERFACE_ENABLED,
+					     NULL);
 		}
+		drv->flags = ifm->ifm_flags;
 		break;
 	}
 }
@@ -1318,11 +1376,16 @@ wpa_driver_bsd_add_scan_entry(struct wpa_scan_results *res,
 	result->caps = sr->isr_capinfo;
 	result->qual = sr->isr_rssi;
 	result->noise = sr->isr_noise;
+
+#ifdef __FreeBSD__
 	/*
 	 * the rssi value reported by the kernel is in 0.5dB steps relative to
 	 * the reported noise floor. see ieee80211_node.h for details.
 	 */
 	result->level = sr->isr_rssi / 2 + sr->isr_noise;
+#else
+	result->level = sr->isr_rssi;
+#endif
 
 	pos = (u8 *)(result + 1);
 
@@ -1477,7 +1540,7 @@ get80211opmode(struct bsd_driver_data *drv)
 	(void) memset(&ifmr, 0, sizeof(ifmr));
 	(void) os_strlcpy(ifmr.ifm_name, drv->ifname, sizeof(ifmr.ifm_name));
 
-	if (ioctl(drv->sock, SIOCGIFMEDIA, (caddr_t)&ifmr) >= 0) {
+	if (ioctl(drv->global->sock, SIOCGIFMEDIA, (caddr_t)&ifmr) >= 0) {
 		if (ifmr.ifm_current & IFM_IEEE80211_ADHOC) {
 			if (ifmr.ifm_current & IFM_FLAG0)
 				return IEEE80211_M_AHDEMO;
@@ -1497,7 +1560,7 @@ get80211opmode(struct bsd_driver_data *drv)
 }
 
 static void *
-wpa_driver_bsd_init(void *ctx, const char *ifname)
+wpa_driver_bsd_init(void *ctx, const char *ifname, void *priv)
 {
 #define	GETPARAM(drv, param, v) \
 	(((v) = get80211param(drv, param)) != -1)
@@ -1507,14 +1570,6 @@ wpa_driver_bsd_init(void *ctx, const char *ifname)
 	if (drv == NULL)
 		return NULL;
 
-	drv->event_buf_len = rtbuf_len();
-
-	drv->event_buf = os_malloc(drv->event_buf_len);
-	if (drv->event_buf == NULL) {
-		wpa_printf(MSG_ERROR, "%s: os_malloc() failed", __func__);
-		goto fail1;
-	}
-
 	/*
 	 * NB: We require the interface name be mappable to an index.
 	 *     This implies we do not support having wpa_supplicant
@@ -1525,24 +1580,12 @@ wpa_driver_bsd_init(void *ctx, const char *ifname)
 	if (drv->ifindex == 0) {
 		wpa_printf(MSG_DEBUG, "%s: interface %s does not exist",
 			   __func__, ifname);
-		goto fail1;
-	}
-	drv->sock = socket(PF_INET, SOCK_DGRAM, 0);
-	if (drv->sock < 0)
-		goto fail1;
-
-	os_strlcpy(drv->ifname, ifname, sizeof(drv->ifname));
-	/* Down interface during setup. */
-	if (bsd_ctrl_iface(drv, 0) < 0)
-		goto fail;
-
-	drv->route = socket(PF_ROUTE, SOCK_RAW, 0);
-	if (drv->route < 0)
 		goto fail;
-	eloop_register_read_sock(drv->route,
-		wpa_driver_bsd_event_receive, ctx, drv);
+	}
 
 	drv->ctx = ctx;
+	drv->global = priv;
+	os_strlcpy(drv->ifname, ifname, sizeof(drv->ifname));
 
 	if (!GETPARAM(drv, IEEE80211_IOC_ROAMING, drv->prev_roaming)) {
 		wpa_printf(MSG_DEBUG, "%s: failed to get roaming state: %s",
@@ -1563,13 +1606,15 @@ wpa_driver_bsd_init(void *ctx, const char *ifname)
 	if (wpa_driver_bsd_capa(drv))
 		goto fail;
 
+	/* Down interface during setup. */
+	if (bsd_ctrl_iface(drv, 0) < 0)
+		goto fail;
+
 	drv->opmode = get80211opmode(drv);
+	dl_list_add(&drv->global->ifaces, &drv->list);
 
 	return drv;
 fail:
-	close(drv->sock);
-fail1:
-	os_free(drv->event_buf);
 	os_free(drv);
 	return NULL;
 #undef GETPARAM
@@ -1580,22 +1625,25 @@ wpa_driver_bsd_deinit(void *priv)
 {
 	struct bsd_driver_data *drv = priv;
 
-	wpa_driver_bsd_set_wpa(drv, 0);
-	eloop_unregister_read_sock(drv->route);
+	if (drv->ifindex != 0 && !drv->if_removed) {
+		wpa_driver_bsd_set_wpa(drv, 0);
 
-	/* NB: mark interface down */
-	bsd_ctrl_iface(drv, 0);
+		/* NB: mark interface down */
+		bsd_ctrl_iface(drv, 0);
 
-	wpa_driver_bsd_set_wpa_internal(drv, drv->prev_wpa, drv->prev_privacy);
-	if (set80211param(drv, IEEE80211_IOC_ROAMING, drv->prev_roaming) < 0)
-		wpa_printf(MSG_DEBUG, "%s: failed to restore roaming state",
-			__func__);
+		wpa_driver_bsd_set_wpa_internal(drv, drv->prev_wpa,
+						drv->prev_privacy);
+
+		if (set80211param(drv, IEEE80211_IOC_ROAMING, drv->prev_roaming)
+		    < 0)
+			wpa_printf(MSG_DEBUG,
+				   "%s: failed to restore roaming state",
+				   __func__);
+	}
 
 	if (drv->sock_xmit != NULL)
 		l2_packet_deinit(drv->sock_xmit);
-	(void) close(drv->route);		/* ioctl socket */
-	(void) close(drv->sock);		/* event socket */
-	os_free(drv->event_buf);
+	dl_list_del(&drv->list);
 	os_free(drv);
 }
 
@@ -1609,10 +1657,74 @@ wpa_driver_bsd_get_capa(void *priv, struct wpa_driver_capa *capa)
 }
 #endif /* HOSTAPD */
 
+static void *
+bsd_global_init(void *ctx)
+{
+	struct bsd_driver_global *global;
+
+	global = os_zalloc(sizeof(*global));
+	if (global == NULL)
+		return NULL;
+
+	global->ctx = ctx;
+	dl_list_init(&global->ifaces);
+
+	global->sock = socket(PF_INET, SOCK_DGRAM, 0);
+	if (global->sock < 0) {
+		wpa_printf(MSG_ERROR, "socket[PF_INET,SOCK_DGRAM]: %s",
+			   strerror(errno));
+		goto fail1;
+	}
+
+	global->route = socket(PF_ROUTE, SOCK_RAW, 0);
+	if (global->route < 0) {
+		wpa_printf(MSG_ERROR, "socket[PF_ROUTE,SOCK_RAW]: %s",
+			   strerror(errno));
+		goto fail;
+	}
+
+	global->event_buf_len = rtbuf_len();
+	global->event_buf = os_malloc(global->event_buf_len);
+	if (global->event_buf == NULL) {
+		wpa_printf(MSG_ERROR, "%s: os_malloc() failed", __func__);
+		goto fail;
+	}
+
+#ifdef HOSTAPD
+	eloop_register_read_sock(global->route, bsd_wireless_event_receive,
+				 NULL, global);
+
+#else /* HOSTAPD */
+	eloop_register_read_sock(global->route, wpa_driver_bsd_event_receive,
+				 NULL, global);
+#endif /* HOSTAPD */
+
+	return global;
+
+fail:
+	close(global->sock);
+fail1:
+	os_free(global);
+	return NULL;
+}
+
+static void
+bsd_global_deinit(void *priv)
+{
+	struct bsd_driver_global *global = priv;
+
+	eloop_unregister_read_sock(global->route);
+	(void) close(global->route);
+	(void) close(global->sock);
+	os_free(global);
+}
+
 
 const struct wpa_driver_ops wpa_driver_bsd_ops = {
 	.name			= "bsd",
 	.desc			= "BSD 802.11 support",
+	.global_init		= bsd_global_init,
+	.global_deinit		= bsd_global_deinit,
 #ifdef HOSTAPD
 	.hapd_init		= bsd_init,
 	.hapd_deinit		= bsd_deinit,
@@ -1625,7 +1737,7 @@ const struct wpa_driver_ops wpa_driver_bsd_ops = {
 	.sta_set_flags		= bsd_set_sta_authorized,
 	.commit			= bsd_commit,
 #else /* HOSTAPD */
-	.init			= wpa_driver_bsd_init,
+	.init2			= wpa_driver_bsd_init,
 	.deinit			= wpa_driver_bsd_deinit,
 	.get_bssid		= wpa_driver_bsd_get_bssid,
 	.get_ssid		= wpa_driver_bsd_get_ssid,
diff --git a/src/drivers/driver_common.c b/src/drivers/driver_common.c
index aebea8cf64e37..c7107ba899b0b 100644
--- a/src/drivers/driver_common.c
+++ b/src/drivers/driver_common.c
@@ -80,6 +80,7 @@ const char * event_to_string(enum wpa_event_type event)
 	E2S(NEW_PEER_CANDIDATE);
 	E2S(ACS_CHANNEL_SELECTED);
 	E2S(DFS_CAC_STARTED);
+	E2S(P2P_LO_STOP);
 	}
 
 	return "UNKNOWN";
@@ -183,12 +184,12 @@ wpa_get_wowlan_triggers(const char *wowlan_triggers,
 
 	start = buf;
 	while (*start != '\0') {
-		while (isblank(*start))
+		while (isblank((unsigned char) *start))
 			start++;
 		if (*start == '\0')
 			break;
 		end = start;
-		while (!isblank(*end) && *end != '\0')
+		while (!isblank((unsigned char) *end) && *end != '\0')
 			end++;
 		last = *end == '\0';
 		*end = '\0';
@@ -218,3 +219,55 @@ out:
 	os_free(buf);
 	return triggers;
 }
+
+
+const char * driver_flag_to_string(u64 flag)
+{
+#define DF2S(x) case WPA_DRIVER_FLAGS_ ## x: return #x
+	switch (flag) {
+	DF2S(DRIVER_IE);
+	DF2S(SET_KEYS_AFTER_ASSOC);
+	DF2S(DFS_OFFLOAD);
+	DF2S(4WAY_HANDSHAKE);
+	DF2S(WIRED);
+	DF2S(SME);
+	DF2S(AP);
+	DF2S(SET_KEYS_AFTER_ASSOC_DONE);
+	DF2S(HT_2040_COEX);
+	DF2S(P2P_CONCURRENT);
+	DF2S(P2P_DEDICATED_INTERFACE);
+	DF2S(P2P_CAPABLE);
+	DF2S(AP_TEARDOWN_SUPPORT);
+	DF2S(P2P_MGMT_AND_NON_P2P);
+	DF2S(SANE_ERROR_CODES);
+	DF2S(OFFCHANNEL_TX);
+	DF2S(EAPOL_TX_STATUS);
+	DF2S(DEAUTH_TX_STATUS);
+	DF2S(BSS_SELECTION);
+	DF2S(TDLS_SUPPORT);
+	DF2S(TDLS_EXTERNAL_SETUP);
+	DF2S(PROBE_RESP_OFFLOAD);
+	DF2S(AP_UAPSD);
+	DF2S(INACTIVITY_TIMER);
+	DF2S(AP_MLME);
+	DF2S(SAE);
+	DF2S(OBSS_SCAN);
+	DF2S(IBSS);
+	DF2S(RADAR);
+	DF2S(DEDICATED_P2P_DEVICE);
+	DF2S(QOS_MAPPING);
+	DF2S(AP_CSA);
+	DF2S(MESH);
+	DF2S(ACS_OFFLOAD);
+	DF2S(KEY_MGMT_OFFLOAD);
+	DF2S(TDLS_CHANNEL_SWITCH);
+	DF2S(HT_IBSS);
+	DF2S(VHT_IBSS);
+	DF2S(SUPPORT_HW_MODE_ANY);
+	DF2S(OFFCHANNEL_SIMULTANEOUS);
+	DF2S(FULL_AP_CLIENT_STATE);
+	DF2S(P2P_LISTEN_OFFLOAD);
+	}
+	return "UNKNOWN";
+#undef DF2S
+}
diff --git a/src/drivers/driver_hostap.c b/src/drivers/driver_hostap.c
index a7aa5eff00bd9..517a3bbb5d308 100644
--- a/src/drivers/driver_hostap.c
+++ b/src/drivers/driver_hostap.c
@@ -258,7 +258,8 @@ static int hostap_init_sockets(struct hostap_driver_data *drv, u8 *own_addr)
 
 
 static int hostap_send_mlme(void *priv, const u8 *msg, size_t len, int noack,
-			    unsigned int freq)
+			    unsigned int freq,
+			    const u16 *csa_offs, size_t csa_offs_len)
 {
 	struct hostap_driver_data *drv = priv;
 	struct ieee80211_hdr *hdr = (struct ieee80211_hdr *) msg;
@@ -307,7 +308,7 @@ static int hostap_send_eapol(void *priv, const u8 *addr, const u8 *data,
 	pos += 2;
 	memcpy(pos, data, data_len);
 
-	res = hostap_send_mlme(drv, (u8 *) hdr, len, 0, 0);
+	res = hostap_send_mlme(drv, (u8 *) hdr, len, 0, 0, NULL, 0);
 	if (res < 0) {
 		wpa_printf(MSG_ERROR, "hostap_send_eapol - packet len: %lu - "
 			   "failed: %d (%s)",
@@ -813,7 +814,7 @@ hostapd_wireless_event_wireless_custom(struct hostap_driver_data *drv,
 
 
 static void hostapd_wireless_event_wireless(struct hostap_driver_data *drv,
-					    char *data, int len)
+					    char *data, unsigned int len)
 {
 	struct iw_event iwe_buf, *iwe = &iwe_buf;
 	char *pos, *end, *custom, *buf;
@@ -821,13 +822,13 @@ static void hostapd_wireless_event_wireless(struct hostap_driver_data *drv,
 	pos = data;
 	end = data + len;
 
-	while (pos + IW_EV_LCP_LEN <= end) {
+	while ((size_t) (end - pos) >= IW_EV_LCP_LEN) {
 		/* Event data may be unaligned, so make a local, aligned copy
 		 * before processing. */
 		memcpy(&iwe_buf, pos, IW_EV_LCP_LEN);
 		wpa_printf(MSG_DEBUG, "Wireless event: cmd=0x%x len=%d",
 			   iwe->cmd, iwe->len);
-		if (iwe->len <= IW_EV_LCP_LEN)
+		if (iwe->len <= IW_EV_LCP_LEN || iwe->len > end - pos)
 			return;
 
 		custom = pos + IW_EV_POINT_LEN;
@@ -846,7 +847,7 @@ static void hostapd_wireless_event_wireless(struct hostap_driver_data *drv,
 
 		switch (iwe->cmd) {
 		case IWEVCUSTOM:
-			if (custom + iwe->u.data.length > end)
+			if (iwe->u.data.length > end - custom)
 				return;
 			buf = malloc(iwe->u.data.length + 1);
 			if (buf == NULL)
@@ -1045,7 +1046,7 @@ static int hostap_sta_deauth(void *priv, const u8 *own_addr, const u8 *addr,
 	memcpy(mgmt.bssid, own_addr, ETH_ALEN);
 	mgmt.u.deauth.reason_code = host_to_le16(reason);
 	return hostap_send_mlme(drv, (u8 *) &mgmt, IEEE80211_HDRLEN +
-				sizeof(mgmt.u.deauth), 0, 0);
+				sizeof(mgmt.u.deauth), 0, 0, NULL, 0);
 }
 
 
@@ -1083,7 +1084,7 @@ static int hostap_sta_disassoc(void *priv, const u8 *own_addr, const u8 *addr,
 	memcpy(mgmt.bssid, own_addr, ETH_ALEN);
 	mgmt.u.disassoc.reason_code = host_to_le16(reason);
 	return  hostap_send_mlme(drv, (u8 *) &mgmt, IEEE80211_HDRLEN +
-				 sizeof(mgmt.u.disassoc), 0, 0);
+				 sizeof(mgmt.u.disassoc), 0, 0, NULL, 0);
 }
 
 
@@ -1161,7 +1162,7 @@ static void wpa_driver_hostap_poll_client(void *priv, const u8 *own_addr,
 	os_memcpy(hdr.IEEE80211_BSSID_FROMDS, own_addr, ETH_ALEN);
 	os_memcpy(hdr.IEEE80211_SA_FROMDS, own_addr, ETH_ALEN);
 
-	hostap_send_mlme(priv, (u8 *)&hdr, sizeof(hdr), 0, 0);
+	hostap_send_mlme(priv, (u8 *)&hdr, sizeof(hdr), 0, 0, NULL, 0);
 }
 
 
diff --git a/src/drivers/driver_macsec_qca.c b/src/drivers/driver_macsec_qca.c
index 3eae2f89d20e8..826d3cc621335 100644
--- a/src/drivers/driver_macsec_qca.c
+++ b/src/drivers/driver_macsec_qca.c
@@ -11,6 +11,7 @@
 #include "includes.h"
 #include <sys/ioctl.h>
 #include <net/if.h>
+#include <inttypes.h>
 #ifdef __linux__
 #include <netpacket/packet.h>
 #include <net/if_arp.h>
@@ -485,15 +486,12 @@ static int macsec_qca_set_replay_protect(void *priv, Boolean enabled,
 }
 
 
-static int macsec_qca_set_current_cipher_suite(void *priv, const u8 *cs,
-					       size_t cs_len)
+static int macsec_qca_set_current_cipher_suite(void *priv, u64 cs)
 {
-	u8 default_cs_id[] = CS_ID_GCM_AES_128;
-
-	if (cs_len != CS_ID_LEN ||
-	    os_memcmp(cs, default_cs_id, cs_len) != 0) {
-		wpa_hexdump(MSG_ERROR, "macsec: NOT supported CipherSuite",
-			    cs, cs_len);
+	if (cs != CS_ID_GCM_AES_128) {
+		wpa_printf(MSG_ERROR,
+			   "%s: NOT supported CipherSuite: %016" PRIx64,
+			   __func__, cs);
 		return -1;
 	}
 
diff --git a/src/drivers/driver_ndis.c b/src/drivers/driver_ndis.c
index 669f1b813c43f..9440f0127235a 100644
--- a/src/drivers/driver_ndis.c
+++ b/src/drivers/driver_ndis.c
@@ -35,6 +35,7 @@ int close(int fd);
 #include "driver.h"
 #include "eloop.h"
 #include "common/ieee802_11_defs.h"
+#include "common/ieee802_11_common.h"
 #include "driver_ndis.h"
 
 int wpa_driver_register_event_cb(struct wpa_driver_ndis_data *drv);
@@ -780,20 +781,7 @@ static int wpa_driver_ndis_scan(void *priv,
 
 static const u8 * wpa_scan_get_ie(const struct wpa_scan_res *res, u8 ie)
 {
-	const u8 *end, *pos;
-
-	pos = (const u8 *) (res + 1);
-	end = pos + res->ie_len;
-
-	while (pos + 1 < end) {
-		if (pos + 2 + pos[1] > end)
-			break;
-		if (pos[0] == ie)
-			return pos;
-		pos += 2 + pos[1];
-	}
-
-	return NULL;
+	return get_ie((const u8 *) (res + 1), res->ie_len, ie);
 }
 
 
diff --git a/src/drivers/driver_nl80211.c b/src/drivers/driver_nl80211.c
index 00b173f3f85a3..1210d43560877 100644
--- a/src/drivers/driver_nl80211.c
+++ b/src/drivers/driver_nl80211.c
@@ -176,13 +176,19 @@ wpa_driver_nl80211_finish_drv_init(struct wpa_driver_nl80211_data *drv,
 static int nl80211_send_frame_cmd(struct i802_bss *bss,
 				  unsigned int freq, unsigned int wait,
 				  const u8 *buf, size_t buf_len, u64 *cookie,
-				  int no_cck, int no_ack, int offchanok);
+				  int no_cck, int no_ack, int offchanok,
+				  const u16 *csa_offs, size_t csa_offs_len);
 static int wpa_driver_nl80211_probe_req_report(struct i802_bss *bss,
 					       int report);
 
-static void add_ifidx(struct wpa_driver_nl80211_data *drv, int ifidx);
-static void del_ifidx(struct wpa_driver_nl80211_data *drv, int ifidx);
-static int have_ifidx(struct wpa_driver_nl80211_data *drv, int ifidx);
+#define IFIDX_ANY -1
+
+static void add_ifidx(struct wpa_driver_nl80211_data *drv, int ifidx,
+		      int ifidx_reason);
+static void del_ifidx(struct wpa_driver_nl80211_data *drv, int ifidx,
+		      int ifidx_reason);
+static int have_ifidx(struct wpa_driver_nl80211_data *drv, int ifidx,
+		      int ifidx_reason);
 
 static int nl80211_set_channel(struct i802_bss *bss,
 			       struct hostapd_freq_params *freq, int set_chan);
@@ -194,6 +200,10 @@ static int nl80211_leave_ibss(struct wpa_driver_nl80211_data *drv,
 
 static int i802_set_iface_flags(struct i802_bss *bss, int up);
 static int nl80211_set_param(void *priv, const char *param);
+#ifdef CONFIG_MESH
+static int nl80211_put_mesh_config(struct nl_msg *msg,
+				   struct wpa_driver_mesh_bss_params *params);
+#endif /* CONFIG_MESH */
 
 
 /* Converts nl80211_chan_width to a common format */
@@ -439,6 +449,8 @@ static int nl_get_multicast_id(struct nl80211_global *global,
 void * nl80211_cmd(struct wpa_driver_nl80211_data *drv,
 		   struct nl_msg *msg, int flags, uint8_t cmd)
 {
+	if (TEST_FAIL())
+		return NULL;
 	return genlmsg_put(msg, 0, 0, drv->global->nl80211_id,
 			   0, flags, cmd, 0);
 }
@@ -757,6 +769,15 @@ static void nl80211_put_wiphy_data_ap(struct i802_bss *bss)
 }
 
 
+static unsigned int nl80211_get_ifindex(void *priv)
+{
+	struct i802_bss *bss = priv;
+	struct wpa_driver_nl80211_data *drv = bss->drv;
+
+	return drv->ifindex;
+}
+
+
 static int wpa_driver_nl80211_get_bssid(void *priv, u8 *bssid)
 {
 	struct i802_bss *bss = priv;
@@ -780,11 +801,12 @@ static int wpa_driver_nl80211_get_ssid(void *priv, u8 *ssid)
 
 
 static void wpa_driver_nl80211_event_newlink(
-	struct wpa_driver_nl80211_data *drv, const char *ifname)
+	struct nl80211_global *global, struct wpa_driver_nl80211_data *drv,
+	int ifindex, const char *ifname)
 {
 	union wpa_event_data event;
 
-	if (os_strcmp(drv->first_bss->ifname, ifname) == 0) {
+	if (drv && os_strcmp(drv->first_bss->ifname, ifname) == 0) {
 		if (if_nametoindex(drv->first_bss->ifname) == 0) {
 			wpa_printf(MSG_DEBUG, "nl80211: Interface %s does not exist - ignore RTM_NEWLINK",
 				   drv->first_bss->ifname);
@@ -798,19 +820,25 @@ static void wpa_driver_nl80211_event_newlink(
 	}
 
 	os_memset(&event, 0, sizeof(event));
+	event.interface_status.ifindex = ifindex;
 	os_strlcpy(event.interface_status.ifname, ifname,
 		   sizeof(event.interface_status.ifname));
 	event.interface_status.ievent = EVENT_INTERFACE_ADDED;
-	wpa_supplicant_event(drv->ctx, EVENT_INTERFACE_STATUS, &event);
+	if (drv)
+		wpa_supplicant_event(drv->ctx, EVENT_INTERFACE_STATUS, &event);
+	else
+		wpa_supplicant_event_global(global->ctx, EVENT_INTERFACE_STATUS,
+					    &event);
 }
 
 
 static void wpa_driver_nl80211_event_dellink(
-	struct wpa_driver_nl80211_data *drv, const char *ifname)
+	struct nl80211_global *global, struct wpa_driver_nl80211_data *drv,
+	int ifindex, const char *ifname)
 {
 	union wpa_event_data event;
 
-	if (os_strcmp(drv->first_bss->ifname, ifname) == 0) {
+	if (drv && os_strcmp(drv->first_bss->ifname, ifname) == 0) {
 		if (drv->if_removed) {
 			wpa_printf(MSG_DEBUG, "nl80211: if_removed already set - ignore RTM_DELLINK event for %s",
 				   ifname);
@@ -825,10 +853,15 @@ static void wpa_driver_nl80211_event_dellink(
 	}
 
 	os_memset(&event, 0, sizeof(event));
+	event.interface_status.ifindex = ifindex;
 	os_strlcpy(event.interface_status.ifname, ifname,
 		   sizeof(event.interface_status.ifname));
 	event.interface_status.ievent = EVENT_INTERFACE_REMOVED;
-	wpa_supplicant_event(drv->ctx, EVENT_INTERFACE_STATUS, &event);
+	if (drv)
+		wpa_supplicant_event(drv->ctx, EVENT_INTERFACE_STATUS, &event);
+	else
+		wpa_supplicant_event_global(global->ctx, EVENT_INTERFACE_STATUS,
+					    &event);
 }
 
 
@@ -882,7 +915,7 @@ nl80211_find_drv(struct nl80211_global *global, int idx, u8 *buf, size_t len)
 	dl_list_for_each(drv, &global->interfaces,
 			 struct wpa_driver_nl80211_data, list) {
 		if (wpa_driver_nl80211_own_ifindex(drv, idx, buf, len) ||
-		    have_ifidx(drv, idx))
+		    have_ifidx(drv, idx, IFIDX_ANY))
 			return drv;
 	}
 	return NULL;
@@ -902,13 +935,6 @@ static void wpa_driver_nl80211_event_rtm_newlink(void *ctx,
 	char ifname[IFNAMSIZ + 1];
 	char extra[100], *pos, *end;
 
-	drv = nl80211_find_drv(global, ifi->ifi_index, buf, len);
-	if (!drv) {
-		wpa_printf(MSG_DEBUG, "nl80211: Ignore RTM_NEWLINK event for foreign ifindex %d",
-			   ifi->ifi_index);
-		return;
-	}
-
 	extra[0] = '\0';
 	pos = extra;
 	end = pos + sizeof(extra);
@@ -952,6 +978,10 @@ static void wpa_driver_nl80211_event_rtm_newlink(void *ctx,
 		   (ifi->ifi_flags & IFF_LOWER_UP) ? "[LOWER_UP]" : "",
 		   (ifi->ifi_flags & IFF_DORMANT) ? "[DORMANT]" : "");
 
+	drv = nl80211_find_drv(global, ifi->ifi_index, buf, len);
+	if (!drv)
+		goto event_newlink;
+
 	if (!drv->if_disabled && !(ifi->ifi_flags & IFF_UP)) {
 		namebuf[0] = '\0';
 		if (if_indextoname(ifi->ifi_index, namebuf) &&
@@ -1046,10 +1076,12 @@ static void wpa_driver_nl80211_event_rtm_newlink(void *ctx,
 				       -1, IF_OPER_UP);
 	}
 
+event_newlink:
 	if (ifname[0])
-		wpa_driver_nl80211_event_newlink(drv, ifname);
+		wpa_driver_nl80211_event_newlink(global, drv, ifi->ifi_index,
+						 ifname);
 
-	if (ifi->ifi_family == AF_BRIDGE && brid) {
+	if (ifi->ifi_family == AF_BRIDGE && brid && drv) {
 		struct i802_bss *bss;
 
 		/* device has been added to bridge */
@@ -1061,7 +1093,7 @@ static void wpa_driver_nl80211_event_rtm_newlink(void *ctx,
 		}
 		wpa_printf(MSG_DEBUG, "nl80211: Add ifindex %u for bridge %s",
 			   brid, namebuf);
-		add_ifidx(drv, brid);
+		add_ifidx(drv, brid, ifi->ifi_index);
 
 		for (bss = drv->first_bss; bss; bss = bss->next) {
 			if (os_strcmp(ifname, bss->ifname) == 0) {
@@ -1085,13 +1117,6 @@ static void wpa_driver_nl80211_event_rtm_dellink(void *ctx,
 	char ifname[IFNAMSIZ + 1];
 	char extra[100], *pos, *end;
 
-	drv = nl80211_find_drv(global, ifi->ifi_index, buf, len);
-	if (!drv) {
-		wpa_printf(MSG_DEBUG, "nl80211: Ignore RTM_DELLINK event for foreign ifindex %d",
-			   ifi->ifi_index);
-		return;
-	}
-
 	extra[0] = '\0';
 	pos = extra;
 	end = pos + sizeof(extra);
@@ -1132,10 +1157,9 @@ static void wpa_driver_nl80211_event_rtm_dellink(void *ctx,
 		   (ifi->ifi_flags & IFF_LOWER_UP) ? "[LOWER_UP]" : "",
 		   (ifi->ifi_flags & IFF_DORMANT) ? "[DORMANT]" : "");
 
-	if (ifname[0] && (ifi->ifi_family != AF_BRIDGE || !brid))
-		wpa_driver_nl80211_event_dellink(drv, ifname);
+	drv = nl80211_find_drv(global, ifi->ifi_index, buf, len);
 
-	if (ifi->ifi_family == AF_BRIDGE && brid) {
+	if (ifi->ifi_family == AF_BRIDGE && brid && drv) {
 		/* device has been removed from bridge */
 		char namebuf[IFNAMSIZ];
 
@@ -1148,8 +1172,12 @@ static void wpa_driver_nl80211_event_rtm_dellink(void *ctx,
 				   "nl80211: Remove ifindex %u for bridge %s",
 				   brid, namebuf);
 		}
-		del_ifidx(drv, brid);
+		del_ifidx(drv, brid, ifi->ifi_index);
 	}
+
+	if (ifi->ifi_family != AF_BRIDGE || !brid)
+		wpa_driver_nl80211_event_dellink(global, drv, ifi->ifi_index,
+						 ifname);
 }
 
 
@@ -1519,11 +1547,16 @@ static void nl80211_check_global(struct nl80211_global *global)
 
 static void wpa_driver_nl80211_rfkill_blocked(void *ctx)
 {
+	struct wpa_driver_nl80211_data *drv = ctx;
+
 	wpa_printf(MSG_DEBUG, "nl80211: RFKILL blocked");
+
 	/*
-	 * This may be for any interface; use ifdown event to disable
-	 * interface.
+	 * rtnetlink ifdown handler will report interfaces other than the P2P
+	 * Device interface as disabled.
 	 */
+	if (drv->nlmode == NL80211_IFTYPE_P2P_DEVICE)
+		wpa_supplicant_event(drv->ctx, EVENT_INTERFACE_DISABLED, NULL);
 }
 
 
@@ -1536,7 +1569,16 @@ static void wpa_driver_nl80211_rfkill_unblocked(void *ctx)
 			   "after rfkill unblock");
 		return;
 	}
-	/* rtnetlink ifup handler will report interface as enabled */
+
+	if (is_p2p_net_interface(drv->nlmode))
+		nl80211_disable_11b_rates(drv, drv->ifindex, 1);
+
+	/*
+	 * rtnetlink ifup handler will report interfaces other than the P2P
+	 * Device interface as enabled.
+	 */
+	if (drv->nlmode == NL80211_IFTYPE_P2P_DEVICE)
+		wpa_supplicant_event(drv->ctx, EVENT_INTERFACE_ENABLED, NULL);
 }
 
 
@@ -1621,13 +1663,65 @@ static void nl80211_destroy_bss(struct i802_bss *bss)
 }
 
 
+static void
+wpa_driver_nl80211_drv_init_rfkill(struct wpa_driver_nl80211_data *drv)
+{
+	struct rfkill_config *rcfg;
+
+	if (drv->rfkill)
+		return;
+
+	rcfg = os_zalloc(sizeof(*rcfg));
+	if (!rcfg)
+		return;
+
+	rcfg->ctx = drv;
+
+	/* rfkill uses netdev sysfs for initialization. However, P2P Device is
+	 * not associated with a netdev, so use the name of some other interface
+	 * sharing the same wiphy as the P2P Device interface.
+	 *
+	 * Note: This is valid, as a P2P Device interface is always dynamically
+	 * created and is created only once another wpa_s interface was added.
+	 */
+	if (drv->nlmode == NL80211_IFTYPE_P2P_DEVICE) {
+		struct nl80211_global *global = drv->global;
+		struct wpa_driver_nl80211_data *tmp1;
+
+		dl_list_for_each(tmp1, &global->interfaces,
+				 struct wpa_driver_nl80211_data, list) {
+			if (drv == tmp1 || drv->wiphy_idx != tmp1->wiphy_idx ||
+			    !tmp1->rfkill)
+				continue;
+
+			wpa_printf(MSG_DEBUG,
+				   "nl80211: Use (%s) to initialize P2P Device rfkill",
+				   tmp1->first_bss->ifname);
+			os_strlcpy(rcfg->ifname, tmp1->first_bss->ifname,
+				   sizeof(rcfg->ifname));
+			break;
+		}
+	} else {
+		os_strlcpy(rcfg->ifname, drv->first_bss->ifname,
+			   sizeof(rcfg->ifname));
+	}
+
+	rcfg->blocked_cb = wpa_driver_nl80211_rfkill_blocked;
+	rcfg->unblocked_cb = wpa_driver_nl80211_rfkill_unblocked;
+	drv->rfkill = rfkill_init(rcfg);
+	if (!drv->rfkill) {
+		wpa_printf(MSG_DEBUG, "nl80211: RFKILL status not available");
+		os_free(rcfg);
+	}
+}
+
+
 static void * wpa_driver_nl80211_drv_init(void *ctx, const char *ifname,
 					  void *global_priv, int hostapd,
 					  const u8 *set_addr,
 					  const char *driver_params)
 {
 	struct wpa_driver_nl80211_data *drv;
-	struct rfkill_config *rcfg;
 	struct i802_bss *bss;
 
 	if (global_priv == NULL)
@@ -1649,6 +1743,7 @@ static void * wpa_driver_nl80211_drv_init(void *ctx, const char *ifname,
 
 	drv->num_if_indices = sizeof(drv->default_if_indices) / sizeof(int);
 	drv->if_indices = drv->default_if_indices;
+	drv->if_indices_reason = drv->default_if_indices_reason;
 
 	drv->first_bss = os_zalloc(sizeof(*drv->first_bss));
 	if (!drv->first_bss) {
@@ -1668,22 +1763,6 @@ static void * wpa_driver_nl80211_drv_init(void *ctx, const char *ifname,
 	if (nl80211_init_bss(bss))
 		goto failed;
 
-	rcfg = os_zalloc(sizeof(*rcfg));
-	if (rcfg == NULL)
-		goto failed;
-	rcfg->ctx = drv;
-	os_strlcpy(rcfg->ifname, ifname, sizeof(rcfg->ifname));
-	rcfg->blocked_cb = wpa_driver_nl80211_rfkill_blocked;
-	rcfg->unblocked_cb = wpa_driver_nl80211_rfkill_unblocked;
-	drv->rfkill = rfkill_init(rcfg);
-	if (drv->rfkill == NULL) {
-		wpa_printf(MSG_DEBUG, "nl80211: RFKILL status not available");
-		os_free(rcfg);
-	}
-
-	if (linux_iface_up(drv->global->ioctl_sock, ifname) > 0)
-		drv->start_iface_up = 1;
-
 	if (wpa_driver_nl80211_finish_drv_init(drv, set_addr, 1, driver_params))
 		goto failed;
 
@@ -1916,6 +1995,10 @@ static int nl80211_mgmt_subscribe_non_ap(struct i802_bss *bss)
 	if (nl80211_register_action_frame(bss, (u8 *) "\x05\x05", 2) < 0)
 		ret = -1;
 
+	/* Radio Measurement - Radio Measurement Request */
+	if (nl80211_register_action_frame(bss, (u8 *) "\x05\x00", 2) < 0)
+		ret = -1;
+
 	/* Radio Measurement - Link Measurement Request */
 	if ((drv->capa.rrm_flags & WPA_DRIVER_FLAGS_TX_POWER_INSERTION) &&
 	    (nl80211_register_action_frame(bss, (u8 *) "\x05\x02", 2) < 0))
@@ -1977,6 +2060,49 @@ static int nl80211_register_spurious_class3(struct i802_bss *bss)
 }
 
 
+static int nl80211_action_subscribe_ap(struct i802_bss *bss)
+{
+	int ret = 0;
+
+	/* Public Action frames */
+	if (nl80211_register_action_frame(bss, (u8 *) "\x04", 1) < 0)
+		ret = -1;
+	/* RRM Measurement Report */
+	if (nl80211_register_action_frame(bss, (u8 *) "\x05\x01", 2) < 0)
+		ret = -1;
+	/* RRM Neighbor Report Request */
+	if (nl80211_register_action_frame(bss, (u8 *) "\x05\x04", 2) < 0)
+		ret = -1;
+	/* FT Action frames */
+	if (nl80211_register_action_frame(bss, (u8 *) "\x06", 1) < 0)
+		ret = -1;
+#ifdef CONFIG_IEEE80211W
+	/* SA Query */
+	if (nl80211_register_action_frame(bss, (u8 *) "\x08", 1) < 0)
+		ret = -1;
+#endif /* CONFIG_IEEE80211W */
+	/* Protected Dual of Public Action */
+	if (nl80211_register_action_frame(bss, (u8 *) "\x09", 1) < 0)
+		ret = -1;
+	/* WNM */
+	if (nl80211_register_action_frame(bss, (u8 *) "\x0a", 1) < 0)
+		ret = -1;
+	/* WMM */
+	if (nl80211_register_action_frame(bss, (u8 *) "\x11", 1) < 0)
+		ret = -1;
+#ifdef CONFIG_FST
+	/* FST Action frames */
+	if (nl80211_register_action_frame(bss, (u8 *) "\x12", 1) < 0)
+		ret = -1;
+#endif /* CONFIG_FST */
+	/* Vendor-specific */
+	if (nl80211_register_action_frame(bss, (u8 *) "\x7f", 1) < 0)
+		ret = -1;
+
+	return ret;
+}
+
+
 static int nl80211_mgmt_subscribe_ap(struct i802_bss *bss)
 {
 	static const int stypes[] = {
@@ -1985,7 +2111,6 @@ static int nl80211_mgmt_subscribe_ap(struct i802_bss *bss)
 		WLAN_FC_STYPE_REASSOC_REQ,
 		WLAN_FC_STYPE_DISASSOC,
 		WLAN_FC_STYPE_DEAUTH,
-		WLAN_FC_STYPE_ACTION,
 		WLAN_FC_STYPE_PROBE_REQ,
 /* Beacon doesn't work as mac80211 doesn't currently allow
  * it, but it wouldn't really be the right thing anyway as
@@ -2010,6 +2135,9 @@ static int nl80211_mgmt_subscribe_ap(struct i802_bss *bss)
 		}
 	}
 
+	if (nl80211_action_subscribe_ap(bss))
+		goto out_err;
+
 	if (nl80211_register_spurious_class3(bss))
 		goto out_err;
 
@@ -2032,10 +2160,7 @@ static int nl80211_mgmt_subscribe_ap_dev_sme(struct i802_bss *bss)
 	wpa_printf(MSG_DEBUG, "nl80211: Subscribe to mgmt frames with AP "
 		   "handle %p (device SME)", bss->nl_mgmt);
 
-	if (nl80211_register_frame(bss, bss->nl_mgmt,
-				   (WLAN_FC_TYPE_MGMT << 2) |
-				   (WLAN_FC_STYPE_ACTION << 4),
-				   NULL, 0) < 0)
+	if (nl80211_action_subscribe_ap(bss))
 		goto out_err;
 
 	nl80211_mgmt_handle_register_eloop(bss);
@@ -2186,6 +2311,11 @@ wpa_driver_nl80211_finish_drv_init(struct wpa_driver_nl80211_data *drv,
 	if (!bss->if_dynamic && nl80211_get_ifmode(bss) == NL80211_IFTYPE_AP)
 		bss->static_ap = 1;
 
+	if (first &&
+	    nl80211_get_ifmode(bss) != NL80211_IFTYPE_P2P_DEVICE &&
+	    linux_iface_up(drv->global->ioctl_sock, bss->ifname) > 0)
+		drv->start_iface_up = 1;
+
 	if (wpa_driver_nl80211_capa(drv))
 		return -1;
 
@@ -2206,7 +2336,8 @@ wpa_driver_nl80211_finish_drv_init(struct wpa_driver_nl80211_data *drv,
 
 	if (drv->hostapd || bss->static_ap)
 		nlmode = NL80211_IFTYPE_AP;
-	else if (bss->if_dynamic)
+	else if (bss->if_dynamic ||
+		 nl80211_get_ifmode(bss) == NL80211_IFTYPE_MESH_POINT)
 		nlmode = nl80211_get_ifmode(bss);
 	else
 		nlmode = NL80211_IFTYPE_STATION;
@@ -2219,6 +2350,8 @@ wpa_driver_nl80211_finish_drv_init(struct wpa_driver_nl80211_data *drv,
 	if (nlmode == NL80211_IFTYPE_P2P_DEVICE)
 		nl80211_get_macaddr(bss);
 
+	wpa_driver_nl80211_drv_init_rfkill(drv);
+
 	if (!rfkill_is_blocked(drv->rfkill)) {
 		int ret = i802_set_iface_flags(bss, 1);
 		if (ret) {
@@ -2226,25 +2359,32 @@ wpa_driver_nl80211_finish_drv_init(struct wpa_driver_nl80211_data *drv,
 				   "interface '%s' UP", bss->ifname);
 			return ret;
 		}
+
+		if (is_p2p_net_interface(nlmode))
+			nl80211_disable_11b_rates(bss->drv,
+						  bss->drv->ifindex, 1);
+
 		if (nlmode == NL80211_IFTYPE_P2P_DEVICE)
 			return ret;
 	} else {
 		wpa_printf(MSG_DEBUG, "nl80211: Could not yet enable "
 			   "interface '%s' due to rfkill", bss->ifname);
-		if (nlmode == NL80211_IFTYPE_P2P_DEVICE)
-			return 0;
-		drv->if_disabled = 1;
+		if (nlmode != NL80211_IFTYPE_P2P_DEVICE)
+			drv->if_disabled = 1;
+
 		send_rfkill_event = 1;
 	}
 
-	if (!drv->hostapd)
+	if (!drv->hostapd && nlmode != NL80211_IFTYPE_P2P_DEVICE)
 		netlink_send_oper_ifla(drv->global->netlink, drv->ifindex,
 				       1, IF_OPER_DORMANT);
 
-	if (linux_get_ifhwaddr(drv->global->ioctl_sock, bss->ifname,
-			       bss->addr))
-		return -1;
-	os_memcpy(drv->perm_addr, bss->addr, ETH_ALEN);
+	if (nlmode != NL80211_IFTYPE_P2P_DEVICE) {
+		if (linux_get_ifhwaddr(drv->global->ioctl_sock, bss->ifname,
+				       bss->addr))
+			return -1;
+		os_memcpy(drv->perm_addr, bss->addr, ETH_ALEN);
+	}
 
 	if (send_rfkill_event) {
 		eloop_register_timeout(0, 0, wpa_driver_nl80211_send_rfkill,
@@ -2279,6 +2419,7 @@ static int wpa_driver_nl80211_del_beacon(struct wpa_driver_nl80211_data *drv)
 static void wpa_driver_nl80211_deinit(struct i802_bss *bss)
 {
 	struct wpa_driver_nl80211_data *drv = bss->drv;
+	unsigned int i;
 
 	wpa_printf(MSG_INFO, "nl80211: deinit ifname=%s disabled_11b_rates=%d",
 		   bss->ifname, drv->disabled_11b_rates);
@@ -2325,6 +2466,9 @@ static void wpa_driver_nl80211_deinit(struct i802_bss *bss)
 	if (drv->if_indices != drv->default_if_indices)
 		os_free(drv->if_indices);
 
+	if (drv->if_indices_reason != drv->default_if_indices_reason)
+		os_free(drv->if_indices_reason);
+
 	if (drv->disabled_11b_rates)
 		nl80211_disable_11b_rates(drv, drv->ifindex, 0);
 
@@ -2372,6 +2516,10 @@ static void wpa_driver_nl80211_deinit(struct i802_bss *bss)
 
 	os_free(drv->extended_capa);
 	os_free(drv->extended_capa_mask);
+	for (i = 0; i < drv->num_iface_ext_capa; i++) {
+		os_free(drv->iface_ext_capa[i].ext_capa);
+		os_free(drv->iface_ext_capa[i].ext_capa_mask);
+	}
 	os_free(drv->first_bss);
 	os_free(drv);
 }
@@ -2468,6 +2616,7 @@ static int wpa_cipher_to_cipher_suites(unsigned int ciphers, u32 suites[],
 }
 
 
+#ifdef CONFIG_DRIVER_NL80211_QCA
 static int issue_key_mgmt_set_key(struct wpa_driver_nl80211_data *drv,
 				  const u8 *key, size_t key_len)
 {
@@ -2495,6 +2644,7 @@ static int issue_key_mgmt_set_key(struct wpa_driver_nl80211_data *drv,
 
 	return ret;
 }
+#endif /* CONFIG_DRIVER_NL80211_QCA */
 
 
 static int wpa_driver_nl80211_set_key(const char *ifname, struct i802_bss *bss,
@@ -2525,6 +2675,7 @@ static int wpa_driver_nl80211_set_key(const char *ifname, struct i802_bss *bss,
 	}
 #endif /* CONFIG_TDLS */
 
+#ifdef CONFIG_DRIVER_NL80211_QCA
 	if (alg == WPA_ALG_PMK &&
 	    (drv->capa.flags & WPA_DRIVER_FLAGS_KEY_MGMT_OFFLOAD)) {
 		wpa_printf(MSG_DEBUG, "%s: calling issue_key_mgmt_set_key",
@@ -2532,6 +2683,7 @@ static int wpa_driver_nl80211_set_key(const char *ifname, struct i802_bss *bss,
 		ret = issue_key_mgmt_set_key(drv, key, key_len);
 		return ret;
 	}
+#endif /* CONFIG_DRIVER_NL80211_QCA */
 
 	if (alg == WPA_ALG_NONE) {
 		msg = nl80211_ifindex_msg(drv, ifindex, 0, NL80211_CMD_DEL_KEY);
@@ -3089,7 +3241,9 @@ static int wpa_driver_nl80211_send_frame(struct i802_bss *bss,
 					 const void *data, size_t len,
 					 int encrypt, int noack,
 					 unsigned int freq, int no_cck,
-					 int offchanok, unsigned int wait_time)
+					 int offchanok, unsigned int wait_time,
+					 const u16 *csa_offs,
+					 size_t csa_offs_len)
 {
 	struct wpa_driver_nl80211_data *drv = bss->drv;
 	u64 cookie;
@@ -3115,7 +3269,8 @@ static int wpa_driver_nl80211_send_frame(struct i802_bss *bss,
 
 	wpa_printf(MSG_DEBUG, "nl80211: send_frame -> send_frame_cmd");
 	res = nl80211_send_frame_cmd(bss, freq, wait_time, data, len,
-				     &cookie, no_cck, noack, offchanok);
+				     &cookie, no_cck, noack, offchanok,
+				     csa_offs, csa_offs_len);
 	if (res == 0 && !noack) {
 		const struct ieee80211_mgmt *mgmt;
 		u16 fc;
@@ -3141,7 +3296,9 @@ static int wpa_driver_nl80211_send_mlme(struct i802_bss *bss, const u8 *data,
 					size_t data_len, int noack,
 					unsigned int freq, int no_cck,
 					int offchanok,
-					unsigned int wait_time)
+					unsigned int wait_time,
+					const u16 *csa_offs,
+					size_t csa_offs_len)
 {
 	struct wpa_driver_nl80211_data *drv = bss->drv;
 	struct ieee80211_mgmt *mgmt;
@@ -3171,7 +3328,7 @@ static int wpa_driver_nl80211_send_mlme(struct i802_bss *bss, const u8 *data,
 		}
 		return nl80211_send_frame_cmd(bss, freq, 0,
 					      data, data_len, NULL, 1, noack,
-					      1);
+					      1, csa_offs, csa_offs_len);
 	}
 
 	if (drv->device_ap_sme && is_ap_interface(drv->nlmode)) {
@@ -3185,7 +3342,8 @@ static int wpa_driver_nl80211_send_mlme(struct i802_bss *bss, const u8 *data,
 					      wait_time,
 					      data, data_len,
 					      &drv->send_action_cookie,
-					      no_cck, noack, offchanok);
+					      no_cck, noack, offchanok,
+					      csa_offs, csa_offs_len);
 	}
 
 	if (WLAN_FC_GET_TYPE(fc) == WLAN_FC_TYPE_MGMT &&
@@ -3205,7 +3363,8 @@ static int wpa_driver_nl80211_send_mlme(struct i802_bss *bss, const u8 *data,
 	wpa_printf(MSG_DEBUG, "nl80211: send_mlme -> send_frame");
 	return wpa_driver_nl80211_send_frame(bss, data, data_len, encrypt,
 					     noack, freq, no_cck, offchanok,
-					     wait_time);
+					     wait_time, csa_offs,
+					     csa_offs_len);
 }
 
 
@@ -3314,6 +3473,48 @@ static int nl80211_put_beacon_int(struct nl_msg *msg, int beacon_int)
 }
 
 
+static int nl80211_put_dtim_period(struct nl_msg *msg, int dtim_period)
+{
+	if (dtim_period > 0) {
+		wpa_printf(MSG_DEBUG, "  * dtim_period=%d", dtim_period);
+		return nla_put_u32(msg, NL80211_ATTR_DTIM_PERIOD, dtim_period);
+	}
+
+	return 0;
+}
+
+
+#ifdef CONFIG_MESH
+static int nl80211_set_mesh_config(void *priv,
+				   struct wpa_driver_mesh_bss_params *params)
+{
+	struct i802_bss *bss = priv;
+	struct wpa_driver_nl80211_data *drv = bss->drv;
+	struct nl_msg *msg;
+	int ret;
+
+	msg = nl80211_drv_msg(drv, 0, NL80211_CMD_SET_MESH_CONFIG);
+	if (!msg)
+		return -1;
+
+	ret = nl80211_put_mesh_config(msg, params);
+	if (ret < 0) {
+		nlmsg_free(msg);
+		return ret;
+	}
+
+	ret = send_and_recv_msgs(drv, msg, NULL, NULL);
+	if (ret) {
+		wpa_printf(MSG_ERROR,
+			   "nl80211: Mesh config set failed: %d (%s)",
+			   ret, strerror(-ret));
+		return ret;
+	}
+	return 0;
+}
+#endif /* CONFIG_MESH */
+
+
 static int wpa_driver_nl80211_set_ap(void *priv,
 				     struct wpa_driver_ap_params *params)
 {
@@ -3327,6 +3528,9 @@ static int wpa_driver_nl80211_set_ap(void *priv,
 	int smps_mode;
 	u32 suites[10], suite;
 	u32 ver;
+#ifdef CONFIG_MESH
+	struct wpa_driver_mesh_bss_params mesh_params;
+#endif /* CONFIG_MESH */
 
 	beacon_set = params->reenable ? 0 : bss->beacon_set;
 
@@ -3350,7 +3554,7 @@ static int wpa_driver_nl80211_set_ap(void *priv,
 	    nla_put(msg, NL80211_ATTR_BEACON_TAIL, params->tail_len,
 		    params->tail) ||
 	    nl80211_put_beacon_int(msg, params->beacon_int) ||
-	    nla_put_u32(msg, NL80211_ATTR_DTIM_PERIOD, params->dtim_period) ||
+	    nl80211_put_dtim_period(msg, params->dtim_period) ||
 	    nla_put(msg, NL80211_ATTR_SSID, params->ssid_len, params->ssid))
 		goto fail;
 	if (params->proberesp && params->proberesp_len) {
@@ -3421,8 +3625,10 @@ static int wpa_driver_nl80211_set_ap(void *priv,
 		goto fail;
 
 	if (params->key_mgmt_suites & WPA_KEY_MGMT_IEEE8021X_NO_WPA &&
-	    params->pairwise_ciphers & (WPA_CIPHER_WEP104 | WPA_CIPHER_WEP40) &&
-	    nla_put_flag(msg, NL80211_ATTR_CONTROL_PORT_NO_ENCRYPT))
+	    (!params->pairwise_ciphers ||
+	     params->pairwise_ciphers & (WPA_CIPHER_WEP104 | WPA_CIPHER_WEP40)) &&
+	    (nla_put_u16(msg, NL80211_ATTR_CONTROL_PORT_ETHERTYPE, ETH_P_PAE) ||
+	     nla_put_flag(msg, NL80211_ATTR_CONTROL_PORT_NO_ENCRYPT)))
 		goto fail;
 
 	wpa_printf(MSG_DEBUG, "nl80211: pairwise_ciphers=0x%x",
@@ -3441,24 +3647,26 @@ static int wpa_driver_nl80211_set_ap(void *priv,
 	    nla_put_u32(msg, NL80211_ATTR_CIPHER_SUITE_GROUP, suite))
 		goto fail;
 
-	switch (params->smps_mode) {
-	case HT_CAP_INFO_SMPS_DYNAMIC:
-		wpa_printf(MSG_DEBUG, "nl80211: SMPS mode - dynamic");
-		smps_mode = NL80211_SMPS_DYNAMIC;
-		break;
-	case HT_CAP_INFO_SMPS_STATIC:
-		wpa_printf(MSG_DEBUG, "nl80211: SMPS mode - static");
-		smps_mode = NL80211_SMPS_STATIC;
-		break;
-	default:
-		/* invalid - fallback to smps off */
-	case HT_CAP_INFO_SMPS_DISABLED:
-		wpa_printf(MSG_DEBUG, "nl80211: SMPS mode - off");
-		smps_mode = NL80211_SMPS_OFF;
-		break;
+	if (params->ht_opmode != -1) {
+		switch (params->smps_mode) {
+		case HT_CAP_INFO_SMPS_DYNAMIC:
+			wpa_printf(MSG_DEBUG, "nl80211: SMPS mode - dynamic");
+			smps_mode = NL80211_SMPS_DYNAMIC;
+			break;
+		case HT_CAP_INFO_SMPS_STATIC:
+			wpa_printf(MSG_DEBUG, "nl80211: SMPS mode - static");
+			smps_mode = NL80211_SMPS_STATIC;
+			break;
+		default:
+			/* invalid - fallback to smps off */
+		case HT_CAP_INFO_SMPS_DISABLED:
+			wpa_printf(MSG_DEBUG, "nl80211: SMPS mode - off");
+			smps_mode = NL80211_SMPS_OFF;
+			break;
+		}
+		if (nla_put_u32(msg, NL80211_ATTR_SMPS_MODE, smps_mode))
+			goto fail;
 	}
-	if (nla_put_u32(msg, NL80211_ATTR_SMPS_MODE, smps_mode))
-		goto fail;
 
 	if (params->beacon_ies) {
 		wpa_hexdump_buf(MSG_DEBUG, "nl80211: beacon_ies",
@@ -3508,6 +3716,12 @@ static int wpa_driver_nl80211_set_ap(void *priv,
 	}
 #endif /* CONFIG_P2P */
 
+	if (params->pbss) {
+		wpa_printf(MSG_DEBUG, "nl80211: PBSS");
+		if (nla_put_flag(msg, NL80211_ATTR_PBSS))
+			goto fail;
+	}
+
 	ret = send_and_recv_msgs(drv, msg, NULL, NULL);
 	if (ret) {
 		wpa_printf(MSG_DEBUG, "nl80211: Beacon set failed: %d (%s)",
@@ -3533,7 +3747,7 @@ static int wpa_driver_nl80211_set_ap(void *priv,
 					   "nl80211: Frequency set succeeded for ht2040 coex");
 				bss->bandwidth = params->freq->bandwidth;
 			}
-		} else if (!beacon_set) {
+		} else if (!beacon_set && params->freq) {
 			/*
 			 * cfg80211 updates the driver on frequence change in AP
 			 * mode only at the point when beaconing is started, so
@@ -3542,6 +3756,18 @@ static int wpa_driver_nl80211_set_ap(void *priv,
 			bss->bandwidth = params->freq->bandwidth;
 		}
 	}
+
+#ifdef CONFIG_MESH
+	if (is_mesh_interface(drv->nlmode) && params->ht_opmode != -1) {
+		os_memset(&mesh_params, 0, sizeof(mesh_params));
+		mesh_params.flags |= WPA_DRIVER_MESH_CONF_FLAG_HT_OP_MODE;
+		mesh_params.ht_opmode = params->ht_opmode;
+		ret = nl80211_set_mesh_config(priv, &mesh_params);
+		if (ret < 0)
+			return ret;
+	}
+#endif /* CONFIG_MESH */
+
 	return ret;
 fail:
 	nlmsg_free(msg);
@@ -3615,6 +3841,12 @@ static int nl80211_put_freq_params(struct nl_msg *msg,
 		wpa_printf(MSG_DEBUG, "  * channel_type=%d", ct);
 		if (nla_put_u32(msg, NL80211_ATTR_WIPHY_CHANNEL_TYPE, ct))
 			return -ENOBUFS;
+	} else {
+		wpa_printf(MSG_DEBUG, "  * channel_type=%d",
+			   NL80211_CHAN_NO_HT);
+		if (nla_put_u32(msg, NL80211_ATTR_WIPHY_CHANNEL_TYPE,
+				NL80211_CHAN_NO_HT))
+			return -ENOBUFS;
 	}
 	return 0;
 }
@@ -3666,6 +3898,8 @@ static u32 sta_flags_nl80211(int flags)
 		f |= BIT(NL80211_STA_FLAG_TDLS_PEER);
 	if (flags & WPA_STA_AUTHENTICATED)
 		f |= BIT(NL80211_STA_FLAG_AUTHENTICATED);
+	if (flags & WPA_STA_ASSOCIATED)
+		f |= BIT(NL80211_STA_FLAG_ASSOCIATED);
 
 	return f;
 }
@@ -3675,11 +3909,11 @@ static u32 sta_flags_nl80211(int flags)
 static u32 sta_plink_state_nl80211(enum mesh_plink_state state)
 {
 	switch (state) {
-	case PLINK_LISTEN:
+	case PLINK_IDLE:
 		return NL80211_PLINK_LISTEN;
-	case PLINK_OPEN_SENT:
+	case PLINK_OPN_SNT:
 		return NL80211_PLINK_OPN_SNT;
-	case PLINK_OPEN_RCVD:
+	case PLINK_OPN_RCVD:
 		return NL80211_PLINK_OPN_RCVD;
 	case PLINK_CNF_RCVD:
 		return NL80211_PLINK_CNF_RCVD;
@@ -3718,7 +3952,17 @@ static int wpa_driver_nl80211_sta_add(void *priv,
 	if (!msg || nla_put(msg, NL80211_ATTR_MAC, ETH_ALEN, params->addr))
 		goto fail;
 
-	if (!params->set || (params->flags & WPA_STA_TDLS_PEER)) {
+	/*
+	 * Set the below properties only in one of the following cases:
+	 * 1. New station is added, already associated.
+	 * 2. Set WPA_STA_TDLS_PEER station.
+	 * 3. Set an already added unassociated station, if driver supports
+	 * full AP client state. (Set these properties after station became
+	 * associated will be rejected by the driver).
+	 */
+	if (!params->set || (params->flags & WPA_STA_TDLS_PEER) ||
+	    (params->set && FULL_AP_CLIENT_STATE_SUPP(drv->capa.flags) &&
+	     (params->flags & WPA_STA_ASSOCIATED))) {
 		wpa_hexdump(MSG_DEBUG, "  * supported rates",
 			    params->supp_rates, params->supp_rates_len);
 		wpa_printf(MSG_DEBUG, "  * capability=0x%x",
@@ -3756,6 +4000,13 @@ static int wpa_driver_nl80211_sta_add(void *priv,
 				    params->ext_capab_len, params->ext_capab))
 				goto fail;
 		}
+
+		if (is_ap_interface(drv->nlmode) &&
+		    nla_put_u8(msg, NL80211_ATTR_STA_SUPPORT_P2P_PS,
+			       params->support_p2p_ps ?
+			       NL80211_P2P_PS_SUPPORTED :
+			       NL80211_P2P_PS_UNSUPPORTED))
+			goto fail;
 	}
 	if (!params->set) {
 		if (params->aid) {
@@ -3766,9 +4017,12 @@ static int wpa_driver_nl80211_sta_add(void *priv,
 			/*
 			 * cfg80211 validates that AID is non-zero, so we have
 			 * to make this a non-zero value for the TDLS case where
-			 * a dummy STA entry is used for now.
+			 * a dummy STA entry is used for now and for a station
+			 * that is still not associated.
 			 */
-			wpa_printf(MSG_DEBUG, "  * aid=1 (TDLS workaround)");
+			wpa_printf(MSG_DEBUG, "  * aid=1 (%s workaround)",
+				   (params->flags & WPA_STA_TDLS_PEER) ?
+				   "TDLS" : "UNASSOC_STA");
 			if (nla_put_u16(msg, NL80211_ATTR_STA_AID, 1))
 				goto fail;
 		}
@@ -3781,6 +4035,15 @@ static int wpa_driver_nl80211_sta_add(void *priv,
 		wpa_printf(MSG_DEBUG, "  * peer_aid=%u", params->aid);
 		if (nla_put_u16(msg, NL80211_ATTR_PEER_AID, params->aid))
 			goto fail;
+	} else if (FULL_AP_CLIENT_STATE_SUPP(drv->capa.flags) &&
+		   (params->flags & WPA_STA_ASSOCIATED)) {
+		wpa_printf(MSG_DEBUG, "  * aid=%u", params->aid);
+		wpa_printf(MSG_DEBUG, "  * listen_interval=%u",
+			   params->listen_interval);
+		if (nla_put_u16(msg, NL80211_ATTR_STA_AID, params->aid) ||
+		    nla_put_u16(msg, NL80211_ATTR_STA_LISTEN_INTERVAL,
+				params->listen_interval))
+			goto fail;
 	}
 
 	if (params->vht_opmode_enabled) {
@@ -3811,6 +4074,45 @@ static int wpa_driver_nl80211_sta_add(void *priv,
 	os_memset(&upd, 0, sizeof(upd));
 	upd.set = sta_flags_nl80211(params->flags);
 	upd.mask = upd.set | sta_flags_nl80211(params->flags_mask);
+
+	/*
+	 * If the driver doesn't support full AP client state, ignore ASSOC/AUTH
+	 * flags, as nl80211 driver moves a new station, by default, into
+	 * associated state.
+	 *
+	 * On the other hand, if the driver supports that feature and the
+	 * station is added in unauthenticated state, set the
+	 * authenticated/associated bits in the mask to prevent moving this
+	 * station to associated state before it is actually associated.
+	 *
+	 * This is irrelevant for mesh mode where the station is added to the
+	 * driver as authenticated already, and ASSOCIATED isn't part of the
+	 * nl80211 API.
+	 */
+	if (!is_mesh_interface(drv->nlmode)) {
+		if (!FULL_AP_CLIENT_STATE_SUPP(drv->capa.flags)) {
+			wpa_printf(MSG_DEBUG,
+				   "nl80211: Ignore ASSOC/AUTH flags since driver doesn't support full AP client state");
+			upd.mask &= ~(BIT(NL80211_STA_FLAG_ASSOCIATED) |
+				      BIT(NL80211_STA_FLAG_AUTHENTICATED));
+		} else if (!params->set &&
+			   !(params->flags & WPA_STA_TDLS_PEER)) {
+			if (!(params->flags & WPA_STA_AUTHENTICATED))
+				upd.mask |= BIT(NL80211_STA_FLAG_AUTHENTICATED);
+			if (!(params->flags & WPA_STA_ASSOCIATED))
+				upd.mask |= BIT(NL80211_STA_FLAG_ASSOCIATED);
+		}
+#ifdef CONFIG_MESH
+	} else {
+		if (params->plink_state == PLINK_ESTAB && params->peer_aid) {
+			ret = nla_put_u16(msg, NL80211_ATTR_MESH_PEER_AID,
+					  params->peer_aid);
+			if (ret)
+				goto fail;
+		}
+#endif /* CONFIG_MESH */
+	}
+
 	wpa_printf(MSG_DEBUG, "  * flags set=0x%x mask=0x%x",
 		   upd.set, upd.mask);
 	if (nla_put(msg, NL80211_ATTR_STA_FLAGS2, sizeof(upd), &upd))
@@ -3933,7 +4235,11 @@ void nl80211_remove_iface(struct wpa_driver_nl80211_data *drv, int ifidx)
 	/* stop listening for EAPOL on this interface */
 	dl_list_for_each(drv2, &drv->global->interfaces,
 			 struct wpa_driver_nl80211_data, list)
-		del_ifidx(drv2, ifidx);
+	{
+		del_ifidx(drv2, ifidx, IFIDX_ANY);
+		/* Remove all bridges learned for this iface */
+		del_ifidx(drv2, IFIDX_ANY, ifidx);
+	}
 
 	msg = nl80211_ifindex_msg(drv, ifidx, 0, NL80211_CMD_DEL_INTERFACE);
 	if (send_and_recv_msgs(drv, msg, NULL, NULL) == 0)
@@ -3942,7 +4248,7 @@ void nl80211_remove_iface(struct wpa_driver_nl80211_data *drv, int ifidx)
 }
 
 
-static const char * nl80211_iftype_str(enum nl80211_iftype mode)
+const char * nl80211_iftype_str(enum nl80211_iftype mode)
 {
 	switch (mode) {
 	case NL80211_IFTYPE_ADHOC:
@@ -4041,7 +4347,7 @@ static int nl80211_create_iface_once(struct wpa_driver_nl80211_data *drv,
 	    iftype == NL80211_IFTYPE_WDS ||
 	    iftype == NL80211_IFTYPE_MONITOR) {
 		/* start listening for EAPOL on this interface */
-		add_ifidx(drv, ifidx);
+		add_ifidx(drv, ifidx, IFIDX_ANY);
 	}
 
 	if (addr && iftype != NL80211_IFTYPE_MONITOR &&
@@ -4124,7 +4430,8 @@ static int nl80211_setup_ap(struct i802_bss *bss)
 
 	if (drv->device_ap_sme && !drv->use_monitor)
 		if (nl80211_mgmt_subscribe_ap_dev_sme(bss))
-			return -1;
+			wpa_printf(MSG_DEBUG,
+				   "nl80211: Failed to subscribe for mgmt frames from SME driver - trying to run without it");
 
 	if (!drv->device_ap_sme && drv->use_monitor &&
 	    nl80211_create_monitor_interface(drv) &&
@@ -4244,7 +4551,7 @@ static int wpa_driver_nl80211_hapd_send_eapol(
 	memcpy(pos, data, data_len);
 
 	res = wpa_driver_nl80211_send_frame(bss, (u8 *) hdr, len, encrypt, 0,
-					    0, 0, 0, 0);
+					    0, 0, 0, 0, NULL, 0);
 	if (res < 0) {
 		wpa_printf(MSG_ERROR, "i802_send_eapol - packet len: %lu - "
 			   "failed: %d (%s)",
@@ -4473,8 +4780,9 @@ retry:
 			goto fail;
 	}
 
-	if (nl80211_ht_vht_overrides(msg, params) < 0)
-		return -1;
+	ret = nl80211_ht_vht_overrides(msg, params);
+	if (ret < 0)
+		goto fail;
 
 	ret = send_and_recv_msgs(drv, msg, NULL, NULL);
 	msg = NULL;
@@ -4648,15 +4956,24 @@ static int nl80211_connect_common(struct wpa_driver_nl80211_data *drv,
 	if (nla_put_flag(msg, NL80211_ATTR_CONTROL_PORT))
 		return -1;
 
+	if (params->key_mgmt_suite == WPA_KEY_MGMT_IEEE8021X_NO_WPA &&
+	    (params->pairwise_suite == WPA_CIPHER_NONE ||
+	     params->pairwise_suite == WPA_CIPHER_WEP104 ||
+	     params->pairwise_suite == WPA_CIPHER_WEP40) &&
+	    (nla_put_u16(msg, NL80211_ATTR_CONTROL_PORT_ETHERTYPE, ETH_P_PAE) ||
+	     nla_put_flag(msg, NL80211_ATTR_CONTROL_PORT_NO_ENCRYPT)))
+		return -1;
+
 	if (params->mgmt_frame_protection == MGMT_FRAME_PROTECTION_REQUIRED &&
 	    nla_put_u32(msg, NL80211_ATTR_USE_MFP, NL80211_MFP_REQUIRED))
 		return -1;
 
 	if (params->rrm_used) {
 		u32 drv_rrm_flags = drv->capa.rrm_flags;
-		if (!(drv_rrm_flags &
-		      WPA_DRIVER_FLAGS_DS_PARAM_SET_IE_IN_PROBES) ||
-		    !(drv_rrm_flags & WPA_DRIVER_FLAGS_QUIET) ||
+		if ((!((drv_rrm_flags &
+			WPA_DRIVER_FLAGS_DS_PARAM_SET_IE_IN_PROBES) &&
+		       (drv_rrm_flags & WPA_DRIVER_FLAGS_QUIET)) &&
+		     !(drv_rrm_flags & WPA_DRIVER_FLAGS_SUPPORT_RRM)) ||
 		    nla_put_flag(msg, NL80211_ATTR_USE_RRM))
 			return -1;
 	}
@@ -4667,6 +4984,22 @@ static int nl80211_connect_common(struct wpa_driver_nl80211_data *drv,
 	if (params->p2p)
 		wpa_printf(MSG_DEBUG, "  * P2P group");
 
+	if (params->pbss) {
+		wpa_printf(MSG_DEBUG, "  * PBSS");
+		if (nla_put_flag(msg, NL80211_ATTR_PBSS))
+			return -1;
+	}
+
+	drv->connect_reassoc = 0;
+	if (params->prev_bssid) {
+		wpa_printf(MSG_DEBUG, "  * prev_bssid=" MACSTR,
+			   MAC2STR(params->prev_bssid));
+		if (nla_put(msg, NL80211_ATTR_PREV_BSSID, ETH_ALEN,
+			    params->prev_bssid))
+			return -1;
+		drv->connect_reassoc = 1;
+	}
+
 	return 0;
 }
 
@@ -4680,6 +5013,7 @@ static int wpa_driver_nl80211_try_connect(
 	int ret;
 	int algs;
 
+#ifdef CONFIG_DRIVER_NL80211_QCA
 	if (params->req_key_mgmt_offload && params->psk &&
 	    (params->key_mgmt_suite == WPA_KEY_MGMT_PSK ||
 	     params->key_mgmt_suite == WPA_KEY_MGMT_PSK_SHA256 ||
@@ -4689,6 +5023,7 @@ static int wpa_driver_nl80211_try_connect(
 		if (ret)
 			return ret;
 	}
+#endif /* CONFIG_DRIVER_NL80211_QCA */
 
 	wpa_printf(MSG_DEBUG, "nl80211: Connect (ifindex=%d)", drv->ifindex);
 	msg = nl80211_drv_msg(drv, 0, NL80211_CMD_CONNECT);
@@ -4817,14 +5152,6 @@ static int wpa_driver_nl80211_associate(
 	if (ret)
 		goto fail;
 
-	if (params->prev_bssid) {
-		wpa_printf(MSG_DEBUG, "  * prev_bssid=" MACSTR,
-			   MAC2STR(params->prev_bssid));
-		if (nla_put(msg, NL80211_ATTR_PREV_BSSID, ETH_ALEN,
-			    params->prev_bssid))
-			goto fail;
-	}
-
 	ret = send_and_recv_msgs(drv, msg, NULL, NULL);
 	msg = NULL;
 	if (ret) {
@@ -4880,6 +5207,9 @@ static int wpa_driver_nl80211_set_mode_impl(
 	int res;
 	int mode_switch_res;
 
+	if (TEST_FAIL())
+		return -1;
+
 	mode_switch_res = nl80211_set_mode(drv, drv->ifindex, nlmode);
 	if (mode_switch_res && nlmode == nl80211_get_ifmode(bss))
 		mode_switch_res = 0;
@@ -5236,6 +5566,8 @@ static int get_sta_handler(struct nl_msg *msg, void *arg)
 		[NL80211_STA_INFO_RX_PACKETS] = { .type = NLA_U32 },
 		[NL80211_STA_INFO_TX_PACKETS] = { .type = NLA_U32 },
 		[NL80211_STA_INFO_TX_FAILED] = { .type = NLA_U32 },
+		[NL80211_STA_INFO_RX_BYTES64] = { .type = NLA_U64 },
+		[NL80211_STA_INFO_TX_BYTES64] = { .type = NLA_U64 },
 	};
 
 	nla_parse(tb, NL80211_ATTR_MAX, genlmsg_attrdata(gnlh, 0),
@@ -5261,10 +5593,23 @@ static int get_sta_handler(struct nl_msg *msg, void *arg)
 	if (stats[NL80211_STA_INFO_INACTIVE_TIME])
 		data->inactive_msec =
 			nla_get_u32(stats[NL80211_STA_INFO_INACTIVE_TIME]);
+	/* For backwards compatibility, fetch the 32-bit counters first. */
 	if (stats[NL80211_STA_INFO_RX_BYTES])
 		data->rx_bytes = nla_get_u32(stats[NL80211_STA_INFO_RX_BYTES]);
 	if (stats[NL80211_STA_INFO_TX_BYTES])
 		data->tx_bytes = nla_get_u32(stats[NL80211_STA_INFO_TX_BYTES]);
+	if (stats[NL80211_STA_INFO_RX_BYTES64] &&
+	    stats[NL80211_STA_INFO_TX_BYTES64]) {
+		/*
+		 * The driver supports 64-bit counters, so use them to override
+		 * the 32-bit values.
+		 */
+		data->rx_bytes =
+			nla_get_u64(stats[NL80211_STA_INFO_RX_BYTES64]);
+		data->tx_bytes =
+			nla_get_u64(stats[NL80211_STA_INFO_TX_BYTES64]);
+		data->bytes_64bit = 1;
+	}
 	if (stats[NL80211_STA_INFO_RX_PACKETS])
 		data->rx_packets =
 			nla_get_u32(stats[NL80211_STA_INFO_RX_PACKETS]);
@@ -5433,7 +5778,7 @@ static int i802_sta_deauth(void *priv, const u8 *own_addr, const u8 *addr,
 	return wpa_driver_nl80211_send_mlme(bss, (u8 *) &mgmt,
 					    IEEE80211_HDRLEN +
 					    sizeof(mgmt.u.deauth), 0, 0, 0, 0,
-					    0);
+					    0, NULL, 0);
 }
 
 
@@ -5460,7 +5805,7 @@ static int i802_sta_disassoc(void *priv, const u8 *own_addr, const u8 *addr,
 	return wpa_driver_nl80211_send_mlme(bss, (u8 *) &mgmt,
 					    IEEE80211_HDRLEN +
 					    sizeof(mgmt.u.disassoc), 0, 0, 0, 0,
-					    0);
+					    0, NULL, 0);
 }
 
 
@@ -5475,7 +5820,9 @@ static void dump_ifidx(struct wpa_driver_nl80211_data *drv)
 	for (i = 0; i < drv->num_if_indices; i++) {
 		if (!drv->if_indices[i])
 			continue;
-		res = os_snprintf(pos, end - pos, " %d", drv->if_indices[i]);
+		res = os_snprintf(pos, end - pos, " %d(%d)",
+				  drv->if_indices[i],
+				  drv->if_indices_reason[i]);
 		if (os_snprintf_error(end - pos, res))
 			break;
 		pos += res;
@@ -5487,14 +5834,16 @@ static void dump_ifidx(struct wpa_driver_nl80211_data *drv)
 }
 
 
-static void add_ifidx(struct wpa_driver_nl80211_data *drv, int ifidx)
+static void add_ifidx(struct wpa_driver_nl80211_data *drv, int ifidx,
+		      int ifidx_reason)
 {
 	int i;
-	int *old;
+	int *old, *old_reason;
 
-	wpa_printf(MSG_DEBUG, "nl80211: Add own interface ifindex %d",
-		   ifidx);
-	if (have_ifidx(drv, ifidx)) {
+	wpa_printf(MSG_DEBUG,
+		   "nl80211: Add own interface ifindex %d (ifidx_reason %d)",
+		   ifidx, ifidx_reason);
+	if (have_ifidx(drv, ifidx, ifidx_reason)) {
 		wpa_printf(MSG_DEBUG, "nl80211: ifindex %d already in the list",
 			   ifidx);
 		return;
@@ -5502,6 +5851,7 @@ static void add_ifidx(struct wpa_driver_nl80211_data *drv, int ifidx)
 	for (i = 0; i < drv->num_if_indices; i++) {
 		if (drv->if_indices[i] == 0) {
 			drv->if_indices[i] = ifidx;
+			drv->if_indices_reason[i] = ifidx_reason;
 			dump_ifidx(drv);
 			return;
 		}
@@ -5512,32 +5862,57 @@ static void add_ifidx(struct wpa_driver_nl80211_data *drv, int ifidx)
 	else
 		old = NULL;
 
+	if (drv->if_indices_reason != drv->default_if_indices_reason)
+		old_reason = drv->if_indices_reason;
+	else
+		old_reason = NULL;
+
 	drv->if_indices = os_realloc_array(old, drv->num_if_indices + 1,
 					   sizeof(int));
+	drv->if_indices_reason = os_realloc_array(old_reason,
+						  drv->num_if_indices + 1,
+						  sizeof(int));
 	if (!drv->if_indices) {
 		if (!old)
 			drv->if_indices = drv->default_if_indices;
 		else
 			drv->if_indices = old;
+	}
+	if (!drv->if_indices_reason) {
+		if (!old_reason)
+			drv->if_indices_reason = drv->default_if_indices_reason;
+		else
+			drv->if_indices_reason = old_reason;
+	}
+	if (!drv->if_indices || !drv->if_indices_reason) {
 		wpa_printf(MSG_ERROR, "Failed to reallocate memory for "
 			   "interfaces");
 		wpa_printf(MSG_ERROR, "Ignoring EAPOL on interface %d", ifidx);
 		return;
-	} else if (!old)
+	}
+	if (!old)
 		os_memcpy(drv->if_indices, drv->default_if_indices,
 			  sizeof(drv->default_if_indices));
+	if (!old_reason)
+		os_memcpy(drv->if_indices_reason,
+			  drv->default_if_indices_reason,
+			  sizeof(drv->default_if_indices_reason));
 	drv->if_indices[drv->num_if_indices] = ifidx;
+	drv->if_indices_reason[drv->num_if_indices] = ifidx_reason;
 	drv->num_if_indices++;
 	dump_ifidx(drv);
 }
 
 
-static void del_ifidx(struct wpa_driver_nl80211_data *drv, int ifidx)
+static void del_ifidx(struct wpa_driver_nl80211_data *drv, int ifidx,
+		      int ifidx_reason)
 {
 	int i;
 
 	for (i = 0; i < drv->num_if_indices; i++) {
-		if (drv->if_indices[i] == ifidx) {
+		if ((drv->if_indices[i] == ifidx || ifidx == IFIDX_ANY) &&
+		    (drv->if_indices_reason[i] == ifidx_reason ||
+		     ifidx_reason == IFIDX_ANY)) {
 			drv->if_indices[i] = 0;
 			break;
 		}
@@ -5546,12 +5921,15 @@ static void del_ifidx(struct wpa_driver_nl80211_data *drv, int ifidx)
 }
 
 
-static int have_ifidx(struct wpa_driver_nl80211_data *drv, int ifidx)
+static int have_ifidx(struct wpa_driver_nl80211_data *drv, int ifidx,
+		      int ifidx_reason)
 {
 	int i;
 
 	for (i = 0; i < drv->num_if_indices; i++)
-		if (drv->if_indices[i] == ifidx)
+		if (drv->if_indices[i] == ifidx &&
+		    (drv->if_indices_reason[i] == ifidx_reason ||
+		     ifidx_reason == IFIDX_ANY))
 			return 1;
 
 	return 0;
@@ -5616,7 +5994,7 @@ static void handle_eapol(int sock, void *eloop_ctx, void *sock_ctx)
 		return;
 	}
 
-	if (have_ifidx(drv, lladdr.sll_ifindex))
+	if (have_ifidx(drv, lladdr.sll_ifindex, IFIDX_ANY))
 		drv_event_eapol_rx(drv->ctx, lladdr.sll_addr, buf, len);
 }
 
@@ -5643,7 +6021,7 @@ static int i802_check_bridge(struct wpa_driver_nl80211_data *drv,
 		}
 		bss->added_bridge = 1;
 		br_ifindex = if_nametoindex(brname);
-		add_ifidx(drv, br_ifindex);
+		add_ifidx(drv, br_ifindex, drv->ifindex);
 	}
 	bss->br_ifindex = br_ifindex;
 
@@ -5705,7 +6083,15 @@ static void *i802_init(struct hostapd_data *hapd,
 		wpa_printf(MSG_DEBUG, "nl80211: Interface %s is in master %s",
 			params->ifname, master_ifname);
 		/* start listening for EAPOL on the master interface */
-		add_ifidx(drv, if_nametoindex(master_ifname));
+		add_ifidx(drv, if_nametoindex(master_ifname), drv->ifindex);
+
+		/* check if master itself is under bridge */
+		if (linux_br_get(master_ifname, master_ifname) == 0) {
+			wpa_printf(MSG_DEBUG, "nl80211: which is in bridge %s",
+				   master_ifname);
+			br_ifindex = if_nametoindex(master_ifname);
+			os_strlcpy(bss->brname, master_ifname, IFNAMSIZ);
+		}
 	} else {
 		master_ifname[0] = '\0';
 	}
@@ -5716,14 +6102,14 @@ static void *i802_init(struct hostapd_data *hapd,
 		if (params->bridge[i]) {
 			ifindex = if_nametoindex(params->bridge[i]);
 			if (ifindex)
-				add_ifidx(drv, ifindex);
+				add_ifidx(drv, ifindex, drv->ifindex);
 			if (ifindex == br_ifindex)
 				br_added = 1;
 		}
 	}
 
 	/* start listening for EAPOL on the default AP interface */
-	add_ifidx(drv, drv->ifindex);
+	add_ifidx(drv, drv->ifindex, IFIDX_ANY);
 
 	if (params->num_bridge && params->bridge[0]) {
 		if (i802_check_bridge(drv, bss, params->bridge[0],
@@ -5735,7 +6121,7 @@ static void *i802_init(struct hostapd_data *hapd,
 
 	if (!br_added && br_ifindex &&
 	    (params->num_bridge == 0 || !params->bridge[0]))
-		add_ifidx(drv, br_ifindex);
+		add_ifidx(drv, br_ifindex, drv->ifindex);
 
 #ifdef CONFIG_LIBNL3_ROUTE
 	if (bss->added_if_into_bridge) {
@@ -5880,7 +6266,8 @@ static int wpa_driver_nl80211_if_add(void *priv, enum wpa_driver_if_type type,
 				     const char *ifname, const u8 *addr,
 				     void *bss_ctx, void **drv_priv,
 				     char *force_ifname, u8 *if_addr,
-				     const char *bridge, int use_existing)
+				     const char *bridge, int use_existing,
+				     int setup_ap)
 {
 	enum nl80211_iftype nlmode;
 	struct i802_bss *bss = priv;
@@ -5964,7 +6351,7 @@ static int wpa_driver_nl80211_if_add(void *priv, enum wpa_driver_if_type type,
 		os_memcpy(if_addr, new_addr, ETH_ALEN);
 	}
 
-	if (type == WPA_IF_AP_BSS) {
+	if (type == WPA_IF_AP_BSS && setup_ap) {
 		struct i802_bss *new_bss = os_zalloc(sizeof(*new_bss));
 		if (new_bss == NULL) {
 			if (added)
@@ -6020,7 +6407,7 @@ static int wpa_driver_nl80211_if_add(void *priv, enum wpa_driver_if_type type,
 	     nlmode == NL80211_IFTYPE_AP_VLAN ||
 	     nlmode == NL80211_IFTYPE_WDS ||
 	     nlmode == NL80211_IFTYPE_MONITOR))
-		add_ifidx(drv, ifidx);
+		add_ifidx(drv, ifidx, IFIDX_ANY);
 
 	return 0;
 }
@@ -6040,8 +6427,10 @@ static int wpa_driver_nl80211_if_remove(struct i802_bss *bss,
 	else if (ifindex > 0 && !bss->added_if) {
 		struct wpa_driver_nl80211_data *drv2;
 		dl_list_for_each(drv2, &drv->global->interfaces,
-				 struct wpa_driver_nl80211_data, list)
-			del_ifidx(drv2, ifindex);
+				 struct wpa_driver_nl80211_data, list) {
+			del_ifidx(drv2, ifindex, IFIDX_ANY);
+			del_ifidx(drv2, IFIDX_ANY, ifindex);
+		}
 	}
 
 	if (type != WPA_IF_AP_BSS)
@@ -6119,7 +6508,8 @@ static int nl80211_send_frame_cmd(struct i802_bss *bss,
 				  unsigned int freq, unsigned int wait,
 				  const u8 *buf, size_t buf_len,
 				  u64 *cookie_out, int no_cck, int no_ack,
-				  int offchanok)
+				  int offchanok, const u16 *csa_offs,
+				  size_t csa_offs_len)
 {
 	struct wpa_driver_nl80211_data *drv = bss->drv;
 	struct nl_msg *msg;
@@ -6139,6 +6529,8 @@ static int nl80211_send_frame_cmd(struct i802_bss *bss,
 	     nla_put_flag(msg, NL80211_ATTR_OFFCHANNEL_TX_OK)) ||
 	    (no_cck && nla_put_flag(msg, NL80211_ATTR_TX_NO_CCK_RATE)) ||
 	    (no_ack && nla_put_flag(msg, NL80211_ATTR_DONT_WAIT_FOR_ACK)) ||
+	    (csa_offs && nla_put(msg, NL80211_ATTR_CSA_C_OFFSETS_TX,
+				 csa_offs_len * sizeof(u16), csa_offs)) ||
 	    nla_put(msg, NL80211_ATTR_FRAME, buf_len, buf))
 		goto fail;
 
@@ -6156,6 +6548,20 @@ static int nl80211_send_frame_cmd(struct i802_bss *bss,
 
 		if (cookie_out)
 			*cookie_out = no_ack ? (u64) -1 : cookie;
+
+		if (drv->num_send_action_cookies == MAX_SEND_ACTION_COOKIES) {
+			wpa_printf(MSG_DEBUG,
+				   "nl80211: Drop oldest pending send action cookie 0x%llx",
+				   (long long unsigned int)
+				   drv->send_action_cookies[0]);
+			os_memmove(&drv->send_action_cookies[0],
+				   &drv->send_action_cookies[1],
+				   (MAX_SEND_ACTION_COOKIES - 1) *
+				   sizeof(u64));
+			drv->num_send_action_cookies--;
+		}
+		drv->send_action_cookies[drv->num_send_action_cookies] = cookie;
+		drv->num_send_action_cookies++;
 	}
 
 fail:
@@ -6198,29 +6604,28 @@ static int wpa_driver_nl80211_send_action(struct i802_bss *bss,
 	     !drv->use_monitor))
 		ret = wpa_driver_nl80211_send_mlme(bss, buf, 24 + data_len,
 						   0, freq, no_cck, 1,
-						   wait_time);
+						   wait_time, NULL, 0);
 	else
 		ret = nl80211_send_frame_cmd(bss, freq, wait_time, buf,
 					     24 + data_len,
 					     &drv->send_action_cookie,
-					     no_cck, 0, 1);
+					     no_cck, 0, 1, NULL, 0);
 
 	os_free(buf);
 	return ret;
 }
 
 
-static void wpa_driver_nl80211_send_action_cancel_wait(void *priv)
+static void nl80211_frame_wait_cancel(struct i802_bss *bss, u64 cookie)
 {
-	struct i802_bss *bss = priv;
 	struct wpa_driver_nl80211_data *drv = bss->drv;
 	struct nl_msg *msg;
 	int ret;
 
 	wpa_printf(MSG_DEBUG, "nl80211: Cancel TX frame wait: cookie=0x%llx",
-		   (long long unsigned int) drv->send_action_cookie);
+		   (long long unsigned int) cookie);
 	if (!(msg = nl80211_cmd_msg(bss, 0, NL80211_CMD_FRAME_WAIT_CANCEL)) ||
-	    nla_put_u64(msg, NL80211_ATTR_COOKIE, drv->send_action_cookie)) {
+	    nla_put_u64(msg, NL80211_ATTR_COOKIE, cookie)) {
 		nlmsg_free(msg);
 		return;
 	}
@@ -6232,6 +6637,30 @@ static void wpa_driver_nl80211_send_action_cancel_wait(void *priv)
 }
 
 
+static void wpa_driver_nl80211_send_action_cancel_wait(void *priv)
+{
+	struct i802_bss *bss = priv;
+	struct wpa_driver_nl80211_data *drv = bss->drv;
+	unsigned int i;
+	u64 cookie;
+
+	/* Cancel the last pending TX cookie */
+	nl80211_frame_wait_cancel(bss, drv->send_action_cookie);
+
+	/*
+	 * Cancel the other pending TX cookies, if any. This is needed since
+	 * the driver may keep a list of all pending offchannel TX operations
+	 * and free up the radio only once they have expired or cancelled.
+	 */
+	for (i = drv->num_send_action_cookies; i > 0; i--) {
+		cookie = drv->send_action_cookies[i - 1];
+		if (cookie != drv->send_action_cookie)
+			nl80211_frame_wait_cancel(bss, cookie);
+	}
+	drv->num_send_action_cookies = 0;
+}
+
+
 static int wpa_driver_nl80211_remain_on_channel(void *priv, unsigned int freq,
 						unsigned int duration)
 {
@@ -6454,9 +6883,13 @@ static int wpa_driver_nl80211_deinit_p2p_cli(void *priv)
 static void wpa_driver_nl80211_resume(void *priv)
 {
 	struct i802_bss *bss = priv;
+	enum nl80211_iftype nlmode = nl80211_get_ifmode(bss);
 
 	if (i802_set_iface_flags(bss, 1))
 		wpa_printf(MSG_DEBUG, "nl80211: Failed to set interface up on resume event");
+
+	if (is_p2p_net_interface(nlmode))
+		nl80211_disable_11b_rates(bss->drv, bss->drv->ifindex, 1);
 }
 
 
@@ -6529,8 +6962,12 @@ static int nl80211_signal_poll(void *priv, struct wpa_signal_info *si)
 
 	os_memset(si, 0, sizeof(*si));
 	res = nl80211_get_link_signal(drv, si);
-	if (res != 0)
-		return res;
+	if (res) {
+		if (drv->nlmode != NL80211_IFTYPE_ADHOC &&
+		    drv->nlmode != NL80211_IFTYPE_MESH_POINT)
+			return res;
+		si->current_signal = 0;
+	}
 
 	res = nl80211_get_channel_width(drv, si);
 	if (res != 0)
@@ -6545,21 +6982,21 @@ static int nl80211_send_frame(void *priv, const u8 *data, size_t data_len,
 {
 	struct i802_bss *bss = priv;
 	return wpa_driver_nl80211_send_frame(bss, data, data_len, encrypt, 0,
-					     0, 0, 0, 0);
+					     0, 0, 0, 0, NULL, 0);
 }
 
 
 static int nl80211_set_param(void *priv, const char *param)
 {
-	wpa_printf(MSG_DEBUG, "nl80211: driver param='%s'", param);
+	struct i802_bss *bss = priv;
+	struct wpa_driver_nl80211_data *drv = bss->drv;
+
 	if (param == NULL)
 		return 0;
+	wpa_printf(MSG_DEBUG, "nl80211: driver param='%s'", param);
 
 #ifdef CONFIG_P2P
 	if (os_strstr(param, "use_p2p_group_interface=1")) {
-		struct i802_bss *bss = priv;
-		struct wpa_driver_nl80211_data *drv = bss->drv;
-
 		wpa_printf(MSG_DEBUG, "nl80211: Use separate P2P group "
 			   "interface");
 		drv->capa.flags |= WPA_DRIVER_FLAGS_P2P_CONCURRENT;
@@ -6567,22 +7004,18 @@ static int nl80211_set_param(void *priv, const char *param)
 	}
 #endif /* CONFIG_P2P */
 
-	if (os_strstr(param, "use_monitor=1")) {
-		struct i802_bss *bss = priv;
-		struct wpa_driver_nl80211_data *drv = bss->drv;
+	if (os_strstr(param, "use_monitor=1"))
 		drv->use_monitor = 1;
-	}
 
 	if (os_strstr(param, "force_connect_cmd=1")) {
-		struct i802_bss *bss = priv;
-		struct wpa_driver_nl80211_data *drv = bss->drv;
 		drv->capa.flags &= ~WPA_DRIVER_FLAGS_SME;
 		drv->force_connect_cmd = 1;
 	}
 
+	if (os_strstr(param, "force_bss_selection=1"))
+		drv->capa.flags |= WPA_DRIVER_FLAGS_BSS_SELECTION;
+
 	if (os_strstr(param, "no_offchannel_tx=1")) {
-		struct i802_bss *bss = priv;
-		struct wpa_driver_nl80211_data *drv = bss->drv;
 		drv->capa.flags &= ~WPA_DRIVER_FLAGS_OFFCHANNEL_TX;
 		drv->test_use_roc_tx = 1;
 	}
@@ -6591,7 +7024,7 @@ static int nl80211_set_param(void *priv, const char *param)
 }
 
 
-static void * nl80211_global_init(void)
+static void * nl80211_global_init(void *ctx)
 {
 	struct nl80211_global *global;
 	struct netlink_config *cfg;
@@ -6599,6 +7032,7 @@ static void * nl80211_global_init(void)
 	global = os_zalloc(sizeof(*global));
 	if (global == NULL)
 		return NULL;
+	global->ctx = ctx;
 	global->ioctl_sock = -1;
 	dl_list_init(&global->interfaces);
 	global->if_add_ifindex = -1;
@@ -6954,7 +7388,7 @@ static void nl80211_send_null_frame(struct i802_bss *bss, const u8 *own_addr,
 	os_memcpy(nulldata.hdr.IEEE80211_SA_FROMDS, own_addr, ETH_ALEN);
 
 	if (wpa_driver_nl80211_send_mlme(bss, (u8 *) &nulldata, size, 0, 0, 0,
-					 0, 0) < 0)
+					 0, 0, NULL, 0) < 0)
 		wpa_printf(MSG_DEBUG, "nl80211_send_null_frame: Failed to "
 			   "send poll frame");
 }
@@ -7224,6 +7658,19 @@ static int driver_nl80211_scan2(void *priv,
 				struct wpa_driver_scan_params *params)
 {
 	struct i802_bss *bss = priv;
+#ifdef CONFIG_DRIVER_NL80211_QCA
+	struct wpa_driver_nl80211_data *drv = bss->drv;
+
+	/*
+	 * Do a vendor specific scan if possible. If only_new_results is
+	 * set, do a normal scan since a kernel (cfg80211) BSS cache flush
+	 * cannot be achieved through a vendor scan. The below condition may
+	 * need to be modified if new scan flags are added in the future whose
+	 * functionality can only be achieved through a normal scan.
+	 */
+	if (drv->scan_vendor_cmd_avail && !params->only_new_results)
+		return wpa_driver_nl80211_vendor_scan(bss, params);
+#endif /* CONFIG_DRIVER_NL80211_QCA */
 	return wpa_driver_nl80211_scan(bss, params);
 }
 
@@ -7261,11 +7708,13 @@ static int driver_nl80211_if_remove(void *priv, enum wpa_driver_if_type type,
 
 static int driver_nl80211_send_mlme(void *priv, const u8 *data,
 				    size_t data_len, int noack,
-				    unsigned int freq)
+				    unsigned int freq,
+				    const u16 *csa_offs, size_t csa_offs_len)
 {
 	struct i802_bss *bss = priv;
 	return wpa_driver_nl80211_send_mlme(bss, data, data_len, noack,
-					    freq, 0, 0, 0);
+					    freq, 0, 0, 0, csa_offs,
+					    csa_offs_len);
 }
 
 
@@ -7340,7 +7789,7 @@ static int wpa_driver_nl80211_update_ft_ies(void *priv, const u8 *md,
 }
 
 
-const u8 * wpa_driver_nl80211_get_macaddr(void *priv)
+static const u8 * wpa_driver_nl80211_get_macaddr(void *priv)
 {
 	struct i802_bss *bss = priv;
 	struct wpa_driver_nl80211_data *drv = bss->drv;
@@ -7495,7 +7944,10 @@ static int wpa_driver_nl80211_status(void *priv, char *buf, size_t buflen)
 				  "capa.mac_addr_rand_scan_supported=%d\n"
 				  "capa.conc_capab=%u\n"
 				  "capa.max_conc_chan_2_4=%u\n"
-				  "capa.max_conc_chan_5_0=%u\n",
+				  "capa.max_conc_chan_5_0=%u\n"
+				  "capa.max_sched_scan_plans=%u\n"
+				  "capa.max_sched_scan_plan_interval=%u\n"
+				  "capa.max_sched_scan_plan_iterations=%u\n",
 				  drv->capa.key_mgmt,
 				  drv->capa.enc,
 				  drv->capa.auth,
@@ -7514,7 +7966,10 @@ static int wpa_driver_nl80211_status(void *priv, char *buf, size_t buflen)
 				  drv->capa.mac_addr_rand_scan_supported,
 				  drv->capa.conc_capab,
 				  drv->capa.max_conc_chan_2_4,
-				  drv->capa.max_conc_chan_5_0);
+				  drv->capa.max_conc_chan_5_0,
+				  drv->capa.max_sched_scan_plans,
+				  drv->capa.max_sched_scan_plan_interval,
+				  drv->capa.max_sched_scan_plan_iterations);
 		if (os_snprintf_error(end - pos, res))
 			return pos - buf;
 		pos += res;
@@ -7557,6 +8012,8 @@ static int nl80211_switch_channel(void *priv, struct csa_settings *settings)
 	struct wpa_driver_nl80211_data *drv = bss->drv;
 	struct nlattr *beacon_csa;
 	int ret = -ENOBUFS;
+	int csa_off_len = 0;
+	int i;
 
 	wpa_printf(MSG_DEBUG, "nl80211: Channel switch request (cs_count=%u block_tx=%u freq=%d width=%d cf1=%d cf2=%d)",
 		   settings->cs_count, settings->block_tx,
@@ -7573,21 +8030,57 @@ static int nl80211_switch_channel(void *priv, struct csa_settings *settings)
 	    (drv->nlmode != NL80211_IFTYPE_P2P_GO))
 		return -EOPNOTSUPP;
 
-	/* check settings validity */
-	if (!settings->beacon_csa.tail ||
-	    ((settings->beacon_csa.tail_len <=
-	      settings->counter_offset_beacon) ||
-	     (settings->beacon_csa.tail[settings->counter_offset_beacon] !=
-	      settings->cs_count)))
+	/*
+	 * Remove empty counters, assuming Probe Response and Beacon frame
+	 * counters match. This implementation assumes that there are only two
+	 * counters.
+	 */
+	if (settings->counter_offset_beacon[0] &&
+	    !settings->counter_offset_beacon[1]) {
+		csa_off_len = 1;
+	} else if (settings->counter_offset_beacon[1] &&
+		   !settings->counter_offset_beacon[0]) {
+		csa_off_len = 1;
+		settings->counter_offset_beacon[0] =
+			settings->counter_offset_beacon[1];
+		settings->counter_offset_presp[0] =
+			settings->counter_offset_presp[1];
+	} else if (settings->counter_offset_beacon[1] &&
+		   settings->counter_offset_beacon[0]) {
+		csa_off_len = 2;
+	} else {
+		wpa_printf(MSG_ERROR, "nl80211: No CSA counters provided");
+		return -EINVAL;
+	}
+
+	/* Check CSA counters validity */
+	if (drv->capa.max_csa_counters &&
+	    csa_off_len > drv->capa.max_csa_counters) {
+		wpa_printf(MSG_ERROR,
+			   "nl80211: Too many CSA counters provided");
 		return -EINVAL;
+	}
 
-	if (settings->beacon_csa.probe_resp &&
-	    ((settings->beacon_csa.probe_resp_len <=
-	      settings->counter_offset_presp) ||
-	     (settings->beacon_csa.probe_resp[settings->counter_offset_presp] !=
-	      settings->cs_count)))
+	if (!settings->beacon_csa.tail)
 		return -EINVAL;
 
+	for (i = 0; i < csa_off_len; i++) {
+		u16 csa_c_off_bcn = settings->counter_offset_beacon[i];
+		u16 csa_c_off_presp = settings->counter_offset_presp[i];
+
+		if ((settings->beacon_csa.tail_len <= csa_c_off_bcn) ||
+		    (settings->beacon_csa.tail[csa_c_off_bcn] !=
+		     settings->cs_count))
+			return -EINVAL;
+
+		if (settings->beacon_csa.probe_resp &&
+		    ((settings->beacon_csa.probe_resp_len <=
+		      csa_c_off_presp) ||
+		     (settings->beacon_csa.probe_resp[csa_c_off_presp] !=
+		      settings->cs_count)))
+			return -EINVAL;
+	}
+
 	if (!(msg = nl80211_bss_msg(bss, 0, NL80211_CMD_CHANNEL_SWITCH)) ||
 	    nla_put_u32(msg, NL80211_ATTR_CH_SWITCH_COUNT,
 			settings->cs_count) ||
@@ -7610,11 +8103,13 @@ static int nl80211_switch_channel(void *priv, struct csa_settings *settings)
 	if (ret)
 		goto error;
 
-	if (nla_put_u16(msg, NL80211_ATTR_CSA_C_OFF_BEACON,
-			settings->counter_offset_beacon) ||
+	if (nla_put(msg, NL80211_ATTR_CSA_C_OFF_BEACON,
+		    csa_off_len * sizeof(u16),
+		    settings->counter_offset_beacon) ||
 	    (settings->beacon_csa.probe_resp &&
-	     nla_put_u16(msg, NL80211_ATTR_CSA_C_OFF_PRESP,
-			 settings->counter_offset_presp)))
+	     nla_put(msg, NL80211_ATTR_CSA_C_OFF_PRESP,
+		     csa_off_len * sizeof(u16),
+		     settings->counter_offset_presp)))
 		goto fail;
 
 	nla_nest_end(msg, beacon_csa);
@@ -7860,6 +8355,7 @@ static int nl80211_set_wowlan(void *priv,
 }
 
 
+#ifdef CONFIG_DRIVER_NL80211_QCA
 static int nl80211_roaming(void *priv, int allowed, const u8 *bssid)
 {
 	struct i802_bss *bss = priv;
@@ -7892,6 +8388,7 @@ static int nl80211_roaming(void *priv, int allowed, const u8 *bssid)
 
 	return send_and_recv_msgs(drv, msg, NULL, NULL);
 }
+#endif /* CONFIG_DRIVER_NL80211_QCA */
 
 
 static int nl80211_set_mac_addr(void *priv, const u8 *addr)
@@ -7900,6 +8397,9 @@ static int nl80211_set_mac_addr(void *priv, const u8 *addr)
 	struct wpa_driver_nl80211_data *drv = bss->drv;
 	int new_addr = addr != NULL;
 
+	if (TEST_FAIL())
+		return -1;
+
 	if (!addr)
 		addr = drv->perm_addr;
 
@@ -7960,6 +8460,46 @@ static int nl80211_put_mesh_id(struct nl_msg *msg, const u8 *mesh_id,
 }
 
 
+static int nl80211_put_mesh_config(struct nl_msg *msg,
+				   struct wpa_driver_mesh_bss_params *params)
+{
+	struct nlattr *container;
+
+	container = nla_nest_start(msg, NL80211_ATTR_MESH_CONFIG);
+	if (!container)
+		return -1;
+
+	if (((params->flags & WPA_DRIVER_MESH_CONF_FLAG_AUTO_PLINKS) &&
+	     nla_put_u32(msg, NL80211_MESHCONF_AUTO_OPEN_PLINKS,
+			 params->auto_plinks)) ||
+	    ((params->flags & WPA_DRIVER_MESH_CONF_FLAG_MAX_PEER_LINKS) &&
+	     nla_put_u16(msg, NL80211_MESHCONF_MAX_PEER_LINKS,
+			 params->max_peer_links)))
+		return -1;
+
+	/*
+	 * Set NL80211_MESHCONF_PLINK_TIMEOUT even if user mpm is used because
+	 * the timer could disconnect stations even in that case.
+	 */
+	if ((params->flags & WPA_DRIVER_MESH_CONF_FLAG_PEER_LINK_TIMEOUT) &&
+	    nla_put_u32(msg, NL80211_MESHCONF_PLINK_TIMEOUT,
+			params->peer_link_timeout)) {
+		wpa_printf(MSG_ERROR, "nl80211: Failed to set PLINK_TIMEOUT");
+		return -1;
+	}
+
+	if ((params->flags & WPA_DRIVER_MESH_CONF_FLAG_HT_OP_MODE) &&
+	    nla_put_u16(msg, NL80211_MESHCONF_HT_OPMODE, params->ht_opmode)) {
+		wpa_printf(MSG_ERROR, "nl80211: Failed to set HT_OP_MODE");
+		return -1;
+	}
+
+	nla_nest_end(msg, container);
+
+	return 0;
+}
+
+
 static int nl80211_join_mesh(struct i802_bss *bss,
 			     struct wpa_driver_mesh_join_params *params)
 {
@@ -7974,7 +8514,8 @@ static int nl80211_join_mesh(struct i802_bss *bss,
 	    nl80211_put_freq_params(msg, &params->freq) ||
 	    nl80211_put_basic_rates(msg, params->basic_rates) ||
 	    nl80211_put_mesh_id(msg, params->meshid, params->meshid_len) ||
-	    nl80211_put_beacon_int(msg, params->beacon_int))
+	    nl80211_put_beacon_int(msg, params->beacon_int) ||
+	    nl80211_put_dtim_period(msg, params->dtim_period))
 		goto fail;
 
 	wpa_printf(MSG_DEBUG, "  * flags=%08X", params->flags);
@@ -8003,30 +8544,12 @@ static int nl80211_join_mesh(struct i802_bss *bss,
 		goto fail;
 	nla_nest_end(msg, container);
 
-	container = nla_nest_start(msg, NL80211_ATTR_MESH_CONFIG);
-	if (!container)
+	params->conf.flags |= WPA_DRIVER_MESH_CONF_FLAG_AUTO_PLINKS;
+	params->conf.flags |= WPA_DRIVER_MESH_CONF_FLAG_PEER_LINK_TIMEOUT;
+	params->conf.flags |= WPA_DRIVER_MESH_CONF_FLAG_MAX_PEER_LINKS;
+	if (nl80211_put_mesh_config(msg, &params->conf) < 0)
 		goto fail;
 
-	if (!(params->conf.flags & WPA_DRIVER_MESH_CONF_FLAG_AUTO_PLINKS) &&
-	    nla_put_u32(msg, NL80211_MESHCONF_AUTO_OPEN_PLINKS, 0))
-		goto fail;
-	if ((params->conf.flags & WPA_DRIVER_MESH_FLAG_DRIVER_MPM) &&
-	    nla_put_u16(msg, NL80211_MESHCONF_MAX_PEER_LINKS,
-			params->max_peer_links))
-		goto fail;
-
-	/*
-	 * Set NL80211_MESHCONF_PLINK_TIMEOUT even if user mpm is used because
-	 * the timer could disconnect stations even in that case.
-	 */
-	if (nla_put_u32(msg, NL80211_MESHCONF_PLINK_TIMEOUT,
-			params->conf.peer_link_timeout)) {
-		wpa_printf(MSG_ERROR, "nl80211: Failed to set PLINK_TIMEOUT");
-		goto fail;
-	}
-
-	nla_nest_end(msg, container);
-
 	ret = send_and_recv_msgs(drv, msg, NULL, NULL);
 	msg = NULL;
 	if (ret) {
@@ -8035,7 +8558,7 @@ static int nl80211_join_mesh(struct i802_bss *bss,
 		goto fail;
 	}
 	ret = 0;
-	bss->freq = params->freq.freq;
+	drv->assoc_freq = bss->freq = params->freq.freq;
 	wpa_printf(MSG_DEBUG, "nl80211: mesh join request send successfully");
 
 fail:
@@ -8376,6 +8899,8 @@ set_val:
 }
 
 
+#ifdef CONFIG_DRIVER_NL80211_QCA
+
 static int hw_mode_to_qca_acs(enum hostapd_hw_mode hw_mode)
 {
 	switch (hw_mode) {
@@ -8700,6 +9225,215 @@ static int nl80211_set_prob_oper_freq(void *priv, unsigned int freq)
 }
 
 
+static int nl80211_p2p_lo_start(void *priv, unsigned int freq,
+				unsigned int period, unsigned int interval,
+				unsigned int count, const u8 *device_types,
+				size_t dev_types_len,
+				const u8 *ies, size_t ies_len)
+{
+	struct i802_bss *bss = priv;
+	struct wpa_driver_nl80211_data *drv = bss->drv;
+	struct nl_msg *msg;
+	struct nlattr *container;
+	int ret;
+
+	wpa_printf(MSG_DEBUG,
+		   "nl80211: Start P2P Listen offload: freq=%u, period=%u, interval=%u, count=%u",
+		   freq, period, interval, count);
+
+	if (!(drv->capa.flags & WPA_DRIVER_FLAGS_P2P_LISTEN_OFFLOAD))
+		return -1;
+
+	if (!(msg = nl80211_drv_msg(drv, 0, NL80211_CMD_VENDOR)) ||
+	    nla_put_u32(msg, NL80211_ATTR_VENDOR_ID, OUI_QCA) ||
+	    nla_put_u32(msg, NL80211_ATTR_VENDOR_SUBCMD,
+			QCA_NL80211_VENDOR_SUBCMD_P2P_LISTEN_OFFLOAD_START))
+		goto fail;
+
+	container = nla_nest_start(msg, NL80211_ATTR_VENDOR_DATA);
+	if (!container)
+		goto fail;
+
+	if (nla_put_u32(msg, QCA_WLAN_VENDOR_ATTR_P2P_LISTEN_OFFLOAD_CHANNEL,
+			freq) ||
+	    nla_put_u32(msg, QCA_WLAN_VENDOR_ATTR_P2P_LISTEN_OFFLOAD_PERIOD,
+			period) ||
+	    nla_put_u32(msg, QCA_WLAN_VENDOR_ATTR_P2P_LISTEN_OFFLOAD_INTERVAL,
+			interval) ||
+	    nla_put_u32(msg, QCA_WLAN_VENDOR_ATTR_P2P_LISTEN_OFFLOAD_COUNT,
+			count) ||
+	    nla_put(msg, QCA_WLAN_VENDOR_ATTR_P2P_LISTEN_OFFLOAD_DEVICE_TYPES,
+		    dev_types_len, device_types) ||
+	    nla_put(msg, QCA_WLAN_VENDOR_ATTR_P2P_LISTEN_OFFLOAD_VENDOR_IE,
+		    ies_len, ies))
+		goto fail;
+
+	nla_nest_end(msg, container);
+	ret = send_and_recv_msgs(drv, msg, NULL, NULL);
+	msg = NULL;
+	if (ret) {
+		wpa_printf(MSG_DEBUG,
+			   "nl80211: Failed to send P2P Listen offload vendor command");
+		goto fail;
+	}
+
+	return 0;
+
+fail:
+	nlmsg_free(msg);
+	return -1;
+}
+
+
+static int nl80211_p2p_lo_stop(void *priv)
+{
+	struct i802_bss *bss = priv;
+	struct wpa_driver_nl80211_data *drv = bss->drv;
+	struct nl_msg *msg;
+
+	wpa_printf(MSG_DEBUG, "nl80211: Stop P2P Listen offload");
+
+	if (!(drv->capa.flags & WPA_DRIVER_FLAGS_P2P_LISTEN_OFFLOAD))
+		return -1;
+
+	if (!(msg = nl80211_drv_msg(drv, 0, NL80211_CMD_VENDOR)) ||
+	    nla_put_u32(msg, NL80211_ATTR_VENDOR_ID, OUI_QCA) ||
+	    nla_put_u32(msg, NL80211_ATTR_VENDOR_SUBCMD,
+			QCA_NL80211_VENDOR_SUBCMD_P2P_LISTEN_OFFLOAD_STOP)) {
+		nlmsg_free(msg);
+		return -1;
+	}
+
+	return send_and_recv_msgs(drv, msg, NULL, NULL);
+}
+
+#endif /* CONFIG_DRIVER_NL80211_QCA */
+
+
+static int nl80211_write_to_file(const char *name, unsigned int val)
+{
+	int fd, len;
+	char tmp[128];
+
+	fd = open(name, O_RDWR);
+	if (fd < 0) {
+		wpa_printf(MSG_ERROR, "nl80211: Failed to open %s: %s",
+			   name, strerror(errno));
+		return fd;
+	}
+
+	len = os_snprintf(tmp, sizeof(tmp), "%u\n", val);
+	len = write(fd, tmp, len);
+	if (len < 0)
+		wpa_printf(MSG_ERROR, "nl80211: Failed to write to %s: %s",
+			   name, strerror(errno));
+	close(fd);
+
+	return 0;
+}
+
+
+static int nl80211_configure_data_frame_filters(void *priv, u32 filter_flags)
+{
+	struct i802_bss *bss = priv;
+	char path[128];
+	int ret;
+
+	wpa_printf(MSG_DEBUG, "nl80211: Data frame filter flags=0x%x",
+		   filter_flags);
+
+	/* Configure filtering of unicast frame encrypted using GTK */
+	ret = os_snprintf(path, sizeof(path),
+			  "/proc/sys/net/ipv4/conf/%s/drop_unicast_in_l2_multicast",
+			  bss->ifname);
+	if (os_snprintf_error(sizeof(path), ret))
+		return -1;
+
+	ret = nl80211_write_to_file(path,
+				    !!(filter_flags &
+				       WPA_DATA_FRAME_FILTER_FLAG_GTK));
+	if (ret) {
+		wpa_printf(MSG_ERROR,
+			   "nl80211: Failed to set IPv4 unicast in multicast filter");
+		return ret;
+	}
+
+	os_snprintf(path, sizeof(path),
+		    "/proc/sys/net/ipv6/conf/%s/drop_unicast_in_l2_multicast",
+		    bss->ifname);
+	ret = nl80211_write_to_file(path,
+				    !!(filter_flags &
+				       WPA_DATA_FRAME_FILTER_FLAG_GTK));
+
+	if (ret) {
+		wpa_printf(MSG_ERROR,
+			   "nl80211: Failed to set IPv6 unicast in multicast filter");
+		return ret;
+	}
+
+	/* Configure filtering of unicast frame encrypted using GTK */
+	os_snprintf(path, sizeof(path),
+		    "/proc/sys/net/ipv4/conf/%s/drop_gratuitous_arp",
+		    bss->ifname);
+	ret = nl80211_write_to_file(path,
+				    !!(filter_flags &
+				       WPA_DATA_FRAME_FILTER_FLAG_ARP));
+	if (ret) {
+		wpa_printf(MSG_ERROR,
+			   "nl80211: Failed set gratuitous ARP filter");
+		return ret;
+	}
+
+	/* Configure filtering of IPv6 NA frames */
+	os_snprintf(path, sizeof(path),
+		    "/proc/sys/net/ipv6/conf/%s/drop_unsolicited_na",
+		    bss->ifname);
+	ret = nl80211_write_to_file(path,
+				    !!(filter_flags &
+				       WPA_DATA_FRAME_FILTER_FLAG_NA));
+	if (ret) {
+		wpa_printf(MSG_ERROR,
+			   "nl80211: Failed to set unsolicited NA filter");
+		return ret;
+	}
+
+	return 0;
+}
+
+
+static int nl80211_get_ext_capab(void *priv, enum wpa_driver_if_type type,
+				 const u8 **ext_capa, const u8 **ext_capa_mask,
+				 unsigned int *ext_capa_len)
+{
+	struct i802_bss *bss = priv;
+	struct wpa_driver_nl80211_data *drv = bss->drv;
+	enum nl80211_iftype nlmode;
+	unsigned int i;
+
+	if (!ext_capa || !ext_capa_mask || !ext_capa_len)
+		return -1;
+
+	nlmode = wpa_driver_nl80211_if_type(type);
+
+	/* By default, use the per-radio values */
+	*ext_capa = drv->extended_capa;
+	*ext_capa_mask = drv->extended_capa_mask;
+	*ext_capa_len = drv->extended_capa_len;
+
+	/* Replace the default value if a per-interface type value exists */
+	for (i = 0; i < drv->num_iface_ext_capa; i++) {
+		if (nlmode == drv->iface_ext_capa[i].iftype) {
+			*ext_capa = drv->iface_ext_capa[i].ext_capa;
+			*ext_capa_mask = drv->iface_ext_capa[i].ext_capa_mask;
+			*ext_capa_len = drv->iface_ext_capa[i].ext_capa_len;
+			break;
+		}
+	}
+
+	return 0;
+}
+
+
 const struct wpa_driver_ops wpa_driver_nl80211_ops = {
 	.name = "nl80211",
 	.desc = "Linux nl80211/cfg80211",
@@ -8710,6 +9444,7 @@ const struct wpa_driver_ops wpa_driver_nl80211_ops = {
 	.sched_scan = wpa_driver_nl80211_sched_scan,
 	.stop_sched_scan = wpa_driver_nl80211_stop_sched_scan,
 	.get_scan_results2 = wpa_driver_nl80211_get_scan_results,
+	.abort_scan = wpa_driver_nl80211_abort_scan,
 	.deauthenticate = driver_nl80211_deauthenticate,
 	.authenticate = driver_nl80211_authenticate,
 	.associate = wpa_driver_nl80211_associate,
@@ -8793,7 +9528,6 @@ const struct wpa_driver_ops wpa_driver_nl80211_ops = {
 	.vendor_cmd = nl80211_vendor_cmd,
 	.set_qos_map = nl80211_set_qos_map,
 	.set_wowlan = nl80211_set_wowlan,
-	.roaming = nl80211_roaming,
 	.set_mac_addr = nl80211_set_mac_addr,
 #ifdef CONFIG_MESH
 	.init_mesh = wpa_driver_nl80211_init_mesh,
@@ -8806,8 +9540,17 @@ const struct wpa_driver_ops wpa_driver_nl80211_ops = {
 	.br_set_net_param = wpa_driver_br_set_net_param,
 	.add_tx_ts = nl80211_add_ts,
 	.del_tx_ts = nl80211_del_ts,
+	.get_ifindex = nl80211_get_ifindex,
+#ifdef CONFIG_DRIVER_NL80211_QCA
+	.roaming = nl80211_roaming,
 	.do_acs = wpa_driver_do_acs,
 	.set_band = nl80211_set_band,
 	.get_pref_freq_list = nl80211_get_pref_freq_list,
 	.set_prob_oper_freq = nl80211_set_prob_oper_freq,
+	.p2p_lo_start = nl80211_p2p_lo_start,
+	.p2p_lo_stop = nl80211_p2p_lo_stop,
+	.set_default_scan_ies = nl80211_set_default_scan_ies,
+#endif /* CONFIG_DRIVER_NL80211_QCA */
+	.configure_data_frame_filters = nl80211_configure_data_frame_filters,
+	.get_ext_capab = nl80211_get_ext_capab,
 };
diff --git a/src/drivers/driver_nl80211.h b/src/drivers/driver_nl80211.h
index 5c21e0faf55cd..d0ec48c9f9734 100644
--- a/src/drivers/driver_nl80211.h
+++ b/src/drivers/driver_nl80211.h
@@ -25,6 +25,7 @@
 #endif /* CONFIG_LIBNL20 */
 
 struct nl80211_global {
+	void *ctx;
 	struct dl_list interfaces;
 	int if_add_ifindex;
 	u64 if_add_wdevid;
@@ -84,6 +85,7 @@ struct wpa_driver_nl80211_data {
 	struct dl_list list;
 	struct dl_list wiphy_list;
 	char phyname[32];
+	unsigned int wiphy_idx;
 	u8 perm_addr[ETH_ALEN];
 	void *ctx;
 	int ifindex;
@@ -94,6 +96,13 @@ struct wpa_driver_nl80211_data {
 	struct wpa_driver_capa capa;
 	u8 *extended_capa, *extended_capa_mask;
 	unsigned int extended_capa_len;
+	struct drv_nl80211_ext_capa {
+		enum nl80211_iftype iftype;
+		u8 *ext_capa, *ext_capa_mask;
+		unsigned int ext_capa_len;
+	} iface_ext_capa[NL80211_IFTYPE_MAX];
+	unsigned int num_iface_ext_capa;
+
 	int has_capability;
 
 	int operstate;
@@ -148,9 +157,16 @@ struct wpa_driver_nl80211_data {
 	unsigned int setband_vendor_cmd_avail:1;
 	unsigned int get_pref_freq_list:1;
 	unsigned int set_prob_oper_freq:1;
+	unsigned int scan_vendor_cmd_avail:1;
+	unsigned int connect_reassoc:1;
+	unsigned int set_wifi_conf_vendor_cmd_avail:1;
 
+	u64 vendor_scan_cookie;
 	u64 remain_on_chan_cookie;
 	u64 send_action_cookie;
+#define MAX_SEND_ACTION_COOKIES 20
+	u64 send_action_cookies[MAX_SEND_ACTION_COOKIES];
+	unsigned int num_send_action_cookies;
 
 	unsigned int last_mgmt_freq;
 
@@ -166,7 +182,10 @@ struct wpa_driver_nl80211_data {
 	struct nl_handle *rtnl_sk; /* nl_sock for NETLINK_ROUTE */
 
 	int default_if_indices[16];
+	/* the AP/AP_VLAN iface that is in this bridge */
+	int default_if_indices_reason[16];
 	int *if_indices;
+	int *if_indices_reason;
 	int num_if_indices;
 
 	/* From failed authentication command */
@@ -182,6 +201,13 @@ struct wpa_driver_nl80211_data {
 	int auth_wep_tx_keyidx;
 	int auth_local_state_change;
 	int auth_p2p;
+
+	/*
+	 * Tells whether the last scan issued from wpa_supplicant was a normal
+	 * scan (NL80211_CMD_TRIGGER_SCAN) or a vendor scan
+	 * (NL80211_CMD_VENDOR). 0 if no pending scan request.
+	 */
+	int last_scan_cmd;
 };
 
 struct nl_msg;
@@ -233,6 +259,8 @@ nl80211_get_hw_feature_data(void *priv, u16 *num_modes, u16 *flags);
 int process_global_event(struct nl_msg *msg, void *arg);
 int process_bss_event(struct nl_msg *msg, void *arg);
 
+const char * nl80211_iftype_str(enum nl80211_iftype mode);
+
 #ifdef ANDROID
 int android_nl_socket_set_nonblocking(struct nl_handle *handle);
 int android_pno_start(struct i802_bss *bss,
@@ -267,11 +295,13 @@ void wpa_driver_nl80211_scan_timeout(void *eloop_ctx, void *timeout_ctx);
 int wpa_driver_nl80211_scan(struct i802_bss *bss,
 			    struct wpa_driver_scan_params *params);
 int wpa_driver_nl80211_sched_scan(void *priv,
-				  struct wpa_driver_scan_params *params,
-				  u32 interval);
+				  struct wpa_driver_scan_params *params);
 int wpa_driver_nl80211_stop_sched_scan(void *priv);
 struct wpa_scan_results * wpa_driver_nl80211_get_scan_results(void *priv);
 void nl80211_dump_scan(struct wpa_driver_nl80211_data *drv);
-const u8 * nl80211_get_ie(const u8 *ies, size_t ies_len, u8 ie);
+int wpa_driver_nl80211_abort_scan(void *priv);
+int wpa_driver_nl80211_vendor_scan(struct i802_bss *bss,
+				   struct wpa_driver_scan_params *params);
+int nl80211_set_default_scan_ies(void *priv, const u8 *ies, size_t ies_len);
 
 #endif /* DRIVER_NL80211_H */
diff --git a/src/drivers/driver_nl80211_capa.c b/src/drivers/driver_nl80211_capa.c
index 4cf31238aeb70..6adc3f6d33dcd 100644
--- a/src/drivers/driver_nl80211_capa.c
+++ b/src/drivers/driver_nl80211_capa.c
@@ -66,7 +66,6 @@ struct wiphy_info_data {
 	unsigned int device_ap_sme:1;
 	unsigned int poll_command_supported:1;
 	unsigned int data_tx_status:1;
-	unsigned int monitor_supported:1;
 	unsigned int auth_supported:1;
 	unsigned int connect_supported:1;
 	unsigned int p2p_go_supported:1;
@@ -129,9 +128,6 @@ static void wiphy_info_supported_iftypes(struct wiphy_info_data *info,
 		case NL80211_IFTYPE_P2P_CLIENT:
 			info->p2p_client_supported = 1;
 			break;
-		case NL80211_IFTYPE_MONITOR:
-			info->monitor_supported = 1;
-			break;
 		}
 	}
 }
@@ -352,13 +348,20 @@ static void wiphy_info_ext_feature_flags(struct wiphy_info_data *info,
 					 struct nlattr *tb)
 {
 	struct wpa_driver_capa *capa = info->capa;
+	u8 *ext_features;
+	int len;
 
 	if (tb == NULL)
 		return;
 
-	if (ext_feature_isset(nla_data(tb), nla_len(tb),
-			      NL80211_EXT_FEATURE_VHT_IBSS))
+	ext_features = nla_data(tb);
+	len = nla_len(tb);
+
+	if (ext_feature_isset(ext_features, len, NL80211_EXT_FEATURE_VHT_IBSS))
 		capa->flags |= WPA_DRIVER_FLAGS_VHT_IBSS;
+
+	if (ext_feature_isset(ext_features, len, NL80211_EXT_FEATURE_RRM))
+		capa->rrm_flags |= WPA_DRIVER_FLAGS_SUPPORT_RRM;
 }
 
 
@@ -428,6 +431,9 @@ static void wiphy_info_feature_flags(struct wiphy_info_data *info,
 
 	if (flags & NL80211_FEATURE_HT_IBSS)
 		capa->flags |= WPA_DRIVER_FLAGS_HT_IBSS;
+
+	if (flags & NL80211_FEATURE_FULL_AP_CLIENT_STATE)
+		capa->flags |= WPA_DRIVER_FLAGS_FULL_AP_CLIENT_STATE;
 }
 
 
@@ -476,6 +482,74 @@ static void wiphy_info_wowlan_triggers(struct wpa_driver_capa *capa,
 }
 
 
+static void wiphy_info_extended_capab(struct wpa_driver_nl80211_data *drv,
+				      struct nlattr *tb)
+{
+	int rem = 0, i;
+	struct nlattr *tb1[NL80211_ATTR_MAX + 1], *attr;
+
+	if (!tb || drv->num_iface_ext_capa == NL80211_IFTYPE_MAX)
+		return;
+
+	nla_for_each_nested(attr, tb, rem) {
+		unsigned int len;
+		struct drv_nl80211_ext_capa *capa;
+
+		nla_parse(tb1, NL80211_ATTR_MAX, nla_data(attr),
+			  nla_len(attr), NULL);
+
+		if (!tb1[NL80211_ATTR_IFTYPE] ||
+		    !tb1[NL80211_ATTR_EXT_CAPA] ||
+		    !tb1[NL80211_ATTR_EXT_CAPA_MASK])
+			continue;
+
+		capa = &drv->iface_ext_capa[drv->num_iface_ext_capa];
+		capa->iftype = nla_get_u32(tb1[NL80211_ATTR_IFTYPE]);
+		wpa_printf(MSG_DEBUG,
+			   "nl80211: Driver-advertised extended capabilities for interface type %s",
+			   nl80211_iftype_str(capa->iftype));
+
+		len = nla_len(tb1[NL80211_ATTR_EXT_CAPA]);
+		capa->ext_capa = os_malloc(len);
+		if (!capa->ext_capa)
+			goto err;
+
+		os_memcpy(capa->ext_capa, nla_data(tb1[NL80211_ATTR_EXT_CAPA]),
+			  len);
+		capa->ext_capa_len = len;
+		wpa_hexdump(MSG_DEBUG, "nl80211: Extended capabilities",
+			    capa->ext_capa, capa->ext_capa_len);
+
+		len = nla_len(tb1[NL80211_ATTR_EXT_CAPA_MASK]);
+		capa->ext_capa_mask = os_malloc(len);
+		if (!capa->ext_capa_mask)
+			goto err;
+
+		os_memcpy(capa->ext_capa_mask,
+			  nla_data(tb1[NL80211_ATTR_EXT_CAPA_MASK]), len);
+		wpa_hexdump(MSG_DEBUG, "nl80211: Extended capabilities mask",
+			    capa->ext_capa_mask, capa->ext_capa_len);
+
+		drv->num_iface_ext_capa++;
+		if (drv->num_iface_ext_capa == NL80211_IFTYPE_MAX)
+			break;
+	}
+
+	return;
+
+err:
+	/* Cleanup allocated memory on error */
+	for (i = 0; i < NL80211_IFTYPE_MAX; i++) {
+		os_free(drv->iface_ext_capa[i].ext_capa);
+		drv->iface_ext_capa[i].ext_capa = NULL;
+		os_free(drv->iface_ext_capa[i].ext_capa_mask);
+		drv->iface_ext_capa[i].ext_capa_mask = NULL;
+		drv->iface_ext_capa[i].ext_capa_len = 0;
+	}
+	drv->num_iface_ext_capa = 0;
+}
+
+
 static int wiphy_info_handler(struct nl_msg *msg, void *arg)
 {
 	struct nlattr *tb[NL80211_ATTR_MAX + 1];
@@ -487,6 +561,9 @@ static int wiphy_info_handler(struct nl_msg *msg, void *arg)
 	nla_parse(tb, NL80211_ATTR_MAX, genlmsg_attrdata(gnlh, 0),
 		  genlmsg_attrlen(gnlh, 0), NULL);
 
+	if (tb[NL80211_ATTR_WIPHY])
+		drv->wiphy_idx = nla_get_u32(tb[NL80211_ATTR_WIPHY]);
+
 	if (tb[NL80211_ATTR_WIPHY_NAME])
 		os_strlcpy(drv->phyname,
 			   nla_get_string(tb[NL80211_ATTR_WIPHY_NAME]),
@@ -499,6 +576,19 @@ static int wiphy_info_handler(struct nl_msg *msg, void *arg)
 		capa->max_sched_scan_ssids =
 			nla_get_u8(tb[NL80211_ATTR_MAX_NUM_SCHED_SCAN_SSIDS]);
 
+	if (tb[NL80211_ATTR_MAX_NUM_SCHED_SCAN_PLANS] &&
+	    tb[NL80211_ATTR_MAX_SCAN_PLAN_INTERVAL] &&
+	    tb[NL80211_ATTR_MAX_SCAN_PLAN_ITERATIONS]) {
+		capa->max_sched_scan_plans =
+			nla_get_u32(tb[NL80211_ATTR_MAX_NUM_SCHED_SCAN_PLANS]);
+
+		capa->max_sched_scan_plan_interval =
+			nla_get_u32(tb[NL80211_ATTR_MAX_SCAN_PLAN_INTERVAL]);
+
+		capa->max_sched_scan_plan_iterations =
+			nla_get_u32(tb[NL80211_ATTR_MAX_SCAN_PLAN_ITERATIONS]);
+	}
+
 	if (tb[NL80211_ATTR_MAX_MATCH_SETS])
 		capa->max_match_sets =
 			nla_get_u8(tb[NL80211_ATTR_MAX_MATCH_SETS]);
@@ -550,6 +640,9 @@ static int wiphy_info_handler(struct nl_msg *msg, void *arg)
 				  nla_len(tb[NL80211_ATTR_EXT_CAPA]));
 			drv->extended_capa_len =
 				nla_len(tb[NL80211_ATTR_EXT_CAPA]);
+			wpa_hexdump(MSG_DEBUG,
+				    "nl80211: Driver-advertised extended capabilities (default)",
+				    drv->extended_capa, drv->extended_capa_len);
 		}
 		drv->extended_capa_mask =
 			os_malloc(nla_len(tb[NL80211_ATTR_EXT_CAPA_MASK]));
@@ -557,6 +650,10 @@ static int wiphy_info_handler(struct nl_msg *msg, void *arg)
 			os_memcpy(drv->extended_capa_mask,
 				  nla_data(tb[NL80211_ATTR_EXT_CAPA_MASK]),
 				  nla_len(tb[NL80211_ATTR_EXT_CAPA_MASK]));
+			wpa_hexdump(MSG_DEBUG,
+				    "nl80211: Driver-advertised extended capabilities mask (default)",
+				    drv->extended_capa_mask,
+				    drv->extended_capa_len);
 		} else {
 			os_free(drv->extended_capa);
 			drv->extended_capa = NULL;
@@ -564,6 +661,8 @@ static int wiphy_info_handler(struct nl_msg *msg, void *arg)
 		}
 	}
 
+	wiphy_info_extended_capab(drv, tb[NL80211_ATTR_IFTYPE_EXT_CAPA]);
+
 	if (tb[NL80211_ATTR_VENDOR_DATA]) {
 		struct nlattr *nl;
 		int rem;
@@ -580,6 +679,7 @@ static int wiphy_info_handler(struct nl_msg *msg, void *arg)
 				case QCA_NL80211_VENDOR_SUBCMD_TEST:
 					drv->vendor_cmd_test_avail = 1;
 					break;
+#ifdef CONFIG_DRIVER_NL80211_QCA
 				case QCA_NL80211_VENDOR_SUBCMD_ROAMING:
 					drv->roaming_vendor_cmd_avail = 1;
 					break;
@@ -602,6 +702,13 @@ static int wiphy_info_handler(struct nl_msg *msg, void *arg)
 				case QCA_NL80211_VENDOR_SUBCMD_SETBAND:
 					drv->setband_vendor_cmd_avail = 1;
 					break;
+				case QCA_NL80211_VENDOR_SUBCMD_TRIGGER_SCAN:
+					drv->scan_vendor_cmd_avail = 1;
+					break;
+				case QCA_NL80211_VENDOR_SUBCMD_SET_WIFI_CONFIGURATION:
+					drv->set_wifi_conf_vendor_cmd_avail = 1;
+					break;
+#endif /* CONFIG_DRIVER_NL80211_QCA */
 				}
 			}
 
@@ -633,6 +740,10 @@ static int wiphy_info_handler(struct nl_msg *msg, void *arg)
 		capa->max_stations =
 			nla_get_u32(tb[NL80211_ATTR_MAX_AP_ASSOC_STA]);
 
+	if (tb[NL80211_ATTR_MAX_CSA_COUNTERS])
+		capa->max_csa_counters =
+			nla_get_u8(tb[NL80211_ATTR_MAX_CSA_COUNTERS]);
+
 	return NL_SKIP;
 }
 
@@ -689,8 +800,6 @@ static int wpa_driver_nl80211_get_info(struct wpa_driver_nl80211_data *drv,
 	if (!drv->capa.max_remain_on_chan)
 		drv->capa.max_remain_on_chan = 5000;
 
-	if (info->channel_switch_supported)
-		drv->capa.flags |= WPA_DRIVER_FLAGS_AP_CSA;
 	drv->capa.wmm_ac_supported = info->wmm_ac_supported;
 
 	drv->capa.mac_addr_rand_sched_scan_supported =
@@ -698,10 +807,24 @@ static int wpa_driver_nl80211_get_info(struct wpa_driver_nl80211_data *drv,
 	drv->capa.mac_addr_rand_scan_supported =
 		info->mac_addr_rand_scan_supported;
 
+	if (info->channel_switch_supported) {
+		drv->capa.flags |= WPA_DRIVER_FLAGS_AP_CSA;
+		if (!drv->capa.max_csa_counters)
+			drv->capa.max_csa_counters = 1;
+	}
+
+	if (!drv->capa.max_sched_scan_plans) {
+		drv->capa.max_sched_scan_plans = 1;
+		drv->capa.max_sched_scan_plan_interval = UINT32_MAX;
+		drv->capa.max_sched_scan_plan_iterations = 0;
+	}
+
 	return 0;
 }
 
 
+#ifdef CONFIG_DRIVER_NL80211_QCA
+
 static int dfs_info_handler(struct nl_msg *msg, void *arg)
 {
 	struct nlattr *tb[NL80211_ATTR_MAX + 1];
@@ -780,8 +903,12 @@ static int features_info_handler(struct nl_msg *msg, void *arg)
 
 		attr = tb_vendor[QCA_WLAN_VENDOR_ATTR_FEATURE_FLAGS];
 		if (attr) {
-			info->flags = nla_data(attr);
-			info->flags_len = nla_len(attr);
+			int len = nla_len(attr);
+			info->flags = os_malloc(len);
+			if (info->flags != NULL) {
+				os_memcpy(info->flags, nla_data(attr), len);
+				info->flags_len = len;
+			}
 		}
 		attr = tb_vendor[QCA_WLAN_VENDOR_ATTR_CONCURRENCY_CAPA];
 		if (attr)
@@ -840,8 +967,17 @@ static void qca_nl80211_get_features(struct wpa_driver_nl80211_data *drv)
 
 	if (check_feature(QCA_WLAN_VENDOR_FEATURE_SUPPORT_HW_MODE_ANY, &info))
 		drv->capa.flags |= WPA_DRIVER_FLAGS_SUPPORT_HW_MODE_ANY;
+
+	if (check_feature(QCA_WLAN_VENDOR_FEATURE_OFFCHANNEL_SIMULTANEOUS,
+			  &info))
+		drv->capa.flags |= WPA_DRIVER_FLAGS_OFFCHANNEL_SIMULTANEOUS;
+	if (check_feature(QCA_WLAN_VENDOR_FEATURE_P2P_LISTEN_OFFLOAD, &info))
+		drv->capa.flags |= WPA_DRIVER_FLAGS_P2P_LISTEN_OFFLOAD;
+	os_free(info.flags);
 }
 
+#endif /* CONFIG_DRIVER_NL80211_QCA */
+
 
 int wpa_driver_nl80211_capa(struct wpa_driver_nl80211_data *drv)
 {
@@ -898,21 +1034,8 @@ int wpa_driver_nl80211_capa(struct wpa_driver_nl80211_data *drv)
 	 * If poll command and tx status are supported, mac80211 is new enough
 	 * to have everything we need to not need monitor interfaces.
 	 */
-	drv->use_monitor = !info.poll_command_supported || !info.data_tx_status;
-
-	if (drv->device_ap_sme && drv->use_monitor) {
-		/*
-		 * Non-mac80211 drivers may not support monitor interface.
-		 * Make sure we do not get stuck with incorrect capability here
-		 * by explicitly testing this.
-		 */
-		if (!info.monitor_supported) {
-			wpa_printf(MSG_DEBUG, "nl80211: Disable use_monitor "
-				   "with device_ap_sme since no monitor mode "
-				   "support detected");
-			drv->use_monitor = 0;
-		}
-	}
+	drv->use_monitor = !info.device_ap_sme &&
+		(!info.poll_command_supported || !info.data_tx_status);
 
 	/*
 	 * If we aren't going to use monitor interfaces, but the
@@ -922,9 +1045,21 @@ int wpa_driver_nl80211_capa(struct wpa_driver_nl80211_data *drv)
 	if (!drv->use_monitor && !info.data_tx_status)
 		drv->capa.flags &= ~WPA_DRIVER_FLAGS_EAPOL_TX_STATUS;
 
+#ifdef CONFIG_DRIVER_NL80211_QCA
 	qca_nl80211_check_dfs_capa(drv);
 	qca_nl80211_get_features(drv);
 
+	/*
+	 * To enable offchannel simultaneous support in wpa_supplicant, the
+	 * underlying driver needs to support the same along with offchannel TX.
+	 * Offchannel TX support is needed since remain_on_channel and
+	 * action_tx use some common data structures and hence cannot be
+	 * scheduled simultaneously.
+	 */
+	if (!(drv->capa.flags & WPA_DRIVER_FLAGS_OFFCHANNEL_TX))
+		drv->capa.flags &= ~WPA_DRIVER_FLAGS_OFFCHANNEL_SIMULTANEOUS;
+#endif /* CONFIG_DRIVER_NL80211_QCA */
+
 	return 0;
 }
 
@@ -933,6 +1068,7 @@ struct phy_info_arg {
 	u16 *num_modes;
 	struct hostapd_hw_modes *modes;
 	int last_mode, last_chan_idx;
+	int failed;
 };
 
 static void phy_info_ht_capa(struct hostapd_hw_modes *mode, struct nlattr *capa,
@@ -1050,7 +1186,7 @@ static int phy_info_freqs(struct phy_info_arg *phy_info,
 				   mode->num_channels + new_channels,
 				   sizeof(struct hostapd_channel_data));
 	if (!channel)
-		return NL_SKIP;
+		return NL_STOP;
 
 	mode->channels = channel;
 	mode->num_channels += new_channels;
@@ -1096,7 +1232,7 @@ static int phy_info_rates(struct hostapd_hw_modes *mode, struct nlattr *tb)
 
 	mode->rates = os_calloc(mode->num_rates, sizeof(int));
 	if (!mode->rates)
-		return NL_SKIP;
+		return NL_STOP;
 
 	idx = 0;
 
@@ -1125,8 +1261,10 @@ static int phy_info_band(struct phy_info_arg *phy_info, struct nlattr *nl_band)
 		mode = os_realloc_array(phy_info->modes,
 					*phy_info->num_modes + 1,
 					sizeof(*mode));
-		if (!mode)
-			return NL_SKIP;
+		if (!mode) {
+			phy_info->failed = 1;
+			return NL_STOP;
+		}
 		phy_info->modes = mode;
 
 		mode = &phy_info->modes[*(phy_info->num_modes)];
@@ -1162,11 +1300,12 @@ static int phy_info_band(struct phy_info_arg *phy_info, struct nlattr *nl_band)
 	phy_info_vht_capa(mode, tb_band[NL80211_BAND_ATTR_VHT_CAPA],
 			  tb_band[NL80211_BAND_ATTR_VHT_MCS_SET]);
 	ret = phy_info_freqs(phy_info, mode, tb_band[NL80211_BAND_ATTR_FREQS]);
-	if (ret != NL_OK)
-		return ret;
-	ret = phy_info_rates(mode, tb_band[NL80211_BAND_ATTR_RATES]);
-	if (ret != NL_OK)
+	if (ret == NL_OK)
+		ret = phy_info_rates(mode, tb_band[NL80211_BAND_ATTR_RATES]);
+	if (ret != NL_OK) {
+		phy_info->failed = 1;
 		return ret;
+	}
 
 	return NL_OK;
 }
@@ -1381,7 +1520,7 @@ static void nl80211_reg_rule_sec(struct nlattr *tb[],
 
 
 static void nl80211_set_vht_mode(struct hostapd_hw_modes *mode, int start,
-				 int end)
+				 int end, int max_bw)
 {
 	int c;
 
@@ -1398,6 +1537,32 @@ static void nl80211_set_vht_mode(struct hostapd_hw_modes *mode, int start,
 
 		if (chan->freq - 70 >= start && chan->freq + 10 <= end)
 			chan->flag |= HOSTAPD_CHAN_VHT_70_10;
+
+		if (max_bw >= 160) {
+			if (chan->freq - 10 >= start && chan->freq + 150 <= end)
+				chan->flag |= HOSTAPD_CHAN_VHT_10_150;
+
+			if (chan->freq - 30 >= start && chan->freq + 130 <= end)
+				chan->flag |= HOSTAPD_CHAN_VHT_30_130;
+
+			if (chan->freq - 50 >= start && chan->freq + 110 <= end)
+				chan->flag |= HOSTAPD_CHAN_VHT_50_110;
+
+			if (chan->freq - 70 >= start && chan->freq + 90 <= end)
+				chan->flag |= HOSTAPD_CHAN_VHT_70_90;
+
+			if (chan->freq - 90 >= start && chan->freq + 70 <= end)
+				chan->flag |= HOSTAPD_CHAN_VHT_90_70;
+
+			if (chan->freq - 110 >= start && chan->freq + 50 <= end)
+				chan->flag |= HOSTAPD_CHAN_VHT_110_50;
+
+			if (chan->freq - 130 >= start && chan->freq + 30 <= end)
+				chan->flag |= HOSTAPD_CHAN_VHT_130_30;
+
+			if (chan->freq - 150 >= start && chan->freq + 10 <= end)
+				chan->flag |= HOSTAPD_CHAN_VHT_150_10;
+		}
 	}
 }
 
@@ -1428,7 +1593,7 @@ static void nl80211_reg_rule_vht(struct nlattr *tb[],
 		if (!results->modes[m].vht_capab)
 			continue;
 
-		nl80211_set_vht_mode(&results->modes[m], start, end);
+		nl80211_set_vht_mode(&results->modes[m], start, end, max_bw);
 	}
 }
 
@@ -1566,6 +1731,7 @@ nl80211_get_hw_feature_data(void *priv, u16 *num_modes, u16 *flags)
 		.num_modes = num_modes,
 		.modes = NULL,
 		.last_mode = -1,
+		.failed = 0,
 	};
 
 	*num_modes = 0;
@@ -1582,6 +1748,16 @@ nl80211_get_hw_feature_data(void *priv, u16 *num_modes, u16 *flags)
 
 	if (send_and_recv_msgs(drv, msg, phy_info_handler, &result) == 0) {
 		nl80211_set_regulatory_flags(drv, &result);
+		if (result.failed) {
+			int i;
+
+			for (i = 0; result.modes && i < *num_modes; i++) {
+				os_free(result.modes[i].channels);
+				os_free(result.modes[i].rates);
+			}
+			os_free(result.modes);
+			return NULL;
+		}
 		return wpa_driver_nl80211_postprocess_modes(result.modes,
 							    num_modes);
 	}
diff --git a/src/drivers/driver_nl80211_event.c b/src/drivers/driver_nl80211_event.c
index 7b0f721e65842..762e3acc28079 100644
--- a/src/drivers/driver_nl80211_event.c
+++ b/src/drivers/driver_nl80211_event.c
@@ -265,10 +265,12 @@ static void mlme_event_connect(struct wpa_driver_nl80211_data *drv,
 			       enum nl80211_commands cmd, struct nlattr *status,
 			       struct nlattr *addr, struct nlattr *req_ie,
 			       struct nlattr *resp_ie,
+			       struct nlattr *timed_out,
 			       struct nlattr *authorized,
 			       struct nlattr *key_replay_ctr,
 			       struct nlattr *ptk_kck,
-			       struct nlattr *ptk_kek)
+			       struct nlattr *ptk_kek,
+			       struct nlattr *subnet_status)
 {
 	union wpa_event_data event;
 	const u8 *ssid;
@@ -284,6 +286,8 @@ static void mlme_event_connect(struct wpa_driver_nl80211_data *drv,
 		return;
 	}
 
+	drv->connect_reassoc = 0;
+
 	status_code = status ? nla_get_u16(status) : WLAN_STATUS_SUCCESS;
 
 	if (cmd == NL80211_CMD_CONNECT) {
@@ -319,6 +323,7 @@ static void mlme_event_connect(struct wpa_driver_nl80211_data *drv,
 			event.assoc_reject.resp_ies_len = nla_len(resp_ie);
 		}
 		event.assoc_reject.status_code = status_code;
+		event.assoc_reject.timed_out = timed_out != NULL;
 		wpa_supplicant_event(drv->ctx, EVENT_ASSOC_REJECT, &event);
 		return;
 	}
@@ -334,9 +339,9 @@ static void mlme_event_connect(struct wpa_driver_nl80211_data *drv,
 		event.assoc_info.req_ies_len = nla_len(req_ie);
 
 		if (cmd == NL80211_CMD_ROAM) {
-			ssid = nl80211_get_ie(event.assoc_info.req_ies,
-					      event.assoc_info.req_ies_len,
-					      WLAN_EID_SSID);
+			ssid = get_ie(event.assoc_info.req_ies,
+				      event.assoc_info.req_ies_len,
+				      WLAN_EID_SSID);
 			if (ssid && ssid[1] > 0 && ssid[1] <= 32) {
 				drv->ssid_len = ssid[1];
 				os_memcpy(drv->ssid, ssid + 2, ssid[1]);
@@ -367,6 +372,17 @@ static void mlme_event_connect(struct wpa_driver_nl80211_data *drv,
 		event.assoc_info.ptk_kek_len = nla_len(ptk_kek);
 	}
 
+	if (subnet_status) {
+		/*
+		 * At least for now, this is only available from
+		 * QCA_WLAN_VENDOR_ATTR_ROAM_AUTH_SUBNET_STATUS and that
+		 * attribute has the same values 0, 1, 2 as are used in the
+		 * variable here, so no mapping between different values are
+		 * needed.
+		 */
+		event.assoc_info.subnet_status = nla_get_u8(subnet_status);
+	}
+
 	wpa_supplicant_event(drv->ctx, EVENT_ASSOC, &event);
 }
 
@@ -560,9 +576,10 @@ static void mlme_event_mgmt(struct i802_bss *bss,
 		rx_freq = drv->last_mgmt_freq = event.rx_mgmt.freq;
 	}
 	wpa_printf(MSG_DEBUG,
-		   "nl80211: RX frame sa=" MACSTR
+		   "nl80211: RX frame da=" MACSTR " sa=" MACSTR " bssid=" MACSTR
 		   " freq=%d ssi_signal=%d fc=0x%x seq_ctrl=0x%x stype=%u (%s) len=%u",
-		   MAC2STR(mgmt->sa), rx_freq, ssi_signal, fc,
+		   MAC2STR(mgmt->da), MAC2STR(mgmt->sa), MAC2STR(mgmt->bssid),
+		   rx_freq, ssi_signal, fc,
 		   le_to_host16(mgmt->seq_ctrl), stype, fc2str(fc),
 		   (unsigned int) len);
 	event.rx_mgmt.frame = frame;
@@ -639,10 +656,39 @@ static void mlme_event_deauth_disassoc(struct wpa_driver_nl80211_data *drv,
 			 * Avoid issues with some roaming cases where
 			 * disconnection event for the old AP may show up after
 			 * we have started connection with the new AP.
+			 * In case of locally generated event clear
+			 * ignore_next_local_deauth as well, to avoid next local
+			 * deauth event be wrongly ignored.
 			 */
-			wpa_printf(MSG_DEBUG, "nl80211: Ignore deauth/disassoc event from old AP " MACSTR " when already authenticating with " MACSTR,
-				   MAC2STR(bssid),
-				   MAC2STR(drv->auth_attempt_bssid));
+			if (!os_memcmp(mgmt->sa, drv->first_bss->addr,
+				       ETH_ALEN)) {
+				wpa_printf(MSG_DEBUG,
+					   "nl80211: Received a locally generated deauth event. Clear ignore_next_local_deauth flag");
+				drv->ignore_next_local_deauth = 0;
+			} else {
+				wpa_printf(MSG_DEBUG,
+					   "nl80211: Ignore deauth/disassoc event from old AP " MACSTR " when already authenticating with " MACSTR,
+					   MAC2STR(bssid),
+					   MAC2STR(drv->auth_attempt_bssid));
+			}
+			return;
+		}
+
+		if (!(drv->capa.flags & WPA_DRIVER_FLAGS_SME) &&
+		    drv->connect_reassoc && drv->associated &&
+		    os_memcmp(bssid, drv->prev_bssid, ETH_ALEN) == 0 &&
+		    os_memcmp(bssid, drv->auth_attempt_bssid, ETH_ALEN) != 0) {
+			/*
+			 * Avoid issues with some roaming cases where
+			 * disconnection event for the old AP may show up after
+			 * we have started connection with the new AP.
+			 */
+			 wpa_printf(MSG_DEBUG,
+				    "nl80211: Ignore deauth/disassoc event from old AP "
+				    MACSTR
+				    " when already connecting with " MACSTR,
+				    MAC2STR(bssid),
+				    MAC2STR(drv->auth_attempt_bssid));
 			return;
 		}
 
@@ -679,13 +725,15 @@ static void mlme_event_deauth_disassoc(struct wpa_driver_nl80211_data *drv,
 				mgmt->u.disassoc.variable;
 		}
 	} else {
+		event.deauth_info.locally_generated =
+			!os_memcmp(mgmt->sa, drv->first_bss->addr, ETH_ALEN);
 		if (drv->ignore_deauth_event) {
 			wpa_printf(MSG_DEBUG, "nl80211: Ignore deauth event due to previous forced deauth-during-auth");
 			drv->ignore_deauth_event = 0;
+			if (event.deauth_info.locally_generated)
+				drv->ignore_next_local_deauth = 0;
 			return;
 		}
-		event.deauth_info.locally_generated =
-			!os_memcmp(mgmt->sa, drv->first_bss->addr, ETH_ALEN);
 		if (drv->ignore_next_local_deauth) {
 			drv->ignore_next_local_deauth = 0;
 			if (event.deauth_info.locally_generated) {
@@ -868,6 +916,7 @@ static void mlme_event_join_ibss(struct wpa_driver_nl80211_data *drv,
 				 struct nlattr *tb[])
 {
 	unsigned int freq;
+	union wpa_event_data event;
 
 	if (tb[NL80211_ATTR_MAC] == NULL) {
 		wpa_printf(MSG_DEBUG, "nl80211: No address in IBSS joined "
@@ -887,7 +936,10 @@ static void mlme_event_join_ibss(struct wpa_driver_nl80211_data *drv,
 		drv->first_bss->freq = freq;
 	}
 
-	wpa_supplicant_event(drv->ctx, EVENT_ASSOC, NULL);
+	os_memset(&event, 0, sizeof(event));
+	event.assoc_info.freq = freq;
+
+	wpa_supplicant_event(drv->ctx, EVENT_ASSOC, &event);
 }
 
 
@@ -968,7 +1020,7 @@ static void mlme_event_ft_event(struct wpa_driver_nl80211_data *drv,
 
 
 static void send_scan_event(struct wpa_driver_nl80211_data *drv, int aborted,
-			    struct nlattr *tb[])
+			    struct nlattr *tb[], int external_scan)
 {
 	union wpa_event_data event;
 	struct nlattr *nl;
@@ -978,7 +1030,7 @@ static void send_scan_event(struct wpa_driver_nl80211_data *drv, int aborted,
 	int freqs[MAX_REPORT_FREQS];
 	int num_freqs = 0;
 
-	if (drv->scan_for_auth) {
+	if (!external_scan && drv->scan_for_auth) {
 		drv->scan_for_auth = 0;
 		wpa_printf(MSG_DEBUG, "nl80211: Scan results for missing "
 			   "cfg80211 BSS entry");
@@ -989,6 +1041,8 @@ static void send_scan_event(struct wpa_driver_nl80211_data *drv, int aborted,
 	os_memset(&event, 0, sizeof(event));
 	info = &event.scan_info;
 	info->aborted = aborted;
+	info->external_scan = external_scan;
+	info->nl_scan_event = 1;
 
 	if (tb[NL80211_ATTR_SCAN_SSIDS]) {
 		nla_for_each_nested(nl, tb[NL80211_ATTR_SCAN_SSIDS], rem) {
@@ -1004,7 +1058,7 @@ static void send_scan_event(struct wpa_driver_nl80211_data *drv, int aborted,
 		}
 	}
 	if (tb[NL80211_ATTR_SCAN_FREQUENCIES]) {
-		char msg[200], *pos, *end;
+		char msg[300], *pos, *end;
 		int res;
 
 		pos = msg;
@@ -1109,7 +1163,7 @@ static void nl80211_new_peer_candidate(struct wpa_driver_nl80211_data *drv,
 		return;
 
 	addr = nla_data(tb[NL80211_ATTR_MAC]);
-	wpa_printf(MSG_DEBUG, "nl80211: New peer candidate" MACSTR,
+	wpa_printf(MSG_DEBUG, "nl80211: New peer candidate " MACSTR,
 		   MAC2STR(addr));
 
 	os_memset(&data, 0, sizeof(data));
@@ -1154,6 +1208,7 @@ static void nl80211_new_station_event(struct wpa_driver_nl80211_data *drv,
 
 
 static void nl80211_del_station_event(struct wpa_driver_nl80211_data *drv,
+				      struct i802_bss *bss,
 				      struct nlattr **tb)
 {
 	u8 *addr;
@@ -1166,7 +1221,7 @@ static void nl80211_del_station_event(struct wpa_driver_nl80211_data *drv,
 		   MAC2STR(addr));
 
 	if (is_ap_interface(drv->nlmode) && drv->device_ap_sme) {
-		drv_event_disassoc(drv->ctx, addr);
+		drv_event_disassoc(bss->ctx, addr);
 		return;
 	}
 
@@ -1175,7 +1230,7 @@ static void nl80211_del_station_event(struct wpa_driver_nl80211_data *drv,
 
 	os_memset(&data, 0, sizeof(data));
 	os_memcpy(data.ibss_peer_lost.peer, addr, ETH_ALEN);
-	wpa_supplicant_event(drv->ctx, EVENT_IBSS_PEER_LOST, &data);
+	wpa_supplicant_event(bss->ctx, EVENT_IBSS_PEER_LOST, &data);
 }
 
 
@@ -1444,6 +1499,8 @@ static void nl80211_spurious_frame(struct i802_bss *bss, struct nlattr **tb,
 }
 
 
+#ifdef CONFIG_DRIVER_NL80211_QCA
+
 static void qca_nl80211_avoid_freq(struct wpa_driver_nl80211_data *drv,
 				   const u8 *data, size_t len)
 {
@@ -1593,10 +1650,12 @@ static void qca_nl80211_key_mgmt_auth(struct wpa_driver_nl80211_data *drv,
 			   tb[QCA_WLAN_VENDOR_ATTR_ROAM_AUTH_BSSID],
 			   tb[QCA_WLAN_VENDOR_ATTR_ROAM_AUTH_REQ_IE],
 			   tb[QCA_WLAN_VENDOR_ATTR_ROAM_AUTH_RESP_IE],
+			   NULL,
 			   tb[QCA_WLAN_VENDOR_ATTR_ROAM_AUTH_AUTHORIZED],
 			   tb[QCA_WLAN_VENDOR_ATTR_ROAM_AUTH_KEY_REPLAY_CTR],
 			   tb[QCA_WLAN_VENDOR_ATTR_ROAM_AUTH_PTK_KCK],
-			   tb[QCA_WLAN_VENDOR_ATTR_ROAM_AUTH_PTK_KEK]);
+			   tb[QCA_WLAN_VENDOR_ATTR_ROAM_AUTH_PTK_KEK],
+			   tb[QCA_WLAN_VENDOR_ATTR_ROAM_AUTH_SUBNET_STATUS]);
 }
 
 
@@ -1686,6 +1745,165 @@ static void qca_nl80211_dfs_offload_radar_event(
 }
 
 
+static void qca_nl80211_scan_trigger_event(struct wpa_driver_nl80211_data *drv,
+					   u8 *data, size_t len)
+{
+	struct nlattr *tb[QCA_WLAN_VENDOR_ATTR_SCAN_MAX + 1];
+	u64 cookie = 0;
+	union wpa_event_data event;
+	struct scan_info *info;
+
+	if (nla_parse(tb, QCA_WLAN_VENDOR_ATTR_SCAN_MAX,
+		      (struct nlattr *) data, len, NULL) ||
+	    !tb[QCA_WLAN_VENDOR_ATTR_SCAN_COOKIE])
+		return;
+
+	cookie = nla_get_u64(tb[QCA_WLAN_VENDOR_ATTR_SCAN_COOKIE]);
+	if (cookie != drv->vendor_scan_cookie) {
+		/* External scan trigger event, ignore */
+		return;
+	}
+
+	/* Cookie match, own scan */
+	os_memset(&event, 0, sizeof(event));
+	info = &event.scan_info;
+	info->external_scan = 0;
+	info->nl_scan_event = 0;
+
+	drv->scan_state = SCAN_STARTED;
+	wpa_supplicant_event(drv->ctx, EVENT_SCAN_STARTED, &event);
+}
+
+
+static void send_vendor_scan_event(struct wpa_driver_nl80211_data *drv,
+				   int aborted, struct nlattr *tb[],
+				   int external_scan)
+{
+	union wpa_event_data event;
+	struct nlattr *nl;
+	int rem;
+	struct scan_info *info;
+	int freqs[MAX_REPORT_FREQS];
+	int num_freqs = 0;
+
+	os_memset(&event, 0, sizeof(event));
+	info = &event.scan_info;
+	info->aborted = aborted;
+	info->external_scan = external_scan;
+
+	if (tb[QCA_WLAN_VENDOR_ATTR_SCAN_SSIDS]) {
+		nla_for_each_nested(nl,
+				    tb[QCA_WLAN_VENDOR_ATTR_SCAN_SSIDS], rem) {
+			struct wpa_driver_scan_ssid *s =
+				&info->ssids[info->num_ssids];
+			s->ssid = nla_data(nl);
+			s->ssid_len = nla_len(nl);
+			wpa_printf(MSG_DEBUG,
+				   "nl80211: Scan probed for SSID '%s'",
+				   wpa_ssid_txt(s->ssid, s->ssid_len));
+			info->num_ssids++;
+			if (info->num_ssids == WPAS_MAX_SCAN_SSIDS)
+				break;
+		}
+	}
+
+	if (tb[QCA_WLAN_VENDOR_ATTR_SCAN_FREQUENCIES]) {
+		char msg[300], *pos, *end;
+		int res;
+
+		pos = msg;
+		end = pos + sizeof(msg);
+		*pos = '\0';
+
+		nla_for_each_nested(nl,
+				    tb[QCA_WLAN_VENDOR_ATTR_SCAN_FREQUENCIES],
+				    rem) {
+			freqs[num_freqs] = nla_get_u32(nl);
+			res = os_snprintf(pos, end - pos, " %d",
+					  freqs[num_freqs]);
+			if (!os_snprintf_error(end - pos, res))
+				pos += res;
+			num_freqs++;
+			if (num_freqs == MAX_REPORT_FREQS - 1)
+				break;
+		}
+
+		info->freqs = freqs;
+		info->num_freqs = num_freqs;
+		wpa_printf(MSG_DEBUG, "nl80211: Scan included frequencies:%s",
+			   msg);
+	}
+	wpa_supplicant_event(drv->ctx, EVENT_SCAN_RESULTS, &event);
+}
+
+
+static void qca_nl80211_scan_done_event(struct wpa_driver_nl80211_data *drv,
+					u8 *data, size_t len)
+{
+	struct nlattr *tb[QCA_WLAN_VENDOR_ATTR_SCAN_MAX + 1];
+	u64 cookie = 0;
+	enum scan_status status;
+	int external_scan;
+
+	if (nla_parse(tb, QCA_WLAN_VENDOR_ATTR_SCAN_MAX,
+		      (struct nlattr *) data, len, NULL) ||
+	    !tb[QCA_WLAN_VENDOR_ATTR_SCAN_STATUS] ||
+	    !tb[QCA_WLAN_VENDOR_ATTR_SCAN_COOKIE])
+		return;
+
+	status = nla_get_u8(tb[QCA_WLAN_VENDOR_ATTR_SCAN_STATUS]);
+	if (status >= VENDOR_SCAN_STATUS_MAX)
+		return; /* invalid status */
+
+	cookie = nla_get_u64(tb[QCA_WLAN_VENDOR_ATTR_SCAN_COOKIE]);
+	if (cookie != drv->vendor_scan_cookie) {
+		/* Event from an external scan, get scan results */
+		external_scan = 1;
+	} else {
+		external_scan = 0;
+		if (status == VENDOR_SCAN_STATUS_NEW_RESULTS)
+			drv->scan_state = SCAN_COMPLETED;
+		else
+			drv->scan_state = SCAN_ABORTED;
+
+		eloop_cancel_timeout(wpa_driver_nl80211_scan_timeout, drv,
+				     drv->ctx);
+		drv->vendor_scan_cookie = 0;
+		drv->last_scan_cmd = 0;
+	}
+
+	send_vendor_scan_event(drv, (status == VENDOR_SCAN_STATUS_ABORTED), tb,
+			       external_scan);
+}
+
+
+static void qca_nl80211_p2p_lo_stop_event(struct wpa_driver_nl80211_data *drv,
+					  u8 *data, size_t len)
+{
+	struct nlattr *tb[QCA_WLAN_VENDOR_ATTR_P2P_LISTEN_OFFLOAD_MAX + 1];
+	union wpa_event_data event;
+
+	wpa_printf(MSG_DEBUG,
+		   "nl80211: P2P listen offload stop vendor event received");
+
+	if (nla_parse(tb, QCA_WLAN_VENDOR_ATTR_P2P_LISTEN_OFFLOAD_MAX,
+		      (struct nlattr *) data, len, NULL) ||
+	    !tb[QCA_WLAN_VENDOR_ATTR_P2P_LISTEN_OFFLOAD_STOP_REASON])
+		return;
+
+	os_memset(&event, 0, sizeof(event));
+	event.p2p_lo_stop.reason_code =
+		nla_get_u8(tb[QCA_WLAN_VENDOR_ATTR_P2P_LISTEN_OFFLOAD_STOP_REASON]);
+
+	wpa_printf(MSG_DEBUG,
+		   "nl80211: P2P Listen offload stop reason: %d",
+		   event.p2p_lo_stop.reason_code);
+	wpa_supplicant_event(drv->ctx, EVENT_P2P_LO_STOP, &event);
+}
+
+#endif /* CONFIG_DRIVER_NL80211_QCA */
+
+
 static void nl80211_vendor_event_qca(struct wpa_driver_nl80211_data *drv,
 				     u32 subcmd, u8 *data, size_t len)
 {
@@ -1693,6 +1911,7 @@ static void nl80211_vendor_event_qca(struct wpa_driver_nl80211_data *drv,
 	case QCA_NL80211_VENDOR_SUBCMD_TEST:
 		wpa_hexdump(MSG_DEBUG, "nl80211: QCA test event", data, len);
 		break;
+#ifdef CONFIG_DRIVER_NL80211_QCA
 	case QCA_NL80211_VENDOR_SUBCMD_AVOID_FREQUENCY:
 		qca_nl80211_avoid_freq(drv, data, len);
 		break;
@@ -1709,6 +1928,16 @@ static void nl80211_vendor_event_qca(struct wpa_driver_nl80211_data *drv,
 	case QCA_NL80211_VENDOR_SUBCMD_DFS_OFFLOAD_RADAR_DETECTED:
 		qca_nl80211_dfs_offload_radar_event(drv, subcmd, data, len);
 		break;
+	case QCA_NL80211_VENDOR_SUBCMD_TRIGGER_SCAN:
+		qca_nl80211_scan_trigger_event(drv, data, len);
+		break;
+	case QCA_NL80211_VENDOR_SUBCMD_SCAN_DONE:
+		qca_nl80211_scan_done_event(drv, data, len);
+		break;
+	case QCA_NL80211_VENDOR_SUBCMD_P2P_LISTEN_OFFLOAD_STOP:
+		qca_nl80211_p2p_lo_stop_event(drv, data, len);
+		break;
+#endif /* CONFIG_DRIVER_NL80211_QCA */
 	default:
 		wpa_printf(MSG_DEBUG,
 			   "nl80211: Ignore unsupported QCA vendor event %u",
@@ -1831,6 +2060,7 @@ static void do_process_drv_event(struct i802_bss *bss, int cmd,
 {
 	struct wpa_driver_nl80211_data *drv = bss->drv;
 	union wpa_event_data data;
+	int external_scan_event = 0;
 
 	wpa_printf(MSG_DEBUG, "nl80211: Drv Event %d (%s) received for %s",
 		   cmd, nl80211_command_to_string(cmd), bss->ifname);
@@ -1883,28 +2113,38 @@ static void do_process_drv_event(struct i802_bss *bss, int cmd,
 	case NL80211_CMD_NEW_SCAN_RESULTS:
 		wpa_dbg(drv->ctx, MSG_DEBUG,
 			"nl80211: New scan results available");
-		drv->scan_state = SCAN_COMPLETED;
 		drv->scan_complete_events = 1;
-		eloop_cancel_timeout(wpa_driver_nl80211_scan_timeout, drv,
-				     drv->ctx);
-		send_scan_event(drv, 0, tb);
+		if (drv->last_scan_cmd == NL80211_CMD_TRIGGER_SCAN) {
+			drv->scan_state = SCAN_COMPLETED;
+			eloop_cancel_timeout(wpa_driver_nl80211_scan_timeout,
+					     drv, drv->ctx);
+			drv->last_scan_cmd = 0;
+		} else {
+			external_scan_event = 1;
+		}
+		send_scan_event(drv, 0, tb, external_scan_event);
 		break;
 	case NL80211_CMD_SCHED_SCAN_RESULTS:
 		wpa_dbg(drv->ctx, MSG_DEBUG,
 			"nl80211: New sched scan results available");
 		drv->scan_state = SCHED_SCAN_RESULTS;
-		send_scan_event(drv, 0, tb);
+		send_scan_event(drv, 0, tb, 0);
 		break;
 	case NL80211_CMD_SCAN_ABORTED:
 		wpa_dbg(drv->ctx, MSG_DEBUG, "nl80211: Scan aborted");
-		drv->scan_state = SCAN_ABORTED;
-		/*
-		 * Need to indicate that scan results are available in order
-		 * not to make wpa_supplicant stop its scanning.
-		 */
-		eloop_cancel_timeout(wpa_driver_nl80211_scan_timeout, drv,
-				     drv->ctx);
-		send_scan_event(drv, 1, tb);
+		if (drv->last_scan_cmd == NL80211_CMD_TRIGGER_SCAN) {
+			drv->scan_state = SCAN_ABORTED;
+			/*
+			 * Need to indicate that scan results are available in
+			 * order not to make wpa_supplicant stop its scanning.
+			 */
+			eloop_cancel_timeout(wpa_driver_nl80211_scan_timeout,
+					     drv, drv->ctx);
+			drv->last_scan_cmd = 0;
+		} else {
+			external_scan_event = 1;
+		}
+		send_scan_event(drv, 1, tb, external_scan_event);
 		break;
 	case NL80211_CMD_AUTHENTICATE:
 	case NL80211_CMD_ASSOCIATE:
@@ -1927,7 +2167,8 @@ static void do_process_drv_event(struct i802_bss *bss, int cmd,
 				   tb[NL80211_ATTR_MAC],
 				   tb[NL80211_ATTR_REQ_IE],
 				   tb[NL80211_ATTR_RESP_IE],
-				   NULL, NULL, NULL, NULL);
+				   tb[NL80211_ATTR_TIMED_OUT],
+				   NULL, NULL, NULL, NULL, NULL);
 		break;
 	case NL80211_CMD_CH_SWITCH_NOTIFY:
 		mlme_event_ch_switch(drv,
@@ -1972,7 +2213,7 @@ static void do_process_drv_event(struct i802_bss *bss, int cmd,
 		nl80211_new_station_event(drv, bss, tb);
 		break;
 	case NL80211_CMD_DEL_STATION:
-		nl80211_del_station_event(drv, tb);
+		nl80211_del_station_event(drv, bss, tb);
 		break;
 	case NL80211_CMD_SET_REKEY_OFFLOAD:
 		nl80211_rekey_offload_event(drv, tb);
diff --git a/src/drivers/driver_nl80211_monitor.c b/src/drivers/driver_nl80211_monitor.c
index 45385da91f6a1..9376d1143800d 100644
--- a/src/drivers/driver_nl80211_monitor.c
+++ b/src/drivers/driver_nl80211_monitor.c
@@ -136,7 +136,7 @@ static void handle_monitor_read(int sock, void *eloop_ctx, void *sock_ctx)
 			break;
 		case IEEE80211_RADIOTAP_TX_FLAGS:
 			injected = 1;
-			failed = le_to_host16((*(uint16_t *) iter.this_arg)) &
+			failed = le_to_host16((*(le16 *) iter.this_arg)) &
 					IEEE80211_RADIOTAP_F_TX_FAIL;
 			break;
 		case IEEE80211_RADIOTAP_DATA_RETRIES:
diff --git a/src/drivers/driver_nl80211_scan.c b/src/drivers/driver_nl80211_scan.c
index 4b762eafbe8ae..c115b6b31b7dc 100644
--- a/src/drivers/driver_nl80211_scan.c
+++ b/src/drivers/driver_nl80211_scan.c
@@ -1,5 +1,6 @@
 /*
  * Driver interaction with Linux nl80211/cfg80211 - Scanning
+ * Copyright(c) 2015 Intel Deutschland GmbH
  * Copyright (c) 2002-2014, Jouni Malinen <j@w1.fi>
  * Copyright (c) 2007, Johannes Berg <johannes@sipsolutions.net>
  * Copyright (c) 2009-2010, Atheros Communications
@@ -14,6 +15,8 @@
 #include "utils/common.h"
 #include "utils/eloop.h"
 #include "common/ieee802_11_defs.h"
+#include "common/ieee802_11_common.h"
+#include "common/qca-vendor.h"
 #include "driver_nl80211.h"
 
 
@@ -93,12 +96,20 @@ static int nl80211_get_noise_for_scan_results(
 void wpa_driver_nl80211_scan_timeout(void *eloop_ctx, void *timeout_ctx)
 {
 	struct wpa_driver_nl80211_data *drv = eloop_ctx;
+
+	wpa_printf(MSG_DEBUG, "nl80211: Scan timeout - try to abort it");
+	if (!wpa_driver_nl80211_abort_scan(drv->first_bss))
+		return;
+
+	wpa_printf(MSG_DEBUG, "nl80211: Failed to abort scan");
+
 	if (drv->ap_scan_as_station != NL80211_IFTYPE_UNSPECIFIED) {
 		wpa_driver_nl80211_set_mode(drv->first_bss,
 					    drv->ap_scan_as_station);
 		drv->ap_scan_as_station = NL80211_IFTYPE_UNSPECIFIED;
 	}
-	wpa_printf(MSG_DEBUG, "Scan timeout - try to get results");
+
+	wpa_printf(MSG_DEBUG, "nl80211: Try to get scan results");
 	wpa_supplicant_event(timeout_ctx, EVENT_SCAN_RESULTS, NULL);
 }
 
@@ -131,6 +142,8 @@ nl80211_scan_common(struct i802_bss *bss, u8 cmd,
 				goto fail;
 		}
 		nla_nest_end(msg, ssids);
+	} else {
+		wpa_printf(MSG_DEBUG, "nl80211: Passive scan requested");
 	}
 
 	if (params->extra_ies) {
@@ -252,6 +265,13 @@ int wpa_driver_nl80211_scan(struct i802_bss *bss,
 			goto fail;
 	}
 
+	if (params->bssid) {
+		wpa_printf(MSG_DEBUG, "nl80211: Scan for a specific BSSID: "
+			   MACSTR, MAC2STR(params->bssid));
+		if (nla_put(msg, NL80211_ATTR_MAC, ETH_ALEN, params->bssid))
+			goto fail;
+	}
+
 	ret = send_and_recv_msgs(drv, msg, NULL, NULL);
 	msg = NULL;
 	if (ret) {
@@ -297,6 +317,7 @@ int wpa_driver_nl80211_scan(struct i802_bss *bss,
 	eloop_cancel_timeout(wpa_driver_nl80211_scan_timeout, drv, drv->ctx);
 	eloop_register_timeout(timeout, 0, wpa_driver_nl80211_scan_timeout,
 			       drv, drv->ctx);
+	drv->last_scan_cmd = NL80211_CMD_TRIGGER_SCAN;
 
 fail:
 	nlmsg_free(msg);
@@ -304,16 +325,82 @@ fail:
 }
 
 
+static int
+nl80211_sched_scan_add_scan_plans(struct wpa_driver_nl80211_data *drv,
+				  struct nl_msg *msg,
+				  struct wpa_driver_scan_params *params)
+{
+	struct nlattr *plans;
+	struct sched_scan_plan *scan_plans = params->sched_scan_plans;
+	unsigned int i;
+
+	plans = nla_nest_start(msg, NL80211_ATTR_SCHED_SCAN_PLANS);
+	if (!plans)
+		return -1;
+
+	for (i = 0; i < params->sched_scan_plans_num; i++) {
+		struct nlattr *plan = nla_nest_start(msg, i + 1);
+
+		if (!plan)
+			return -1;
+
+		if (!scan_plans[i].interval ||
+		    scan_plans[i].interval >
+		    drv->capa.max_sched_scan_plan_interval) {
+			wpa_printf(MSG_DEBUG,
+				   "nl80211: sched scan plan no. %u: Invalid interval: %u",
+				   i, scan_plans[i].interval);
+			return -1;
+		}
+
+		if (nla_put_u32(msg, NL80211_SCHED_SCAN_PLAN_INTERVAL,
+				scan_plans[i].interval))
+			return -1;
+
+		if (scan_plans[i].iterations >
+		    drv->capa.max_sched_scan_plan_iterations) {
+			wpa_printf(MSG_DEBUG,
+				   "nl80211: sched scan plan no. %u: Invalid number of iterations: %u",
+				   i, scan_plans[i].iterations);
+			return -1;
+		}
+
+		if (scan_plans[i].iterations &&
+		    nla_put_u32(msg, NL80211_SCHED_SCAN_PLAN_ITERATIONS,
+				scan_plans[i].iterations))
+			return -1;
+
+		nla_nest_end(msg, plan);
+
+		/*
+		 * All the scan plans must specify the number of iterations
+		 * except the last plan, which will run infinitely. So if the
+		 * number of iterations is not specified, this ought to be the
+		 * last scan plan.
+		 */
+		if (!scan_plans[i].iterations)
+			break;
+	}
+
+	if (i != params->sched_scan_plans_num - 1) {
+		wpa_printf(MSG_DEBUG,
+			   "nl80211: All sched scan plans but the last must specify number of iterations");
+		return -1;
+	}
+
+	nla_nest_end(msg, plans);
+	return 0;
+}
+
+
 /**
  * wpa_driver_nl80211_sched_scan - Initiate a scheduled scan
  * @priv: Pointer to private driver data from wpa_driver_nl80211_init()
  * @params: Scan parameters
- * @interval: Interval between scan cycles in milliseconds
  * Returns: 0 on success, -1 on failure or if not supported
  */
 int wpa_driver_nl80211_sched_scan(void *priv,
-				  struct wpa_driver_scan_params *params,
-				  u32 interval)
+				  struct wpa_driver_scan_params *params)
 {
 	struct i802_bss *bss = priv;
 	struct wpa_driver_nl80211_data *drv = bss->drv;
@@ -328,11 +415,27 @@ int wpa_driver_nl80211_sched_scan(void *priv,
 		return android_pno_start(bss, params);
 #endif /* ANDROID */
 
+	if (!params->sched_scan_plans_num ||
+	    params->sched_scan_plans_num > drv->capa.max_sched_scan_plans) {
+		wpa_printf(MSG_ERROR,
+			   "nl80211: Invalid number of sched scan plans: %u",
+			   params->sched_scan_plans_num);
+		return -1;
+	}
+
 	msg = nl80211_scan_common(bss, NL80211_CMD_START_SCHED_SCAN, params);
-	if (!msg ||
-	    nla_put_u32(msg, NL80211_ATTR_SCHED_SCAN_INTERVAL, interval))
+	if (!msg)
 		goto fail;
 
+	if (drv->capa.max_sched_scan_plan_iterations) {
+		if (nl80211_sched_scan_add_scan_plans(drv, msg, params))
+			goto fail;
+	} else {
+		if (nla_put_u32(msg, NL80211_ATTR_SCHED_SCAN_INTERVAL,
+				params->sched_scan_plans[0].interval * 1000))
+			goto fail;
+	}
+
 	if ((drv->num_filter_ssids &&
 	    (int) drv->num_filter_ssids <= drv->capa.max_match_sets) ||
 	    params->filter_rssi) {
@@ -395,8 +498,7 @@ int wpa_driver_nl80211_sched_scan(void *priv,
 		goto fail;
 	}
 
-	wpa_printf(MSG_DEBUG, "nl80211: Sched scan requested (ret=%d) - "
-		   "scan interval %d msec", ret, interval);
+	wpa_printf(MSG_DEBUG, "nl80211: Sched scan requested (ret=%d)", ret);
 
 fail:
 	nlmsg_free(msg);
@@ -436,28 +538,6 @@ int wpa_driver_nl80211_stop_sched_scan(void *priv)
 }
 
 
-const u8 * nl80211_get_ie(const u8 *ies, size_t ies_len, u8 ie)
-{
-	const u8 *end, *pos;
-
-	if (ies == NULL)
-		return NULL;
-
-	pos = ies;
-	end = ies + ies_len;
-
-	while (pos + 1 < end) {
-		if (pos + 2 + pos[1] > end)
-			break;
-		if (pos[0] == ie)
-			return pos;
-		pos += 2 + pos[1];
-	}
-
-	return NULL;
-}
-
-
 static int nl80211_scan_filtered(struct wpa_driver_nl80211_data *drv,
 				 const u8 *ie, size_t ie_len)
 {
@@ -467,7 +547,7 @@ static int nl80211_scan_filtered(struct wpa_driver_nl80211_data *drv,
 	if (drv->filter_ssids == NULL)
 		return 0;
 
-	ssid = nl80211_get_ie(ie, ie_len, WLAN_EID_SSID);
+	ssid = get_ie(ie, ie_len, WLAN_EID_SSID);
 	if (ssid == NULL)
 		return 1;
 
@@ -628,9 +708,9 @@ int bss_info_handler(struct nl_msg *msg, void *arg)
 		if (os_memcmp(res->res[i]->bssid, r->bssid, ETH_ALEN) != 0)
 			continue;
 
-		s1 = nl80211_get_ie((u8 *) (res->res[i] + 1),
-				    res->res[i]->ie_len, WLAN_EID_SSID);
-		s2 = nl80211_get_ie((u8 *) (r + 1), r->ie_len, WLAN_EID_SSID);
+		s1 = get_ie((u8 *) (res->res[i] + 1),
+			    res->res[i]->ie_len, WLAN_EID_SSID);
+		s2 = get_ie((u8 *) (r + 1), r->ie_len, WLAN_EID_SSID);
 		if (s1 == NULL || s2 == NULL || s1[1] != s2[1] ||
 		    os_memcmp(s1, s2, 2 + s1[1]) != 0)
 			continue;
@@ -781,3 +861,263 @@ void nl80211_dump_scan(struct wpa_driver_nl80211_data *drv)
 
 	wpa_scan_results_free(res);
 }
+
+
+int wpa_driver_nl80211_abort_scan(void *priv)
+{
+	struct i802_bss *bss = priv;
+	struct wpa_driver_nl80211_data *drv = bss->drv;
+	int ret;
+	struct nl_msg *msg;
+
+	wpa_printf(MSG_DEBUG, "nl80211: Abort scan");
+	msg = nl80211_cmd_msg(bss, 0, NL80211_CMD_ABORT_SCAN);
+	ret = send_and_recv_msgs(drv, msg, NULL, NULL);
+	if (ret) {
+		wpa_printf(MSG_DEBUG, "nl80211: Abort scan failed: ret=%d (%s)",
+			   ret, strerror(-ret));
+	}
+
+	return ret;
+}
+
+
+#ifdef CONFIG_DRIVER_NL80211_QCA
+
+static int scan_cookie_handler(struct nl_msg *msg, void *arg)
+{
+	struct nlattr *tb[NL80211_ATTR_MAX + 1];
+	struct genlmsghdr *gnlh = nlmsg_data(nlmsg_hdr(msg));
+	u64 *cookie = arg;
+
+	nla_parse(tb, NL80211_ATTR_MAX, genlmsg_attrdata(gnlh, 0),
+		  genlmsg_attrlen(gnlh, 0), NULL);
+
+	if (tb[NL80211_ATTR_VENDOR_DATA]) {
+		struct nlattr *nl_vendor = tb[NL80211_ATTR_VENDOR_DATA];
+		struct nlattr *tb_vendor[QCA_WLAN_VENDOR_ATTR_SCAN_MAX + 1];
+
+		nla_parse(tb_vendor, QCA_WLAN_VENDOR_ATTR_SCAN_MAX,
+			  nla_data(nl_vendor), nla_len(nl_vendor), NULL);
+
+		if (tb_vendor[QCA_WLAN_VENDOR_ATTR_SCAN_COOKIE])
+			*cookie = nla_get_u64(
+				tb_vendor[QCA_WLAN_VENDOR_ATTR_SCAN_COOKIE]);
+	}
+
+	return NL_SKIP;
+}
+
+
+/**
+ * wpa_driver_nl80211_vendor_scan - Request the driver to initiate a vendor scan
+ * @bss: Pointer to private driver data from wpa_driver_nl80211_init()
+ * @params: Scan parameters
+ * Returns: 0 on success, -1 on failure
+ */
+int wpa_driver_nl80211_vendor_scan(struct i802_bss *bss,
+				   struct wpa_driver_scan_params *params)
+{
+	struct wpa_driver_nl80211_data *drv = bss->drv;
+	struct nl_msg *msg = NULL;
+	struct nlattr *attr;
+	size_t i;
+	u32 scan_flags = 0;
+	int ret = -1;
+	u64 cookie = 0;
+
+	wpa_dbg(drv->ctx, MSG_DEBUG, "nl80211: vendor scan request");
+	drv->scan_for_auth = 0;
+
+	if (!(msg = nl80211_drv_msg(drv, 0, NL80211_CMD_VENDOR)) ||
+	    nla_put_u32(msg, NL80211_ATTR_VENDOR_ID, OUI_QCA) ||
+	    nla_put_u32(msg, NL80211_ATTR_VENDOR_SUBCMD,
+			QCA_NL80211_VENDOR_SUBCMD_TRIGGER_SCAN) )
+		goto fail;
+
+	attr = nla_nest_start(msg, NL80211_ATTR_VENDOR_DATA);
+	if (attr == NULL)
+		goto fail;
+
+	if (params->num_ssids) {
+		struct nlattr *ssids;
+
+		ssids = nla_nest_start(msg, QCA_WLAN_VENDOR_ATTR_SCAN_SSIDS);
+		if (ssids == NULL)
+			goto fail;
+		for (i = 0; i < params->num_ssids; i++) {
+			wpa_hexdump_ascii(MSG_MSGDUMP, "nl80211: Scan SSID",
+					params->ssids[i].ssid,
+					params->ssids[i].ssid_len);
+			if (nla_put(msg, i + 1, params->ssids[i].ssid_len,
+				    params->ssids[i].ssid))
+				goto fail;
+		}
+		nla_nest_end(msg, ssids);
+	}
+
+	if (params->extra_ies) {
+		wpa_hexdump(MSG_MSGDUMP, "nl80211: Scan extra IEs",
+			    params->extra_ies, params->extra_ies_len);
+		if (nla_put(msg, QCA_WLAN_VENDOR_ATTR_SCAN_IE,
+			    params->extra_ies_len, params->extra_ies))
+			goto fail;
+	}
+
+	if (params->freqs) {
+		struct nlattr *freqs;
+
+		freqs = nla_nest_start(msg,
+				       QCA_WLAN_VENDOR_ATTR_SCAN_FREQUENCIES);
+		if (freqs == NULL)
+			goto fail;
+		for (i = 0; params->freqs[i]; i++) {
+			wpa_printf(MSG_MSGDUMP,
+				   "nl80211: Scan frequency %u MHz",
+				   params->freqs[i]);
+			if (nla_put_u32(msg, i + 1, params->freqs[i]))
+				goto fail;
+		}
+		nla_nest_end(msg, freqs);
+	}
+
+	os_free(drv->filter_ssids);
+	drv->filter_ssids = params->filter_ssids;
+	params->filter_ssids = NULL;
+	drv->num_filter_ssids = params->num_filter_ssids;
+
+	if (params->low_priority && drv->have_low_prio_scan) {
+		wpa_printf(MSG_DEBUG,
+			   "nl80211: Add NL80211_SCAN_FLAG_LOW_PRIORITY");
+		scan_flags |= NL80211_SCAN_FLAG_LOW_PRIORITY;
+	}
+
+	if (params->mac_addr_rand) {
+		wpa_printf(MSG_DEBUG,
+			   "nl80211: Add NL80211_SCAN_FLAG_RANDOM_ADDR");
+		scan_flags |= NL80211_SCAN_FLAG_RANDOM_ADDR;
+
+		if (params->mac_addr) {
+			wpa_printf(MSG_DEBUG, "nl80211: MAC address: " MACSTR,
+				   MAC2STR(params->mac_addr));
+			if (nla_put(msg, QCA_WLAN_VENDOR_ATTR_SCAN_MAC,
+				    ETH_ALEN, params->mac_addr))
+				goto fail;
+		}
+
+		if (params->mac_addr_mask) {
+			wpa_printf(MSG_DEBUG, "nl80211: MAC address mask: "
+				   MACSTR, MAC2STR(params->mac_addr_mask));
+			if (nla_put(msg, QCA_WLAN_VENDOR_ATTR_SCAN_MAC_MASK,
+				    ETH_ALEN, params->mac_addr_mask))
+				goto fail;
+		}
+	}
+
+	if (scan_flags &&
+	    nla_put_u32(msg, NL80211_ATTR_SCAN_FLAGS, scan_flags))
+		goto fail;
+
+	if (params->p2p_probe) {
+		struct nlattr *rates;
+
+		wpa_printf(MSG_DEBUG, "nl80211: P2P probe - mask SuppRates");
+
+		rates = nla_nest_start(msg,
+				       QCA_WLAN_VENDOR_ATTR_SCAN_SUPP_RATES);
+		if (rates == NULL)
+			goto fail;
+
+		/*
+		 * Remove 2.4 GHz rates 1, 2, 5.5, 11 Mbps from supported rates
+		 * by masking out everything else apart from the OFDM rates 6,
+		 * 9, 12, 18, 24, 36, 48, 54 Mbps from non-MCS rates. All 5 GHz
+		 * rates are left enabled.
+		 */
+		if (nla_put(msg, NL80211_BAND_2GHZ, 8,
+			    "\x0c\x12\x18\x24\x30\x48\x60\x6c"))
+			goto fail;
+		nla_nest_end(msg, rates);
+
+		if (nla_put_flag(msg, QCA_WLAN_VENDOR_ATTR_SCAN_TX_NO_CCK_RATE))
+			goto fail;
+	}
+
+	nla_nest_end(msg, attr);
+
+	ret = send_and_recv_msgs(drv, msg, scan_cookie_handler, &cookie);
+	msg = NULL;
+	if (ret) {
+		wpa_printf(MSG_DEBUG,
+			   "nl80211: Vendor scan trigger failed: ret=%d (%s)",
+			   ret, strerror(-ret));
+		goto fail;
+	}
+
+	drv->vendor_scan_cookie = cookie;
+	drv->scan_state = SCAN_REQUESTED;
+
+	wpa_printf(MSG_DEBUG,
+		   "nl80211: Vendor scan requested (ret=%d) - scan timeout 30 seconds, scan cookie:0x%llx",
+		   ret, (long long unsigned int) cookie);
+	eloop_cancel_timeout(wpa_driver_nl80211_scan_timeout, drv, drv->ctx);
+	eloop_register_timeout(30, 0, wpa_driver_nl80211_scan_timeout,
+			       drv, drv->ctx);
+	drv->last_scan_cmd = NL80211_CMD_VENDOR;
+
+fail:
+	nlmsg_free(msg);
+	return ret;
+}
+
+
+/**
+ * nl80211_set_default_scan_ies - Set the scan default IEs to the driver
+ * @priv: Pointer to private driver data from wpa_driver_nl80211_init()
+ * @ies: Pointer to IEs buffer
+ * @ies_len: Length of IEs in bytes
+ * Returns: 0 on success, -1 on failure
+ */
+int nl80211_set_default_scan_ies(void *priv, const u8 *ies, size_t ies_len)
+{
+	struct i802_bss *bss = priv;
+	struct wpa_driver_nl80211_data *drv = bss->drv;
+	struct nl_msg *msg = NULL;
+	struct nlattr *attr;
+	int ret = -1;
+
+	if (!drv->set_wifi_conf_vendor_cmd_avail)
+		return -1;
+
+	if (!(msg = nl80211_drv_msg(drv, 0, NL80211_CMD_VENDOR)) ||
+	    nla_put_u32(msg, NL80211_ATTR_VENDOR_ID, OUI_QCA) ||
+	    nla_put_u32(msg, NL80211_ATTR_VENDOR_SUBCMD,
+			QCA_NL80211_VENDOR_SUBCMD_SET_WIFI_CONFIGURATION))
+		goto fail;
+
+	attr = nla_nest_start(msg, NL80211_ATTR_VENDOR_DATA);
+	if (attr == NULL)
+		goto fail;
+
+	wpa_hexdump(MSG_MSGDUMP, "nl80211: Scan default IEs", ies, ies_len);
+	if (nla_put(msg, QCA_WLAN_VENDOR_ATTR_CONFIG_SCAN_DEFAULT_IES,
+		    ies_len, ies))
+		goto fail;
+
+	nla_nest_end(msg, attr);
+
+	ret = send_and_recv_msgs(drv, msg, NULL, NULL);
+	msg = NULL;
+	if (ret) {
+		wpa_printf(MSG_ERROR,
+			   "nl80211: Set scan default IEs failed: ret=%d (%s)",
+			   ret, strerror(-ret));
+		goto fail;
+	}
+
+fail:
+	nlmsg_free(msg);
+	return ret;
+}
+
+#endif /* CONFIG_DRIVER_NL80211_QCA */
diff --git a/src/drivers/driver_privsep.c b/src/drivers/driver_privsep.c
index 1f1676a20ac58..43d41937d474c 100644
--- a/src/drivers/driver_privsep.c
+++ b/src/drivers/driver_privsep.c
@@ -161,11 +161,11 @@ wpa_driver_privsep_get_scan_results2(void *priv)
 		return NULL;
 	}
 
-	while (results->num < (size_t) num && pos + sizeof(int) < end) {
+	while (results->num < (size_t) num && end - pos > (int) sizeof(int)) {
 		int len;
 		os_memcpy(&len, pos, sizeof(int));
 		pos += sizeof(int);
-		if (len < 0 || len > 10000 || pos + len > end)
+		if (len < 0 || len > 10000 || len > end - pos)
 			break;
 
 		r = os_malloc(len);
diff --git a/src/drivers/driver_roboswitch.c b/src/drivers/driver_roboswitch.c
index d3e05955f7a88..e8a51354dd0cc 100644
--- a/src/drivers/driver_roboswitch.c
+++ b/src/drivers/driver_roboswitch.c
@@ -1,6 +1,6 @@
 /*
  * WPA Supplicant - roboswitch driver interface
- * Copyright (c) 2008-2009 Jouke Witteveen
+ * Copyright (c) 2008-2012 Jouke Witteveen
  *
  * This software may be distributed under the terms of the BSD license.
  * See README for more details.
@@ -401,7 +401,9 @@ static void * wpa_driver_roboswitch_init(void *ctx, const char *ifname)
 		os_free(drv);
 		return NULL;
 	}
-	if (if_mii(&drv->ifr)->phy_id != ROBO_PHY_ADDR) {
+	/* BCM63xx devices provide 0 here */
+	if (if_mii(&drv->ifr)->phy_id != ROBO_PHY_ADDR &&
+	    if_mii(&drv->ifr)->phy_id != 0) {
 		wpa_printf(MSG_INFO, "%s: Invalid phy address (not a "
 			   "RoboSwitch?)", __func__);
 		os_free(drv);
diff --git a/src/drivers/driver_wext.c b/src/drivers/driver_wext.c
index 01defdff4f155..791cd5d435d00 100644
--- a/src/drivers/driver_wext.c
+++ b/src/drivers/driver_wext.c
@@ -422,7 +422,7 @@ static void wpa_driver_wext_event_assoc_ies(struct wpa_driver_wext_data *drv)
 
 
 static void wpa_driver_wext_event_wireless(struct wpa_driver_wext_data *drv,
-					   char *data, int len)
+					   char *data, unsigned int len)
 {
 	struct iw_event iwe_buf, *iwe = &iwe_buf;
 	char *pos, *end, *custom, *buf;
@@ -430,13 +430,13 @@ static void wpa_driver_wext_event_wireless(struct wpa_driver_wext_data *drv,
 	pos = data;
 	end = data + len;
 
-	while (pos + IW_EV_LCP_LEN <= end) {
+	while ((size_t) (end - pos) >= IW_EV_LCP_LEN) {
 		/* Event data may be unaligned, so make a local, aligned copy
 		 * before processing. */
 		os_memcpy(&iwe_buf, pos, IW_EV_LCP_LEN);
 		wpa_printf(MSG_DEBUG, "Wireless event: cmd=0x%x len=%d",
 			   iwe->cmd, iwe->len);
-		if (iwe->len <= IW_EV_LCP_LEN)
+		if (iwe->len <= IW_EV_LCP_LEN || iwe->len > end - pos)
 			return;
 
 		custom = pos + IW_EV_POINT_LEN;
@@ -480,7 +480,7 @@ static void wpa_driver_wext_event_wireless(struct wpa_driver_wext_data *drv,
 			}
 			break;
 		case IWEVMICHAELMICFAILURE:
-			if (custom + iwe->u.data.length > end) {
+			if (iwe->u.data.length > end - custom) {
 				wpa_printf(MSG_DEBUG, "WEXT: Invalid "
 					   "IWEVMICHAELMICFAILURE length");
 				return;
@@ -489,7 +489,7 @@ static void wpa_driver_wext_event_wireless(struct wpa_driver_wext_data *drv,
 				drv->ctx, custom, iwe->u.data.length);
 			break;
 		case IWEVCUSTOM:
-			if (custom + iwe->u.data.length > end) {
+			if (iwe->u.data.length > end - custom) {
 				wpa_printf(MSG_DEBUG, "WEXT: Invalid "
 					   "IWEVCUSTOM length");
 				return;
@@ -508,7 +508,7 @@ static void wpa_driver_wext_event_wireless(struct wpa_driver_wext_data *drv,
 					     NULL);
 			break;
 		case IWEVASSOCREQIE:
-			if (custom + iwe->u.data.length > end) {
+			if (iwe->u.data.length > end - custom) {
 				wpa_printf(MSG_DEBUG, "WEXT: Invalid "
 					   "IWEVASSOCREQIE length");
 				return;
@@ -517,7 +517,7 @@ static void wpa_driver_wext_event_wireless(struct wpa_driver_wext_data *drv,
 				drv, custom, iwe->u.data.length);
 			break;
 		case IWEVASSOCRESPIE:
-			if (custom + iwe->u.data.length > end) {
+			if (iwe->u.data.length > end - custom) {
 				wpa_printf(MSG_DEBUG, "WEXT: Invalid "
 					   "IWEVASSOCRESPIE length");
 				return;
@@ -526,7 +526,7 @@ static void wpa_driver_wext_event_wireless(struct wpa_driver_wext_data *drv,
 				drv, custom, iwe->u.data.length);
 			break;
 		case IWEVPMKIDCAND:
-			if (custom + iwe->u.data.length > end) {
+			if (iwe->u.data.length > end - custom) {
 				wpa_printf(MSG_DEBUG, "WEXT: Invalid "
 					   "IWEVPMKIDCAND length");
 				return;
@@ -1220,7 +1220,7 @@ static void wext_get_scan_ssid(struct iw_event *iwe,
 			       char *end)
 {
 	int ssid_len = iwe->u.essid.length;
-	if (custom + ssid_len > end)
+	if (ssid_len > end - custom)
 		return;
 	if (iwe->u.essid.flags &&
 	    ssid_len > 0 &&
@@ -1316,7 +1316,7 @@ static void wext_get_scan_rate(struct iw_event *iwe,
 	size_t clen;
 
 	clen = iwe->len;
-	if (custom + clen > end)
+	if (clen > (size_t) (end - custom))
 		return;
 	maxrate = 0;
 	while (((ssize_t) clen) >= (ssize_t) sizeof(struct iw_param)) {
@@ -1369,7 +1369,7 @@ static void wext_get_scan_custom(struct iw_event *iwe,
 	u8 *tmp;
 
 	clen = iwe->u.data.length;
-	if (custom + clen > end)
+	if (clen > (size_t) (end - custom))
 		return;
 
 	if (clen > 7 && os_strncmp(custom, "wpa_ie=", 7) == 0) {
@@ -1441,8 +1441,8 @@ static void wpa_driver_wext_add_scan_entry(struct wpa_scan_results *res,
 	/* Figure out whether we need to fake any IEs */
 	pos = data->ie;
 	end = pos + data->ie_len;
-	while (pos && pos + 1 < end) {
-		if (pos + 2 + pos[1] > end)
+	while (pos && end - pos > 1) {
+		if (2 + pos[1] > end - pos)
 			break;
 		if (pos[0] == WLAN_EID_SSID)
 			ssid_ie = pos;
@@ -1530,11 +1530,11 @@ struct wpa_scan_results * wpa_driver_wext_get_scan_results(void *priv)
 	end = (char *) res_buf + len;
 	os_memset(&data, 0, sizeof(data));
 
-	while (pos + IW_EV_LCP_LEN <= end) {
+	while ((size_t) (end - pos) >= IW_EV_LCP_LEN) {
 		/* Event data may be unaligned, so make a local, aligned copy
 		 * before processing. */
 		os_memcpy(&iwe_buf, pos, IW_EV_LCP_LEN);
-		if (iwe->len <= IW_EV_LCP_LEN)
+		if (iwe->len <= IW_EV_LCP_LEN || iwe->len > end - pos)
 			break;
 
 		custom = pos + IW_EV_POINT_LEN;
diff --git a/src/drivers/driver_wired.c b/src/drivers/driver_wired.c
index f95f3ccf5b66a..422a22064ebe2 100644
--- a/src/drivers/driver_wired.c
+++ b/src/drivers/driver_wired.c
@@ -8,12 +8,17 @@
  */
 
 #include "includes.h"
+
+#include "common.h"
+#include "eloop.h"
+#include "driver.h"
+
 #include <sys/ioctl.h>
+#undef IFNAMSIZ
 #include <net/if.h>
 #ifdef __linux__
 #include <netpacket/packet.h>
 #include <net/if_arp.h>
-#include <net/if.h>
 #endif /* __linux__ */
 #if defined(__FreeBSD__) || defined(__DragonFly__) || defined(__FreeBSD_kernel__)
 #include <net/if_dl.h>
@@ -23,10 +28,6 @@
 #include <sys/sockio.h>
 #endif /* __sun__ */
 
-#include "common.h"
-#include "eloop.h"
-#include "driver.h"
-
 #ifdef _MSC_VER
 #pragma pack(push, 1)
 #endif /* _MSC_VER */
diff --git a/src/drivers/drivers.c b/src/drivers/drivers.c
index a98af9ac7d711..00773a7113f69 100644
--- a/src/drivers/drivers.c
+++ b/src/drivers/drivers.c
@@ -10,42 +10,6 @@
 #include "utils/common.h"
 #include "driver.h"
 
-#ifdef CONFIG_DRIVER_WEXT
-extern struct wpa_driver_ops wpa_driver_wext_ops; /* driver_wext.c */
-#endif /* CONFIG_DRIVER_WEXT */
-#ifdef CONFIG_DRIVER_NL80211
-extern struct wpa_driver_ops wpa_driver_nl80211_ops; /* driver_nl80211.c */
-#endif /* CONFIG_DRIVER_NL80211 */
-#ifdef CONFIG_DRIVER_HOSTAP
-extern struct wpa_driver_ops wpa_driver_hostap_ops; /* driver_hostap.c */
-#endif /* CONFIG_DRIVER_HOSTAP */
-#ifdef CONFIG_DRIVER_BSD
-extern struct wpa_driver_ops wpa_driver_bsd_ops; /* driver_bsd.c */
-#endif /* CONFIG_DRIVER_BSD */
-#ifdef CONFIG_DRIVER_OPENBSD
-extern struct wpa_driver_ops wpa_driver_openbsd_ops; /* driver_openbsd.c */
-#endif /* CONFIG_DRIVER_OPENBSD */
-#ifdef CONFIG_DRIVER_NDIS
-extern struct wpa_driver_ops wpa_driver_ndis_ops; /* driver_ndis.c */
-#endif /* CONFIG_DRIVER_NDIS */
-#ifdef CONFIG_DRIVER_WIRED
-extern struct wpa_driver_ops wpa_driver_wired_ops; /* driver_wired.c */
-#endif /* CONFIG_DRIVER_WIRED */
-#ifdef CONFIG_DRIVER_MACSEC_QCA
- /* driver_macsec_qca.c */
-extern struct wpa_driver_ops wpa_driver_macsec_qca_ops;
-#endif /* CONFIG_DRIVER_MACSEC_QCA */
-#ifdef CONFIG_DRIVER_ROBOSWITCH
-/* driver_roboswitch.c */
-extern struct wpa_driver_ops wpa_driver_roboswitch_ops;
-#endif /* CONFIG_DRIVER_ROBOSWITCH */
-#ifdef CONFIG_DRIVER_ATHEROS
-extern struct wpa_driver_ops wpa_driver_atheros_ops; /* driver_atheros.c */
-#endif /* CONFIG_DRIVER_ATHEROS */
-#ifdef CONFIG_DRIVER_NONE
-extern struct wpa_driver_ops wpa_driver_none_ops; /* driver_none.c */
-#endif /* CONFIG_DRIVER_NONE */
-
 
 const struct wpa_driver_ops *const wpa_drivers[] =
 {
diff --git a/src/drivers/drivers.mak b/src/drivers/drivers.mak
index 3dd43c73803e7..c6d3f8181808a 100644
--- a/src/drivers/drivers.mak
+++ b/src/drivers/drivers.mak
@@ -29,12 +29,15 @@ DRV_OBJS += ../src/drivers/driver_nl80211_capa.o
 DRV_OBJS += ../src/drivers/driver_nl80211_event.o
 DRV_OBJS += ../src/drivers/driver_nl80211_monitor.o
 DRV_OBJS += ../src/drivers/driver_nl80211_scan.o
-DRV_OBJS += ../src/utils/radiotap.o
+ifdef CONFIG_DRIVER_NL80211_QCA
+DRV_CFLAGS += -DCONFIG_DRIVER_NL80211_QCA
+endif
 NEED_SME=y
 NEED_AP_MLME=y
 NEED_NETLINK=y
 NEED_LINUX_IOCTL=y
 NEED_RFKILL=y
+NEED_RADIOTAP=y
 
 ifdef CONFIG_LIBNL32
   DRV_LIBS += -lnl-3
@@ -60,7 +63,9 @@ else
   endif
 
   ifdef CONFIG_LIBNL20
-    DRV_LIBS += -lnl-genl
+    ifndef CONFIG_LIBNL_TINY
+      DRV_LIBS += -lnl-genl
+    endif
     DRV_CFLAGS += -DCONFIG_LIBNL20
   endif
 endif
@@ -159,6 +164,10 @@ ifdef NEED_RFKILL
 DRV_OBJS += ../src/drivers/rfkill.o
 endif
 
+ifdef NEED_RADIOTAP
+DRV_OBJS += ../src/utils/radiotap.o
+endif
+
 ifdef CONFIG_VLAN_NETLINK
 ifdef CONFIG_FULL_DYNAMIC_VLAN
 ifdef CONFIG_LIBNL32
diff --git a/src/drivers/drivers.mk b/src/drivers/drivers.mk
index 8da4c53e0f82e..c6fe4c20c561b 100644
--- a/src/drivers/drivers.mk
+++ b/src/drivers/drivers.mk
@@ -25,12 +25,15 @@ DRV_OBJS += src/drivers/driver_nl80211_capa.c
 DRV_OBJS += src/drivers/driver_nl80211_event.c
 DRV_OBJS += src/drivers/driver_nl80211_monitor.c
 DRV_OBJS += src/drivers/driver_nl80211_scan.c
-DRV_OBJS += src/utils/radiotap.c
+ifdef CONFIG_DRIVER_NL80211_QCA
+DRV_CFLAGS += -DCONFIG_DRIVER_NL80211_QCA
+endif
 NEED_SME=y
 NEED_AP_MLME=y
 NEED_NETLINK=y
 NEED_LINUX_IOCTL=y
 NEED_RFKILL=y
+NEED_RADIOTAP=y
 
 ifdef CONFIG_LIBNL32
   DRV_LIBS += -lnl-3
@@ -48,7 +51,9 @@ else
   endif
 
   ifdef CONFIG_LIBNL20
-    DRV_LIBS += -lnl-genl
+    ifndef CONFIG_LIBNL_TINY
+      DRV_LIBS += -lnl-genl
+    endif
     DRV_CFLAGS += -DCONFIG_LIBNL20
   endif
 endif
@@ -144,6 +149,10 @@ ifdef NEED_RFKILL
 DRV_OBJS += src/drivers/rfkill.c
 endif
 
+ifdef NEED_RADIOTAP
+DRV_OBJS += src/utils/radiotap.c
+endif
+
 ifdef CONFIG_DRIVER_CUSTOM
 DRV_CFLAGS += -DCONFIG_DRIVER_CUSTOM
 endif
diff --git a/src/drivers/nl80211_copy.h b/src/drivers/nl80211_copy.h
index ae16ba9cb1e31..2206941514345 100644
--- a/src/drivers/nl80211_copy.h
+++ b/src/drivers/nl80211_copy.h
@@ -10,6 +10,7 @@
  * Copyright 2008, 2009 Luis R. Rodriguez <lrodriguez@atheros.com>
  * Copyright 2008 Jouni Malinen <jouni.malinen@atheros.com>
  * Copyright 2008 Colin McCabe <colin@cozybit.com>
+ * Copyright 2015	Intel Deutschland GmbH
  *
  * Permission to use, copy, modify, and/or distribute this software for any
  * purpose with or without fee is hereby granted, provided that the above
@@ -321,14 +322,24 @@
  * @NL80211_CMD_GET_SCAN: get scan results
  * @NL80211_CMD_TRIGGER_SCAN: trigger a new scan with the given parameters
  *	%NL80211_ATTR_TX_NO_CCK_RATE is used to decide whether to send the
- *	probe requests at CCK rate or not.
+ *	probe requests at CCK rate or not. %NL80211_ATTR_MAC can be used to
+ *	specify a BSSID to scan for; if not included, the wildcard BSSID will
+ *	be used.
  * @NL80211_CMD_NEW_SCAN_RESULTS: scan notification (as a reply to
  *	NL80211_CMD_GET_SCAN and on the "scan" multicast group)
  * @NL80211_CMD_SCAN_ABORTED: scan was aborted, for unspecified reasons,
  *	partial scan results may be available
  *
  * @NL80211_CMD_START_SCHED_SCAN: start a scheduled scan at certain
- *	intervals, as specified by %NL80211_ATTR_SCHED_SCAN_INTERVAL.
+ *	intervals and certain number of cycles, as specified by
+ *	%NL80211_ATTR_SCHED_SCAN_PLANS. If %NL80211_ATTR_SCHED_SCAN_PLANS is
+ *	not specified and only %NL80211_ATTR_SCHED_SCAN_INTERVAL is specified,
+ *	scheduled scan will run in an infinite loop with the specified interval.
+ *	These attributes are mutually exculsive,
+ *	i.e. NL80211_ATTR_SCHED_SCAN_INTERVAL must not be passed if
+ *	NL80211_ATTR_SCHED_SCAN_PLANS is defined.
+ *	If for some reason scheduled scan is aborted by the driver, all scan
+ *	plans are canceled (including scan plans that did not start yet).
  *	Like with normal scans, if SSIDs (%NL80211_ATTR_SCAN_SSIDS)
  *	are passed, they are used in the probe requests.  For
  *	broadcast, a broadcast SSID must be passed (ie. an empty
@@ -418,7 +429,11 @@
  * @NL80211_CMD_ASSOCIATE: association request and notification; like
  *	NL80211_CMD_AUTHENTICATE but for Association and Reassociation
  *	(similar to MLME-ASSOCIATE.request, MLME-REASSOCIATE.request,
- *	MLME-ASSOCIATE.confirm or MLME-REASSOCIATE.confirm primitives).
+ *	MLME-ASSOCIATE.confirm or MLME-REASSOCIATE.confirm primitives). The
+ *	%NL80211_ATTR_PREV_BSSID attribute is used to specify whether the
+ *	request is for the initial association to an ESS (that attribute not
+ *	included) or for reassociation within the ESS (that attribute is
+ *	included).
  * @NL80211_CMD_DEAUTHENTICATE: deauthentication request and notification; like
  *	NL80211_CMD_AUTHENTICATE but for Deauthentication frames (similar to
  *	MLME-DEAUTHENTICATION.request and MLME-DEAUTHENTICATE.indication
@@ -468,6 +483,9 @@
  *	set of BSSID,frequency parameters is used (i.e., either the enforcing
  *	%NL80211_ATTR_MAC,%NL80211_ATTR_WIPHY_FREQ or the less strict
  *	%NL80211_ATTR_MAC_HINT and %NL80211_ATTR_WIPHY_FREQ_HINT).
+ *	%NL80211_ATTR_PREV_BSSID can be used to request a reassociation within
+ *	the ESS in case the device is already associated and an association with
+ *	a different BSS is desired.
  *	Background scan period can optionally be
  *	specified in %NL80211_ATTR_BG_SCAN_PERIOD,
  *	if not specified default background scan configuration
@@ -475,7 +493,12 @@
  *	This attribute is ignored if driver does not support roam scan.
  *	It is also sent as an event, with the BSSID and response IEs when the
  *	connection is established or failed to be established. This can be
- *	determined by the STATUS_CODE attribute.
+ *	determined by the %NL80211_ATTR_STATUS_CODE attribute (0 = success,
+ *	non-zero = failure). If %NL80211_ATTR_TIMED_OUT is included in the
+ *	event, the connection attempt failed due to not being able to initiate
+ *	authentication/association or not receiving a response from the AP.
+ *	Non-zero %NL80211_ATTR_STATUS_CODE value is indicated in that case as
+ *	well to remain backwards compatible.
  * @NL80211_CMD_ROAM: request that the card roam (currently not implemented),
  *	sent as an event when the card/driver roamed by itself.
  * @NL80211_CMD_DISCONNECT: drop a given connection; also used to notify
@@ -811,6 +834,10 @@
  *	as an event to indicate changes for devices with wiphy-specific regdom
  *	management.
  *
+ * @NL80211_CMD_ABORT_SCAN: Stop an ongoing scan. Returns -ENOENT if a scan is
+ *	not running. The driver indicates the status of the scan through
+ *	cfg80211_scan_done().
+ *
  * @NL80211_CMD_MAX: highest used command number
  * @__NL80211_CMD_AFTER_LAST: internal use
  */
@@ -997,6 +1024,8 @@ enum nl80211_commands {
 
 	NL80211_CMD_WIPHY_REG_CHANGE,
 
+	NL80211_CMD_ABORT_SCAN,
+
 	/* add new commands above here */
 
 	/* used to define NL80211_CMD_MAX below */
@@ -1270,8 +1299,11 @@ enum nl80211_commands {
  * @NL80211_ATTR_RESP_IE: (Re)association response information elements as
  *	sent by peer, for ROAM and successful CONNECT events.
  *
- * @NL80211_ATTR_PREV_BSSID: previous BSSID, to be used by in ASSOCIATE
- *	commands to specify using a reassociate frame
+ * @NL80211_ATTR_PREV_BSSID: previous BSSID, to be used in ASSOCIATE and CONNECT
+ *	commands to specify a request to reassociate within an ESS, i.e., to use
+ *	Reassociate Request frame (with the value of this attribute in the
+ *	Current AP address field) instead of Association Request frame which is
+ *	used for the initial association to an ESS.
  *
  * @NL80211_ATTR_KEY: key information in a nested attribute with
  *	%NL80211_KEY_* sub-attributes
@@ -1712,6 +1744,8 @@ enum nl80211_commands {
  *	underlying device supports these minimal RRM features:
  *		%NL80211_FEATURE_DS_PARAM_SET_IE_IN_PROBES,
  *		%NL80211_FEATURE_QUIET,
+ *	Or, if global RRM is supported, see:
+ *		%NL80211_EXT_FEATURE_RRM
  *	If this flag is used, driver must add the Power Capabilities IE to the
  *	association request. In addition, it must also set the RRM capability
  *	flag in the association request's Capability Info field.
@@ -1754,12 +1788,85 @@ enum nl80211_commands {
  *	should be contained in the result as the sum of the respective counters
  *	over all channels.
  *
- * @NL80211_ATTR_SCHED_SCAN_DELAY: delay before a scheduled scan (or a
- *	WoWLAN net-detect scan) is started, u32 in seconds.
+ * @NL80211_ATTR_SCHED_SCAN_DELAY: delay before the first cycle of a
+ *	scheduled scan is started.  Or the delay before a WoWLAN
+ *	net-detect scan is started, counting from the moment the
+ *	system is suspended.  This value is a u32, in seconds.
 
  * @NL80211_ATTR_REG_INDOOR: flag attribute, if set indicates that the device
  *      is operating in an indoor environment.
  *
+ * @NL80211_ATTR_MAX_NUM_SCHED_SCAN_PLANS: maximum number of scan plans for
+ *	scheduled scan supported by the device (u32), a wiphy attribute.
+ * @NL80211_ATTR_MAX_SCAN_PLAN_INTERVAL: maximum interval (in seconds) for
+ *	a scan plan (u32), a wiphy attribute.
+ * @NL80211_ATTR_MAX_SCAN_PLAN_ITERATIONS: maximum number of iterations in
+ *	a scan plan (u32), a wiphy attribute.
+ * @NL80211_ATTR_SCHED_SCAN_PLANS: a list of scan plans for scheduled scan.
+ *	Each scan plan defines the number of scan iterations and the interval
+ *	between scans. The last scan plan will always run infinitely,
+ *	thus it must not specify the number of iterations, only the interval
+ *	between scans. The scan plans are executed sequentially.
+ *	Each scan plan is a nested attribute of &enum nl80211_sched_scan_plan.
+ * @NL80211_ATTR_PBSS: flag attribute. If set it means operate
+ *	in a PBSS. Specified in %NL80211_CMD_CONNECT to request
+ *	connecting to a PCP, and in %NL80211_CMD_START_AP to start
+ *	a PCP instead of AP. Relevant for DMG networks only.
+ * @NL80211_ATTR_BSS_SELECT: nested attribute for driver supporting the
+ *	BSS selection feature. When used with %NL80211_CMD_GET_WIPHY it contains
+ *	attributes according &enum nl80211_bss_select_attr to indicate what
+ *	BSS selection behaviours are supported. When used with %NL80211_CMD_CONNECT
+ *	it contains the behaviour-specific attribute containing the parameters for
+ *	BSS selection to be done by driver and/or firmware.
+ *
+ * @NL80211_ATTR_STA_SUPPORT_P2P_PS: whether P2P PS mechanism supported
+ *	or not. u8, one of the values of &enum nl80211_sta_p2p_ps_status
+ *
+ * @NL80211_ATTR_PAD: attribute used for padding for 64-bit alignment
+ *
+ * @NL80211_ATTR_IFTYPE_EXT_CAPA: Nested attribute of the following attributes:
+ *	%NL80211_ATTR_IFTYPE, %NL80211_ATTR_EXT_CAPA,
+ *	%NL80211_ATTR_EXT_CAPA_MASK, to specify the extended capabilities per
+ *	interface type.
+ *
+ * @NL80211_ATTR_MU_MIMO_GROUP_DATA: array of 24 bytes that defines a MU-MIMO
+ *	groupID for monitor mode.
+ *	The first 8 bytes are a mask that defines the membership in each
+ *	group (there are 64 groups, group 0 and 63 are reserved),
+ *	each bit represents a group and set to 1 for being a member in
+ *	that group and 0 for not being a member.
+ *	The remaining 16 bytes define the position in each group: 2 bits for
+ *	each group.
+ *	(smaller group numbers represented on most significant bits and bigger
+ *	group numbers on least significant bits.)
+ *	This attribute is used only if all interfaces are in monitor mode.
+ *	Set this attribute in order to monitor packets using the given MU-MIMO
+ *	groupID data.
+ *	to turn off that feature set all the bits of the groupID to zero.
+ * @NL80211_ATTR_MU_MIMO_FOLLOW_MAC_ADDR: mac address for the sniffer to follow
+ *	when using MU-MIMO air sniffer.
+ *	to turn that feature off set an invalid mac address
+ *	(e.g. FF:FF:FF:FF:FF:FF)
+ *
+ * @NL80211_ATTR_SCAN_START_TIME_TSF: The time at which the scan was actually
+ *	started (u64). The time is the TSF of the BSS the interface that
+ *	requested the scan is connected to (if available, otherwise this
+ *	attribute must not be included).
+ * @NL80211_ATTR_SCAN_START_TIME_TSF_BSSID: The BSS according to which
+ *	%NL80211_ATTR_SCAN_START_TIME_TSF is set.
+ * @NL80211_ATTR_MEASUREMENT_DURATION: measurement duration in TUs (u16). If
+ *	%NL80211_ATTR_MEASUREMENT_DURATION_MANDATORY is not set, this is the
+ *	maximum measurement duration allowed. This attribute is used with
+ *	measurement requests. It can also be used with %NL80211_CMD_TRIGGER_SCAN
+ *	if the scan is used for beacon report radio measurement.
+ * @NL80211_ATTR_MEASUREMENT_DURATION_MANDATORY: flag attribute that indicates
+ *	that the duration specified with %NL80211_ATTR_MEASUREMENT_DURATION is
+ *	mandatory. If this flag is not set, the duration is the maximum duration
+ *	and the actual measurement duration may be shorter.
+ *
+ * @NL80211_ATTR_MESH_PEER_AID: Association ID for the mesh peer (u16). This is
+ *	used to pull the stored data for mesh peer in power save state.
+ *
  * @NUM_NL80211_ATTR: total number of nl80211_attrs available
  * @NL80211_ATTR_MAX: highest attribute number currently defined
  * @__NL80211_ATTR_AFTER_LAST: internal use
@@ -2129,6 +2236,31 @@ enum nl80211_attrs {
 
 	NL80211_ATTR_REG_INDOOR,
 
+	NL80211_ATTR_MAX_NUM_SCHED_SCAN_PLANS,
+	NL80211_ATTR_MAX_SCAN_PLAN_INTERVAL,
+	NL80211_ATTR_MAX_SCAN_PLAN_ITERATIONS,
+	NL80211_ATTR_SCHED_SCAN_PLANS,
+
+	NL80211_ATTR_PBSS,
+
+	NL80211_ATTR_BSS_SELECT,
+
+	NL80211_ATTR_STA_SUPPORT_P2P_PS,
+
+	NL80211_ATTR_PAD,
+
+	NL80211_ATTR_IFTYPE_EXT_CAPA,
+
+	NL80211_ATTR_MU_MIMO_GROUP_DATA,
+	NL80211_ATTR_MU_MIMO_FOLLOW_MAC_ADDR,
+
+	NL80211_ATTR_SCAN_START_TIME_TSF,
+	NL80211_ATTR_SCAN_START_TIME_TSF_BSSID,
+	NL80211_ATTR_MEASUREMENT_DURATION,
+	NL80211_ATTR_MEASUREMENT_DURATION_MANDATORY,
+
+	NL80211_ATTR_MESH_PEER_AID,
+
 	/* add attributes here, update the policy in nl80211.c */
 
 	__NL80211_ATTR_AFTER_LAST,
@@ -2272,6 +2404,20 @@ enum nl80211_sta_flags {
 	NL80211_STA_FLAG_MAX = __NL80211_STA_FLAG_AFTER_LAST - 1
 };
 
+/**
+ * enum nl80211_sta_p2p_ps_status - station support of P2P PS
+ *
+ * @NL80211_P2P_PS_UNSUPPORTED: station doesn't support P2P PS mechanism
+ * @@NL80211_P2P_PS_SUPPORTED: station supports P2P PS mechanism
+ * @NUM_NL80211_P2P_PS_STATUS: number of values
+ */
+enum nl80211_sta_p2p_ps_status {
+	NL80211_P2P_PS_UNSUPPORTED = 0,
+	NL80211_P2P_PS_SUPPORTED,
+
+	NUM_NL80211_P2P_PS_STATUS,
+};
+
 #define NL80211_STA_FLAG_MAX_OLD_API	NL80211_STA_FLAG_TDLS_PEER
 
 /**
@@ -2429,6 +2575,9 @@ enum nl80211_sta_bss_param {
  *	TID+1 and the special TID 16 (i.e. value 17) is used for non-QoS frames;
  *	each one of those is again nested with &enum nl80211_tid_stats
  *	attributes carrying the actual values.
+ * @NL80211_STA_INFO_RX_DURATION: aggregate PPDU duration for all frames
+ *	received from the station (u64, usec)
+ * @NL80211_STA_INFO_PAD: attribute used for padding for 64-bit alignment
  * @__NL80211_STA_INFO_AFTER_LAST: internal
  * @NL80211_STA_INFO_MAX: highest possible station info attribute
  */
@@ -2465,6 +2614,8 @@ enum nl80211_sta_info {
 	NL80211_STA_INFO_BEACON_RX,
 	NL80211_STA_INFO_BEACON_SIGNAL_AVG,
 	NL80211_STA_INFO_TID_STATS,
+	NL80211_STA_INFO_RX_DURATION,
+	NL80211_STA_INFO_PAD,
 
 	/* keep last */
 	__NL80211_STA_INFO_AFTER_LAST,
@@ -2481,6 +2632,7 @@ enum nl80211_sta_info {
  *	transmitted MSDUs (not counting the first attempt; u64)
  * @NL80211_TID_STATS_TX_MSDU_FAILED: number of failed transmitted
  *	MSDUs (u64)
+ * @NL80211_TID_STATS_PAD: attribute used for padding for 64-bit alignment
  * @NUM_NL80211_TID_STATS: number of attributes here
  * @NL80211_TID_STATS_MAX: highest numbered attribute here
  */
@@ -2490,6 +2642,7 @@ enum nl80211_tid_stats {
 	NL80211_TID_STATS_TX_MSDU,
 	NL80211_TID_STATS_TX_MSDU_RETRIES,
 	NL80211_TID_STATS_TX_MSDU_FAILED,
+	NL80211_TID_STATS_PAD,
 
 	/* keep last */
 	NUM_NL80211_TID_STATS,
@@ -2619,16 +2772,17 @@ enum nl80211_band_attr {
  *	an indoor surroundings, i.e., it is connected to AC power (and not
  *	through portable DC inverters) or is under the control of a master
  *	that is acting as an AP and is connected to AC power.
- * @NL80211_FREQUENCY_ATTR_GO_CONCURRENT: GO operation is allowed on this
+ * @NL80211_FREQUENCY_ATTR_IR_CONCURRENT: IR operation is allowed on this
  *	channel if it's connected concurrently to a BSS on the same channel on
  *	the 2 GHz band or to a channel in the same UNII band (on the 5 GHz
- *	band), and IEEE80211_CHAN_RADAR is not set. Instantiating a GO on a
- *	channel that has the GO_CONCURRENT attribute set can be done when there
- *	is a clear assessment that the device is operating under the guidance of
- *	an authorized master, i.e., setting up a GO while the device is also
- *	connected to an AP with DFS and radar detection on the UNII band (it is
- *	up to user-space, i.e., wpa_supplicant to perform the required
- *	verifications)
+ *	band), and IEEE80211_CHAN_RADAR is not set. Instantiating a GO or TDLS
+ *	off-channel on a channel that has the IR_CONCURRENT attribute set can be
+ *	done when there is a clear assessment that the device is operating under
+ *	the guidance of an authorized master, i.e., setting up a GO or TDLS
+ *	off-channel while the device is also connected to an AP with DFS and
+ *	radar detection on the UNII band (it is up to user-space, i.e.,
+ *	wpa_supplicant to perform the required verifications). Using this
+ *	attribute for IR is disallowed for master interfaces (IBSS, AP).
  * @NL80211_FREQUENCY_ATTR_NO_20MHZ: 20 MHz operation is not allowed
  *	on this channel in current regulatory domain.
  * @NL80211_FREQUENCY_ATTR_NO_10MHZ: 10 MHz operation is not allowed
@@ -2640,7 +2794,7 @@ enum nl80211_band_attr {
  * See https://apps.fcc.gov/eas/comments/GetPublishedDocument.html?id=327&tn=528122
  * for more information on the FCC description of the relaxations allowed
  * by NL80211_FREQUENCY_ATTR_INDOOR_ONLY and
- * NL80211_FREQUENCY_ATTR_GO_CONCURRENT.
+ * NL80211_FREQUENCY_ATTR_IR_CONCURRENT.
  */
 enum nl80211_frequency_attr {
 	__NL80211_FREQUENCY_ATTR_INVALID,
@@ -2658,7 +2812,7 @@ enum nl80211_frequency_attr {
 	NL80211_FREQUENCY_ATTR_NO_160MHZ,
 	NL80211_FREQUENCY_ATTR_DFS_CAC_TIME,
 	NL80211_FREQUENCY_ATTR_INDOOR_ONLY,
-	NL80211_FREQUENCY_ATTR_GO_CONCURRENT,
+	NL80211_FREQUENCY_ATTR_IR_CONCURRENT,
 	NL80211_FREQUENCY_ATTR_NO_20MHZ,
 	NL80211_FREQUENCY_ATTR_NO_10MHZ,
 
@@ -2671,6 +2825,8 @@ enum nl80211_frequency_attr {
 #define NL80211_FREQUENCY_ATTR_PASSIVE_SCAN	NL80211_FREQUENCY_ATTR_NO_IR
 #define NL80211_FREQUENCY_ATTR_NO_IBSS		NL80211_FREQUENCY_ATTR_NO_IR
 #define NL80211_FREQUENCY_ATTR_NO_IR		NL80211_FREQUENCY_ATTR_NO_IR
+#define NL80211_FREQUENCY_ATTR_GO_CONCURRENT \
+					NL80211_FREQUENCY_ATTR_IR_CONCURRENT
 
 /**
  * enum nl80211_bitrate_attr - bitrate attributes
@@ -2829,7 +2985,7 @@ enum nl80211_sched_scan_match_attr {
  * @NL80211_RRF_AUTO_BW: maximum available bandwidth should be calculated
  *	base on contiguous rules and wider channels will be allowed to cross
  *	multiple contiguous/overlapping frequency ranges.
- * @NL80211_RRF_GO_CONCURRENT: See &NL80211_FREQUENCY_ATTR_GO_CONCURRENT
+ * @NL80211_RRF_IR_CONCURRENT: See &NL80211_FREQUENCY_ATTR_IR_CONCURRENT
  * @NL80211_RRF_NO_HT40MINUS: channels can't be used in HT40- operation
  * @NL80211_RRF_NO_HT40PLUS: channels can't be used in HT40+ operation
  * @NL80211_RRF_NO_80MHZ: 80MHz operation not allowed
@@ -2846,7 +3002,7 @@ enum nl80211_reg_rule_flags {
 	NL80211_RRF_NO_IR		= 1<<7,
 	__NL80211_RRF_NO_IBSS		= 1<<8,
 	NL80211_RRF_AUTO_BW		= 1<<11,
-	NL80211_RRF_GO_CONCURRENT	= 1<<12,
+	NL80211_RRF_IR_CONCURRENT	= 1<<12,
 	NL80211_RRF_NO_HT40MINUS	= 1<<13,
 	NL80211_RRF_NO_HT40PLUS		= 1<<14,
 	NL80211_RRF_NO_80MHZ		= 1<<15,
@@ -2858,6 +3014,7 @@ enum nl80211_reg_rule_flags {
 #define NL80211_RRF_NO_IR		NL80211_RRF_NO_IR
 #define NL80211_RRF_NO_HT40		(NL80211_RRF_NO_HT40MINUS |\
 					 NL80211_RRF_NO_HT40PLUS)
+#define NL80211_RRF_GO_CONCURRENT	NL80211_RRF_IR_CONCURRENT
 
 /* For backport compatibility with older userspace */
 #define NL80211_RRF_NO_IR_ALL		(NL80211_RRF_NO_IR | __NL80211_RRF_NO_IBSS)
@@ -2922,6 +3079,7 @@ enum nl80211_user_reg_hint_type {
  *	transmitting data (on channel or globally)
  * @NL80211_SURVEY_INFO_TIME_SCAN: time the radio spent for scan
  *	(on this channel or globally)
+ * @NL80211_SURVEY_INFO_PAD: attribute used for padding for 64-bit alignment
  * @NL80211_SURVEY_INFO_MAX: highest survey info attribute number
  *	currently defined
  * @__NL80211_SURVEY_INFO_AFTER_LAST: internal use
@@ -2937,6 +3095,7 @@ enum nl80211_survey_info {
 	NL80211_SURVEY_INFO_TIME_RX,
 	NL80211_SURVEY_INFO_TIME_TX,
 	NL80211_SURVEY_INFO_TIME_SCAN,
+	NL80211_SURVEY_INFO_PAD,
 
 	/* keep last */
 	__NL80211_SURVEY_INFO_AFTER_LAST,
@@ -3359,6 +3518,16 @@ enum nl80211_bss_scan_width {
  *	(not present if no beacon frame has been received yet)
  * @NL80211_BSS_PRESP_DATA: the data in @NL80211_BSS_INFORMATION_ELEMENTS and
  *	@NL80211_BSS_TSF is known to be from a probe response (flag attribute)
+ * @NL80211_BSS_LAST_SEEN_BOOTTIME: CLOCK_BOOTTIME timestamp when this entry
+ *	was last updated by a received frame. The value is expected to be
+ *	accurate to about 10ms. (u64, nanoseconds)
+ * @NL80211_BSS_PAD: attribute used for padding for 64-bit alignment
+ * @NL80211_BSS_PARENT_TSF: the time at the start of reception of the first
+ *	octet of the timestamp field of the last beacon/probe received for
+ *	this BSS. The time is the TSF of the BSS specified by
+ *	@NL80211_BSS_PARENT_BSSID. (u64).
+ * @NL80211_BSS_PARENT_BSSID: the BSS according to which @NL80211_BSS_PARENT_TSF
+ *	is set.
  * @__NL80211_BSS_AFTER_LAST: internal
  * @NL80211_BSS_MAX: highest BSS attribute
  */
@@ -3378,6 +3547,10 @@ enum nl80211_bss {
 	NL80211_BSS_CHAN_WIDTH,
 	NL80211_BSS_BEACON_TSF,
 	NL80211_BSS_PRESP_DATA,
+	NL80211_BSS_LAST_SEEN_BOOTTIME,
+	NL80211_BSS_PAD,
+	NL80211_BSS_PARENT_TSF,
+	NL80211_BSS_PARENT_BSSID,
 
 	/* keep last */
 	__NL80211_BSS_AFTER_LAST,
@@ -3563,11 +3736,15 @@ enum nl80211_txrate_gi {
  * @NL80211_BAND_2GHZ: 2.4 GHz ISM band
  * @NL80211_BAND_5GHZ: around 5 GHz band (4.9 - 5.7 GHz)
  * @NL80211_BAND_60GHZ: around 60 GHz band (58.32 - 64.80 GHz)
+ * @NUM_NL80211_BANDS: number of bands, avoid using this in userspace
+ *	since newer kernel versions may support more bands
  */
 enum nl80211_band {
 	NL80211_BAND_2GHZ,
 	NL80211_BAND_5GHZ,
 	NL80211_BAND_60GHZ,
+
+	NUM_NL80211_BANDS,
 };
 
 /**
@@ -4353,12 +4530,38 @@ enum nl80211_feature_flags {
 /**
  * enum nl80211_ext_feature_index - bit index of extended features.
  * @NL80211_EXT_FEATURE_VHT_IBSS: This driver supports IBSS with VHT datarates.
+ * @NL80211_EXT_FEATURE_RRM: This driver supports RRM. When featured, user can
+ *	can request to use RRM (see %NL80211_ATTR_USE_RRM) with
+ *	%NL80211_CMD_ASSOCIATE and %NL80211_CMD_CONNECT requests, which will set
+ *	the ASSOC_REQ_USE_RRM flag in the association request even if
+ *	NL80211_FEATURE_QUIET is not advertized.
+ * @NL80211_EXT_FEATURE_MU_MIMO_AIR_SNIFFER: This device supports MU-MIMO air
+ *	sniffer which means that it can be configured to hear packets from
+ *	certain groups which can be configured by the
+ *	%NL80211_ATTR_MU_MIMO_GROUP_DATA attribute,
+ *	or can be configured to follow a station by configuring the
+ *	%NL80211_ATTR_MU_MIMO_FOLLOW_MAC_ADDR attribute.
+ * @NL80211_EXT_FEATURE_SCAN_START_TIME: This driver includes the actual
+ *	time the scan started in scan results event. The time is the TSF of
+ *	the BSS that the interface that requested the scan is connected to
+ *	(if available).
+ * @NL80211_EXT_FEATURE_BSS_PARENT_TSF: Per BSS, this driver reports the
+ *	time the last beacon/probe was received. The time is the TSF of the
+ *	BSS that the interface that requested the scan is connected to
+ *	(if available).
+ * @NL80211_EXT_FEATURE_SET_SCAN_DWELL: This driver supports configuration of
+ *	channel dwell time.
  *
  * @NUM_NL80211_EXT_FEATURES: number of extended features.
  * @MAX_NL80211_EXT_FEATURES: highest extended feature index.
  */
 enum nl80211_ext_feature_index {
 	NL80211_EXT_FEATURE_VHT_IBSS,
+	NL80211_EXT_FEATURE_RRM,
+	NL80211_EXT_FEATURE_MU_MIMO_AIR_SNIFFER,
+	NL80211_EXT_FEATURE_SCAN_START_TIME,
+	NL80211_EXT_FEATURE_BSS_PARENT_TSF,
+	NL80211_EXT_FEATURE_SET_SCAN_DWELL,
 
 	/* add new features before the definition below */
 	NUM_NL80211_EXT_FEATURES,
@@ -4584,4 +4787,72 @@ enum nl80211_tdls_peer_capability {
 	NL80211_TDLS_PEER_WMM = 1<<2,
 };
 
+/**
+ * enum nl80211_sched_scan_plan - scanning plan for scheduled scan
+ * @__NL80211_SCHED_SCAN_PLAN_INVALID: attribute number 0 is reserved
+ * @NL80211_SCHED_SCAN_PLAN_INTERVAL: interval between scan iterations. In
+ *	seconds (u32).
+ * @NL80211_SCHED_SCAN_PLAN_ITERATIONS: number of scan iterations in this
+ *	scan plan (u32). The last scan plan must not specify this attribute
+ *	because it will run infinitely. A value of zero is invalid as it will
+ *	make the scan plan meaningless.
+ * @NL80211_SCHED_SCAN_PLAN_MAX: highest scheduled scan plan attribute number
+ *	currently defined
+ * @__NL80211_SCHED_SCAN_PLAN_AFTER_LAST: internal use
+ */
+enum nl80211_sched_scan_plan {
+	__NL80211_SCHED_SCAN_PLAN_INVALID,
+	NL80211_SCHED_SCAN_PLAN_INTERVAL,
+	NL80211_SCHED_SCAN_PLAN_ITERATIONS,
+
+	/* keep last */
+	__NL80211_SCHED_SCAN_PLAN_AFTER_LAST,
+	NL80211_SCHED_SCAN_PLAN_MAX =
+		__NL80211_SCHED_SCAN_PLAN_AFTER_LAST - 1
+};
+
+/**
+ * struct nl80211_bss_select_rssi_adjust - RSSI adjustment parameters.
+ *
+ * @band: band of BSS that must match for RSSI value adjustment.
+ * @delta: value used to adjust the RSSI value of matching BSS.
+ */
+struct nl80211_bss_select_rssi_adjust {
+	__u8 band;
+	__s8 delta;
+} __attribute__((packed));
+
+/**
+ * enum nl80211_bss_select_attr - attributes for bss selection.
+ *
+ * @__NL80211_BSS_SELECT_ATTR_INVALID: reserved.
+ * @NL80211_BSS_SELECT_ATTR_RSSI: Flag indicating only RSSI-based BSS selection
+ *	is requested.
+ * @NL80211_BSS_SELECT_ATTR_BAND_PREF: attribute indicating BSS
+ *	selection should be done such that the specified band is preferred.
+ *	When there are multiple BSS-es in the preferred band, the driver
+ *	shall use RSSI-based BSS selection as a second step. The value of
+ *	this attribute is according to &enum nl80211_band (u32).
+ * @NL80211_BSS_SELECT_ATTR_RSSI_ADJUST: When present the RSSI level for
+ *	BSS-es in the specified band is to be adjusted before doing
+ *	RSSI-based BSS selection. The attribute value is a packed structure
+ *	value as specified by &struct nl80211_bss_select_rssi_adjust.
+ * @NL80211_BSS_SELECT_ATTR_MAX: highest bss select attribute number.
+ * @__NL80211_BSS_SELECT_ATTR_AFTER_LAST: internal use.
+ *
+ * One and only one of these attributes are found within %NL80211_ATTR_BSS_SELECT
+ * for %NL80211_CMD_CONNECT. It specifies the required BSS selection behaviour
+ * which the driver shall use.
+ */
+enum nl80211_bss_select_attr {
+	__NL80211_BSS_SELECT_ATTR_INVALID,
+	NL80211_BSS_SELECT_ATTR_RSSI,
+	NL80211_BSS_SELECT_ATTR_BAND_PREF,
+	NL80211_BSS_SELECT_ATTR_RSSI_ADJUST,
+
+	/* keep last */
+	__NL80211_BSS_SELECT_ATTR_AFTER_LAST,
+	NL80211_BSS_SELECT_ATTR_MAX = __NL80211_BSS_SELECT_ATTR_AFTER_LAST - 1
+};
+
 #endif /* __LINUX_NL80211_H */
diff --git a/src/drivers/rfkill.c b/src/drivers/rfkill.c
index 45b26c46b69c7..4d4d1b4489fd4 100644
--- a/src/drivers/rfkill.c
+++ b/src/drivers/rfkill.c
@@ -8,6 +8,7 @@
 
 #include "includes.h"
 #include <fcntl.h>
+#include <limits.h>
 
 #include "utils/common.h"
 #include "utils/eloop.h"
@@ -47,6 +48,7 @@ struct rfkill_data {
 	struct rfkill_config *cfg;
 	int fd;
 	int blocked;
+	uint32_t idx;
 };
 
 
@@ -69,12 +71,13 @@ static void rfkill_receive(int sock, void *eloop_ctx, void *sock_ctx)
 			   (int) len, RFKILL_EVENT_SIZE_V1);
 		return;
 	}
+	if (event.op != RFKILL_OP_CHANGE || event.idx != rfkill->idx)
+		return;
+
 	wpa_printf(MSG_DEBUG, "rfkill: event: idx=%u type=%d "
 		   "op=%u soft=%u hard=%u",
 		   event.idx, event.type, event.op, event.soft,
 		   event.hard);
-	if (event.op != RFKILL_OP_CHANGE || event.type != RFKILL_TYPE_WLAN)
-		return;
 
 	if (event.hard) {
 		wpa_printf(MSG_INFO, "rfkill: WLAN hard blocked");
@@ -102,11 +105,23 @@ struct rfkill_data * rfkill_init(struct rfkill_config *cfg)
 	struct rfkill_data *rfkill;
 	struct rfkill_event event;
 	ssize_t len;
+	char *phy = NULL, *rfk_phy;
+	char buf[24 + IFNAMSIZ + 1];
+	char buf2[31 + 11 + 1];
+	int found = 0;
 
 	rfkill = os_zalloc(sizeof(*rfkill));
 	if (rfkill == NULL)
 		return NULL;
 
+	os_snprintf(buf, sizeof(buf), "/sys/class/net/%s/phy80211",
+		    cfg->ifname);
+	phy = realpath(buf, NULL);
+	if (!phy) {
+		wpa_printf(MSG_INFO, "rfkill: Cannot get wiphy information");
+		goto fail;
+	}
+
 	rfkill->cfg = cfg;
 	rfkill->fd = open("/dev/rfkill", O_RDONLY);
 	if (rfkill->fd < 0) {
@@ -136,13 +151,27 @@ struct rfkill_data * rfkill_init(struct rfkill_config *cfg)
 				   (int) len, RFKILL_EVENT_SIZE_V1);
 			continue;
 		}
+		if (event.op != RFKILL_OP_ADD ||
+		    event.type != RFKILL_TYPE_WLAN)
+			continue;
+
+		os_snprintf(buf2, sizeof(buf2),
+			    "/sys/class/rfkill/rfkill%d/device", event.idx);
+		rfk_phy = realpath(buf2, NULL);
+		if (!rfk_phy)
+			goto fail2;
+		found = os_strcmp(phy, rfk_phy) == 0;
+		free(rfk_phy);
+
+		if (!found)
+			continue;
+
 		wpa_printf(MSG_DEBUG, "rfkill: initial event: idx=%u type=%d "
 			   "op=%u soft=%u hard=%u",
 			   event.idx, event.type, event.op, event.soft,
 			   event.hard);
-		if (event.op != RFKILL_OP_ADD ||
-		    event.type != RFKILL_TYPE_WLAN)
-			continue;
+
+		rfkill->idx = event.idx;
 		if (event.hard) {
 			wpa_printf(MSG_INFO, "rfkill: WLAN hard blocked");
 			rfkill->blocked = 1;
@@ -150,8 +179,13 @@ struct rfkill_data * rfkill_init(struct rfkill_config *cfg)
 			wpa_printf(MSG_INFO, "rfkill: WLAN soft blocked");
 			rfkill->blocked = 1;
 		}
+		break;
 	}
 
+	if (!found)
+		goto fail2;
+
+	free(phy);
 	eloop_register_read_sock(rfkill->fd, rfkill_receive, rfkill, NULL);
 
 	return rfkill;
@@ -160,6 +194,8 @@ fail2:
 	close(rfkill->fd);
 fail:
 	os_free(rfkill);
+	/* use standard free function to match realpath() */
+	free(phy);
 	return NULL;
 }
 
diff --git a/src/eap_common/eap_eke_common.c b/src/eap_common/eap_eke_common.c
index 4dfdb3f9c96bd..621746821538b 100644
--- a/src/eap_common/eap_eke_common.c
+++ b/src/eap_common/eap_eke_common.c
@@ -44,9 +44,7 @@ static int eap_eke_dhcomp_len(u8 dhgroup, u8 encr)
 	int dhlen;
 
 	dhlen = eap_eke_dh_len(dhgroup);
-	if (dhlen < 0)
-		return -1;
-	if (encr != EAP_EKE_ENCR_AES128_CBC)
+	if (dhlen < 0 || encr != EAP_EKE_ENCR_AES128_CBC)
 		return -1;
 	return AES_BLOCK_SIZE + dhlen;
 }
@@ -166,13 +164,10 @@ int eap_eke_dh_init(u8 group, u8 *ret_priv, u8 *ret_pub)
 	size_t pub_len, i;
 
 	generator = eap_eke_dh_generator(group);
-	if (generator < 0 || generator > 255)
-		return -1;
-	gen = generator;
-
 	dh = eap_eke_dh_group(group);
-	if (dh == NULL)
+	if (generator < 0 || generator > 255 || !dh)
 		return -1;
+	gen = generator;
 
 	/* x = random number 2 .. p-1 */
 	if (random_get_bytes(ret_priv, dh->prime_len))
@@ -411,11 +406,8 @@ int eap_eke_shared_secret(struct eap_eke_session *sess, const u8 *key,
 	size_t len;
 	const struct dh_group *dh;
 
-	if (sess->encr != EAP_EKE_ENCR_AES128_CBC)
-		return -1;
-
 	dh = eap_eke_dh_group(sess->dhgroup);
-	if (dh == NULL)
+	if (sess->encr != EAP_EKE_ENCR_AES128_CBC || !dh)
 		return -1;
 
 	/* Decrypt peer DHComponent */
@@ -635,6 +627,7 @@ int eap_eke_prot(struct eap_eke_session *sess,
 
 	if (*prot_len < block_size + data_len + pad + icv_len) {
 		wpa_printf(MSG_INFO, "EAP-EKE: Not enough room for Prot() data");
+		return -1;
 	}
 	pos = prot;
 
@@ -653,10 +646,8 @@ int eap_eke_prot(struct eap_eke_session *sess,
 		pos += pad;
 	}
 
-	if (aes_128_cbc_encrypt(sess->ke, iv, e, data_len + pad) < 0)
-		return -1;
-
-	if (eap_eke_mac(sess->mac, sess->ki, e, data_len + pad, pos) < 0)
+	if (aes_128_cbc_encrypt(sess->ke, iv, e, data_len + pad) < 0 ||
+	    eap_eke_mac(sess->mac, sess->ki, e, data_len + pad, pos) < 0)
 		return -1;
 	pos += icv_len;
 
@@ -684,9 +675,8 @@ int eap_eke_decrypt_prot(struct eap_eke_session *sess,
 	else
 		return -1;
 
-	if (prot_len < 2 * block_size + icv_len)
-		return -1;
-	if ((prot_len - icv_len) % block_size)
+	if (prot_len < 2 * block_size + icv_len ||
+	    (prot_len - icv_len) % block_size)
 		return -1;
 
 	if (eap_eke_mac(sess->mac, sess->ki, prot + block_size,
@@ -737,22 +727,14 @@ int eap_eke_session_init(struct eap_eke_session *sess, u8 dhgroup, u8 encr,
 	sess->mac = mac;
 
 	sess->prf_len = eap_eke_prf_len(prf);
-	if (sess->prf_len < 0)
-		return -1;
 	sess->nonce_len = eap_eke_nonce_len(prf);
-	if (sess->nonce_len < 0)
-		return -1;
 	sess->auth_len = eap_eke_auth_len(prf);
-	if (sess->auth_len < 0)
-		return -1;
 	sess->dhcomp_len = eap_eke_dhcomp_len(sess->dhgroup, sess->encr);
-	if (sess->dhcomp_len < 0)
-		return -1;
 	sess->pnonce_len = eap_eke_pnonce_len(sess->mac);
-	if (sess->pnonce_len < 0)
-		return -1;
 	sess->pnonce_ps_len = eap_eke_pnonce_ps_len(sess->mac);
-	if (sess->pnonce_ps_len < 0)
+	if (sess->prf_len < 0 || sess->nonce_len < 0 || sess->auth_len < 0 ||
+	    sess->dhcomp_len < 0 || sess->pnonce_len < 0 ||
+	    sess->pnonce_ps_len < 0)
 		return -1;
 
 	return 0;
diff --git a/src/eap_common/eap_fast_common.c b/src/eap_common/eap_fast_common.c
index 151cc7859c5da..9ef671c41c7d7 100644
--- a/src/eap_common/eap_fast_common.c
+++ b/src/eap_common/eap_fast_common.c
@@ -93,8 +93,7 @@ void eap_fast_derive_master_secret(const u8 *pac_key, const u8 *server_random,
 }
 
 
-u8 * eap_fast_derive_key(void *ssl_ctx, struct tls_connection *conn,
-			 const char *label, size_t len)
+u8 * eap_fast_derive_key(void *ssl_ctx, struct tls_connection *conn, size_t len)
 {
 	u8 *out;
 
@@ -102,7 +101,7 @@ u8 * eap_fast_derive_key(void *ssl_ctx, struct tls_connection *conn,
 	if (out == NULL)
 		return NULL;
 
-	if (tls_connection_prf(ssl_ctx, conn, label, 1, 1, out, len)) {
+	if (tls_connection_get_eap_fast_key(ssl_ctx, conn, out, len)) {
 		os_free(out);
 		return NULL;
 	}
@@ -111,22 +110,24 @@ u8 * eap_fast_derive_key(void *ssl_ctx, struct tls_connection *conn,
 }
 
 
-void eap_fast_derive_eap_msk(const u8 *simck, u8 *msk)
+int eap_fast_derive_eap_msk(const u8 *simck, u8 *msk)
 {
 	/*
 	 * RFC 4851, Section 5.4: EAP Master Session Key Generation
 	 * MSK = T-PRF(S-IMCK[j], "Session Key Generating Function", 64)
 	 */
 
-	sha1_t_prf(simck, EAP_FAST_SIMCK_LEN,
-		   "Session Key Generating Function", (u8 *) "", 0,
-		   msk, EAP_FAST_KEY_LEN);
+	if (sha1_t_prf(simck, EAP_FAST_SIMCK_LEN,
+		       "Session Key Generating Function", (u8 *) "", 0,
+		       msk, EAP_FAST_KEY_LEN) < 0)
+		return -1;
 	wpa_hexdump_key(MSG_DEBUG, "EAP-FAST: Derived key (MSK)",
 			msk, EAP_FAST_KEY_LEN);
+	return 0;
 }
 
 
-void eap_fast_derive_eap_emsk(const u8 *simck, u8 *emsk)
+int eap_fast_derive_eap_emsk(const u8 *simck, u8 *emsk)
 {
 	/*
 	 * RFC 4851, Section 5.4: EAP Master Session Key Genreration
@@ -134,11 +135,13 @@ void eap_fast_derive_eap_emsk(const u8 *simck, u8 *emsk)
 	 *        "Extended Session Key Generating Function", 64)
 	 */
 
-	sha1_t_prf(simck, EAP_FAST_SIMCK_LEN,
-		   "Extended Session Key Generating Function", (u8 *) "", 0,
-		   emsk, EAP_EMSK_LEN);
+	if (sha1_t_prf(simck, EAP_FAST_SIMCK_LEN,
+		       "Extended Session Key Generating Function", (u8 *) "", 0,
+		       emsk, EAP_EMSK_LEN) < 0)
+		return -1;
 	wpa_hexdump_key(MSG_DEBUG, "EAP-FAST: Derived key (EMSK)",
 			emsk, EAP_EMSK_LEN);
+	return 0;
 }
 
 
diff --git a/src/eap_common/eap_fast_common.h b/src/eap_common/eap_fast_common.h
index d59a8450ba8c7..724204cb5e325 100644
--- a/src/eap_common/eap_fast_common.h
+++ b/src/eap_common/eap_fast_common.h
@@ -98,9 +98,9 @@ struct wpabuf * eap_fast_tlv_eap_payload(struct wpabuf *buf);
 void eap_fast_derive_master_secret(const u8 *pac_key, const u8 *server_random,
 				   const u8 *client_random, u8 *master_secret);
 u8 * eap_fast_derive_key(void *ssl_ctx, struct tls_connection *conn,
-			 const char *label, size_t len);
-void eap_fast_derive_eap_msk(const u8 *simck, u8 *msk);
-void eap_fast_derive_eap_emsk(const u8 *simck, u8 *emsk);
+			 size_t len);
+int eap_fast_derive_eap_msk(const u8 *simck, u8 *msk);
+int eap_fast_derive_eap_emsk(const u8 *simck, u8 *emsk);
 int eap_fast_parse_tlv(struct eap_fast_tlv_parse *tlv,
 		       int tlv_type, u8 *pos, size_t len);
 
diff --git a/src/eap_common/eap_gpsk_common.c b/src/eap_common/eap_gpsk_common.c
index 8c7ae27b933c2..b0818797025f2 100644
--- a/src/eap_common/eap_gpsk_common.c
+++ b/src/eap_common/eap_gpsk_common.c
@@ -92,7 +92,8 @@ static int eap_gpsk_gkdf_sha256(const u8 *psk /* Y */,
 	n = (len + hashlen - 1) / hashlen;
 	for (i = 1; i <= n; i++) {
 		WPA_PUT_BE16(ibuf, i);
-		hmac_sha256_vector(psk, 32, 2, addr, vlen, hash);
+		if (hmac_sha256_vector(psk, 32, 2, addr, vlen, hash))
+			return -1;
 		clen = left > hashlen ? hashlen : left;
 		os_memcpy(opos, hash, clen);
 		opos += clen;
@@ -534,8 +535,7 @@ int eap_gpsk_compute_mic(const u8 *sk, size_t sk_len, int vendor,
 		break;
 #ifdef EAP_GPSK_SHA256
 	case EAP_GPSK_CIPHER_SHA256:
-		hmac_sha256(sk, sk_len, data, len, mic);
-		ret = 0;
+		ret = hmac_sha256(sk, sk_len, data, len, mic);
 		break;
 #endif /* EAP_GPSK_SHA256 */
 	default:
@@ -545,5 +545,8 @@ int eap_gpsk_compute_mic(const u8 *sk, size_t sk_len, int vendor,
 		break;
 	}
 
+	if (ret)
+		wpa_printf(MSG_DEBUG, "EAP-GPSK: Could not compute MIC");
+
 	return ret;
 }
diff --git a/src/eap_common/eap_pax_common.c b/src/eap_common/eap_pax_common.c
index 0e80ef511c113..a11bce8f9ba32 100644
--- a/src/eap_common/eap_pax_common.c
+++ b/src/eap_common/eap_pax_common.c
@@ -57,7 +57,8 @@ int eap_pax_kdf(u8 mac_id, const u8 *key, size_t key_len,
 	left = output_len;
 	for (counter = 1; counter <= (u8) num_blocks; counter++) {
 		size_t clen = left > EAP_PAX_MAC_LEN ? EAP_PAX_MAC_LEN : left;
-		hmac_sha1_vector(key, key_len, 3, addr, len, mac);
+		if (hmac_sha1_vector(key, key_len, 3, addr, len, mac) < 0)
+			return -1;
 		os_memcpy(pos, mac, clen);
 		pos += clen;
 		left -= clen;
@@ -106,7 +107,8 @@ int eap_pax_mac(u8 mac_id, const u8 *key, size_t key_len,
 	len[2] = data3_len;
 
 	count = (data1 ? 1 : 0) + (data2 ? 1 : 0) + (data3 ? 1 : 0);
-	hmac_sha1_vector(key, key_len, count, addr, len, hash);
+	if (hmac_sha1_vector(key, key_len, count, addr, len, hash) < 0)
+		return -1;
 	os_memcpy(mac, hash, EAP_PAX_MAC_LEN);
 
 	return 0;
diff --git a/src/eap_common/eap_pwd_common.c b/src/eap_common/eap_pwd_common.c
index 4d27623f87bfd..67f8f7098c4b6 100644
--- a/src/eap_common/eap_pwd_common.c
+++ b/src/eap_common/eap_pwd_common.c
@@ -115,6 +115,26 @@ int compute_password_element(EAP_PWD_group *grp, u16 num,
         case 26:
 		nid = NID_secp224r1;
 		break;
+#ifdef NID_brainpoolP224r1
+	case 27:
+		nid = NID_brainpoolP224r1;
+		break;
+#endif /* NID_brainpoolP224r1 */
+#ifdef NID_brainpoolP256r1
+	case 28:
+		nid = NID_brainpoolP256r1;
+		break;
+#endif /* NID_brainpoolP256r1 */
+#ifdef NID_brainpoolP384r1
+	case 29:
+		nid = NID_brainpoolP384r1;
+		break;
+#endif /* NID_brainpoolP384r1 */
+#ifdef NID_brainpoolP512r1
+	case 30:
+		nid = NID_brainpoolP512r1;
+		break;
+#endif /* NID_brainpoolP512r1 */
         default:
 		wpa_printf(MSG_INFO, "EAP-pwd: unsupported group %d", num);
 		return -1;
diff --git a/src/eap_common/eap_sake_common.c b/src/eap_common/eap_sake_common.c
index c22e43ed84b60..8819541b2264c 100644
--- a/src/eap_common/eap_sake_common.c
+++ b/src/eap_common/eap_sake_common.c
@@ -121,7 +121,7 @@ static int eap_sake_parse_add_attr(struct eap_sake_parse_attr *attr,
 		attr->next_tmpid_len = len;
 		break;
 	case EAP_SAKE_AT_MSK_LIFE:
-		wpa_printf(MSG_DEBUG, "EAP-SAKE: Parse: AT_IV");
+		wpa_printf(MSG_DEBUG, "EAP-SAKE: Parse: AT_MSK_LIFE");
 		if (len != 4) {
 			wpa_printf(MSG_DEBUG, "EAP-SAKE: Invalid "
 				   "AT_MSK_LIFE payload length %d", len);
diff --git a/src/eap_common/ikev2_common.c b/src/eap_common/ikev2_common.c
index d60358c733f0b..90fb89e243b83 100644
--- a/src/eap_common/ikev2_common.c
+++ b/src/eap_common/ikev2_common.c
@@ -62,13 +62,15 @@ int ikev2_integ_hash(int alg, const u8 *key, size_t key_len, const u8 *data,
 	case AUTH_HMAC_SHA1_96:
 		if (key_len != 20)
 			return -1;
-		hmac_sha1(key, key_len, data, data_len, tmphash);
+		if (hmac_sha1(key, key_len, data, data_len, tmphash) < 0)
+			return -1;
 		os_memcpy(hash, tmphash, 12);
 		break;
 	case AUTH_HMAC_MD5_96:
 		if (key_len != 16)
 			return -1;
-		hmac_md5(key, key_len, data, data_len, tmphash);
+		if (hmac_md5(key, key_len, data, data_len, tmphash) < 0)
+			return -1;
 		os_memcpy(hash, tmphash, 12);
 		break;
 	default:
@@ -98,16 +100,13 @@ int ikev2_prf_hash(int alg, const u8 *key, size_t key_len,
 {
 	switch (alg) {
 	case PRF_HMAC_SHA1:
-		hmac_sha1_vector(key, key_len, num_elem, addr, len, hash);
-		break;
+		return hmac_sha1_vector(key, key_len, num_elem, addr, len,
+					hash);
 	case PRF_HMAC_MD5:
-		hmac_md5_vector(key, key_len, num_elem, addr, len, hash);
-		break;
+		return hmac_md5_vector(key, key_len, num_elem, addr, len, hash);
 	default:
 		return -1;
 	}
-
-	return 0;
 }
 
 
diff --git a/src/eap_peer/eap.c b/src/eap_peer/eap.c
index 56c24b5503200..9110ca5b9cfd6 100644
--- a/src/eap_peer/eap.c
+++ b/src/eap_peer/eap.c
@@ -48,6 +48,8 @@ static void eap_sm_parseEapReq(struct eap_sm *sm, const struct wpabuf *req);
 static const char * eap_sm_method_state_txt(EapMethodState state);
 static const char * eap_sm_decision_txt(EapDecision decision);
 #endif /* CONFIG_CTRL_IFACE || !CONFIG_NO_STDOUT_DEBUG */
+static void eap_sm_request(struct eap_sm *sm, enum wpa_ctrl_req_type field,
+			   const char *msg, size_t msglen);
 
 
 
@@ -188,6 +190,14 @@ SM_STATE(EAP, INITIALIZE)
 	 */
 	eapol_set_bool(sm, EAPOL_eapResp, FALSE);
 	eapol_set_bool(sm, EAPOL_eapNoResp, FALSE);
+	/*
+	 * RFC 4137 does not reset ignore here, but since it is possible for
+	 * some method code paths to end up not setting ignore=FALSE, clear the
+	 * value here to avoid issues if a previous authentication attempt
+	 * failed with ignore=TRUE being left behind in the last
+	 * m.check(eapReqData) operation.
+	 */
+	sm->ignore = 0;
 	sm->num_rounds = 0;
 	sm->prev_failure = 0;
 	sm->expected_failure = 0;
@@ -312,11 +322,14 @@ SM_STATE(EAP, GET_METHOD)
 	wpa_printf(MSG_DEBUG, "EAP: Initialize selected EAP method: "
 		   "vendor %u method %u (%s)",
 		   sm->reqVendor, method, sm->m->name);
-	if (reinit)
+	if (reinit) {
 		sm->eap_method_priv = sm->m->init_for_reauth(
 			sm, sm->eap_method_priv);
-	else
+	} else {
+		sm->waiting_ext_cert_check = 0;
+		sm->ext_cert_check = 0;
 		sm->eap_method_priv = sm->m->init(sm);
+	}
 
 	if (sm->eap_method_priv == NULL) {
 		struct eap_peer_config *config = eap_get_config(sm);
@@ -1373,13 +1386,10 @@ static int eap_sm_imsi_identity(struct eap_sm *sm,
 	return 0;
 }
 
-#endif /* PCSC_FUNCS */
-
 
 static int eap_sm_set_scard_pin(struct eap_sm *sm,
 				struct eap_peer_config *conf)
 {
-#ifdef PCSC_FUNCS
 	if (scard_set_pin(sm->scard_ctx, conf->pin)) {
 		/*
 		 * Make sure the same PIN is not tried again in order to avoid
@@ -1393,24 +1403,20 @@ static int eap_sm_set_scard_pin(struct eap_sm *sm,
 		return -1;
 	}
 	return 0;
-#else /* PCSC_FUNCS */
-	return -1;
-#endif /* PCSC_FUNCS */
 }
 
+
 static int eap_sm_get_scard_identity(struct eap_sm *sm,
 				     struct eap_peer_config *conf)
 {
-#ifdef PCSC_FUNCS
 	if (eap_sm_set_scard_pin(sm, conf))
 		return -1;
 
 	return eap_sm_imsi_identity(sm, conf);
-#else /* PCSC_FUNCS */
-	return -1;
-#endif /* PCSC_FUNCS */
 }
 
+#endif /* PCSC_FUNCS */
+
 
 /**
  * eap_sm_buildIdentity - Build EAP-Identity/Response for the current network
@@ -1453,23 +1459,27 @@ struct wpabuf * eap_sm_buildIdentity(struct eap_sm *sm, int id, int encrypted)
 				  identity, identity_len);
 	}
 
-	if (identity == NULL) {
-		wpa_printf(MSG_WARNING, "EAP: buildIdentity: identity "
-			   "configuration was not available");
-		if (config->pcsc) {
+	if (config->pcsc) {
+#ifdef PCSC_FUNCS
+		if (!identity) {
 			if (eap_sm_get_scard_identity(sm, config) < 0)
 				return NULL;
 			identity = config->identity;
 			identity_len = config->identity_len;
-			wpa_hexdump_ascii(MSG_DEBUG, "permanent identity from "
-					  "IMSI", identity, identity_len);
-		} else {
-			eap_sm_request_identity(sm);
+			wpa_hexdump_ascii(MSG_DEBUG,
+					  "permanent identity from IMSI",
+					  identity, identity_len);
+		} else if (eap_sm_set_scard_pin(sm, config) < 0) {
 			return NULL;
 		}
-	} else if (config->pcsc) {
-		if (eap_sm_set_scard_pin(sm, config) < 0)
-			return NULL;
+#else /* PCSC_FUNCS */
+		return NULL;
+#endif /* PCSC_FUNCS */
+	} else if (!identity) {
+		wpa_printf(MSG_WARNING,
+			"EAP: buildIdentity: identity configuration was not available");
+		eap_sm_request_identity(sm);
+		return NULL;
 	}
 
 	resp = eap_msg_alloc(EAP_VENDOR_IETF, EAP_TYPE_IDENTITY, identity_len,
@@ -1510,15 +1520,9 @@ static void eap_sm_processNotify(struct eap_sm *sm, const struct wpabuf *req)
 
 static struct wpabuf * eap_sm_buildNotify(int id)
 {
-	struct wpabuf *resp;
-
 	wpa_printf(MSG_DEBUG, "EAP: Generating EAP-Response Notification");
-	resp = eap_msg_alloc(EAP_VENDOR_IETF, EAP_TYPE_NOTIFICATION, 0,
-			     EAP_CODE_RESPONSE, id);
-	if (resp == NULL)
-		return NULL;
-
-	return resp;
+	return eap_msg_alloc(EAP_VENDOR_IETF, EAP_TYPE_NOTIFICATION, 0,
+			EAP_CODE_RESPONSE, id);
 }
 
 
@@ -1850,6 +1854,11 @@ static void eap_peer_sm_tls_event(void *ctx, enum tls_event ev,
 	case TLS_CERT_CHAIN_SUCCESS:
 		eap_notify_status(sm, "remote certificate verification",
 				  "success");
+		if (sm->ext_cert_check) {
+			sm->waiting_ext_cert_check = 1;
+			eap_sm_request(sm, WPA_CTRL_REQ_EXT_CERT_CHECK,
+				       NULL, 0);
+		}
 		break;
 	case TLS_CERT_CHAIN_FAILURE:
 		wpa_msg(sm->msg_ctx, MSG_INFO, WPA_EVENT_EAP_TLS_CERT_ERROR
@@ -2172,10 +2181,10 @@ int eap_sm_get_status(struct eap_sm *sm, char *buf, size_t buflen, int verbose)
 #endif /* CONFIG_CTRL_IFACE */
 
 
-#if defined(CONFIG_CTRL_IFACE) || !defined(CONFIG_NO_STDOUT_DEBUG)
 static void eap_sm_request(struct eap_sm *sm, enum wpa_ctrl_req_type field,
 			   const char *msg, size_t msglen)
 {
+#if defined(CONFIG_CTRL_IFACE) || !defined(CONFIG_NO_STDOUT_DEBUG)
 	struct eap_peer_config *config;
 	const char *txt = NULL;
 	char *tmp;
@@ -2224,16 +2233,17 @@ static void eap_sm_request(struct eap_sm *sm, enum wpa_ctrl_req_type field,
 	case WPA_CTRL_REQ_SIM:
 		txt = msg;
 		break;
+	case WPA_CTRL_REQ_EXT_CERT_CHECK:
+		break;
 	default:
 		return;
 	}
 
 	if (sm->eapol_cb->eap_param_needed)
 		sm->eapol_cb->eap_param_needed(sm->eapol_ctx, field, txt);
-}
-#else /* CONFIG_CTRL_IFACE || !CONFIG_NO_STDOUT_DEBUG */
-#define eap_sm_request(sm, type, msg, msglen) do { } while (0)
 #endif /* CONFIG_CTRL_IFACE || !CONFIG_NO_STDOUT_DEBUG */
+}
+
 
 const char * eap_sm_get_method_name(struct eap_sm *sm)
 {
diff --git a/src/eap_peer/eap_aka.c b/src/eap_peer/eap_aka.c
index dc9e8cc34d4af..0bac62dee523a 100644
--- a/src/eap_peer/eap_aka.c
+++ b/src/eap_peer/eap_aka.c
@@ -1492,7 +1492,6 @@ static u8 * eap_aka_get_emsk(struct eap_sm *sm, void *priv, size_t *len)
 int eap_peer_aka_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_peer_method_alloc(EAP_PEER_METHOD_INTERFACE_VERSION,
 				    EAP_VENDOR_IETF, EAP_TYPE_AKA, "AKA");
@@ -1511,10 +1510,7 @@ int eap_peer_aka_register(void)
 	eap->get_identity = eap_aka_get_identity;
 	eap->get_emsk = eap_aka_get_emsk;
 
-	ret = eap_peer_method_register(eap);
-	if (ret)
-		eap_peer_method_free(eap);
-	return ret;
+	return eap_peer_method_register(eap);
 }
 
 
@@ -1522,7 +1518,6 @@ int eap_peer_aka_register(void)
 int eap_peer_aka_prime_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_peer_method_alloc(EAP_PEER_METHOD_INTERFACE_VERSION,
 				    EAP_VENDOR_IETF, EAP_TYPE_AKA_PRIME,
@@ -1542,10 +1537,6 @@ int eap_peer_aka_prime_register(void)
 	eap->get_identity = eap_aka_get_identity;
 	eap->get_emsk = eap_aka_get_emsk;
 
-	ret = eap_peer_method_register(eap);
-	if (ret)
-		eap_peer_method_free(eap);
-
-	return ret;
+	return eap_peer_method_register(eap);
 }
 #endif /* EAP_AKA_PRIME */
diff --git a/src/eap_peer/eap_config.h b/src/eap_peer/eap_config.h
index 2b1a1d5e4b254..f98007263b338 100644
--- a/src/eap_peer/eap_config.h
+++ b/src/eap_peer/eap_config.h
@@ -181,13 +181,13 @@ struct eap_peer_config {
 	 * subject_match - Constraint for server certificate subject
 	 *
 	 * This substring is matched against the subject of the authentication
-	 * server certificate. If this string is set, the server sertificate is
+	 * server certificate. If this string is set, the server certificate is
 	 * only accepted if it contains this string in the subject. The subject
 	 * string is in following format:
 	 *
 	 * /C=US/ST=CA/L=San Francisco/CN=Test AS/emailAddress=as@n.example.com
 	 *
-	 * Note: Since this is a substring match, this cannot be used securily
+	 * Note: Since this is a substring match, this cannot be used securely
 	 * to do a suffix match against a possible domain name in the CN entry.
 	 * For such a use case, domain_suffix_match should be used instead.
 	 */
@@ -198,7 +198,7 @@ struct eap_peer_config {
 	 *
 	 * Semicolon separated string of entries to be matched against the
 	 * alternative subject name of the authentication server certificate.
-	 * If this string is set, the server sertificate is only accepted if it
+	 * If this string is set, the server certificate is only accepted if it
 	 * contains one of the entries in an alternative subject name
 	 * extension.
 	 *
@@ -739,6 +739,20 @@ struct eap_peer_config {
 	 * erp - Whether EAP Re-authentication Protocol (ERP) is enabled
 	 */
 	int erp;
+
+	/**
+	 * pending_ext_cert_check - External server certificate check status
+	 *
+	 * This field should not be set in configuration step. It is only used
+	 * internally when control interface is used to request external
+	 * validation of server certificate chain.
+	 */
+	enum {
+		NO_CHECK = 0,
+		PENDING_CHECK,
+		EXT_CERT_CHECK_GOOD,
+		EXT_CERT_CHECK_BAD,
+	} pending_ext_cert_check;
 };
 
 
diff --git a/src/eap_peer/eap_eke.c b/src/eap_peer/eap_eke.c
index dfbda5644f6fc..f899f653fdca4 100644
--- a/src/eap_peer/eap_eke.c
+++ b/src/eap_peer/eap_eke.c
@@ -452,6 +452,7 @@ static struct wpabuf * eap_eke_process_commit(struct eap_sm *sm,
 	/* DHComponent_P = Encr(key, y_p) */
 	rpos = wpabuf_put(resp, data->sess.dhcomp_len);
 	if (eap_eke_dhcomp(&data->sess, key, pub, rpos) < 0) {
+		wpabuf_free(resp);
 		wpa_printf(MSG_INFO, "EAP-EKE: Failed to build DHComponent_P");
 		os_memset(key, 0, sizeof(key));
 		return eap_eke_build_fail(data, ret, id,
@@ -770,7 +771,6 @@ static u8 * eap_eke_get_session_id(struct eap_sm *sm, void *priv, size_t *len)
 int eap_peer_eke_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_peer_method_alloc(EAP_PEER_METHOD_INTERFACE_VERSION,
 				    EAP_VENDOR_IETF, EAP_TYPE_EKE, "EKE");
@@ -785,8 +785,5 @@ int eap_peer_eke_register(void)
 	eap->get_emsk = eap_eke_get_emsk;
 	eap->getSessionId = eap_eke_get_session_id;
 
-	ret = eap_peer_method_register(eap);
-	if (ret)
-		eap_peer_method_free(eap);
-	return ret;
+	return eap_peer_method_register(eap);
 }
diff --git a/src/eap_peer/eap_fast.c b/src/eap_peer/eap_fast.c
index 4cbe3bacb0a61..964ebe74fede8 100644
--- a/src/eap_peer/eap_fast.c
+++ b/src/eap_peer/eap_fast.c
@@ -1,6 +1,6 @@
 /*
  * EAP peer method: EAP-FAST (RFC 4851)
- * Copyright (c) 2004-2008, Jouni Malinen <j@w1.fi>
+ * Copyright (c) 2004-2015, Jouni Malinen <j@w1.fi>
  *
  * This software may be distributed under the terms of the BSD license.
  * See README for more details.
@@ -67,6 +67,7 @@ struct eap_fast_data {
 	int simck_idx;
 
 	struct wpabuf *pending_phase2_req;
+	struct wpabuf *pending_resp;
 };
 
 
@@ -112,8 +113,8 @@ static int eap_fast_session_ticket_cb(void *ctx, const u8 *ticket, size_t len,
 }
 
 
-static int eap_fast_parse_phase1(struct eap_fast_data *data,
-				 const char *phase1)
+static void eap_fast_parse_phase1(struct eap_fast_data *data,
+				  const char *phase1)
 {
 	const char *pos;
 
@@ -139,8 +140,6 @@ static int eap_fast_parse_phase1(struct eap_fast_data *data,
 		wpa_printf(MSG_DEBUG, "EAP-FAST: Using binary format for PAC "
 			   "list");
 	}
-
-	return 0;
 }
 
 
@@ -158,10 +157,8 @@ static void * eap_fast_init(struct eap_sm *sm)
 	data->fast_version = EAP_FAST_VERSION;
 	data->max_pac_list_len = 10;
 
-	if (config->phase1 && eap_fast_parse_phase1(data, config->phase1) < 0) {
-		eap_fast_deinit(sm, data);
-		return NULL;
-	}
+	if (config->phase1)
+		eap_fast_parse_phase1(data, config->phase1);
 
 	if (eap_peer_select_phase2_methods(config, "auth=",
 					   &data->phase2_types,
@@ -254,14 +251,16 @@ static void eap_fast_deinit(struct eap_sm *sm, void *priv)
 	os_memset(data->emsk, 0, EAP_EMSK_LEN);
 	os_free(data->session_id);
 	wpabuf_free(data->pending_phase2_req);
+	wpabuf_free(data->pending_resp);
 	os_free(data);
 }
 
 
 static int eap_fast_derive_msk(struct eap_fast_data *data)
 {
-	eap_fast_derive_eap_msk(data->simck, data->key_data);
-	eap_fast_derive_eap_emsk(data->simck, data->emsk);
+	if (eap_fast_derive_eap_msk(data->simck, data->key_data) < 0 ||
+	    eap_fast_derive_eap_emsk(data->simck, data->emsk) < 0)
+		return -1;
 	data->success = 1;
 	return 0;
 }
@@ -276,7 +275,7 @@ static int eap_fast_derive_key_auth(struct eap_sm *sm,
 	 * Extra key material after TLS key_block: session_key_seed[40]
 	 */
 
-	sks = eap_fast_derive_key(sm->ssl_ctx, data->ssl.conn, "key expansion",
+	sks = eap_fast_derive_key(sm->ssl_ctx, data->ssl.conn,
 				  EAP_FAST_SKS_LEN);
 	if (sks == NULL) {
 		wpa_printf(MSG_DEBUG, "EAP-FAST: Failed to derive "
@@ -304,7 +303,6 @@ static int eap_fast_derive_key_provisioning(struct eap_sm *sm,
 	os_free(data->key_block_p);
 	data->key_block_p = (struct eap_fast_key_block_provisioning *)
 		eap_fast_derive_key(sm->ssl_ctx, data->ssl.conn,
-				    "key expansion",
 				    sizeof(*data->key_block_p));
 	if (data->key_block_p == NULL) {
 		wpa_printf(MSG_DEBUG, "EAP-FAST: Failed to derive key block");
@@ -711,9 +709,10 @@ static int eap_fast_get_cmk(struct eap_sm *sm, struct eap_fast_data *data,
 	if (eap_fast_get_phase2_key(sm, data, isk, sizeof(isk)) < 0)
 		return -1;
 	wpa_hexdump_key(MSG_MSGDUMP, "EAP-FAST: ISK[j]", isk, sizeof(isk));
-	sha1_t_prf(data->simck, EAP_FAST_SIMCK_LEN,
-		   "Inner Methods Compound Keys",
-		   isk, sizeof(isk), imck, sizeof(imck));
+	if (sha1_t_prf(data->simck, EAP_FAST_SIMCK_LEN,
+		       "Inner Methods Compound Keys",
+		       isk, sizeof(isk), imck, sizeof(imck)) < 0)
+		return -1;
 	data->simck_idx++;
 	os_memcpy(data->simck, imck, EAP_FAST_SIMCK_LEN);
 	wpa_hexdump_key(MSG_MSGDUMP, "EAP-FAST: S-IMCK[j]",
@@ -1096,7 +1095,7 @@ static int eap_fast_parse_decrypted(struct wpabuf *decrypted,
 	/* Parse TLVs from the decrypted Phase 2 data */
 	pos = wpabuf_mhead(decrypted);
 	end = pos + wpabuf_len(decrypted);
-	while (pos + 4 < end) {
+	while (end - pos > 4) {
 		mandatory = pos[0] & 0x80;
 		tlv_type = WPA_GET_BE16(pos) & 0x3fff;
 		pos += 2;
@@ -1443,7 +1442,7 @@ static int eap_fast_clear_pac_opaque_ext(struct eap_sm *sm,
 static int eap_fast_set_provisioning_ciphers(struct eap_sm *sm,
 					     struct eap_fast_data *data)
 {
-	u8 ciphers[5];
+	u8 ciphers[7];
 	int count = 0;
 
 	if (data->provisioning_allowed & EAP_FAST_PROV_UNAUTH) {
@@ -1455,7 +1454,9 @@ static int eap_fast_set_provisioning_ciphers(struct eap_sm *sm,
 	if (data->provisioning_allowed & EAP_FAST_PROV_AUTH) {
 		wpa_printf(MSG_DEBUG, "EAP-FAST: Enabling authenticated "
 			   "provisioning TLS cipher suites");
+		ciphers[count++] = TLS_CIPHER_RSA_DHE_AES256_SHA;
 		ciphers[count++] = TLS_CIPHER_RSA_DHE_AES128_SHA;
+		ciphers[count++] = TLS_CIPHER_AES256_SHA;
 		ciphers[count++] = TLS_CIPHER_AES128_SHA;
 		ciphers[count++] = TLS_CIPHER_RC4_SHA;
 	}
@@ -1567,6 +1568,34 @@ static struct wpabuf * eap_fast_process(struct eap_sm *sm, void *priv,
 			res = 1;
 		}
 	} else {
+		if (sm->waiting_ext_cert_check && data->pending_resp) {
+			struct eap_peer_config *config = eap_get_config(sm);
+
+			if (config->pending_ext_cert_check ==
+			    EXT_CERT_CHECK_GOOD) {
+				wpa_printf(MSG_DEBUG,
+					   "EAP-FAST: External certificate check succeeded - continue handshake");
+				resp = data->pending_resp;
+				data->pending_resp = NULL;
+				sm->waiting_ext_cert_check = 0;
+				return resp;
+			}
+
+			if (config->pending_ext_cert_check ==
+			    EXT_CERT_CHECK_BAD) {
+				wpa_printf(MSG_DEBUG,
+					   "EAP-FAST: External certificate check failed - force authentication failure");
+				ret->methodState = METHOD_DONE;
+				ret->decision = DECISION_FAIL;
+				sm->waiting_ext_cert_check = 0;
+				return NULL;
+			}
+
+			wpa_printf(MSG_DEBUG,
+				   "EAP-FAST: Continuing to wait external server certificate validation");
+			return NULL;
+		}
+
 		/* Continue processing TLS handshake (phase 1). */
 		res = eap_peer_tls_process_helper(sm, &data->ssl,
 						  EAP_TYPE_FAST,
@@ -1580,6 +1609,14 @@ static struct wpabuf * eap_fast_process(struct eap_sm *sm, void *priv,
 			return resp;
 		}
 
+		if (sm->waiting_ext_cert_check) {
+			wpa_printf(MSG_DEBUG,
+				   "EAP-FAST: Waiting external server certificate validation");
+			wpabuf_free(data->pending_resp);
+			data->pending_resp = resp;
+			return NULL;
+		}
+
 		if (tls_connection_established(sm->ssl_ctx, data->ssl.conn)) {
 			char cipher[80];
 			wpa_printf(MSG_DEBUG,
@@ -1644,6 +1681,8 @@ static void eap_fast_deinit_for_reauth(struct eap_sm *sm, void *priv)
 	data->key_block_p = NULL;
 	wpabuf_free(data->pending_phase2_req);
 	data->pending_phase2_req = NULL;
+	wpabuf_free(data->pending_resp);
+	data->pending_resp = NULL;
 }
 
 
@@ -1721,7 +1760,7 @@ static u8 * eap_fast_get_session_id(struct eap_sm *sm, void *priv, size_t *len)
 	struct eap_fast_data *data = priv;
 	u8 *id;
 
-	if (!data->success)
+	if (!data->success || !data->session_id)
 		return NULL;
 
 	id = os_malloc(data->id_len);
@@ -1757,7 +1796,6 @@ static u8 * eap_fast_get_emsk(struct eap_sm *sm, void *priv, size_t *len)
 int eap_peer_fast_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_peer_method_alloc(EAP_PEER_METHOD_INTERFACE_VERSION,
 				    EAP_VENDOR_IETF, EAP_TYPE_FAST, "FAST");
@@ -1778,8 +1816,5 @@ int eap_peer_fast_register(void)
 #endif
 	eap->get_emsk = eap_fast_get_emsk;
 
-	ret = eap_peer_method_register(eap);
-	if (ret)
-		eap_peer_method_free(eap);
-	return ret;
+	return eap_peer_method_register(eap);
 }
diff --git a/src/eap_peer/eap_fast_pac.c b/src/eap_peer/eap_fast_pac.c
index 89e604ecf84b0..c815860355137 100644
--- a/src/eap_peer/eap_fast_pac.c
+++ b/src/eap_peer/eap_fast_pac.c
@@ -455,7 +455,8 @@ int eap_fast_load_pac(struct eap_sm *sm, struct eap_fast_pac **pac_root,
 	}
 
 	if (pac) {
-		err = "PAC block not terminated with END";
+		if (!err)
+			err = "PAC block not terminated with END";
 		eap_fast_free_pac(pac);
 	}
 
@@ -709,7 +710,7 @@ static void eap_fast_pac_get_a_id(struct eap_fast_pac *pac)
 	pos = pac->pac_info;
 	end = pos + pac->pac_info_len;
 
-	while (pos + 4 < end) {
+	while (end - pos > 4) {
 		type = WPA_GET_BE16(pos);
 		pos += 2;
 		len = WPA_GET_BE16(pos);
@@ -801,8 +802,10 @@ int eap_fast_load_pac_bin(struct eap_sm *sm, struct eap_fast_pac **pac_root,
 	while (pos < end) {
 		u16 val;
 
-		if (end - pos < 2 + EAP_FAST_PAC_KEY_LEN + 2 + 2)
+		if (end - pos < 2 + EAP_FAST_PAC_KEY_LEN + 2 + 2) {
+			pac = NULL;
 			goto parse_fail;
+		}
 
 		pac = os_zalloc(sizeof(*pac));
 		if (pac == NULL)
diff --git a/src/eap_peer/eap_gpsk.c b/src/eap_peer/eap_gpsk.c
index 902b4ba26d6e4..177cbccf58508 100644
--- a/src/eap_peer/eap_gpsk.c
+++ b/src/eap_peer/eap_gpsk.c
@@ -771,7 +771,6 @@ static u8 * eap_gpsk_get_session_id(struct eap_sm *sm, void *priv, size_t *len)
 int eap_peer_gpsk_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_peer_method_alloc(EAP_PEER_METHOD_INTERFACE_VERSION,
 				    EAP_VENDOR_IETF, EAP_TYPE_GPSK, "GPSK");
@@ -786,8 +785,5 @@ int eap_peer_gpsk_register(void)
 	eap->get_emsk = eap_gpsk_get_emsk;
 	eap->getSessionId = eap_gpsk_get_session_id;
 
-	ret = eap_peer_method_register(eap);
-	if (ret)
-		eap_peer_method_free(eap);
-	return ret;
+	return eap_peer_method_register(eap);
 }
diff --git a/src/eap_peer/eap_gtc.c b/src/eap_peer/eap_gtc.c
index 9f3cfbdacadc8..a519a780a90b6 100644
--- a/src/eap_peer/eap_gtc.c
+++ b/src/eap_peer/eap_gtc.c
@@ -127,7 +127,6 @@ static struct wpabuf * eap_gtc_process(struct eap_sm *sm, void *priv,
 int eap_peer_gtc_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_peer_method_alloc(EAP_PEER_METHOD_INTERFACE_VERSION,
 				    EAP_VENDOR_IETF, EAP_TYPE_GTC, "GTC");
@@ -138,8 +137,5 @@ int eap_peer_gtc_register(void)
 	eap->deinit = eap_gtc_deinit;
 	eap->process = eap_gtc_process;
 
-	ret = eap_peer_method_register(eap);
-	if (ret)
-		eap_peer_method_free(eap);
-	return ret;
+	return eap_peer_method_register(eap);
 }
diff --git a/src/eap_peer/eap_i.h b/src/eap_peer/eap_i.h
index 99b44dae4e34e..6ab24834d654a 100644
--- a/src/eap_peer/eap_i.h
+++ b/src/eap_peer/eap_i.h
@@ -366,6 +366,8 @@ struct eap_sm {
 	int external_sim;
 
 	unsigned int expected_failure:1;
+	unsigned int ext_cert_check:1;
+	unsigned int waiting_ext_cert_check:1;
 
 	struct dl_list erp_keys; /* struct eap_erp_key */
 };
diff --git a/src/eap_peer/eap_ikev2.c b/src/eap_peer/eap_ikev2.c
index b5ef71bac3ba4..390f0ec8cf4df 100644
--- a/src/eap_peer/eap_ikev2.c
+++ b/src/eap_peer/eap_ikev2.c
@@ -513,7 +513,6 @@ static u8 * eap_ikev2_get_session_id(struct eap_sm *sm, void *priv, size_t *len)
 int eap_peer_ikev2_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_peer_method_alloc(EAP_PEER_METHOD_INTERFACE_VERSION,
 				    EAP_VENDOR_IETF, EAP_TYPE_IKEV2,
@@ -529,8 +528,5 @@ int eap_peer_ikev2_register(void)
 	eap->get_emsk = eap_ikev2_get_emsk;
 	eap->getSessionId = eap_ikev2_get_session_id;
 
-	ret = eap_peer_method_register(eap);
-	if (ret)
-		eap_peer_method_free(eap);
-	return ret;
+	return eap_peer_method_register(eap);
 }
diff --git a/src/eap_peer/eap_leap.c b/src/eap_peer/eap_leap.c
index e0f8bcf6b0df7..ff6fa4afd2f72 100644
--- a/src/eap_peer/eap_leap.c
+++ b/src/eap_peer/eap_leap.c
@@ -393,7 +393,6 @@ static u8 * eap_leap_getKey(struct eap_sm *sm, void *priv, size_t *len)
 int eap_peer_leap_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_peer_method_alloc(EAP_PEER_METHOD_INTERFACE_VERSION,
 				    EAP_VENDOR_IETF, EAP_TYPE_LEAP, "LEAP");
@@ -406,8 +405,5 @@ int eap_peer_leap_register(void)
 	eap->isKeyAvailable = eap_leap_isKeyAvailable;
 	eap->getKey = eap_leap_getKey;
 
-	ret = eap_peer_method_register(eap);
-	if (ret)
-		eap_peer_method_free(eap);
-	return ret;
+	return eap_peer_method_register(eap);
 }
diff --git a/src/eap_peer/eap_md5.c b/src/eap_peer/eap_md5.c
index d06befaeb1df5..efae8deba85d5 100644
--- a/src/eap_peer/eap_md5.c
+++ b/src/eap_peer/eap_md5.c
@@ -102,7 +102,6 @@ static struct wpabuf * eap_md5_process(struct eap_sm *sm, void *priv,
 int eap_peer_md5_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_peer_method_alloc(EAP_PEER_METHOD_INTERFACE_VERSION,
 				    EAP_VENDOR_IETF, EAP_TYPE_MD5, "MD5");
@@ -113,8 +112,5 @@ int eap_peer_md5_register(void)
 	eap->deinit = eap_md5_deinit;
 	eap->process = eap_md5_process;
 
-	ret = eap_peer_method_register(eap);
-	if (ret)
-		eap_peer_method_free(eap);
-	return ret;
+	return eap_peer_method_register(eap);
 }
diff --git a/src/eap_peer/eap_methods.c b/src/eap_peer/eap_methods.c
index 1bdd81e1ad52a..9747954952a7b 100644
--- a/src/eap_peer/eap_methods.c
+++ b/src/eap_peer/eap_methods.c
@@ -18,6 +18,8 @@
 
 static struct eap_method *eap_methods = NULL;
 
+static void eap_peer_method_free(struct eap_method *method);
+
 
 /**
  * eap_peer_get_eap_method - Get EAP method based on type number
@@ -295,7 +297,7 @@ struct eap_method * eap_peer_method_alloc(int version, int vendor,
  * eap_peer_method_free - Free EAP peer method structure
  * @method: Method structure allocated with eap_peer_method_alloc()
  */
-void eap_peer_method_free(struct eap_method *method)
+static void eap_peer_method_free(struct eap_method *method)
 {
 	os_free(method);
 }
@@ -303,26 +305,31 @@ void eap_peer_method_free(struct eap_method *method)
 
 /**
  * eap_peer_method_register - Register an EAP peer method
- * @method: EAP method to register
+ * @method: EAP method to register from eap_peer_method_alloc()
  * Returns: 0 on success, -1 on invalid method, or -2 if a matching EAP method
  * has already been registered
  *
  * Each EAP peer method needs to call this function to register itself as a
- * supported EAP method.
+ * supported EAP method. The caller must not free the allocated method data
+ * regardless of the return value.
  */
 int eap_peer_method_register(struct eap_method *method)
 {
 	struct eap_method *m, *last = NULL;
 
 	if (method == NULL || method->name == NULL ||
-	    method->version != EAP_PEER_METHOD_INTERFACE_VERSION)
+	    method->version != EAP_PEER_METHOD_INTERFACE_VERSION) {
+		eap_peer_method_free(method);
 		return -1;
+	}
 
 	for (m = eap_methods; m; m = m->next) {
 		if ((m->vendor == method->vendor &&
 		     m->method == method->method) ||
-		    os_strcmp(m->name, method->name) == 0)
+		    os_strcmp(m->name, method->name) == 0) {
+			eap_peer_method_free(method);
 			return -2;
+		}
 		last = m;
 	}
 
diff --git a/src/eap_peer/eap_methods.h b/src/eap_peer/eap_methods.h
index e35c919abce94..b96b211de2589 100644
--- a/src/eap_peer/eap_methods.h
+++ b/src/eap_peer/eap_methods.h
@@ -16,7 +16,6 @@ const struct eap_method * eap_peer_get_methods(size_t *count);
 
 struct eap_method * eap_peer_method_alloc(int version, int vendor,
 					  EapType method, const char *name);
-void eap_peer_method_free(struct eap_method *method);
 int eap_peer_method_register(struct eap_method *method);
 
 
diff --git a/src/eap_peer/eap_mschapv2.c b/src/eap_peer/eap_mschapv2.c
index 6acf1e8ad390a..ce2227d388ef4 100644
--- a/src/eap_peer/eap_mschapv2.c
+++ b/src/eap_peer/eap_mschapv2.c
@@ -880,7 +880,6 @@ static u8 * eap_mschapv2_getKey(struct eap_sm *sm, void *priv, size_t *len)
 int eap_peer_mschapv2_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_peer_method_alloc(EAP_PEER_METHOD_INTERFACE_VERSION,
 				    EAP_VENDOR_IETF, EAP_TYPE_MSCHAPV2,
@@ -894,8 +893,5 @@ int eap_peer_mschapv2_register(void)
 	eap->isKeyAvailable = eap_mschapv2_isKeyAvailable;
 	eap->getKey = eap_mschapv2_getKey;
 
-	ret = eap_peer_method_register(eap);
-	if (ret)
-		eap_peer_method_free(eap);
-	return ret;
+	return eap_peer_method_register(eap);
 }
diff --git a/src/eap_peer/eap_otp.c b/src/eap_peer/eap_otp.c
index 9ac744a7ddade..0ab4c7907ab5a 100644
--- a/src/eap_peer/eap_otp.c
+++ b/src/eap_peer/eap_otp.c
@@ -83,7 +83,6 @@ static struct wpabuf * eap_otp_process(struct eap_sm *sm, void *priv,
 int eap_peer_otp_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_peer_method_alloc(EAP_PEER_METHOD_INTERFACE_VERSION,
 				    EAP_VENDOR_IETF, EAP_TYPE_OTP, "OTP");
@@ -94,8 +93,5 @@ int eap_peer_otp_register(void)
 	eap->deinit = eap_otp_deinit;
 	eap->process = eap_otp_process;
 
-	ret = eap_peer_method_register(eap);
-	if (ret)
-		eap_peer_method_free(eap);
-	return ret;
+	return eap_peer_method_register(eap);
 }
diff --git a/src/eap_peer/eap_pax.c b/src/eap_peer/eap_pax.c
index c920bcd3182f8..a7012d2870cf3 100644
--- a/src/eap_peer/eap_pax.c
+++ b/src/eap_peer/eap_pax.c
@@ -276,9 +276,16 @@ static struct wpabuf * eap_pax_process_std_3(struct eap_pax_data *data,
 	left -= 2;
 	wpa_hexdump(MSG_MSGDUMP, "EAP-PAX: MAC_CK(B, CID)",
 		    pos, EAP_PAX_MAC_LEN);
-	eap_pax_mac(data->mac_id, data->ck, EAP_PAX_CK_LEN,
-		    data->rand.r.y, EAP_PAX_RAND_LEN,
-		    (u8 *) data->cid, data->cid_len, NULL, 0, mac);
+	if (eap_pax_mac(data->mac_id, data->ck, EAP_PAX_CK_LEN,
+			data->rand.r.y, EAP_PAX_RAND_LEN,
+			(u8 *) data->cid, data->cid_len, NULL, 0, mac) < 0) {
+		wpa_printf(MSG_INFO,
+			   "EAP-PAX: Could not derive MAC_CK(B, CID)");
+		ret->methodState = METHOD_DONE;
+		ret->decision = DECISION_FAIL;
+		return NULL;
+	}
+
 	if (os_memcmp_const(pos, mac, EAP_PAX_MAC_LEN) != 0) {
 		wpa_printf(MSG_INFO, "EAP-PAX: Invalid MAC_CK(B, CID) "
 			   "received");
@@ -306,9 +313,12 @@ static struct wpabuf * eap_pax_process_std_3(struct eap_pax_data *data,
 	/* Optional ADE could be added here, if needed */
 
 	rpos = wpabuf_put(resp, EAP_PAX_ICV_LEN);
-	eap_pax_mac(data->mac_id, data->ick, EAP_PAX_ICK_LEN,
-		    wpabuf_head(resp), wpabuf_len(resp) - EAP_PAX_ICV_LEN,
-		    NULL, 0, NULL, 0, rpos);
+	if (eap_pax_mac(data->mac_id, data->ick, EAP_PAX_ICK_LEN,
+			wpabuf_head(resp), wpabuf_len(resp) - EAP_PAX_ICV_LEN,
+			NULL, 0, NULL, 0, rpos) < 0) {
+		wpabuf_free(resp);
+		return NULL;
+	}
 	wpa_hexdump(MSG_MSGDUMP, "EAP-PAX: ICV", rpos, EAP_PAX_ICV_LEN);
 
 	data->state = PAX_DONE;
@@ -472,9 +482,13 @@ static u8 * eap_pax_getKey(struct eap_sm *sm, void *priv, size_t *len)
 		return NULL;
 
 	*len = EAP_MSK_LEN;
-	eap_pax_kdf(data->mac_id, data->mk, EAP_PAX_MK_LEN,
-		    "Master Session Key", data->rand.e, 2 * EAP_PAX_RAND_LEN,
-		    EAP_MSK_LEN, key);
+	if (eap_pax_kdf(data->mac_id, data->mk, EAP_PAX_MK_LEN,
+			"Master Session Key",
+			data->rand.e, 2 * EAP_PAX_RAND_LEN,
+			EAP_MSK_LEN, key) < 0) {
+		os_free(key);
+		return NULL;
+	}
 
 	return key;
 }
@@ -493,10 +507,13 @@ static u8 * eap_pax_get_emsk(struct eap_sm *sm, void *priv, size_t *len)
 		return NULL;
 
 	*len = EAP_EMSK_LEN;
-	eap_pax_kdf(data->mac_id, data->mk, EAP_PAX_MK_LEN,
-		    "Extended Master Session Key",
-		    data->rand.e, 2 * EAP_PAX_RAND_LEN,
-		    EAP_EMSK_LEN, key);
+	if (eap_pax_kdf(data->mac_id, data->mk, EAP_PAX_MK_LEN,
+			"Extended Master Session Key",
+			data->rand.e, 2 * EAP_PAX_RAND_LEN,
+			EAP_EMSK_LEN, key) < 0) {
+		os_free(key);
+		return NULL;
+	}
 
 	return key;
 }
@@ -525,7 +542,6 @@ static u8 * eap_pax_get_session_id(struct eap_sm *sm, void *priv, size_t *len)
 int eap_peer_pax_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_peer_method_alloc(EAP_PEER_METHOD_INTERFACE_VERSION,
 				    EAP_VENDOR_IETF, EAP_TYPE_PAX, "PAX");
@@ -540,8 +556,5 @@ int eap_peer_pax_register(void)
 	eap->get_emsk = eap_pax_get_emsk;
 	eap->getSessionId = eap_pax_get_session_id;
 
-	ret = eap_peer_method_register(eap);
-	if (ret)
-		eap_peer_method_free(eap);
-	return ret;
+	return eap_peer_method_register(eap);
 }
diff --git a/src/eap_peer/eap_peap.c b/src/eap_peer/eap_peap.c
index 98a48a6cf5d31..45ba38168d4fc 100644
--- a/src/eap_peer/eap_peap.c
+++ b/src/eap_peer/eap_peap.c
@@ -1,6 +1,6 @@
 /*
  * EAP peer method: EAP-PEAP (draft-josefsson-pppext-eap-tls-eap-10.txt)
- * Copyright (c) 2004-2008, Jouni Malinen <j@w1.fi>
+ * Copyright (c) 2004-2015, Jouni Malinen <j@w1.fi>
  *
  * This software may be distributed under the terms of the BSD license.
  * See README for more details.
@@ -59,6 +59,7 @@ struct eap_peap_data {
 	size_t id_len;
 
 	struct wpabuf *pending_phase2_req;
+	struct wpabuf *pending_resp;
 	enum { NO_BINDING, OPTIONAL_BINDING, REQUIRE_BINDING } crypto_binding;
 	int crypto_binding_used;
 	u8 binding_nonce[32];
@@ -69,8 +70,8 @@ struct eap_peap_data {
 };
 
 
-static int eap_peap_parse_phase1(struct eap_peap_data *data,
-				 const char *phase1)
+static void eap_peap_parse_phase1(struct eap_peap_data *data,
+				  const char *phase1)
 {
 	const char *pos;
 
@@ -125,8 +126,6 @@ static int eap_peap_parse_phase1(struct eap_peap_data *data,
 		wpa_printf(MSG_DEBUG, "EAP-PEAP: SoH version 2 enabled");
 	}
 #endif /* EAP_TNC */
-
-	return 0;
 }
 
 
@@ -144,11 +143,8 @@ static void * eap_peap_init(struct eap_sm *sm)
 	data->peap_outer_success = 2;
 	data->crypto_binding = OPTIONAL_BINDING;
 
-	if (config && config->phase1 &&
-	    eap_peap_parse_phase1(data, config->phase1) < 0) {
-		eap_peap_deinit(sm, data);
-		return NULL;
-	}
+	if (config && config->phase1)
+		eap_peap_parse_phase1(data, config->phase1);
 
 	if (eap_peer_select_phase2_methods(config, "auth=",
 					   &data->phase2_types,
@@ -191,6 +187,7 @@ static void eap_peap_deinit(struct eap_sm *sm, void *priv)
 	eap_peap_free_key(data);
 	os_free(data->session_id);
 	wpabuf_free(data->pending_phase2_req);
+	wpabuf_free(data->pending_resp);
 	os_free(data);
 }
 
@@ -256,6 +253,7 @@ static int eap_peap_derive_cmk(struct eap_sm *sm, struct eap_peap_data *data)
 {
 	u8 *tk;
 	u8 isk[32], imck[60];
+	int resumed;
 
 	/*
 	 * Tunnel key (TK) is the first 60 octets of the key generated by
@@ -266,8 +264,12 @@ static int eap_peap_derive_cmk(struct eap_sm *sm, struct eap_peap_data *data)
 		return -1;
 	wpa_hexdump_key(MSG_DEBUG, "EAP-PEAP: TK", tk, 60);
 
-	if (data->reauth &&
-	    tls_connection_resumed(sm->ssl_ctx, data->ssl.conn)) {
+	resumed = tls_connection_resumed(sm->ssl_ctx, data->ssl.conn);
+	wpa_printf(MSG_DEBUG,
+		   "EAP-PEAP: CMK derivation - reauth=%d resumed=%d phase2_eap_started=%d phase2_success=%d",
+		   data->reauth, resumed, data->phase2_eap_started,
+		   data->phase2_success);
+	if (data->reauth && !data->phase2_eap_started && resumed) {
 		/* Fast-connect: IPMK|CMK = TK */
 		os_memcpy(data->ipmk, tk, 40);
 		wpa_hexdump_key(MSG_DEBUG, "EAP-PEAP: IPMK from TK",
@@ -337,7 +339,8 @@ static int eap_tlv_add_cryptobinding(struct eap_sm *sm,
 		    addr[0], len[0]);
 	wpa_hexdump(MSG_MSGDUMP, "EAP-PEAP: Compound_MAC data 2",
 		    addr[1], len[1]);
-	hmac_sha1_vector(data->cmk, 20, 2, addr, len, mac);
+	if (hmac_sha1_vector(data->cmk, 20, 2, addr, len, mac) < 0)
+		return -1;
 	wpa_hexdump(MSG_MSGDUMP, "EAP-PEAP: Compound_MAC", mac, SHA1_MAC_LEN);
 	data->crypto_binding_used = 1;
 
@@ -648,6 +651,7 @@ static int eap_peap_phase2_request(struct eap_sm *sm,
 					if (*resp == NULL) {
 						ret->methodState = METHOD_DONE;
 						ret->decision = DECISION_FAIL;
+						wpabuf_free(buf);
 						return -1;
 					}
 					wpabuf_put_buf(*resp, buf);
@@ -1006,6 +1010,34 @@ static struct wpabuf * eap_peap_process(struct eap_sm *sm, void *priv,
 	    !data->resuming) {
 		res = eap_peap_decrypt(sm, data, ret, req, &msg, &resp);
 	} else {
+		if (sm->waiting_ext_cert_check && data->pending_resp) {
+			struct eap_peer_config *config = eap_get_config(sm);
+
+			if (config->pending_ext_cert_check ==
+			    EXT_CERT_CHECK_GOOD) {
+				wpa_printf(MSG_DEBUG,
+					   "EAP-PEAP: External certificate check succeeded - continue handshake");
+				resp = data->pending_resp;
+				data->pending_resp = NULL;
+				sm->waiting_ext_cert_check = 0;
+				return resp;
+			}
+
+			if (config->pending_ext_cert_check ==
+			    EXT_CERT_CHECK_BAD) {
+				wpa_printf(MSG_DEBUG,
+					   "EAP-PEAP: External certificate check failed - force authentication failure");
+				ret->methodState = METHOD_DONE;
+				ret->decision = DECISION_FAIL;
+				sm->waiting_ext_cert_check = 0;
+				return NULL;
+			}
+
+			wpa_printf(MSG_DEBUG,
+				   "EAP-PEAP: Continuing to wait external server certificate validation");
+			return NULL;
+		}
+
 		res = eap_peer_tls_process_helper(sm, &data->ssl,
 						  EAP_TYPE_PEAP,
 						  data->peap_version, id, &msg,
@@ -1018,6 +1050,16 @@ static struct wpabuf * eap_peap_process(struct eap_sm *sm, void *priv,
 			ret->decision = DECISION_FAIL;
 			return resp;
 		}
+
+
+		if (sm->waiting_ext_cert_check) {
+			wpa_printf(MSG_DEBUG,
+				   "EAP-PEAP: Waiting external server certificate validation");
+			wpabuf_free(data->pending_resp);
+			data->pending_resp = resp;
+			return NULL;
+		}
+
 		if (tls_connection_established(sm->ssl_ctx, data->ssl.conn)) {
 			char *label;
 			wpa_printf(MSG_DEBUG,
@@ -1123,6 +1165,8 @@ static void eap_peap_deinit_for_reauth(struct eap_sm *sm, void *priv)
 	struct eap_peap_data *data = priv;
 	wpabuf_free(data->pending_phase2_req);
 	data->pending_phase2_req = NULL;
+	wpabuf_free(data->pending_resp);
+	data->pending_resp = NULL;
 	data->crypto_binding_used = 0;
 }
 
@@ -1237,7 +1281,6 @@ static u8 * eap_peap_get_session_id(struct eap_sm *sm, void *priv, size_t *len)
 int eap_peer_peap_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_peer_method_alloc(EAP_PEER_METHOD_INTERFACE_VERSION,
 				    EAP_VENDOR_IETF, EAP_TYPE_PEAP, "PEAP");
@@ -1255,8 +1298,5 @@ int eap_peer_peap_register(void)
 	eap->init_for_reauth = eap_peap_init_for_reauth;
 	eap->getSessionId = eap_peap_get_session_id;
 
-	ret = eap_peer_method_register(eap);
-	if (ret)
-		eap_peer_method_free(eap);
-	return ret;
+	return eap_peer_method_register(eap);
 }
diff --git a/src/eap_peer/eap_psk.c b/src/eap_peer/eap_psk.c
index f01266354e904..ac18c158ad8bb 100644
--- a/src/eap_peer/eap_psk.c
+++ b/src/eap_peer/eap_psk.c
@@ -480,7 +480,6 @@ static u8 * eap_psk_get_emsk(struct eap_sm *sm, void *priv, size_t *len)
 int eap_peer_psk_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_peer_method_alloc(EAP_PEER_METHOD_INTERFACE_VERSION,
 				    EAP_VENDOR_IETF, EAP_TYPE_PSK, "PSK");
@@ -495,8 +494,5 @@ int eap_peer_psk_register(void)
 	eap->getSessionId = eap_psk_get_session_id;
 	eap->get_emsk = eap_psk_get_emsk;
 
-	ret = eap_peer_method_register(eap);
-	if (ret)
-		eap_peer_method_free(eap);
-	return ret;
+	return eap_peer_method_register(eap);
 }
diff --git a/src/eap_peer/eap_pwd.c b/src/eap_peer/eap_pwd.c
index 1f785443ee5ac..d2bc981cd06b8 100644
--- a/src/eap_peer/eap_pwd.c
+++ b/src/eap_peer/eap_pwd.c
@@ -418,7 +418,6 @@ eap_pwd_perform_commit_exchange(struct eap_sm *sm, struct eap_pwd_data *data,
 		wpa_printf(MSG_INFO, "EAP-PWD (peer): element inversion fail");
 		goto fin;
 	}
-	BN_clear_free(mask);
 
 	if (((x = BN_new()) == NULL) ||
 	    ((y = BN_new()) == NULL)) {
@@ -555,6 +554,7 @@ fin:
 	os_free(element);
 	BN_clear_free(x);
 	BN_clear_free(y);
+	BN_clear_free(mask);
 	BN_clear_free(cofactor);
 	EC_POINT_clear_free(K);
 	EC_POINT_clear_free(point);
@@ -774,7 +774,8 @@ eap_pwd_perform_confirm_exchange(struct eap_sm *sm, struct eap_pwd_data *data,
 	wpabuf_put_data(data->outbuf, conf, SHA256_MAC_LEN);
 
 fin:
-	bin_clear_free(cruft, BN_num_bytes(data->grp->prime));
+	if (data->grp)
+		bin_clear_free(cruft, BN_num_bytes(data->grp->prime));
 	BN_clear_free(x);
 	BN_clear_free(y);
 	if (data->outbuf == NULL) {
@@ -903,7 +904,7 @@ eap_pwd_process(struct eap_sm *sm, void *priv, struct eap_method_ret *ret,
 	/*
 	 * buffer and ACK the fragment
 	 */
-	if (EAP_PWD_GET_MORE_BIT(lm_exch)) {
+	if (EAP_PWD_GET_MORE_BIT(lm_exch) || data->in_frag_pos) {
 		data->in_frag_pos += len;
 		if (data->in_frag_pos > wpabuf_size(data->inbuf)) {
 			wpa_printf(MSG_INFO, "EAP-pwd: Buffer overflow attack "
@@ -916,7 +917,8 @@ eap_pwd_process(struct eap_sm *sm, void *priv, struct eap_method_ret *ret,
 			return NULL;
 		}
 		wpabuf_put_data(data->inbuf, pos, len);
-
+	}
+	if (EAP_PWD_GET_MORE_BIT(lm_exch)) {
 		resp = eap_msg_alloc(EAP_VENDOR_IETF, EAP_TYPE_PWD,
 				     EAP_PWD_HDR_SIZE,
 				     EAP_CODE_RESPONSE, eap_get_id(reqData));
@@ -930,10 +932,8 @@ eap_pwd_process(struct eap_sm *sm, void *priv, struct eap_method_ret *ret,
 	 * we're buffering and this is the last fragment
 	 */
 	if (data->in_frag_pos) {
-		wpabuf_put_data(data->inbuf, pos, len);
 		wpa_printf(MSG_DEBUG, "EAP-pwd: Last fragment, %d bytes",
 			   (int) len);
-		data->in_frag_pos += len;
 		pos = wpabuf_head_u8(data->inbuf);
 		len = data->in_frag_pos;
 	}
@@ -1054,7 +1054,6 @@ static u8 * eap_pwd_get_emsk(struct eap_sm *sm, void *priv, size_t *len)
 int eap_peer_pwd_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_peer_method_alloc(EAP_PEER_METHOD_INTERFACE_VERSION,
 				    EAP_VENDOR_IETF, EAP_TYPE_PWD, "PWD");
@@ -1069,8 +1068,5 @@ int eap_peer_pwd_register(void)
 	eap->getSessionId = eap_pwd_get_session_id;
 	eap->get_emsk = eap_pwd_get_emsk;
 
-	ret = eap_peer_method_register(eap);
-	if (ret)
-		eap_peer_method_free(eap);
-	return ret;
+	return eap_peer_method_register(eap);
 }
diff --git a/src/eap_peer/eap_sake.c b/src/eap_peer/eap_sake.c
index c4f9843febb35..330febbefd78c 100644
--- a/src/eap_peer/eap_sake.c
+++ b/src/eap_peer/eap_sake.c
@@ -309,11 +309,20 @@ static struct wpabuf * eap_sake_process_confirm(struct eap_sm *sm,
 		return NULL;
 	}
 
-	eap_sake_compute_mic(data->tek.auth, data->rand_s, data->rand_p,
-			     data->serverid, data->serverid_len,
-			     data->peerid, data->peerid_len, 0,
-			     wpabuf_head(reqData), wpabuf_len(reqData),
-			     attr.mic_s, mic_s);
+	if (eap_sake_compute_mic(data->tek.auth, data->rand_s, data->rand_p,
+				 data->serverid, data->serverid_len,
+				 data->peerid, data->peerid_len, 0,
+				 wpabuf_head(reqData), wpabuf_len(reqData),
+				 attr.mic_s, mic_s)) {
+		wpa_printf(MSG_INFO, "EAP-SAKE: Failed to compute MIC");
+		eap_sake_state(data, FAILURE);
+		ret->methodState = METHOD_DONE;
+		ret->decision = DECISION_FAIL;
+		ret->allowNotifications = FALSE;
+		wpa_printf(MSG_DEBUG, "EAP-SAKE: Sending Response/Auth-Reject");
+		return eap_sake_build_msg(data, id, 0,
+					  EAP_SAKE_SUBTYPE_AUTH_REJECT);
+	}
 	if (os_memcmp_const(attr.mic_s, mic_s, EAP_SAKE_MIC_LEN) != 0) {
 		wpa_printf(MSG_INFO, "EAP-SAKE: Incorrect AT_MIC_S");
 		eap_sake_state(data, FAILURE);
@@ -494,7 +503,6 @@ static u8 * eap_sake_get_emsk(struct eap_sm *sm, void *priv, size_t *len)
 int eap_peer_sake_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_peer_method_alloc(EAP_PEER_METHOD_INTERFACE_VERSION,
 				    EAP_VENDOR_IETF, EAP_TYPE_SAKE, "SAKE");
@@ -509,8 +517,5 @@ int eap_peer_sake_register(void)
 	eap->getSessionId = eap_sake_get_session_id;
 	eap->get_emsk = eap_sake_get_emsk;
 
-	ret = eap_peer_method_register(eap);
-	if (ret)
-		eap_peer_method_free(eap);
-	return ret;
+	return eap_peer_method_register(eap);
 }
diff --git a/src/eap_peer/eap_sim.c b/src/eap_peer/eap_sim.c
index 99a2816ce61ed..b97c95db196f0 100644
--- a/src/eap_peer/eap_sim.c
+++ b/src/eap_peer/eap_sim.c
@@ -249,6 +249,7 @@ static int eap_sim_gsm_auth(struct eap_sm *sm, struct eap_sim_data *data)
 			return eap_sim_ext_sim_req(sm, data);
 	}
 
+#ifdef PCSC_FUNCS
 	if (conf->pcsc) {
 		if (scard_gsm_auth(sm->scard_ctx, data->rand[0],
 				   data->sres[0], data->kc[0]) ||
@@ -263,6 +264,7 @@ static int eap_sim_gsm_auth(struct eap_sm *sm, struct eap_sim_data *data)
 		}
 		return 0;
 	}
+#endif /* PCSC_FUNCS */
 
 #ifdef CONFIG_SIM_SIMULATOR
 	if (conf->password) {
@@ -1135,7 +1137,7 @@ static void * eap_sim_init_for_reauth(struct eap_sm *sm, void *priv)
 	if (random_get_bytes(data->nonce_mt, EAP_SIM_NONCE_MT_LEN)) {
 		wpa_printf(MSG_WARNING, "EAP-SIM: Failed to get random data "
 			   "for NONCE_MT");
-		os_free(data);
+		eap_sim_deinit(sm, data);
 		return NULL;
 	}
 	data->num_id_req = 0;
@@ -1235,7 +1237,6 @@ static u8 * eap_sim_get_emsk(struct eap_sm *sm, void *priv, size_t *len)
 int eap_peer_sim_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_peer_method_alloc(EAP_PEER_METHOD_INTERFACE_VERSION,
 				    EAP_VENDOR_IETF, EAP_TYPE_SIM, "SIM");
@@ -1254,8 +1255,5 @@ int eap_peer_sim_register(void)
 	eap->get_identity = eap_sim_get_identity;
 	eap->get_emsk = eap_sim_get_emsk;
 
-	ret = eap_peer_method_register(eap);
-	if (ret)
-		eap_peer_method_free(eap);
-	return ret;
+	return eap_peer_method_register(eap);
 }
diff --git a/src/eap_peer/eap_tls.c b/src/eap_peer/eap_tls.c
index 66a027a626e0d..ca2354f8a7850 100644
--- a/src/eap_peer/eap_tls.c
+++ b/src/eap_peer/eap_tls.c
@@ -1,6 +1,6 @@
 /*
  * EAP peer method: EAP-TLS (RFC 2716)
- * Copyright (c) 2004-2008, 2012, Jouni Malinen <j@w1.fi>
+ * Copyright (c) 2004-2008, 2012-2015, Jouni Malinen <j@w1.fi>
  *
  * This software may be distributed under the terms of the BSD license.
  * See README for more details.
@@ -25,6 +25,7 @@ struct eap_tls_data {
 	size_t id_len;
 	void *ssl_ctx;
 	u8 eap_type;
+	struct wpabuf *pending_resp;
 };
 
 
@@ -142,6 +143,7 @@ static void eap_tls_deinit(struct eap_sm *sm, void *priv)
 	eap_peer_tls_ssl_deinit(sm, &data->ssl);
 	eap_tls_free_key(data);
 	os_free(data->session_id);
+	wpabuf_free(data->pending_resp);
 	os_free(data);
 }
 
@@ -216,6 +218,32 @@ static struct wpabuf * eap_tls_process(struct eap_sm *sm, void *priv,
 	struct eap_tls_data *data = priv;
 	struct wpabuf msg;
 
+	if (sm->waiting_ext_cert_check && data->pending_resp) {
+		struct eap_peer_config *config = eap_get_config(sm);
+
+		if (config->pending_ext_cert_check == EXT_CERT_CHECK_GOOD) {
+			wpa_printf(MSG_DEBUG,
+				   "EAP-TLS: External certificate check succeeded - continue handshake");
+			resp = data->pending_resp;
+			data->pending_resp = NULL;
+			sm->waiting_ext_cert_check = 0;
+			return resp;
+		}
+
+		if (config->pending_ext_cert_check == EXT_CERT_CHECK_BAD) {
+			wpa_printf(MSG_DEBUG,
+				   "EAP-TLS: External certificate check failed - force authentication failure");
+			ret->methodState = METHOD_DONE;
+			ret->decision = DECISION_FAIL;
+			sm->waiting_ext_cert_check = 0;
+			return NULL;
+		}
+
+		wpa_printf(MSG_DEBUG,
+			   "EAP-TLS: Continuing to wait external server certificate validation");
+		return NULL;
+	}
+
 	pos = eap_peer_tls_process_init(sm, &data->ssl, data->eap_type, ret,
 					reqData, &left, &flags);
 	if (pos == NULL)
@@ -237,6 +265,14 @@ static struct wpabuf * eap_tls_process(struct eap_sm *sm, void *priv,
 		return eap_tls_failure(sm, data, ret, res, resp, id);
 	}
 
+	if (sm->waiting_ext_cert_check) {
+		wpa_printf(MSG_DEBUG,
+			   "EAP-TLS: Waiting external server certificate validation");
+		wpabuf_free(data->pending_resp);
+		data->pending_resp = resp;
+		return NULL;
+	}
+
 	if (tls_connection_established(data->ssl_ctx, data->ssl.conn))
 		eap_tls_success(sm, data, ret);
 
@@ -258,6 +294,10 @@ static Boolean eap_tls_has_reauth_data(struct eap_sm *sm, void *priv)
 
 static void eap_tls_deinit_for_reauth(struct eap_sm *sm, void *priv)
 {
+	struct eap_tls_data *data = priv;
+
+	wpabuf_free(data->pending_resp);
+	data->pending_resp = NULL;
 }
 
 
@@ -350,7 +390,6 @@ static u8 * eap_tls_get_session_id(struct eap_sm *sm, void *priv, size_t *len)
 int eap_peer_tls_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_peer_method_alloc(EAP_PEER_METHOD_INTERFACE_VERSION,
 				    EAP_VENDOR_IETF, EAP_TYPE_TLS, "TLS");
@@ -369,10 +408,7 @@ int eap_peer_tls_register(void)
 	eap->init_for_reauth = eap_tls_init_for_reauth;
 	eap->get_emsk = eap_tls_get_emsk;
 
-	ret = eap_peer_method_register(eap);
-	if (ret)
-		eap_peer_method_free(eap);
-	return ret;
+	return eap_peer_method_register(eap);
 }
 
 
@@ -380,7 +416,6 @@ int eap_peer_tls_register(void)
 int eap_peer_unauth_tls_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_peer_method_alloc(EAP_PEER_METHOD_INTERFACE_VERSION,
 				    EAP_VENDOR_UNAUTH_TLS,
@@ -399,10 +434,7 @@ int eap_peer_unauth_tls_register(void)
 	eap->init_for_reauth = eap_tls_init_for_reauth;
 	eap->get_emsk = eap_tls_get_emsk;
 
-	ret = eap_peer_method_register(eap);
-	if (ret)
-		eap_peer_method_free(eap);
-	return ret;
+	return eap_peer_method_register(eap);
 }
 #endif /* EAP_UNAUTH_TLS */
 
@@ -411,7 +443,6 @@ int eap_peer_unauth_tls_register(void)
 int eap_peer_wfa_unauth_tls_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_peer_method_alloc(EAP_PEER_METHOD_INTERFACE_VERSION,
 				    EAP_VENDOR_WFA_NEW,
@@ -431,9 +462,6 @@ int eap_peer_wfa_unauth_tls_register(void)
 	eap->init_for_reauth = eap_tls_init_for_reauth;
 	eap->get_emsk = eap_tls_get_emsk;
 
-	ret = eap_peer_method_register(eap);
-	if (ret)
-		eap_peer_method_free(eap);
-	return ret;
+	return eap_peer_method_register(eap);
 }
 #endif /* CONFIG_HS20 */
diff --git a/src/eap_peer/eap_tls_common.c b/src/eap_peer/eap_tls_common.c
index af2b7541d7016..0dcb9c138f81d 100644
--- a/src/eap_peer/eap_tls_common.c
+++ b/src/eap_peer/eap_tls_common.c
@@ -80,6 +80,10 @@ static void eap_tls_params_flags(struct tls_connection_params *params,
 		params->flags |= TLS_CONN_DISABLE_TLSv1_2;
 	if (os_strstr(txt, "tls_disable_tlsv1_2=0"))
 		params->flags &= ~TLS_CONN_DISABLE_TLSv1_2;
+	if (os_strstr(txt, "tls_ext_cert_check=1"))
+		params->flags |= TLS_CONN_EXT_CERT_CHECK;
+	if (os_strstr(txt, "tls_ext_cert_check=0"))
+		params->flags &= ~TLS_CONN_EXT_CERT_CHECK;
 }
 
 
@@ -177,6 +181,8 @@ static int eap_tls_params_from_conf(struct eap_sm *sm,
 
 	params->openssl_ciphers = config->openssl_ciphers;
 
+	sm->ext_cert_check = !!(params->flags & TLS_CONN_EXT_CERT_CHECK);
+
 	return 0;
 }
 
@@ -190,8 +196,10 @@ static int eap_tls_init_connection(struct eap_sm *sm,
 
 	if (config->ocsp)
 		params->flags |= TLS_CONN_REQUEST_OCSP;
-	if (config->ocsp == 2)
+	if (config->ocsp >= 2)
 		params->flags |= TLS_CONN_REQUIRE_OCSP;
+	if (config->ocsp == 3)
+		params->flags |= TLS_CONN_REQUIRE_OCSP_ALL;
 	data->conn = tls_connection_init(data->ssl_ctx);
 	if (data->conn == NULL) {
 		wpa_printf(MSG_INFO, "SSL: Failed to initialize new TLS "
@@ -320,8 +328,8 @@ u8 * eap_peer_tls_derive_key(struct eap_sm *sm, struct eap_ssl_data *data,
 	if (out == NULL)
 		return NULL;
 
-	if (tls_connection_prf(data->ssl_ctx, data->conn, label, 0, 0,
-			       out, len)) {
+	if (tls_connection_export_key(data->ssl_ctx, data->conn, label, out,
+				      len)) {
 		os_free(out);
 		return NULL;
 	}
@@ -350,10 +358,8 @@ u8 * eap_peer_tls_derive_session_id(struct eap_sm *sm,
 	struct tls_random keys;
 	u8 *out;
 
-	if (tls_connection_get_random(sm->ssl_ctx, data->conn, &keys))
-		return NULL;
-
-	if (keys.client_random == NULL || keys.server_random == NULL)
+	if (tls_connection_get_random(sm->ssl_ctx, data->conn, &keys) ||
+	    keys.client_random == NULL || keys.server_random == NULL)
 		return NULL;
 
 	*len = 1 + keys.client_random_len + keys.server_random_len;
@@ -1035,6 +1041,9 @@ int eap_peer_select_phase2_methods(struct eap_peer_config *config,
 		if (vendor == EAP_VENDOR_IETF && method == EAP_TYPE_NONE) {
 			wpa_printf(MSG_ERROR, "TLS: Unsupported Phase2 EAP "
 				   "method '%s'", start);
+			os_free(methods);
+			os_free(buf);
+			return -1;
 		} else {
 			num_methods++;
 			_methods = os_realloc_array(methods, num_methods,
diff --git a/src/eap_peer/eap_tnc.c b/src/eap_peer/eap_tnc.c
index 25b9f124801a1..726221e6b69ca 100644
--- a/src/eap_peer/eap_tnc.c
+++ b/src/eap_peer/eap_tnc.c
@@ -10,6 +10,7 @@
 
 #include "common.h"
 #include "eap_i.h"
+#include "eap_config.h"
 #include "tncc.h"
 
 
@@ -35,12 +36,16 @@ struct eap_tnc_data {
 static void * eap_tnc_init(struct eap_sm *sm)
 {
 	struct eap_tnc_data *data;
+	struct eap_peer_config *config = eap_get_config(sm);
 
 	data = os_zalloc(sizeof(*data));
 	if (data == NULL)
 		return NULL;
 	data->state = WAIT_START;
-	data->fragment_size = 1300;
+	if (config && config->fragment_size)
+		data->fragment_size = config->fragment_size;
+	else
+		data->fragment_size = 1300;
 	data->tncc = tncc_init();
 	if (data->tncc == NULL) {
 		os_free(data);
@@ -345,11 +350,6 @@ static struct wpabuf * eap_tnc_process(struct eap_sm *sm, void *priv,
 	ret->decision = DECISION_UNCOND_SUCC;
 	ret->allowNotifications = TRUE;
 
-	if (data->out_buf) {
-		data->state = PROC_MSG;
-		return eap_tnc_build_msg(data, ret, id);
-	}
-
 	if (tncs_done) {
 		resp = eap_msg_alloc(EAP_VENDOR_IETF, EAP_TYPE_TNC, 1,
 				     EAP_CODE_RESPONSE, eap_get_id(reqData));
@@ -410,7 +410,6 @@ fail:
 int eap_peer_tnc_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_peer_method_alloc(EAP_PEER_METHOD_INTERFACE_VERSION,
 				    EAP_VENDOR_IETF, EAP_TYPE_TNC, "TNC");
@@ -421,8 +420,5 @@ int eap_peer_tnc_register(void)
 	eap->deinit = eap_tnc_deinit;
 	eap->process = eap_tnc_process;
 
-	ret = eap_peer_method_register(eap);
-	if (ret)
-		eap_peer_method_free(eap);
-	return ret;
+	return eap_peer_method_register(eap);
 }
diff --git a/src/eap_peer/eap_ttls.c b/src/eap_peer/eap_ttls.c
index b186c9156a741..92f94dcd60190 100644
--- a/src/eap_peer/eap_ttls.c
+++ b/src/eap_peer/eap_ttls.c
@@ -1,6 +1,6 @@
 /*
  * EAP peer method: EAP-TTLS (RFC 5281)
- * Copyright (c) 2004-2011, Jouni Malinen <j@w1.fi>
+ * Copyright (c) 2004-2015, Jouni Malinen <j@w1.fi>
  *
  * This software may be distributed under the terms of the BSD license.
  * See README for more details.
@@ -35,6 +35,7 @@ struct eap_ttls_data {
 	void *phase2_priv;
 	int phase2_success;
 	int phase2_start;
+	EapDecision decision_succ;
 
 	enum phase2_types {
 		EAP_TTLS_PHASE2_EAP,
@@ -58,6 +59,7 @@ struct eap_ttls_data {
 	size_t id_len;
 
 	struct wpabuf *pending_phase2_req;
+	struct wpabuf *pending_resp;
 
 #ifdef EAP_TNC
 	int ready_for_tnc;
@@ -70,6 +72,7 @@ static void * eap_ttls_init(struct eap_sm *sm)
 {
 	struct eap_ttls_data *data;
 	struct eap_peer_config *config = eap_get_config(sm);
+	int selected_non_eap;
 	char *selected;
 
 	data = os_zalloc(sizeof(*data));
@@ -77,26 +80,67 @@ static void * eap_ttls_init(struct eap_sm *sm)
 		return NULL;
 	data->ttls_version = EAP_TTLS_VERSION;
 	selected = "EAP";
+	selected_non_eap = 0;
 	data->phase2_type = EAP_TTLS_PHASE2_EAP;
 
+	/*
+	 * Either one auth= type or one or more autheap= methods can be
+	 * specified.
+	 */
 	if (config && config->phase2) {
+		const char *token, *last = NULL;
+
+		while ((token = cstr_token(config->phase2, " \t", &last))) {
+			if (os_strncmp(token, "auth=", 5) != 0)
+				continue;
+			token += 5;
+
+			if (last - token == 8 &&
+			    os_strncmp(token, "MSCHAPV2", 8) == 0) {
+				selected = "MSCHAPV2";
+				data->phase2_type = EAP_TTLS_PHASE2_MSCHAPV2;
+			} else if (last - token == 6 &&
+				   os_strncmp(token, "MSCHAP", 6) == 0) {
+				selected = "MSCHAP";
+				data->phase2_type = EAP_TTLS_PHASE2_MSCHAP;
+			} else if (last - token == 3 &&
+				   os_strncmp(token, "PAP", 3) == 0) {
+				selected = "PAP";
+				data->phase2_type = EAP_TTLS_PHASE2_PAP;
+			} else if (last - token == 4 &&
+				   os_strncmp(token, "CHAP", 4) == 0) {
+				selected = "CHAP";
+				data->phase2_type = EAP_TTLS_PHASE2_CHAP;
+			} else {
+				wpa_printf(MSG_ERROR,
+					   "EAP-TTLS: Unsupported Phase2 type '%s'",
+					   token);
+				eap_ttls_deinit(sm, data);
+				return NULL;
+			}
+
+			if (selected_non_eap) {
+				wpa_printf(MSG_ERROR,
+					   "EAP-TTLS: Only one Phase2 type can be specified");
+				eap_ttls_deinit(sm, data);
+				return NULL;
+			}
+
+			selected_non_eap = 1;
+		}
+
 		if (os_strstr(config->phase2, "autheap=")) {
+			if (selected_non_eap) {
+				wpa_printf(MSG_ERROR,
+					   "EAP-TTLS: Both auth= and autheap= params cannot be specified");
+				eap_ttls_deinit(sm, data);
+				return NULL;
+			}
 			selected = "EAP";
 			data->phase2_type = EAP_TTLS_PHASE2_EAP;
-		} else if (os_strstr(config->phase2, "auth=MSCHAPV2")) {
-			selected = "MSCHAPV2";
-			data->phase2_type = EAP_TTLS_PHASE2_MSCHAPV2;
-		} else if (os_strstr(config->phase2, "auth=MSCHAP")) {
-			selected = "MSCHAP";
-			data->phase2_type = EAP_TTLS_PHASE2_MSCHAP;
-		} else if (os_strstr(config->phase2, "auth=PAP")) {
-			selected = "PAP";
-			data->phase2_type = EAP_TTLS_PHASE2_PAP;
-		} else if (os_strstr(config->phase2, "auth=CHAP")) {
-			selected = "CHAP";
-			data->phase2_type = EAP_TTLS_PHASE2_CHAP;
 		}
 	}
+
 	wpa_printf(MSG_DEBUG, "EAP-TTLS: Phase2 type: %s", selected);
 
 	if (data->phase2_type == EAP_TTLS_PHASE2_EAP) {
@@ -153,6 +197,7 @@ static void eap_ttls_deinit(struct eap_sm *sm, void *priv)
 	eap_ttls_free_key(data);
 	os_free(data->session_id);
 	wpabuf_free(data->pending_phase2_req);
+	wpabuf_free(data->pending_resp);
 	os_free(data);
 }
 
@@ -1408,6 +1453,32 @@ static int eap_ttls_process_handshake(struct eap_sm *sm,
 {
 	int res;
 
+	if (sm->waiting_ext_cert_check && data->pending_resp) {
+		struct eap_peer_config *config = eap_get_config(sm);
+
+		if (config->pending_ext_cert_check == EXT_CERT_CHECK_GOOD) {
+			wpa_printf(MSG_DEBUG,
+				   "EAP-TTLS: External certificate check succeeded - continue handshake");
+			*out_data = data->pending_resp;
+			data->pending_resp = NULL;
+			sm->waiting_ext_cert_check = 0;
+			return 0;
+		}
+
+		if (config->pending_ext_cert_check == EXT_CERT_CHECK_BAD) {
+			wpa_printf(MSG_DEBUG,
+				   "EAP-TTLS: External certificate check failed - force authentication failure");
+			ret->methodState = METHOD_DONE;
+			ret->decision = DECISION_FAIL;
+			sm->waiting_ext_cert_check = 0;
+			return 0;
+		}
+
+		wpa_printf(MSG_DEBUG,
+			   "EAP-TTLS: Continuing to wait external server certificate validation");
+		return 0;
+	}
+
 	res = eap_peer_tls_process_helper(sm, &data->ssl, EAP_TYPE_TTLS,
 					  data->ttls_version, identifier,
 					  in_data, out_data);
@@ -1418,6 +1489,15 @@ static int eap_ttls_process_handshake(struct eap_sm *sm,
 		return -1;
 	}
 
+	if (sm->waiting_ext_cert_check) {
+		wpa_printf(MSG_DEBUG,
+			   "EAP-TTLS: Waiting external server certificate validation");
+		wpabuf_free(data->pending_resp);
+		data->pending_resp = *out_data;
+		*out_data = NULL;
+		return 0;
+	}
+
 	if (tls_connection_established(sm->ssl_ctx, data->ssl.conn)) {
 		wpa_printf(MSG_DEBUG, "EAP-TTLS: TLS done, proceed to "
 			   "Phase 2");
@@ -1468,6 +1548,7 @@ static void eap_ttls_check_auth_status(struct eap_sm *sm,
 			wpa_printf(MSG_DEBUG, "EAP-TTLS: Authentication "
 				   "completed successfully");
 			data->phase2_success = 1;
+			data->decision_succ = ret->decision;
 #ifdef EAP_TNC
 			if (!data->ready_for_tnc && !data->tnc_started) {
 				/*
@@ -1485,6 +1566,18 @@ static void eap_ttls_check_auth_status(struct eap_sm *sm,
 			wpa_printf(MSG_DEBUG, "EAP-TTLS: Authentication "
 				   "completed successfully (MAY_CONT)");
 			data->phase2_success = 1;
+			data->decision_succ = ret->decision;
+	} else if (data->decision_succ != DECISION_FAIL &&
+		   data->phase2_success &&
+		   !data->ssl.tls_out) {
+		/*
+		 * This is needed to cover the case where the final Phase 2
+		 * message gets fragmented since fragmentation clears
+		 * decision back to FAIL.
+		 */
+		wpa_printf(MSG_DEBUG,
+			   "EAP-TTLS: Restore success decision after fragmented frame sent completely");
+		ret->decision = data->decision_succ;
 	}
 }
 
@@ -1557,6 +1650,9 @@ static void eap_ttls_deinit_for_reauth(struct eap_sm *sm, void *priv)
 	struct eap_ttls_data *data = priv;
 	wpabuf_free(data->pending_phase2_req);
 	data->pending_phase2_req = NULL;
+	wpabuf_free(data->pending_resp);
+	data->pending_resp = NULL;
+	data->decision_succ = DECISION_FAIL;
 #ifdef EAP_TNC
 	data->ready_for_tnc = 0;
 	data->tnc_started = 0;
@@ -1695,7 +1791,6 @@ static u8 * eap_ttls_get_emsk(struct eap_sm *sm, void *priv, size_t *len)
 int eap_peer_ttls_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_peer_method_alloc(EAP_PEER_METHOD_INTERFACE_VERSION,
 				    EAP_VENDOR_IETF, EAP_TYPE_TTLS, "TTLS");
@@ -1714,8 +1809,5 @@ int eap_peer_ttls_register(void)
 	eap->init_for_reauth = eap_ttls_init_for_reauth;
 	eap->get_emsk = eap_ttls_get_emsk;
 
-	ret = eap_peer_method_register(eap);
-	if (ret)
-		eap_peer_method_free(eap);
-	return ret;
+	return eap_peer_method_register(eap);
 }
diff --git a/src/eap_peer/eap_vendor_test.c b/src/eap_peer/eap_vendor_test.c
index b61057ee67555..16e3c39563b72 100644
--- a/src/eap_peer/eap_vendor_test.c
+++ b/src/eap_peer/eap_vendor_test.c
@@ -169,7 +169,6 @@ static u8 * eap_vendor_test_getKey(struct eap_sm *sm, void *priv, size_t *len)
 int eap_peer_vendor_test_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_peer_method_alloc(EAP_PEER_METHOD_INTERFACE_VERSION,
 				    EAP_VENDOR_ID, EAP_VENDOR_TYPE,
@@ -183,8 +182,5 @@ int eap_peer_vendor_test_register(void)
 	eap->isKeyAvailable = eap_vendor_test_isKeyAvailable;
 	eap->getKey = eap_vendor_test_getKey;
 
-	ret = eap_peer_method_register(eap);
-	if (ret)
-		eap_peer_method_free(eap);
-	return ret;
+	return eap_peer_method_register(eap);
 }
diff --git a/src/eap_peer/eap_wsc.c b/src/eap_peer/eap_wsc.c
index 7ac99c7ce727b..d140c88b8cdd8 100644
--- a/src/eap_peer/eap_wsc.c
+++ b/src/eap_peer/eap_wsc.c
@@ -17,7 +17,7 @@
 
 
 struct eap_wsc_data {
-	enum { WAIT_START, MESG, FRAG_ACK, WAIT_FRAG_ACK, DONE, FAIL } state;
+	enum { WAIT_START, MESG, WAIT_FRAG_ACK, FAIL } state;
 	int registrar;
 	struct wpabuf *in_buf;
 	struct wpabuf *out_buf;
@@ -36,12 +36,8 @@ static const char * eap_wsc_state_txt(int state)
 		return "WAIT_START";
 	case MESG:
 		return "MESG";
-	case FRAG_ACK:
-		return "FRAG_ACK";
 	case WAIT_FRAG_ACK:
 		return "WAIT_FRAG_ACK";
-	case DONE:
-		return "DONE";
 	case FAIL:
 		return "FAIL";
 	default:
@@ -579,7 +575,6 @@ send_msg:
 int eap_peer_wsc_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_peer_method_alloc(EAP_PEER_METHOD_INTERFACE_VERSION,
 				    EAP_VENDOR_WFA, EAP_VENDOR_TYPE_WSC,
@@ -591,8 +586,5 @@ int eap_peer_wsc_register(void)
 	eap->deinit = eap_wsc_deinit;
 	eap->process = eap_wsc_process;
 
-	ret = eap_peer_method_register(eap);
-	if (ret)
-		eap_peer_method_free(eap);
-	return ret;
+	return eap_peer_method_register(eap);
 }
diff --git a/src/eap_peer/ikev2.c b/src/eap_peer/ikev2.c
index 55ab72aee66c7..ca6502ea02e73 100644
--- a/src/eap_peer/ikev2.c
+++ b/src/eap_peer/ikev2.c
@@ -128,7 +128,7 @@ static int ikev2_parse_transform(struct ikev2_proposal_data *prop,
 
 	t = (const struct ikev2_transform *) pos;
 	transform_len = WPA_GET_BE16(t->transform_length);
-	if (transform_len < (int) sizeof(*t) || pos + transform_len > end) {
+	if (transform_len < (int) sizeof(*t) || transform_len > end - pos) {
 		wpa_printf(MSG_INFO, "IKEV2: Invalid transform length %d",
 			   transform_len);
 		return -1;
@@ -248,7 +248,7 @@ static int ikev2_parse_proposal(struct ikev2_proposal_data *prop,
 
 	ppos = (const u8 *) (p + 1);
 	pend = pos + proposal_len;
-	if (ppos + p->spi_size > pend) {
+	if (p->spi_size > pend - ppos) {
 		wpa_printf(MSG_INFO, "IKEV2: Not enough room for SPI "
 			   "in proposal");
 		return -1;
diff --git a/src/eap_peer/tncc.c b/src/eap_peer/tncc.c
index 7ca956e5b235d..0c5caa7dd522e 100644
--- a/src/eap_peer/tncc.c
+++ b/src/eap_peer/tncc.c
@@ -104,7 +104,7 @@ static struct tnc_if_imc *tnc_imc[TNC_MAX_IMC_ID] = { NULL };
 
 /* TNCC functions that IMCs can call */
 
-TNC_Result TNC_TNCC_ReportMessageTypes(
+static TNC_Result TNC_TNCC_ReportMessageTypes(
 	TNC_IMCID imcID,
 	TNC_MessageTypeList supportedTypes,
 	TNC_UInt32 typeCount)
@@ -138,7 +138,7 @@ TNC_Result TNC_TNCC_ReportMessageTypes(
 }
 
 
-TNC_Result TNC_TNCC_SendMessage(
+static TNC_Result TNC_TNCC_SendMessage(
 	TNC_IMCID imcID,
 	TNC_ConnectionID connectionID,
 	TNC_BufferReference message,
@@ -183,7 +183,7 @@ TNC_Result TNC_TNCC_SendMessage(
 }
 
 
-TNC_Result TNC_TNCC_RequestHandshakeRetry(
+static TNC_Result TNC_TNCC_RequestHandshakeRetry(
 	TNC_IMCID imcID,
 	TNC_ConnectionID connectionID,
 	TNC_RetryReason reason)
@@ -203,8 +203,8 @@ TNC_Result TNC_TNCC_RequestHandshakeRetry(
 }
 
 
-TNC_Result TNC_9048_LogMessage(TNC_IMCID imcID, TNC_UInt32 severity,
-			       const char *message)
+static TNC_Result TNC_9048_LogMessage(TNC_IMCID imcID, TNC_UInt32 severity,
+				      const char *message)
 {
 	wpa_printf(MSG_DEBUG, "TNC: TNC_9048_LogMessage(imcID=%lu "
 		   "severity==%lu message='%s')",
@@ -213,8 +213,9 @@ TNC_Result TNC_9048_LogMessage(TNC_IMCID imcID, TNC_UInt32 severity,
 }
 
 
-TNC_Result TNC_9048_UserMessage(TNC_IMCID imcID, TNC_ConnectionID connectionID,
-				const char *message)
+static TNC_Result TNC_9048_UserMessage(TNC_IMCID imcID,
+				       TNC_ConnectionID connectionID,
+				       const char *message)
 {
 	wpa_printf(MSG_DEBUG, "TNC: TNC_9048_UserMessage(imcID=%lu "
 		   "connectionID==%lu message='%s')",
@@ -223,7 +224,7 @@ TNC_Result TNC_9048_UserMessage(TNC_IMCID imcID, TNC_ConnectionID connectionID,
 }
 
 
-TNC_Result TNC_TNCC_BindFunction(
+static TNC_Result TNC_TNCC_BindFunction(
 	TNC_IMCID imcID,
 	char *functionName,
 	void **pOutfunctionPointer)
@@ -694,6 +695,8 @@ enum tncc_process_res tncc_process_if_tnccs(struct tncc_data *tncc,
 	enum tncc_process_res res = TNCCS_PROCESS_OK_NO_RECOMMENDATION;
 	int recommendation_msg = 0;
 
+	wpa_hexdump_ascii(MSG_MSGDUMP, "TNC: Received IF-TNCCS message",
+			  msg, len);
 	buf = dup_binstr(msg, len);
 	if (buf == NULL)
 		return TNCCS_PROCESS_ERROR;
diff --git a/src/eap_server/eap_methods.h b/src/eap_server/eap_methods.h
index 0baa3279086e4..3bf1495f76bf0 100644
--- a/src/eap_server/eap_methods.h
+++ b/src/eap_server/eap_methods.h
@@ -15,7 +15,6 @@ const struct eap_method * eap_server_get_eap_method(int vendor,
 						    EapType method);
 struct eap_method * eap_server_method_alloc(int version, int vendor,
 					    EapType method, const char *name);
-void eap_server_method_free(struct eap_method *method);
 int eap_server_method_register(struct eap_method *method);
 
 EapType eap_server_get_type(const char *name, int *vendor);
diff --git a/src/eap_server/eap_server_aka.c b/src/eap_server/eap_server_aka.c
index db9b6aa2db39a..a8bb5eae6b56a 100644
--- a/src/eap_server/eap_server_aka.c
+++ b/src/eap_server/eap_server_aka.c
@@ -1319,7 +1319,6 @@ static u8 * eap_aka_get_session_id(struct eap_sm *sm, void *priv, size_t *len)
 int eap_server_aka_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_server_method_alloc(EAP_SERVER_METHOD_INTERFACE_VERSION,
 				      EAP_VENDOR_IETF, EAP_TYPE_AKA, "AKA");
@@ -1337,10 +1336,7 @@ int eap_server_aka_register(void)
 	eap->get_emsk = eap_aka_get_emsk;
 	eap->getSessionId = eap_aka_get_session_id;
 
-	ret = eap_server_method_register(eap);
-	if (ret)
-		eap_server_method_free(eap);
-	return ret;
+	return eap_server_method_register(eap);
 }
 
 
@@ -1348,7 +1344,6 @@ int eap_server_aka_register(void)
 int eap_server_aka_prime_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_server_method_alloc(EAP_SERVER_METHOD_INTERFACE_VERSION,
 				      EAP_VENDOR_IETF, EAP_TYPE_AKA_PRIME,
@@ -1367,10 +1362,6 @@ int eap_server_aka_prime_register(void)
 	eap->get_emsk = eap_aka_get_emsk;
 	eap->getSessionId = eap_aka_get_session_id;
 
-	ret = eap_server_method_register(eap);
-	if (ret)
-		eap_server_method_free(eap);
-
-	return ret;
+	return eap_server_method_register(eap);
 }
 #endif /* EAP_SERVER_AKA_PRIME */
diff --git a/src/eap_server/eap_server_eke.c b/src/eap_server/eap_server_eke.c
index ba82be9c3f3ad..1eba8f515648a 100644
--- a/src/eap_server/eap_server_eke.c
+++ b/src/eap_server/eap_server_eke.c
@@ -792,7 +792,6 @@ static u8 * eap_eke_get_session_id(struct eap_sm *sm, void *priv, size_t *len)
 int eap_server_eke_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_server_method_alloc(EAP_SERVER_METHOD_INTERFACE_VERSION,
 				      EAP_VENDOR_IETF, EAP_TYPE_EKE, "EKE");
@@ -810,8 +809,5 @@ int eap_server_eke_register(void)
 	eap->get_emsk = eap_eke_get_emsk;
 	eap->getSessionId = eap_eke_get_session_id;
 
-	ret = eap_server_method_register(eap);
-	if (ret)
-		eap_server_method_free(eap);
-	return ret;
+	return eap_server_method_register(eap);
 }
diff --git a/src/eap_server/eap_server_fast.c b/src/eap_server/eap_server_fast.c
index bd9018e78b56b..20491726880e9 100644
--- a/src/eap_server/eap_server_fast.c
+++ b/src/eap_server/eap_server_fast.c
@@ -180,42 +180,47 @@ static int eap_fast_session_ticket_cb(void *ctx, const u8 *ticket, size_t len,
 			buf, end - buf);
 
 	pos = buf;
-	while (pos + 1 < end) {
-		if (pos + 2 + pos[1] > end)
+	while (end - pos > 1) {
+		u8 id, elen;
+
+		id = *pos++;
+		elen = *pos++;
+		if (elen > end - pos)
 			break;
 
-		switch (*pos) {
+		switch (id) {
 		case PAC_OPAQUE_TYPE_PAD:
 			goto done;
 		case PAC_OPAQUE_TYPE_KEY:
-			if (pos[1] != EAP_FAST_PAC_KEY_LEN) {
-				wpa_printf(MSG_DEBUG, "EAP-FAST: Invalid "
-					   "PAC-Key length %d", pos[1]);
+			if (elen != EAP_FAST_PAC_KEY_LEN) {
+				wpa_printf(MSG_DEBUG,
+					   "EAP-FAST: Invalid PAC-Key length %d",
+					   elen);
 				os_free(buf);
 				return -1;
 			}
-			pac_key = pos + 2;
+			pac_key = pos;
 			wpa_hexdump_key(MSG_DEBUG, "EAP-FAST: PAC-Key from "
 					"decrypted PAC-Opaque",
 					pac_key, EAP_FAST_PAC_KEY_LEN);
 			break;
 		case PAC_OPAQUE_TYPE_LIFETIME:
-			if (pos[1] != 4) {
+			if (elen != 4) {
 				wpa_printf(MSG_DEBUG, "EAP-FAST: Invalid "
 					   "PAC-Key lifetime length %d",
-					   pos[1]);
+					   elen);
 				os_free(buf);
 				return -1;
 			}
-			lifetime = WPA_GET_BE32(pos + 2);
+			lifetime = WPA_GET_BE32(pos);
 			break;
 		case PAC_OPAQUE_TYPE_IDENTITY:
-			identity = pos + 2;
-			identity_len = pos[1];
+			identity = pos;
+			identity_len = elen;
 			break;
 		}
 
-		pos += 2 + pos[1];
+		pos += elen;
 	}
 done:
 
@@ -273,7 +278,7 @@ static void eap_fast_derive_key_auth(struct eap_sm *sm,
 	 * Extra key material after TLS key_block: session_key_seed[40]
 	 */
 
-	sks = eap_fast_derive_key(sm->ssl_ctx, data->ssl.conn, "key expansion",
+	sks = eap_fast_derive_key(sm->ssl_ctx, data->ssl.conn,
 				  EAP_FAST_SKS_LEN);
 	if (sks == NULL) {
 		wpa_printf(MSG_DEBUG, "EAP-FAST: Failed to derive "
@@ -300,7 +305,6 @@ static void eap_fast_derive_key_provisioning(struct eap_sm *sm,
 	os_free(data->key_block_p);
 	data->key_block_p = (struct eap_fast_key_block_provisioning *)
 		eap_fast_derive_key(sm->ssl_ctx, data->ssl.conn,
-				    "key expansion",
 				    sizeof(*data->key_block_p));
 	if (data->key_block_p == NULL) {
 		wpa_printf(MSG_DEBUG, "EAP-FAST: Failed to derive key block");
@@ -407,11 +411,13 @@ static int eap_fast_update_icmk(struct eap_sm *sm, struct eap_fast_data *data)
 static void * eap_fast_init(struct eap_sm *sm)
 {
 	struct eap_fast_data *data;
-	u8 ciphers[5] = {
+	u8 ciphers[7] = {
 		TLS_CIPHER_ANON_DH_AES128_SHA,
 		TLS_CIPHER_AES128_SHA,
 		TLS_CIPHER_RSA_DHE_AES128_SHA,
 		TLS_CIPHER_RC4_SHA,
+		TLS_CIPHER_RSA_DHE_AES256_SHA,
+		TLS_CIPHER_AES256_SHA,
 		TLS_CIPHER_NONE
 	};
 
@@ -1134,7 +1140,7 @@ static int eap_fast_parse_tlvs(struct wpabuf *data,
 
 	pos = wpabuf_mhead(data);
 	end = pos + wpabuf_len(data);
-	while (pos + 4 < end) {
+	while (end - pos > 4) {
 		mandatory = pos[0] & 0x80;
 		tlv_type = WPA_GET_BE16(pos) & 0x3fff;
 		pos += 2;
@@ -1559,7 +1565,10 @@ static u8 * eap_fast_getKey(struct eap_sm *sm, void *priv, size_t *len)
 	if (eapKeyData == NULL)
 		return NULL;
 
-	eap_fast_derive_eap_msk(data->simck, eapKeyData);
+	if (eap_fast_derive_eap_msk(data->simck, eapKeyData) < 0) {
+		os_free(eapKeyData);
+		return NULL;
+	}
 	*len = EAP_FAST_KEY_LEN;
 
 	return eapKeyData;
@@ -1578,7 +1587,10 @@ static u8 * eap_fast_get_emsk(struct eap_sm *sm, void *priv, size_t *len)
 	if (eapKeyData == NULL)
 		return NULL;
 
-	eap_fast_derive_eap_emsk(data->simck, eapKeyData);
+	if (eap_fast_derive_eap_emsk(data->simck, eapKeyData) < 0) {
+		os_free(eapKeyData);
+		return NULL;
+	}
 	*len = EAP_EMSK_LEN;
 
 	return eapKeyData;
@@ -1607,7 +1619,6 @@ static u8 * eap_fast_get_session_id(struct eap_sm *sm, void *priv, size_t *len)
 int eap_server_fast_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_server_method_alloc(EAP_SERVER_METHOD_INTERFACE_VERSION,
 				      EAP_VENDOR_IETF, EAP_TYPE_FAST, "FAST");
@@ -1625,8 +1636,5 @@ int eap_server_fast_register(void)
 	eap->isSuccess = eap_fast_isSuccess;
 	eap->getSessionId = eap_fast_get_session_id;
 
-	ret = eap_server_method_register(eap);
-	if (ret)
-		eap_server_method_free(eap);
-	return ret;
+	return eap_server_method_register(eap);
 }
diff --git a/src/eap_server/eap_server_gpsk.c b/src/eap_server/eap_server_gpsk.c
index 50f15c31d0dc0..94e74ec9b2f7d 100644
--- a/src/eap_server/eap_server_gpsk.c
+++ b/src/eap_server/eap_server_gpsk.c
@@ -631,7 +631,6 @@ static u8 * eap_gpsk_get_session_id(struct eap_sm *sm, void *priv, size_t *len)
 int eap_server_gpsk_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_server_method_alloc(EAP_SERVER_METHOD_INTERFACE_VERSION,
 				      EAP_VENDOR_IETF, EAP_TYPE_GPSK, "GPSK");
@@ -649,8 +648,5 @@ int eap_server_gpsk_register(void)
 	eap->get_emsk = eap_gpsk_get_emsk;
 	eap->getSessionId = eap_gpsk_get_session_id;
 
-	ret = eap_server_method_register(eap);
-	if (ret)
-		eap_server_method_free(eap);
-	return ret;
+	return eap_server_method_register(eap);
 }
diff --git a/src/eap_server/eap_server_gtc.c b/src/eap_server/eap_server_gtc.c
index 98ac3c6ec4958..193a8517ac086 100644
--- a/src/eap_server/eap_server_gtc.c
+++ b/src/eap_server/eap_server_gtc.c
@@ -202,7 +202,6 @@ static Boolean eap_gtc_isSuccess(struct eap_sm *sm, void *priv)
 int eap_server_gtc_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_server_method_alloc(EAP_SERVER_METHOD_INTERFACE_VERSION,
 				      EAP_VENDOR_IETF, EAP_TYPE_GTC, "GTC");
@@ -217,8 +216,5 @@ int eap_server_gtc_register(void)
 	eap->isDone = eap_gtc_isDone;
 	eap->isSuccess = eap_gtc_isSuccess;
 
-	ret = eap_server_method_register(eap);
-	if (ret)
-		eap_server_method_free(eap);
-	return ret;
+	return eap_server_method_register(eap);
 }
diff --git a/src/eap_server/eap_server_identity.c b/src/eap_server/eap_server_identity.c
index 45015336b9079..1b1db53f25b20 100644
--- a/src/eap_server/eap_server_identity.c
+++ b/src/eap_server/eap_server_identity.c
@@ -157,7 +157,6 @@ static Boolean eap_identity_isSuccess(struct eap_sm *sm, void *priv)
 int eap_server_identity_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_server_method_alloc(EAP_SERVER_METHOD_INTERFACE_VERSION,
 				      EAP_VENDOR_IETF, EAP_TYPE_IDENTITY,
@@ -174,8 +173,5 @@ int eap_server_identity_register(void)
 	eap->isDone = eap_identity_isDone;
 	eap->isSuccess = eap_identity_isSuccess;
 
-	ret = eap_server_method_register(eap);
-	if (ret)
-		eap_server_method_free(eap);
-	return ret;
+	return eap_server_method_register(eap);
 }
diff --git a/src/eap_server/eap_server_ikev2.c b/src/eap_server/eap_server_ikev2.c
index 16e62764cc55a..3a249d141e0cf 100644
--- a/src/eap_server/eap_server_ikev2.c
+++ b/src/eap_server/eap_server_ikev2.c
@@ -550,7 +550,6 @@ static u8 * eap_ikev2_get_session_id(struct eap_sm *sm, void *priv, size_t *len)
 int eap_server_ikev2_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_server_method_alloc(EAP_SERVER_METHOD_INTERFACE_VERSION,
 				      EAP_VENDOR_IETF, EAP_TYPE_IKEV2,
@@ -569,8 +568,5 @@ int eap_server_ikev2_register(void)
 	eap->get_emsk = eap_ikev2_get_emsk;
 	eap->getSessionId = eap_ikev2_get_session_id;
 
-	ret = eap_server_method_register(eap);
-	if (ret)
-		eap_server_method_free(eap);
-	return ret;
+	return eap_server_method_register(eap);
 }
diff --git a/src/eap_server/eap_server_md5.c b/src/eap_server/eap_server_md5.c
index 71e8d59e03960..cf5ceb1d15298 100644
--- a/src/eap_server/eap_server_md5.c
+++ b/src/eap_server/eap_server_md5.c
@@ -153,7 +153,6 @@ static Boolean eap_md5_isSuccess(struct eap_sm *sm, void *priv)
 int eap_server_md5_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_server_method_alloc(EAP_SERVER_METHOD_INTERFACE_VERSION,
 				      EAP_VENDOR_IETF, EAP_TYPE_MD5, "MD5");
@@ -168,8 +167,5 @@ int eap_server_md5_register(void)
 	eap->isDone = eap_md5_isDone;
 	eap->isSuccess = eap_md5_isSuccess;
 
-	ret = eap_server_method_register(eap);
-	if (ret)
-		eap_server_method_free(eap);
-	return ret;
+	return eap_server_method_register(eap);
 }
diff --git a/src/eap_server/eap_server_methods.c b/src/eap_server/eap_server_methods.c
index 9e9dc934eb776..79ed3447ac0a2 100644
--- a/src/eap_server/eap_server_methods.c
+++ b/src/eap_server/eap_server_methods.c
@@ -87,7 +87,7 @@ struct eap_method * eap_server_method_alloc(int version, int vendor,
  * eap_server_method_free - Free EAP server method structure
  * @method: Method structure allocated with eap_server_method_alloc()
  */
-void eap_server_method_free(struct eap_method *method)
+static void eap_server_method_free(struct eap_method *method)
 {
 	os_free(method);
 }
@@ -95,26 +95,31 @@ void eap_server_method_free(struct eap_method *method)
 
 /**
  * eap_server_method_register - Register an EAP server method
- * @method: EAP method to register
+ * @method: EAP method to register from eap_server_method_alloc()
  * Returns: 0 on success, -1 on invalid method, or -2 if a matching EAP method
  * has already been registered
  *
  * Each EAP server method needs to call this function to register itself as a
- * supported EAP method.
+ * supported EAP method. The caller must not free the allocated method data
+ * regardless of the return value.
  */
 int eap_server_method_register(struct eap_method *method)
 {
 	struct eap_method *m, *last = NULL;
 
 	if (method == NULL || method->name == NULL ||
-	    method->version != EAP_SERVER_METHOD_INTERFACE_VERSION)
+	    method->version != EAP_SERVER_METHOD_INTERFACE_VERSION) {
+		eap_server_method_free(method);
 		return -1;
+	}
 
 	for (m = eap_methods; m; m = m->next) {
 		if ((m->vendor == method->vendor &&
 		     m->method == method->method) ||
-		    os_strcmp(m->name, method->name) == 0)
+		    os_strcmp(m->name, method->name) == 0) {
+			eap_server_method_free(method);
 			return -2;
+		}
 		last = m;
 	}
 
diff --git a/src/eap_server/eap_server_mschapv2.c b/src/eap_server/eap_server_mschapv2.c
index 98d74e0d717e2..460cd9c82ff56 100644
--- a/src/eap_server/eap_server_mschapv2.c
+++ b/src/eap_server/eap_server_mschapv2.c
@@ -571,7 +571,6 @@ static Boolean eap_mschapv2_isSuccess(struct eap_sm *sm, void *priv)
 int eap_server_mschapv2_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_server_method_alloc(EAP_SERVER_METHOD_INTERFACE_VERSION,
 				      EAP_VENDOR_IETF, EAP_TYPE_MSCHAPV2,
@@ -588,8 +587,5 @@ int eap_server_mschapv2_register(void)
 	eap->getKey = eap_mschapv2_getKey;
 	eap->isSuccess = eap_mschapv2_isSuccess;
 
-	ret = eap_server_method_register(eap);
-	if (ret)
-		eap_server_method_free(eap);
-	return ret;
+	return eap_server_method_register(eap);
 }
diff --git a/src/eap_server/eap_server_pax.c b/src/eap_server/eap_server_pax.c
index 0e6b4a0698edc..782b8c316537e 100644
--- a/src/eap_server/eap_server_pax.c
+++ b/src/eap_server/eap_server_pax.c
@@ -565,7 +565,6 @@ static u8 * eap_pax_get_session_id(struct eap_sm *sm, void *priv, size_t *len)
 int eap_server_pax_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_server_method_alloc(EAP_SERVER_METHOD_INTERFACE_VERSION,
 				      EAP_VENDOR_IETF, EAP_TYPE_PAX, "PAX");
@@ -583,8 +582,5 @@ int eap_server_pax_register(void)
 	eap->get_emsk = eap_pax_get_emsk;
 	eap->getSessionId = eap_pax_get_session_id;
 
-	ret = eap_server_method_register(eap);
-	if (ret)
-		eap_server_method_free(eap);
-	return ret;
+	return eap_server_method_register(eap);
 }
diff --git a/src/eap_server/eap_server_peap.c b/src/eap_server/eap_server_peap.c
index 51062b0987e45..18d31b527fdd7 100644
--- a/src/eap_server/eap_server_peap.c
+++ b/src/eap_server/eap_server_peap.c
@@ -335,6 +335,18 @@ static int eap_peap_derive_cmk(struct eap_sm *sm, struct eap_peap_data *data)
 		return -1;
 	wpa_hexdump_key(MSG_DEBUG, "EAP-PEAP: TK", tk, 60);
 
+	if (tls_connection_resumed(sm->ssl_ctx, data->ssl.conn)) {
+		/* Fast-connect: IPMK|CMK = TK */
+		os_memcpy(data->ipmk, tk, 40);
+		wpa_hexdump_key(MSG_DEBUG, "EAP-PEAP: IPMK from TK",
+				data->ipmk, 40);
+		os_memcpy(data->cmk, tk + 40, 20);
+		wpa_hexdump_key(MSG_DEBUG, "EAP-PEAP: CMK from TK",
+				data->cmk, 20);
+		os_free(tk);
+		return 0;
+	}
+
 	eap_peap_get_isk(data, isk, sizeof(isk));
 	wpa_hexdump_key(MSG_DEBUG, "EAP-PEAP: ISK", isk, sizeof(isk));
 
@@ -357,7 +369,6 @@ static int eap_peap_derive_cmk(struct eap_sm *sm, struct eap_peap_data *data)
 
 	os_free(tk);
 
-	/* TODO: fast-connect: IPMK|CMK = TK */
 	os_memcpy(data->ipmk, imck, 40);
 	wpa_hexdump_key(MSG_DEBUG, "EAP-PEAP: IPMK (S-IPMKj)", data->ipmk, 40);
 	os_memcpy(data->cmk, imck + 40, 20);
@@ -1267,8 +1278,9 @@ static void eap_peap_process(struct eap_sm *sm, void *priv,
 
 	wpa_printf(MSG_DEBUG,
 		   "EAP-PEAP: Resuming previous session - skip Phase2");
-	eap_peap_state(data, SUCCESS_REQ);
-	tls_connection_set_success_data_resumed(data->ssl.conn);
+	eap_peap_req_success(sm, data);
+	if (data->state == SUCCESS_REQ)
+		tls_connection_set_success_data_resumed(data->ssl.conn);
 }
 
 
@@ -1351,7 +1363,6 @@ static u8 * eap_peap_get_session_id(struct eap_sm *sm, void *priv, size_t *len)
 int eap_server_peap_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_server_method_alloc(EAP_SERVER_METHOD_INTERFACE_VERSION,
 				      EAP_VENDOR_IETF, EAP_TYPE_PEAP, "PEAP");
@@ -1368,8 +1379,5 @@ int eap_server_peap_register(void)
 	eap->isSuccess = eap_peap_isSuccess;
 	eap->getSessionId = eap_peap_get_session_id;
 
-	ret = eap_server_method_register(eap);
-	if (ret)
-		eap_server_method_free(eap);
-	return ret;
+	return eap_server_method_register(eap);
 }
diff --git a/src/eap_server/eap_server_psk.c b/src/eap_server/eap_server_psk.c
index 12b5d25d67ffc..857d421393bc8 100644
--- a/src/eap_server/eap_server_psk.c
+++ b/src/eap_server/eap_server_psk.c
@@ -510,7 +510,6 @@ static u8 * eap_psk_get_session_id(struct eap_sm *sm, void *priv, size_t *len)
 int eap_server_psk_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_server_method_alloc(EAP_SERVER_METHOD_INTERFACE_VERSION,
 				      EAP_VENDOR_IETF, EAP_TYPE_PSK, "PSK");
@@ -528,8 +527,5 @@ int eap_server_psk_register(void)
 	eap->get_emsk = eap_psk_get_emsk;
 	eap->getSessionId = eap_psk_get_session_id;
 
-	ret = eap_server_method_register(eap);
-	if (ret)
-		eap_server_method_free(eap);
-	return ret;
+	return eap_server_method_register(eap);
 }
diff --git a/src/eap_server/eap_server_pwd.c b/src/eap_server/eap_server_pwd.c
index cb83ff7305bd0..64bf708e039a4 100644
--- a/src/eap_server/eap_server_pwd.c
+++ b/src/eap_server/eap_server_pwd.c
@@ -178,8 +178,13 @@ static void eap_pwd_build_id_req(struct eap_sm *sm, struct eap_pwd_data *data,
 		return;
 	}
 
-	/* an lfsr is good enough to generate unpredictable tokens */
-	data->token = os_random();
+	if (os_get_random((u8 *) &data->token, sizeof(data->token)) < 0) {
+		wpabuf_free(data->outbuf);
+		data->outbuf = NULL;
+		eap_pwd_state(data, FAILURE);
+		return;
+	}
+
 	wpabuf_put_be16(data->outbuf, data->group_num);
 	wpabuf_put_u8(data->outbuf, EAP_PWD_DEFAULT_RAND_FUNC);
 	wpabuf_put_u8(data->outbuf, EAP_PWD_DEFAULT_PRF);
@@ -970,7 +975,7 @@ static void eap_pwd_process(struct eap_sm *sm, void *priv,
 	/*
 	 * the first and all intermediate fragments have the M bit set
 	 */
-	if (EAP_PWD_GET_MORE_BIT(lm_exch)) {
+	if (EAP_PWD_GET_MORE_BIT(lm_exch) || data->in_frag_pos) {
 		if ((data->in_frag_pos + len) > wpabuf_size(data->inbuf)) {
 			wpa_printf(MSG_DEBUG, "EAP-pwd: Buffer overflow "
 				   "attack detected! (%d+%d > %d)",
@@ -981,6 +986,8 @@ static void eap_pwd_process(struct eap_sm *sm, void *priv,
 		}
 		wpabuf_put_data(data->inbuf, pos, len);
 		data->in_frag_pos += len;
+	}
+	if (EAP_PWD_GET_MORE_BIT(lm_exch)) {
 		wpa_printf(MSG_DEBUG, "EAP-pwd: Got a %d byte fragment",
 			   (int) len);
 		return;
@@ -990,8 +997,6 @@ static void eap_pwd_process(struct eap_sm *sm, void *priv,
 	 * buffering fragments so that's how we know it's the last)
 	 */
 	if (data->in_frag_pos) {
-		wpabuf_put_data(data->inbuf, pos, len);
-		data->in_frag_pos += len;
 		pos = wpabuf_head_u8(data->inbuf);
 		len = data->in_frag_pos;
 		wpa_printf(MSG_DEBUG, "EAP-pwd: Last fragment, %d bytes",
@@ -1094,7 +1099,6 @@ static u8 * eap_pwd_get_session_id(struct eap_sm *sm, void *priv, size_t *len)
 int eap_server_pwd_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 	struct timeval tp;
 	struct timezone tz;
 	u32 sr;
@@ -1121,9 +1125,6 @@ int eap_server_pwd_register(void)
 	eap->isSuccess = eap_pwd_is_success;
 	eap->getSessionId = eap_pwd_get_session_id;
 
-	ret = eap_server_method_register(eap);
-	if (ret)
-		eap_server_method_free(eap);
-	return ret;
+	return eap_server_method_register(eap);
 }
 
diff --git a/src/eap_server/eap_server_sake.c b/src/eap_server/eap_server_sake.c
index de70777318991..84d0e0be4dd12 100644
--- a/src/eap_server/eap_server_sake.c
+++ b/src/eap_server/eap_server_sake.c
@@ -520,7 +520,6 @@ static u8 * eap_sake_get_session_id(struct eap_sm *sm, void *priv, size_t *len)
 int eap_server_sake_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_server_method_alloc(EAP_SERVER_METHOD_INTERFACE_VERSION,
 				      EAP_VENDOR_IETF, EAP_TYPE_SAKE, "SAKE");
@@ -538,8 +537,5 @@ int eap_server_sake_register(void)
 	eap->get_emsk = eap_sake_get_emsk;
 	eap->getSessionId = eap_sake_get_session_id;
 
-	ret = eap_server_method_register(eap);
-	if (ret)
-		eap_server_method_free(eap);
-	return ret;
+	return eap_server_method_register(eap);
 }
diff --git a/src/eap_server/eap_server_sim.c b/src/eap_server/eap_server_sim.c
index ddfb71cf4e2ea..3a6ed795c7680 100644
--- a/src/eap_server/eap_server_sim.c
+++ b/src/eap_server/eap_server_sim.c
@@ -846,7 +846,6 @@ static u8 * eap_sim_get_session_id(struct eap_sm *sm, void *priv, size_t *len)
 int eap_server_sim_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_server_method_alloc(EAP_SERVER_METHOD_INTERFACE_VERSION,
 				      EAP_VENDOR_IETF, EAP_TYPE_SIM, "SIM");
@@ -864,8 +863,5 @@ int eap_server_sim_register(void)
 	eap->get_emsk = eap_sim_get_emsk;
 	eap->getSessionId = eap_sim_get_session_id;
 
-	ret = eap_server_method_register(eap);
-	if (ret)
-		eap_server_method_free(eap);
-	return ret;
+	return eap_server_method_register(eap);
 }
diff --git a/src/eap_server/eap_server_tls.c b/src/eap_server/eap_server_tls.c
index bd18a4ba654ce..7249858844ef2 100644
--- a/src/eap_server/eap_server_tls.c
+++ b/src/eap_server/eap_server_tls.c
@@ -375,7 +375,6 @@ static u8 * eap_tls_get_session_id(struct eap_sm *sm, void *priv, size_t *len)
 int eap_server_tls_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_server_method_alloc(EAP_SERVER_METHOD_INTERFACE_VERSION,
 				      EAP_VENDOR_IETF, EAP_TYPE_TLS, "TLS");
@@ -393,10 +392,7 @@ int eap_server_tls_register(void)
 	eap->get_emsk = eap_tls_get_emsk;
 	eap->getSessionId = eap_tls_get_session_id;
 
-	ret = eap_server_method_register(eap);
-	if (ret)
-		eap_server_method_free(eap);
-	return ret;
+	return eap_server_method_register(eap);
 }
 
 
@@ -404,7 +400,6 @@ int eap_server_tls_register(void)
 int eap_server_unauth_tls_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_server_method_alloc(EAP_SERVER_METHOD_INTERFACE_VERSION,
 				      EAP_VENDOR_UNAUTH_TLS,
@@ -423,10 +418,7 @@ int eap_server_unauth_tls_register(void)
 	eap->isSuccess = eap_tls_isSuccess;
 	eap->get_emsk = eap_tls_get_emsk;
 
-	ret = eap_server_method_register(eap);
-	if (ret)
-		eap_server_method_free(eap);
-	return ret;
+	return eap_server_method_register(eap);
 }
 #endif /* EAP_SERVER_UNAUTH_TLS */
 
@@ -435,7 +427,6 @@ int eap_server_unauth_tls_register(void)
 int eap_server_wfa_unauth_tls_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_server_method_alloc(EAP_SERVER_METHOD_INTERFACE_VERSION,
 				      EAP_VENDOR_WFA_NEW,
@@ -454,9 +445,6 @@ int eap_server_wfa_unauth_tls_register(void)
 	eap->isSuccess = eap_tls_isSuccess;
 	eap->get_emsk = eap_tls_get_emsk;
 
-	ret = eap_server_method_register(eap);
-	if (ret)
-		eap_server_method_free(eap);
-	return ret;
+	return eap_server_method_register(eap);
 }
 #endif /* CONFIG_HS20 */
diff --git a/src/eap_server/eap_server_tls_common.c b/src/eap_server/eap_server_tls_common.c
index 05677b70e8873..69096954b8262 100644
--- a/src/eap_server/eap_server_tls_common.c
+++ b/src/eap_server/eap_server_tls_common.c
@@ -115,8 +115,8 @@ u8 * eap_server_tls_derive_key(struct eap_sm *sm, struct eap_ssl_data *data,
 	if (out == NULL)
 		return NULL;
 
-	if (tls_connection_prf(sm->ssl_ctx, data->conn, label, 0, 0,
-			       out, len)) {
+	if (tls_connection_export_key(sm->ssl_ctx, data->conn, label, out,
+				      len)) {
 		os_free(out);
 		return NULL;
 	}
diff --git a/src/eap_server/eap_server_tnc.c b/src/eap_server/eap_server_tnc.c
index 21bd26f8296ef..b568558fd42e1 100644
--- a/src/eap_server/eap_server_tnc.c
+++ b/src/eap_server/eap_server_tnc.c
@@ -554,7 +554,6 @@ static Boolean eap_tnc_isSuccess(struct eap_sm *sm, void *priv)
 int eap_server_tnc_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_server_method_alloc(EAP_SERVER_METHOD_INTERFACE_VERSION,
 				      EAP_VENDOR_IETF, EAP_TYPE_TNC, "TNC");
@@ -569,8 +568,5 @@ int eap_server_tnc_register(void)
 	eap->isDone = eap_tnc_isDone;
 	eap->isSuccess = eap_tnc_isSuccess;
 
-	ret = eap_server_method_register(eap);
-	if (ret)
-		eap_server_method_free(eap);
-	return ret;
+	return eap_server_method_register(eap);
 }
diff --git a/src/eap_server/eap_server_ttls.c b/src/eap_server/eap_server_ttls.c
index 53ffa1ec6785a..a53633f8f1fe0 100644
--- a/src/eap_server/eap_server_ttls.c
+++ b/src/eap_server/eap_server_ttls.c
@@ -1335,7 +1335,6 @@ static u8 * eap_ttls_get_emsk(struct eap_sm *sm, void *priv, size_t *len)
 int eap_server_ttls_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_server_method_alloc(EAP_SERVER_METHOD_INTERFACE_VERSION,
 				      EAP_VENDOR_IETF, EAP_TYPE_TTLS, "TTLS");
@@ -1353,8 +1352,5 @@ int eap_server_ttls_register(void)
 	eap->getSessionId = eap_ttls_get_session_id;
 	eap->get_emsk = eap_ttls_get_emsk;
 
-	ret = eap_server_method_register(eap);
-	if (ret)
-		eap_server_method_free(eap);
-	return ret;
+	return eap_server_method_register(eap);
 }
diff --git a/src/eap_server/eap_server_vendor_test.c b/src/eap_server/eap_server_vendor_test.c
index 30f600d3baf63..96399775945b8 100644
--- a/src/eap_server/eap_server_vendor_test.c
+++ b/src/eap_server/eap_server_vendor_test.c
@@ -168,7 +168,6 @@ static Boolean eap_vendor_test_isSuccess(struct eap_sm *sm, void *priv)
 int eap_server_vendor_test_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_server_method_alloc(EAP_SERVER_METHOD_INTERFACE_VERSION,
 				      EAP_VENDOR_ID, EAP_VENDOR_TYPE,
@@ -185,8 +184,5 @@ int eap_server_vendor_test_register(void)
 	eap->getKey = eap_vendor_test_getKey;
 	eap->isSuccess = eap_vendor_test_isSuccess;
 
-	ret = eap_server_method_register(eap);
-	if (ret)
-		eap_server_method_free(eap);
-	return ret;
+	return eap_server_method_register(eap);
 }
diff --git a/src/eap_server/eap_server_wsc.c b/src/eap_server/eap_server_wsc.c
index 9d9c28d704c10..7d9d285c39d01 100644
--- a/src/eap_server/eap_server_wsc.c
+++ b/src/eap_server/eap_server_wsc.c
@@ -488,7 +488,6 @@ static int eap_wsc_getTimeout(struct eap_sm *sm, void *priv)
 int eap_server_wsc_register(void)
 {
 	struct eap_method *eap;
-	int ret;
 
 	eap = eap_server_method_alloc(EAP_SERVER_METHOD_INTERFACE_VERSION,
 				      EAP_VENDOR_WFA, EAP_VENDOR_TYPE_WSC,
@@ -505,8 +504,5 @@ int eap_server_wsc_register(void)
 	eap->isSuccess = eap_wsc_isSuccess;
 	eap->getTimeout = eap_wsc_getTimeout;
 
-	ret = eap_server_method_register(eap);
-	if (ret)
-		eap_server_method_free(eap);
-	return ret;
+	return eap_server_method_register(eap);
 }
diff --git a/src/eap_server/eap_sim_db.c b/src/eap_server/eap_sim_db.c
index acf5435300dc5..d84c3d27de6be 100644
--- a/src/eap_server/eap_sim_db.c
+++ b/src/eap_server/eap_sim_db.c
@@ -66,6 +66,7 @@ struct eap_sim_db_data {
 	struct eap_sim_pseudonym *pseudonyms;
 	struct eap_sim_reauth *reauths;
 	struct eap_sim_db_pending *pending;
+	unsigned int eap_sim_db_timeout;
 #ifdef CONFIG_SQLITE
 	sqlite3 *sqlite_db;
 	char db_tmp_identity[100];
@@ -76,6 +77,10 @@ struct eap_sim_db_data {
 };
 
 
+static void eap_sim_db_del_timeout(void *eloop_ctx, void *user_ctx);
+static void eap_sim_db_query_timeout(void *eloop_ctx, void *user_ctx);
+
+
 #ifdef CONFIG_SQLITE
 
 static int db_table_exists(sqlite3 *db, const char *name)
@@ -397,6 +402,57 @@ static void eap_sim_db_add_pending(struct eap_sim_db_data *data,
 }
 
 
+static void eap_sim_db_free_pending(struct eap_sim_db_data *data,
+				    struct eap_sim_db_pending *entry)
+{
+	eloop_cancel_timeout(eap_sim_db_query_timeout, data, entry);
+	eloop_cancel_timeout(eap_sim_db_del_timeout, data, entry);
+	os_free(entry);
+}
+
+
+static void eap_sim_db_del_pending(struct eap_sim_db_data *data,
+				   struct eap_sim_db_pending *entry)
+{
+	struct eap_sim_db_pending **pp = &data->pending;
+
+	while (*pp != NULL) {
+		if (*pp == entry) {
+			*pp = entry->next;
+			eap_sim_db_free_pending(data, entry);
+			return;
+		}
+		pp = &(*pp)->next;
+	}
+}
+
+
+static void eap_sim_db_del_timeout(void *eloop_ctx, void *user_ctx)
+{
+	struct eap_sim_db_data *data = eloop_ctx;
+	struct eap_sim_db_pending *entry = user_ctx;
+
+	wpa_printf(MSG_DEBUG, "EAP-SIM DB: Delete query timeout for %p", entry);
+	eap_sim_db_del_pending(data, entry);
+}
+
+
+static void eap_sim_db_query_timeout(void *eloop_ctx, void *user_ctx)
+{
+	struct eap_sim_db_data *data = eloop_ctx;
+	struct eap_sim_db_pending *entry = user_ctx;
+
+	/*
+	 * Report failure and allow some time for EAP server to process it
+	 * before deleting the query.
+	 */
+	wpa_printf(MSG_DEBUG, "EAP-SIM DB: Query timeout for %p", entry);
+	entry->state = FAILURE;
+	data->get_complete_cb(data->ctx, entry->cb_session_ctx);
+	eloop_register_timeout(1, 0, eap_sim_db_del_timeout, data, entry);
+}
+
+
 static void eap_sim_db_sim_resp_auth(struct eap_sim_db_data *data,
 				     const char *imsi, char *buf)
 {
@@ -472,7 +528,7 @@ static void eap_sim_db_sim_resp_auth(struct eap_sim_db_data *data,
 
 parse_fail:
 	wpa_printf(MSG_DEBUG, "EAP-SIM DB: Failed to parse response string");
-	os_free(entry);
+	eap_sim_db_free_pending(data, entry);
 }
 
 
@@ -563,7 +619,7 @@ static void eap_sim_db_aka_resp_auth(struct eap_sim_db_data *data,
 
 parse_fail:
 	wpa_printf(MSG_DEBUG, "EAP-SIM DB: Failed to parse response string");
-	os_free(entry);
+	eap_sim_db_free_pending(data, entry);
 }
 
 
@@ -690,12 +746,13 @@ static void eap_sim_db_close_socket(struct eap_sim_db_data *data)
 /**
  * eap_sim_db_init - Initialize EAP-SIM DB / authentication gateway interface
  * @config: Configuration data (e.g., file name)
+ * @db_timeout: Database lookup timeout
  * @get_complete_cb: Callback function for reporting availability of triplets
  * @ctx: Context pointer for get_complete_cb
  * Returns: Pointer to a private data structure or %NULL on failure
  */
 struct eap_sim_db_data *
-eap_sim_db_init(const char *config,
+eap_sim_db_init(const char *config, unsigned int db_timeout,
 		void (*get_complete_cb)(void *ctx, void *session_ctx),
 		void *ctx)
 {
@@ -709,6 +766,7 @@ eap_sim_db_init(const char *config,
 	data->sock = -1;
 	data->get_complete_cb = get_complete_cb;
 	data->ctx = ctx;
+	data->eap_sim_db_timeout = db_timeout;
 	data->fname = os_strdup(config);
 	if (data->fname == NULL)
 		goto fail;
@@ -796,7 +854,7 @@ void eap_sim_db_deinit(void *priv)
 	while (pending) {
 		prev_pending = pending;
 		pending = pending->next;
-		os_free(prev_pending);
+		eap_sim_db_free_pending(data, prev_pending);
 	}
 
 	os_free(data);
@@ -833,11 +891,11 @@ static int eap_sim_db_send(struct eap_sim_db_data *data, const char *msg,
 }
 
 
-static void eap_sim_db_expire_pending(struct eap_sim_db_data *data)
+static void eap_sim_db_expire_pending(struct eap_sim_db_data *data,
+				      struct eap_sim_db_pending *entry)
 {
-	/* TODO: add limit for maximum length for pending list; remove latest
-	 * (i.e., last) entry from the list if the limit is reached; could also
-	 * use timeout to expire pending entries */
+	eloop_register_timeout(data->eap_sim_db_timeout, 0,
+			       eap_sim_db_query_timeout, data, entry);
 }
 
 
@@ -891,7 +949,7 @@ int eap_sim_db_get_gsm_triplets(struct eap_sim_db_data *data,
 		if (entry->state == FAILURE) {
 			wpa_printf(MSG_DEBUG, "EAP-SIM DB: Pending entry -> "
 				   "failure");
-			os_free(entry);
+			eap_sim_db_free_pending(data, entry);
 			return EAP_SIM_DB_FAILURE;
 		}
 
@@ -911,7 +969,7 @@ int eap_sim_db_get_gsm_triplets(struct eap_sim_db_data *data,
 		os_memcpy(sres, entry->u.sim.sres,
 			  num_chal * EAP_SIM_SRES_LEN);
 		os_memcpy(kc, entry->u.sim.kc, num_chal * EAP_SIM_KC_LEN);
-		os_free(entry);
+		eap_sim_db_free_pending(data, entry);
 		return num_chal;
 	}
 
@@ -945,7 +1003,8 @@ int eap_sim_db_get_gsm_triplets(struct eap_sim_db_data *data,
 	entry->cb_session_ctx = cb_session_ctx;
 	entry->state = PENDING;
 	eap_sim_db_add_pending(data, entry);
-	eap_sim_db_expire_pending(data);
+	eap_sim_db_expire_pending(data, entry);
+	wpa_printf(MSG_DEBUG, "EAP-SIM DB: Added query %p", entry);
 
 	return EAP_SIM_DB_PENDING;
 }
@@ -1356,7 +1415,7 @@ int eap_sim_db_get_aka_auth(struct eap_sim_db_data *data, const char *username,
 	entry = eap_sim_db_get_pending(data, imsi, 1);
 	if (entry) {
 		if (entry->state == FAILURE) {
-			os_free(entry);
+			eap_sim_db_free_pending(data, entry);
 			wpa_printf(MSG_DEBUG, "EAP-SIM DB: Failure");
 			return EAP_SIM_DB_FAILURE;
 		}
@@ -1375,7 +1434,7 @@ int eap_sim_db_get_aka_auth(struct eap_sim_db_data *data, const char *username,
 		os_memcpy(ck, entry->u.aka.ck, EAP_AKA_CK_LEN);
 		os_memcpy(res, entry->u.aka.res, EAP_AKA_RES_MAX_LEN);
 		*res_len = entry->u.aka.res_len;
-		os_free(entry);
+		eap_sim_db_free_pending(data, entry);
 		return 0;
 	}
 
@@ -1406,7 +1465,8 @@ int eap_sim_db_get_aka_auth(struct eap_sim_db_data *data, const char *username,
 	entry->cb_session_ctx = cb_session_ctx;
 	entry->state = PENDING;
 	eap_sim_db_add_pending(data, entry);
-	eap_sim_db_expire_pending(data);
+	eap_sim_db_expire_pending(data, entry);
+	wpa_printf(MSG_DEBUG, "EAP-SIM DB: Added query %p", entry);
 
 	return EAP_SIM_DB_PENDING;
 }
diff --git a/src/eap_server/eap_sim_db.h b/src/eap_server/eap_sim_db.h
index 53a1a7c3b4e30..ca900b9158523 100644
--- a/src/eap_server/eap_sim_db.h
+++ b/src/eap_server/eap_sim_db.h
@@ -31,7 +31,7 @@ enum eap_sim_db_method {
 struct eap_sim_db_data;
 
 struct eap_sim_db_data *
-eap_sim_db_init(const char *config,
+eap_sim_db_init(const char *config, unsigned int db_timeout,
 		void (*get_complete_cb)(void *ctx, void *session_ctx),
 		void *ctx);
 
diff --git a/src/eap_server/ikev2.c b/src/eap_server/ikev2.c
index 632598fac72ae..5385cd89246fc 100644
--- a/src/eap_server/ikev2.c
+++ b/src/eap_server/ikev2.c
@@ -133,7 +133,7 @@ static int ikev2_parse_transform(struct ikev2_initiator_data *data,
 
 	t = (const struct ikev2_transform *) pos;
 	transform_len = WPA_GET_BE16(t->transform_length);
-	if (transform_len < (int) sizeof(*t) || pos + transform_len > end) {
+	if (transform_len < (int) sizeof(*t) || transform_len > end - pos) {
 		wpa_printf(MSG_INFO, "IKEV2: Invalid transform length %d",
 			   transform_len);
 		return -1;
@@ -221,7 +221,7 @@ static int ikev2_parse_proposal(struct ikev2_initiator_data *data,
 
 	p = (const struct ikev2_proposal *) pos;
 	proposal_len = WPA_GET_BE16(p->proposal_length);
-	if (proposal_len < (int) sizeof(*p) || pos + proposal_len > end) {
+	if (proposal_len < (int) sizeof(*p) || proposal_len > end - pos) {
 		wpa_printf(MSG_INFO, "IKEV2: Invalid proposal length %d",
 			   proposal_len);
 		return -1;
@@ -256,7 +256,7 @@ static int ikev2_parse_proposal(struct ikev2_initiator_data *data,
 
 	ppos = (const u8 *) (p + 1);
 	pend = pos + proposal_len;
-	if (ppos + p->spi_size > pend) {
+	if (p->spi_size > pend - ppos) {
 		wpa_printf(MSG_INFO, "IKEV2: Not enough room for SPI "
 			   "in proposal");
 		return -1;
diff --git a/src/eap_server/tncs.c b/src/eap_server/tncs.c
index dc6f689c0b5eb..cfcbd3ed828c6 100644
--- a/src/eap_server/tncs.c
+++ b/src/eap_server/tncs.c
@@ -140,7 +140,7 @@ static struct tncs_data * tncs_get_conn(TNC_ConnectionID connectionID)
 
 
 /* TNCS functions that IMVs can call */
-TNC_Result TNC_TNCS_ReportMessageTypes(
+static TNC_Result TNC_TNCS_ReportMessageTypes(
 	TNC_IMVID imvID,
 	TNC_MessageTypeList supportedTypes,
 	TNC_UInt32 typeCount)
@@ -173,7 +173,7 @@ TNC_Result TNC_TNCS_ReportMessageTypes(
 }
 
 
-TNC_Result TNC_TNCS_SendMessage(
+static TNC_Result TNC_TNCS_SendMessage(
 	TNC_IMVID imvID,
 	TNC_ConnectionID connectionID,
 	TNC_BufferReference message,
@@ -222,7 +222,7 @@ TNC_Result TNC_TNCS_SendMessage(
 }
 
 
-TNC_Result TNC_TNCS_RequestHandshakeRetry(
+static TNC_Result TNC_TNCS_RequestHandshakeRetry(
 	TNC_IMVID imvID,
 	TNC_ConnectionID connectionID,
 	TNC_RetryReason reason)
@@ -233,7 +233,7 @@ TNC_Result TNC_TNCS_RequestHandshakeRetry(
 }
 
 
-TNC_Result TNC_TNCS_ProvideRecommendation(
+static TNC_Result TNC_TNCS_ProvideRecommendation(
 	TNC_IMVID imvID,
 	TNC_ConnectionID connectionID,
 	TNC_IMV_Action_Recommendation recommendation,
@@ -260,7 +260,7 @@ TNC_Result TNC_TNCS_ProvideRecommendation(
 }
 
 
-TNC_Result TNC_TNCS_GetAttribute(
+static TNC_Result TNC_TNCS_GetAttribute(
 	TNC_IMVID imvID,
 	TNC_ConnectionID connectionID,
 	TNC_AttributeID attribureID,
@@ -274,7 +274,7 @@ TNC_Result TNC_TNCS_GetAttribute(
 }
 
 
-TNC_Result TNC_TNCS_SetAttribute(
+static TNC_Result TNC_TNCS_SetAttribute(
 	TNC_IMVID imvID,
 	TNC_ConnectionID connectionID,
 	TNC_AttributeID attribureID,
@@ -287,7 +287,7 @@ TNC_Result TNC_TNCS_SetAttribute(
 }
 
 
-TNC_Result TNC_TNCS_BindFunction(
+static TNC_Result TNC_TNCS_BindFunction(
 	TNC_IMVID imvID,
 	char *functionName,
 	void **pOutFunctionPointer)
diff --git a/src/eapol_auth/eapol_auth_sm.c b/src/eapol_auth/eapol_auth_sm.c
index ff33d286223fd..ff673bb2e7858 100644
--- a/src/eapol_auth/eapol_auth_sm.c
+++ b/src/eapol_auth/eapol_auth_sm.c
@@ -866,10 +866,13 @@ eapol_auth_alloc(struct eapol_authenticator *eapol, const u8 *addr,
 		sm->radius_cui = wpabuf_alloc_copy(radius_cui,
 						   os_strlen(radius_cui));
 
-	sm->acct_multi_session_id_lo = eapol->acct_multi_session_id_lo++;
-	if (eapol->acct_multi_session_id_lo == 0)
-		eapol->acct_multi_session_id_hi++;
-	sm->acct_multi_session_id_hi = eapol->acct_multi_session_id_hi;
+#ifndef CONFIG_NO_RADIUS
+	if (radius_gen_session_id((u8 *) &sm->acct_multi_session_id,
+				  sizeof(sm->acct_multi_session_id)) < 0) {
+		eapol_auth_free(sm);
+		return NULL;
+	}
+#endif /* CONFIG_NO_RADIUS */
 
 	return sm;
 }
@@ -884,6 +887,9 @@ void eapol_auth_free(struct eapol_state_machine *sm)
 	eloop_cancel_timeout(eapol_sm_step_cb, sm, NULL);
 	if (sm->eap)
 		eap_server_sm_deinit(sm->eap);
+
+	wpabuf_free(sm->radius_cui);
+	os_free(sm->identity);
 	os_free(sm);
 }
 
@@ -1271,7 +1277,6 @@ struct eapol_authenticator * eapol_auth_init(struct eapol_auth_config *conf,
 					     struct eapol_auth_cb *cb)
 {
 	struct eapol_authenticator *eapol;
-	struct os_time now;
 
 	eapol = os_zalloc(sizeof(*eapol));
 	if (eapol == NULL)
@@ -1300,12 +1305,6 @@ struct eapol_authenticator * eapol_auth_init(struct eapol_auth_config *conf,
 	eapol->cb.erp_get_key = cb->erp_get_key;
 	eapol->cb.erp_add_key = cb->erp_add_key;
 
-	/* Acct-Multi-Session-Id should be unique over reboots. If reliable
-	 * clock is not available, this could be replaced with reboot counter,
-	 * etc. */
-	os_get_time(&now);
-	eapol->acct_multi_session_id_hi = now.sec;
-
 	return eapol;
 }
 
diff --git a/src/eapol_auth/eapol_auth_sm_i.h b/src/eapol_auth/eapol_auth_sm_i.h
index a29b49c90c72f..04386b2ce5514 100644
--- a/src/eapol_auth/eapol_auth_sm_i.h
+++ b/src/eapol_auth/eapol_auth_sm_i.h
@@ -30,9 +30,6 @@ struct eapol_authenticator {
 
 	u8 *default_wep_key;
 	u8 default_wep_key_idx;
-
-	u32 acct_multi_session_id_hi;
-	u32 acct_multi_session_id_lo;
 };
 
 
@@ -162,12 +159,6 @@ struct eapol_state_machine {
 	struct radius_class_data radius_class;
 	struct wpabuf *radius_cui; /* Chargeable-User-Identity */
 
-	/* Keys for encrypting and signing EAPOL-Key frames */
-	u8 *eapol_key_sign;
-	size_t eapol_key_sign_len;
-	u8 *eapol_key_crypt;
-	size_t eapol_key_crypt_len;
-
 	struct eap_sm *eap;
 
 	Boolean initializing; /* in process of initializing state machines */
@@ -179,8 +170,7 @@ struct eapol_state_machine {
 
 	int remediation;
 
-	u32 acct_multi_session_id_hi;
-	u32 acct_multi_session_id_lo;
+	u64 acct_multi_session_id;
 };
 
 #endif /* EAPOL_AUTH_SM_I_H */
diff --git a/src/eapol_supp/eapol_supp_sm.c b/src/eapol_supp/eapol_supp_sm.c
index 09cf4f6b92225..65460fc3bec05 100644
--- a/src/eapol_supp/eapol_supp_sm.c
+++ b/src/eapol_supp/eapol_supp_sm.c
@@ -314,6 +314,16 @@ SM_STATE(SUPP_PAE, RESTART)
 {
 	SM_ENTRY(SUPP_PAE, RESTART);
 	sm->eapRestart = TRUE;
+	if (sm->altAccept) {
+		/*
+		 * Prevent EAP peer state machine from failing due to prior
+		 * external EAP success notification (altSuccess=TRUE in the
+		 * IDLE state could result in a transition to the FAILURE state.
+		 */
+		wpa_printf(MSG_DEBUG, "EAPOL: Clearing prior altAccept TRUE");
+		sm->eapSuccess = FALSE;
+		sm->altAccept = FALSE;
+	}
 }
 
 
diff --git a/src/fst/fst.c b/src/fst/fst.c
index 2880870213e61..32cd941b41e24 100644
--- a/src/fst/fst.c
+++ b/src/fst/fst.c
@@ -15,6 +15,7 @@
 #include "fst/fst_defs.h"
 #include "fst/fst_ctrl_iface.h"
 
+static int fst_global_initialized = 0;
 struct dl_list fst_global_ctrls_list;
 
 
@@ -106,6 +107,7 @@ int fst_global_init(void)
 	dl_list_init(&fst_global_groups_list);
 	dl_list_init(&fst_global_ctrls_list);
 	fst_session_global_init();
+	fst_global_initialized = 1;
 	return 0;
 }
 
@@ -115,6 +117,9 @@ void fst_global_deinit(void)
 	struct fst_group *group;
 	struct fst_ctrl_handle *h;
 
+	if (!fst_global_initialized)
+		return;
+
 	fst_session_global_deinit();
 	while ((group = fst_first_group()) != NULL)
 		fst_group_delete(group);
@@ -122,6 +127,7 @@ void fst_global_deinit(void)
 				  struct fst_ctrl_handle,
 				  global_ctrls_lentry)))
 		fst_global_del_ctrl(h);
+	fst_global_initialized = 0;
 }
 
 
@@ -160,7 +166,7 @@ void fst_global_del_ctrl(struct fst_ctrl_handle *h)
 void fst_rx_action(struct fst_iface *iface, const struct ieee80211_mgmt *mgmt,
 		   size_t len)
 {
-	if (fst_iface_is_connected(iface, mgmt->sa))
+	if (fst_iface_is_connected(iface, mgmt->sa, FALSE))
 		fst_session_on_action_rx(iface, mgmt, len);
 	else
 		wpa_printf(MSG_DEBUG,
diff --git a/src/fst/fst_ctrl_aux.c b/src/fst/fst_ctrl_aux.c
index dc7b2a7d72021..b6328279b745e 100644
--- a/src/fst/fst_ctrl_aux.c
+++ b/src/fst/fst_ctrl_aux.c
@@ -14,27 +14,28 @@
 
 
 static const char *session_event_names[] = {
-	[EVENT_FST_ESTABLISHED] FST_PVAL_EVT_TYPE_ESTABLISHED,
-	[EVENT_FST_SETUP] FST_PVAL_EVT_TYPE_SETUP,
-	[EVENT_FST_SESSION_STATE_CHANGED] FST_PVAL_EVT_TYPE_SESSION_STATE,
+	[EVENT_FST_ESTABLISHED] = FST_PVAL_EVT_TYPE_ESTABLISHED,
+	[EVENT_FST_SETUP] = FST_PVAL_EVT_TYPE_SETUP,
+	[EVENT_FST_SESSION_STATE_CHANGED] = FST_PVAL_EVT_TYPE_SESSION_STATE,
 };
 
 static const char *reason_names[] = {
-	[REASON_TEARDOWN] FST_CS_PVAL_REASON_TEARDOWN,
-	[REASON_SETUP] FST_CS_PVAL_REASON_SETUP,
-	[REASON_SWITCH] FST_CS_PVAL_REASON_SWITCH,
-	[REASON_STT] FST_CS_PVAL_REASON_STT,
-	[REASON_REJECT] FST_CS_PVAL_REASON_REJECT,
-	[REASON_ERROR_PARAMS] FST_CS_PVAL_REASON_ERROR_PARAMS,
-	[REASON_RESET] FST_CS_PVAL_REASON_RESET,
-	[REASON_DETACH_IFACE] FST_CS_PVAL_REASON_DETACH_IFACE,
+	[REASON_TEARDOWN] = FST_CS_PVAL_REASON_TEARDOWN,
+	[REASON_SETUP] = FST_CS_PVAL_REASON_SETUP,
+	[REASON_SWITCH] = FST_CS_PVAL_REASON_SWITCH,
+	[REASON_STT] = FST_CS_PVAL_REASON_STT,
+	[REASON_REJECT] = FST_CS_PVAL_REASON_REJECT,
+	[REASON_ERROR_PARAMS] = FST_CS_PVAL_REASON_ERROR_PARAMS,
+	[REASON_RESET] = FST_CS_PVAL_REASON_RESET,
+	[REASON_DETACH_IFACE] = FST_CS_PVAL_REASON_DETACH_IFACE,
 };
 
 static const char *session_state_names[] = {
-	[FST_SESSION_STATE_INITIAL] FST_CS_PVAL_STATE_INITIAL,
-	[FST_SESSION_STATE_SETUP_COMPLETION] FST_CS_PVAL_STATE_SETUP_COMPLETION,
-	[FST_SESSION_STATE_TRANSITION_DONE] FST_CS_PVAL_STATE_TRANSITION_DONE,
-	[FST_SESSION_STATE_TRANSITION_CONFIRMED]
+	[FST_SESSION_STATE_INITIAL] = FST_CS_PVAL_STATE_INITIAL,
+	[FST_SESSION_STATE_SETUP_COMPLETION] =
+	FST_CS_PVAL_STATE_SETUP_COMPLETION,
+	[FST_SESSION_STATE_TRANSITION_DONE] = FST_CS_PVAL_STATE_TRANSITION_DONE,
+	[FST_SESSION_STATE_TRANSITION_CONFIRMED] =
 	FST_CS_PVAL_STATE_TRANSITION_CONFIRMED,
 };
 
diff --git a/src/fst/fst_ctrl_iface.c b/src/fst/fst_ctrl_iface.c
index d0907188a389e..7820e586629f2 100644
--- a/src/fst/fst_ctrl_iface.c
+++ b/src/fst/fst_ctrl_iface.c
@@ -648,9 +648,9 @@ static int list_groups(const char *cmd, char *buf, size_t buflen)
 static const char * band_freq(enum mb_band_id band)
 {
 	static const char *band_names[] = {
-		[MB_BAND_ID_WIFI_2_4GHZ] "2.4GHZ",
-		[MB_BAND_ID_WIFI_5GHZ] "5GHZ",
-		[MB_BAND_ID_WIFI_60GHZ] "60GHZ",
+		[MB_BAND_ID_WIFI_2_4GHZ] = "2.4GHZ",
+		[MB_BAND_ID_WIFI_5GHZ] = "5GHZ",
+		[MB_BAND_ID_WIFI_60GHZ] = "60GHZ",
 	};
 
 	return fst_get_str_name(band, band_names, ARRAY_SIZE(band_names));
@@ -749,7 +749,7 @@ int fst_ctrl_iface_mb_info(const u8 *addr, char *buf, size_t buflen)
 
 	foreach_fst_group(g) {
 		foreach_fst_group_iface(g, f) {
-			if (fst_iface_is_connected(f, addr)) {
+			if (fst_iface_is_connected(f, addr, TRUE)) {
 				ret += print_band(num++, f, addr,
 						  buf + ret, buflen - ret);
 			}
diff --git a/src/fst/fst_defs.h b/src/fst/fst_defs.h
index 8ddcc61376b2d..5859f6f5ed918 100644
--- a/src/fst/fst_defs.h
+++ b/src/fst/fst_defs.h
@@ -34,7 +34,7 @@ enum session_type {
 struct session_transition_ie {
 	u8 element_id;
 	u8 length;
-	u32 fsts_id;
+	le32 fsts_id;
 	u8 session_control;
 	u8 new_band_id;
 	u8 new_band_setup;
@@ -47,7 +47,7 @@ struct session_transition_ie {
 struct fst_setup_req {
 	u8 action;
 	u8 dialog_token;
-	u32 llt;
+	le32 llt;
 	struct session_transition_ie stie;
 	/* Multi-band (optional) */
 	/* Wakeup Schedule (optional) */
@@ -70,18 +70,18 @@ struct fst_setup_res {
 struct fst_ack_req {
 	u8 action;
 	u8 dialog_token;
-	u32 fsts_id;
+	le32 fsts_id;
 } STRUCT_PACKED;
 
 struct fst_ack_res {
 	u8 action;
 	u8 dialog_token;
-	u32 fsts_id;
+	le32 fsts_id;
 } STRUCT_PACKED;
 
 struct fst_tear_down {
 	u8 action;
-	u32 fsts_id;
+	le32 fsts_id;
 } STRUCT_PACKED;
 
 #endif /* IEEE_80211_FST_DEFS_H */
diff --git a/src/fst/fst_group.c b/src/fst/fst_group.c
index f6c7be9435f41..321d40d50cd23 100644
--- a/src/fst/fst_group.c
+++ b/src/fst/fst_group.c
@@ -18,22 +18,6 @@
 
 struct dl_list fst_global_groups_list;
 
-#ifndef HOSTAPD
-static Boolean fst_has_fst_peer(struct fst_iface *iface, Boolean *has_peer)
-{
-	const u8 *bssid;
-
-	bssid = fst_iface_get_bssid(iface);
-	if (!bssid) {
-		*has_peer = FALSE;
-		return FALSE;
-	}
-
-	*has_peer = TRUE;
-	return fst_iface_get_peer_mb_ie(iface, bssid) != NULL;
-}
-#endif /* HOSTAPD */
-
 
 static void fst_dump_mb_ies(const char *group_id, const char *ifname,
 			    struct wpabuf *mbies)
@@ -147,16 +131,6 @@ static struct wpabuf * fst_group_create_mb_ie(struct fst_group *g,
 	struct fst_iface *f;
 	unsigned int nof_mbies = 0;
 	unsigned int nof_ifaces_added = 0;
-#ifndef HOSTAPD
-	Boolean has_peer;
-	Boolean has_fst_peer;
-
-	foreach_fst_group_iface(g, f) {
-		has_fst_peer = fst_has_fst_peer(f, &has_peer);
-		if (has_peer && !has_fst_peer)
-			return NULL;
-	}
-#endif /* HOSTAPD */
 
 	foreach_fst_group_iface(g, f) {
 		if (f == i)
@@ -222,43 +196,35 @@ static const u8 * fst_mbie_get_peer_addr(const struct multi_band_ie *mbie)
 }
 
 
-static struct fst_iface *
-fst_group_get_new_iface_by_mbie_and_band_id(struct fst_group *g,
-					    const u8 *mb_ies_buff,
-					    size_t mb_ies_size,
-					    u8 band_id,
-					    u8 *iface_peer_addr)
+static const u8 * fst_mbie_get_peer_addr_for_band(const struct wpabuf *mbies,
+						  u8 band_id)
 {
-	while (mb_ies_size >= 2) {
-		const struct multi_band_ie *mbie =
-			(const struct multi_band_ie *) mb_ies_buff;
-
-		if (mbie->eid != WLAN_EID_MULTI_BAND ||
-		    (size_t) 2 + mbie->len < sizeof(*mbie))
-			break;
+	const u8 *p = wpabuf_head(mbies);
+	size_t s = wpabuf_len(mbies);
 
-		if (mbie->band_id == band_id) {
-			struct fst_iface *iface;
+	while (s >= 2) {
+		const struct multi_band_ie *mbie =
+			(const struct multi_band_ie *) p;
 
-			foreach_fst_group_iface(g, iface) {
-				const u8 *peer_addr =
-					fst_mbie_get_peer_addr(mbie);
+		if (mbie->eid != WLAN_EID_MULTI_BAND) {
+			fst_printf(MSG_INFO, "unexpected eid %d", mbie->eid);
+			return NULL;
+		}
 
-				if (peer_addr &&
-				    fst_iface_is_connected(iface, peer_addr) &&
-				    band_id == fst_iface_get_band_id(iface)) {
-					os_memcpy(iface_peer_addr, peer_addr,
-						  ETH_ALEN);
-					return iface;
-				}
-			}
-			break;
+		if (mbie->len < sizeof(*mbie) - 2 || mbie->len > s - 2) {
+			fst_printf(MSG_INFO, "invalid mbie len %d",
+				   mbie->len);
+			return NULL;
 		}
 
-		mb_ies_buff += 2 + mbie->len;
-		mb_ies_size -= 2 + mbie->len;
+		if (mbie->band_id == band_id)
+			return fst_mbie_get_peer_addr(mbie);
+
+		p += 2 + mbie->len;
+		s -= 2 + mbie->len;
 	}
 
+	fst_printf(MSG_INFO, "mbie doesn't contain band %d", band_id);
 	return NULL;
 }
 
@@ -295,78 +261,172 @@ u32 fst_group_assign_fsts_id(struct fst_group *g)
 }
 
 
-static Boolean
-fst_group_does_iface_appear_in_other_mbies(struct fst_group *g,
-					   struct fst_iface *iface,
-					   struct fst_iface *other,
-					   u8 *peer_addr)
+/**
+ * fst_group_get_peer_other_connection_1 - Find peer's "other" connection
+ * (iface, MAC tuple) by using peer's MB IE on iface.
+ *
+ * @iface: iface on which FST Setup Request was received
+ * @peer_addr: Peer address on iface
+ * @band_id: "other" connection band id
+ * @other_peer_addr (out): Peer's MAC address on the "other" connection (on the
+ *   "other" iface)
+ *
+ * This function parses peer's MB IE on iface. It looks for peer's MAC address
+ * on band_id (tmp_peer_addr). Next all interfaces are iterated to find an
+ * interface which correlates with band_id. If such interface is found, peer
+ * database is iterated to see if tmp_peer_addr is connected over it.
+ */
+static struct fst_iface *
+fst_group_get_peer_other_connection_1(struct fst_iface *iface,
+				      const u8 *peer_addr, u8 band_id,
+				      u8 *other_peer_addr)
 {
-	struct fst_get_peer_ctx *ctx;
-	const u8 *addr;
-	const u8 *iface_addr;
-	enum mb_band_id  iface_band_id;
+	const struct wpabuf *mbies;
+	struct fst_iface *other_iface;
+	const u8 *tmp_peer_addr;
 
-	WPA_ASSERT(g == fst_iface_get_group(iface));
-	WPA_ASSERT(g == fst_iface_get_group(other));
+	/* Get peer's MB IEs on iface */
+	mbies = fst_iface_get_peer_mb_ie(iface, peer_addr);
+	if (!mbies)
+		return NULL;
 
-	iface_addr = fst_iface_get_addr(iface);
-	iface_band_id = fst_iface_get_band_id(iface);
+	/* Get peer's MAC address on the "other" interface */
+	tmp_peer_addr = fst_mbie_get_peer_addr_for_band(mbies, band_id);
+	if (!tmp_peer_addr) {
+		fst_printf(MSG_INFO,
+			   "couldn't extract other peer addr from mbies");
+		return NULL;
+	}
 
-	addr = fst_iface_get_peer_first(other, &ctx, TRUE);
-	for (; addr; addr = fst_iface_get_peer_next(other, &ctx, TRUE)) {
-		const struct wpabuf *mbies;
-		u8 other_iface_peer_addr[ETH_ALEN];
-		struct fst_iface *other_new_iface;
+	fst_printf(MSG_DEBUG, "found other peer addr from mbies: " MACSTR,
+		   MAC2STR(tmp_peer_addr));
 
-		mbies = fst_iface_get_peer_mb_ie(other, addr);
-		if (!mbies)
+	foreach_fst_group_iface(fst_iface_get_group(iface), other_iface) {
+		if (other_iface == iface ||
+		    band_id != fst_iface_get_band_id(other_iface))
 			continue;
-
-		other_new_iface = fst_group_get_new_iface_by_mbie_and_band_id(
-			g, wpabuf_head(mbies), wpabuf_len(mbies),
-			iface_band_id, other_iface_peer_addr);
-		if (other_new_iface == iface &&
-		    os_memcmp(iface_addr, other_iface_peer_addr,
-			      ETH_ALEN) != 0) {
-			os_memcpy(peer_addr, addr, ETH_ALEN);
-			return TRUE;
+		if (fst_iface_is_connected(other_iface, tmp_peer_addr, FALSE)) {
+			os_memcpy(other_peer_addr, tmp_peer_addr, ETH_ALEN);
+			return other_iface;
 		}
 	}
 
-	return FALSE;
+	return NULL;
 }
 
 
-struct fst_iface *
-fst_group_find_new_iface_by_stie(struct fst_group *g,
-				 struct fst_iface *iface,
-				 const u8 *peer_addr,
-				 const struct session_transition_ie *stie,
-				 u8 *iface_peer_addr)
+/**
+ * fst_group_get_peer_other_connection_2 - Find peer's "other" connection
+ * (iface, MAC tuple) by using MB IEs of other peers.
+ *
+ * @iface: iface on which FST Setup Request was received
+ * @peer_addr: Peer address on iface
+ * @band_id: "other" connection band id
+ * @other_peer_addr (out): Peer's MAC address on the "other" connection (on the
+ *   "other" iface)
+ *
+ * This function iterates all connection (other_iface, cur_peer_addr tuples).
+ * For each connection, MB IE (of cur_peer_addr on other_iface) is parsed and
+ * MAC address on iface's band_id is extracted (this_peer_addr).
+ * this_peer_addr is then compared to peer_addr. A match indicates we have
+ * found the "other" connection.
+ */
+static struct fst_iface *
+fst_group_get_peer_other_connection_2(struct fst_iface *iface,
+				      const u8 *peer_addr, u8 band_id,
+				      u8 *other_peer_addr)
 {
-	struct fst_iface *i;
+	u8 this_band_id = fst_iface_get_band_id(iface);
+	const u8 *cur_peer_addr, *this_peer_addr;
+	struct fst_get_peer_ctx *ctx;
+	struct fst_iface *other_iface;
+	const struct wpabuf *cur_mbie;
 
-	foreach_fst_group_iface(g, i) {
-		if (i == iface ||
-		    stie->new_band_id != fst_iface_get_band_id(i))
+	foreach_fst_group_iface(fst_iface_get_group(iface), other_iface) {
+		if (other_iface == iface ||
+		    band_id != fst_iface_get_band_id(other_iface))
 			continue;
-		if (fst_group_does_iface_appear_in_other_mbies(g, iface, i,
-			iface_peer_addr))
-			return i;
-		break;
+		cur_peer_addr = fst_iface_get_peer_first(other_iface, &ctx,
+							 TRUE);
+		for (; cur_peer_addr;
+		     cur_peer_addr = fst_iface_get_peer_next(other_iface, &ctx,
+							     TRUE)) {
+			cur_mbie = fst_iface_get_peer_mb_ie(other_iface,
+							    cur_peer_addr);
+			if (!cur_mbie)
+				continue;
+			this_peer_addr = fst_mbie_get_peer_addr_for_band(
+				cur_mbie, this_band_id);
+			if (!this_peer_addr)
+				continue;
+			if (os_memcmp(this_peer_addr, peer_addr, ETH_ALEN) ==
+			    0) {
+				os_memcpy(other_peer_addr, cur_peer_addr,
+					  ETH_ALEN);
+				return other_iface;
+			}
+		}
 	}
+
 	return NULL;
 }
 
 
+/**
+ * fst_group_get_peer_other_connection - Find peer's "other" connection (iface,
+ * MAC tuple).
+ *
+ * @iface: iface on which FST Setup Request was received
+ * @peer_addr: Peer address on iface
+ * @band_id: "other" connection band id
+ * @other_peer_addr (out): Peer's MAC address on the "other" connection (on the
+ *   "other" iface)
+ *
+ * This function is called upon receiving FST Setup Request from some peer who
+ * has peer_addr on iface. It searches for another connection of the same peer
+ * on different interface which correlates with band_id. MB IEs received from
+ * peer (on the two different interfaces) are used to identify same peer.
+ */
 struct fst_iface *
-fst_group_get_new_iface_by_stie_and_mbie(
-	struct fst_group *g, const u8 *mb_ies_buff, size_t mb_ies_size,
-	const struct session_transition_ie *stie, u8 *iface_peer_addr)
+fst_group_get_peer_other_connection(struct fst_iface *iface,
+				    const u8 *peer_addr, u8 band_id,
+				    u8 *other_peer_addr)
 {
-	return fst_group_get_new_iface_by_mbie_and_band_id(
-		g, mb_ies_buff, mb_ies_size, stie->new_band_id,
-		iface_peer_addr);
+	struct fst_iface *other_iface;
+
+	fst_printf(MSG_DEBUG, "%s: %s:" MACSTR ", %d", __func__,
+		   fst_iface_get_name(iface), MAC2STR(peer_addr), band_id);
+
+	/*
+	 * Two search methods are used:
+	 * 1. Use peer's MB IE on iface to extract peer's MAC address on
+	 *    "other" connection. Then check if such "other" connection exists.
+	 * 2. Iterate peer database, examine each MB IE to see if it points to
+	 *    (iface, peer_addr) tuple
+	 */
+
+	other_iface = fst_group_get_peer_other_connection_1(iface, peer_addr,
+							    band_id,
+							    other_peer_addr);
+	if (other_iface) {
+		fst_printf(MSG_DEBUG, "found by method #1. %s:" MACSTR,
+			   fst_iface_get_name(other_iface),
+			   MAC2STR(other_peer_addr));
+		return other_iface;
+	}
+
+	other_iface = fst_group_get_peer_other_connection_2(iface, peer_addr,
+							    band_id,
+							    other_peer_addr);
+	if (other_iface) {
+		fst_printf(MSG_DEBUG, "found by method #2. %s:" MACSTR,
+			   fst_iface_get_name(other_iface),
+			   MAC2STR(other_peer_addr));
+		return other_iface;
+	}
+
+	fst_printf(MSG_INFO, "%s: other connection not found", __func__);
+	return NULL;
 }
 
 
diff --git a/src/fst/fst_group.h b/src/fst/fst_group.h
index 3a87c0bc91c91..00aee9c8c25c9 100644
--- a/src/fst/fst_group.h
+++ b/src/fst/fst_group.h
@@ -48,15 +48,9 @@ Boolean fst_group_delete_if_empty(struct fst_group *group);
 struct fst_iface * fst_group_get_iface_by_name(struct fst_group *g,
 					       const char *ifname);
 struct fst_iface *
-fst_group_find_new_iface_by_stie(struct fst_group *g,
-				 struct fst_iface *iface,
-				 const u8 *peer_addr,
-				 const struct session_transition_ie *stie,
-				 u8 *iface_peer_addr);
-struct fst_iface *
-fst_group_get_new_iface_by_stie_and_mbie(
-	struct fst_group *g, const u8 *mb_ies_buff, size_t mb_ies_size,
-	const struct session_transition_ie *stie, u8 *iface_peer_addr);
+fst_group_get_peer_other_connection(struct fst_iface *iface,
+				    const u8 *peer_addr, u8 band_id,
+				    u8 *other_peer_addr);
 u8  fst_group_assign_dialog_token(struct fst_group *g);
 u32 fst_group_assign_fsts_id(struct fst_group *g);
 
diff --git a/src/fst/fst_iface.c b/src/fst/fst_iface.c
index 5a92d2c33e420..35e83cb7b4710 100644
--- a/src/fst/fst_iface.c
+++ b/src/fst/fst_iface.c
@@ -49,12 +49,13 @@ void fst_iface_delete(struct fst_iface *i)
 }
 
 
-Boolean fst_iface_is_connected(struct fst_iface *iface, const u8 *addr)
+Boolean fst_iface_is_connected(struct fst_iface *iface, const u8 *addr,
+			       Boolean mb_only)
 {
 	struct fst_get_peer_ctx *ctx;
-	const u8 *a = fst_iface_get_peer_first(iface, &ctx, TRUE);
+	const u8 *a = fst_iface_get_peer_first(iface, &ctx, mb_only);
 
-	for (; a != NULL; a = fst_iface_get_peer_next(iface, &ctx, TRUE))
+	for (; a != NULL; a = fst_iface_get_peer_next(iface, &ctx, mb_only))
 		if (os_memcmp(addr, a, ETH_ALEN) == 0)
 			return TRUE;
 
diff --git a/src/fst/fst_iface.h b/src/fst/fst_iface.h
index 4670d894f7cbd..0eb27325a2b88 100644
--- a/src/fst/fst_iface.h
+++ b/src/fst/fst_iface.h
@@ -123,7 +123,8 @@ static inline const u8 * fst_iface_get_peer_next(struct fst_iface *i,
 	return i->iface_obj.get_peer_next(i->iface_obj.ctx, ctx, mb_only);
 }
 
-Boolean fst_iface_is_connected(struct fst_iface *iface, const u8 *addr);
+Boolean fst_iface_is_connected(struct fst_iface *iface, const u8 *addr,
+			       Boolean mb_only);
 void fst_iface_attach_mbie(struct fst_iface *i, struct wpabuf *mbie);
 enum mb_band_id fst_iface_get_band_id(struct fst_iface *i);
 
diff --git a/src/fst/fst_session.c b/src/fst/fst_session.c
index 55fa69495e99a..76e2c78f4ff6c 100644
--- a/src/fst/fst_session.c
+++ b/src/fst/fst_session.c
@@ -44,7 +44,7 @@
 #define FST_LLT_MS_DEFAULT 50
 #define FST_ACTION_MAX_SUPPORTED   FST_ACTION_ON_CHANNEL_TUNNEL
 
-const char * const fst_action_names[] = {
+static const char * const fst_action_names[] = {
 	[FST_ACTION_SETUP_REQUEST]     = "Setup Request",
 	[FST_ACTION_SETUP_RESPONSE]    = "Setup Response",
 	[FST_ACTION_TEAR_DOWN]         = "Tear Down",
@@ -181,7 +181,8 @@ static void fst_session_timeout_handler(void *eloop_data, void *user_ctx)
 
 static void fst_session_stt_arm(struct fst_session *s)
 {
-	eloop_register_timeout(0, TU_TO_US(FST_DEFAULT_SESSION_TIMEOUT_TU),
+	/* Action frames sometimes get delayed. Use relaxed timeout (2*) */
+	eloop_register_timeout(0, 2 * TU_TO_US(FST_DEFAULT_SESSION_TIMEOUT_TU),
 			       fst_session_timeout_handler, NULL, s);
 	s->stt_armed = TRUE;
 }
@@ -363,7 +364,6 @@ static void fst_session_handle_setup_request(struct fst_iface *iface,
 	struct fst_iface *new_iface = NULL;
 	struct fst_group *g;
 	u8 new_iface_peer_addr[ETH_ALEN];
-	const struct wpabuf *peer_mbies;
 	size_t plen;
 
 	if (frame_len < IEEE80211_HDRLEN + 1 + sizeof(*req))  {
@@ -399,36 +399,18 @@ static void fst_session_handle_setup_request(struct fst_iface *iface,
 				 MAC2STR(mgmt->sa));
 	}
 
-	peer_mbies = fst_iface_get_peer_mb_ie(iface, mgmt->sa);
-	if (peer_mbies) {
-		new_iface = fst_group_get_new_iface_by_stie_and_mbie(
-			g, wpabuf_head(peer_mbies), wpabuf_len(peer_mbies),
-			&req->stie, new_iface_peer_addr);
-		if (new_iface)
-			fst_printf_iface(iface, MSG_INFO,
-					 "FST Request: new iface (%s:" MACSTR
-					 ") found by MB IEs",
-					 fst_iface_get_name(new_iface),
-					 MAC2STR(new_iface_peer_addr));
-	}
-
-	if (!new_iface) {
-		new_iface = fst_group_find_new_iface_by_stie(
-			g, iface, mgmt->sa, &req->stie,
-			new_iface_peer_addr);
-		if (new_iface)
-			fst_printf_iface(iface, MSG_INFO,
-					 "FST Request: new iface (%s:" MACSTR
-					 ") found by others",
-					 fst_iface_get_name(new_iface),
-					 MAC2STR(new_iface_peer_addr));
-	}
-
+	new_iface = fst_group_get_peer_other_connection(iface, mgmt->sa,
+							req->stie.new_band_id,
+							new_iface_peer_addr);
 	if (!new_iface) {
 		fst_printf_iface(iface, MSG_WARNING,
 				 "FST Request dropped: new iface not found");
 		return;
 	}
+	fst_printf_iface(iface, MSG_INFO,
+			 "FST Request: new iface (%s:" MACSTR ") found",
+			 fst_iface_get_name(new_iface),
+			 MAC2STR(new_iface_peer_addr));
 
 	s = fst_find_session_in_progress(mgmt->sa, g);
 	if (s) {
@@ -447,7 +429,9 @@ static void fst_session_handle_setup_request(struct fst_iface *iface,
 		 * the initiator’s MAC address, in which case, the responder
 		 * shall delete the received FST Setup Request.
 		 */
-		if (os_memcmp(mgmt->da, mgmt->sa, ETH_ALEN) > 0) {
+		if (fst_session_is_ready_pending(s) &&
+		    /* waiting for Setup Response */
+		    os_memcmp(mgmt->da, mgmt->sa, ETH_ALEN) > 0) {
 			fst_printf_session(s, MSG_WARNING,
 					   "FST Request dropped due to MAC comparison (our MAC is "
 					   MACSTR ")",
@@ -455,23 +439,26 @@ static void fst_session_handle_setup_request(struct fst_iface *iface,
 			return;
 		}
 
-		if (!fst_session_is_ready_pending(s)) {
-			fst_printf_session(s, MSG_WARNING,
-					   "FST Request from " MACSTR
-					   " dropped due to inappropriate state %s",
-					   MAC2STR(mgmt->da),
-					   fst_session_state_name(s->state));
-			return;
-		}
+		/*
+		 * State is SETUP_COMPLETION (either in transition or not) or
+		 * TRANSITION_DONE (in transition).
+		 * Setup Request arriving in this state could mean:
+		 * 1. peer sent it before receiving our Setup Request (race
+		 *    condition)
+		 * 2. peer didn't receive our Setup Response. Peer is retrying
+		 *    after STT timeout
+		 * 3. peer's FST state machines are out of sync due to some
+		 *    other reason
+		 *
+		 * We will reset our session and create a new one instead.
+		 */
 
+		fst_printf_session(s, MSG_WARNING,
+			"resetting due to FST request");
 
 		/*
 		 * If FST Setup Request arrived with the same FSTS ID as one we
-		 * initialized before, it means the other side either didn't
-		 * receive our FST Request or skipped it for some reason (for
-		 * example, due to numerical MAC comparison).
-		 *
-		 * In this case, there's no need to tear down the session.
+		 * initialized before, there's no need to tear down the session.
 		 * Moreover, as FSTS ID is the same, the other side will
 		 * associate this tear down with the session it initiated that
 		 * will break the sync.
@@ -483,7 +470,6 @@ static void fst_session_handle_setup_request(struct fst_iface *iface,
 					   "Skipping TearDown as the FST request has the same FSTS ID as initiated");
 		fst_session_set_state(s, FST_SESSION_STATE_INITIAL, &evext);
 		fst_session_stt_disarm(s);
-		fst_printf_session(s, MSG_WARNING, "reset due to FST request");
 	}
 
 	s = fst_session_create(g);
@@ -521,7 +507,9 @@ static void fst_session_handle_setup_response(struct fst_session *s,
 	enum hostapd_hw_mode hw_mode;
 	u8 channel;
 	union fst_session_state_switch_extra evext = {
-		.to_initial = {0},
+		.to_initial = {
+			.reject_code = 0,
+		},
 	};
 
 	if (iface != s->data.old_iface) {
@@ -863,13 +851,15 @@ int fst_session_initiate_setup(struct fst_session *s)
 		return -EINVAL;
 	}
 
-	if (!fst_iface_is_connected(s->data.old_iface, s->data.old_peer_addr)) {
+	if (!fst_iface_is_connected(s->data.old_iface, s->data.old_peer_addr,
+				    FALSE)) {
 		fst_printf_session(s, MSG_ERROR,
 				   "The preset old peer address is not connected");
 		return -EINVAL;
 	}
 
-	if (!fst_iface_is_connected(s->data.new_iface, s->data.new_peer_addr)) {
+	if (!fst_iface_is_connected(s->data.new_iface, s->data.new_peer_addr,
+				    FALSE)) {
 		fst_printf_session(s, MSG_ERROR,
 				   "The preset new peer address is not connected");
 		return -EINVAL;
@@ -966,7 +956,8 @@ int fst_session_respond(struct fst_session *s, u8 status_code)
 		return -EINVAL;
 	}
 
-	if (!fst_iface_is_connected(s->data.old_iface, s->data.old_peer_addr)) {
+	if (!fst_iface_is_connected(s->data.old_iface,
+				    s->data.old_peer_addr, FALSE)) {
 		fst_printf_session(s, MSG_ERROR,
 				   "The preset peer address is not in the peer list");
 		return -EINVAL;
@@ -984,7 +975,7 @@ int fst_session_respond(struct fst_session *s, u8 status_code)
 	res.stie.length = sizeof(res.stie) - 2;
 
 	if (status_code == WLAN_STATUS_SUCCESS) {
-		res.stie.fsts_id = s->data.fsts_id;
+		res.stie.fsts_id = host_to_le32(s->data.fsts_id);
 		res.stie.session_control = SESSION_CONTROL(SESSION_TYPE_BSS, 0);
 
 		fst_iface_get_channel_info(s->data.new_iface, &hw_mode,
@@ -1458,7 +1449,7 @@ int fst_test_req_send_fst_response(const char *params)
 	res.stie.length = sizeof(res.stie) - 2;
 
 	if (res.status_code == WLAN_STATUS_SUCCESS) {
-		res.stie.fsts_id = fsts_id;
+		res.stie.fsts_id = host_to_le32(fsts_id);
 		res.stie.session_control = SESSION_CONTROL(SESSION_TYPE_BSS, 0);
 
 		fst_iface_get_channel_info(s.data.new_iface, &hw_mode,
@@ -1507,7 +1498,7 @@ int fst_test_req_send_ack_request(const char *params)
 	os_memset(&req, 0, sizeof(req));
 	req.action = FST_ACTION_ACK_REQUEST;
 	req.dialog_token = g->dialog_token;
-	req.fsts_id = fsts_id;
+	req.fsts_id = host_to_le32(fsts_id);
 
 	return fst_session_send_action(&s, FALSE, &req, sizeof(req), NULL);
 }
@@ -1535,7 +1526,7 @@ int fst_test_req_send_ack_response(const char *params)
 	os_memset(&res, 0, sizeof(res));
 	res.action = FST_ACTION_ACK_RESPONSE;
 	res.dialog_token = g->dialog_token;
-	res.fsts_id = fsts_id;
+	res.fsts_id = host_to_le32(fsts_id);
 
 	return fst_session_send_action(&s, FALSE, &res, sizeof(res), NULL);
 }
@@ -1562,7 +1553,7 @@ int fst_test_req_send_tear_down(const char *params)
 
 	os_memset(&td, 0, sizeof(td));
 	td.action = FST_ACTION_TEAR_DOWN;
-	td.fsts_id = fsts_id;
+	td.fsts_id = host_to_le32(fsts_id);
 
 	return fst_session_send_action(&s, TRUE, &td, sizeof(td), NULL);
 }
diff --git a/src/l2_packet/l2_packet_linux.c b/src/l2_packet/l2_packet_linux.c
index 41de2f85d9cde..a7a300e568e6d 100644
--- a/src/l2_packet/l2_packet_linux.c
+++ b/src/l2_packet/l2_packet_linux.c
@@ -30,11 +30,14 @@ struct l2_packet_data {
 	int l2_hdr; /* whether to include layer 2 (Ethernet) header data
 		     * buffers */
 
+#ifndef CONFIG_NO_LINUX_PACKET_SOCKET_WAR
 	/* For working around Linux packet socket behavior and regression. */
 	int fd_br_rx;
-	int last_from_br;
+	int last_from_br, last_from_br_prev;
 	u8 last_hash[SHA1_MAC_LEN];
-	unsigned int num_rx, num_rx_br;
+	u8 last_hash_prev[SHA1_MAC_LEN];
+	unsigned int num_rx_br;
+#endif /* CONFIG_NO_LINUX_PACKET_SOCKET_WAR */
 };
 
 /* Generated by 'sudo tcpdump -s 3000 -dd greater 278 and ip and udp and
@@ -127,7 +130,6 @@ static void l2_packet_receive(int sock, void *eloop_ctx, void *sock_ctx)
 	struct sockaddr_ll ll;
 	socklen_t fromlen;
 
-	l2->num_rx++;
 	os_memset(&ll, 0, sizeof(ll));
 	fromlen = sizeof(ll);
 	res = recvfrom(sock, buf, sizeof(buf), 0, (struct sockaddr *) &ll,
@@ -141,6 +143,7 @@ static void l2_packet_receive(int sock, void *eloop_ctx, void *sock_ctx)
 	wpa_printf(MSG_DEBUG, "%s: src=" MACSTR " len=%d",
 		   __func__, MAC2STR(ll.sll_addr), (int) res);
 
+#ifndef CONFIG_NO_LINUX_PACKET_SOCKET_WAR
 	if (l2->fd_br_rx >= 0) {
 		u8 hash[SHA1_MAC_LEN];
 		const u8 *addr[1];
@@ -169,14 +172,24 @@ static void l2_packet_receive(int sock, void *eloop_ctx, void *sock_ctx)
 				   __func__);
 			return;
 		}
+		if (l2->last_from_br_prev &&
+		    os_memcmp(hash, l2->last_hash_prev, SHA1_MAC_LEN) == 0) {
+			wpa_printf(MSG_DEBUG, "%s: Drop duplicate RX(prev)",
+				   __func__);
+			return;
+		}
+		os_memcpy(l2->last_hash_prev, l2->last_hash, SHA1_MAC_LEN);
+		l2->last_from_br_prev = l2->last_from_br;
 		os_memcpy(l2->last_hash, hash, SHA1_MAC_LEN);
 	}
 
 	l2->last_from_br = 0;
+#endif /* CONFIG_NO_LINUX_PACKET_SOCKET_WAR */
 	l2->rx_callback(l2->rx_callback_ctx, ll.sll_addr, buf, res);
 }
 
 
+#ifndef CONFIG_NO_LINUX_PACKET_SOCKET_WAR
 static void l2_packet_receive_br(int sock, void *eloop_ctx, void *sock_ctx)
 {
 	struct l2_packet_data *l2 = eloop_ctx;
@@ -202,6 +215,11 @@ static void l2_packet_receive_br(int sock, void *eloop_ctx, void *sock_ctx)
 	wpa_printf(MSG_DEBUG, "%s: src=" MACSTR " len=%d",
 		   __func__, MAC2STR(ll.sll_addr), (int) res);
 
+	if (os_memcmp(ll.sll_addr, l2->own_addr, ETH_ALEN) == 0) {
+		wpa_printf(MSG_DEBUG, "%s: Drop RX of own frame", __func__);
+		return;
+	}
+
 	addr[0] = buf;
 	len[0] = res;
 	sha1_vector(1, addr, len, hash);
@@ -210,10 +228,18 @@ static void l2_packet_receive_br(int sock, void *eloop_ctx, void *sock_ctx)
 		wpa_printf(MSG_DEBUG, "%s: Drop duplicate RX", __func__);
 		return;
 	}
+	if (!l2->last_from_br_prev &&
+	    os_memcmp(hash, l2->last_hash_prev, SHA1_MAC_LEN) == 0) {
+		wpa_printf(MSG_DEBUG, "%s: Drop duplicate RX(prev)", __func__);
+		return;
+	}
+	os_memcpy(l2->last_hash_prev, l2->last_hash, SHA1_MAC_LEN);
+	l2->last_from_br_prev = l2->last_from_br;
 	l2->last_from_br = 1;
 	os_memcpy(l2->last_hash, hash, SHA1_MAC_LEN);
 	l2->rx_callback(l2->rx_callback_ctx, ll.sll_addr, buf, res);
 }
+#endif /* CONFIG_NO_LINUX_PACKET_SOCKET_WAR */
 
 
 struct l2_packet_data * l2_packet_init(
@@ -233,7 +259,9 @@ struct l2_packet_data * l2_packet_init(
 	l2->rx_callback = rx_callback;
 	l2->rx_callback_ctx = rx_callback_ctx;
 	l2->l2_hdr = l2_hdr;
+#ifndef CONFIG_NO_LINUX_PACKET_SOCKET_WAR
 	l2->fd_br_rx = -1;
+#endif /* CONFIG_NO_LINUX_PACKET_SOCKET_WAR */
 
 	l2->fd = socket(PF_PACKET, l2_hdr ? SOCK_RAW : SOCK_DGRAM,
 			htons(protocol));
@@ -289,6 +317,7 @@ struct l2_packet_data * l2_packet_init_bridge(
 	void *rx_callback_ctx, int l2_hdr)
 {
 	struct l2_packet_data *l2;
+#ifndef CONFIG_NO_LINUX_PACKET_SOCKET_WAR
 	struct sock_filter ethertype_sock_filter_insns[] = {
 		/* Load ethertype */
 		BPF_STMT(BPF_LD | BPF_H | BPF_ABS, 2 * ETH_ALEN),
@@ -304,12 +333,14 @@ struct l2_packet_data * l2_packet_init_bridge(
 		.filter = ethertype_sock_filter_insns,
 	};
 	struct sockaddr_ll ll;
+#endif /* CONFIG_NO_LINUX_PACKET_SOCKET_WAR */
 
 	l2 = l2_packet_init(br_ifname, own_addr, protocol, rx_callback,
 			    rx_callback_ctx, l2_hdr);
 	if (!l2)
 		return NULL;
 
+#ifndef CONFIG_NO_LINUX_PACKET_SOCKET_WAR
 	/*
 	 * The Linux packet socket behavior has changed over the years and there
 	 * is an inconvenient regression in it that breaks RX for a specific
@@ -357,6 +388,7 @@ struct l2_packet_data * l2_packet_init_bridge(
 	}
 
 	eloop_register_read_sock(l2->fd_br_rx, l2_packet_receive_br, l2, NULL);
+#endif /* CONFIG_NO_LINUX_PACKET_SOCKET_WAR */
 
 	return l2;
 }
@@ -372,10 +404,12 @@ void l2_packet_deinit(struct l2_packet_data *l2)
 		close(l2->fd);
 	}
 
+#ifndef CONFIG_NO_LINUX_PACKET_SOCKET_WAR
 	if (l2->fd_br_rx >= 0) {
 		eloop_unregister_read_sock(l2->fd_br_rx);
 		close(l2->fd_br_rx);
 	}
+#endif /* CONFIG_NO_LINUX_PACKET_SOCKET_WAR */
 
 	os_free(l2);
 }
diff --git a/src/l2_packet/l2_packet_pcap.c b/src/l2_packet/l2_packet_pcap.c
index bb4f4a31d0151..423c099fde88e 100644
--- a/src/l2_packet/l2_packet_pcap.c
+++ b/src/l2_packet/l2_packet_pcap.c
@@ -312,6 +312,18 @@ struct l2_packet_data * l2_packet_init(
 }
 
 
+struct l2_packet_data * l2_packet_init_bridge(
+	const char *br_ifname, const char *ifname, const u8 *own_addr,
+	unsigned short protocol,
+	void (*rx_callback)(void *ctx, const u8 *src_addr,
+			    const u8 *buf, size_t len),
+	void *rx_callback_ctx, int l2_hdr)
+{
+	return l2_packet_init(br_ifname, own_addr, protocol, rx_callback,
+			      rx_callback_ctx, l2_hdr);
+}
+
+
 void l2_packet_deinit(struct l2_packet_data *l2)
 {
 	if (l2 == NULL)
diff --git a/src/p2p/p2p.c b/src/p2p/p2p.c
index 767706c01d6b3..996b4e8249863 100644
--- a/src/p2p/p2p.c
+++ b/src/p2p/p2p.c
@@ -10,6 +10,7 @@
 
 #include "common.h"
 #include "eloop.h"
+#include "common/defs.h"
 #include "common/ieee802_11_defs.h"
 #include "common/ieee802_11_common.h"
 #include "common/wpa_ctrl.h"
@@ -445,8 +446,9 @@ static struct p2p_device * p2p_create_device(struct p2p_data *p2p,
 static void p2p_copy_client_info(struct p2p_device *dev,
 				 struct p2p_client_info *cli)
 {
-	os_memcpy(dev->info.device_name, cli->dev_name, cli->dev_name_len);
-	dev->info.device_name[cli->dev_name_len] = '\0';
+	p2p_copy_filter_devname(dev->info.device_name,
+				sizeof(dev->info.device_name),
+				cli->dev_name, cli->dev_name_len);
 	dev->info.dev_capab = cli->dev_capab;
 	dev->info.config_methods = cli->config_methods;
 	os_memcpy(dev->info.pri_dev_type, cli->pri_dev_type, 8);
@@ -636,11 +638,11 @@ static void p2p_update_peer_vendor_elems(struct p2p_device *dev, const u8 *ies,
 
 	end = ies + ies_len;
 
-	for (pos = ies; pos + 1 < end; pos += len) {
+	for (pos = ies; end - pos > 1; pos += len) {
 		id = *pos++;
 		len = *pos++;
 
-		if (pos + len > end)
+		if (len > end - pos)
 			break;
 
 		if (id != WLAN_EID_VENDOR_SPECIFIC || len < 3)
@@ -786,11 +788,11 @@ int p2p_add_device(struct p2p_data *p2p, const u8 *addr, int freq,
 		dev->oper_ssid_len = msg.ssid[1];
 	}
 
-	if (msg.adv_service_instance && msg.adv_service_instance_len) {
-		wpabuf_free(dev->info.p2ps_instance);
+	wpabuf_free(dev->info.p2ps_instance);
+	dev->info.p2ps_instance = NULL;
+	if (msg.adv_service_instance && msg.adv_service_instance_len)
 		dev->info.p2ps_instance = wpabuf_alloc_copy(
 			msg.adv_service_instance, msg.adv_service_instance_len);
-	}
 
 	if (freq >= 2412 && freq <= 2484 && msg.ds_params &&
 	    *msg.ds_params >= 1 && *msg.ds_params <= 14) {
@@ -1220,9 +1222,14 @@ int p2p_find(struct p2p_data *p2p, unsigned int timeout,
 
 	p2p->start_after_scan = P2P_AFTER_SCAN_NOTHING;
 	p2p_clear_timeout(p2p);
+	if (p2p->pending_listen_freq) {
+		p2p_dbg(p2p, "Clear pending_listen_freq for p2p_find");
+		p2p->pending_listen_freq = 0;
+	}
 	p2p->cfg->stop_listen(p2p->cfg->cb_ctx);
 	p2p->find_type = type;
 	p2p_device_clear_reported(p2p);
+	os_memset(p2p->sd_query_no_ack, 0, ETH_ALEN);
 	p2p_set_state(p2p, P2P_SEARCH);
 	p2p->search_delay = search_delay;
 	p2p->in_search_delay = 0;
@@ -1459,7 +1466,7 @@ static void p2p_prepare_channel_best(struct p2p_data *p2p)
 
 
 /**
- * p2p_prepare_channel - Select operating channel for GO Negotiation
+ * p2p_prepare_channel - Select operating channel for GO Negotiation or P2PS PD
  * @p2p: P2P module context from p2p_init()
  * @dev: Selected peer device
  * @force_freq: Forced frequency in MHz or 0 if not forced
@@ -1468,9 +1475,9 @@ static void p2p_prepare_channel_best(struct p2p_data *p2p)
  * Returns: 0 on success, -1 on failure (channel not supported for P2P)
  *
  * This function is used to do initial operating channel selection for GO
- * Negotiation prior to having received peer information. The selected channel
- * may be further optimized in p2p_reselect_channel() once the peer information
- * is available.
+ * Negotiation prior to having received peer information or for P2PS PD
+ * signalling. The selected channel may be further optimized in
+ * p2p_reselect_channel() once the peer information is available.
  */
 int p2p_prepare_channel(struct p2p_data *p2p, struct p2p_device *dev,
 			unsigned int force_freq, unsigned int pref_freq, int go)
@@ -2028,8 +2035,23 @@ static void p2p_add_dev_from_probe_req(struct p2p_data *p2p, const u8 *addr,
 
 	dev = p2p_get_device(p2p, addr);
 	if (dev) {
-		if (dev->country[0] == 0 && msg.listen_channel)
-			os_memcpy(dev->country, msg.listen_channel, 3);
+		if (msg.listen_channel) {
+			int freq;
+
+			if (dev->country[0] == 0)
+				os_memcpy(dev->country, msg.listen_channel, 3);
+
+			freq = p2p_channel_to_freq(msg.listen_channel[3],
+						   msg.listen_channel[4]);
+
+			if (freq > 0 && dev->listen_freq != freq) {
+				p2p_dbg(p2p,
+					"Updated peer " MACSTR " Listen channel (Probe Request): %d -> %d MHz",
+					MAC2STR(addr), dev->listen_freq, freq);
+				dev->listen_freq = freq;
+			}
+		}
+
 		os_get_reltime(&dev->last_seen);
 		p2p_parse_free(&msg);
 		return; /* already known */
@@ -2212,6 +2234,58 @@ struct wpabuf * p2p_build_probe_resp_ies(struct p2p_data *p2p,
 	return buf;
 }
 
+static int p2p_build_probe_resp_buf(struct p2p_data *p2p, struct wpabuf *buf,
+				    struct wpabuf *ies,
+				    const u8 *addr, int rx_freq)
+{
+	struct ieee80211_mgmt *resp;
+	u8 channel, op_class;
+
+	resp = wpabuf_put(buf, offsetof(struct ieee80211_mgmt,
+					u.probe_resp.variable));
+
+	resp->frame_control = host_to_le16((WLAN_FC_TYPE_MGMT << 2) |
+					   (WLAN_FC_STYPE_PROBE_RESP << 4));
+	os_memcpy(resp->da, addr, ETH_ALEN);
+	os_memcpy(resp->sa, p2p->cfg->dev_addr, ETH_ALEN);
+	os_memcpy(resp->bssid, p2p->cfg->dev_addr, ETH_ALEN);
+	resp->u.probe_resp.beacon_int = host_to_le16(100);
+	/* hardware or low-level driver will setup seq_ctrl and timestamp */
+	resp->u.probe_resp.capab_info =
+	    host_to_le16(WLAN_CAPABILITY_SHORT_PREAMBLE |
+		     WLAN_CAPABILITY_PRIVACY |
+		     WLAN_CAPABILITY_SHORT_SLOT_TIME);
+
+	wpabuf_put_u8(buf, WLAN_EID_SSID);
+	wpabuf_put_u8(buf, P2P_WILDCARD_SSID_LEN);
+	wpabuf_put_data(buf, P2P_WILDCARD_SSID, P2P_WILDCARD_SSID_LEN);
+
+	wpabuf_put_u8(buf, WLAN_EID_SUPP_RATES);
+	wpabuf_put_u8(buf, 8);
+	wpabuf_put_u8(buf, (60 / 5) | 0x80);
+	wpabuf_put_u8(buf, 90 / 5);
+	wpabuf_put_u8(buf, (120 / 5) | 0x80);
+	wpabuf_put_u8(buf, 180 / 5);
+	wpabuf_put_u8(buf, (240 / 5) | 0x80);
+	wpabuf_put_u8(buf, 360 / 5);
+	wpabuf_put_u8(buf, 480 / 5);
+	wpabuf_put_u8(buf, 540 / 5);
+
+	if (!rx_freq) {
+		channel = p2p->cfg->channel;
+	} else if (p2p_freq_to_channel(rx_freq, &op_class, &channel)) {
+		p2p_err(p2p, "Failed to convert freq to channel");
+		return -1;
+	}
+
+	wpabuf_put_u8(buf, WLAN_EID_DS_PARAMS);
+	wpabuf_put_u8(buf, 1);
+	wpabuf_put_u8(buf, channel);
+
+	wpabuf_put_buf(buf, ies);
+
+	return 0;
+}
 
 static int p2p_service_find_asp(struct p2p_data *p2p, const u8 *hash)
 {
@@ -2245,10 +2319,8 @@ p2p_reply_probe(struct p2p_data *p2p, const u8 *addr, const u8 *dst,
 {
 	struct ieee802_11_elems elems;
 	struct wpabuf *buf;
-	struct ieee80211_mgmt *resp;
 	struct p2p_message msg;
 	struct wpabuf *ies;
-	u8 channel, op_class;
 
 	if (ieee802_11_parse_elems((u8 *) ie, ie_len, &elems, 0) ==
 	    ParseFailed) {
@@ -2392,49 +2464,12 @@ p2p_reply_probe(struct p2p_data *p2p, const u8 *addr, const u8 *dst,
 		return P2P_PREQ_NOT_PROCESSED;
 	}
 
-	resp = wpabuf_put(buf, offsetof(struct ieee80211_mgmt,
-					u.probe_resp.variable));
-
-	resp->frame_control = host_to_le16((WLAN_FC_TYPE_MGMT << 2) |
-					   (WLAN_FC_STYPE_PROBE_RESP << 4));
-	os_memcpy(resp->da, addr, ETH_ALEN);
-	os_memcpy(resp->sa, p2p->cfg->dev_addr, ETH_ALEN);
-	os_memcpy(resp->bssid, p2p->cfg->dev_addr, ETH_ALEN);
-	resp->u.probe_resp.beacon_int = host_to_le16(100);
-	/* hardware or low-level driver will setup seq_ctrl and timestamp */
-	resp->u.probe_resp.capab_info =
-		host_to_le16(WLAN_CAPABILITY_SHORT_PREAMBLE |
-			     WLAN_CAPABILITY_PRIVACY |
-			     WLAN_CAPABILITY_SHORT_SLOT_TIME);
-
-	wpabuf_put_u8(buf, WLAN_EID_SSID);
-	wpabuf_put_u8(buf, P2P_WILDCARD_SSID_LEN);
-	wpabuf_put_data(buf, P2P_WILDCARD_SSID, P2P_WILDCARD_SSID_LEN);
-
-	wpabuf_put_u8(buf, WLAN_EID_SUPP_RATES);
-	wpabuf_put_u8(buf, 8);
-	wpabuf_put_u8(buf, (60 / 5) | 0x80);
-	wpabuf_put_u8(buf, 90 / 5);
-	wpabuf_put_u8(buf, (120 / 5) | 0x80);
-	wpabuf_put_u8(buf, 180 / 5);
-	wpabuf_put_u8(buf, (240 / 5) | 0x80);
-	wpabuf_put_u8(buf, 360 / 5);
-	wpabuf_put_u8(buf, 480 / 5);
-	wpabuf_put_u8(buf, 540 / 5);
-
-	if (!rx_freq) {
-		channel = p2p->cfg->channel;
-	} else if (p2p_freq_to_channel(rx_freq, &op_class, &channel)) {
+	if (p2p_build_probe_resp_buf(p2p, buf, ies, addr, rx_freq)) {
 		wpabuf_free(ies);
 		wpabuf_free(buf);
 		return P2P_PREQ_NOT_PROCESSED;
 	}
 
-	wpabuf_put_u8(buf, WLAN_EID_DS_PARAMS);
-	wpabuf_put_u8(buf, 1);
-	wpabuf_put_u8(buf, channel);
-
-	wpabuf_put_buf(buf, ies);
 	wpabuf_free(ies);
 
 	p2p->cfg->send_probe_resp(p2p->cfg->cb_ctx, buf, rx_freq);
@@ -2448,12 +2483,18 @@ p2p_reply_probe(struct p2p_data *p2p, const u8 *addr, const u8 *dst,
 enum p2p_probe_req_status
 p2p_probe_req_rx(struct p2p_data *p2p, const u8 *addr, const u8 *dst,
 		 const u8 *bssid, const u8 *ie, size_t ie_len,
-		 unsigned int rx_freq)
+		 unsigned int rx_freq, int p2p_lo_started)
 {
 	enum p2p_probe_req_status res;
 
 	p2p_add_dev_from_probe_req(p2p, addr, ie, ie_len);
 
+	if (p2p_lo_started) {
+		p2p_dbg(p2p,
+			"Probe Response is offloaded, do not reply Probe Request");
+		return P2P_PREQ_PROCESSED;
+	}
+
 	res = p2p_reply_probe(p2p, addr, dst, bssid, ie, ie_len, rx_freq);
 	if (res != P2P_PREQ_PROCESSED && res != P2P_PREQ_NOT_PROCESSED)
 		return res;
@@ -2944,7 +2985,6 @@ void p2p_deinit(struct p2p_data *p2p)
 	wpabuf_free(p2p->wfd_coupled_sink_info);
 #endif /* CONFIG_WIFI_DISPLAY */
 
-	eloop_cancel_timeout(p2p_ext_listen_timeout, p2p, NULL);
 	eloop_cancel_timeout(p2p_scan_timeout, p2p, NULL);
 	eloop_cancel_timeout(p2p_go_neg_start, p2p, NULL);
 	eloop_cancel_timeout(p2p_go_neg_wait_timeout, p2p, NULL);
@@ -2959,7 +2999,6 @@ void p2p_deinit(struct p2p_data *p2p)
 	os_free(p2p->groups);
 	p2ps_prov_free(p2p);
 	wpabuf_free(p2p->sd_resp);
-	os_free(p2p->after_scan_tx);
 	p2p_remove_wps_vendor_extensions(p2p);
 	os_free(p2p->no_go_freq.range);
 	p2p_service_flush_asp(p2p);
@@ -2971,6 +3010,8 @@ void p2p_deinit(struct p2p_data *p2p)
 void p2p_flush(struct p2p_data *p2p)
 {
 	struct p2p_device *dev, *prev;
+
+	p2p_ext_listen(p2p, 0, 0);
 	p2p_stop_find(p2p);
 	dl_list_for_each_safe(dev, prev, &p2p->devices, struct p2p_device,
 			      list) {
@@ -3157,13 +3198,18 @@ int p2p_set_country(struct p2p_data *p2p, const char *country)
 
 static int p2p_pre_find_operation(struct p2p_data *p2p, struct p2p_device *dev)
 {
+	int res;
+
 	if (dev->sd_pending_bcast_queries == 0) {
 		/* Initialize with total number of registered broadcast
 		 * SD queries. */
 		dev->sd_pending_bcast_queries = p2p->num_p2p_sd_queries;
 	}
 
-	if (p2p_start_sd(p2p, dev) == 0)
+	res = p2p_start_sd(p2p, dev);
+	if (res == -2)
+		return -2;
+	if (res == 0)
 		return 1;
 
 	if (dev->req_config_methods &&
@@ -3183,7 +3229,7 @@ static int p2p_pre_find_operation(struct p2p_data *p2p, struct p2p_device *dev)
 void p2p_continue_find(struct p2p_data *p2p)
 {
 	struct p2p_device *dev;
-	int found;
+	int found, res;
 
 	p2p_set_state(p2p, P2P_SEARCH);
 
@@ -3196,10 +3242,13 @@ void p2p_continue_find(struct p2p_data *p2p)
 		}
 		if (!found)
 			continue;
-		if (p2p_pre_find_operation(p2p, dev) > 0) {
+		res = p2p_pre_find_operation(p2p, dev);
+		if (res > 0) {
 			p2p->last_p2p_find_oper = dev;
 			return;
 		}
+		if (res == -2)
+			goto skip_sd;
 	}
 
 	/*
@@ -3207,14 +3256,19 @@ void p2p_continue_find(struct p2p_data *p2p)
 	 * iteration device.
 	 */
 	dl_list_for_each(dev, &p2p->devices, struct p2p_device, list) {
-		if (p2p_pre_find_operation(p2p, dev) > 0) {
+		res = p2p_pre_find_operation(p2p, dev);
+		if (res > 0) {
 			p2p->last_p2p_find_oper = dev;
 			return;
 		}
+		if (res == -2)
+			goto skip_sd;
 		if (dev == p2p->last_p2p_find_oper)
 			break;
 	}
 
+skip_sd:
+	os_memset(p2p->sd_query_no_ack, 0, ETH_ALEN);
 	p2p_listen_in_find(p2p, 1);
 }
 
@@ -3226,8 +3280,17 @@ static void p2p_sd_cb(struct p2p_data *p2p, int success)
 	p2p->pending_action_state = P2P_NO_PENDING_ACTION;
 
 	if (!success) {
-		if (p2p->sd_peer)
+		if (p2p->sd_peer) {
+			if (is_zero_ether_addr(p2p->sd_query_no_ack)) {
+				os_memcpy(p2p->sd_query_no_ack,
+					  p2p->sd_peer->info.p2p_device_addr,
+					  ETH_ALEN);
+				p2p_dbg(p2p,
+					"First SD Query no-ACK in this search iteration: "
+					MACSTR, MAC2STR(p2p->sd_query_no_ack));
+			}
 			p2p->cfg->send_action_done(p2p->cfg->cb_ctx);
+		}
 		p2p->sd_peer = NULL;
 		if (p2p->state != P2P_IDLE)
 			p2p_continue_find(p2p);
@@ -3326,6 +3389,43 @@ static void p2p_prov_disc_cb(struct p2p_data *p2p, int success)
 	}
 
 	/*
+	 * If after PD Request the peer doesn't expect to receive PD Response
+	 * the PD Request ACK indicates a completion of the current PD. This
+	 * happens only on the advertiser side sending the follow-on PD Request
+	 * with the status different than 12 (Success: accepted by user).
+	 */
+	if (p2p->p2ps_prov && !p2p->p2ps_prov->pd_seeker &&
+	    p2p->p2ps_prov->status != P2P_SC_SUCCESS_DEFERRED) {
+		p2p_dbg(p2p, "P2PS PD completion on Follow-on PD Request ACK");
+
+		if (p2p->send_action_in_progress) {
+			p2p->send_action_in_progress = 0;
+			p2p->cfg->send_action_done(p2p->cfg->cb_ctx);
+		}
+
+		p2p->pending_action_state = P2P_NO_PENDING_ACTION;
+
+		if (p2p->cfg->p2ps_prov_complete) {
+			p2p->cfg->p2ps_prov_complete(
+				p2p->cfg->cb_ctx,
+				p2p->p2ps_prov->status,
+				p2p->p2ps_prov->adv_mac,
+				p2p->p2ps_prov->adv_mac,
+				p2p->p2ps_prov->session_mac,
+				NULL, p2p->p2ps_prov->adv_id,
+				p2p->p2ps_prov->session_id,
+				0, 0, NULL, 0, 0, 0,
+				NULL, NULL, 0, 0, NULL, 0);
+		}
+
+		if (p2p->user_initiated_pd)
+			p2p_reset_pending_pd(p2p);
+
+		p2ps_prov_free(p2p);
+		return;
+	}
+
+	/*
 	 * This postponing, of resetting pending_action_state, needs to be
 	 * done only for user initiated PD requests and not internal ones.
 	 */
@@ -3399,9 +3499,11 @@ int p2p_scan_res_handler(struct p2p_data *p2p, const u8 *bssid, int freq,
 		 * operation was started.
 		 */
 		p2p_dbg(p2p, "Ignore old scan result for " MACSTR
-			" (rx_time=%u.%06u)",
+			" (rx_time=%u.%06u find_start=%u.%06u)",
 			MAC2STR(bssid), (unsigned int) rx_time->sec,
-			(unsigned int) rx_time->usec);
+			(unsigned int) rx_time->usec,
+			(unsigned int) p2p->find_start.sec,
+			(unsigned int) p2p->find_start.usec);
 		return 0;
 	}
 
@@ -3426,7 +3528,8 @@ void p2p_scan_res_handled(struct p2p_data *p2p)
 }
 
 
-void p2p_scan_ie(struct p2p_data *p2p, struct wpabuf *ies, const u8 *dev_id)
+void p2p_scan_ie(struct p2p_data *p2p, struct wpabuf *ies, const u8 *dev_id,
+		 unsigned int bands)
 {
 	u8 dev_capab;
 	u8 *len;
@@ -3460,6 +3563,9 @@ void p2p_scan_ie(struct p2p_data *p2p, struct wpabuf *ies, const u8 *dev_id)
 		p2p_buf_add_ext_listen_timing(ies, p2p->ext_listen_period,
 					      p2p->ext_listen_interval);
 
+	if (bands & BAND_60_GHZ)
+		p2p_buf_add_device_info(ies, p2p, NULL);
+
 	if (p2p->p2ps_seek && p2p->p2ps_seek_count)
 		p2p_buf_add_service_hash(ies, p2p);
 
@@ -3694,6 +3800,8 @@ void p2p_send_action_cb(struct p2p_data *p2p, unsigned int freq, const u8 *dst,
 		break;
 	case P2P_PENDING_INVITATION_RESPONSE:
 		p2p_invitation_resp_cb(p2p, success);
+		if (p2p->inv_status != P2P_SC_SUCCESS)
+			p2p_check_after_scan_tx_continuation(p2p);
 		break;
 	case P2P_PENDING_DEV_DISC_REQUEST:
 		p2p_dev_disc_req_cb(p2p, success);
@@ -5400,3 +5508,34 @@ void p2p_set_own_pref_freq_list(struct p2p_data *p2p,
 			i, p2p->pref_freq_list[i]);
 	}
 }
+
+
+struct wpabuf * p2p_build_probe_resp_template(struct p2p_data *p2p,
+					      unsigned int freq)
+{
+	struct wpabuf *ies, *buf;
+	u8 addr[] = { 0xFF, 0xFF, 0xFF, 0xFF, 0xFF, 0xFF };
+	int ret;
+
+	ies = p2p_build_probe_resp_ies(p2p, NULL, 0);
+	if (!ies) {
+		wpa_printf(MSG_ERROR,
+			   "CTRL: Failed to build Probe Response IEs");
+		return NULL;
+	}
+
+	buf = wpabuf_alloc(200 + wpabuf_len(ies));
+	if (!buf) {
+		wpabuf_free(ies);
+		return NULL;
+	}
+
+	ret = p2p_build_probe_resp_buf(p2p, buf, ies, addr, freq);
+	wpabuf_free(ies);
+	if (ret) {
+		wpabuf_free(buf);
+		return NULL;
+	}
+
+	return buf;
+}
diff --git a/src/p2p/p2p.h b/src/p2p/p2p.h
index b4060be477b6b..7b18dcfc3ff3a 100644
--- a/src/p2p/p2p.h
+++ b/src/p2p/p2p.h
@@ -31,7 +31,7 @@
 /**
  * P2P_MAX_REG_CLASSES - Maximum number of regulatory classes
  */
-#define P2P_MAX_REG_CLASSES 10
+#define P2P_MAX_REG_CLASSES 15
 
 /**
  * P2P_MAX_REG_CLASS_CHANNELS - Maximum number of channels per regulatory class
@@ -99,6 +99,10 @@ struct p2p_go_neg_results {
 
 	int vht;
 
+	u8 max_oper_chwidth;
+
+	unsigned int vht_center_freq2;
+
 	/**
 	 * ssid - SSID of the group
 	 */
@@ -224,6 +228,16 @@ struct p2ps_provision {
 	u8 cpt_priority[P2PS_FEATURE_CAPAB_CPT_MAX + 1];
 
 	/**
+	 * force_freq - The only allowed channel frequency in MHz or 0.
+	 */
+	unsigned int force_freq;
+
+	/**
+	 * pref_freq - Preferred operating frequency in MHz or 0.
+	 */
+	unsigned int pref_freq;
+
+	/**
 	 * info - Vendor defined extra Provisioning information
 	 */
 	char info[0];
@@ -1024,6 +1038,8 @@ struct p2p_config {
 	 * @ssid_len: Buffer for returning length of @ssid
 	 * @group_iface: Buffer for returning whether a separate group interface
 	 *	would be used
+	 * @freq: Variable for returning the current operating frequency of a
+	 *	currently running P2P GO.
 	 * Returns: 1 if GO info found, 0 otherwise
 	 *
 	 * This is used to compose New Group settings (SSID, and intended
@@ -1031,7 +1047,8 @@ struct p2p_config {
 	 * result in our being an autonomous GO.
 	 */
 	int (*get_go_info)(void *ctx, u8 *intended_addr,
-			   u8 *ssid, size_t *ssid_len, int *group_iface);
+			   u8 *ssid, size_t *ssid_len, int *group_iface,
+			   unsigned int *freq);
 
 	/**
 	 * remove_stale_groups - Remove stale P2PS groups
@@ -1056,7 +1073,9 @@ struct p2p_config {
 				   const u8 *persist_ssid,
 				   size_t persist_ssid_size, int response_done,
 				   int prov_start, const char *session_info,
-				   const u8 *feat_cap, size_t feat_cap_len);
+				   const u8 *feat_cap, size_t feat_cap_len,
+				   unsigned int freq, const u8 *group_ssid,
+				   size_t group_ssid_len);
 
 	/**
 	 * prov_disc_resp_cb - Callback for indicating completion of PD Response
@@ -1070,14 +1089,20 @@ struct p2p_config {
 
 	/**
 	 * p2ps_group_capability - Determine group capability
+	 * @ctx: Callback context from cb_ctx
+	 * @incoming: Peer requested roles, expressed with P2PS_SETUP_* bitmap.
+	 * @role: Local roles, expressed with P2PS_SETUP_* bitmap.
+	 * @force_freq: Variable for returning forced frequency for the group.
+	 * @pref_freq: Variable for returning preferred frequency for the group.
+	 * Returns: P2PS_SETUP_* bitmap of group capability result.
 	 *
-	 * This function can be used to determine group capability based on
-	 * information from P2PS PD exchange and the current state of ongoing
-	 * groups and driver capabilities.
-	 *
-	 * P2PS_SETUP_* bitmap is used as the parameters and return value.
+	 * This function can be used to determine group capability and
+	 * frequencies based on information from P2PS PD exchange and the
+	 * current state of ongoing groups and driver capabilities.
 	 */
-	u8 (*p2ps_group_capability)(void *ctx, u8 incoming, u8 role);
+	u8 (*p2ps_group_capability)(void *ctx, u8 incoming, u8 role,
+				    unsigned int *force_freq,
+				    unsigned int *pref_freq);
 
 	/**
 	 * get_pref_freq_list - Get preferred frequency list for an interface
@@ -1530,12 +1555,13 @@ enum p2p_probe_req_status {
  * @ie: Information elements from the Probe Request frame body
  * @ie_len: Length of ie buffer in octets
  * @rx_freq: Probe Request frame RX frequency
+ * @p2p_lo_started: Whether P2P Listen Offload is started
  * Returns: value indicating the type and status of the probe request
  */
 enum p2p_probe_req_status
 p2p_probe_req_rx(struct p2p_data *p2p, const u8 *addr, const u8 *dst,
 		 const u8 *bssid, const u8 *ie, size_t ie_len,
-		 unsigned int rx_freq);
+		 unsigned int rx_freq, int p2p_lo_started);
 
 /**
  * p2p_rx_action - Report received Action frame
@@ -1691,6 +1717,12 @@ struct p2p_group_config {
 	int freq;
 
 	/**
+	 * ip_addr_alloc - Whether IP address allocation within 4-way handshake
+	 *	is supported
+	 */
+	int ip_addr_alloc;
+
+	/**
 	 * cb_ctx - Context to use with callback functions
 	 */
 	void *cb_ctx;
@@ -1877,8 +1909,10 @@ int p2p_assoc_req_ie(struct p2p_data *p2p, const u8 *bssid, u8 *buf,
  * @p2p: P2P module context from p2p_init()
  * @ies: Buffer for writing P2P IE
  * @dev_id: Device ID to search for or %NULL for any
+ * @bands: Frequency bands used in the scan (enum wpa_radio_work_band bitmap)
  */
-void p2p_scan_ie(struct p2p_data *p2p, struct wpabuf *ies, const u8 *dev_id);
+void p2p_scan_ie(struct p2p_data *p2p, struct wpabuf *ies, const u8 *dev_id,
+		 unsigned int bands);
 
 /**
  * p2p_scan_ie_buf_len - Get maximum buffer length needed for p2p_scan_ie
@@ -2100,6 +2134,16 @@ int p2p_client_limit_reached(struct p2p_group *group);
 const u8 * p2p_iterate_group_members(struct p2p_group *group, void **next);
 
 /**
+ * p2p_group_get_client_interface_addr - Get P2P Interface Address of a client in a group
+ * @group: P2P group context from p2p_group_init()
+ * @dev_addr: P2P Device Address of the client
+ * Returns: P2P Interface Address of the client if found or %NULL if no match
+ * found
+ */
+const u8 * p2p_group_get_client_interface_addr(struct p2p_group *group,
+					       const u8 *dev_addr);
+
+/**
  * p2p_group_get_dev_addr - Get a P2P Device Address of a client in a group
  * @group: P2P group context from p2p_group_init()
  * @addr: P2P Interface Address of the client
@@ -2241,7 +2285,7 @@ struct wpabuf * wifi_display_encaps(struct wpabuf *subelems);
  * discovery (p2p_find). A random number of 100 TU units is picked for each
  * Listen state iteration from [min_disc_int,max_disc_int] range.
  *
- * max_disc_tu can be used to futher limit the discoverable duration. However,
+ * max_disc_tu can be used to further limit the discoverable duration. However,
  * it should be noted that use of this parameter is not recommended since it
  * would not be compliant with the P2P specification.
  */
@@ -2340,4 +2384,7 @@ void p2p_set_own_pref_freq_list(struct p2p_data *p2p,
 int p2p_group_get_common_freqs(struct p2p_group *group, int *common_freqs,
 			       unsigned int *num);
 
+struct wpabuf * p2p_build_probe_resp_template(struct p2p_data *p2p,
+					      unsigned int freq);
+
 #endif /* P2P_H */
diff --git a/src/p2p/p2p_build.c b/src/p2p/p2p_build.c
index 793d28ba7bdd2..2882c6ad02e7e 100644
--- a/src/p2p/p2p_build.c
+++ b/src/p2p/p2p_build.c
@@ -202,11 +202,11 @@ void p2p_buf_add_device_info(struct wpabuf *buf, struct p2p_data *p2p,
 	if (peer && peer->wps_method != WPS_NOT_READY) {
 		if (peer->wps_method == WPS_PBC)
 			methods |= WPS_CONFIG_PUSHBUTTON;
+		else if (peer->wps_method == WPS_P2PS)
+			methods |= WPS_CONFIG_P2PS;
 		else if (peer->wps_method == WPS_PIN_DISPLAY ||
-			 peer->wps_method == WPS_PIN_KEYPAD) {
+			 peer->wps_method == WPS_PIN_KEYPAD)
 			methods |= WPS_CONFIG_DISPLAY | WPS_CONFIG_KEYPAD;
-			methods |= WPS_CONFIG_P2PS;
-		}
 	} else if (p2p->cfg->config_methods) {
 		methods |= p2p->cfg->config_methods &
 			(WPS_CONFIG_PUSHBUTTON | WPS_CONFIG_DISPLAY |
diff --git a/src/p2p/p2p_go_neg.c b/src/p2p/p2p_go_neg.c
index 83b43563d945f..9f0b3f3d37a44 100644
--- a/src/p2p/p2p_go_neg.c
+++ b/src/p2p/p2p_go_neg.c
@@ -38,7 +38,7 @@ int p2p_peer_channels_check(struct p2p_data *p2p, struct p2p_channels *own,
 {
 	const u8 *pos, *end;
 	struct p2p_channels *ch;
-	size_t channels;
+	u8 channels;
 	struct p2p_channels intersection;
 
 	ch = &dev->channels;
@@ -58,14 +58,14 @@ int p2p_peer_channels_check(struct p2p_data *p2p, struct p2p_channels *own,
 	}
 	pos += 3;
 
-	while (pos + 2 < end) {
+	while (end - pos > 2) {
 		struct p2p_reg_class *cl = &ch->reg_class[ch->reg_classes];
 		cl->reg_class = *pos++;
-		if (pos + 1 + pos[0] > end) {
+		channels = *pos++;
+		if (channels > end - pos) {
 			p2p_info(p2p, "Invalid peer Channel List");
 			return -1;
 		}
-		channels = *pos++;
 		cl->channels = channels > P2P_MAX_REG_CLASS_CHANNELS ?
 			P2P_MAX_REG_CLASS_CHANNELS : channels;
 		os_memcpy(cl->channel, pos, cl->channels);
@@ -384,7 +384,7 @@ void p2p_reselect_channel(struct p2p_data *p2p,
 	unsigned int i;
 	const int op_classes_5ghz[] = { 124, 125, 115, 0 };
 	const int op_classes_ht40[] = { 126, 127, 116, 117, 0 };
-	const int op_classes_vht[] = { 128, 0 };
+	const int op_classes_vht[] = { 128, 129, 130, 0 };
 
 	if (p2p->own_freq_preference > 0 &&
 	    p2p_freq_to_channel(p2p->own_freq_preference,
@@ -901,6 +901,14 @@ void p2p_process_go_neg_req(struct p2p_data *p2p, const u8 *sa,
 			return;
 		}
 
+		if (dev->go_neg_req_sent &&
+		    (dev->flags & P2P_DEV_PEER_WAITING_RESPONSE)) {
+			p2p_dbg(p2p,
+				"Do not reply since peer is waiting for us to start a new GO Negotiation and GO Neg Request already sent");
+			p2p_parse_free(&msg);
+			return;
+		}
+
 		go = p2p_go_det(p2p->go_intent, *msg.go_intent);
 		if (go < 0) {
 			p2p_dbg(p2p, "Incompatible GO Intent");
@@ -1052,7 +1060,7 @@ fail:
 			P2P_PENDING_GO_NEG_RESPONSE_FAILURE;
 	if (p2p_send_action(p2p, freq, sa, p2p->cfg->dev_addr,
 			    p2p->cfg->dev_addr,
-			    wpabuf_head(resp), wpabuf_len(resp), 500) < 0) {
+			    wpabuf_head(resp), wpabuf_len(resp), 100) < 0) {
 		p2p_dbg(p2p, "Failed to send Action frame");
 	}
 
@@ -1260,6 +1268,11 @@ void p2p_process_go_neg_resp(struct p2p_data *p2p, const u8 *sa,
 		dev->client_timeout = msg.config_timeout[1];
 	}
 
+	if (msg.wfd_subelems) {
+		wpabuf_free(dev->info.wfd_subelems);
+		dev->info.wfd_subelems = wpabuf_dup(msg.wfd_subelems);
+	}
+
 	if (!msg.operating_channel && !go) {
 		/*
 		 * Note: P2P Client may omit Operating Channel attribute to
@@ -1386,7 +1399,7 @@ fail:
 
 	if (p2p_send_action(p2p, freq, sa, p2p->cfg->dev_addr, sa,
 			    wpabuf_head(dev->go_neg_conf),
-			    wpabuf_len(dev->go_neg_conf), 200) < 0) {
+			    wpabuf_len(dev->go_neg_conf), 50) < 0) {
 		p2p_dbg(p2p, "Failed to send Action frame");
 		p2p_go_neg_failed(p2p, -1);
 		p2p->cfg->send_action_done(p2p->cfg->cb_ctx);
diff --git a/src/p2p/p2p_group.c b/src/p2p/p2p_group.c
index 0d66993465686..051b4e391505e 100644
--- a/src/p2p/p2p_group.c
+++ b/src/p2p/p2p_group.c
@@ -155,7 +155,8 @@ static void p2p_group_add_common_ies(struct p2p_group *group,
 		group_capab |= P2P_GROUP_CAPAB_CROSS_CONN;
 	if (group->num_members >= group->cfg->max_clients)
 		group_capab |= P2P_GROUP_CAPAB_GROUP_LIMIT;
-	group_capab |= P2P_GROUP_CAPAB_IP_ADDR_ALLOCATION;
+	if (group->cfg->ip_addr_alloc)
+		group_capab |= P2P_GROUP_CAPAB_IP_ADDR_ALLOCATION;
 	p2p_buf_add_capability(ie, dev_capab, group_capab);
 }
 
@@ -296,14 +297,14 @@ static int wifi_display_add_dev_info_descr(struct wpabuf *buf,
 	os_memset(zero_addr, 0, ETH_ALEN);
 	pos = wpabuf_head_u8(m->wfd_ie);
 	end = pos + wpabuf_len(m->wfd_ie);
-	while (pos + 1 < end) {
+	while (end - pos >= 3) {
 		u8 id;
 		u16 len;
 
 		id = *pos++;
 		len = WPA_GET_BE16(pos);
 		pos += 2;
-		if (pos + len > end)
+		if (len > end - pos)
 			break;
 
 		switch (id) {
@@ -849,6 +850,20 @@ static struct p2p_group_member * p2p_group_get_client(struct p2p_group *group,
 }
 
 
+const u8 * p2p_group_get_client_interface_addr(struct p2p_group *group,
+					       const u8 *dev_addr)
+{
+	struct p2p_group_member *m;
+
+	if (!group)
+		return NULL;
+	m = p2p_group_get_client(group, dev_addr);
+	if (m)
+		return m->addr;
+	return NULL;
+}
+
+
 static struct p2p_group_member * p2p_group_get_client_iface(
 	struct p2p_group *group, const u8 *interface_addr)
 {
@@ -1097,7 +1112,7 @@ int p2p_group_get_common_freqs(struct p2p_group *group, int *common_freqs,
 		struct p2p_device *dev;
 
 		dev = p2p_get_device(group->p2p, m->dev_addr);
-		if (!dev)
+		if (!dev || dev->channels.reg_classes == 0)
 			continue;
 
 		p2p_channels_intersect(&intersect, &dev->channels, &res);
diff --git a/src/p2p/p2p_i.h b/src/p2p/p2p_i.h
index 0ce4058fe3e69..47524d4991a5a 100644
--- a/src/p2p/p2p_i.h
+++ b/src/p2p/p2p_i.h
@@ -308,6 +308,18 @@ struct p2p_data {
 	 */
 	int num_p2p_sd_queries;
 
+	/**
+	 * sd_query_no_ack - The first peer (Dev Addr) that did not ACK SD Query
+	 *
+	 * This is used to track the first peer that did not ACK an SD Query
+	 * within a single P2P Search iteration. All zeros address means no such
+	 * peer was yet seen. This information is used to allow a new Listen and
+	 * Search phases to be once every pending SD Query has been sent once to
+	 * each peer instead of looping all pending attempts continuously until
+	 * running out of retry maximums.
+	 */
+	u8 sd_query_no_ack[ETH_ALEN];
+
 	/* GO Negotiation data */
 
 	/**
@@ -691,6 +703,8 @@ int p2p_channel_random_social(struct p2p_channels *chans, u8 *op_class,
 			      u8 *op_channel);
 
 /* p2p_parse.c */
+void p2p_copy_filter_devname(char *dst, size_t dst_len,
+			     const void *src, size_t src_len);
 int p2p_parse_p2p_ie(const struct wpabuf *buf, struct p2p_message *msg);
 int p2p_parse_ies(const u8 *data, size_t len, struct p2p_message *msg);
 int p2p_parse(const u8 *data, size_t len, struct p2p_message *msg);
diff --git a/src/p2p/p2p_invitation.c b/src/p2p/p2p_invitation.c
index 108e5b7f93e4d..bbba001a7c930 100644
--- a/src/p2p/p2p_invitation.c
+++ b/src/p2p/p2p_invitation.c
@@ -284,7 +284,7 @@ void p2p_process_invitation_req(struct p2p_data *p2p, const u8 *sa,
 
 		if (!p2p_channels_includes(&intersection, reg_class, channel))
 		{
-			p2p_dbg(p2p, "forced freq %d MHz not in the supported channels interaction",
+			p2p_dbg(p2p, "forced freq %d MHz not in the supported channels intersection",
 				op_freq);
 			status = P2P_SC_FAIL_NO_COMMON_CHANNELS;
 			goto fail;
@@ -418,7 +418,7 @@ fail:
 	p2p->pending_action_state = P2P_PENDING_INVITATION_RESPONSE;
 	if (p2p_send_action(p2p, freq, sa, p2p->cfg->dev_addr,
 			    p2p->cfg->dev_addr,
-			    wpabuf_head(resp), wpabuf_len(resp), 200) < 0) {
+			    wpabuf_head(resp), wpabuf_len(resp), 50) < 0) {
 		p2p_dbg(p2p, "Failed to send Action frame");
 	}
 
diff --git a/src/p2p/p2p_parse.c b/src/p2p/p2p_parse.c
index bd1e68bd42417..5d2299cb25c2e 100644
--- a/src/p2p/p2p_parse.c
+++ b/src/p2p/p2p_parse.c
@@ -15,11 +15,29 @@
 #include "p2p_i.h"
 
 
+void p2p_copy_filter_devname(char *dst, size_t dst_len,
+			     const void *src, size_t src_len)
+{
+	size_t i;
+
+	if (src_len >= dst_len)
+		src_len = dst_len - 1;
+	os_memcpy(dst, src, src_len);
+	dst[src_len] = '\0';
+	for (i = 0; i < src_len; i++) {
+		if (dst[i] == '\0')
+			break;
+		if (is_ctrl_char(dst[i]))
+			dst[i] = '_';
+	}
+}
+
+
 static int p2p_parse_attribute(u8 id, const u8 *data, u16 len,
 			       struct p2p_message *msg)
 {
 	const u8 *pos;
-	size_t i, nlen;
+	u16 nlen;
 	char devtype[WPS_DEV_TYPE_BUFSIZE];
 
 	switch (id) {
@@ -149,21 +167,14 @@ static int p2p_parse_attribute(u8 id, const u8 *data, u16 len,
 		pos += 2;
 		nlen = WPA_GET_BE16(pos);
 		pos += 2;
-		if (data + len - pos < (int) nlen ||
-		    nlen > WPS_DEV_NAME_MAX_LEN) {
+		if (nlen > data + len - pos || nlen > WPS_DEV_NAME_MAX_LEN) {
 			wpa_printf(MSG_DEBUG, "P2P: Invalid Device Name "
-				   "length %d (buf len %d)", (int) nlen,
+				   "length %u (buf len %d)", nlen,
 				   (int) (data + len - pos));
 			return -1;
 		}
-		os_memcpy(msg->device_name, pos, nlen);
-		msg->device_name[nlen] = '\0';
-		for (i = 0; i < nlen; i++) {
-			if (msg->device_name[i] == '\0')
-				break;
-			if (is_ctrl_char(msg->device_name[i]))
-				msg->device_name[i] = '_';
-		}
+		p2p_copy_filter_devname(msg->device_name,
+					sizeof(msg->device_name), pos, nlen);
 		wpa_printf(MSG_DEBUG, "P2P: * Device Info: addr " MACSTR
 			   " primary device type %s device name '%s' "
 			   "config methods 0x%x",
@@ -637,49 +648,48 @@ int p2p_group_info_parse(const u8 *gi, size_t gi_len,
 	gend = gi + gi_len;
 	while (g < gend) {
 		struct p2p_client_info *cli;
-		const u8 *t, *cend;
-		int count;
+		const u8 *cend;
+		u16 count;
+		u8 len;
 
 		cli = &info->client[info->num_clients];
-		cend = g + 1 + g[0];
-		if (cend > gend)
+		len = *g++;
+		if (len > gend - g || len < 2 * ETH_ALEN + 1 + 2 + 8 + 1)
 			return -1; /* invalid data */
+		cend = g + len;
 		/* g at start of P2P Client Info Descriptor */
-		/* t at Device Capability Bitmap */
-		t = g + 1 + 2 * ETH_ALEN;
-		if (t > cend)
-			return -1; /* invalid data */
-		cli->p2p_device_addr = g + 1;
-		cli->p2p_interface_addr = g + 1 + ETH_ALEN;
-		cli->dev_capab = t[0];
-
-		if (t + 1 + 2 + 8 + 1 > cend)
-			return -1; /* invalid data */
-
-		cli->config_methods = WPA_GET_BE16(&t[1]);
-		cli->pri_dev_type = &t[3];
-
-		t += 1 + 2 + 8;
-		/* t at Number of Secondary Device Types */
-		cli->num_sec_dev_types = *t++;
-		if (t + 8 * cli->num_sec_dev_types > cend)
+		cli->p2p_device_addr = g;
+		g += ETH_ALEN;
+		cli->p2p_interface_addr = g;
+		g += ETH_ALEN;
+		cli->dev_capab = *g++;
+
+		cli->config_methods = WPA_GET_BE16(g);
+		g += 2;
+		cli->pri_dev_type = g;
+		g += 8;
+
+		/* g at Number of Secondary Device Types */
+		len = *g++;
+		if (8 * len > cend - g)
 			return -1; /* invalid data */
-		cli->sec_dev_types = t;
-		t += 8 * cli->num_sec_dev_types;
+		cli->num_sec_dev_types = len;
+		cli->sec_dev_types = g;
+		g += 8 * len;
 
-		/* t at Device Name in WPS TLV format */
-		if (t + 2 + 2 > cend)
+		/* g at Device Name in WPS TLV format */
+		if (cend - g < 2 + 2)
 			return -1; /* invalid data */
-		if (WPA_GET_BE16(t) != ATTR_DEV_NAME)
+		if (WPA_GET_BE16(g) != ATTR_DEV_NAME)
 			return -1; /* invalid Device Name TLV */
-		t += 2;
-		count = WPA_GET_BE16(t);
-		t += 2;
-		if (count > cend - t)
+		g += 2;
+		count = WPA_GET_BE16(g);
+		g += 2;
+		if (count > cend - g)
 			return -1; /* invalid Device Name TLV */
 		if (count >= WPS_DEV_NAME_MAX_LEN)
 			count = WPS_DEV_NAME_MAX_LEN;
-		cli->dev_name = (const char *) t;
+		cli->dev_name = (const char *) g;
 		cli->dev_name_len = count;
 
 		g = cend;
diff --git a/src/p2p/p2p_pd.c b/src/p2p/p2p_pd.c
index 890094551821a..93a0535f873a0 100644
--- a/src/p2p/p2p_pd.c
+++ b/src/p2p/p2p_pd.c
@@ -40,21 +40,31 @@ static void p2p_build_wps_ie_config_methods(struct wpabuf *buf,
 }
 
 
-static void p2ps_add_new_group_info(struct p2p_data *p2p, struct wpabuf *buf)
+static void p2ps_add_new_group_info(struct p2p_data *p2p,
+				    struct p2p_device *dev,
+				    struct wpabuf *buf)
 {
 	int found;
 	u8 intended_addr[ETH_ALEN];
 	u8 ssid[SSID_MAX_LEN];
 	size_t ssid_len;
 	int group_iface;
+	unsigned int force_freq;
 
 	if (!p2p->cfg->get_go_info)
 		return;
 
 	found = p2p->cfg->get_go_info(
 		p2p->cfg->cb_ctx, intended_addr, ssid,
-		&ssid_len, &group_iface);
+		&ssid_len, &group_iface, &force_freq);
 	if (found) {
+		if (force_freq > 0) {
+			p2p->p2ps_prov->force_freq = force_freq;
+			p2p->p2ps_prov->pref_freq = 0;
+
+			if (dev)
+				p2p_prepare_channel(p2p, dev, force_freq, 0, 0);
+		}
 		p2p_buf_add_group_id(buf, p2p->cfg->dev_addr,
 				     ssid, ssid_len);
 
@@ -92,62 +102,62 @@ static void p2ps_add_pd_req_attrs(struct p2p_data *p2p, struct p2p_device *dev,
 	size_t ssid_len;
 	u8 go_dev_addr[ETH_ALEN];
 	u8 intended_addr[ETH_ALEN];
+	int follow_on_req_fail = prov->status >= 0 &&
+		prov->status != P2P_SC_SUCCESS_DEFERRED;
 
 	/* If we might be explicite group owner, add GO details */
-	if (prov->conncap & (P2PS_SETUP_GROUP_OWNER |
-			     P2PS_SETUP_NEW))
-		p2ps_add_new_group_info(p2p, buf);
+	if (!follow_on_req_fail &&
+	    (prov->conncap & (P2PS_SETUP_GROUP_OWNER | P2PS_SETUP_NEW)))
+		p2ps_add_new_group_info(p2p, dev, buf);
 
 	if (prov->status >= 0)
 		p2p_buf_add_status(buf, (u8) prov->status);
 	else
 		prov->method = config_methods;
 
-	if (p2p->cfg->get_persistent_group) {
-		shared_group = p2p->cfg->get_persistent_group(
-			p2p->cfg->cb_ctx, dev->info.p2p_device_addr, NULL, 0,
-			go_dev_addr, ssid, &ssid_len, intended_addr);
-	}
-
-	/* Add Operating Channel if conncap includes GO */
-	if (shared_group ||
-	    (prov->conncap & (P2PS_SETUP_GROUP_OWNER |
-			      P2PS_SETUP_NEW))) {
-		u8 tmp;
+	if (!follow_on_req_fail) {
+		if (p2p->cfg->get_persistent_group) {
+			shared_group = p2p->cfg->get_persistent_group(
+				p2p->cfg->cb_ctx, dev->info.p2p_device_addr,
+				NULL, 0, go_dev_addr, ssid, &ssid_len,
+				intended_addr);
+		}
 
-		p2p_go_select_channel(p2p, dev, &tmp);
+		if (shared_group ||
+		    (prov->conncap & (P2PS_SETUP_CLIENT | P2PS_SETUP_NEW)))
+			p2p_buf_add_channel_list(buf, p2p->cfg->country,
+						 &p2p->channels);
 
-		if (p2p->op_reg_class && p2p->op_channel)
+		if ((shared_group && !is_zero_ether_addr(intended_addr)) ||
+		    (prov->conncap & (P2PS_SETUP_GROUP_OWNER | P2PS_SETUP_NEW)))
 			p2p_buf_add_operating_channel(buf, p2p->cfg->country,
 						      p2p->op_reg_class,
 						      p2p->op_channel);
-		else
-			p2p_buf_add_operating_channel(buf, p2p->cfg->country,
-						      p2p->cfg->op_reg_class,
-						      p2p->cfg->op_channel);
 	}
 
-	p2p_buf_add_channel_list(buf, p2p->cfg->country, &p2p->cfg->channels);
-
-	if (prov->info[0])
+	if (prov->status < 0 && prov->info[0])
 		p2p_buf_add_session_info(buf, prov->info);
 
-	p2p_buf_add_connection_capability(buf, prov->conncap);
+	if (!follow_on_req_fail)
+		p2p_buf_add_connection_capability(buf, prov->conncap);
 
 	p2p_buf_add_advertisement_id(buf, prov->adv_id, prov->adv_mac);
 
-	if (shared_group || prov->conncap == P2PS_SETUP_NEW ||
-	    prov->conncap ==
-	    (P2PS_SETUP_GROUP_OWNER | P2PS_SETUP_NEW) ||
-	    prov->conncap ==
-	    (P2PS_SETUP_GROUP_OWNER | P2PS_SETUP_CLIENT)) {
-		/* Add Config Timeout */
-		p2p_buf_add_config_timeout(buf, p2p->go_timeout,
-					   p2p->client_timeout);
-	}
+	if (!follow_on_req_fail) {
+		if (shared_group || prov->conncap == P2PS_SETUP_NEW ||
+		    prov->conncap ==
+		    (P2PS_SETUP_GROUP_OWNER | P2PS_SETUP_NEW) ||
+		    prov->conncap ==
+		    (P2PS_SETUP_GROUP_OWNER | P2PS_SETUP_CLIENT)) {
+			/* Add Config Timeout */
+			p2p_buf_add_config_timeout(buf, p2p->go_timeout,
+						   p2p->client_timeout);
+		}
 
-	p2p_buf_add_listen_channel(buf, p2p->cfg->country, p2p->cfg->reg_class,
-				   p2p->cfg->channel);
+		p2p_buf_add_listen_channel(buf, p2p->cfg->country,
+					   p2p->cfg->reg_class,
+					   p2p->cfg->channel);
+	}
 
 	p2p_buf_add_session_id(buf, prov->session_id, prov->session_mac);
 
@@ -285,6 +295,11 @@ static struct wpabuf * p2p_build_prov_disc_resp(struct p2p_data *p2p,
 		u8 *len = p2p_buf_add_ie_hdr(buf);
 		struct p2ps_provision *prov = p2p->p2ps_prov;
 		u8 group_capab;
+		u8 conncap = 0;
+
+		if (status == P2P_SC_SUCCESS ||
+		    status == P2P_SC_SUCCESS_DEFERRED)
+			conncap = prov->conncap;
 
 		if (!status && prov->status != -1)
 			status = prov->status;
@@ -301,7 +316,7 @@ static struct wpabuf * p2p_build_prov_disc_resp(struct p2p_data *p2p,
 				       group_capab);
 		p2p_buf_add_device_info(buf, p2p, NULL);
 
-		if (persist_ssid && p2p->cfg->get_persistent_group &&
+		if (persist_ssid && p2p->cfg->get_persistent_group && dev &&
 		    (status == P2P_SC_SUCCESS ||
 		     status == P2P_SC_SUCCESS_DEFERRED)) {
 			u8 ssid[SSID_MAX_LEN];
@@ -323,16 +338,11 @@ static struct wpabuf * p2p_build_prov_disc_resp(struct p2p_data *p2p,
 			}
 		}
 
-		if (!persist && (prov->conncap & P2PS_SETUP_GROUP_OWNER))
-			p2ps_add_new_group_info(p2p, buf);
+		if (!persist && (conncap & P2PS_SETUP_GROUP_OWNER))
+			p2ps_add_new_group_info(p2p, dev, buf);
 
 		/* Add Operating Channel if conncap indicates GO */
-		if (persist || (prov->conncap & P2PS_SETUP_GROUP_OWNER)) {
-			u8 tmp;
-
-			if (dev)
-				p2p_go_select_channel(p2p, dev, &tmp);
-
+		if (persist || (conncap & P2PS_SETUP_GROUP_OWNER)) {
 			if (p2p->op_reg_class && p2p->op_channel)
 				p2p_buf_add_operating_channel(
 					buf, p2p->cfg->country,
@@ -345,17 +355,20 @@ static struct wpabuf * p2p_build_prov_disc_resp(struct p2p_data *p2p,
 					p2p->cfg->op_channel);
 		}
 
-		p2p_buf_add_channel_list(buf, p2p->cfg->country,
-					 &p2p->cfg->channels);
+		if (persist ||
+		    (conncap & (P2PS_SETUP_CLIENT | P2PS_SETUP_GROUP_OWNER)))
+			p2p_buf_add_channel_list(buf, p2p->cfg->country,
+						 &p2p->channels);
 
-		if (!persist && (status == P2P_SC_SUCCESS ||
-				 status == P2P_SC_SUCCESS_DEFERRED))
-			p2p_buf_add_connection_capability(buf, prov->conncap);
+		if (!persist && conncap)
+			p2p_buf_add_connection_capability(buf, conncap);
 
 		p2p_buf_add_advertisement_id(buf, adv_id, prov->adv_mac);
 
-		p2p_buf_add_config_timeout(buf, p2p->go_timeout,
-					   p2p->client_timeout);
+		if (persist ||
+		    (conncap & (P2PS_SETUP_CLIENT | P2PS_SETUP_GROUP_OWNER)))
+			p2p_buf_add_config_timeout(buf, p2p->go_timeout,
+						   p2p->client_timeout);
 
 		p2p_buf_add_session_id(buf, prov->session_id,
 				       prov->session_mac);
@@ -427,6 +440,117 @@ static u8 p2ps_own_preferred_cpt(const u8 *cpt_priority, u8 req_cpt_mask)
 }
 
 
+/* Check if the message contains a valid P2PS PD Request */
+static int p2ps_validate_pd_req(struct p2p_data *p2p, struct p2p_message *msg,
+				const u8 *addr)
+{
+	u8 group_id = 0;
+	u8 intended_addr = 0;
+	u8 operating_channel = 0;
+	u8 channel_list = 0;
+	u8 config_timeout = 0;
+	u8 listen_channel = 0;
+
+#define P2PS_PD_REQ_CHECK(_val, _attr) \
+do { \
+	if ((_val) && !msg->_attr) { \
+		p2p_dbg(p2p, "Not P2PS PD Request. Missing %s", #_attr); \
+		return -1; \
+	} \
+} while (0)
+
+	P2PS_PD_REQ_CHECK(1, adv_id);
+	P2PS_PD_REQ_CHECK(1, session_id);
+	P2PS_PD_REQ_CHECK(1, session_mac);
+	P2PS_PD_REQ_CHECK(1, adv_mac);
+	P2PS_PD_REQ_CHECK(1, capability);
+	P2PS_PD_REQ_CHECK(1, p2p_device_info);
+	P2PS_PD_REQ_CHECK(1, feature_cap);
+
+	/*
+	 * We don't need to check Connection Capability, Persistent Group,
+	 * and related attributes for follow-on PD Request with a status
+	 * other than SUCCESS_DEFERRED.
+	 */
+	if (msg->status && *msg->status != P2P_SC_SUCCESS_DEFERRED)
+		return 0;
+
+	P2PS_PD_REQ_CHECK(1, conn_cap);
+
+	/*
+	 * Note 1: A feature capability attribute structure can be changed
+	 * in the future. The assumption is that such modifications are
+	 * backward compatible, therefore we allow processing of msg.feature_cap
+	 * exceeding the size of the p2ps_feature_capab structure.
+	 * Note 2: Verification of msg.feature_cap_len below has to be changed
+	 * to allow 2 byte feature capability processing if
+	 * struct p2ps_feature_capab is extended to include additional fields
+	 * and it affects the structure size.
+	 */
+	if (msg->feature_cap_len < sizeof(struct p2ps_feature_capab)) {
+		p2p_dbg(p2p, "P2PS: Invalid feature capability len");
+		return -1;
+	}
+
+	switch (*msg->conn_cap) {
+	case P2PS_SETUP_NEW:
+		group_id = 1;
+		intended_addr = 1;
+		operating_channel = 1;
+		channel_list = 1;
+		config_timeout = 1;
+		listen_channel = 1;
+		break;
+	case P2PS_SETUP_CLIENT:
+		channel_list = 1;
+		listen_channel = 1;
+		break;
+	case P2PS_SETUP_GROUP_OWNER:
+		group_id = 1;
+		intended_addr = 1;
+		operating_channel = 1;
+		break;
+	case P2PS_SETUP_NEW | P2PS_SETUP_GROUP_OWNER:
+		group_id = 1;
+		operating_channel = 1;
+		intended_addr = 1;
+		channel_list = 1;
+		config_timeout = 1;
+		break;
+	case P2PS_SETUP_CLIENT | P2PS_SETUP_GROUP_OWNER:
+		group_id = 1;
+		intended_addr = 1;
+		operating_channel = 1;
+		channel_list = 1;
+		config_timeout = 1;
+		break;
+	default:
+		p2p_dbg(p2p, "Invalid P2PS PD connection capability");
+		return -1;
+	}
+
+	if (msg->persistent_dev) {
+		channel_list = 1;
+		config_timeout = 1;
+		if (os_memcmp(msg->persistent_dev, addr, ETH_ALEN) == 0) {
+			intended_addr = 1;
+			operating_channel = 1;
+		}
+	}
+
+	P2PS_PD_REQ_CHECK(group_id, group_id);
+	P2PS_PD_REQ_CHECK(intended_addr, intended_addr);
+	P2PS_PD_REQ_CHECK(operating_channel, operating_channel);
+	P2PS_PD_REQ_CHECK(channel_list, channel_list);
+	P2PS_PD_REQ_CHECK(config_timeout, config_timeout);
+	P2PS_PD_REQ_CHECK(listen_channel, listen_channel);
+
+#undef P2PS_PD_REQ_CHECK
+
+	return 0;
+}
+
+
 void p2p_process_prov_disc_req(struct p2p_data *p2p, const u8 *sa,
 			       const u8 *data, size_t len, int rx_freq)
 {
@@ -440,14 +564,16 @@ void p2p_process_prov_disc_req(struct p2p_data *p2p, const u8 *sa,
 	u8 conncap = P2PS_SETUP_NEW;
 	u8 auto_accept = 0;
 	u32 session_id = 0;
-	u8 session_mac[ETH_ALEN];
-	u8 adv_mac[ETH_ALEN];
+	u8 session_mac[ETH_ALEN] = { 0, 0, 0, 0, 0, 0 };
+	u8 adv_mac[ETH_ALEN] = { 0, 0, 0, 0, 0, 0 };
 	const u8 *group_mac;
 	int passwd_id = DEV_PW_DEFAULT;
 	u16 config_methods;
 	u16 allowed_config_methods = WPS_CONFIG_DISPLAY | WPS_CONFIG_KEYPAD;
 	struct p2ps_feature_capab resp_fcap = { 0, 0 };
-	struct p2ps_feature_capab *req_fcap;
+	struct p2ps_feature_capab *req_fcap = NULL;
+	u8 remote_conncap;
+	u16 method;
 
 	if (p2p_parse(data, len, &msg))
 		return;
@@ -466,300 +592,431 @@ void p2p_process_prov_disc_req(struct p2p_data *p2p, const u8 *sa,
 				   0)) {
 			p2p_dbg(p2p, "Provision Discovery Request add device failed "
 				MACSTR, MAC2STR(sa));
+			goto out;
+		}
+
+		if (!dev) {
+			dev = p2p_get_device(p2p, sa);
+			if (!dev) {
+				p2p_dbg(p2p,
+					"Provision Discovery device not found "
+					MACSTR, MAC2STR(sa));
+				goto out;
+			}
 		}
 	} else if (msg.wfd_subelems) {
 		wpabuf_free(dev->info.wfd_subelems);
 		dev->info.wfd_subelems = wpabuf_dup(msg.wfd_subelems);
 	}
 
-	if (msg.adv_id)
-		allowed_config_methods |= WPS_CONFIG_P2PS;
-	else
+	if (!msg.adv_id) {
 		allowed_config_methods |= WPS_CONFIG_PUSHBUTTON;
+		if (!(msg.wps_config_methods & allowed_config_methods)) {
+			p2p_dbg(p2p,
+				"Unsupported Config Methods in Provision Discovery Request");
+			goto out;
+		}
 
-	if (!(msg.wps_config_methods & allowed_config_methods)) {
-		p2p_dbg(p2p, "Unsupported Config Methods in Provision Discovery Request");
-		goto out;
-	}
+		/* Legacy (non-P2PS) - Unknown groups allowed for P2PS */
+		if (msg.group_id) {
+			size_t i;
 
-	/* Legacy (non-P2PS) - Unknown groups allowed for P2PS */
-	if (!msg.adv_id && msg.group_id) {
-		size_t i;
-		for (i = 0; i < p2p->num_groups; i++) {
-			if (p2p_group_is_group_id_match(p2p->groups[i],
-							msg.group_id,
-							msg.group_id_len))
-				break;
+			for (i = 0; i < p2p->num_groups; i++) {
+				if (p2p_group_is_group_id_match(
+					    p2p->groups[i],
+					    msg.group_id, msg.group_id_len))
+					break;
+			}
+			if (i == p2p->num_groups) {
+				p2p_dbg(p2p,
+					"PD request for unknown P2P Group ID - reject");
+				goto out;
+			}
 		}
-		if (i == p2p->num_groups) {
-			p2p_dbg(p2p, "PD request for unknown P2P Group ID - reject");
+	} else {
+		allowed_config_methods |= WPS_CONFIG_P2PS;
+
+		/*
+		 * Set adv_id here, so in case of an error, a P2PS PD Response
+		 * will be sent.
+		 */
+		adv_id = WPA_GET_LE32(msg.adv_id);
+		if (p2ps_validate_pd_req(p2p, &msg, sa) < 0) {
+			reject = P2P_SC_FAIL_INVALID_PARAMS;
 			goto out;
 		}
-	}
 
-	if (dev) {
-		dev->flags &= ~(P2P_DEV_PD_PEER_DISPLAY |
-				P2P_DEV_PD_PEER_KEYPAD |
-				P2P_DEV_PD_PEER_P2PS);
+		req_fcap = (struct p2ps_feature_capab *) msg.feature_cap;
 
-		/* Remove stale persistent groups */
-		if (p2p->cfg->remove_stale_groups) {
-			p2p->cfg->remove_stale_groups(
-				p2p->cfg->cb_ctx, dev->info.p2p_device_addr,
-				msg.persistent_dev,
-				msg.persistent_ssid, msg.persistent_ssid_len);
+		os_memcpy(session_mac, msg.session_mac, ETH_ALEN);
+		os_memcpy(adv_mac, msg.adv_mac, ETH_ALEN);
+
+		session_id = WPA_GET_LE32(msg.session_id);
+
+		if (msg.conn_cap)
+			conncap = *msg.conn_cap;
+
+		/*
+		 * We need to verify a P2PS config methog in an initial PD
+		 * request or in a follow-on PD request with the status
+		 * SUCCESS_DEFERRED.
+		 */
+		if ((!msg.status || *msg.status == P2P_SC_SUCCESS_DEFERRED) &&
+		    !(msg.wps_config_methods & allowed_config_methods)) {
+			p2p_dbg(p2p,
+				"Unsupported Config Methods in Provision Discovery Request");
+			goto out;
 		}
+
+		/*
+		 * TODO: since we don't support multiple PD, reject PD request
+		 * if we are in the middle of P2PS PD with some other peer
+		 */
 	}
+
+	dev->flags &= ~(P2P_DEV_PD_PEER_DISPLAY |
+			P2P_DEV_PD_PEER_KEYPAD |
+			P2P_DEV_PD_PEER_P2PS);
+
 	if (msg.wps_config_methods & WPS_CONFIG_DISPLAY) {
 		p2p_dbg(p2p, "Peer " MACSTR
 			" requested us to show a PIN on display", MAC2STR(sa));
-		if (dev)
-			dev->flags |= P2P_DEV_PD_PEER_KEYPAD;
+		dev->flags |= P2P_DEV_PD_PEER_KEYPAD;
 		passwd_id = DEV_PW_USER_SPECIFIED;
 	} else if (msg.wps_config_methods & WPS_CONFIG_KEYPAD) {
 		p2p_dbg(p2p, "Peer " MACSTR
 			" requested us to write its PIN using keypad",
 			MAC2STR(sa));
-		if (dev)
-			dev->flags |= P2P_DEV_PD_PEER_DISPLAY;
+		dev->flags |= P2P_DEV_PD_PEER_DISPLAY;
 		passwd_id = DEV_PW_REGISTRAR_SPECIFIED;
 	} else if (msg.wps_config_methods & WPS_CONFIG_P2PS) {
 		p2p_dbg(p2p, "Peer " MACSTR " requesting P2PS PIN",
 			MAC2STR(sa));
-		if (dev)
-			dev->flags |= P2P_DEV_PD_PEER_P2PS;
+		dev->flags |= P2P_DEV_PD_PEER_P2PS;
 		passwd_id = DEV_PW_P2PS_DEFAULT;
 	}
 
-	reject = P2P_SC_SUCCESS;
+	/* Remove stale persistent groups */
+	if (p2p->cfg->remove_stale_groups) {
+		p2p->cfg->remove_stale_groups(
+			p2p->cfg->cb_ctx, dev->info.p2p_device_addr,
+			msg.persistent_dev,
+			msg.persistent_ssid, msg.persistent_ssid_len);
+	}
 
-	os_memset(session_mac, 0, ETH_ALEN);
-	os_memset(adv_mac, 0, ETH_ALEN);
+	reject = P2P_SC_SUCCESS;
 
-	/* Note 1: A feature capability attribute structure can be changed
-	 * in the future. The assumption is that such modifications are
-	 * backwards compatible, therefore we allow processing of
-	 * msg.feature_cap exceeding the size of the p2ps_feature_capab
-	 * structure.
-	 * Note 2: Vverification of msg.feature_cap_len below has to be changed
-	 * to allow 2 byte feature capability processing if struct
-	 * p2ps_feature_capab is extended to include additional fields and it
-	 * affects the structure size.
+	/*
+	 * End of a legacy P2P PD Request processing, from this point continue
+	 * with P2PS one.
 	 */
-	if (msg.adv_id && msg.session_id && msg.session_mac && msg.adv_mac &&
-	    msg.feature_cap && msg.feature_cap_len >= sizeof(*req_fcap) &&
-	    (msg.status || msg.conn_cap)) {
-		u8 remote_conncap;
+	if (!msg.adv_id)
+		goto out;
 
-		req_fcap = (struct p2ps_feature_capab *) msg.feature_cap;
+	remote_conncap = conncap;
 
-		os_memcpy(session_mac, msg.session_mac, ETH_ALEN);
-		os_memcpy(adv_mac, msg.adv_mac, ETH_ALEN);
+	if (!msg.status) {
+		unsigned int forced_freq, pref_freq;
 
-		session_id = WPA_GET_LE32(msg.session_id);
-		adv_id = WPA_GET_LE32(msg.adv_id);
-
-		if (!msg.status)
-			p2ps_adv = p2p_service_p2ps_id(p2p, adv_id);
+		if (os_memcmp(p2p->cfg->dev_addr, msg.adv_mac, ETH_ALEN)) {
+			p2p_dbg(p2p,
+				"P2PS PD adv mac does not match the local one");
+			reject = P2P_SC_FAIL_INCOMPATIBLE_PARAMS;
+			goto out;
+		}
 
-		p2p_dbg(p2p, "adv_id: %x - p2ps_adv - %p", adv_id, p2ps_adv);
+		p2ps_adv = p2p_service_p2ps_id(p2p, adv_id);
+		if (!p2ps_adv) {
+			p2p_dbg(p2p, "P2PS PD invalid adv_id=0x%X", adv_id);
+			reject = P2P_SC_FAIL_INCOMPATIBLE_PARAMS;
+			goto out;
+		}
+		p2p_dbg(p2p, "adv_id: 0x%X, p2ps_adv: %p", adv_id, p2ps_adv);
 
-		if (msg.conn_cap)
-			conncap = *msg.conn_cap;
-		remote_conncap = conncap;
+		auto_accept = p2ps_adv->auto_accept;
+		conncap = p2p->cfg->p2ps_group_capability(p2p->cfg->cb_ctx,
+							  conncap, auto_accept,
+							  &forced_freq,
+							  &pref_freq);
 
-		if (p2ps_adv) {
-			auto_accept = p2ps_adv->auto_accept;
-			conncap = p2p->cfg->p2ps_group_capability(
-				p2p->cfg->cb_ctx, conncap, auto_accept);
+		p2p_dbg(p2p, "Conncap: local:%d remote:%d result:%d",
+			auto_accept, remote_conncap, conncap);
 
-			p2p_dbg(p2p, "Conncap: local:%d remote:%d result:%d",
-				auto_accept, remote_conncap, conncap);
+		p2p_prepare_channel(p2p, dev, forced_freq, pref_freq, 0);
 
-			resp_fcap.cpt =
-				p2ps_own_preferred_cpt(p2ps_adv->cpt_priority,
+		resp_fcap.cpt = p2ps_own_preferred_cpt(p2ps_adv->cpt_priority,
 						       req_fcap->cpt);
 
+		p2p_dbg(p2p, "cpt: service:0x%x remote:0x%x result:0x%x",
+			p2ps_adv->cpt_mask, req_fcap->cpt, resp_fcap.cpt);
+
+		if (!resp_fcap.cpt) {
+			p2p_dbg(p2p,
+				"Incompatible P2PS feature capability CPT bitmask");
+			reject = P2P_SC_FAIL_INCOMPATIBLE_PARAMS;
+		} else if (p2ps_adv->config_methods &&
+			   !(msg.wps_config_methods &
+			     p2ps_adv->config_methods)) {
 			p2p_dbg(p2p,
-				"cpt: service:0x%x remote:0x%x result:0x%x",
-				p2ps_adv->cpt_mask, req_fcap->cpt,
-				resp_fcap.cpt);
+				"Unsupported config methods in Provision Discovery Request (own=0x%x peer=0x%x)",
+				p2ps_adv->config_methods,
+				msg.wps_config_methods);
+			reject = P2P_SC_FAIL_INCOMPATIBLE_PARAMS;
+		} else if (!p2ps_adv->state) {
+			p2p_dbg(p2p, "P2PS state unavailable");
+			reject = P2P_SC_FAIL_UNABLE_TO_ACCOMMODATE;
+		} else if (!conncap) {
+			p2p_dbg(p2p, "Conncap resolution failed");
+			reject = P2P_SC_FAIL_INCOMPATIBLE_PARAMS;
+		}
 
-			if (!resp_fcap.cpt) {
-				p2p_dbg(p2p,
-					"Incompatible P2PS feature capability CPT bitmask");
-				reject = P2P_SC_FAIL_INCOMPATIBLE_PARAMS;
-			} else if (p2ps_adv->config_methods &&
-				   !(msg.wps_config_methods &
-				   p2ps_adv->config_methods)) {
-				p2p_dbg(p2p,
-					"Unsupported config methods in Provision Discovery Request (own=0x%x peer=0x%x)",
-					p2ps_adv->config_methods,
-					msg.wps_config_methods);
-				reject = P2P_SC_FAIL_INCOMPATIBLE_PARAMS;
-			} else if (!p2ps_adv->state) {
-				p2p_dbg(p2p, "P2PS state unavailable");
-				reject = P2P_SC_FAIL_UNABLE_TO_ACCOMMODATE;
-			} else if (!conncap) {
-				p2p_dbg(p2p, "Conncap resolution failed");
-				reject = P2P_SC_FAIL_INCOMPATIBLE_PARAMS;
-			}
+		if (msg.wps_config_methods & WPS_CONFIG_KEYPAD) {
+			p2p_dbg(p2p, "Keypad - always defer");
+			auto_accept = 0;
+		}
 
-			if (msg.wps_config_methods & WPS_CONFIG_KEYPAD) {
-				p2p_dbg(p2p, "Keypad - always defer");
-				auto_accept = 0;
+		if ((remote_conncap & (P2PS_SETUP_NEW | P2PS_SETUP_CLIENT) ||
+		     msg.persistent_dev) && conncap != P2PS_SETUP_NEW &&
+		    msg.channel_list && msg.channel_list_len &&
+		    p2p_peer_channels_check(p2p, &p2p->channels, dev,
+					    msg.channel_list,
+					    msg.channel_list_len) < 0) {
+			p2p_dbg(p2p,
+				"No common channels - force deferred flow");
+			auto_accept = 0;
+		}
+
+		if (((remote_conncap & P2PS_SETUP_GROUP_OWNER) ||
+		     msg.persistent_dev) && msg.operating_channel) {
+			struct p2p_channels intersect;
+
+			/*
+			 * There are cases where only the operating channel is
+			 * provided. This requires saving the channel as the
+			 * supported channel list, and verifying that it is
+			 * supported.
+			 */
+			if (dev->channels.reg_classes == 0 ||
+			    !p2p_channels_includes(&dev->channels,
+						   msg.operating_channel[3],
+						   msg.operating_channel[4])) {
+				struct p2p_channels *ch = &dev->channels;
+
+				os_memset(ch, 0, sizeof(*ch));
+				ch->reg_class[0].reg_class =
+					msg.operating_channel[3];
+				ch->reg_class[0].channel[0] =
+					msg.operating_channel[4];
+				ch->reg_class[0].channels = 1;
+				ch->reg_classes = 1;
 			}
 
-			if (auto_accept || reject != P2P_SC_SUCCESS) {
-				struct p2ps_provision *tmp;
-
-				if (reject == P2P_SC_SUCCESS && !conncap) {
-					reject =
-						P2P_SC_FAIL_INCOMPATIBLE_PARAMS;
-				}
-
-				if (p2ps_setup_p2ps_prov(
-					    p2p, adv_id, session_id,
-					    msg.wps_config_methods,
-					    session_mac, adv_mac) < 0) {
-					reject = P2P_SC_FAIL_UNABLE_TO_ACCOMMODATE;
-					goto out;
-				}
-
-				tmp = p2p->p2ps_prov;
-				if (conncap) {
-					tmp->conncap = conncap;
-					tmp->status = P2P_SC_SUCCESS;
-				} else {
-					tmp->conncap = auto_accept;
-					tmp->status = P2P_SC_FAIL_INCOMPATIBLE_PARAMS;
-				}
-
-				if (reject != P2P_SC_SUCCESS)
-					goto out;
+			p2p_channels_intersect(&p2p->channels, &dev->channels,
+					       &intersect);
+
+			if (intersect.reg_classes == 0) {
+				p2p_dbg(p2p,
+					"No common channels - force deferred flow");
+				auto_accept = 0;
 			}
-		} else if (!msg.status) {
-			reject = P2P_SC_FAIL_INCOMPATIBLE_PARAMS;
-			goto out;
 		}
 
-		if (!msg.status && !auto_accept &&
-		    (!p2p->p2ps_prov || p2p->p2ps_prov->adv_id != adv_id)) {
+		if (auto_accept || reject != P2P_SC_SUCCESS) {
 			struct p2ps_provision *tmp;
 
-			if (!conncap) {
-				reject = P2P_SC_FAIL_INCOMPATIBLE_PARAMS;
-				goto out;
-			}
-
 			if (p2ps_setup_p2ps_prov(p2p, adv_id, session_id,
 						 msg.wps_config_methods,
 						 session_mac, adv_mac) < 0) {
 				reject = P2P_SC_FAIL_UNABLE_TO_ACCOMMODATE;
 				goto out;
 			}
+
 			tmp = p2p->p2ps_prov;
-			reject = P2P_SC_FAIL_INFO_CURRENTLY_UNAVAILABLE;
-			tmp->status = reject;
+			tmp->force_freq = forced_freq;
+			tmp->pref_freq = pref_freq;
+			if (conncap) {
+				tmp->conncap = conncap;
+				tmp->status = P2P_SC_SUCCESS;
+			} else {
+				tmp->conncap = auto_accept;
+				tmp->status = P2P_SC_FAIL_INCOMPATIBLE_PARAMS;
+			}
+
+			if (reject != P2P_SC_SUCCESS)
+				goto out;
 		}
+	}
 
-		if (msg.status) {
-			if (*msg.status &&
-			    *msg.status != P2P_SC_SUCCESS_DEFERRED) {
-				reject = *msg.status;
-			} else if (*msg.status == P2P_SC_SUCCESS_DEFERRED &&
-				   p2p->p2ps_prov) {
-				u16 method = p2p->p2ps_prov->method;
+	if (!msg.status && !auto_accept &&
+	    (!p2p->p2ps_prov || p2p->p2ps_prov->adv_id != adv_id)) {
+		struct p2ps_provision *tmp;
 
-				conncap = p2p->cfg->p2ps_group_capability(
-					p2p->cfg->cb_ctx, remote_conncap,
-					p2p->p2ps_prov->conncap);
+		if (!conncap) {
+			reject = P2P_SC_FAIL_INCOMPATIBLE_PARAMS;
+			goto out;
+		}
 
-				p2p_dbg(p2p,
-					"Conncap: local:%d remote:%d result:%d",
-					p2p->p2ps_prov->conncap,
-					remote_conncap, conncap);
+		if (p2ps_setup_p2ps_prov(p2p, adv_id, session_id,
+					 msg.wps_config_methods,
+					 session_mac, adv_mac) < 0) {
+			reject = P2P_SC_FAIL_UNABLE_TO_ACCOMMODATE;
+			goto out;
+		}
+		tmp = p2p->p2ps_prov;
+		reject = P2P_SC_FAIL_INFO_CURRENTLY_UNAVAILABLE;
+		tmp->status = reject;
+	}
 
-				resp_fcap.cpt = p2ps_own_preferred_cpt(
-					p2p->p2ps_prov->cpt_priority,
-					req_fcap->cpt);
+	/* Not a P2PS Follow-on PD */
+	if (!msg.status)
+		goto out;
 
-				p2p_dbg(p2p,
-					"cpt: local:0x%x remote:0x%x result:0x%x",
-					p2p->p2ps_prov->cpt_mask,
-					req_fcap->cpt, resp_fcap.cpt);
+	if (*msg.status && *msg.status != P2P_SC_SUCCESS_DEFERRED) {
+		reject = *msg.status;
+		goto out;
+	}
 
-				/*
-				 * Ensure that if we asked for PIN originally,
-				 * our method is consistent with original
-				 * request.
-				 */
-				if (method & WPS_CONFIG_DISPLAY)
-					method = WPS_CONFIG_KEYPAD;
-				else if (method & WPS_CONFIG_KEYPAD)
-					method = WPS_CONFIG_DISPLAY;
-
-				if (!conncap ||
-				    !(msg.wps_config_methods & method)) {
-					/*
-					 * Reject this "Deferred Accept*
-					 * if incompatible conncap or method
-					 */
-					reject =
-						P2P_SC_FAIL_INCOMPATIBLE_PARAMS;
-				} else if (!resp_fcap.cpt) {
-					p2p_dbg(p2p,
-						"Incompatible P2PS feature capability CPT bitmask");
-					reject =
-						P2P_SC_FAIL_INCOMPATIBLE_PARAMS;
-				} else {
-					reject = P2P_SC_SUCCESS;
-				}
-
-				p2p->p2ps_prov->status = reject;
-				p2p->p2ps_prov->conncap = conncap;
-			}
-		}
+	if (*msg.status != P2P_SC_SUCCESS_DEFERRED || !p2p->p2ps_prov)
+		goto out;
+
+	if (p2p->p2ps_prov->adv_id != adv_id ||
+	    os_memcmp(p2p->p2ps_prov->adv_mac, msg.adv_mac, ETH_ALEN)) {
+		p2p_dbg(p2p,
+			"P2PS Follow-on PD with mismatch Advertisement ID/MAC");
+		goto out;
 	}
 
+	if (p2p->p2ps_prov->session_id != session_id ||
+	    os_memcmp(p2p->p2ps_prov->session_mac, msg.session_mac, ETH_ALEN)) {
+		p2p_dbg(p2p, "P2PS Follow-on PD with mismatch Session ID/MAC");
+		goto out;
+	}
+
+	method = p2p->p2ps_prov->method;
+
+	conncap = p2p->cfg->p2ps_group_capability(p2p->cfg->cb_ctx,
+						  remote_conncap,
+						  p2p->p2ps_prov->conncap,
+						  &p2p->p2ps_prov->force_freq,
+						  &p2p->p2ps_prov->pref_freq);
+
+	resp_fcap.cpt = p2ps_own_preferred_cpt(p2p->p2ps_prov->cpt_priority,
+					       req_fcap->cpt);
+
+	p2p_dbg(p2p, "cpt: local:0x%x remote:0x%x result:0x%x",
+		p2p->p2ps_prov->cpt_mask, req_fcap->cpt, resp_fcap.cpt);
+
+	p2p_prepare_channel(p2p, dev, p2p->p2ps_prov->force_freq,
+			    p2p->p2ps_prov->pref_freq, 0);
+
+	/*
+	 * Ensure that if we asked for PIN originally, our method is consistent
+	 * with original request.
+	 */
+	if (method & WPS_CONFIG_DISPLAY)
+		method = WPS_CONFIG_KEYPAD;
+	else if (method & WPS_CONFIG_KEYPAD)
+		method = WPS_CONFIG_DISPLAY;
+
+	if (!conncap || !(msg.wps_config_methods & method)) {
+		/*
+		 * Reject this "Deferred Accept*
+		 * if incompatible conncap or method
+		 */
+		reject = P2P_SC_FAIL_INCOMPATIBLE_PARAMS;
+	} else if (!resp_fcap.cpt) {
+		p2p_dbg(p2p,
+			"Incompatible P2PS feature capability CPT bitmask");
+		reject = P2P_SC_FAIL_INCOMPATIBLE_PARAMS;
+	} else if ((remote_conncap & (P2PS_SETUP_NEW | P2PS_SETUP_CLIENT) ||
+		    msg.persistent_dev) && conncap != P2PS_SETUP_NEW &&
+		   msg.channel_list && msg.channel_list_len &&
+		   p2p_peer_channels_check(p2p, &p2p->channels, dev,
+					   msg.channel_list,
+					   msg.channel_list_len) < 0) {
+		p2p_dbg(p2p,
+			"No common channels in Follow-On Provision Discovery Request");
+		reject = P2P_SC_FAIL_NO_COMMON_CHANNELS;
+	} else {
+		reject = P2P_SC_SUCCESS;
+	}
+
+	dev->oper_freq = 0;
+	if (reject == P2P_SC_SUCCESS || reject == P2P_SC_SUCCESS_DEFERRED) {
+		u8 tmp;
+
+		if (msg.operating_channel)
+			dev->oper_freq =
+				p2p_channel_to_freq(msg.operating_channel[3],
+						    msg.operating_channel[4]);
+
+		if ((conncap & P2PS_SETUP_GROUP_OWNER) &&
+		    p2p_go_select_channel(p2p, dev, &tmp) < 0)
+			reject = P2P_SC_FAIL_NO_COMMON_CHANNELS;
+	}
+
+	p2p->p2ps_prov->status = reject;
+	p2p->p2ps_prov->conncap = conncap;
+
 out:
 	if (reject == P2P_SC_SUCCESS ||
 	    reject == P2P_SC_FAIL_INFO_CURRENTLY_UNAVAILABLE)
 		config_methods = msg.wps_config_methods;
 	else
 		config_methods = 0;
-	resp = p2p_build_prov_disc_resp(p2p, dev, msg.dialog_token, reject,
-					config_methods, adv_id,
-					msg.group_id, msg.group_id_len,
-					msg.persistent_ssid,
-					msg.persistent_ssid_len,
-					(const u8 *) &resp_fcap,
-					sizeof(resp_fcap));
-	if (resp == NULL) {
-		p2p_parse_free(&msg);
-		return;
-	}
-	p2p_dbg(p2p, "Sending Provision Discovery Response");
-	if (rx_freq > 0)
-		freq = rx_freq;
-	else
-		freq = p2p_channel_to_freq(p2p->cfg->reg_class,
-					   p2p->cfg->channel);
-	if (freq < 0) {
-		p2p_dbg(p2p, "Unknown regulatory class/channel");
+
+	/*
+	 * Send PD Response for an initial PD Request or for follow-on
+	 * PD Request with P2P_SC_SUCCESS_DEFERRED status.
+	 */
+	if (!msg.status || *msg.status == P2P_SC_SUCCESS_DEFERRED) {
+		resp = p2p_build_prov_disc_resp(p2p, dev, msg.dialog_token,
+						reject, config_methods, adv_id,
+						msg.group_id, msg.group_id_len,
+						msg.persistent_ssid,
+						msg.persistent_ssid_len,
+						(const u8 *) &resp_fcap,
+						sizeof(resp_fcap));
+		if (!resp) {
+			p2p_parse_free(&msg);
+			return;
+		}
+		p2p_dbg(p2p, "Sending Provision Discovery Response");
+		if (rx_freq > 0)
+			freq = rx_freq;
+		else
+			freq = p2p_channel_to_freq(p2p->cfg->reg_class,
+						   p2p->cfg->channel);
+		if (freq < 0) {
+			p2p_dbg(p2p, "Unknown regulatory class/channel");
+			wpabuf_free(resp);
+			p2p_parse_free(&msg);
+			return;
+		}
+		p2p->pending_action_state = P2P_PENDING_PD_RESPONSE;
+		if (p2p_send_action(p2p, freq, sa, p2p->cfg->dev_addr,
+				    p2p->cfg->dev_addr,
+				    wpabuf_head(resp), wpabuf_len(resp),
+				    50) < 0)
+			p2p_dbg(p2p, "Failed to send Action frame");
+		else
+			p2p->send_action_in_progress = 1;
+
 		wpabuf_free(resp);
+	}
+
+	if (!dev) {
 		p2p_parse_free(&msg);
 		return;
 	}
-	p2p->pending_action_state = P2P_PENDING_PD_RESPONSE;
-	if (p2p_send_action(p2p, freq, sa, p2p->cfg->dev_addr,
-			    p2p->cfg->dev_addr,
-			    wpabuf_head(resp), wpabuf_len(resp), 200) < 0) {
-		p2p_dbg(p2p, "Failed to send Action frame");
-	} else
-		p2p->send_action_in_progress = 1;
 
-	wpabuf_free(resp);
+	freq = 0;
+	if (reject == P2P_SC_SUCCESS && conncap == P2PS_SETUP_GROUP_OWNER) {
+		freq = p2p_channel_to_freq(p2p->op_reg_class,
+					   p2p->op_channel);
+		if (freq < 0)
+			freq = 0;
+	}
 
 	if (!p2p->cfg->p2ps_prov_complete) {
 		/* Don't emit anything */
@@ -771,7 +1028,8 @@ out:
 					     NULL, adv_id, session_id,
 					     0, 0, msg.persistent_ssid,
 					     msg.persistent_ssid_len,
-					     0, 0, NULL, NULL, 0);
+					     0, 0, NULL, NULL, 0, freq,
+					     NULL, 0);
 	} else if (msg.status && *msg.status == P2P_SC_SUCCESS_DEFERRED &&
 		   p2p->p2ps_prov) {
 		p2p->p2ps_prov->status = reject;
@@ -784,7 +1042,8 @@ out:
 						     session_id, conncap, 0,
 						     msg.persistent_ssid,
 						     msg.persistent_ssid_len, 0,
-						     0, NULL, NULL, 0);
+						     0, NULL, NULL, 0, freq,
+						     NULL, 0);
 		else
 			p2p->cfg->p2ps_prov_complete(p2p->cfg->cb_ctx,
 						     *msg.status,
@@ -796,7 +1055,8 @@ out:
 						     msg.persistent_ssid_len, 0,
 						     0, NULL,
 						     (const u8 *) &resp_fcap,
-						     sizeof(resp_fcap));
+						     sizeof(resp_fcap), freq,
+						     NULL, 0);
 	} else if (msg.status && p2p->p2ps_prov) {
 		p2p->p2ps_prov->status = P2P_SC_SUCCESS;
 		p2p->cfg->p2ps_prov_complete(p2p->cfg->cb_ctx, *msg.status, sa,
@@ -807,7 +1067,7 @@ out:
 					     msg.persistent_ssid_len,
 					     0, 0, NULL,
 					     (const u8 *) &resp_fcap,
-					     sizeof(resp_fcap));
+					     sizeof(resp_fcap), freq, NULL, 0);
 	} else if (msg.status) {
 	} else if (auto_accept && reject == P2P_SC_SUCCESS) {
 		p2p->cfg->p2ps_prov_complete(p2p->cfg->cb_ctx, P2P_SC_SUCCESS,
@@ -818,7 +1078,11 @@ out:
 					     msg.persistent_ssid_len,
 					     0, 0, NULL,
 					     (const u8 *) &resp_fcap,
-					     sizeof(resp_fcap));
+					     sizeof(resp_fcap), freq,
+					     msg.group_id ?
+					     msg.group_id + ETH_ALEN : NULL,
+					     msg.group_id ?
+					     msg.group_id_len - ETH_ALEN : 0);
 	} else if (reject == P2P_SC_FAIL_INFO_CURRENTLY_UNAVAILABLE &&
 		   (!msg.session_info || !msg.session_info_len)) {
 		p2p->p2ps_prov->method = msg.wps_config_methods;
@@ -831,7 +1095,7 @@ out:
 					     msg.persistent_ssid_len,
 					     0, 1, NULL,
 					     (const u8 *) &resp_fcap,
-					     sizeof(resp_fcap));
+					     sizeof(resp_fcap), freq, NULL, 0);
 	} else if (reject == P2P_SC_FAIL_INFO_CURRENTLY_UNAVAILABLE) {
 		size_t buf_len = msg.session_info_len;
 		char *buf = os_malloc(2 * buf_len + 1);
@@ -848,7 +1112,8 @@ out:
 				session_id, conncap, passwd_id,
 				msg.persistent_ssid, msg.persistent_ssid_len,
 				0, 1, buf,
-				(const u8 *) &resp_fcap, sizeof(resp_fcap));
+				(const u8 *) &resp_fcap, sizeof(resp_fcap),
+				freq, NULL, 0);
 
 			os_free(buf);
 		}
@@ -898,7 +1163,7 @@ out:
 					msg.group_id, msg.group_id_len);
 	}
 
-	if (dev && reject == P2P_SC_SUCCESS) {
+	if (reject == P2P_SC_SUCCESS) {
 		switch (config_methods) {
 		case WPS_CONFIG_DISPLAY:
 			dev->wps_prov_info = WPS_CONFIG_KEYPAD;
@@ -1084,6 +1349,9 @@ void p2p_process_prov_disc_resp(struct p2p_data *p2p, const u8 *sa,
 			" with no pending request", MAC2STR(sa));
 		p2p_parse_free(&msg);
 		return;
+	} else if (msg.wfd_subelems) {
+		wpabuf_free(dev->info.wfd_subelems);
+		dev->info.wfd_subelems = wpabuf_dup(msg.wfd_subelems);
 	}
 
 	if (dev->dialog_token != msg.dialog_token) {
@@ -1148,17 +1416,71 @@ void p2p_process_prov_disc_resp(struct p2p_data *p2p, const u8 *sa,
 		passwd_id = DEV_PW_P2PS_DEFAULT;
 	}
 
-	if ((msg.conn_cap || msg.persistent_dev) &&
-	    (status == P2P_SC_SUCCESS || status == P2P_SC_SUCCESS_DEFERRED) &&
+	if ((status == P2P_SC_SUCCESS || status == P2P_SC_SUCCESS_DEFERRED) &&
 	    p2p->p2ps_prov) {
+		dev->oper_freq = 0;
+
+		/*
+		 * Save the reported channel list and operating frequency.
+		 * Note that the specification mandates that the responder
+		 * should include in the channel list only channels reported by
+		 * the initiator, so this is only a sanity check, and if this
+		 * fails the flow would continue, although it would probably
+		 * fail. Same is true for the operating channel.
+		 */
+		if (msg.channel_list && msg.channel_list_len &&
+		    p2p_peer_channels_check(p2p, &p2p->channels, dev,
+					    msg.channel_list,
+					    msg.channel_list_len) < 0)
+			p2p_dbg(p2p, "P2PS PD Response - no common channels");
+
+		if (msg.operating_channel) {
+			if (p2p_channels_includes(&p2p->channels,
+						  msg.operating_channel[3],
+						  msg.operating_channel[4]) &&
+			    p2p_channels_includes(&dev->channels,
+						  msg.operating_channel[3],
+						  msg.operating_channel[4])) {
+				dev->oper_freq =
+					p2p_channel_to_freq(
+						msg.operating_channel[3],
+						msg.operating_channel[4]);
+			} else {
+				p2p_dbg(p2p,
+					"P2PS PD Response - invalid operating channel");
+			}
+		}
+
 		if (p2p->cfg->p2ps_prov_complete) {
+			int freq = 0;
+
+			if (conncap == P2PS_SETUP_GROUP_OWNER) {
+				u8 tmp;
+
+				/*
+				 * Re-select the operating channel as it is
+				 * possible that original channel is no longer
+				 * valid. This should not really fail.
+				 */
+				if (p2p_go_select_channel(p2p, dev, &tmp) < 0)
+					p2p_dbg(p2p,
+						"P2PS PD channel selection failed");
+
+				freq = p2p_channel_to_freq(p2p->op_reg_class,
+							   p2p->op_channel);
+				if (freq < 0)
+					freq = 0;
+			}
+
 			p2p->cfg->p2ps_prov_complete(
 				p2p->cfg->cb_ctx, status, sa, adv_mac,
 				p2p->p2ps_prov->session_mac,
 				group_mac, adv_id, p2p->p2ps_prov->session_id,
 				conncap, passwd_id, msg.persistent_ssid,
 				msg.persistent_ssid_len, 1, 0, NULL,
-				msg.feature_cap, msg.feature_cap_len);
+				msg.feature_cap, msg.feature_cap_len, freq,
+				msg.group_id ? msg.group_id + ETH_ALEN : NULL,
+				msg.group_id ? msg.group_id_len - ETH_ALEN : 0);
 		}
 		p2ps_prov_free(p2p);
 	} else if (status != P2P_SC_SUCCESS &&
@@ -1169,7 +1491,7 @@ void p2p_process_prov_disc_resp(struct p2p_data *p2p, const u8 *sa,
 				p2p->cfg->cb_ctx, status, sa, adv_mac,
 				p2p->p2ps_prov->session_mac,
 				group_mac, adv_id, p2p->p2ps_prov->session_id,
-				0, 0, NULL, 0, 1, 0, NULL, NULL, 0);
+				0, 0, NULL, 0, 1, 0, NULL, NULL, 0, 0, NULL, 0);
 		p2ps_prov_free(p2p);
 	}
 
@@ -1318,6 +1640,10 @@ int p2p_send_prov_disc_req(struct p2p_data *p2p, struct p2p_device *dev,
 			"Building PD Request based on P2PS config method 0x%x status %d --> req_config_methods 0x%x",
 			p2p->p2ps_prov->method, p2p->p2ps_prov->status,
 			dev->req_config_methods);
+
+		if (p2p_prepare_channel(p2p, dev, p2p->p2ps_prov->force_freq,
+					p2p->p2ps_prov->pref_freq, 1) < 0)
+			return -1;
 	}
 
 	req = p2p_build_prov_disc_req(p2p, dev, join);
diff --git a/src/p2p/p2p_sd.c b/src/p2p/p2p_sd.c
index 1a2af04b80043..a8bc5ba7f344c 100644
--- a/src/p2p/p2p_sd.c
+++ b/src/p2p/p2p_sd.c
@@ -28,11 +28,11 @@ static int wfd_wsd_supported(struct wpabuf *wfd)
 	pos = wpabuf_head(wfd);
 	end = pos + wpabuf_len(wfd);
 
-	while (pos + 3 <= end) {
+	while (end - pos >= 3) {
 		subelem = *pos++;
 		len = WPA_GET_BE16(pos);
 		pos += 2;
-		if (pos + len > end)
+		if (len > end - pos)
 			break;
 
 		if (subelem == WFD_SUBELEM_DEVICE_INFO && len >= 6) {
@@ -288,6 +288,14 @@ int p2p_start_sd(struct p2p_data *p2p, struct p2p_device *dev)
 	query = p2p_pending_sd_req(p2p, dev);
 	if (query == NULL)
 		return -1;
+	if (p2p->state == P2P_SEARCH &&
+	    os_memcmp(p2p->sd_query_no_ack, dev->info.p2p_device_addr,
+		      ETH_ALEN) == 0) {
+		p2p_dbg(p2p, "Do not start Service Discovery with " MACSTR
+			" due to it being the first no-ACK peer in this search iteration",
+			MAC2STR(dev->info.p2p_device_addr));
+		return -2;
+	}
 
 	p2p_dbg(p2p, "Start Service Discovery with " MACSTR,
 		MAC2STR(dev->info.p2p_device_addr));
@@ -355,11 +363,11 @@ void p2p_rx_gas_initial_req(struct p2p_data *p2p, const u8 *sa,
 	pos++;
 
 	slen = *pos++;
-	next = pos + slen;
-	if (next > end || slen < 2) {
+	if (slen > end - pos || slen < 2) {
 		p2p_dbg(p2p, "Invalid IE in GAS Initial Request");
 		return;
 	}
+	next = pos + slen;
 	pos++; /* skip QueryRespLenLimit and PAME-BI */
 
 	if (*pos != ACCESS_NETWORK_QUERY_PROTOCOL) {
@@ -370,16 +378,16 @@ void p2p_rx_gas_initial_req(struct p2p_data *p2p, const u8 *sa,
 
 	pos = next;
 	/* Query Request */
-	if (pos + 2 > end)
+	if (end - pos < 2)
 		return;
 	slen = WPA_GET_LE16(pos);
 	pos += 2;
-	if (pos + slen > end)
+	if (slen > end - pos)
 		return;
 	end = pos + slen;
 
 	/* ANQP Query Request */
-	if (pos + 4 > end)
+	if (end - pos < 4)
 		return;
 	if (WPA_GET_LE16(pos) != ANQP_VENDOR_SPECIFIC) {
 		p2p_dbg(p2p, "Unsupported ANQP Info ID %u", WPA_GET_LE16(pos));
@@ -389,7 +397,7 @@ void p2p_rx_gas_initial_req(struct p2p_data *p2p, const u8 *sa,
 
 	slen = WPA_GET_LE16(pos);
 	pos += 2;
-	if (pos + slen > end || slen < 3 + 1) {
+	if (slen > end - pos || slen < 3 + 1) {
 		p2p_dbg(p2p, "Invalid ANQP Query Request length");
 		return;
 	}
@@ -401,7 +409,7 @@ void p2p_rx_gas_initial_req(struct p2p_data *p2p, const u8 *sa,
 	}
 	pos += 4;
 
-	if (pos + 2 > end)
+	if (end - pos < 2)
 		return;
 	update_indic = WPA_GET_LE16(pos);
 	p2p_dbg(p2p, "Service Update Indicator: %u", update_indic);
@@ -417,9 +425,16 @@ void p2p_sd_response(struct p2p_data *p2p, int freq, const u8 *dst,
 		     u8 dialog_token, const struct wpabuf *resp_tlvs)
 {
 	struct wpabuf *resp;
+	size_t max_len;
+
+	/*
+	 * In the 60 GHz, we have a smaller maximum frame length for management
+	 * frames.
+	 */
+	max_len = (freq > 56160) ? 928 : 1400;
 
 	/* TODO: fix the length limit to match with the maximum frame length */
-	if (wpabuf_len(resp_tlvs) > 1400) {
+	if (wpabuf_len(resp_tlvs) > max_len) {
 		p2p_dbg(p2p, "SD response long enough to require fragmentation");
 		if (p2p->sd_resp) {
 			/*
@@ -512,11 +527,11 @@ void p2p_rx_gas_initial_resp(struct p2p_data *p2p, const u8 *sa,
 	pos++;
 
 	slen = *pos++;
-	next = pos + slen;
-	if (next > end || slen < 2) {
+	if (slen > end - pos || slen < 2) {
 		p2p_dbg(p2p, "Invalid IE in GAS Initial Response");
 		return;
 	}
+	next = pos + slen;
 	pos++; /* skip QueryRespLenLimit and PAME-BI */
 
 	if (*pos != ACCESS_NETWORK_QUERY_PROTOCOL) {
@@ -527,14 +542,14 @@ void p2p_rx_gas_initial_resp(struct p2p_data *p2p, const u8 *sa,
 
 	pos = next;
 	/* Query Response */
-	if (pos + 2 > end) {
+	if (end - pos < 2) {
 		p2p_dbg(p2p, "Too short Query Response");
 		return;
 	}
 	slen = WPA_GET_LE16(pos);
 	pos += 2;
 	p2p_dbg(p2p, "Query Response Length: %d", slen);
-	if (pos + slen > end) {
+	if (slen > end - pos) {
 		p2p_dbg(p2p, "Not enough Query Response data");
 		return;
 	}
@@ -552,7 +567,7 @@ void p2p_rx_gas_initial_resp(struct p2p_data *p2p, const u8 *sa,
 	}
 
 	/* ANQP Query Response */
-	if (pos + 4 > end)
+	if (end - pos < 4)
 		return;
 	if (WPA_GET_LE16(pos) != ANQP_VENDOR_SPECIFIC) {
 		p2p_dbg(p2p, "Unsupported ANQP Info ID %u", WPA_GET_LE16(pos));
@@ -562,7 +577,7 @@ void p2p_rx_gas_initial_resp(struct p2p_data *p2p, const u8 *sa,
 
 	slen = WPA_GET_LE16(pos);
 	pos += 2;
-	if (pos + slen > end || slen < 3 + 1) {
+	if (slen > end - pos || slen < 3 + 1) {
 		p2p_dbg(p2p, "Invalid ANQP Query Response length");
 		return;
 	}
@@ -574,7 +589,7 @@ void p2p_rx_gas_initial_resp(struct p2p_data *p2p, const u8 *sa,
 	}
 	pos += 4;
 
-	if (pos + 2 > end)
+	if (end - pos < 2)
 		return;
 	update_indic = WPA_GET_LE16(pos);
 	p2p_dbg(p2p, "Service Update Indicator: %u", update_indic);
@@ -606,7 +621,7 @@ void p2p_rx_gas_comeback_req(struct p2p_data *p2p, const u8 *sa,
 {
 	struct wpabuf *resp;
 	u8 dialog_token;
-	size_t frag_len;
+	size_t frag_len, max_len;
 	int more = 0;
 
 	wpa_hexdump(MSG_DEBUG, "P2P: RX GAS Comeback Request", data, len);
@@ -630,9 +645,14 @@ void p2p_rx_gas_comeback_req(struct p2p_data *p2p, const u8 *sa,
 		return;
 	}
 
+	/*
+	 * In the 60 GHz, we have a smaller maximum frame length for management
+	 * frames.
+	 */
+	max_len = (rx_freq > 56160) ? 928 : 1400;
 	frag_len = wpabuf_len(p2p->sd_resp) - p2p->sd_resp_pos;
-	if (frag_len > 1400) {
-		frag_len = 1400;
+	if (frag_len > max_len) {
+		frag_len = max_len;
 		more = 1;
 	}
 	resp = p2p_build_gas_comeback_resp(dialog_token, WLAN_STATUS_SUCCESS,
@@ -727,11 +747,11 @@ void p2p_rx_gas_comeback_resp(struct p2p_data *p2p, const u8 *sa,
 	pos++;
 
 	slen = *pos++;
-	next = pos + slen;
-	if (next > end || slen < 2) {
+	if (slen > end - pos || slen < 2) {
 		p2p_dbg(p2p, "Invalid IE in GAS Comeback Response");
 		return;
 	}
+	next = pos + slen;
 	pos++; /* skip QueryRespLenLimit and PAME-BI */
 
 	if (*pos != ACCESS_NETWORK_QUERY_PROTOCOL) {
@@ -742,14 +762,14 @@ void p2p_rx_gas_comeback_resp(struct p2p_data *p2p, const u8 *sa,
 
 	pos = next;
 	/* Query Response */
-	if (pos + 2 > end) {
+	if (end - pos < 2) {
 		p2p_dbg(p2p, "Too short Query Response");
 		return;
 	}
 	slen = WPA_GET_LE16(pos);
 	pos += 2;
 	p2p_dbg(p2p, "Query Response Length: %d", slen);
-	if (pos + slen > end) {
+	if (slen > end - pos) {
 		p2p_dbg(p2p, "Not enough Query Response data");
 		return;
 	}
@@ -768,7 +788,7 @@ void p2p_rx_gas_comeback_resp(struct p2p_data *p2p, const u8 *sa,
 	}
 
 	/* ANQP Query Response */
-	if (pos + 4 > end)
+	if (end - pos < 4)
 		return;
 	if (WPA_GET_LE16(pos) != ANQP_VENDOR_SPECIFIC) {
 		p2p_dbg(p2p, "Unsupported ANQP Info ID %u", WPA_GET_LE16(pos));
@@ -783,7 +803,7 @@ void p2p_rx_gas_comeback_resp(struct p2p_data *p2p, const u8 *sa,
 		p2p_dbg(p2p, "Invalid ANQP Query Response length");
 		return;
 	}
-	if (pos + 4 > end)
+	if (end - pos < 4)
 		return;
 
 	if (WPA_GET_BE32(pos) != P2P_IE_VENDOR_TYPE) {
@@ -793,7 +813,7 @@ void p2p_rx_gas_comeback_resp(struct p2p_data *p2p, const u8 *sa,
 	}
 	pos += 4;
 
-	if (pos + 2 > end)
+	if (end - pos < 2)
 		return;
 	p2p->sd_rx_update_indic = WPA_GET_LE16(pos);
 	p2p_dbg(p2p, "Service Update Indicator: %u", p2p->sd_rx_update_indic);
diff --git a/src/pae/ieee802_1x_cp.c b/src/pae/ieee802_1x_cp.c
index cf43c594c4022..e294e64662852 100644
--- a/src/pae/ieee802_1x_cp.c
+++ b/src/pae/ieee802_1x_cp.c
@@ -20,7 +20,7 @@
 #define STATE_MACHINE_DATA struct ieee802_1x_cp_sm
 #define STATE_MACHINE_DEBUG_PREFIX "CP"
 
-static u8 default_cs_id[] = CS_ID_GCM_AES_128;
+static u64 default_cs_id = CS_ID_GCM_AES_128;
 
 /* The variable defined in clause 12 in IEEE Std 802.1X-2010 */
 enum connect_type { PENDING, UNAUTHENTICATED, AUTHENTICATED, SECURE };
@@ -45,7 +45,7 @@ struct ieee802_1x_cp_sm {
 	Boolean elected_self;
 	u8 *authorization_data1;
 	enum confidentiality_offset cipher_offset;
-	u8 *cipher_suite;
+	u64 cipher_suite;
 	Boolean new_sak; /* clear by CP */
 	struct ieee802_1x_mka_ki distributed_ki;
 	u8 distributed_an;
@@ -71,7 +71,7 @@ struct ieee802_1x_cp_sm {
 	Boolean replay_protect;
 	u32 replay_window;
 
-	u8 *current_cipher_suite;
+	u64 current_cipher_suite;
 	enum confidentiality_offset confidentiality_offset;
 	Boolean controlled_port_enabled;
 
@@ -97,8 +97,7 @@ static void ieee802_1x_cp_transmit_when_timeout(void *eloop_ctx,
 static int changed_cipher(struct ieee802_1x_cp_sm *sm)
 {
 	return sm->confidentiality_offset != sm->cipher_offset ||
-		os_memcmp(sm->current_cipher_suite, sm->cipher_suite,
-			  CS_ID_LEN) != 0;
+		sm->current_cipher_suite != sm->cipher_suite;
 }
 
 
@@ -185,21 +184,17 @@ SM_STATE(CP, AUTHENTICATED)
 
 SM_STATE(CP, SECURED)
 {
-	struct ieee802_1x_cp_conf conf;
-
 	SM_ENTRY(CP, SECURED);
 
 	sm->chgd_server = FALSE;
 
-	ieee802_1x_kay_cp_conf(sm->kay, &conf);
-	sm->protect_frames = conf.protect;
-	sm->replay_protect = conf.replay_protect;
-	sm->validate_frames = conf.validate;
+	sm->protect_frames = sm->kay->macsec_protect;
+	sm->replay_protect = sm->kay->macsec_replay_protect;
+	sm->validate_frames = sm->kay->macsec_validate;
 
-	/* NOTE: now no other than default cipher suiter(AES-GCM-128) */
-	os_memcpy(sm->current_cipher_suite, sm->cipher_suite, CS_ID_LEN);
-	secy_cp_control_current_cipher_suite(sm->kay, sm->current_cipher_suite,
-					     CS_ID_LEN);
+	/* NOTE: now no other than default cipher suite (AES-GCM-128) */
+	sm->current_cipher_suite = sm->cipher_suite;
+	secy_cp_control_current_cipher_suite(sm->kay, sm->current_cipher_suite);
 
 	sm->confidentiality_offset = sm->cipher_offset;
 
@@ -428,9 +423,7 @@ SM_STEP(CP)
 /**
  * ieee802_1x_cp_sm_init -
  */
-struct ieee802_1x_cp_sm * ieee802_1x_cp_sm_init(
-	struct ieee802_1x_kay *kay,
-	struct ieee802_1x_cp_conf *pcp_conf)
+struct ieee802_1x_cp_sm * ieee802_1x_cp_sm_init(struct ieee802_1x_kay *kay)
 {
 	struct ieee802_1x_cp_sm *sm;
 
@@ -446,10 +439,10 @@ struct ieee802_1x_cp_sm * ieee802_1x_cp_sm_init(
 
 	sm->chgd_server = FALSE;
 
-	sm->protect_frames = pcp_conf->protect;
-	sm->validate_frames = pcp_conf->validate;
-	sm->replay_protect = pcp_conf->replay_protect;
-	sm->replay_window = pcp_conf->replay_window;
+	sm->protect_frames = kay->macsec_protect;
+	sm->validate_frames = kay->macsec_validate;
+	sm->replay_protect = kay->macsec_replay_protect;
+	sm->replay_window = kay->macsec_replay_window;
 
 	sm->controlled_port_enabled = FALSE;
 
@@ -460,17 +453,8 @@ struct ieee802_1x_cp_sm * ieee802_1x_cp_sm_init(
 	sm->orx = FALSE;
 	sm->otx = FALSE;
 
-	sm->cipher_suite = os_zalloc(CS_ID_LEN);
-	sm->current_cipher_suite = os_zalloc(CS_ID_LEN);
-	if (!sm->cipher_suite || !sm->current_cipher_suite) {
-		wpa_printf(MSG_ERROR, "CP-%s: out of memory", __func__);
-		os_free(sm->cipher_suite);
-		os_free(sm->current_cipher_suite);
-		os_free(sm);
-		return NULL;
-	}
-	os_memcpy(sm->current_cipher_suite, default_cs_id, CS_ID_LEN);
-	os_memcpy(sm->cipher_suite, default_cs_id, CS_ID_LEN);
+	sm->current_cipher_suite = default_cs_id;
+	sm->cipher_suite = default_cs_id;
 	sm->cipher_offset = CONFIDENTIALITY_OFFSET_0;
 	sm->confidentiality_offset = sm->cipher_offset;
 	sm->transmit_delay = MKA_LIFE_TIME;
@@ -530,8 +514,6 @@ void ieee802_1x_cp_sm_deinit(struct ieee802_1x_cp_sm *sm)
 	eloop_cancel_timeout(ieee802_1x_cp_step_cb, sm, NULL);
 	os_free(sm->lki);
 	os_free(sm->oki);
-	os_free(sm->cipher_suite);
-	os_free(sm->current_cipher_suite);
 	os_free(sm->authorization_data);
 	os_free(sm);
 }
@@ -618,10 +600,10 @@ void ieee802_1x_cp_set_authorizationdata(void *cp_ctx, u8 *pdata, int len)
 /**
  * ieee802_1x_cp_set_ciphersuite -
  */
-void ieee802_1x_cp_set_ciphersuite(void *cp_ctx, void *pid)
+void ieee802_1x_cp_set_ciphersuite(void *cp_ctx, u64 cs)
 {
 	struct ieee802_1x_cp_sm *sm = cp_ctx;
-	os_memcpy(sm->cipher_suite, pid, CS_ID_LEN);
+	sm->cipher_suite = cs;
 }
 
 
diff --git a/src/pae/ieee802_1x_cp.h b/src/pae/ieee802_1x_cp.h
index 773c93052bf65..695629e5c0bce 100644
--- a/src/pae/ieee802_1x_cp.h
+++ b/src/pae/ieee802_1x_cp.h
@@ -16,17 +16,7 @@ struct ieee802_1x_cp_sm;
 struct ieee802_1x_kay;
 struct ieee802_1x_mka_ki;
 
-struct ieee802_1x_cp_conf {
-	Boolean protect;
-	Boolean replay_protect;
-	enum validate_frames validate;
-	u32 replay_window;
-};
-
-
-struct ieee802_1x_cp_sm *
-ieee802_1x_cp_sm_init(struct ieee802_1x_kay *kay,
-		      struct ieee802_1x_cp_conf *pcp_conf);
+struct ieee802_1x_cp_sm * ieee802_1x_cp_sm_init(struct ieee802_1x_kay *kay);
 void ieee802_1x_cp_sm_deinit(struct ieee802_1x_cp_sm *sm);
 void ieee802_1x_cp_sm_step(void *cp_ctx);
 void ieee802_1x_cp_connect_pending(void *cp_ctx);
@@ -36,7 +26,7 @@ void ieee802_1x_cp_connect_secure(void *cp_ctx);
 void ieee802_1x_cp_signal_chgdserver(void *cp_ctx);
 void ieee802_1x_cp_set_electedself(void *cp_ctx, Boolean status);
 void ieee802_1x_cp_set_authorizationdata(void *cp_ctx, u8 *pdata, int len);
-void ieee802_1x_cp_set_ciphersuite(void *cp_ctx, void *pid);
+void ieee802_1x_cp_set_ciphersuite(void *cp_ctx, u64 cs);
 void ieee802_1x_cp_set_offset(void *cp_ctx, enum confidentiality_offset offset);
 void ieee802_1x_cp_signal_newsak(void *cp_ctx);
 void ieee802_1x_cp_set_distributedki(void *cp_ctx,
diff --git a/src/pae/ieee802_1x_kay.c b/src/pae/ieee802_1x_kay.c
index ef744304a2bbf..a8e7efc9b3bda 100644
--- a/src/pae/ieee802_1x_kay.c
+++ b/src/pae/ieee802_1x_kay.c
@@ -29,6 +29,8 @@
 
 #define PENDING_PN_EXHAUSTION 0xC0000000
 
+#define MKA_ALIGN_LENGTH(len) (((len) + 0x3) & ~0x3)
+
 /* IEEE Std 802.1X-2010, Table 9-1 - MKA Algorithm Agility */
 #define MKA_ALGO_AGILITY_2009 { 0x00, 0x80, 0xC2, 0x01 }
 static u8 mka_algo_agility[4] = MKA_ALGO_AGILITY_2009;
@@ -37,12 +39,11 @@ static u8 mka_algo_agility[4] = MKA_ALGO_AGILITY_2009;
 static struct macsec_ciphersuite cipher_suite_tbl[] = {
 	/* GCM-AES-128 */
 	{
-		CS_ID_GCM_AES_128,
-		CS_NAME_GCM_AES_128,
-		MACSEC_CAP_INTEG_AND_CONF_0_30_50,
-		16,
-
-		0 /* index */
+		.id = CS_ID_GCM_AES_128,
+		.name = CS_NAME_GCM_AES_128,
+		.capable = MACSEC_CAP_INTEG_AND_CONF_0_30_50,
+		.sak_len = DEFAULT_SA_KEY_LEN,
+		.index = 0,
 	},
 };
 #define CS_TABLE_SIZE (ARRAY_SIZE(cipher_suite_tbl))
@@ -50,16 +51,21 @@ static struct macsec_ciphersuite cipher_suite_tbl[] = {
 
 static struct mka_alg mka_alg_tbl[] = {
 	{
-		MKA_ALGO_AGILITY_2009,
+		.parameter = MKA_ALGO_AGILITY_2009,
+
 		/* 128-bit CAK, KEK, ICK, ICV */
-		16, 16,	16, 16,
-		ieee802_1x_cak_128bits_aes_cmac,
-		ieee802_1x_ckn_128bits_aes_cmac,
-		ieee802_1x_kek_128bits_aes_cmac,
-		ieee802_1x_ick_128bits_aes_cmac,
-		ieee802_1x_icv_128bits_aes_cmac,
-
-		1, /* index */
+		.cak_len = DEFAULT_ICV_LEN,
+		.kek_len = DEFAULT_ICV_LEN,
+		.ick_len = DEFAULT_ICV_LEN,
+		.icv_len = DEFAULT_ICV_LEN,
+
+		.cak_trfm = ieee802_1x_cak_128bits_aes_cmac,
+		.ckn_trfm = ieee802_1x_ckn_128bits_aes_cmac,
+		.kek_trfm = ieee802_1x_kek_128bits_aes_cmac,
+		.ick_trfm = ieee802_1x_ick_128bits_aes_cmac,
+		.icv_hash = ieee802_1x_icv_128bits_aes_cmac,
+
+		.index = 1,
 	},
 };
 #define MKA_ALG_TABLE_SIZE (ARRAY_SIZE(mka_alg_tbl))
@@ -73,16 +79,6 @@ static int is_ki_equal(struct ieee802_1x_mka_ki *ki1,
 }
 
 
-struct mka_param_body_handler {
-	int (*body_tx)(struct ieee802_1x_mka_participant *participant,
-		       struct wpabuf *buf);
-	int (*body_rx)(struct ieee802_1x_mka_participant *participant,
-		       const u8 *mka_msg, size_t msg_len);
-	int (*body_length)(struct ieee802_1x_mka_participant *participant);
-	Boolean (*body_present)(struct ieee802_1x_mka_participant *participant);
-};
-
-
 static void set_mka_param_body_len(void *body, unsigned int len)
 {
 	struct ieee802_1x_mka_hdr *hdr = body;
@@ -98,7 +94,7 @@ static unsigned int get_mka_param_body_len(const void *body)
 }
 
 
-static int get_mka_param_body_type(const void *body)
+static u8 get_mka_param_body_type(const void *body)
 {
 	const struct ieee802_1x_mka_hdr *hdr = body;
 	return hdr->type;
@@ -122,8 +118,8 @@ ieee802_1x_mka_dump_basic_body(struct ieee802_1x_mka_basic_body *body)
 	wpa_printf(MSG_DEBUG, "\tPriority......: %d", body->priority);
 	wpa_printf(MSG_DEBUG, "\tKeySvr........: %d", body->key_server);
 	wpa_printf(MSG_DEBUG, "\tMACSecDesired.: %d", body->macsec_desired);
-	wpa_printf(MSG_DEBUG, "\tMACSecCapable.: %d", body->macsec_capbility);
-	wpa_printf(MSG_DEBUG, "\tBody Length...: %d", (int) body_len);
+	wpa_printf(MSG_DEBUG, "\tMACSecCapable.: %d", body->macsec_capability);
+	wpa_printf(MSG_DEBUG, "\tBody Length...: %zu", body_len);
 	wpa_printf(MSG_DEBUG, "\tSCI MAC.......: " MACSTR,
 		   MAC2STR(body->actor_sci.addr));
 	wpa_printf(MSG_DEBUG, "\tSCI Port .....: %d",
@@ -148,7 +144,7 @@ ieee802_1x_mka_dump_peer_body(struct ieee802_1x_mka_peer_body *body)
 	size_t body_len;
 	size_t i;
 	u8 *mi;
-	u32 mn;
+	be32 mn;
 
 	if (body == NULL)
 		return;
@@ -156,10 +152,10 @@ ieee802_1x_mka_dump_peer_body(struct ieee802_1x_mka_peer_body *body)
 	body_len = get_mka_param_body_len(body);
 	if (body->type == MKA_LIVE_PEER_LIST) {
 		wpa_printf(MSG_DEBUG, "*** Live Peer List ***");
-		wpa_printf(MSG_DEBUG, "\tBody Length...: %d", (int) body_len);
+		wpa_printf(MSG_DEBUG, "\tBody Length...: %zu", body_len);
 	} else if (body->type == MKA_POTENTIAL_PEER_LIST) {
 		wpa_printf(MSG_DEBUG, "*** Potential Live Peer List ***");
-		wpa_printf(MSG_DEBUG, "\tBody Length...: %d", (int) body_len);
+		wpa_printf(MSG_DEBUG, "\tBody Length...: %zu", body_len);
 	}
 
 	for (i = 0; i < body_len; i += MI_LEN + sizeof(mn)) {
@@ -187,7 +183,7 @@ ieee802_1x_mka_dump_dist_sak_body(struct ieee802_1x_mka_dist_sak_body *body)
 	wpa_printf(MSG_INFO, "\tDistributed AN........: %d", body->dan);
 	wpa_printf(MSG_INFO, "\tConfidentiality Offset: %d",
 		   body->confid_offset);
-	wpa_printf(MSG_INFO, "\tBody Length...........: %d", (int) body_len);
+	wpa_printf(MSG_INFO, "\tBody Length...........: %zu", body_len);
 	if (!body_len)
 		return;
 
@@ -280,7 +276,7 @@ ieee802_1x_kay_get_principal_participant(struct ieee802_1x_kay *kay)
 			return participant;
 	}
 
-	wpa_printf(MSG_DEBUG, "KaY: principal participant is not founded");
+	wpa_printf(MSG_DEBUG, "KaY: principal participant is not found");
 	return NULL;
 }
 
@@ -300,36 +296,46 @@ static struct ieee802_1x_kay_peer * get_peer_mi(struct dl_list *peers,
 
 
 /**
- * ieee802_1x_kay_is_in_potential_peer
+ * ieee802_1x_kay_get_potential_peer
  */
-static Boolean
-ieee802_1x_kay_is_in_potential_peer(
+static struct ieee802_1x_kay_peer *
+ieee802_1x_kay_get_potential_peer(
 	struct ieee802_1x_mka_participant *participant, const u8 *mi)
 {
-	return get_peer_mi(&participant->potential_peers, mi) != NULL;
+	return get_peer_mi(&participant->potential_peers, mi);
 }
 
 
 /**
- * ieee802_1x_kay_is_in_live_peer
+ * ieee802_1x_kay_get_live_peer
+ */
+static struct ieee802_1x_kay_peer *
+ieee802_1x_kay_get_live_peer(struct ieee802_1x_mka_participant *participant,
+			     const u8 *mi)
+{
+	return get_peer_mi(&participant->live_peers, mi);
+}
+
+
+/**
+ * ieee802_1x_kay_is_in_potential_peer
  */
 static Boolean
-ieee802_1x_kay_is_in_live_peer(
+ieee802_1x_kay_is_in_potential_peer(
 	struct ieee802_1x_mka_participant *participant, const u8 *mi)
 {
-	return get_peer_mi(&participant->live_peers, mi) != NULL;
+	return ieee802_1x_kay_get_potential_peer(participant, mi) != NULL;
 }
 
 
 /**
- * ieee802_1x_kay_is_in_peer
+ * ieee802_1x_kay_is_in_live_peer
  */
 static Boolean
-ieee802_1x_kay_is_in_peer(struct ieee802_1x_mka_participant *participant,
-			  const u8 *mi)
+ieee802_1x_kay_is_in_live_peer(
+	struct ieee802_1x_mka_participant *participant, const u8 *mi)
 {
-	return ieee802_1x_kay_is_in_live_peer(participant, mi) ||
-		ieee802_1x_kay_is_in_potential_peer(participant, mi);
+	return ieee802_1x_kay_get_live_peer(participant, mi) != NULL;
 }
 
 
@@ -342,22 +348,11 @@ ieee802_1x_kay_get_peer(struct ieee802_1x_mka_participant *participant,
 {
 	struct ieee802_1x_kay_peer *peer;
 
-	peer = get_peer_mi(&participant->live_peers, mi);
+	peer = ieee802_1x_kay_get_live_peer(participant, mi);
 	if (peer)
 		return peer;
 
-	return get_peer_mi(&participant->potential_peers, mi);
-}
-
-
-/**
- * ieee802_1x_kay_get_live_peer
- */
-static struct ieee802_1x_kay_peer *
-ieee802_1x_kay_get_live_peer(struct ieee802_1x_mka_participant *participant,
-			     const u8 *mi)
-{
-	return get_peer_mi(&participant->live_peers, mi);
+	return ieee802_1x_kay_get_potential_peer(participant, mi);
 }
 
 
@@ -366,18 +361,28 @@ ieee802_1x_kay_get_live_peer(struct ieee802_1x_mka_participant *participant,
  */
 static struct macsec_ciphersuite *
 ieee802_1x_kay_get_cipher_suite(struct ieee802_1x_mka_participant *participant,
-				u8 *cs_id)
+				const u8 *cs_id)
 {
 	unsigned int i;
+	u64 cs;
+	be64 _cs;
+
+	os_memcpy(&_cs, cs_id, CS_ID_LEN);
+	cs = be_to_host64(_cs);
 
 	for (i = 0; i < CS_TABLE_SIZE; i++) {
-		if (os_memcmp(cipher_suite_tbl[i].id, cs_id, CS_ID_LEN) == 0)
-			break;
+		if (cipher_suite_tbl[i].id == cs)
+			return &cipher_suite_tbl[i];
 	}
-	if (i >= CS_TABLE_SIZE)
-		return NULL;
 
-	return &cipher_suite_tbl[i];
+	return NULL;
+}
+
+
+static Boolean sci_equal(const struct ieee802_1x_mka_sci *a,
+			 const struct ieee802_1x_mka_sci *b)
+{
+	return os_memcmp(a, b, sizeof(struct ieee802_1x_mka_sci)) == 0;
 }
 
 
@@ -392,13 +397,13 @@ ieee802_1x_kay_get_peer_sci(struct ieee802_1x_mka_participant *participant,
 
 	dl_list_for_each(peer, &participant->live_peers,
 			 struct ieee802_1x_kay_peer, list) {
-		if (os_memcmp(&peer->sci, sci, sizeof(peer->sci)) == 0)
+		if (sci_equal(&peer->sci, sci))
 			return peer;
 	}
 
 	dl_list_for_each(peer, &participant->potential_peers,
 			 struct ieee802_1x_kay_peer, list) {
-		if (os_memcmp(&peer->sci, sci, sizeof(peer->sci)) == 0)
+		if (sci_equal(&peer->sci, sci))
 			return peer;
 	}
 
@@ -435,8 +440,8 @@ ieee802_1x_kay_init_receive_sa(struct receive_sc *psc, u8 an, u32 lowest_pn,
 
 	dl_list_add(&psc->sa_list, &psa->list);
 	wpa_printf(MSG_DEBUG,
-		   "KaY: Create receive SA(AN: %d lowest_pn: %u of SC(channel: %d)",
-		   (int) an, lowest_pn, psc->channel);
+		   "KaY: Create receive SA(AN: %hhu lowest_pn: %u of SC(channel: %d)",
+		   an, lowest_pn, psc->channel);
 
 	return psa;
 }
@@ -449,8 +454,8 @@ static void ieee802_1x_kay_deinit_receive_sa(struct receive_sa *psa)
 {
 	psa->pkey = NULL;
 	wpa_printf(MSG_DEBUG,
-		   "KaY: Delete receive SA(an: %d) of SC(channel: %d)",
-		   psa->an, psa->sc->channel);
+		   "KaY: Delete receive SA(an: %hhu) of SC",
+		   psa->an);
 	dl_list_del(&psa->list);
 	os_free(psa);
 }
@@ -509,19 +514,22 @@ ieee802_1x_kay_deinit_receive_sc(
 }
 
 
-/**
- * ieee802_1x_kay_create_live_peer
- */
+static void ieee802_1x_kay_dump_peer(struct ieee802_1x_kay_peer *peer)
+{
+	wpa_hexdump(MSG_DEBUG, "\tMI: ", peer->mi, sizeof(peer->mi));
+	wpa_printf(MSG_DEBUG, "\tMN: %d", peer->mn);
+	wpa_hexdump(MSG_DEBUG, "\tSCI Addr: ", peer->sci.addr, ETH_ALEN);
+	wpa_printf(MSG_DEBUG, "\tPort: %d", peer->sci.port);
+}
+
+
 static struct ieee802_1x_kay_peer *
-ieee802_1x_kay_create_live_peer(struct ieee802_1x_mka_participant *participant,
-				u8 *mi, u32 mn)
+ieee802_1x_kay_create_peer(const u8 *mi, u32 mn)
 {
 	struct ieee802_1x_kay_peer *peer;
-	struct receive_sc *rxsc;
-	u32 sc_ch = 0;
 
 	peer = os_zalloc(sizeof(*peer));
-	if (peer == NULL) {
+	if (!peer) {
 		wpa_printf(MSG_ERROR, "KaY-%s: out of memory", __func__);
 		return NULL;
 	}
@@ -530,24 +538,43 @@ ieee802_1x_kay_create_live_peer(struct ieee802_1x_mka_participant *participant,
 	peer->mn = mn;
 	peer->expire = time(NULL) + MKA_LIFE_TIME / 1000;
 	peer->sak_used = FALSE;
+
+	return peer;
+}
+
+
+/**
+ * ieee802_1x_kay_create_live_peer
+ */
+static struct ieee802_1x_kay_peer *
+ieee802_1x_kay_create_live_peer(struct ieee802_1x_mka_participant *participant,
+				const u8 *mi, u32 mn)
+{
+	struct ieee802_1x_kay_peer *peer;
+	struct receive_sc *rxsc;
+	u32 sc_ch = 0;
+
+	peer = ieee802_1x_kay_create_peer(mi, mn);
+	if (!peer)
+		return NULL;
+
 	os_memcpy(&peer->sci, &participant->current_peer_sci,
 		  sizeof(peer->sci));
-	dl_list_add(&participant->live_peers, &peer->list);
 
 	secy_get_available_receive_sc(participant->kay, &sc_ch);
 
 	rxsc = ieee802_1x_kay_init_receive_sc(&peer->sci, sc_ch);
-	if (!rxsc)
+	if (!rxsc) {
+		os_free(peer);
 		return NULL;
+	}
 
+	dl_list_add(&participant->live_peers, &peer->list);
 	dl_list_add(&participant->rxsc_list, &rxsc->list);
 	secy_create_receive_sc(participant->kay, rxsc);
 
 	wpa_printf(MSG_DEBUG, "KaY: Live peer created");
-	wpa_hexdump(MSG_DEBUG, "\tMI: ", peer->mi, sizeof(peer->mi));
-	wpa_printf(MSG_DEBUG, "\tMN: %d", peer->mn);
-	wpa_hexdump(MSG_DEBUG, "\tSCI Addr: ", peer->sci.addr, ETH_ALEN);
-	wpa_printf(MSG_DEBUG, "\tPort: %d", peer->sci.port);
+	ieee802_1x_kay_dump_peer(peer);
 
 	return peer;
 }
@@ -562,24 +589,14 @@ ieee802_1x_kay_create_potential_peer(
 {
 	struct ieee802_1x_kay_peer *peer;
 
-	peer = os_zalloc(sizeof(*peer));
-	if (peer == NULL) {
-		wpa_printf(MSG_ERROR, "KaY-%s: out of memory", __func__);
+	peer = ieee802_1x_kay_create_peer(mi, mn);
+	if (!peer)
 		return NULL;
-	}
-
-	os_memcpy(peer->mi, mi, MI_LEN);
-	peer->mn = mn;
-	peer->expire = time(NULL) + MKA_LIFE_TIME / 1000;
-	peer->sak_used = FALSE;
 
 	dl_list_add(&participant->potential_peers, &peer->list);
 
 	wpa_printf(MSG_DEBUG, "KaY: potential peer created");
-	wpa_hexdump(MSG_DEBUG, "\tMI: ", peer->mi, sizeof(peer->mi));
-	wpa_printf(MSG_DEBUG, "\tMN: %d", peer->mn);
-	wpa_hexdump(MSG_DEBUG, "\tSCI Addr: ", peer->sci.addr, ETH_ALEN);
-	wpa_printf(MSG_DEBUG, "\tPort: %d", peer->sci.port);
+	ieee802_1x_kay_dump_peer(peer);
 
 	return peer;
 }
@@ -596,11 +613,12 @@ ieee802_1x_kay_move_live_peer(struct ieee802_1x_mka_participant *participant,
 	struct receive_sc *rxsc;
 	u32 sc_ch = 0;
 
-	dl_list_for_each(peer, &participant->potential_peers,
-			 struct ieee802_1x_kay_peer, list) {
-		if (os_memcmp(peer->mi, mi, MI_LEN) == 0)
-			break;
-	}
+	peer = ieee802_1x_kay_get_potential_peer(participant, mi);
+
+	rxsc = ieee802_1x_kay_init_receive_sc(&participant->current_peer_sci,
+					      sc_ch);
+	if (!rxsc)
+		return NULL;
 
 	os_memcpy(&peer->sci, &participant->current_peer_sci,
 		  sizeof(peer->sci));
@@ -608,20 +626,13 @@ ieee802_1x_kay_move_live_peer(struct ieee802_1x_mka_participant *participant,
 	peer->expire = time(NULL) + MKA_LIFE_TIME / 1000;
 
 	wpa_printf(MSG_DEBUG, "KaY: move potential peer to live peer");
-	wpa_hexdump(MSG_DEBUG, "\tMI: ", peer->mi, sizeof(peer->mi));
-	wpa_printf(MSG_DEBUG, "\tMN: %d", peer->mn);
-	wpa_hexdump(MSG_DEBUG, "\tSCI Addr: ", peer->sci.addr, ETH_ALEN);
-	wpa_printf(MSG_DEBUG, "\tPort: %d", peer->sci.port);
+	ieee802_1x_kay_dump_peer(peer);
 
 	dl_list_del(&peer->list);
 	dl_list_add_tail(&participant->live_peers, &peer->list);
 
 	secy_get_available_receive_sc(participant->kay, &sc_ch);
 
-	rxsc = ieee802_1x_kay_init_receive_sc(&peer->sci, sc_ch);
-	if (!rxsc)
-		return NULL;
-
 	dl_list_add(&participant->rxsc_list, &rxsc->list);
 	secy_create_receive_sc(participant->kay, rxsc);
 
@@ -651,7 +662,7 @@ ieee802_1x_mka_basic_body_length(struct ieee802_1x_mka_participant *participant)
 
 	length = sizeof(struct ieee802_1x_mka_basic_body);
 	length += participant->ckn.len;
-	return (length + 0x3) & ~0x3;
+	return MKA_ALIGN_LENGTH(length);
 }
 
 
@@ -677,17 +688,17 @@ ieee802_1x_mka_encode_basic_body(
 		body->key_server = participant->can_be_key_server;
 
 	body->macsec_desired = kay->macsec_desired;
-	body->macsec_capbility = kay->macsec_capable;
+	body->macsec_capability = kay->macsec_capable;
 	set_mka_param_body_len(body, length - MKA_HDR_LEN);
 
 	os_memcpy(body->actor_sci.addr, kay->actor_sci.addr,
 		  sizeof(kay->actor_sci.addr));
-	body->actor_sci.port = host_to_be16(kay->actor_sci.port);
+	body->actor_sci.port = kay->actor_sci.port;
 
 	os_memcpy(body->actor_mi, participant->mi, sizeof(body->actor_mi));
 	participant->mn = participant->mn + 1;
 	body->actor_mn = host_to_be32(participant->mn);
-	os_memcpy(body->algo_agility, participant->kay->algo_agility,
+	os_memcpy(body->algo_agility, kay->algo_agility,
 		  sizeof(body->algo_agility));
 
 	os_memcpy(body->ckn, participant->ckn.name, participant->ckn.len);
@@ -698,6 +709,17 @@ ieee802_1x_mka_encode_basic_body(
 }
 
 
+static Boolean
+reset_participant_mi(struct ieee802_1x_mka_participant *participant)
+{
+	if (os_get_random(participant->mi, sizeof(participant->mi)) < 0)
+		return FALSE;
+	participant->mn = 0;
+
+	return TRUE;
+}
+
+
 /**
  * ieee802_1x_mka_decode_basic_body -
  */
@@ -729,16 +751,15 @@ ieee802_1x_mka_decode_basic_body(struct ieee802_1x_kay *kay, const u8 *mka_msg,
 
 	/* If the peer's MI is my MI, I will choose new MI */
 	if (os_memcmp(body->actor_mi, participant->mi, MI_LEN) == 0) {
-		if (os_get_random(participant->mi, sizeof(participant->mi)) < 0)
+		if (!reset_participant_mi(participant))
 			return NULL;
-		participant->mn = 0;
 	}
 
 	os_memcpy(participant->current_peer_id.mi, body->actor_mi, MI_LEN);
-	participant->current_peer_id.mn =  be_to_host32(body->actor_mn);
+	participant->current_peer_id.mn = body->actor_mn;
 	os_memcpy(participant->current_peer_sci.addr, body->actor_sci.addr,
 		  sizeof(participant->current_peer_sci.addr));
-	participant->current_peer_sci.port = be_to_host16(body->actor_sci.port);
+	participant->current_peer_sci.port = body->actor_sci.port;
 
 	/* handler peer */
 	peer = ieee802_1x_kay_get_peer(participant, body->actor_mi);
@@ -763,14 +784,14 @@ ieee802_1x_mka_decode_basic_body(struct ieee802_1x_kay *kay, const u8 *mka_msg,
 			return NULL;
 
 		peer->macsec_desired = body->macsec_desired;
-		peer->macsec_capbility = body->macsec_capbility;
+		peer->macsec_capability = body->macsec_capability;
 		peer->is_key_server = (Boolean) body->key_server;
 		peer->key_server_priority = body->priority;
 	} else if (peer->mn < be_to_host32(body->actor_mn)) {
 		peer->mn = be_to_host32(body->actor_mn);
 		peer->expire = time(NULL) + MKA_LIFE_TIME / 1000;
 		peer->macsec_desired = body->macsec_desired;
-		peer->macsec_capbility = body->macsec_capbility;
+		peer->macsec_capability = body->macsec_capability;
 		peer->is_key_server = (Boolean) body->key_server;
 		peer->key_server_priority = body->priority;
 	} else {
@@ -807,7 +828,7 @@ ieee802_1x_mka_get_live_peer_length(
 			 struct ieee802_1x_kay_peer, list)
 		len += sizeof(struct ieee802_1x_mka_peer_id);
 
-	return (len + 0x3) & ~0x3;
+	return MKA_ALIGN_LENGTH(len);
 }
 
 
@@ -836,7 +857,6 @@ ieee802_1x_mka_encode_live_peer_body(
 				       sizeof(struct ieee802_1x_mka_peer_id));
 		os_memcpy(body_peer->mi, peer->mi, MI_LEN);
 		body_peer->mn = host_to_be32(peer->mn);
-		body_peer++;
 	}
 
 	ieee802_1x_mka_dump_peer_body(body);
@@ -868,7 +888,7 @@ ieee802_1x_mka_get_potential_peer_length(
 			 struct ieee802_1x_kay_peer, list)
 		len += sizeof(struct ieee802_1x_mka_peer_id);
 
-	return (len + 0x3) & ~0x3;
+	return MKA_ALIGN_LENGTH(len);
 }
 
 
@@ -897,7 +917,6 @@ ieee802_1x_mka_encode_potential_peer_body(
 				       sizeof(struct ieee802_1x_mka_peer_id));
 		os_memcpy(body_peer->mi, peer->mi, MI_LEN);
 		body_peer->mn = host_to_be32(peer->mn);
-		body_peer++;
 	}
 
 	ieee802_1x_mka_dump_peer_body(body);
@@ -912,62 +931,54 @@ static Boolean
 ieee802_1x_mka_i_in_peerlist(struct ieee802_1x_mka_participant *participant,
 			     const u8 *mka_msg, size_t msg_len)
 {
-	Boolean included = FALSE;
 	struct ieee802_1x_mka_hdr *hdr;
 	size_t body_len;
 	size_t left_len;
-	int body_type;
-	u32 peer_mn;
-	const u8 *peer_mi;
+	u8 body_type;
 	const u8 *pos;
 	size_t i;
 
-	pos = mka_msg;
-	left_len = msg_len;
-	while (left_len > (MKA_HDR_LEN + DEFAULT_ICV_LEN)) {
+	for (pos = mka_msg, left_len = msg_len;
+	     left_len > MKA_HDR_LEN + DEFAULT_ICV_LEN;
+	     left_len -= body_len + MKA_HDR_LEN,
+		     pos += body_len + MKA_HDR_LEN) {
 		hdr = (struct ieee802_1x_mka_hdr *) pos;
 		body_len = get_mka_param_body_len(hdr);
 		body_type = get_mka_param_body_type(hdr);
 
 		if (body_type != MKA_LIVE_PEER_LIST &&
 		    body_type != MKA_POTENTIAL_PEER_LIST)
-			goto SKIP_PEER;
+			continue;
 
 		ieee802_1x_mka_dump_peer_body(
 			(struct ieee802_1x_mka_peer_body *)pos);
 
 		if (left_len < (MKA_HDR_LEN + body_len + DEFAULT_ICV_LEN)) {
 			wpa_printf(MSG_ERROR,
-				   "KaY: MKA Peer Packet Body Length (%d bytes) is less than the Parameter Set Header Length (%d bytes) + the Parameter Set Body Length (%d bytes) + %d bytes of ICV",
-				   (int) left_len, (int) MKA_HDR_LEN,
-				   (int) body_len, DEFAULT_ICV_LEN);
-			goto SKIP_PEER;
+				   "KaY: MKA Peer Packet Body Length (%zu bytes) is less than the Parameter Set Header Length (%zu bytes) + the Parameter Set Body Length (%zu bytes) + %d bytes of ICV",
+				   left_len, MKA_HDR_LEN,
+				   body_len, DEFAULT_ICV_LEN);
+			continue;
 		}
 
 		if ((body_len % 16) != 0) {
 			wpa_printf(MSG_ERROR,
-				   "KaY: MKA Peer Packet Body Length (%d bytes) should multiple of 16 octets",
-				   (int) body_len);
-			goto SKIP_PEER;
-		}
-
-		for (i = 0; i < body_len; i += MI_LEN + sizeof(peer_mn)) {
-			peer_mi = MKA_HDR_LEN + pos + i;
-			os_memcpy(&peer_mn, peer_mi + MI_LEN, sizeof(peer_mn));
-			peer_mn = be_to_host32(peer_mn);
-			if (os_memcmp(peer_mi, participant->mi, MI_LEN) == 0 &&
-			    peer_mn == participant->mn) {
-				included = TRUE;
-				break;
-			}
+				   "KaY: MKA Peer Packet Body Length (%zu bytes) should be a multiple of 16 octets",
+				   body_len);
+			continue;
 		}
 
-		if (included)
-			return TRUE;
+		for (i = 0; i < body_len;
+		     i += sizeof(struct ieee802_1x_mka_peer_id)) {
+			const struct ieee802_1x_mka_peer_id *peer_mi;
 
-SKIP_PEER:
-		left_len -= body_len + MKA_HDR_LEN;
-		pos += body_len + MKA_HDR_LEN;
+			peer_mi = (const struct ieee802_1x_mka_peer_id *)
+				(pos + MKA_HDR_LEN + i);
+			if (os_memcmp(peer_mi->mi, participant->mi,
+				      MI_LEN) == 0 &&
+			    be_to_host32(peer_mi->mn) == participant->mn)
+				return TRUE;
+		}
 	}
 
 	return FALSE;
@@ -984,8 +995,6 @@ static int ieee802_1x_mka_decode_live_peer_body(
 	const struct ieee802_1x_mka_hdr *hdr;
 	struct ieee802_1x_kay_peer *peer;
 	size_t body_len;
-	u32 peer_mn;
-	const u8 *peer_mi;
 	size_t i;
 	Boolean is_included;
 
@@ -994,36 +1003,40 @@ static int ieee802_1x_mka_decode_live_peer_body(
 
 	hdr = (const struct ieee802_1x_mka_hdr *) peer_msg;
 	body_len = get_mka_param_body_len(hdr);
+	if (body_len % 16 != 0) {
+		wpa_printf(MSG_ERROR,
+			   "KaY: MKA Peer Packet Body Length (%zu bytes) should be a multiple of 16 octets",
+			   body_len);
+		return -1;
+	}
+
+	for (i = 0; i < body_len; i += sizeof(struct ieee802_1x_mka_peer_id)) {
+		const struct ieee802_1x_mka_peer_id *peer_mi;
+		u32 peer_mn;
 
-	for (i = 0; i < body_len; i += MI_LEN + sizeof(peer_mn)) {
-		peer_mi = MKA_HDR_LEN + peer_msg + i;
-		os_memcpy(&peer_mn, peer_mi + MI_LEN, sizeof(peer_mn));
-		peer_mn = be_to_host32(peer_mn);
+		peer_mi = (const struct ieee802_1x_mka_peer_id *)
+			(peer_msg + MKA_HDR_LEN + i);
+		peer_mn = be_to_host32(peer_mi->mn);
 
 		/* it is myself */
 		if (os_memcmp(peer_mi, participant->mi, MI_LEN) == 0) {
 			/* My message id is used by other participant */
-			if (peer_mn > participant->mn) {
-				if (os_get_random(participant->mi,
-						  sizeof(participant->mi)) < 0)
-					wpa_printf(MSG_DEBUG,
-						   "KaY: Could not update mi");
-				participant->mn = 0;
-			}
+			if (peer_mn > participant->mn &&
+			    !reset_participant_mi(participant))
+				wpa_printf(MSG_DEBUG, "KaY: Could not update mi");
 			continue;
 		}
+
 		if (!is_included)
 			continue;
 
-		peer = ieee802_1x_kay_get_peer(participant, peer_mi);
-		if (NULL != peer) {
+		peer = ieee802_1x_kay_get_peer(participant, peer_mi->mi);
+		if (peer) {
 			peer->mn = peer_mn;
 			peer->expire = time(NULL) + MKA_LIFE_TIME / 1000;
-		} else {
-			if (!ieee802_1x_kay_create_potential_peer(
-				participant, peer_mi, peer_mn)) {
-				return -1;
-			}
+		} else if (!ieee802_1x_kay_create_potential_peer(
+				participant, peer_mi->mi, peer_mn)) {
+			return -1;
 		}
 	}
 
@@ -1039,30 +1052,33 @@ ieee802_1x_mka_decode_potential_peer_body(
 	struct ieee802_1x_mka_participant *participant,
 	const u8 *peer_msg, size_t msg_len)
 {
-	struct ieee802_1x_mka_hdr *hdr;
+	const struct ieee802_1x_mka_hdr *hdr;
 	size_t body_len;
-	u32 peer_mn;
-	const u8 *peer_mi;
 	size_t i;
 
-	hdr = (struct ieee802_1x_mka_hdr *) peer_msg;
+	hdr = (const struct ieee802_1x_mka_hdr *) peer_msg;
 	body_len = get_mka_param_body_len(hdr);
+	if (body_len % 16 != 0) {
+		wpa_printf(MSG_ERROR,
+			   "KaY: MKA Peer Packet Body Length (%zu bytes) should be a multiple of 16 octets",
+			   body_len);
+		return -1;
+	}
 
-	for (i = 0; i < body_len; i += MI_LEN + sizeof(peer_mn)) {
-		peer_mi = MKA_HDR_LEN + peer_msg + i;
-		os_memcpy(&peer_mn, peer_mi + MI_LEN, sizeof(peer_mn));
-		peer_mn = be_to_host32(peer_mn);
+	for (i = 0; i < body_len; i += sizeof(struct ieee802_1x_mka_peer_id)) {
+		const struct ieee802_1x_mka_peer_id *peer_mi;
+		u32 peer_mn;
+
+		peer_mi = (struct ieee802_1x_mka_peer_id *)
+			(peer_msg + MKA_HDR_LEN + i);
+		peer_mn = be_to_host32(peer_mi->mn);
 
 		/* it is myself */
 		if (os_memcmp(peer_mi, participant->mi, MI_LEN) == 0) {
 			/* My message id is used by other participant */
-			if (peer_mn > participant->mn) {
-				if (os_get_random(participant->mi,
-						  sizeof(participant->mi)) < 0)
-					wpa_printf(MSG_DEBUG,
-						   "KaY: Could not update mi");
-				participant->mn = 0;
-			}
+			if (peer_mn > participant->mn &&
+			    !reset_participant_mi(participant))
+				wpa_printf(MSG_DEBUG, "KaY: Could not update mi");
 			continue;
 		}
 	}
@@ -1078,10 +1094,7 @@ static Boolean
 ieee802_1x_mka_sak_use_body_present(
 	struct ieee802_1x_mka_participant *participant)
 {
-	if (participant->to_use_sak)
-		return TRUE;
-	else
-		return FALSE;
+	return participant->to_use_sak;
 }
 
 
@@ -1096,12 +1109,8 @@ ieee802_1x_mka_get_sak_use_length(
 
 	if (participant->kay->macsec_desired && participant->advised_desired)
 		length = sizeof(struct ieee802_1x_mka_sak_use_body);
-	else
-		length = MKA_HDR_LEN;
 
-	length = (length + 0x3) & ~0x3;
-
-	return length;
+	return MKA_ALIGN_LENGTH(length);
 }
 
 
@@ -1146,11 +1155,12 @@ ieee802_1x_mka_encode_sak_use_body(
 	struct wpabuf *buf)
 {
 	struct ieee802_1x_mka_sak_use_body *body;
+	struct ieee802_1x_kay *kay = participant->kay;
 	unsigned int length;
 	u32 pn = 1;
 
 	length = ieee802_1x_mka_get_sak_use_length(participant);
-	body = wpabuf_put(buf, sizeof(struct ieee802_1x_mka_sak_use_body));
+	body = wpabuf_put(buf, length);
 
 	body->type = MKA_SAK_USE;
 	set_mka_param_body_len(body, length - MKA_HDR_LEN);
@@ -1166,9 +1176,9 @@ ieee802_1x_mka_encode_sak_use_body(
 	}
 
 	/* data protect, lowest accept packet number */
-	body->delay_protect = participant->kay->macsec_replay_protect;
+	body->delay_protect = kay->macsec_replay_protect;
 	pn = ieee802_1x_mka_get_lpn(participant, &participant->lki);
-	if (pn > participant->kay->pn_exhaustion) {
+	if (pn > kay->pn_exhaustion) {
 		wpa_printf(MSG_WARNING, "KaY: My LPN exhaustion");
 		if (participant->is_key_server)
 			participant->new_sak = TRUE;
@@ -1179,20 +1189,12 @@ ieee802_1x_mka_encode_sak_use_body(
 	body->olpn = host_to_be32(pn);
 
 	/* plain tx, plain rx */
-	if (participant->kay->macsec_protect)
-		body->ptx = FALSE;
-	else
-		body->ptx = TRUE;
-
-	if (participant->kay->macsec_validate == Strict)
-		body->prx = FALSE;
-	else
-		body->prx = TRUE;
+	body->ptx = !kay->macsec_protect;
+	body->prx = kay->macsec_validate != Strict;
 
 	/* latest key: rx, tx, key server member identifier key number */
 	body->lan = participant->lan;
-	os_memcpy(body->lsrv_mi, participant->lki.mi,
-		  sizeof(body->lsrv_mi));
+	os_memcpy(body->lsrv_mi, participant->lki.mi, sizeof(body->lsrv_mi));
 	body->lkn = host_to_be32(participant->lki.kn);
 	body->lrx = participant->lrx;
 	body->ltx = participant->ltx;
@@ -1213,16 +1215,11 @@ ieee802_1x_mka_encode_sak_use_body(
 
 	/* set CP's variable */
 	if (body->ltx) {
-		if (!participant->kay->tx_enable)
-			participant->kay->tx_enable = TRUE;
-
-		if (!participant->kay->port_enable)
-			participant->kay->port_enable = TRUE;
-	}
-	if (body->lrx) {
-		if (!participant->kay->rx_enable)
-			participant->kay->rx_enable = TRUE;
+		kay->tx_enable = TRUE;
+		kay->port_enable = TRUE;
 	}
+	if (body->lrx)
+		kay->rx_enable = TRUE;
 
 	ieee802_1x_mka_dump_sak_use_body(body);
 	return 0;
@@ -1246,7 +1243,8 @@ ieee802_1x_mka_decode_sak_use_body(
 	struct ieee802_1x_mka_ki ki;
 	u32 lpn;
 	Boolean all_receiving;
-	Boolean founded;
+	Boolean found;
+	struct ieee802_1x_kay *kay = participant->kay;
 
 	if (!participant->principal) {
 		wpa_printf(MSG_WARNING, "KaY: Participant is not principal");
@@ -1266,8 +1264,8 @@ ieee802_1x_mka_decode_sak_use_body(
 
 	if ((body_len != 0) && (body_len < 40)) {
 		wpa_printf(MSG_ERROR,
-			   "KaY: MKA Use SAK Packet Body Length (%d bytes) should be 0, 40, or more octets",
-			   (int) body_len);
+			   "KaY: MKA Use SAK Packet Body Length (%zu bytes) should be 0, 40, or more octets",
+			   body_len);
 		return -1;
 	}
 
@@ -1288,30 +1286,29 @@ ieee802_1x_mka_decode_sak_use_body(
 
 	/* check latest key is valid */
 	if (body->ltx || body->lrx) {
-		founded = FALSE;
+		found = FALSE;
 		os_memcpy(ki.mi, body->lsrv_mi, sizeof(ki.mi));
-		ki.kn = ntohl(body->lkn);
+		ki.kn = be_to_host32(body->lkn);
 		dl_list_for_each(sa_key, &participant->sak_list,
 				 struct data_key, list) {
 			if (is_ki_equal(&sa_key->key_identifier, &ki)) {
-				founded = TRUE;
+				found = TRUE;
 				break;
 			}
 		}
-		if (!founded) {
+		if (!found) {
 			wpa_printf(MSG_WARNING, "KaY: Latest key is invalid");
 			return -1;
 		}
 		if (os_memcmp(participant->lki.mi, body->lsrv_mi,
 			      sizeof(participant->lki.mi)) == 0 &&
-		    ntohl(body->lkn) == participant->lki.kn &&
+		    be_to_host32(body->lkn) == participant->lki.kn &&
 		    body->lan == participant->lan) {
 			peer->sak_used = TRUE;
 		}
 		if (body->ltx && peer->is_key_server) {
-			ieee802_1x_cp_set_servertransmitting(
-				participant->kay->cp, TRUE);
-			ieee802_1x_cp_sm_step(participant->kay->cp);
+			ieee802_1x_cp_set_servertransmitting(kay->cp, TRUE);
+			ieee802_1x_cp_sm_step(kay->cp);
 		}
 	}
 
@@ -1319,7 +1316,7 @@ ieee802_1x_mka_decode_sak_use_body(
 	if (body->otx || body->orx) {
 		if (os_memcmp(participant->oki.mi, body->osrv_mi,
 			      sizeof(participant->oki.mi)) != 0 ||
-		    ntohl(body->okn) != participant->oki.kn ||
+		    be_to_host32(body->okn) != participant->oki.kn ||
 		    body->oan != participant->oan) {
 			wpa_printf(MSG_WARNING, "KaY: Old key is invalid");
 			return -1;
@@ -1327,7 +1324,8 @@ ieee802_1x_mka_decode_sak_use_body(
 	}
 
 	/* TODO: how to set the MACsec hardware when delay_protect is true */
-	if (body->delay_protect && (!ntohl(body->llpn) || !ntohl(body->olpn))) {
+	if (body->delay_protect &&
+	    (!be_to_host32(body->llpn) || !be_to_host32(body->olpn))) {
 		wpa_printf(MSG_WARNING,
 			   "KaY: Lowest packet number should greater than 0 when delay_protect is TRUE");
 		return -1;
@@ -1344,28 +1342,28 @@ ieee802_1x_mka_decode_sak_use_body(
 	}
 	if (all_receiving) {
 		participant->to_dist_sak = FALSE;
-		ieee802_1x_cp_set_allreceiving(participant->kay->cp, TRUE);
-		ieee802_1x_cp_sm_step(participant->kay->cp);
+		ieee802_1x_cp_set_allreceiving(kay->cp, TRUE);
+		ieee802_1x_cp_sm_step(kay->cp);
 	}
 
 	/* if i'm key server, and detects peer member pn exhaustion, rekey.*/
-	lpn = ntohl(body->llpn);
-	if (lpn > participant->kay->pn_exhaustion) {
+	lpn = be_to_host32(body->llpn);
+	if (lpn > kay->pn_exhaustion) {
 		if (participant->is_key_server) {
 			participant->new_sak = TRUE;
 			wpa_printf(MSG_WARNING, "KaY: Peer LPN exhaustion");
 		}
 	}
 
-	founded = FALSE;
+	found = FALSE;
 	dl_list_for_each(txsa, &participant->txsc->sa_list,
 			 struct transmit_sa, list) {
 		if (sa_key != NULL && txsa->pkey == sa_key) {
-			founded = TRUE;
+			found = TRUE;
 			break;
 		}
 	}
-	if (!founded) {
+	if (!found) {
 		wpa_printf(MSG_WARNING, "KaY: Can't find txsa");
 		return -1;
 	}
@@ -1373,9 +1371,9 @@ ieee802_1x_mka_decode_sak_use_body(
 	/* FIXME: Secy creates txsa with default npn. If MKA detected Latest Key
 	 * npn is larger than txsa's npn, set it to txsa.
 	 */
-	secy_get_transmit_next_pn(participant->kay, txsa);
+	secy_get_transmit_next_pn(kay, txsa);
 	if (lpn > txsa->next_pn) {
-		secy_set_transmit_next_pn(participant->kay, txsa);
+		secy_set_transmit_next_pn(kay, txsa);
 		wpa_printf(MSG_INFO, "KaY: update lpn =0x%x", lpn);
 	}
 
@@ -1390,10 +1388,7 @@ static Boolean
 ieee802_1x_mka_dist_sak_body_present(
 	struct ieee802_1x_mka_participant *participant)
 {
-	if (!participant->to_dist_sak || !participant->new_key)
-		return FALSE;
-
-	return TRUE;
+	return participant->to_dist_sak && participant->new_key;
 }
 
 
@@ -1404,21 +1399,18 @@ static int
 ieee802_1x_mka_get_dist_sak_length(
 	struct ieee802_1x_mka_participant *participant)
 {
-	int length;
-	int cs_index = participant->kay->macsec_csindex;
+	int length = MKA_HDR_LEN;
+	unsigned int cs_index = participant->kay->macsec_csindex;
 
-	if (participant->advised_desired) {
+	if (participant->advised_desired && cs_index < CS_TABLE_SIZE) {
 		length = sizeof(struct ieee802_1x_mka_dist_sak_body);
 		if (cs_index != DEFAULT_CS_INDEX)
 			length += CS_ID_LEN;
 
 		length += cipher_suite_tbl[cs_index].sak_len + 8;
-	} else {
-		length = MKA_HDR_LEN;
 	}
-	length = (length + 0x3) & ~0x3;
 
-	return length;
+	return MKA_ALIGN_LENGTH(length);
 }
 
 
@@ -1433,7 +1425,7 @@ ieee802_1x_mka_encode_dist_sak_body(
 	struct ieee802_1x_mka_dist_sak_body *body;
 	struct data_key *sak;
 	unsigned int length;
-	int cs_index;
+	unsigned int cs_index;
 	int sak_pos;
 
 	length = ieee802_1x_mka_get_dist_sak_length(participant);
@@ -1452,8 +1444,13 @@ ieee802_1x_mka_encode_dist_sak_body(
 	body->kn = host_to_be32(sak->key_identifier.kn);
 	cs_index = participant->kay->macsec_csindex;
 	sak_pos = 0;
+	if (cs_index >= CS_TABLE_SIZE)
+		return -1;
 	if (cs_index != DEFAULT_CS_INDEX) {
-		os_memcpy(body->sak, cipher_suite_tbl[cs_index].id, CS_ID_LEN);
+		be64 cs;
+
+		cs = host_to_be64(cipher_suite_tbl[cs_index].id);
+		os_memcpy(body->sak, &cs, CS_ID_LEN);
 		sak_pos = CS_ID_LEN;
 	}
 	if (aes_wrap(participant->kek.key, 16,
@@ -1472,39 +1469,13 @@ ieee802_1x_mka_encode_dist_sak_body(
 /**
  * ieee802_1x_kay_init_data_key -
  */
-static struct data_key *
-ieee802_1x_kay_init_data_key(const struct key_conf *conf)
+static void ieee802_1x_kay_init_data_key(struct data_key *pkey)
 {
-	struct data_key *pkey;
-
-	if (!conf)
-		return NULL;
-
-	pkey = os_zalloc(sizeof(*pkey));
-	if (pkey == NULL) {
-		wpa_printf(MSG_ERROR, "%s: out of memory", __func__);
-		return NULL;
-	}
-
-	pkey->key = os_zalloc(conf->key_len);
-	if (pkey->key == NULL) {
-		wpa_printf(MSG_ERROR, "%s: out of memory", __func__);
-		os_free(pkey);
-		return NULL;
-	}
-
-	os_memcpy(pkey->key, conf->key, conf->key_len);
-	os_memcpy(&pkey->key_identifier, &conf->ki,
-		  sizeof(pkey->key_identifier));
-	pkey->confidentiality_offset = conf->offset;
-	pkey->an = conf->an;
-	pkey->transmits = conf->tx;
-	pkey->receives = conf->rx;
+	pkey->transmits = TRUE;
+	pkey->receives = TRUE;
 	os_get_time(&pkey->created_time);
 
 	pkey->user = 1;
-
-	return pkey;
 }
 
 
@@ -1521,19 +1492,18 @@ ieee802_1x_mka_decode_dist_sak_body(
 	struct ieee802_1x_kay_peer *peer;
 	struct macsec_ciphersuite *cs;
 	size_t body_len;
-	struct key_conf *conf;
 	struct data_key *sa_key = NULL;
-	struct ieee802_1x_mka_ki sak_ki;
 	int sak_len;
 	u8 *wrap_sak;
 	u8 *unwrap_sak;
+	struct ieee802_1x_kay *kay = participant->kay;
 
 	hdr = (struct ieee802_1x_mka_hdr *) mka_msg;
 	body_len = get_mka_param_body_len(hdr);
 	if ((body_len != 0) && (body_len != 28) && (body_len < 36)) {
 		wpa_printf(MSG_ERROR,
-			   "KaY: MKA Use SAK Packet Body Length (%d bytes) should be 0, 28, 36, or more octets",
-			   (int) body_len);
+			   "KaY: MKA Use SAK Packet Body Length (%zu bytes) should be 0, 28, 36, or more octets",
+			   body_len);
 		return -1;
 	}
 
@@ -1547,8 +1517,8 @@ ieee802_1x_mka_decode_dist_sak_body(
 			   "KaY: I can't accept the distributed SAK as myself is key server ");
 		return -1;
 	}
-	if (!participant->kay->macsec_desired ||
-	    participant->kay->macsec_capable == MACSEC_CAP_NOT_IMPLEMENTED) {
+	if (!kay->macsec_desired ||
+	    kay->macsec_capable == MACSEC_CAP_NOT_IMPLEMENTED) {
 		wpa_printf(MSG_ERROR,
 			   "KaY: I am not MACsec-desired or without MACsec capable");
 		return -1;
@@ -1561,28 +1531,29 @@ ieee802_1x_mka_decode_dist_sak_body(
 			   "KaY: The key server is not in my live peers list");
 		return -1;
 	}
-	if (os_memcmp(&participant->kay->key_server_sci,
-		      &peer->sci, sizeof(struct ieee802_1x_mka_sci)) != 0) {
+	if (!sci_equal(&kay->key_server_sci, &peer->sci)) {
 		wpa_printf(MSG_ERROR, "KaY: The key server is not elected");
 		return -1;
 	}
+
 	if (body_len == 0) {
-		participant->kay->authenticated = TRUE;
-		participant->kay->secured = FALSE;
-		participant->kay->failed = FALSE;
+		kay->authenticated = TRUE;
+		kay->secured = FALSE;
+		kay->failed = FALSE;
 		participant->advised_desired = FALSE;
-		ieee802_1x_cp_connect_authenticated(participant->kay->cp);
-		ieee802_1x_cp_sm_step(participant->kay->cp);
+		ieee802_1x_cp_connect_authenticated(kay->cp);
+		ieee802_1x_cp_sm_step(kay->cp);
 		wpa_printf(MSG_WARNING, "KaY:The Key server advise no MACsec");
 		participant->to_use_sak = TRUE;
 		return 0;
 	}
+
 	participant->advised_desired = TRUE;
-	participant->kay->authenticated = FALSE;
-	participant->kay->secured = TRUE;
-	participant->kay->failed = FALSE;
-	ieee802_1x_cp_connect_secure(participant->kay->cp);
-	ieee802_1x_cp_sm_step(participant->kay->cp);
+	kay->authenticated = FALSE;
+	kay->secured = TRUE;
+	kay->failed = FALSE;
+	ieee802_1x_cp_connect_secure(kay->cp);
+	ieee802_1x_cp_sm_step(kay->cp);
 
 	body = (struct ieee802_1x_mka_dist_sak_body *)mka_msg;
 	ieee802_1x_mka_dump_dist_sak_body(body);
@@ -1595,10 +1566,12 @@ ieee802_1x_mka_decode_dist_sak_body(
 			return 0;
 		}
 	}
+
 	if (body_len == 28) {
 		sak_len = DEFAULT_SA_KEY_LEN;
 		wrap_sak =  body->sak;
-		participant->kay->macsec_csindex = DEFAULT_CS_INDEX;
+		kay->macsec_csindex = DEFAULT_CS_INDEX;
+		cs = &cipher_suite_tbl[kay->macsec_csindex];
 	} else {
 		cs = ieee802_1x_kay_get_cipher_suite(participant, body->sak);
 		if (!cs) {
@@ -1608,7 +1581,7 @@ ieee802_1x_mka_decode_dist_sak_body(
 		}
 		sak_len = cs->sak_len;
 		wrap_sak = body->sak + CS_ID_LEN;
-		participant->kay->macsec_csindex = cs->index;
+		kay->macsec_csindex = cs->index;
 	}
 
 	unwrap_sak = os_zalloc(sak_len);
@@ -1624,62 +1597,36 @@ ieee802_1x_mka_decode_dist_sak_body(
 	}
 	wpa_hexdump(MSG_DEBUG, "\tAES Key Unwrap of SAK:", unwrap_sak, sak_len);
 
-	conf = os_zalloc(sizeof(*conf));
-	if (!conf) {
-		wpa_printf(MSG_ERROR, "KaY-%s: Out of memory", __func__);
-		os_free(unwrap_sak);
-		return -1;
-	}
-	conf->key_len = sak_len;
-
-	conf->key = os_zalloc(conf->key_len);
-	if (!conf->key) {
-		wpa_printf(MSG_ERROR, "KaY-%s: Out of memory", __func__);
+	sa_key = os_zalloc(sizeof(*sa_key));
+	if (!sa_key) {
 		os_free(unwrap_sak);
-		os_free(conf);
 		return -1;
 	}
 
-	os_memcpy(conf->key, unwrap_sak, conf->key_len);
+	os_memcpy(&sa_key->key_identifier.mi, &participant->current_peer_id.mi,
+		  MI_LEN);
+	sa_key->key_identifier.kn = be_to_host32(body->kn);
 
-	os_memcpy(&sak_ki.mi, &participant->current_peer_id.mi,
-		  sizeof(sak_ki.mi));
-	sak_ki.kn = be_to_host32(body->kn);
+	sa_key->key = unwrap_sak;
+	sa_key->key_len = sak_len;
 
-	os_memcpy(conf->ki.mi, sak_ki.mi, MI_LEN);
-	conf->ki.kn = sak_ki.kn;
-	conf->an = body->dan;
-	conf->offset = body->confid_offset;
-	conf->rx = TRUE;
-	conf->tx = TRUE;
-
-	sa_key = ieee802_1x_kay_init_data_key(conf);
-	if (!sa_key) {
-		os_free(unwrap_sak);
-		os_free(conf->key);
-		os_free(conf);
-		return -1;
-	}
+	sa_key->confidentiality_offset = body->confid_offset;
+	sa_key->an = body->dan;
+	ieee802_1x_kay_init_data_key(sa_key);
 
 	dl_list_add(&participant->sak_list, &sa_key->list);
 
-	ieee802_1x_cp_set_ciphersuite(
-		participant->kay->cp,
-		cipher_suite_tbl[participant->kay->macsec_csindex].id);
-	ieee802_1x_cp_sm_step(participant->kay->cp);
-	ieee802_1x_cp_set_offset(participant->kay->cp, body->confid_offset);
-	ieee802_1x_cp_sm_step(participant->kay->cp);
-	ieee802_1x_cp_set_distributedki(participant->kay->cp, &sak_ki);
-	ieee802_1x_cp_set_distributedan(participant->kay->cp, body->dan);
-	ieee802_1x_cp_signal_newsak(participant->kay->cp);
-	ieee802_1x_cp_sm_step(participant->kay->cp);
+	ieee802_1x_cp_set_ciphersuite(kay->cp, cs->id);
+	ieee802_1x_cp_sm_step(kay->cp);
+	ieee802_1x_cp_set_offset(kay->cp, body->confid_offset);
+	ieee802_1x_cp_sm_step(kay->cp);
+	ieee802_1x_cp_set_distributedki(kay->cp, &sa_key->key_identifier);
+	ieee802_1x_cp_set_distributedan(kay->cp, body->dan);
+	ieee802_1x_cp_signal_newsak(kay->cp);
+	ieee802_1x_cp_sm_step(kay->cp);
 
 	participant->to_use_sak = TRUE;
 
-	os_free(unwrap_sak);
-	os_free(conf->key);
-	os_free(conf);
-
 	return 0;
 }
 
@@ -1705,7 +1652,7 @@ ieee802_1x_mka_get_icv_length(struct ieee802_1x_mka_participant *participant)
 	length = sizeof(struct ieee802_1x_mka_icv_body);
 	length += mka_alg_tbl[participant->kay->mka_algindex].icv_len;
 
-	return (length + 0x3) & ~0x3;
+	return MKA_ALIGN_LENGTH(length);
 }
 
 
@@ -1733,12 +1680,9 @@ ieee802_1x_mka_encode_icv_body(struct ieee802_1x_mka_participant *participant,
 		return -1;
 	}
 
-	if (length != DEFAULT_ICV_LEN)  {
-		os_memcpy(wpabuf_put(buf, length - MKA_HDR_LEN), cmac,
-			  length - MKA_HDR_LEN);
-	} else {
-		os_memcpy(wpabuf_put(buf, length), cmac, length);
-	}
+	if (length != DEFAULT_ICV_LEN)
+		length -= MKA_HDR_LEN;
+	os_memcpy(wpabuf_put(buf, length), cmac, length);
 
 	return 0;
 }
@@ -1754,7 +1698,7 @@ ieee802_1x_mka_decode_icv_body(struct ieee802_1x_mka_participant *participant,
 	struct ieee802_1x_mka_icv_body *body;
 	size_t body_len;
 	size_t left_len;
-	int body_type;
+	u8 body_type;
 	const u8 *pos;
 
 	pos = mka_msg;
@@ -1801,8 +1745,8 @@ ieee802_1x_mka_decode_dist_cak_body(
 	body_len = get_mka_param_body_len(hdr);
 	if (body_len < 28) {
 		wpa_printf(MSG_ERROR,
-			   "KaY: MKA Use SAK Packet Body Length (%d bytes) should be 28 or more octets",
-			   (int) body_len);
+			   "KaY: MKA Use SAK Packet Body Length (%zu bytes) should be 28 or more octets",
+			   body_len);
 		return -1;
 	}
 
@@ -1825,8 +1769,8 @@ ieee802_1x_mka_decode_kmd_body(
 	body_len = get_mka_param_body_len(hdr);
 	if (body_len < 5) {
 		wpa_printf(MSG_ERROR,
-			   "KaY: MKA Use SAK Packet Body Length (%d bytes) should be 5 or more octets",
-			   (int) body_len);
+			   "KaY: MKA Use SAK Packet Body Length (%zu bytes) should be 5 or more octets",
+			   body_len);
 		return -1;
 	}
 
@@ -1845,77 +1789,87 @@ static int ieee802_1x_mka_decode_announce_body(
 }
 
 
-static struct mka_param_body_handler mak_body_handler[] = {
+struct mka_param_body_handler {
+	int (*body_tx)(struct ieee802_1x_mka_participant *participant,
+		       struct wpabuf *buf);
+	int (*body_rx)(struct ieee802_1x_mka_participant *participant,
+		       const u8 *mka_msg, size_t msg_len);
+	int (*body_length)(struct ieee802_1x_mka_participant *participant);
+	Boolean (*body_present)(struct ieee802_1x_mka_participant *participant);
+};
+
+
+static struct mka_param_body_handler mka_body_handler[] = {
 	/* basic parameter set */
 	{
-		ieee802_1x_mka_encode_basic_body,
-		NULL,
-		ieee802_1x_mka_basic_body_length,
-		ieee802_1x_mka_basic_body_present
+		.body_tx      = ieee802_1x_mka_encode_basic_body,
+		.body_rx      = NULL,
+		.body_length  = ieee802_1x_mka_basic_body_length,
+		.body_present = ieee802_1x_mka_basic_body_present
 	},
 
 	/* live peer list parameter set */
 	{
-		ieee802_1x_mka_encode_live_peer_body,
-		ieee802_1x_mka_decode_live_peer_body,
-		ieee802_1x_mka_get_live_peer_length,
-		ieee802_1x_mka_live_peer_body_present
+		.body_tx      = ieee802_1x_mka_encode_live_peer_body,
+		.body_rx      = ieee802_1x_mka_decode_live_peer_body,
+		.body_length  = ieee802_1x_mka_get_live_peer_length,
+		.body_present = ieee802_1x_mka_live_peer_body_present
 	},
 
 	/* potential peer list parameter set */
 	{
-		ieee802_1x_mka_encode_potential_peer_body,
-		ieee802_1x_mka_decode_potential_peer_body,
-		ieee802_1x_mka_get_potential_peer_length,
-		ieee802_1x_mka_potential_peer_body_present
+		.body_tx      = ieee802_1x_mka_encode_potential_peer_body,
+		.body_rx      = ieee802_1x_mka_decode_potential_peer_body,
+		.body_length  = ieee802_1x_mka_get_potential_peer_length,
+		.body_present = ieee802_1x_mka_potential_peer_body_present
 	},
 
 	/* sak use parameter set */
 	{
-		ieee802_1x_mka_encode_sak_use_body,
-		ieee802_1x_mka_decode_sak_use_body,
-		ieee802_1x_mka_get_sak_use_length,
-		ieee802_1x_mka_sak_use_body_present
+		.body_tx      = ieee802_1x_mka_encode_sak_use_body,
+		.body_rx      = ieee802_1x_mka_decode_sak_use_body,
+		.body_length  = ieee802_1x_mka_get_sak_use_length,
+		.body_present = ieee802_1x_mka_sak_use_body_present
 	},
 
 	/* distribute sak parameter set */
 	{
-		ieee802_1x_mka_encode_dist_sak_body,
-		ieee802_1x_mka_decode_dist_sak_body,
-		ieee802_1x_mka_get_dist_sak_length,
-		ieee802_1x_mka_dist_sak_body_present
+		.body_tx      = ieee802_1x_mka_encode_dist_sak_body,
+		.body_rx      = ieee802_1x_mka_decode_dist_sak_body,
+		.body_length  = ieee802_1x_mka_get_dist_sak_length,
+		.body_present = ieee802_1x_mka_dist_sak_body_present
 	},
 
 	/* distribute cak parameter set */
 	{
-		NULL,
-		ieee802_1x_mka_decode_dist_cak_body,
-		NULL,
-		NULL
+		.body_tx      = NULL,
+		.body_rx      = ieee802_1x_mka_decode_dist_cak_body,
+		.body_length  = NULL,
+		.body_present = NULL
 	},
 
 	/* kmd parameter set */
 	{
-		NULL,
-		ieee802_1x_mka_decode_kmd_body,
-		NULL,
-		NULL
+		.body_tx      = NULL,
+		.body_rx      = ieee802_1x_mka_decode_kmd_body,
+		.body_length  = NULL,
+		.body_present = NULL
 	},
 
 	/* announce parameter set */
 	{
-		NULL,
-		ieee802_1x_mka_decode_announce_body,
-		NULL,
-		NULL
+		.body_tx      = NULL,
+		.body_rx      = ieee802_1x_mka_decode_announce_body,
+		.body_length  = NULL,
+		.body_present = NULL
 	},
 
 	/* icv parameter set */
 	{
-		ieee802_1x_mka_encode_icv_body,
-		NULL,
-		ieee802_1x_mka_get_icv_length,
-		ieee802_1x_mka_icv_body_present
+		.body_tx      = ieee802_1x_mka_encode_icv_body,
+		.body_rx      = NULL,
+		.body_length  = ieee802_1x_mka_get_icv_length,
+		.body_present = ieee802_1x_mka_icv_body_present
 	},
 };
 
@@ -1923,7 +1877,7 @@ static struct mka_param_body_handler mak_body_handler[] = {
 /**
  * ieee802_1x_kay_deinit_data_key -
  */
-void ieee802_1x_kay_deinit_data_key(struct data_key *pkey)
+static void ieee802_1x_kay_deinit_data_key(struct data_key *pkey)
 {
 	if (!pkey)
 		return;
@@ -1945,11 +1899,13 @@ static int
 ieee802_1x_kay_generate_new_sak(struct ieee802_1x_mka_participant *participant)
 {
 	struct data_key *sa_key = NULL;
-	struct key_conf *conf;
 	struct ieee802_1x_kay_peer *peer;
 	struct ieee802_1x_kay *kay = participant->kay;
 	int ctx_len, ctx_offset;
 	u8 *context;
+	unsigned int key_len;
+	u8 *key;
+	struct macsec_ciphersuite *cs;
 
 	/* check condition for generating a fresh SAK:
 	 * must have one live peer
@@ -1976,40 +1932,29 @@ ieee802_1x_kay_generate_new_sak(struct ieee802_1x_mka_participant *participant)
 		return -1;
 	}
 
-	conf = os_zalloc(sizeof(*conf));
-	if (!conf) {
+	cs = &cipher_suite_tbl[kay->macsec_csindex];
+	key_len = cs->sak_len;
+	key = os_zalloc(key_len);
+	if (!key) {
 		wpa_printf(MSG_ERROR, "KaY-%s: Out of memory", __func__);
 		return -1;
 	}
-	conf->key_len = cipher_suite_tbl[kay->macsec_csindex].sak_len;
 
-	conf->key = os_zalloc(conf->key_len);
-	if (!conf->key) {
-		os_free(conf);
-		wpa_printf(MSG_ERROR, "KaY-%s: Out of memory", __func__);
-		return -1;
-	}
-
-	ctx_len = conf->key_len + sizeof(kay->dist_kn);
+	ctx_len = key_len + sizeof(kay->dist_kn);
 	dl_list_for_each(peer, &participant->live_peers,
 			 struct ieee802_1x_kay_peer, list)
 		ctx_len += sizeof(peer->mi);
 	ctx_len += sizeof(participant->mi);
 
 	context = os_zalloc(ctx_len);
-	if (!context) {
-		os_free(conf->key);
-		os_free(conf);
-		return -1;
-	}
+	if (!context)
+		goto fail;
+
 	ctx_offset = 0;
-	if (os_get_random(context + ctx_offset, conf->key_len) < 0) {
-		os_free(context);
-		os_free(conf->key);
-		os_free(conf);
-		return -1;
-	}
-	ctx_offset += conf->key_len;
+	if (os_get_random(context + ctx_offset, key_len) < 0)
+		goto fail;
+
+	ctx_offset += key_len;
 	dl_list_for_each(peer, &participant->live_peers,
 			 struct ieee802_1x_kay_peer, list) {
 		os_memcpy(context + ctx_offset, peer->mi, sizeof(peer->mi));
@@ -2020,46 +1965,44 @@ ieee802_1x_kay_generate_new_sak(struct ieee802_1x_mka_participant *participant)
 	ctx_offset += sizeof(participant->mi);
 	os_memcpy(context + ctx_offset, &kay->dist_kn, sizeof(kay->dist_kn));
 
-	if (conf->key_len == 16) {
+	if (key_len == 16) {
 		ieee802_1x_sak_128bits_aes_cmac(participant->cak.key,
-						context, ctx_len, conf->key);
-	} else if (conf->key_len == 32) {
+						context, ctx_len, key);
+	} else if (key_len == 32) {
 		ieee802_1x_sak_128bits_aes_cmac(participant->cak.key,
-						context, ctx_len, conf->key);
+						context, ctx_len, key);
 	} else {
 		wpa_printf(MSG_ERROR, "KaY: SAK Length not support");
-		os_free(conf->key);
-		os_free(conf);
-		os_free(context);
-		return -1;
+		goto fail;
 	}
-	wpa_hexdump(MSG_DEBUG, "KaY: generated new SAK",
-		    conf->key, conf->key_len);
-
-	os_memcpy(conf->ki.mi, participant->mi, MI_LEN);
-	conf->ki.kn = participant->kay->dist_kn;
-	conf->an = participant->kay->dist_an;
-	conf->offset = kay->macsec_confidentiality;
-	conf->rx = TRUE;
-	conf->tx = TRUE;
+	wpa_hexdump(MSG_DEBUG, "KaY: generated new SAK", key, key_len);
+	os_free(context);
+	context = NULL;
 
-	sa_key = ieee802_1x_kay_init_data_key(conf);
+	sa_key = os_zalloc(sizeof(*sa_key));
 	if (!sa_key) {
-		os_free(conf->key);
-		os_free(conf);
-		os_free(context);
-		return -1;
+		wpa_printf(MSG_ERROR, "KaY-%s: Out of memory", __func__);
+		goto fail;
 	}
+
+	sa_key->key = key;
+	sa_key->key_len = key_len;
+	os_memcpy(sa_key->key_identifier.mi, participant->mi, MI_LEN);
+	sa_key->key_identifier.kn = kay->dist_kn;
+
+	sa_key->confidentiality_offset = kay->macsec_confidentiality;
+	sa_key->an = kay->dist_an;
+	ieee802_1x_kay_init_data_key(sa_key);
+
 	participant->new_key = sa_key;
 
 	dl_list_add(&participant->sak_list, &sa_key->list);
-	ieee802_1x_cp_set_ciphersuite(participant->kay->cp,
-				      cipher_suite_tbl[kay->macsec_csindex].id);
+	ieee802_1x_cp_set_ciphersuite(kay->cp, cs->id);
 	ieee802_1x_cp_sm_step(kay->cp);
-	ieee802_1x_cp_set_offset(kay->cp, conf->offset);
+	ieee802_1x_cp_set_offset(kay->cp, kay->macsec_confidentiality);
 	ieee802_1x_cp_sm_step(kay->cp);
-	ieee802_1x_cp_set_distributedki(kay->cp, &conf->ki);
-	ieee802_1x_cp_set_distributedan(kay->cp, conf->an);
+	ieee802_1x_cp_set_distributedki(kay->cp, &sa_key->key_identifier);
+	ieee802_1x_cp_set_distributedan(kay->cp, sa_key->an);
 	ieee802_1x_cp_signal_newsak(kay->cp);
 	ieee802_1x_cp_sm_step(kay->cp);
 
@@ -2067,17 +2010,31 @@ ieee802_1x_kay_generate_new_sak(struct ieee802_1x_mka_participant *participant)
 			 struct ieee802_1x_kay_peer, list)
 		peer->sak_used = FALSE;
 
-	participant->kay->dist_kn++;
-	participant->kay->dist_an++;
-	if (participant->kay->dist_an > 3)
-		participant->kay->dist_an = 0;
+	kay->dist_kn++;
+	kay->dist_an++;
+	if (kay->dist_an > 3)
+		kay->dist_an = 0;
 
-	participant->kay->dist_time = time(NULL);
+	kay->dist_time = time(NULL);
 
-	os_free(conf->key);
-	os_free(conf);
-	os_free(context);
 	return 0;
+
+fail:
+	os_free(key);
+	os_free(context);
+	return -1;
+}
+
+
+static int compare_priorities(const struct ieee802_1x_kay_peer *peer,
+			      const struct ieee802_1x_kay_peer *other)
+{
+	if (peer->key_server_priority < other->key_server_priority)
+		return -1;
+	if (other->key_server_priority < peer->key_server_priority)
+		return 1;
+
+	return os_memcmp(peer->sci.addr, other->sci.addr, ETH_ALEN);
 }
 
 
@@ -2092,7 +2049,6 @@ ieee802_1x_kay_elect_key_server(struct ieee802_1x_mka_participant *participant)
 	struct ieee802_1x_kay_peer *key_server = NULL;
 	struct ieee802_1x_kay *kay = participant->kay;
 	Boolean i_is_key_server;
-	int i;
 
 	if (participant->is_obliged_key_server) {
 		participant->new_sak = TRUE;
@@ -2112,47 +2068,26 @@ ieee802_1x_kay_elect_key_server(struct ieee802_1x_mka_participant *participant)
 			continue;
 		}
 
-		if (peer->key_server_priority <
-		    key_server->key_server_priority) {
+		if (compare_priorities(peer, key_server) < 0)
 			key_server = peer;
-		} else if (peer->key_server_priority ==
-			   key_server->key_server_priority) {
-			for (i = 0; i < 6; i++) {
-				if (peer->sci.addr[i] <
-				    key_server->sci.addr[i])
-					key_server = peer;
-			}
-		}
 	}
 
 	/* elect the key server between me and the above elected peer */
 	i_is_key_server = FALSE;
 	if (key_server && participant->can_be_key_server) {
-		if (kay->actor_priority
-			   < key_server->key_server_priority) {
-			i_is_key_server = TRUE;
-		} else if (kay->actor_priority
-					== key_server->key_server_priority) {
-			for (i = 0; i < 6; i++) {
-				if (kay->actor_sci.addr[i]
-					< key_server->sci.addr[i]) {
-					i_is_key_server = TRUE;
-				}
-			}
-		}
-	}
+		struct ieee802_1x_kay_peer tmp;
 
-	if (!key_server && !i_is_key_server) {
-		participant->principal = FALSE;
-		participant->is_key_server = FALSE;
-		participant->is_elected = FALSE;
-		return 0;
+		tmp.key_server_priority = kay->actor_priority;
+		os_memcpy(&tmp.sci, &kay->actor_sci, sizeof(tmp.sci));
+		if (compare_priorities(&tmp, key_server) < 0)
+			i_is_key_server = TRUE;
+	} else if (participant->can_be_key_server) {
+		i_is_key_server = TRUE;
 	}
 
 	if (i_is_key_server) {
 		ieee802_1x_cp_set_electedself(kay->cp, TRUE);
-		if (os_memcmp(&kay->key_server_sci, &kay->actor_sci,
-			      sizeof(kay->key_server_sci))) {
+		if (!sci_equal(&kay->key_server_sci, &kay->actor_sci)) {
 			ieee802_1x_cp_signal_chgdserver(kay->cp);
 			ieee802_1x_cp_sm_step(kay->cp);
 		}
@@ -2167,12 +2102,9 @@ ieee802_1x_kay_elect_key_server(struct ieee802_1x_mka_participant *participant)
 		os_memcpy(&kay->key_server_sci, &kay->actor_sci,
 			  sizeof(kay->key_server_sci));
 		kay->key_server_priority = kay->actor_priority;
-	}
-
-	if (key_server) {
+	} else if (key_server) {
 		ieee802_1x_cp_set_electedself(kay->cp, FALSE);
-		if (os_memcmp(&kay->key_server_sci, &key_server->sci,
-			      sizeof(kay->key_server_sci))) {
+		if (!sci_equal(&kay->key_server_sci, &key_server->sci)) {
 			ieee802_1x_cp_signal_chgdserver(kay->cp);
 			ieee802_1x_cp_sm_step(kay->cp);
 		}
@@ -2184,6 +2116,10 @@ ieee802_1x_kay_elect_key_server(struct ieee802_1x_mka_participant *participant)
 		os_memcpy(&kay->key_server_sci, &key_server->sci,
 			  sizeof(kay->key_server_sci));
 		kay->key_server_priority = key_server->key_server_priority;
+	} else {
+		participant->principal = FALSE;
+		participant->is_key_server = FALSE;
+		participant->is_elected = FALSE;
 	}
 
 	return 0;
@@ -2226,11 +2162,11 @@ ieee802_1x_kay_decide_macsec_use(
 		if (!peer->macsec_desired)
 			continue;
 
-		if (peer->macsec_capbility == MACSEC_CAP_NOT_IMPLEMENTED)
+		if (peer->macsec_capability == MACSEC_CAP_NOT_IMPLEMENTED)
 			continue;
 
-		less_capability = (less_capability < peer->macsec_capbility) ?
-			less_capability : peer->macsec_capbility;
+		less_capability = (less_capability < peer->macsec_capability) ?
+			less_capability : peer->macsec_capability;
 		has_peer = TRUE;
 	}
 
@@ -2291,10 +2227,10 @@ ieee802_1x_kay_encode_mkpdu(struct ieee802_1x_mka_participant *participant,
 	eapol_hdr->type = IEEE802_1X_TYPE_EAPOL_MKA;
 	eapol_hdr->length = host_to_be16(pbuf->size - pbuf->used);
 
-	for (i = 0; i < ARRAY_SIZE(mak_body_handler); i++) {
-		if (mak_body_handler[i].body_present &&
-		    mak_body_handler[i].body_present(participant)) {
-			if (mak_body_handler[i].body_tx(participant, pbuf))
+	for (i = 0; i < ARRAY_SIZE(mka_body_handler); i++) {
+		if (mka_body_handler[i].body_present &&
+		    mka_body_handler[i].body_present(participant)) {
+			if (mka_body_handler[i].body_tx(participant, pbuf))
 				return -1;
 		}
 	}
@@ -2316,10 +2252,10 @@ ieee802_1x_participant_send_mkpdu(
 
 	wpa_printf(MSG_DEBUG, "KaY: to enpacket and send the MKPDU");
 	length += sizeof(struct ieee802_1x_hdr) + sizeof(struct ieee8023_hdr);
-	for (i = 0; i < ARRAY_SIZE(mak_body_handler); i++) {
-		if (mak_body_handler[i].body_present &&
-		    mak_body_handler[i].body_present(participant))
-			length += mak_body_handler[i].body_length(participant);
+	for (i = 0; i < ARRAY_SIZE(mka_body_handler); i++) {
+		if (mka_body_handler[i].body_present &&
+		    mka_body_handler[i].body_present(participant))
+			length += mka_body_handler[i].body_length(participant);
 	}
 
 	buf = wpabuf_alloc(length);
@@ -2360,27 +2296,16 @@ static void ieee802_1x_participant_timer(void *eloop_ctx, void *timeout_ctx)
 	participant = (struct ieee802_1x_mka_participant *)eloop_ctx;
 	kay = participant->kay;
 	if (participant->cak_life) {
-		if (now > participant->cak_life) {
-			kay->authenticated = FALSE;
-			kay->secured = FALSE;
-			kay->failed = TRUE;
-			ieee802_1x_kay_delete_mka(kay, &participant->ckn);
-			return;
-		}
+		if (now > participant->cak_life)
+			goto delete_mka;
 	}
 
 	/* should delete MKA instance if there are not live peers
 	 * when the MKA life elapsed since its creating */
 	if (participant->mka_life) {
 		if (dl_list_empty(&participant->live_peers)) {
-			if (now > participant->mka_life) {
-				kay->authenticated = FALSE;
-				kay->secured = FALSE;
-				kay->failed = TRUE;
-				ieee802_1x_kay_delete_mka(kay,
-							  &participant->ckn);
-				return;
-			}
+			if (now > participant->mka_life)
+				goto delete_mka;
 		} else {
 			participant->mka_life = 0;
 		}
@@ -2397,8 +2322,7 @@ static void ieee802_1x_participant_timer(void *eloop_ctx, void *timeout_ctx)
 			dl_list_for_each_safe(rxsc, pre_rxsc,
 					      &participant->rxsc_list,
 					      struct receive_sc, list) {
-				if (os_memcmp(&rxsc->sci, &peer->sci,
-					      sizeof(rxsc->sci)) == 0) {
+				if (sci_equal(&rxsc->sci, &peer->sci)) {
 					secy_delete_receive_sc(kay, rxsc);
 					ieee802_1x_kay_deinit_receive_sc(
 						participant, rxsc);
@@ -2469,6 +2393,14 @@ static void ieee802_1x_participant_timer(void *eloop_ctx, void *timeout_ctx)
 	eloop_register_timeout(MKA_HELLO_TIME / 1000, 0,
 			       ieee802_1x_participant_timer,
 			       participant, NULL);
+
+	return;
+
+delete_mka:
+	kay->authenticated = FALSE;
+	kay->secured = FALSE;
+	kay->failed = TRUE;
+	ieee802_1x_kay_delete_mka(kay, &participant->ckn);
 }
 
 
@@ -2506,8 +2438,8 @@ ieee802_1x_kay_init_transmit_sa(struct transmit_sc *psc, u8 an, u32 next_PN,
 
 	dl_list_add(&psc->sa_list, &psa->list);
 	wpa_printf(MSG_DEBUG,
-		   "KaY: Create transmit SA(an: %d, next_PN: %u) of SC(channel: %d)",
-		   (int) an, next_PN, psc->channel);
+		   "KaY: Create transmit SA(an: %hhu, next_PN: %u) of SC(channel: %d)",
+		   an, next_PN, psc->channel);
 
 	return psa;
 }
@@ -2520,8 +2452,8 @@ static void ieee802_1x_kay_deinit_transmit_sa(struct transmit_sa *psa)
 {
 	psa->pkey = NULL;
 	wpa_printf(MSG_DEBUG,
-		   "KaY: Delete transmit SA(an: %d) of SC(channel: %d)",
-		   psa->an, psa->sc->channel);
+		   "KaY: Delete transmit SA(an: %hhu) of SC",
+		   psa->an);
 	dl_list_del(&psa->list);
 	os_free(psa);
 }
@@ -2837,38 +2769,6 @@ int ieee802_1x_kay_enable_new_info(struct ieee802_1x_kay *kay)
 
 
 /**
- * ieee802_1x_kay_cp_conf -
- */
-int ieee802_1x_kay_cp_conf(struct ieee802_1x_kay *kay,
-			   struct ieee802_1x_cp_conf *pconf)
-{
-	pconf->protect = kay->macsec_protect;
-	pconf->replay_protect = kay->macsec_replay_protect;
-	pconf->validate = kay->macsec_validate;
-
-	return 0;
-}
-
-
-/**
- * ieee802_1x_kay_alloc_cp_sm -
- */
-static struct ieee802_1x_cp_sm *
-ieee802_1x_kay_alloc_cp_sm(struct ieee802_1x_kay *kay)
-{
-	struct ieee802_1x_cp_conf conf;
-
-	os_memset(&conf, 0, sizeof(conf));
-	conf.protect = kay->macsec_protect;
-	conf.replay_protect = kay->macsec_replay_protect;
-	conf.validate = kay->macsec_validate;
-	conf.replay_window = kay->macsec_replay_window;
-
-	return ieee802_1x_cp_sm_init(kay, &conf);
-}
-
-
-/**
  * ieee802_1x_kay_mkpdu_sanity_check -
  *     sanity check specified in clause 11.11.2 of IEEE802.1X-2010
  */
@@ -2896,13 +2796,13 @@ static int ieee802_1x_kay_mkpdu_sanity_check(struct ieee802_1x_kay *kay,
 		return -1;
 	}
 
-	/* MKPDU should not less than 32 octets */
+	/* MKPDU should not be less than 32 octets */
 	mka_msg_len = be_to_host16(eapol_hdr->length);
 	if (mka_msg_len < 32) {
 		wpa_printf(MSG_MSGDUMP, "KaY: MKPDU is less than 32 octets");
 		return -1;
 	}
-	/* MKPDU should multiple 4 octets */
+	/* MKPDU should be a multiple of 4 octets */
 	if ((mka_msg_len % 4) != 0) {
 		wpa_printf(MSG_MSGDUMP,
 			   "KaY: MKPDU is not multiple of 4 octets");
@@ -2915,9 +2815,9 @@ static int ieee802_1x_kay_mkpdu_sanity_check(struct ieee802_1x_kay *kay,
 	/* EAPOL-MKA body should comprise basic parameter set and ICV */
 	if (mka_msg_len < MKA_HDR_LEN + body_len + DEFAULT_ICV_LEN) {
 		wpa_printf(MSG_ERROR,
-			   "KaY: Received EAPOL-MKA Packet Body Length (%d bytes) is less than the Basic Parameter Set Header Length (%d bytes) + the Basic Parameter Set Body Length (%d bytes) + %d bytes of ICV",
-			   (int) mka_msg_len, (int) MKA_HDR_LEN,
-			   (int) body_len, DEFAULT_ICV_LEN);
+			   "KaY: Received EAPOL-MKA Packet Body Length (%zu bytes) is less than the Basic Parameter Set Header Length (%zu bytes) + the Basic Parameter Set Body Length (%zu bytes) + %d bytes of ICV",
+			   mka_msg_len, MKA_HDR_LEN,
+			   body_len, DEFAULT_ICV_LEN);
 		return -1;
 	}
 
@@ -2948,21 +2848,19 @@ static int ieee802_1x_kay_mkpdu_sanity_check(struct ieee802_1x_kay *kay,
 		wpa_printf(MSG_ERROR, "KaY: omac1_aes_128 failed");
 		return -1;
 	}
+
 	msg_icv = ieee802_1x_mka_decode_icv_body(participant, (u8 *) mka_hdr,
 						 mka_msg_len);
-
-	if (msg_icv) {
-		if (os_memcmp_const(msg_icv, icv,
-				    mka_alg_tbl[kay->mka_algindex].icv_len) !=
-		    0) {
-			wpa_printf(MSG_ERROR,
-				   "KaY: Computed ICV is not equal to Received ICV");
-		return -1;
-		}
-	} else {
+	if (!msg_icv) {
 		wpa_printf(MSG_ERROR, "KaY: No ICV");
 		return -1;
 	}
+	if (os_memcmp_const(msg_icv, icv,
+			    mka_alg_tbl[kay->mka_algindex].icv_len) != 0) {
+		wpa_printf(MSG_ERROR,
+			   "KaY: Computed ICV is not equal to Received ICV");
+		return -1;
+	}
 
 	return 0;
 }
@@ -2978,10 +2876,9 @@ static int ieee802_1x_kay_decode_mkpdu(struct ieee802_1x_kay *kay,
 	struct ieee802_1x_mka_hdr *hdr;
 	size_t body_len;
 	size_t left_len;
-	int body_type;
+	u8 body_type;
 	int i;
 	const u8 *pos;
-	Boolean my_included;
 	Boolean handled[256];
 
 	if (ieee802_1x_kay_mkpdu_sanity_check(kay, buf, len))
@@ -3002,28 +2899,27 @@ static int ieee802_1x_kay_decode_mkpdu(struct ieee802_1x_kay *kay,
 	left_len -= body_len + MKA_HDR_LEN;
 
 	/* check i am in the peer's peer list */
-	my_included = ieee802_1x_mka_i_in_peerlist(participant, pos, left_len);
-	if (my_included) {
+	if (ieee802_1x_mka_i_in_peerlist(participant, pos, left_len) &&
+	    !ieee802_1x_kay_is_in_live_peer(participant,
+					    participant->current_peer_id.mi)) {
 		/* accept the peer as live peer */
-		if (!ieee802_1x_kay_is_in_peer(
-			    participant,
-			    participant->current_peer_id.mi)) {
-			if (!ieee802_1x_kay_create_live_peer(
+		if (ieee802_1x_kay_is_in_potential_peer(
+			    participant, participant->current_peer_id.mi)) {
+			if (!ieee802_1x_kay_move_live_peer(
 				    participant,
 				    participant->current_peer_id.mi,
-				    participant->current_peer_id.mn))
+				    be_to_host32(participant->
+						 current_peer_id.mn)))
+				return -1;
+		} else if (!ieee802_1x_kay_create_live_peer(
+				   participant, participant->current_peer_id.mi,
+				   be_to_host32(participant->
+						current_peer_id.mn))) {
 				return -1;
-			ieee802_1x_kay_elect_key_server(participant);
-			ieee802_1x_kay_decide_macsec_use(participant);
-		}
-		if (ieee802_1x_kay_is_in_potential_peer(
-			    participant, participant->current_peer_id.mi)) {
-			ieee802_1x_kay_move_live_peer(
-				participant, participant->current_peer_id.mi,
-				participant->current_peer_id.mn);
-			ieee802_1x_kay_elect_key_server(participant);
-			ieee802_1x_kay_decide_macsec_use(participant);
 		}
+
+		ieee802_1x_kay_elect_key_server(participant);
+		ieee802_1x_kay_decide_macsec_use(participant);
 	}
 
 	/*
@@ -3034,7 +2930,9 @@ static int ieee802_1x_kay_decode_mkpdu(struct ieee802_1x_kay *kay,
 		handled[i] = FALSE;
 
 	handled[0] = TRUE;
-	while (left_len > MKA_HDR_LEN + DEFAULT_ICV_LEN) {
+	for (; left_len > MKA_HDR_LEN + DEFAULT_ICV_LEN;
+	     pos += body_len + MKA_HDR_LEN,
+		     left_len -= body_len + MKA_HDR_LEN) {
 		hdr = (struct ieee802_1x_mka_hdr *) pos;
 		body_len = get_mka_param_body_len(hdr);
 		body_type = get_mka_param_body_type(hdr);
@@ -3044,28 +2942,25 @@ static int ieee802_1x_kay_decode_mkpdu(struct ieee802_1x_kay *kay,
 
 		if (left_len < (MKA_HDR_LEN + body_len + DEFAULT_ICV_LEN)) {
 			wpa_printf(MSG_ERROR,
-				   "KaY: MKA Peer Packet Body Length (%d bytes) is less than the Parameter Set Header Length (%d bytes) + the Parameter Set Body Length (%d bytes) + %d bytes of ICV",
-				   (int) left_len, (int) MKA_HDR_LEN,
-				   (int) body_len, DEFAULT_ICV_LEN);
-			goto next_para_set;
+				   "KaY: MKA Peer Packet Body Length (%zu bytes) is less than the Parameter Set Header Length (%zu bytes) + the Parameter Set Body Length (%zu bytes) + %d bytes of ICV",
+				   left_len, MKA_HDR_LEN,
+				   body_len, DEFAULT_ICV_LEN);
+			continue;
 		}
 
 		if (handled[body_type])
-			goto next_para_set;
+			continue;
 
 		handled[body_type] = TRUE;
-		if (mak_body_handler[body_type].body_rx) {
-			mak_body_handler[body_type].body_rx
+		if (body_type < ARRAY_SIZE(mka_body_handler) &&
+		    mka_body_handler[body_type].body_rx) {
+			mka_body_handler[body_type].body_rx
 				(participant, pos, left_len);
 		} else {
 			wpa_printf(MSG_ERROR,
-				   "The type %d not supported in this MKA version %d",
+				   "The type %d is not supported in this MKA version %d",
 				   body_type, MKA_VERSION_ID);
 		}
-
-next_para_set:
-		pos += body_len + MKA_HDR_LEN;
-		left_len -= body_len + MKA_HDR_LEN;
 	}
 
 	kay->active = TRUE;
@@ -3094,10 +2989,10 @@ static void kay_l2_receive(void *ctx, const u8 *src_addr, const u8 *buf,
 	eth_hdr = (struct ieee8023_hdr *) buf;
 	eapol_hdr = (struct ieee802_1x_hdr *) (eth_hdr + 1);
 	if (len != sizeof(*eth_hdr) + sizeof(*eapol_hdr) +
-	    ntohs(eapol_hdr->length)) {
+	    be_to_host16(eapol_hdr->length)) {
 		wpa_printf(MSG_MSGDUMP, "KAY: EAPOL MPDU is invalid: (%lu-%lu)",
 			   (unsigned long) len,
-			   (unsigned long) ntohs(eapol_hdr->length));
+			   (unsigned long) be_to_host16(eapol_hdr->length));
 		return;
 	}
 
@@ -3106,7 +3001,7 @@ static void kay_l2_receive(void *ctx, const u8 *src_addr, const u8 *buf,
 			   eapol_hdr->version);
 		return;
 	}
-	if (ntohs(eth_hdr->ethertype) != ETH_P_PAE ||
+	if (be_to_host16(eth_hdr->ethertype) != ETH_P_PAE ||
 	    eapol_hdr->type != IEEE802_1X_TYPE_EAPOL_MKA)
 		return;
 
@@ -3147,7 +3042,7 @@ ieee802_1x_kay_init(struct ieee802_1x_kay_ctx *ctx, enum macsec_policy policy,
 
 	os_strlcpy(kay->if_name, ifname, IFNAMSIZ);
 	os_memcpy(kay->actor_sci.addr, addr, ETH_ALEN);
-	kay->actor_sci.port = 0x0001;
+	kay->actor_sci.port = host_to_be16(0x0001);
 	kay->actor_priority = DEFAULT_PRIO_NOT_KEY_SERVER;
 
 	/* While actor acts as a key server, shall distribute sakey */
@@ -3192,7 +3087,7 @@ ieee802_1x_kay_init(struct ieee802_1x_kay_ctx *ctx, enum macsec_policy policy,
 	wpa_printf(MSG_DEBUG, "KaY: secy init macsec done");
 
 	/* init CP */
-	kay->cp = ieee802_1x_kay_alloc_cp_sm(kay);
+	kay->cp = ieee802_1x_cp_sm_init(kay);
 	if (kay->cp == NULL) {
 		ieee802_1x_kay_deinit(kay);
 		return NULL;
@@ -3314,7 +3209,7 @@ ieee802_1x_kay_create_mka(struct ieee802_1x_kay *kay, struct mka_key_name *ckn,
 	default:
 		participant->is_obliged_key_server = FALSE;
 		participant->can_be_key_server = TRUE;
-		participant->is_key_server = FALSE;
+		participant->is_key_server = TRUE;
 		participant->is_elected = FALSE;
 		break;
 	}
@@ -3335,9 +3230,8 @@ ieee802_1x_kay_create_mka(struct ieee802_1x_kay *kay, struct mka_key_name *ckn,
 	participant->retry_count = 0;
 	participant->kay = kay;
 
-	if (os_get_random(participant->mi, sizeof(participant->mi)) < 0)
+	if (!reset_participant_mi(participant))
 		goto fail;
-	participant->mn = 0;
 
 	participant->lrx = FALSE;
 	participant->ltx = FALSE;
@@ -3422,6 +3316,7 @@ ieee802_1x_kay_delete_mka(struct ieee802_1x_kay *kay, struct mka_key_name *ckn)
 		return;
 	}
 
+	eloop_cancel_timeout(ieee802_1x_participant_timer, participant, NULL);
 	dl_list_del(&participant->list);
 
 	/* remove live peer */
@@ -3510,14 +3405,15 @@ ieee802_1x_kay_new_sak(struct ieee802_1x_kay *kay)
  * ieee802_1x_kay_change_cipher_suite -
  */
 int
-ieee802_1x_kay_change_cipher_suite(struct ieee802_1x_kay *kay, int cs_index)
+ieee802_1x_kay_change_cipher_suite(struct ieee802_1x_kay *kay,
+				   unsigned int cs_index)
 {
 	struct ieee802_1x_mka_participant *participant;
 
 	if (!kay)
 		return -1;
 
-	if ((unsigned int) cs_index >= CS_TABLE_SIZE) {
+	if (cs_index >= CS_TABLE_SIZE) {
 		wpa_printf(MSG_ERROR,
 			   "KaY: Configured cipher suite index is out of range");
 		return -1;
diff --git a/src/pae/ieee802_1x_kay.h b/src/pae/ieee802_1x_kay.h
index 064417ea51ad0..afbaa336cbda6 100644
--- a/src/pae/ieee802_1x_kay.h
+++ b/src/pae/ieee802_1x_kay.h
@@ -14,7 +14,6 @@
 #include "common/ieee802_1x_defs.h"
 
 struct macsec_init_params;
-struct ieee802_1x_cp_conf;
 
 #define MI_LEN			12
 #define MAX_KEY_LEN		32  /* 32 bytes, 256 bits */
@@ -32,7 +31,7 @@ struct ieee802_1x_mka_ki {
 
 struct ieee802_1x_mka_sci {
 	u8 addr[ETH_ALEN];
-	u16 port;
+	be16 port;
 };
 
 struct mka_key {
@@ -48,8 +47,6 @@ struct mka_key_name {
 enum mka_created_mode {
 	PSK,
 	EAP_EXCHANGE,
-	DISTRIBUTED,
-	CACHED,
 };
 
 struct ieee802_1x_kay_ctx {
@@ -61,7 +58,7 @@ struct ieee802_1x_kay_ctx {
 	int (*macsec_deinit)(void *ctx);
 	int (*enable_protect_frames)(void *ctx, Boolean enabled);
 	int (*set_replay_protect)(void *ctx, Boolean enabled, u32 window);
-	int (*set_current_cipher_suite)(void *ctx, const u8 *cs, size_t cs_len);
+	int (*set_current_cipher_suite)(void *ctx, u64 cs);
 	int (*enable_controlled_port)(void *ctx, Boolean enabled);
 	int (*get_receive_lowest_pn)(void *ctx, u32 channel, u8 an,
 				     u32 *lowest_pn);
@@ -126,7 +123,7 @@ struct ieee802_1x_kay {
 	Boolean is_obliged_key_server;
 	char if_name[IFNAMSIZ];
 
-	int macsec_csindex;  /*  MACsec cipher suite table index */
+	unsigned int macsec_csindex;  /* MACsec cipher suite table index */
 	int mka_algindex;  /* MKA alg table index */
 
 	u32 dist_kn;
@@ -171,7 +168,7 @@ void ieee802_1x_kay_mka_participate(struct ieee802_1x_kay *kay,
 				    Boolean status);
 int ieee802_1x_kay_new_sak(struct ieee802_1x_kay *kay);
 int ieee802_1x_kay_change_cipher_suite(struct ieee802_1x_kay *kay,
-				       int cs_index);
+				       unsigned int cs_index);
 
 int ieee802_1x_kay_set_latest_sa_attr(struct ieee802_1x_kay *kay,
 				      struct ieee802_1x_mka_ki *lki, u8 lan,
@@ -188,7 +185,5 @@ int ieee802_1x_kay_enable_tx_sas(struct ieee802_1x_kay *kay,
 int ieee802_1x_kay_enable_rx_sas(struct ieee802_1x_kay *kay,
 				 struct ieee802_1x_mka_ki *lki);
 int ieee802_1x_kay_enable_new_info(struct ieee802_1x_kay *kay);
-int ieee802_1x_kay_cp_conf(struct ieee802_1x_kay *kay,
-			   struct ieee802_1x_cp_conf *pconf);
 
 #endif /* IEEE802_1X_KAY_H */
diff --git a/src/pae/ieee802_1x_kay_i.h b/src/pae/ieee802_1x_kay_i.h
index bdad3a5beb137..622282e97c513 100644
--- a/src/pae/ieee802_1x_kay_i.h
+++ b/src/pae/ieee802_1x_kay_i.h
@@ -38,7 +38,7 @@ struct ieee802_1x_kay;
 
 struct ieee802_1x_mka_peer_id {
 	u8 mi[MI_LEN];
-	u32 mn;
+	be32 mn;
 };
 
 struct ieee802_1x_kay_peer {
@@ -49,21 +49,11 @@ struct ieee802_1x_kay_peer {
 	Boolean is_key_server;
 	u8 key_server_priority;
 	Boolean macsec_desired;
-	enum macsec_cap macsec_capbility;
+	enum macsec_cap macsec_capability;
 	Boolean sak_used;
 	struct dl_list list;
 };
 
-struct key_conf {
-	u8 *key;
-	struct ieee802_1x_mka_ki ki;
-	enum confidentiality_offset offset;
-	u8 an;
-	Boolean tx;
-	Boolean rx;
-	int key_len; /* unit: byte */
-};
-
 struct data_key {
 	u8 *key;
 	int key_len;
@@ -147,7 +137,7 @@ struct receive_sa {
 };
 
 struct macsec_ciphersuite {
-	u8 id[CS_ID_LEN];
+	u64 id;
 	char name[32];
 	enum macsec_cap capable;
 	int sak_len; /* unit: byte */
@@ -241,48 +231,48 @@ struct ieee802_1x_mka_participant {
 
 struct ieee802_1x_mka_hdr {
 	/* octet 1 */
-	u32 type:8;
+	u8 type;
 	/* octet 2 */
-	u32 reserve:8;
+	u8 reserve;
 	/* octet 3 */
 #if __BYTE_ORDER == __LITTLE_ENDIAN
-	u32 length:4;
-	u32 reserve1:4;
+	u8 length:4;
+	u8 reserve1:4;
 #elif __BYTE_ORDER == __BIG_ENDIAN
-	u32 reserve1:4;
-	u32 length:4;
+	u8 reserve1:4;
+	u8 length:4;
 #else
 #error "Please fix <bits/endian.h>"
 #endif
 	/* octet 4 */
-	u32 length1:8;
+	u8 length1;
 };
 
 #define MKA_HDR_LEN sizeof(struct ieee802_1x_mka_hdr)
 
 struct ieee802_1x_mka_basic_body {
 	/* octet 1 */
-	u32 version:8;
+	u8 version;
 	/* octet 2 */
-	u32 priority:8;
+	u8 priority;
 	/* octet 3 */
 #if __BYTE_ORDER == __LITTLE_ENDIAN
-	u32 length:4;
-	u32 macsec_capbility:2;
-	u32 macsec_desired:1;
-	u32 key_server:1;
+	u8 length:4;
+	u8 macsec_capability:2;
+	u8 macsec_desired:1;
+	u8 key_server:1;
 #elif __BYTE_ORDER == __BIG_ENDIAN
-	u32 key_server:1;
-	u32 macsec_desired:1;
-	u32 macsec_capbility:2;
-	u32 length:4;
+	u8 key_server:1;
+	u8 macsec_desired:1;
+	u8 macsec_capability:2;
+	u8 length:4;
 #endif
 	/* octet 4 */
-	u32 length1:8;
+	u8 length1;
 
 	struct ieee802_1x_mka_sci actor_sci;
 	u8 actor_mi[MI_LEN];
-	u32 actor_mn;
+	be32 actor_mn;
 	u8 algo_agility[4];
 
 	/* followed by CAK Name*/
@@ -291,19 +281,19 @@ struct ieee802_1x_mka_basic_body {
 
 struct ieee802_1x_mka_peer_body {
 	/* octet 1 */
-	u32 type:8;
+	u8 type;
 	/* octet 2 */
-	u32 reserve:8;
+	u8 reserve;
 	/* octet 3 */
 #if __BYTE_ORDER == __LITTLE_ENDIAN
-	u32 length:4;
-	u32 reserve1:4;
+	u8 length:4;
+	u8 reserve1:4;
 #elif __BYTE_ORDER == __BIG_ENDIAN
-	u32 reserve1:4;
-	u32 length:4;
+	u8 reserve1:4;
+	u8 length:4;
 #endif
 	/* octet 4 */
-	u32 length1:8;
+	u8 length1;
 
 	u8 peer[0];
 	/* followed by Peers */
@@ -311,83 +301,83 @@ struct ieee802_1x_mka_peer_body {
 
 struct ieee802_1x_mka_sak_use_body {
 	/* octet 1 */
-	u32 type:8;
+	u8 type;
 	/* octet 2 */
 #if __BYTE_ORDER == __LITTLE_ENDIAN
-	u32 orx:1;
-	u32 otx:1;
-	u32 oan:2;
-	u32 lrx:1;
-	u32 ltx:1;
-	u32 lan:2;
+	u8 orx:1;
+	u8 otx:1;
+	u8 oan:2;
+	u8 lrx:1;
+	u8 ltx:1;
+	u8 lan:2;
 #elif __BYTE_ORDER == __BIG_ENDIAN
-	u32 lan:2;
-	u32 ltx:1;
-	u32 lrx:1;
-	u32 oan:2;
-	u32 otx:1;
-	u32 orx:1;
+	u8 lan:2;
+	u8 ltx:1;
+	u8 lrx:1;
+	u8 oan:2;
+	u8 otx:1;
+	u8 orx:1;
 #endif
 
 	/* octet 3 */
 #if __BYTE_ORDER == __LITTLE_ENDIAN
-	u32 length:4;
-	u32 delay_protect:1;
-	u32 reserve:1;
-	u32 prx:1;
-	u32 ptx:1;
+	u8 length:4;
+	u8 delay_protect:1;
+	u8 reserve:1;
+	u8 prx:1;
+	u8 ptx:1;
 #elif __BYTE_ORDER == __BIG_ENDIAN
-	u32 ptx:1;
-	u32 prx:1;
-	u32 reserve:1;
-	u32 delay_protect:1;
-	u32 length:4;
+	u8 ptx:1;
+	u8 prx:1;
+	u8 reserve:1;
+	u8 delay_protect:1;
+	u8 length:4;
 #endif
 
 	/* octet 4 */
-	u32 length1:8;
+	u8 length1;
 
 	/* octet 5 - 16 */
 	u8 lsrv_mi[MI_LEN];
 	/* octet 17 - 20 */
-	u32 lkn;
+	be32 lkn;
 	/* octet 21 - 24 */
-	u32 llpn;
+	be32 llpn;
 
 	/* octet 25 - 36 */
 	u8 osrv_mi[MI_LEN];
 	/* octet 37 - 40 */
-	u32 okn;
+	be32 okn;
 	/* octet 41 - 44 */
-	u32 olpn;
+	be32 olpn;
 };
 
 
 struct ieee802_1x_mka_dist_sak_body {
 	/* octet 1 */
-	u32 type:8;
+	u8 type;
 	/* octet 2 */
 #if __BYTE_ORDER == __LITTLE_ENDIAN
-	u32 reserve:4;
-	u32 confid_offset:2;
-	u32 dan:2;
+	u8 reserve:4;
+	u8 confid_offset:2;
+	u8 dan:2;
 #elif __BYTE_ORDER == __BIG_ENDIAN
-	u32 dan:2;
-	u32 confid_offset:2;
-	u32 reserve:4;
+	u8 dan:2;
+	u8 confid_offset:2;
+	u8 reserve:4;
 #endif
 	/* octet 3 */
 #if __BYTE_ORDER == __LITTLE_ENDIAN
-	u32 length:4;
-	u32 reserve1:4;
+	u8 length:4;
+	u8 reserve1:4;
 #elif __BYTE_ORDER == __BIG_ENDIAN
-	u32 reserve1:4;
-	u32 length:4;
+	u8 reserve1:4;
+	u8 length:4;
 #endif
 	/* octet 4 */
-	u32 length1:8;
+	u8 length1;
 	/* octet 5 - 8 */
-	u32 kn;
+	be32 kn;
 
 	/* for GCM-AES-128: octet 9-32: SAK
 	 * for other cipher suite: octet 9-16: cipher suite id, octet 17-: SAK
@@ -398,19 +388,19 @@ struct ieee802_1x_mka_dist_sak_body {
 
 struct ieee802_1x_mka_icv_body {
 	/* octet 1 */
-	u32 type:8;
+	u8 type;
 	/* octet 2 */
-	u32 reserve:8;
+	u8 reserve;
 	/* octet 3 */
 #if __BYTE_ORDER == __LITTLE_ENDIAN
-	u32 length:4;
-	u32 reserve1:4;
+	u8 length:4;
+	u8 reserve1:4;
 #elif __BYTE_ORDER == __BIG_ENDIAN
-	u32 reserve1:4;
-	u32 length:4;
+	u8 reserve1:4;
+	u8 length:4;
 #endif
 	/* octet 4 */
-	u32 length1:8;
+	u8 length1;
 
 	/* octet 5 - */
 	u8 icv[0];
diff --git a/src/pae/ieee802_1x_secy_ops.c b/src/pae/ieee802_1x_secy_ops.c
index fbe05dc35d7cb..2d12911dbfcfd 100644
--- a/src/pae/ieee802_1x_secy_ops.c
+++ b/src/pae/ieee802_1x_secy_ops.c
@@ -65,8 +65,7 @@ int secy_cp_control_replay(struct ieee802_1x_kay *kay, Boolean enabled, u32 win)
 }
 
 
-int secy_cp_control_current_cipher_suite(struct ieee802_1x_kay *kay,
-					 const u8 *cs, size_t cs_len)
+int secy_cp_control_current_cipher_suite(struct ieee802_1x_kay *kay, u64 cs)
 {
 	struct ieee802_1x_kay_ctx *ops;
 
@@ -82,7 +81,7 @@ int secy_cp_control_current_cipher_suite(struct ieee802_1x_kay *kay,
 		return -1;
 	}
 
-	return ops->set_current_cipher_suite(ops->ctx, cs, cs_len);
+	return ops->set_current_cipher_suite(ops->ctx, cs);
 }
 
 
diff --git a/src/pae/ieee802_1x_secy_ops.h b/src/pae/ieee802_1x_secy_ops.h
index 295b823a9d7f3..f5057ee119583 100644
--- a/src/pae/ieee802_1x_secy_ops.h
+++ b/src/pae/ieee802_1x_secy_ops.h
@@ -26,8 +26,7 @@ int secy_cp_control_validate_frames(struct ieee802_1x_kay *kay,
 				    enum validate_frames vf);
 int secy_cp_control_protect_frames(struct ieee802_1x_kay *kay, Boolean flag);
 int secy_cp_control_replay(struct ieee802_1x_kay *kay, Boolean flag, u32 win);
-int secy_cp_control_current_cipher_suite(struct ieee802_1x_kay *kay,
-					 const u8 *cs, size_t cs_len);
+int secy_cp_control_current_cipher_suite(struct ieee802_1x_kay *kay, u64 cs);
 int secy_cp_control_confidentiality_offset(struct ieee802_1x_kay *kay,
 					   enum confidentiality_offset co);
 int secy_cp_control_enable_port(struct ieee802_1x_kay *kay, Boolean flag);
diff --git a/src/radius/radius.c b/src/radius/radius.c
index 1ebfd11f3b9a2..407e4f8b96149 100644
--- a/src/radius/radius.c
+++ b/src/radius/radius.c
@@ -1,6 +1,6 @@
 /*
  * RADIUS message processing
- * Copyright (c) 2002-2009, 2011-2014, Jouni Malinen <j@w1.fi>
+ * Copyright (c) 2002-2009, 2011-2015, Jouni Malinen <j@w1.fi>
  *
  * This software may be distributed under the terms of the BSD license.
  * See README for more details.
@@ -173,6 +173,8 @@ static const struct radius_attr_type radius_attrs[] =
 	{ RADIUS_ATTR_USER_PASSWORD, "User-Password", RADIUS_ATTR_UNDIST },
 	{ RADIUS_ATTR_NAS_IP_ADDRESS, "NAS-IP-Address", RADIUS_ATTR_IP },
 	{ RADIUS_ATTR_NAS_PORT, "NAS-Port", RADIUS_ATTR_INT32 },
+	{ RADIUS_ATTR_SERVICE_TYPE, "Service-Type", RADIUS_ATTR_INT32 },
+	{ RADIUS_ATTR_FRAMED_IP_ADDRESS, "Framed-IP-Address", RADIUS_ATTR_IP },
 	{ RADIUS_ATTR_FRAMED_MTU, "Framed-MTU", RADIUS_ATTR_INT32 },
 	{ RADIUS_ATTR_REPLY_MESSAGE, "Reply-Message", RADIUS_ATTR_TEXT },
 	{ RADIUS_ATTR_STATE, "State", RADIUS_ATTR_UNDIST },
@@ -214,6 +216,7 @@ static const struct radius_attr_type radius_attrs[] =
 	  RADIUS_ATTR_INT32 },
 	{ RADIUS_ATTR_EVENT_TIMESTAMP, "Event-Timestamp",
 	  RADIUS_ATTR_INT32 },
+	{ RADIUS_ATTR_EGRESS_VLANID, "EGRESS-VLANID", RADIUS_ATTR_HEXDUMP },
 	{ RADIUS_ATTR_NAS_PORT_TYPE, "NAS-Port-Type", RADIUS_ATTR_INT32 },
 	{ RADIUS_ATTR_TUNNEL_TYPE, "Tunnel-Type", RADIUS_ATTR_HEXDUMP },
 	{ RADIUS_ATTR_TUNNEL_MEDIUM_TYPE, "Tunnel-Medium-Type",
@@ -535,7 +538,8 @@ int radius_msg_verify_acct_req(struct radius_msg *msg, const u8 *secret,
 
 
 int radius_msg_verify_das_req(struct radius_msg *msg, const u8 *secret,
-			      size_t secret_len)
+			      size_t secret_len,
+			      int require_message_authenticator)
 {
 	const u8 *addr[4];
 	size_t len[4];
@@ -574,7 +578,11 @@ int radius_msg_verify_das_req(struct radius_msg *msg, const u8 *secret,
 	}
 
 	if (attr == NULL) {
-		/* Message-Authenticator is MAY; not required */
+		if (require_message_authenticator) {
+			wpa_printf(MSG_WARNING,
+				   "Missing Message-Authenticator attribute in RADIUS message");
+			return 1;
+		}
 		return 0;
 	}
 
@@ -703,7 +711,7 @@ struct radius_msg * radius_msg_parse(const u8 *data, size_t len)
 
 		attr = (struct radius_attr_hdr *) pos;
 
-		if (pos + attr->length > end || attr->length < sizeof(*attr))
+		if (attr->length > end - pos || attr->length < sizeof(*attr))
 			goto fail;
 
 		/* TODO: check that attr->length is suitable for attr->type */
@@ -815,8 +823,9 @@ int radius_msg_verify_msg_auth(struct radius_msg *msg, const u8 *secret,
 		os_memcpy(msg->hdr->authenticator, req_auth,
 			  sizeof(msg->hdr->authenticator));
 	}
-	hmac_md5(secret, secret_len, wpabuf_head(msg->buf),
-		 wpabuf_len(msg->buf), auth);
+	if (hmac_md5(secret, secret_len, wpabuf_head(msg->buf),
+		     wpabuf_len(msg->buf), auth) < 0)
+		return 1;
 	os_memcpy(attr + 1, orig, MD5_MAC_LEN);
 	if (req_auth) {
 		os_memcpy(msg->hdr->authenticator, orig_authenticator,
@@ -859,8 +868,8 @@ int radius_msg_verify(struct radius_msg *msg, const u8 *secret,
 	len[2] = wpabuf_len(msg->buf) - sizeof(struct radius_hdr);
 	addr[3] = secret;
 	len[3] = secret_len;
-	md5_vector(4, addr, len, hash);
-	if (os_memcmp_const(hash, msg->hdr->authenticator, MD5_MAC_LEN) != 0) {
+	if (md5_vector(4, addr, len, hash) < 0 ||
+	    os_memcmp_const(hash, msg->hdr->authenticator, MD5_MAC_LEN) != 0) {
 		wpa_printf(MSG_INFO, "Response Authenticator invalid!");
 		return 1;
 	}
@@ -892,25 +901,11 @@ int radius_msg_copy_attr(struct radius_msg *dst, struct radius_msg *src,
 
 /* Create Request Authenticator. The value should be unique over the lifetime
  * of the shared secret between authenticator and authentication server.
- * Use one-way MD5 hash calculated from current timestamp and some data given
- * by the caller. */
-void radius_msg_make_authenticator(struct radius_msg *msg,
-				   const u8 *data, size_t len)
+ */
+int radius_msg_make_authenticator(struct radius_msg *msg)
 {
-	struct os_time tv;
-	long int l;
-	const u8 *addr[3];
-	size_t elen[3];
-
-	os_get_time(&tv);
-	l = os_random();
-	addr[0] = (u8 *) &tv;
-	elen[0] = sizeof(tv);
-	addr[1] = data;
-	elen[1] = len;
-	addr[2] = (u8 *) &l;
-	elen[2] = sizeof(l);
-	md5_vector(3, addr, elen, msg->hdr->authenticator);
+	return os_get_random((u8 *) &msg->hdr->authenticator,
+			     sizeof(msg->hdr->authenticator));
 }
 
 
@@ -1028,7 +1023,10 @@ static u8 * decrypt_ms_key(const u8 *key, size_t len,
 			addr[1] = pos - MD5_MAC_LEN;
 			elen[1] = MD5_MAC_LEN;
 		}
-		md5_vector(first ? 3 : 2, addr, elen, hash);
+		if (md5_vector(first ? 3 : 2, addr, elen, hash) < 0) {
+			os_free(plain);
+			return NULL;
+		}
 		first = 0;
 
 		for (i = 0; i < MD5_MAC_LEN; i++)
@@ -1210,7 +1208,11 @@ int radius_msg_add_mppe_keys(struct radius_msg *msg,
 	vhdr = (struct radius_attr_vendor *) pos;
 	vhdr->vendor_type = RADIUS_VENDOR_ATTR_MS_MPPE_SEND_KEY;
 	pos = (u8 *) (vhdr + 1);
-	salt = os_random() | 0x8000;
+	if (os_get_random((u8 *) &salt, sizeof(salt)) < 0) {
+		os_free(buf);
+		return 0;
+	}
+	salt |= 0x8000;
 	WPA_PUT_BE16(pos, salt);
 	pos += 2;
 	encrypt_ms_key(send_key, send_key_len, salt, req_authenticator, secret,
@@ -1422,12 +1424,30 @@ struct radius_tunnel_attrs {
 };
 
 
+static int cmp_int(const void *a, const void *b)
+{
+	int x, y;
+
+	x = *((int *) a);
+	y = *((int *) b);
+	return (x - y);
+}
+
+
 /**
  * radius_msg_get_vlanid - Parse RADIUS attributes for VLAN tunnel information
+ * The k tagged vlans found are sorted by vlan_id and stored in the first k
+ * items of tagged.
+ *
  * @msg: RADIUS message
- * Returns: VLAN ID for the first tunnel configuration or 0 if none is found
+ * @untagged: Pointer to store untagged vid
+ * @numtagged: Size of tagged
+ * @tagged: Pointer to store tagged list
+ *
+ * Returns: 0 if neither tagged nor untagged configuration is found, 1 otherwise
  */
-int radius_msg_get_vlanid(struct radius_msg *msg)
+int radius_msg_get_vlanid(struct radius_msg *msg, int *untagged, int numtagged,
+			  int *tagged)
 {
 	struct radius_tunnel_attrs tunnel[RADIUS_TUNNEL_TAGS], *tun;
 	size_t i;
@@ -1435,8 +1455,12 @@ int radius_msg_get_vlanid(struct radius_msg *msg)
 	const u8 *data;
 	char buf[10];
 	size_t dlen;
+	int j, taggedidx = 0, vlan_id;
 
 	os_memset(&tunnel, 0, sizeof(tunnel));
+	for (j = 0; j < numtagged; j++)
+		tagged[j] = 0;
+	*untagged = 0;
 
 	for (i = 0; i < msg->attr_used; i++) {
 		attr = radius_get_attr_hdr(msg, i);
@@ -1473,21 +1497,44 @@ int radius_msg_get_vlanid(struct radius_msg *msg)
 				break;
 			os_memcpy(buf, data, dlen);
 			buf[dlen] = '\0';
+			vlan_id = atoi(buf);
+			if (vlan_id <= 0)
+				break;
 			tun->tag_used++;
-			tun->vlanid = atoi(buf);
+			tun->vlanid = vlan_id;
+			break;
+		case RADIUS_ATTR_EGRESS_VLANID: /* RFC 4675 */
+			if (attr->length != 6)
+				break;
+			vlan_id = WPA_GET_BE24(data + 1);
+			if (vlan_id <= 0)
+				break;
+			if (data[0] == 0x32)
+				*untagged = vlan_id;
+			else if (data[0] == 0x31 && tagged &&
+				 taggedidx < numtagged)
+				tagged[taggedidx++] = vlan_id;
 			break;
 		}
 	}
 
+	/* Use tunnel with the lowest tag for untagged VLAN id */
 	for (i = 0; i < RADIUS_TUNNEL_TAGS; i++) {
 		tun = &tunnel[i];
 		if (tun->tag_used &&
 		    tun->type == RADIUS_TUNNEL_TYPE_VLAN &&
 		    tun->medium_type == RADIUS_TUNNEL_MEDIUM_TYPE_802 &&
-		    tun->vlanid > 0)
-			return tun->vlanid;
+		    tun->vlanid > 0) {
+			*untagged = tun->vlanid;
+			break;
+		}
 	}
 
+	if (taggedidx)
+		qsort(tagged, taggedidx, sizeof(int), cmp_int);
+
+	if (*untagged > 0 || taggedidx)
+		return 1;
 	return 0;
 }
 
@@ -1669,3 +1716,14 @@ u8 radius_msg_find_unlisted_attr(struct radius_msg *msg, u8 *attrs)
 
 	return 0;
 }
+
+
+int radius_gen_session_id(u8 *id, size_t len)
+{
+	/*
+	 * Acct-Session-Id and Acct-Multi-Session-Id should be globally and
+	 * temporarily unique. A high quality random number is required
+	 * therefore. This could be be improved by switching to a GUID.
+	 */
+	return os_get_random(id, len);
+}
diff --git a/src/radius/radius.h b/src/radius/radius.h
index 5977339e08d2b..cd510d2c88e22 100644
--- a/src/radius/radius.h
+++ b/src/radius/radius.h
@@ -1,6 +1,6 @@
 /*
  * RADIUS message processing
- * Copyright (c) 2002-2009, 2012, 2014, Jouni Malinen <j@w1.fi>
+ * Copyright (c) 2002-2009, 2012, 2014-2015, Jouni Malinen <j@w1.fi>
  *
  * This software may be distributed under the terms of the BSD license.
  * See README for more details.
@@ -52,6 +52,8 @@ enum { RADIUS_ATTR_USER_NAME = 1,
        RADIUS_ATTR_USER_PASSWORD = 2,
        RADIUS_ATTR_NAS_IP_ADDRESS = 4,
        RADIUS_ATTR_NAS_PORT = 5,
+       RADIUS_ATTR_SERVICE_TYPE = 6,
+       RADIUS_ATTR_FRAMED_IP_ADDRESS = 8,
        RADIUS_ATTR_FRAMED_MTU = 12,
        RADIUS_ATTR_REPLY_MESSAGE = 18,
        RADIUS_ATTR_STATE = 24,
@@ -79,6 +81,7 @@ enum { RADIUS_ATTR_USER_NAME = 1,
        RADIUS_ATTR_ACCT_INPUT_GIGAWORDS = 52,
        RADIUS_ATTR_ACCT_OUTPUT_GIGAWORDS = 53,
        RADIUS_ATTR_EVENT_TIMESTAMP = 55,
+       RADIUS_ATTR_EGRESS_VLANID = 56,
        RADIUS_ATTR_NAS_PORT_TYPE = 61,
        RADIUS_ATTR_TUNNEL_TYPE = 64,
        RADIUS_ATTR_TUNNEL_MEDIUM_TYPE = 65,
@@ -108,6 +111,9 @@ enum { RADIUS_ATTR_USER_NAME = 1,
 };
 
 
+/* Service-Type values (RFC 2865, 5.6) */
+#define RADIUS_SERVICE_TYPE_FRAMED 2
+
 /* Termination-Action */
 #define RADIUS_TERMINATION_ACTION_DEFAULT 0
 #define RADIUS_TERMINATION_ACTION_RADIUS_REQUEST 1
@@ -236,7 +242,8 @@ void radius_msg_finish_acct_resp(struct radius_msg *msg, const u8 *secret,
 int radius_msg_verify_acct_req(struct radius_msg *msg, const u8 *secret,
 			       size_t secret_len);
 int radius_msg_verify_das_req(struct radius_msg *msg, const u8 *secret,
-			       size_t secret_len);
+			      size_t secret_len,
+			      int require_message_authenticator);
 struct radius_attr_hdr * radius_msg_add_attr(struct radius_msg *msg, u8 type,
 					     const u8 *data, size_t data_len);
 struct radius_msg * radius_msg_parse(const u8 *data, size_t len);
@@ -250,8 +257,7 @@ int radius_msg_verify_msg_auth(struct radius_msg *msg, const u8 *secret,
 			       size_t secret_len, const u8 *req_auth);
 int radius_msg_copy_attr(struct radius_msg *dst, struct radius_msg *src,
 			 u8 type);
-void radius_msg_make_authenticator(struct radius_msg *msg,
-				   const u8 *data, size_t len);
+int radius_msg_make_authenticator(struct radius_msg *msg);
 struct radius_ms_mppe_keys *
 radius_msg_get_ms_keys(struct radius_msg *msg, struct radius_msg *sent_msg,
 		       const u8 *secret, size_t secret_len);
@@ -274,7 +280,8 @@ radius_msg_add_attr_user_password(struct radius_msg *msg,
 				  const u8 *data, size_t data_len,
 				  const u8 *secret, size_t secret_len);
 int radius_msg_get_attr(struct radius_msg *msg, u8 type, u8 *buf, size_t len);
-int radius_msg_get_vlanid(struct radius_msg *msg);
+int radius_msg_get_vlanid(struct radius_msg *msg, int *untagged, int numtagged,
+			  int *tagged);
 char * radius_msg_get_tunnel_password(struct radius_msg *msg, int *keylen,
 				      const u8 *secret, size_t secret_len,
 				      struct radius_msg *sent_msg, size_t n);
@@ -319,4 +326,6 @@ int radius_copy_class(struct radius_class_data *dst,
 
 u8 radius_msg_find_unlisted_attr(struct radius_msg *msg, u8 *attrs);
 
+int radius_gen_session_id(u8 *id, size_t len);
+
 #endif /* RADIUS_H */
diff --git a/src/radius/radius_client.c b/src/radius/radius_client.c
index 693f61ea04552..06c804d132fd5 100644
--- a/src/radius/radius_client.c
+++ b/src/radius/radius_client.c
@@ -226,6 +226,16 @@ struct radius_client_data {
 	 * next_radius_identifier - Next RADIUS message identifier to use
 	 */
 	u8 next_radius_identifier;
+
+	/**
+	 * interim_error_cb - Interim accounting error callback
+	 */
+	void (*interim_error_cb)(const u8 *addr, void *ctx);
+
+	/**
+	 * interim_error_cb_ctx - interim_error_cb() context data
+	 */
+	void *interim_error_cb_ctx;
 };
 
 
@@ -297,6 +307,25 @@ int radius_client_register(struct radius_client_data *radius,
 }
 
 
+/**
+ * radius_client_set_interim_erro_cb - Register an interim acct error callback
+ * @radius: RADIUS client context from radius_client_init()
+ * @addr: Station address from the failed message
+ * @cb: Handler for interim accounting errors
+ * @ctx: Context pointer for handler callbacks
+ *
+ * This function is used to register a handler for processing failed
+ * transmission attempts of interim accounting update messages.
+ */
+void radius_client_set_interim_error_cb(struct radius_client_data *radius,
+					void (*cb)(const u8 *addr, void *ctx),
+					void *ctx)
+{
+	radius->interim_error_cb = cb;
+	radius->interim_error_cb_ctx = ctx;
+}
+
+
 /*
  * Returns >0 if message queue was flushed (i.e., the message that triggered
  * the error is not available anymore)
@@ -308,7 +337,7 @@ static int radius_client_handle_send_error(struct radius_client_data *radius,
 	int _errno = errno;
 	wpa_printf(MSG_INFO, "send[RADIUS,s=%d]: %s", s, strerror(errno));
 	if (_errno == ENOTCONN || _errno == EDESTADDRREQ || _errno == EINVAL ||
-	    _errno == EBADF || _errno == ENETUNREACH) {
+	    _errno == EBADF || _errno == ENETUNREACH || _errno == EACCES) {
 		hostapd_logger(radius->ctx, NULL, HOSTAPD_MODULE_RADIUS,
 			       HOSTAPD_LEVEL_INFO,
 			       "Send failed - maybe interface status changed -"
@@ -336,6 +365,8 @@ static int radius_client_retransmit(struct radius_client_data *radius,
 	int s;
 	struct wpabuf *buf;
 	size_t prev_num_msgs;
+	u8 *acct_delay_time;
+	size_t acct_delay_time_len;
 
 	if (entry->msg_type == RADIUS_ACCT ||
 	    entry->msg_type == RADIUS_ACCT_INTERIM) {
@@ -371,12 +402,52 @@ static int radius_client_retransmit(struct radius_client_data *radius,
 			conf->auth_server->retransmissions++;
 		}
 	}
+
+	if (entry->msg_type == RADIUS_ACCT_INTERIM) {
+		wpa_printf(MSG_DEBUG,
+			   "RADIUS: Failed to transmit interim accounting update to "
+			   MACSTR " - drop message and request a new update",
+			   MAC2STR(entry->addr));
+		if (radius->interim_error_cb)
+			radius->interim_error_cb(entry->addr,
+						 radius->interim_error_cb_ctx);
+		return 1;
+	}
+
 	if (s < 0) {
 		wpa_printf(MSG_INFO,
 			   "RADIUS: No valid socket for retransmission");
 		return 1;
 	}
 
+	if (entry->msg_type == RADIUS_ACCT &&
+	    radius_msg_get_attr_ptr(entry->msg, RADIUS_ATTR_ACCT_DELAY_TIME,
+				    &acct_delay_time, &acct_delay_time_len,
+				    NULL) == 0 &&
+	    acct_delay_time_len == 4) {
+		struct radius_hdr *hdr;
+		u32 delay_time;
+
+		/*
+		 * Need to assign a new identifier since attribute contents
+		 * changes.
+		 */
+		hdr = radius_msg_get_hdr(entry->msg);
+		hdr->identifier = radius_client_get_id(radius);
+
+		/* Update Acct-Delay-Time to show wait time in queue */
+		delay_time = now - entry->first_try;
+		WPA_PUT_BE32(acct_delay_time, delay_time);
+
+		wpa_printf(MSG_DEBUG,
+			   "RADIUS: Updated Acct-Delay-Time to %u for retransmission",
+			   delay_time);
+		radius_msg_finish_acct(entry->msg, entry->shared_secret,
+				       entry->shared_secret_len);
+		if (radius->conf->msg_dumps)
+			radius_msg_dump(entry->msg);
+	}
+
 	/* retransmit; remove entry if too many attempts */
 	entry->attempts++;
 	hostapd_logger(radius->ctx, entry->addr, HOSTAPD_MODULE_RADIUS,
@@ -407,7 +478,6 @@ static int radius_client_retransmit(struct radius_client_data *radius,
 static void radius_client_timer(void *eloop_ctx, void *timeout_ctx)
 {
 	struct radius_client_data *radius = eloop_ctx;
-	struct hostapd_radius_servers *conf = radius->conf;
 	struct os_reltime now;
 	os_time_t first;
 	struct radius_msg_list *entry, *prev, *tmp;
@@ -476,10 +546,10 @@ static void radius_client_timer(void *eloop_ctx, void *timeout_ctx)
 			       (long int) (first - now.sec));
 	}
 
-	if (auth_failover && conf->num_auth_servers > 1)
+	if (auth_failover)
 		radius_client_auth_failover(radius);
 
-	if (acct_failover && conf->num_acct_servers > 1)
+	if (acct_failover)
 		radius_client_acct_failover(radius);
 }
 
@@ -625,39 +695,6 @@ static void radius_client_list_add(struct radius_client_data *radius,
 }
 
 
-static void radius_client_list_del(struct radius_client_data *radius,
-				   RadiusType msg_type, const u8 *addr)
-{
-	struct radius_msg_list *entry, *prev, *tmp;
-
-	if (addr == NULL)
-		return;
-
-	entry = radius->msgs;
-	prev = NULL;
-	while (entry) {
-		if (entry->msg_type == msg_type &&
-		    os_memcmp(entry->addr, addr, ETH_ALEN) == 0) {
-			if (prev)
-				prev->next = entry->next;
-			else
-				radius->msgs = entry->next;
-			tmp = entry;
-			entry = entry->next;
-			hostapd_logger(radius->ctx, addr,
-				       HOSTAPD_MODULE_RADIUS,
-				       HOSTAPD_LEVEL_DEBUG,
-				       "Removing matching RADIUS message");
-			radius_client_msg_free(tmp);
-			radius->num_msgs--;
-			continue;
-		}
-		prev = entry;
-		entry = entry->next;
-	}
-}
-
-
 /**
  * radius_client_send - Send a RADIUS request
  * @radius: RADIUS client context from radius_client_init()
@@ -669,16 +706,19 @@ static void radius_client_list_del(struct radius_client_data *radius,
  * This function is used to transmit a RADIUS authentication (RADIUS_AUTH) or
  * accounting request (RADIUS_ACCT or RADIUS_ACCT_INTERIM). The only difference
  * between accounting and interim accounting messages is that the interim
- * message will override any pending interim accounting updates while a new
- * accounting message does not remove any pending messages.
+ * message will not be retransmitted. Instead, a callback is used to indicate
+ * that the transmission failed for the specific station @addr so that a new
+ * interim accounting update message can be generated with up-to-date session
+ * data instead of trying to resend old information.
  *
  * The message is added on the retransmission queue and will be retransmitted
  * automatically until a response is received or maximum number of retries
- * (RADIUS_CLIENT_MAX_RETRIES) is reached.
+ * (RADIUS_CLIENT_MAX_RETRIES) is reached. No such retries are used with
+ * RADIUS_ACCT_INTERIM, i.e., such a pending message is removed from the queue
+ * automatically on transmission failure.
  *
  * The related device MAC address can be used to identify pending messages that
- * can be removed with radius_client_flush_auth() or with interim accounting
- * updates.
+ * can be removed with radius_client_flush_auth().
  */
 int radius_client_send(struct radius_client_data *radius,
 		       struct radius_msg *msg, RadiusType msg_type,
@@ -691,11 +731,6 @@ int radius_client_send(struct radius_client_data *radius,
 	int s, res;
 	struct wpabuf *buf;
 
-	if (msg_type == RADIUS_ACCT_INTERIM) {
-		/* Remove any pending interim acct update for the same STA. */
-		radius_client_list_del(radius, msg_type, addr);
-	}
-
 	if (msg_type == RADIUS_ACCT || msg_type == RADIUS_ACCT_INTERIM) {
 		if (conf->acct_server && radius->acct_sock < 0)
 			radius_client_init_acct(radius);
@@ -1015,6 +1050,9 @@ radius_change_server(struct radius_client_data *radius,
 	int sel_sock;
 	struct radius_msg_list *entry;
 	struct hostapd_radius_servers *conf = radius->conf;
+	struct sockaddr_in disconnect_addr = {
+		.sin_family = AF_UNSPEC,
+	};
 
 	hostapd_logger(radius->ctx, NULL, HOSTAPD_MODULE_RADIUS,
 		       HOSTAPD_LEVEL_INFO,
@@ -1023,6 +1061,12 @@ radius_change_server(struct radius_client_data *radius,
 		       hostapd_ip_txt(&nserv->addr, abuf, sizeof(abuf)),
 		       nserv->port);
 
+	if (oserv && oserv == nserv) {
+		/* Reconnect to same server, flush */
+		if (auth)
+			radius_client_flush(radius, 1);
+	}
+
 	if (oserv && oserv != nserv &&
 	    (nserv->shared_secret_len != oserv->shared_secret_len ||
 	     os_memcmp(nserv->shared_secret, oserv->shared_secret,
@@ -1125,6 +1169,11 @@ radius_change_server(struct radius_client_data *radius,
 		}
 	}
 
+	/* Force a reconnect by disconnecting the socket first */
+	if (connect(sel_sock, (struct sockaddr *) &disconnect_addr,
+		    sizeof(disconnect_addr)) < 0)
+		wpa_printf(MSG_INFO, "disconnect[radius]: %s", strerror(errno));
+
 	if (connect(sel_sock, addr, addrlen) < 0) {
 		wpa_printf(MSG_INFO, "connect[radius]: %s", strerror(errno));
 		return -1;
@@ -1587,11 +1636,16 @@ static int radius_client_dump_acct_server(char *buf, size_t buflen,
 int radius_client_get_mib(struct radius_client_data *radius, char *buf,
 			  size_t buflen)
 {
-	struct hostapd_radius_servers *conf = radius->conf;
+	struct hostapd_radius_servers *conf;
 	int i;
 	struct hostapd_radius_server *serv;
 	int count = 0;
 
+	if (!radius)
+		return 0;
+
+	conf = radius->conf;
+
 	if (conf->auth_servers) {
 		for (i = 0; i < conf->num_auth_servers; i++) {
 			serv = &conf->auth_servers[i];
diff --git a/src/radius/radius_client.h b/src/radius/radius_client.h
index 3db16aa282ba7..8ca0874db498a 100644
--- a/src/radius/radius_client.h
+++ b/src/radius/radius_client.h
@@ -241,6 +241,9 @@ int radius_client_register(struct radius_client_data *radius,
 			    const u8 *shared_secret, size_t shared_secret_len,
 			    void *data),
 			   void *data);
+void radius_client_set_interim_error_cb(struct radius_client_data *radius,
+					void (*cb)(const u8 *addr, void *ctx),
+					void *ctx);
 int radius_client_send(struct radius_client_data *radius,
 		       struct radius_msg *msg,
 		       RadiusType msg_type, const u8 *addr);
diff --git a/src/radius/radius_das.c b/src/radius/radius_das.c
index b7d991bbd0979..8a3d7e0324bc2 100644
--- a/src/radius/radius_das.c
+++ b/src/radius/radius_das.c
@@ -23,6 +23,7 @@ struct radius_das_data {
 	struct hostapd_ip_addr client_addr;
 	unsigned int time_window;
 	int require_event_timestamp;
+	int require_message_authenticator;
 	void *ctx;
 	enum radius_das_res (*disconnect)(void *ctx,
 					  struct radius_das_attrs *attr);
@@ -234,9 +235,11 @@ static void radius_das_receive(int sock, void *eloop_ctx, void *sock_ctx)
 		radius_msg_dump(msg);
 
 	if (radius_msg_verify_das_req(msg, das->shared_secret,
-				       das->shared_secret_len)) {
-		wpa_printf(MSG_DEBUG, "DAS: Invalid authenticator in packet "
-			   "from %s:%d - drop", abuf, from_port);
+				       das->shared_secret_len,
+				       das->require_message_authenticator)) {
+		wpa_printf(MSG_DEBUG,
+			   "DAS: Invalid authenticator or Message-Authenticator in packet from %s:%d - drop",
+			   abuf, from_port);
 		goto fail;
 	}
 
@@ -362,6 +365,8 @@ radius_das_init(struct radius_das_conf *conf)
 
 	das->time_window = conf->time_window;
 	das->require_event_timestamp = conf->require_event_timestamp;
+	das->require_message_authenticator =
+		conf->require_message_authenticator;
 	das->ctx = conf->ctx;
 	das->disconnect = conf->disconnect;
 
diff --git a/src/radius/radius_das.h b/src/radius/radius_das.h
index ce731d46a9ace..9863fdc1eaca0 100644
--- a/src/radius/radius_das.h
+++ b/src/radius/radius_das.h
@@ -44,6 +44,7 @@ struct radius_das_conf {
 	const struct hostapd_ip_addr *client_addr;
 	unsigned int time_window;
 	int require_event_timestamp;
+	int require_message_authenticator;
 	void *ctx;
 	enum radius_das_res (*disconnect)(void *ctx,
 					  struct radius_das_attrs *attr);
diff --git a/src/rsn_supp/pmksa_cache.c b/src/rsn_supp/pmksa_cache.c
index ef7b683864765..3d8d12223c261 100644
--- a/src/rsn_supp/pmksa_cache.c
+++ b/src/rsn_supp/pmksa_cache.c
@@ -15,7 +15,7 @@
 #include "wpa_i.h"
 #include "pmksa_cache.h"
 
-#ifdef IEEE8021X_EAPOL
+#if defined(IEEE8021X_EAPOL) && !defined(CONFIG_NO_WPA)
 
 static const int pmksa_cache_max_entries = 32;
 
@@ -109,6 +109,7 @@ static void pmksa_cache_set_expiration(struct rsn_pmksa_cache *pmksa)
  * @pmksa: Pointer to PMKSA cache data from pmksa_cache_init()
  * @pmk: The new pairwise master key
  * @pmk_len: PMK length in bytes, usually PMK_LEN (32)
+ * @pmkid: Calculated PMKID
  * @kck: Key confirmation key or %NULL if not yet derived
  * @kck_len: KCK length in bytes
  * @aa: Authenticator address
@@ -124,13 +125,13 @@ static void pmksa_cache_set_expiration(struct rsn_pmksa_cache *pmksa)
  */
 struct rsn_pmksa_cache_entry *
 pmksa_cache_add(struct rsn_pmksa_cache *pmksa, const u8 *pmk, size_t pmk_len,
-		const u8 *kck, size_t kck_len,
+		const u8 *pmkid, const u8 *kck, size_t kck_len,
 		const u8 *aa, const u8 *spa, void *network_ctx, int akmp)
 {
 	struct rsn_pmksa_cache_entry *entry, *pos, *prev;
 	struct os_reltime now;
 
-	if (pmk_len > PMK_LEN)
+	if (pmk_len > PMK_LEN_MAX)
 		return NULL;
 
 	if (wpa_key_mgmt_suite_b(akmp) && !kck)
@@ -141,7 +142,9 @@ pmksa_cache_add(struct rsn_pmksa_cache *pmksa, const u8 *pmk, size_t pmk_len,
 		return NULL;
 	os_memcpy(entry->pmk, pmk, pmk_len);
 	entry->pmk_len = pmk_len;
-	if (akmp == WPA_KEY_MGMT_IEEE8021X_SUITE_B_192)
+	if (pmkid)
+		os_memcpy(entry->pmkid, pmkid, PMKID_LEN);
+	else if (akmp == WPA_KEY_MGMT_IEEE8021X_SUITE_B_192)
 		rsn_pmkid_suite_b_192(kck, kck_len, aa, spa, entry->pmkid);
 	else if (wpa_key_mgmt_suite_b(akmp))
 		rsn_pmkid_suite_b(kck, kck_len, aa, spa, entry->pmkid);
@@ -344,7 +347,7 @@ pmksa_cache_clone_entry(struct rsn_pmksa_cache *pmksa,
 	struct rsn_pmksa_cache_entry *new_entry;
 
 	new_entry = pmksa_cache_add(pmksa, old_entry->pmk, old_entry->pmk_len,
-				    NULL, 0,
+				    NULL, NULL, 0,
 				    aa, pmksa->sm->own_addr,
 				    old_entry->network_ctx, old_entry->akmp);
 	if (new_entry == NULL)
diff --git a/src/rsn_supp/pmksa_cache.h b/src/rsn_supp/pmksa_cache.h
index f8e040e067d95..daede6dac7fe6 100644
--- a/src/rsn_supp/pmksa_cache.h
+++ b/src/rsn_supp/pmksa_cache.h
@@ -15,7 +15,7 @@
 struct rsn_pmksa_cache_entry {
 	struct rsn_pmksa_cache_entry *next;
 	u8 pmkid[PMKID_LEN];
-	u8 pmk[PMK_LEN];
+	u8 pmk[PMK_LEN_MAX];
 	size_t pmk_len;
 	os_time_t expiration;
 	int akmp; /* WPA_KEY_MGMT_* */
@@ -44,7 +44,7 @@ enum pmksa_free_reason {
 	PMKSA_EXPIRE,
 };
 
-#ifdef IEEE8021X_EAPOL
+#if defined(IEEE8021X_EAPOL) && !defined(CONFIG_NO_WPA)
 
 struct rsn_pmksa_cache *
 pmksa_cache_init(void (*free_cb)(struct rsn_pmksa_cache_entry *entry,
@@ -57,7 +57,7 @@ struct rsn_pmksa_cache_entry * pmksa_cache_get(struct rsn_pmksa_cache *pmksa,
 int pmksa_cache_list(struct rsn_pmksa_cache *pmksa, char *buf, size_t len);
 struct rsn_pmksa_cache_entry *
 pmksa_cache_add(struct rsn_pmksa_cache *pmksa, const u8 *pmk, size_t pmk_len,
-		const u8 *kck, size_t kck_len,
+		const u8 *pmkid, const u8 *kck, size_t kck_len,
 		const u8 *aa, const u8 *spa, void *network_ctx, int akmp);
 struct rsn_pmksa_cache_entry * pmksa_cache_get_current(struct wpa_sm *sm);
 void pmksa_cache_clear_current(struct wpa_sm *sm);
@@ -105,7 +105,7 @@ static inline int pmksa_cache_list(struct rsn_pmksa_cache *pmksa, char *buf,
 
 static inline struct rsn_pmksa_cache_entry *
 pmksa_cache_add(struct rsn_pmksa_cache *pmksa, const u8 *pmk, size_t pmk_len,
-		const u8 *kck, size_t kck_len,
+		const u8 *pmkid, const u8 *kck, size_t kck_len,
 		const u8 *aa, const u8 *spa, void *network_ctx, int akmp)
 {
 	return NULL;
diff --git a/src/rsn_supp/preauth.c b/src/rsn_supp/preauth.c
index c6534af2c96eb..4c9a4fb8b14ca 100644
--- a/src/rsn_supp/preauth.c
+++ b/src/rsn_supp/preauth.c
@@ -18,7 +18,7 @@
 #include "wpa_i.h"
 
 
-#ifdef IEEE8021X_EAPOL
+#if defined(IEEE8021X_EAPOL) && !defined(CONFIG_NO_WPA)
 
 #define PMKID_CANDIDATE_PRIO_SCAN 1000
 
@@ -93,7 +93,7 @@ static void rsn_preauth_eapol_cb(struct eapol_sm *eapol,
 			wpa_hexdump_key(MSG_DEBUG, "RSN: PMK from pre-auth",
 					pmk, pmk_len);
 			sm->pmk_len = pmk_len;
-			pmksa_cache_add(sm->pmksa, pmk, pmk_len,
+			pmksa_cache_add(sm->pmksa, pmk, pmk_len, NULL,
 					NULL, 0,
 					sm->preauth_bssid, sm->own_addr,
 					sm->network_ctx,
@@ -538,4 +538,4 @@ int rsn_preauth_in_progress(struct wpa_sm *sm)
 	return sm->preauth_eapol != NULL;
 }
 
-#endif /* IEEE8021X_EAPOL */
+#endif /* IEEE8021X_EAPOL && !CONFIG_NO_WPA */
diff --git a/src/rsn_supp/preauth.h b/src/rsn_supp/preauth.h
index 277f0663b0f08..8caf3ee56b5f2 100644
--- a/src/rsn_supp/preauth.h
+++ b/src/rsn_supp/preauth.h
@@ -11,7 +11,7 @@
 
 struct wpa_scan_results;
 
-#ifdef IEEE8021X_EAPOL
+#if defined(IEEE8021X_EAPOL) && !defined(CONFIG_NO_WPA)
 
 void pmksa_candidate_free(struct wpa_sm *sm);
 int rsn_preauth_init(struct wpa_sm *sm, const u8 *dst,
@@ -27,7 +27,7 @@ int rsn_preauth_get_status(struct wpa_sm *sm, char *buf, size_t buflen,
 			   int verbose);
 int rsn_preauth_in_progress(struct wpa_sm *sm);
 
-#else /* IEEE8021X_EAPOL */
+#else /* IEEE8021X_EAPOL && !CONFIG_NO_WPA */
 
 static inline void pmksa_candidate_free(struct wpa_sm *sm)
 {
@@ -74,6 +74,6 @@ static inline int rsn_preauth_in_progress(struct wpa_sm *sm)
 	return 0;
 }
 
-#endif /* IEEE8021X_EAPOL */
+#endif /* IEEE8021X_EAPOL && !CONFIG_NO_WPA */
 
 #endif /* PREAUTH_H */
diff --git a/src/rsn_supp/tdls.c b/src/rsn_supp/tdls.c
index 722c20a706f9d..e4241681842ac 100644
--- a/src/rsn_supp/tdls.c
+++ b/src/rsn_supp/tdls.c
@@ -627,9 +627,15 @@ static void wpa_tdls_tpk_timeout(void *eloop_ctx, void *timeout_ctx)
 	 */
 
 	if (peer->initiator) {
+		u8 addr[ETH_ALEN];
+
 		wpa_printf(MSG_DEBUG, "TDLS: TPK lifetime expired for " MACSTR
 			   " - try to renew", MAC2STR(peer->addr));
-		wpa_tdls_start(sm, peer->addr);
+		/* cache the peer address before do_teardown */
+		os_memcpy(addr, peer->addr, ETH_ALEN);
+		wpa_tdls_do_teardown(sm, peer,
+				     WLAN_REASON_TDLS_TEARDOWN_UNSPECIFIED);
+		wpa_tdls_start(sm, addr);
 	} else {
 		wpa_printf(MSG_DEBUG, "TDLS: TPK lifetime expired for " MACSTR
 			   " - tear down", MAC2STR(peer->addr));
@@ -2170,6 +2176,14 @@ static int wpa_tdls_process_tpk_m2(struct wpa_sm *sm, const u8 *src_addr,
 			   "ignore TPK M2 from " MACSTR, MAC2STR(src_addr));
 		return -1;
 	}
+
+	if (peer->tpk_success) {
+		wpa_printf(MSG_INFO, "TDLS: Ignore incoming TPK M2 retry, from "
+			   MACSTR " as TPK M3 was already sent",
+			   MAC2STR(src_addr));
+		return 0;
+	}
+
 	wpa_tdls_tpk_retry_timeout_cancel(sm, peer, WLAN_TDLS_SETUP_REQUEST);
 
 	if (len < 3 + 2 + 1) {
@@ -2325,7 +2339,7 @@ static int wpa_tdls_process_tpk_m2(struct wpa_sm *sm, const u8 *src_addr,
 		    kde.ftie, sizeof(*ftie));
 	ftie = (struct wpa_tdls_ftie *) kde.ftie;
 
-	if (!os_memcmp(peer->inonce, ftie->Snonce, WPA_NONCE_LEN) == 0) {
+	if (os_memcmp(peer->inonce, ftie->Snonce, WPA_NONCE_LEN) != 0) {
 		wpa_printf(MSG_INFO, "TDLS: FTIE SNonce in TPK M2 does "
 			   "not match with FTIE SNonce used in TPK M1");
 		/* Silently discard the frame */
@@ -2386,7 +2400,7 @@ skip_rsn:
 	wpa_printf(MSG_DEBUG, "TDLS: Sending TDLS Setup Confirm / "
 		   "TPK Handshake Message 3");
 	if (wpa_tdls_send_tpk_m3(sm, src_addr, dtoken, lnkid, peer) < 0)
-		goto error;
+		goto error_no_msg;
 
 	if (!peer->tpk_success) {
 		/*
@@ -2407,6 +2421,7 @@ skip_rsn:
 error:
 	wpa_tdls_send_error(sm, src_addr, WLAN_TDLS_SETUP_CONFIRM, dtoken, 1,
 			    status);
+error_no_msg:
 	wpa_tdls_disable_peer_link(sm, peer);
 	return -1;
 }
@@ -2503,13 +2518,13 @@ static int wpa_tdls_process_tpk_m3(struct wpa_sm *sm, const u8 *src_addr,
 		goto error;
 	}
 
-	if (!os_memcmp(peer->rnonce, ftie->Anonce, WPA_NONCE_LEN) == 0) {
+	if (os_memcmp(peer->rnonce, ftie->Anonce, WPA_NONCE_LEN) != 0) {
 		wpa_printf(MSG_INFO, "TDLS: FTIE ANonce in TPK M3 does "
 			   "not match with FTIE ANonce used in TPK M2");
 		goto error;
 	}
 
-	if (!os_memcmp(peer->inonce, ftie->Snonce, WPA_NONCE_LEN) == 0) {
+	if (os_memcmp(peer->inonce, ftie->Snonce, WPA_NONCE_LEN) != 0) {
 		wpa_printf(MSG_INFO, "TDLS: FTIE SNonce in TPK M3 does not "
 			   "match with FTIE SNonce used in TPK M1");
 		goto error;
diff --git a/src/rsn_supp/wpa.c b/src/rsn_supp/wpa.c
index a9f255e37b436..3c4787925e20a 100644
--- a/src/rsn_supp/wpa.c
+++ b/src/rsn_supp/wpa.c
@@ -1,6 +1,7 @@
 /*
  * WPA Supplicant - WPA state machine and EAPOL-Key processing
  * Copyright (c) 2003-2015, Jouni Malinen <j@w1.fi>
+ * Copyright(c) 2015 Intel Deutschland GmbH
  *
  * This software may be distributed under the terms of the BSD license.
  * See README for more details.
@@ -23,6 +24,9 @@
 #include "peerkey.h"
 
 
+static const u8 null_rsc[8] = { 0, 0, 0, 0, 0, 0, 0, 0 };
+
+
 /**
  * wpa_eapol_key_send - Send WPA/RSN EAPOL-Key message
  * @sm: Pointer to WPA state machine data from wpa_sm_init()
@@ -34,11 +38,13 @@
  * @msg: EAPOL-Key message
  * @msg_len: Length of message
  * @key_mic: Pointer to the buffer to which the EAPOL-Key MIC is written
+ * Returns: >= 0 on success, < 0 on failure
  */
-void wpa_eapol_key_send(struct wpa_sm *sm, const u8 *kck, size_t kck_len,
-			int ver, const u8 *dest, u16 proto,
-			u8 *msg, size_t msg_len, u8 *key_mic)
+int wpa_eapol_key_send(struct wpa_sm *sm, const u8 *kck, size_t kck_len,
+		       int ver, const u8 *dest, u16 proto,
+		       u8 *msg, size_t msg_len, u8 *key_mic)
 {
+	int ret = -1;
 	size_t mic_len = wpa_mic_len(sm->key_mgmt);
 
 	if (is_zero_ether_addr(dest) && is_zero_ether_addr(sm->bssid)) {
@@ -69,10 +75,11 @@ void wpa_eapol_key_send(struct wpa_sm *sm, const u8 *kck, size_t kck_len,
 	wpa_hexdump_key(MSG_DEBUG, "WPA: KCK", kck, kck_len);
 	wpa_hexdump(MSG_DEBUG, "WPA: Derived Key MIC", key_mic, mic_len);
 	wpa_hexdump(MSG_MSGDUMP, "WPA: TX EAPOL-Key", msg, msg_len);
-	wpa_sm_ether_send(sm, dest, proto, msg, msg_len);
+	ret = wpa_sm_ether_send(sm, dest, proto, msg, msg_len);
 	eapol_sm_notify_tx_eapol_key(sm->eapol);
 out:
 	os_free(msg);
+	return ret;
 }
 
 
@@ -124,7 +131,7 @@ void wpa_sm_key_request(struct wpa_sm *sm, int error, int pairwise)
 		EAPOL_KEY_TYPE_RSN : EAPOL_KEY_TYPE_WPA;
 	key_info = WPA_KEY_INFO_REQUEST | ver;
 	if (sm->ptk_set)
-		key_info |= WPA_KEY_INFO_MIC;
+		key_info |= WPA_KEY_INFO_MIC | WPA_KEY_INFO_SECURE;
 	if (error)
 		key_info |= WPA_KEY_INFO_ERROR;
 	if (pairwise)
@@ -206,15 +213,21 @@ static int wpa_supplicant_get_pmk(struct wpa_sm *sm,
 #endif /* CONFIG_IEEE80211R */
 	} else if (wpa_key_mgmt_wpa_ieee8021x(sm->key_mgmt) && sm->eapol) {
 		int res, pmk_len;
-		pmk_len = PMK_LEN;
-		res = eapol_sm_get_key(sm->eapol, sm->pmk, PMK_LEN);
+
+		if (sm->key_mgmt & WPA_KEY_MGMT_IEEE8021X_SUITE_B_192)
+			pmk_len = PMK_LEN_SUITE_B_192;
+		else
+			pmk_len = PMK_LEN;
+		res = eapol_sm_get_key(sm->eapol, sm->pmk, pmk_len);
 		if (res) {
-			/*
-			 * EAP-LEAP is an exception from other EAP methods: it
-			 * uses only 16-byte PMK.
-			 */
-			res = eapol_sm_get_key(sm->eapol, sm->pmk, 16);
-			pmk_len = 16;
+			if (pmk_len == PMK_LEN) {
+				/*
+				 * EAP-LEAP is an exception from other EAP
+				 * methods: it uses only 16-byte PMK.
+				 */
+				res = eapol_sm_get_key(sm->eapol, sm->pmk, 16);
+				pmk_len = 16;
+			}
 		} else {
 #ifdef CONFIG_IEEE80211R
 			u8 buf[2 * PMK_LEN];
@@ -236,7 +249,7 @@ static int wpa_supplicant_get_pmk(struct wpa_sm *sm,
 			    !wpa_key_mgmt_suite_b(sm->key_mgmt) &&
 			    !wpa_key_mgmt_ft(sm->key_mgmt)) {
 				sa = pmksa_cache_add(sm->pmksa,
-						     sm->pmk, pmk_len,
+						     sm->pmk, pmk_len, NULL,
 						     NULL, 0,
 						     src_addr, sm->own_addr,
 						     sm->network_ctx,
@@ -257,7 +270,7 @@ static int wpa_supplicant_get_pmk(struct wpa_sm *sm,
 				 * much we can do here without knowing what
 				 * exactly caused the server to misbehave.
 				 */
-				wpa_dbg(sm->ctx->msg_ctx, MSG_INFO,
+				wpa_msg(sm->ctx->msg_ctx, MSG_INFO,
 					"RSN: PMKID mismatch - authentication server may have derived different MSK?!");
 				return -1;
 			}
@@ -318,7 +331,7 @@ static int wpa_supplicant_get_pmk(struct wpa_sm *sm,
  * @wpa_ie: WPA/RSN IE
  * @wpa_ie_len: Length of the WPA/RSN IE
  * @ptk: PTK to use for keyed hash and encryption
- * Returns: 0 on success, -1 on failure
+ * Returns: >= 0 on success, < 0 on failure
  */
 int wpa_supplicant_send_2_of_4(struct wpa_sm *sm, const unsigned char *dst,
 			       const struct wpa_eapol_key *key,
@@ -351,13 +364,12 @@ int wpa_supplicant_send_2_of_4(struct wpa_sm *sm, const unsigned char *dst,
 		if (rsn_ie_buf == NULL)
 			return -1;
 		os_memcpy(rsn_ie_buf, wpa_ie, wpa_ie_len);
-		res = wpa_insert_pmkid(rsn_ie_buf, wpa_ie_len,
+		res = wpa_insert_pmkid(rsn_ie_buf, &wpa_ie_len,
 				       sm->pmk_r1_name);
 		if (res < 0) {
 			os_free(rsn_ie_buf);
 			return -1;
 		}
-		wpa_ie_len += res;
 
 		if (sm->assoc_resp_ies) {
 			os_memcpy(rsn_ie_buf + wpa_ie_len, sm->assoc_resp_ies,
@@ -409,10 +421,8 @@ int wpa_supplicant_send_2_of_4(struct wpa_sm *sm, const unsigned char *dst,
 	os_memcpy(reply->key_nonce, nonce, WPA_NONCE_LEN);
 
 	wpa_dbg(sm->ctx->msg_ctx, MSG_DEBUG, "WPA: Sending EAPOL-Key 2/4");
-	wpa_eapol_key_send(sm, ptk->kck, ptk->kck_len, ver, dst, ETH_P_EAPOL,
-			   rbuf, rlen, key_mic);
-
-	return 0;
+	return wpa_eapol_key_send(sm, ptk->kck, ptk->kck_len, ver, dst,
+				  ETH_P_EAPOL, rbuf, rlen, key_mic);
 }
 
 
@@ -500,6 +510,7 @@ static void wpa_supplicant_process_1_of_4(struct wpa_sm *sm,
 		os_memset(buf, 0, sizeof(buf));
 	}
 	sm->tptk_set = 1;
+	sm->tk_to_set = 1;
 
 	kde = sm->assoc_wpa_ie;
 	kde_len = sm->assoc_wpa_ie_len;
@@ -525,7 +536,7 @@ static void wpa_supplicant_process_1_of_4(struct wpa_sm *sm,
 #endif /* CONFIG_P2P */
 
 	if (wpa_supplicant_send_2_of_4(sm, sm->bssid, key, ver, sm->snonce,
-				       kde, kde_len, ptk))
+				       kde, kde_len, ptk) < 0)
 		goto failed;
 
 	os_free(kde_buf);
@@ -603,7 +614,12 @@ static int wpa_supplicant_install_ptk(struct wpa_sm *sm,
 	int keylen, rsclen;
 	enum wpa_alg alg;
 	const u8 *key_rsc;
-	u8 null_rsc[8] = { 0, 0, 0, 0, 0, 0, 0, 0 };
+
+	if (!sm->tk_to_set) {
+		wpa_dbg(sm->ctx->msg_ctx, MSG_DEBUG,
+			"WPA: Do not re-install same PTK to the driver");
+		return 0;
+	}
 
 	wpa_dbg(sm->ctx->msg_ctx, MSG_DEBUG,
 		"WPA: Installing PTK to the driver");
@@ -643,6 +659,7 @@ static int wpa_supplicant_install_ptk(struct wpa_sm *sm,
 
 	/* TK is not needed anymore in supplicant */
 	os_memset(sm->ptk.tk, 0, WPA_TK_MAX_LEN);
+	sm->tk_to_set = 0;
 
 	if (sm->wpa_ptk_rekey) {
 		eloop_cancel_timeout(wpa_sm_rekey_ptk, sm, NULL);
@@ -753,12 +770,43 @@ static int wpa_supplicant_gtk_tx_bit_workaround(const struct wpa_sm *sm,
 }
 
 
+static int wpa_supplicant_rsc_relaxation(const struct wpa_sm *sm,
+					 const u8 *rsc)
+{
+	int rsclen;
+
+	if (!sm->wpa_rsc_relaxation)
+		return 0;
+
+	rsclen = wpa_cipher_rsc_len(sm->group_cipher);
+
+	/*
+	 * Try to detect RSC (endian) corruption issue where the AP sends
+	 * the RSC bytes in EAPOL-Key message in the wrong order, both if
+	 * it's actually a 6-byte field (as it should be) and if it treats
+	 * it as an 8-byte field.
+	 * An AP model known to have this bug is the Sapido RB-1632.
+	 */
+	if (rsclen == 6 && ((rsc[5] && !rsc[0]) || rsc[6] || rsc[7])) {
+		wpa_msg(sm->ctx->msg_ctx, MSG_WARNING,
+			"RSC %02x%02x%02x%02x%02x%02x%02x%02x is likely bogus, using 0",
+			rsc[0], rsc[1], rsc[2], rsc[3],
+			rsc[4], rsc[5], rsc[6], rsc[7]);
+
+		return 1;
+	}
+
+	return 0;
+}
+
+
 static int wpa_supplicant_pairwise_gtk(struct wpa_sm *sm,
 				       const struct wpa_eapol_key *key,
 				       const u8 *gtk, size_t gtk_len,
 				       int key_info)
 {
 	struct wpa_gtk_data gd;
+	const u8 *key_rsc;
 
 	/*
 	 * IEEE Std 802.11i-2004 - 8.5.2 EAPOL-Key frames - Figure 43x
@@ -784,11 +832,15 @@ static int wpa_supplicant_pairwise_gtk(struct wpa_sm *sm,
 	os_memcpy(gd.gtk, gtk, gtk_len);
 	gd.gtk_len = gtk_len;
 
+	key_rsc = key->key_rsc;
+	if (wpa_supplicant_rsc_relaxation(sm, key->key_rsc))
+		key_rsc = null_rsc;
+
 	if (sm->group_cipher != WPA_CIPHER_GTK_NOT_USED &&
 	    (wpa_supplicant_check_group_cipher(sm, sm->group_cipher,
 					       gtk_len, gtk_len,
 					       &gd.key_rsc_len, &gd.alg) ||
-	     wpa_supplicant_install_gtk(sm, &gd, key->key_rsc))) {
+	     wpa_supplicant_install_gtk(sm, &gd, key_rsc))) {
 		wpa_dbg(sm->ctx->msg_ctx, MSG_DEBUG,
 			"RSN: Failed to install GTK");
 		os_memset(&gd, 0, sizeof(gd));
@@ -989,8 +1041,8 @@ static int wpa_supplicant_validate_ie_ft(struct wpa_sm *sm,
 	if (sm->assoc_resp_ies) {
 		pos = sm->assoc_resp_ies;
 		end = pos + sm->assoc_resp_ies_len;
-		while (pos + 2 < end) {
-			if (pos + 2 + pos[1] > end)
+		while (end - pos > 2) {
+			if (2 + pos[1] > end - pos)
 				break;
 			switch (*pos) {
 			case WLAN_EID_MOBILITY_DOMAIN:
@@ -1086,7 +1138,7 @@ static int wpa_supplicant_validate_ie(struct wpa_sm *sm,
  * @ver: Version bits from EAPOL-Key Key Info
  * @key_info: Key Info
  * @ptk: PTK to use for keyed hash and encryption
- * Returns: 0 on success, -1 on failure
+ * Returns: >= 0 on success, < 0 on failure
  */
 int wpa_supplicant_send_4_of_4(struct wpa_sm *sm, const unsigned char *dst,
 			       const struct wpa_eapol_key *key,
@@ -1126,10 +1178,8 @@ int wpa_supplicant_send_4_of_4(struct wpa_sm *sm, const unsigned char *dst,
 		WPA_PUT_BE16(reply->key_data_length, 0);
 
 	wpa_dbg(sm->ctx->msg_ctx, MSG_DEBUG, "WPA: Sending EAPOL-Key 4/4");
-	wpa_eapol_key_send(sm, ptk->kck, ptk->kck_len, ver, dst, ETH_P_EAPOL,
-			   rbuf, rlen, key_mic);
-
-	return 0;
+	return wpa_eapol_key_send(sm, ptk->kck, ptk->kck_len, ver, dst,
+				  ETH_P_EAPOL, rbuf, rlen, key_mic);
 }
 
 
@@ -1202,7 +1252,7 @@ static void wpa_supplicant_process_3_of_4(struct wpa_sm *sm,
 #endif /* CONFIG_P2P */
 
 	if (wpa_supplicant_send_4_of_4(sm, sm->bssid, key, ver, key_info,
-				       &sm->ptk)) {
+				       &sm->ptk) < 0) {
 		goto failed;
 	}
 
@@ -1247,7 +1297,7 @@ static void wpa_supplicant_process_3_of_4(struct wpa_sm *sm,
 	if (sm->proto == WPA_PROTO_RSN && wpa_key_mgmt_suite_b(sm->key_mgmt)) {
 		struct rsn_pmksa_cache_entry *sa;
 
-		sa = pmksa_cache_add(sm->pmksa, sm->pmk, sm->pmk_len,
+		sa = pmksa_cache_add(sm->pmksa, sm->pmk, sm->pmk_len, NULL,
 				     sm->ptk.kck, sm->ptk.kck_len,
 				     sm->bssid, sm->own_addr,
 				     sm->network_ctx, sm->key_mgmt);
@@ -1437,10 +1487,8 @@ static int wpa_supplicant_send_2_of_2(struct wpa_sm *sm,
 		WPA_PUT_BE16(reply->key_data_length, 0);
 
 	wpa_dbg(sm->ctx->msg_ctx, MSG_DEBUG, "WPA: Sending EAPOL-Key 2/2");
-	wpa_eapol_key_send(sm, sm->ptk.kck, sm->ptk.kck_len, ver, sm->bssid,
-			   ETH_P_EAPOL, rbuf, rlen, key_mic);
-
-	return 0;
+	return wpa_eapol_key_send(sm, sm->ptk.kck, sm->ptk.kck_len, ver,
+				  sm->bssid, ETH_P_EAPOL, rbuf, rlen, key_mic);
 }
 
 
@@ -1453,6 +1501,7 @@ static void wpa_supplicant_process_1_of_2(struct wpa_sm *sm,
 	u16 key_info;
 	int rekey, ret;
 	struct wpa_gtk_data gd;
+	const u8 *key_rsc;
 
 	if (!sm->msg_3_of_4_ok) {
 		wpa_msg(sm->ctx->msg_ctx, MSG_INFO,
@@ -1483,8 +1532,12 @@ static void wpa_supplicant_process_1_of_2(struct wpa_sm *sm,
 	if (ret)
 		goto failed;
 
-	if (wpa_supplicant_install_gtk(sm, &gd, key->key_rsc) ||
-	    wpa_supplicant_send_2_of_2(sm, key, ver, key_info))
+	key_rsc = key->key_rsc;
+	if (wpa_supplicant_rsc_relaxation(sm, key->key_rsc))
+		key_rsc = null_rsc;
+
+	if (wpa_supplicant_install_gtk(sm, &gd, key_rsc) ||
+	    wpa_supplicant_send_2_of_2(sm, key, ver, key_info) < 0)
 		goto failed;
 	os_memset(&gd, 0, sizeof(gd));
 
@@ -1617,14 +1670,14 @@ static int wpa_supplicant_decrypt_key_data(struct wpa_sm *sm,
 		}
 		if (aes_unwrap(sm->ptk.kek, sm->ptk.kek_len, *key_data_len / 8,
 			       key_data, buf)) {
-			os_free(buf);
+			bin_clear_free(buf, *key_data_len);
 			wpa_msg(sm->ctx->msg_ctx, MSG_WARNING,
 				"WPA: AES unwrap failed - "
 				"could not decrypt EAPOL-Key key data");
 			return -1;
 		}
 		os_memcpy(key_data, buf, *key_data_len);
-		os_free(buf);
+		bin_clear_free(buf, *key_data_len);
 		WPA_PUT_BE16(key->key_data_length, *key_data_len);
 	} else {
 		wpa_msg(sm->ctx->msg_ctx, MSG_WARNING,
@@ -2237,6 +2290,9 @@ void wpa_sm_deinit(struct wpa_sm *sm)
 #ifdef CONFIG_IEEE80211R
 	os_free(sm->assoc_resp_ies);
 #endif /* CONFIG_IEEE80211R */
+#ifdef CONFIG_TESTING_OPTIONS
+	wpabuf_free(sm->test_assoc_ie);
+#endif /* CONFIG_TESTING_OPTIONS */
 	os_free(sm);
 }
 
@@ -2335,12 +2391,13 @@ void wpa_sm_notify_disassoc(struct wpa_sm *sm)
  * @sm: Pointer to WPA state machine data from wpa_sm_init()
  * @pmk: The new PMK
  * @pmk_len: The length of the new PMK in bytes
+ * @pmkid: Calculated PMKID
  * @bssid: AA to add into PMKSA cache or %NULL to not cache the PMK
  *
  * Configure the PMK for WPA state machine.
  */
 void wpa_sm_set_pmk(struct wpa_sm *sm, const u8 *pmk, size_t pmk_len,
-		    const u8 *bssid)
+		    const u8 *pmkid, const u8 *bssid)
 {
 	if (sm == NULL)
 		return;
@@ -2355,7 +2412,7 @@ void wpa_sm_set_pmk(struct wpa_sm *sm, const u8 *pmk, size_t pmk_len,
 #endif /* CONFIG_IEEE80211R */
 
 	if (bssid) {
-		pmksa_cache_add(sm->pmksa, pmk, pmk_len, NULL, 0,
+		pmksa_cache_add(sm->pmksa, pmk, pmk_len, pmkid, NULL, 0,
 				bssid, sm->own_addr,
 				sm->network_ctx, sm->key_mgmt);
 	}
@@ -2439,6 +2496,7 @@ void wpa_sm_set_config(struct wpa_sm *sm, struct rsn_supp_config *config)
 			sm->ssid_len = 0;
 		sm->wpa_ptk_rekey = config->wpa_ptk_rekey;
 		sm->p2p = config->p2p;
+		sm->wpa_rsc_relaxation = config->wpa_rsc_relaxation;
 	} else {
 		sm->network_ctx = NULL;
 		sm->peerkey_enabled = 0;
@@ -2449,6 +2507,7 @@ void wpa_sm_set_config(struct wpa_sm *sm, struct rsn_supp_config *config)
 		sm->ssid_len = 0;
 		sm->wpa_ptk_rekey = 0;
 		sm->p2p = 0;
+		sm->wpa_rsc_relaxation = 0;
 	}
 }
 
@@ -2636,6 +2695,17 @@ int wpa_sm_set_assoc_wpa_ie_default(struct wpa_sm *sm, u8 *wpa_ie,
 	if (sm == NULL)
 		return -1;
 
+#ifdef CONFIG_TESTING_OPTIONS
+	if (sm->test_assoc_ie) {
+		wpa_printf(MSG_DEBUG,
+			   "TESTING: Replace association WPA/RSN IE");
+		if (*wpa_ie_len < wpabuf_len(sm->test_assoc_ie))
+			return -1;
+		os_memcpy(wpa_ie, wpabuf_head(sm->test_assoc_ie),
+			  wpabuf_len(sm->test_assoc_ie));
+		res = wpabuf_len(sm->test_assoc_ie);
+	} else
+#endif /* CONFIG_TESTING_OPTIONS */
 	res = wpa_gen_wpa_ie(sm, wpa_ie, *wpa_ie_len);
 	if (res < 0)
 		return -1;
@@ -2975,3 +3045,12 @@ void wpa_sm_set_ptk_kck_kek(struct wpa_sm *sm,
 	}
 	sm->ptk_set = 1;
 }
+
+
+#ifdef CONFIG_TESTING_OPTIONS
+void wpa_sm_set_test_assoc_ie(struct wpa_sm *sm, struct wpabuf *buf)
+{
+	wpabuf_free(sm->test_assoc_ie);
+	sm->test_assoc_ie = buf;
+}
+#endif /* CONFIG_TESTING_OPTIONS */
diff --git a/src/rsn_supp/wpa.h b/src/rsn_supp/wpa.h
index e163b7010b70e..0b7477f31bc7a 100644
--- a/src/rsn_supp/wpa.h
+++ b/src/rsn_supp/wpa.h
@@ -104,6 +104,7 @@ struct rsn_supp_config {
 	size_t ssid_len;
 	int wpa_ptk_rekey;
 	int p2p;
+	int wpa_rsc_relaxation;
 };
 
 #ifndef CONFIG_NO_WPA
@@ -113,7 +114,7 @@ void wpa_sm_deinit(struct wpa_sm *sm);
 void wpa_sm_notify_assoc(struct wpa_sm *sm, const u8 *bssid);
 void wpa_sm_notify_disassoc(struct wpa_sm *sm);
 void wpa_sm_set_pmk(struct wpa_sm *sm, const u8 *pmk, size_t pmk_len,
-		    const u8 *bssid);
+		    const u8 *pmkid, const u8 *bssid);
 void wpa_sm_set_pmk_from_pmksa(struct wpa_sm *sm);
 void wpa_sm_set_fast_reauth(struct wpa_sm *sm, int fast_reauth);
 void wpa_sm_set_scard_ctx(struct wpa_sm *sm, void *scard_ctx);
@@ -180,7 +181,8 @@ static inline void wpa_sm_notify_disassoc(struct wpa_sm *sm)
 }
 
 static inline void wpa_sm_set_pmk(struct wpa_sm *sm, const u8 *pmk,
-				  size_t pmk_len)
+				  size_t pmk_len, const u8 *pmkid,
+				  const u8 *bssid)
 {
 }
 
@@ -320,7 +322,8 @@ static inline void wpa_sm_set_rx_replay_ctr(struct wpa_sm *sm,
 }
 
 static inline void wpa_sm_set_ptk_kck_kek(struct wpa_sm *sm, const u8 *ptk_kck,
-					  const u8 *ptk_kek)
+					  size_t ptk_kck_len,
+					  const u8 *ptk_kek, size_t ptk_kek_len)
 {
 }
 
@@ -415,7 +418,12 @@ int wpa_tdls_enable_chan_switch(struct wpa_sm *sm, const u8 *addr,
 				u8 oper_class,
 				struct hostapd_freq_params *freq_params);
 int wpa_tdls_disable_chan_switch(struct wpa_sm *sm, const u8 *addr);
+#ifdef CONFIG_TDLS_TESTING
+extern unsigned int tdls_testing;
+#endif /* CONFIG_TDLS_TESTING */
+
 
 int wpa_wnmsleep_install_key(struct wpa_sm *sm, u8 subelem_id, u8 *buf);
+void wpa_sm_set_test_assoc_ie(struct wpa_sm *sm, struct wpabuf *buf);
 
 #endif /* WPA_H */
diff --git a/src/rsn_supp/wpa_i.h b/src/rsn_supp/wpa_i.h
index 965a9c1d577c3..f653ba6e041d4 100644
--- a/src/rsn_supp/wpa_i.h
+++ b/src/rsn_supp/wpa_i.h
@@ -19,11 +19,12 @@ struct wpa_eapol_key;
  * struct wpa_sm - Internal WPA state machine data
  */
 struct wpa_sm {
-	u8 pmk[PMK_LEN];
+	u8 pmk[PMK_LEN_MAX];
 	size_t pmk_len;
 	struct wpa_ptk ptk, tptk;
 	int ptk_set, tptk_set;
 	unsigned int msg_3_of_4_ok:1;
+	unsigned int tk_to_set:1;
 	u8 snonce[WPA_NONCE_LEN];
 	u8 anonce[WPA_NONCE_LEN]; /* ANonce from the last 1/4 msg */
 	int renew_snonce;
@@ -60,6 +61,7 @@ struct wpa_sm {
 	size_t ssid_len;
 	int wpa_ptk_rekey;
 	int p2p;
+	int wpa_rsc_relaxation;
 
 	u8 own_addr[ETH_ALEN];
 	const char *ifname;
@@ -132,6 +134,10 @@ struct wpa_sm {
 #ifdef CONFIG_P2P
 	u8 p2p_ip_addr[3 * 4];
 #endif /* CONFIG_P2P */
+
+#ifdef CONFIG_TESTING_OPTIONS
+	struct wpabuf *test_assoc_ie;
+#endif /* CONFIG_TESTING_OPTIONS */
 };
 
 
@@ -342,16 +348,14 @@ wpa_sm_tdls_disable_channel_switch(struct wpa_sm *sm, const u8 *addr)
 static inline int wpa_sm_key_mgmt_set_pmk(struct wpa_sm *sm,
 					  const u8 *pmk, size_t pmk_len)
 {
-	if (!sm->proactive_key_caching)
-		return 0;
 	if (!sm->ctx->key_mgmt_set_pmk)
 		return -1;
 	return sm->ctx->key_mgmt_set_pmk(sm->ctx->ctx, pmk, pmk_len);
 }
 
-void wpa_eapol_key_send(struct wpa_sm *sm, const u8 *kck, size_t kck_len,
-			int ver, const u8 *dest, u16 proto,
-			u8 *msg, size_t msg_len, u8 *key_mic);
+int wpa_eapol_key_send(struct wpa_sm *sm, const u8 *kck, size_t kck_len,
+		       int ver, const u8 *dest, u16 proto,
+		       u8 *msg, size_t msg_len, u8 *key_mic);
 int wpa_supplicant_send_2_of_4(struct wpa_sm *sm, const unsigned char *dst,
 			       const struct wpa_eapol_key *key,
 			       int ver, const u8 *nonce,
diff --git a/src/rsn_supp/wpa_ie.c b/src/rsn_supp/wpa_ie.c
index 0c37b35c1ee1d..c44844ec583bf 100644
--- a/src/rsn_supp/wpa_ie.c
+++ b/src/rsn_supp/wpa_ie.c
@@ -378,7 +378,7 @@ static int wpa_parse_generic(const u8 *pos, const u8 *end,
 		return 0;
 	}
 
-	if (pos + 1 + RSN_SELECTOR_LEN < end &&
+	if (1 + RSN_SELECTOR_LEN < end - pos &&
 	    pos[1] >= RSN_SELECTOR_LEN + PMKID_LEN &&
 	    RSN_SELECTOR_GET(pos + 2) == RSN_KEY_DATA_PMKID) {
 		ie->pmkid = pos + 2 + RSN_SELECTOR_LEN;
@@ -491,13 +491,13 @@ int wpa_supplicant_parse_ies(const u8 *buf, size_t len,
 	int ret = 0;
 
 	os_memset(ie, 0, sizeof(*ie));
-	for (pos = buf, end = pos + len; pos + 1 < end; pos += 2 + pos[1]) {
+	for (pos = buf, end = pos + len; end - pos > 1; pos += 2 + pos[1]) {
 		if (pos[0] == 0xdd &&
 		    ((pos == buf + len - 1) || pos[1] == 0)) {
 			/* Ignore padding */
 			break;
 		}
-		if (pos + 2 + pos[1] > end) {
+		if (2 + pos[1] > end - pos) {
 			wpa_printf(MSG_DEBUG, "WPA: EAPOL-Key Key Data "
 				   "underflow (ie=%d len=%d pos=%d)",
 				   pos[0], pos[1], (int) (pos - buf));
diff --git a/src/tls/Makefile b/src/tls/Makefile
index 27cdfcaa97489..52a890a157d2e 100644
--- a/src/tls/Makefile
+++ b/src/tls/Makefile
@@ -24,6 +24,7 @@ LIB_OBJS= \
 	tlsv1_client.o \
 	tlsv1_client_read.o \
 	tlsv1_client_write.o \
+	tlsv1_client_ocsp.o \
 	tlsv1_common.o \
 	tlsv1_cred.o \
 	tlsv1_record.o \
diff --git a/src/tls/asn1.h b/src/tls/asn1.h
index 74750076731de..6bd7df565dba4 100644
--- a/src/tls/asn1.h
+++ b/src/tls/asn1.h
@@ -20,6 +20,7 @@
 #define ASN1_TAG_EXTERNAL	0x08 /* not yet parsed */
 #define ASN1_TAG_REAL		0x09 /* not yet parsed */
 #define ASN1_TAG_ENUMERATED	0x0A /* not yet parsed */
+#define ASN1_TAG_EMBEDDED_PDV	0x0B /* not yet parsed */
 #define ASN1_TAG_UTF8STRING	0x0C /* not yet parsed */
 #define ANS1_TAG_RELATIVE_OID	0x0D
 #define ASN1_TAG_SEQUENCE	0x10 /* shall be constructed */
@@ -35,7 +36,8 @@
 #define ASN1_TAG_VISIBLESTRING	0x1A
 #define ASN1_TAG_GENERALSTRING	0x1B /* not yet parsed */
 #define ASN1_TAG_UNIVERSALSTRING	0x1C /* not yet parsed */
-#define ASN1_TAG_BMPSTRING	0x1D /* not yet parsed */
+#define ASN1_TAG_CHARACTERSTRING	0x1D /* not yet parsed */
+#define ASN1_TAG_BMPSTRING	0x1E /* not yet parsed */
 
 #define ASN1_CLASS_UNIVERSAL		0
 #define ASN1_CLASS_APPLICATION		1
diff --git a/src/tls/pkcs5.c b/src/tls/pkcs5.c
index 8a93483781d80..a2ad83b8a898d 100644
--- a/src/tls/pkcs5.c
+++ b/src/tls/pkcs5.c
@@ -1,6 +1,6 @@
 /*
  * PKCS #5 (Password-based Encryption)
- * Copyright (c) 2009, Jouni Malinen <j@w1.fi>
+ * Copyright (c) 2009-2015, Jouni Malinen <j@w1.fi>
  *
  * This software may be distributed under the terms of the BSD license.
  * See README for more details.
@@ -11,6 +11,7 @@
 #include "common.h"
 #include "crypto/crypto.h"
 #include "crypto/md5.h"
+#include "crypto/sha1.h"
 #include "asn1.h"
 #include "pkcs5.h"
 
@@ -18,30 +19,261 @@
 struct pkcs5_params {
 	enum pkcs5_alg {
 		PKCS5_ALG_UNKNOWN,
-		PKCS5_ALG_MD5_DES_CBC
+		PKCS5_ALG_MD5_DES_CBC,
+		PKCS5_ALG_PBES2,
+		PKCS5_ALG_SHA1_3DES_CBC,
 	} alg;
-	u8 salt[8];
+	u8 salt[64];
 	size_t salt_len;
 	unsigned int iter_count;
+	enum pbes2_enc_alg {
+		PBES2_ENC_ALG_UNKNOWN,
+		PBES2_ENC_ALG_DES_EDE3_CBC,
+	} enc_alg;
+	u8 iv[8];
+	size_t iv_len;
 };
 
 
+static int oid_is_rsadsi(struct asn1_oid *oid)
+{
+	return oid->len >= 4 &&
+		oid->oid[0] == 1 /* iso */ &&
+		oid->oid[1] == 2 /* member-body */ &&
+		oid->oid[2] == 840 /* us */ &&
+		oid->oid[3] == 113549 /* rsadsi */;
+}
+
+
+static int pkcs5_is_oid(struct asn1_oid *oid, unsigned long alg)
+{
+	return oid->len == 7 &&
+		oid_is_rsadsi(oid) &&
+		oid->oid[4] == 1 /* pkcs */ &&
+		oid->oid[5] == 5 /* pkcs-5 */ &&
+		oid->oid[6] == alg;
+}
+
+
+static int enc_alg_is_oid(struct asn1_oid *oid, unsigned long alg)
+{
+	return oid->len == 6 &&
+		oid_is_rsadsi(oid) &&
+		oid->oid[4] == 3 /* encryptionAlgorithm */ &&
+		oid->oid[5] == alg;
+}
+
+
+static int pkcs12_is_pbe_oid(struct asn1_oid *oid, unsigned long alg)
+{
+	return oid->len == 8 &&
+		oid_is_rsadsi(oid) &&
+		oid->oid[4] == 1 /* pkcs */ &&
+		oid->oid[5] == 12 /* pkcs-12 */ &&
+		oid->oid[6] == 1 /* pkcs-12PbeIds */ &&
+		oid->oid[7] == alg;
+}
+
+
 static enum pkcs5_alg pkcs5_get_alg(struct asn1_oid *oid)
 {
-	if (oid->len == 7 &&
-	    oid->oid[0] == 1 /* iso */ &&
-	    oid->oid[1] == 2 /* member-body */ &&
-	    oid->oid[2] == 840 /* us */ &&
-	    oid->oid[3] == 113549 /* rsadsi */ &&
-	    oid->oid[4] == 1 /* pkcs */ &&
-	    oid->oid[5] == 5 /* pkcs-5 */ &&
-	    oid->oid[6] == 3 /* pbeWithMD5AndDES-CBC */)
+	if (pkcs5_is_oid(oid, 3)) /* pbeWithMD5AndDES-CBC (PBES1) */
 		return PKCS5_ALG_MD5_DES_CBC;
-
+	if (pkcs12_is_pbe_oid(oid, 3)) /* pbeWithSHAAnd3-KeyTripleDES-CBC */
+		return PKCS5_ALG_SHA1_3DES_CBC;
+	if (pkcs5_is_oid(oid, 13)) /* id-PBES2 (PBES2) */
+		return PKCS5_ALG_PBES2;
 	return PKCS5_ALG_UNKNOWN;
 }
 
 
+static int pkcs5_get_params_pbes2(struct pkcs5_params *params, const u8 *pos,
+				  const u8 *enc_alg_end)
+{
+	struct asn1_hdr hdr;
+	const u8 *end, *kdf_end;
+	struct asn1_oid oid;
+	char obuf[80];
+
+	/*
+	 * RFC 2898, Ch. A.4
+	 *
+	 * PBES2-params ::= SEQUENCE {
+	 *     keyDerivationFunc AlgorithmIdentifier {{PBES2-KDFs}},
+	 *     encryptionScheme AlgorithmIdentifier {{PBES2-Encs}} }
+	 *
+	 * PBES2-KDFs ALGORITHM-IDENTIFIER ::=
+	 *     { {PBKDF2-params IDENTIFIED BY id-PBKDF2}, ... }
+	 */
+
+	if (asn1_get_next(pos, enc_alg_end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_SEQUENCE) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #5: Expected SEQUENCE (PBES2-params) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+	pos = hdr.payload;
+	end = hdr.payload + hdr.length;
+
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_SEQUENCE) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #5: Expected SEQUENCE (keyDerivationFunc) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+
+	pos = hdr.payload;
+	kdf_end = end = hdr.payload + hdr.length;
+
+	if (asn1_get_oid(pos, end - pos, &oid, &pos)) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #5: Failed to parse OID (keyDerivationFunc algorithm)");
+		return -1;
+	}
+
+	asn1_oid_to_str(&oid, obuf, sizeof(obuf));
+	wpa_printf(MSG_DEBUG, "PKCS #5: PBES2 keyDerivationFunc algorithm %s",
+		   obuf);
+	if (!pkcs5_is_oid(&oid, 12)) /* id-PBKDF2 */ {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #5: Unsupported PBES2 keyDerivationFunc algorithm %s",
+			   obuf);
+		return -1;
+	}
+
+	/*
+	 * RFC 2898, C.
+	 *
+	 * PBKDF2-params ::= SEQUENCE {
+	 *     salt CHOICE {
+	 *       specified OCTET STRING,
+	 *       otherSource AlgorithmIdentifier {{PBKDF2-SaltSources}}
+	 *     },
+	 *     iterationCount INTEGER (1..MAX),
+	 *     keyLength INTEGER (1..MAX) OPTIONAL,
+	 *     prf AlgorithmIdentifier {{PBKDF2-PRFs}} DEFAULT
+	 *     algid-hmacWithSHA1
+	 * }
+	 */
+
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_SEQUENCE) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #5: Expected SEQUENCE (PBKDF2-params) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+
+	pos = hdr.payload;
+	end = hdr.payload + hdr.length;
+
+	/* For now, only support the salt CHOICE specified (OCTET STRING) */
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_OCTETSTRING ||
+	    hdr.length > sizeof(params->salt)) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #5: Expected OCTET STRING (salt.specified) - found class %d tag 0x%x size %d",
+			   hdr.class, hdr.tag, hdr.length);
+		return -1;
+	}
+	pos = hdr.payload + hdr.length;
+	os_memcpy(params->salt, hdr.payload, hdr.length);
+	params->salt_len = hdr.length;
+	wpa_hexdump(MSG_DEBUG, "PKCS #5: salt", params->salt, params->salt_len);
+
+	/* iterationCount INTEGER */
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL || hdr.tag != ASN1_TAG_INTEGER) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #5: Expected INTEGER - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+	if (hdr.length == 1) {
+		params->iter_count = *hdr.payload;
+	} else if (hdr.length == 2) {
+		params->iter_count = WPA_GET_BE16(hdr.payload);
+	} else if (hdr.length == 4) {
+		params->iter_count = WPA_GET_BE32(hdr.payload);
+	} else {
+		wpa_hexdump(MSG_DEBUG,
+			    "PKCS #5: Unsupported INTEGER value (iterationCount)",
+			    hdr.payload, hdr.length);
+		return -1;
+	}
+	wpa_printf(MSG_DEBUG, "PKCS #5: iterationCount=0x%x",
+		   params->iter_count);
+	if (params->iter_count == 0 || params->iter_count > 0xffff) {
+		wpa_printf(MSG_INFO, "PKCS #5: Unsupported iterationCount=0x%x",
+			   params->iter_count);
+		return -1;
+	}
+
+	/* For now, ignore optional keyLength and prf */
+
+	pos = kdf_end;
+
+	/* encryptionScheme AlgorithmIdentifier {{PBES2-Encs}} */
+
+	if (asn1_get_next(pos, enc_alg_end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_SEQUENCE) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #5: Expected SEQUENCE (encryptionScheme) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+
+	pos = hdr.payload;
+	end = hdr.payload + hdr.length;
+
+	if (asn1_get_oid(pos, end - pos, &oid, &pos)) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #5: Failed to parse OID (encryptionScheme algorithm)");
+		return -1;
+	}
+
+	asn1_oid_to_str(&oid, obuf, sizeof(obuf));
+	wpa_printf(MSG_DEBUG, "PKCS #5: PBES2 encryptionScheme algorithm %s",
+		   obuf);
+	if (enc_alg_is_oid(&oid, 7)) {
+		params->enc_alg = PBES2_ENC_ALG_DES_EDE3_CBC;
+	} else {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #5: Unsupported PBES2 encryptionScheme algorithm %s",
+			   obuf);
+		return -1;
+	}
+
+	/*
+	 * RFC 2898, B.2.2:
+	 * The parameters field associated with this OID in an
+	 * AlgorithmIdentifier shall have type OCTET STRING (SIZE(8)),
+	 * specifying the initialization vector for CBC mode.
+	 */
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_OCTETSTRING ||
+	    hdr.length != 8) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #5: Expected OCTET STRING (SIZE(8)) (IV) - found class %d tag 0x%x size %d",
+			   hdr.class, hdr.tag, hdr.length);
+		return -1;
+	}
+	os_memcpy(params->iv, hdr.payload, hdr.length);
+	params->iv_len = hdr.length;
+	wpa_hexdump(MSG_DEBUG, "PKCS #5: IV", params->iv, params->iv_len);
+
+	return 0;
+}
+
+
 static int pkcs5_get_params(const u8 *enc_alg, size_t enc_alg_len,
 			    struct pkcs5_params *params)
 {
@@ -71,11 +303,23 @@ static int pkcs5_get_params(const u8 *enc_alg, size_t enc_alg_len,
 		return -1;
 	}
 
+	if (params->alg == PKCS5_ALG_PBES2)
+		return pkcs5_get_params_pbes2(params, pos, enc_alg_end);
+
+	/* PBES1 */
+
 	/*
 	 * PKCS#5, Section 8
 	 * PBEParameter ::= SEQUENCE {
 	 *   salt OCTET STRING SIZE(8),
 	 *   iterationCount INTEGER }
+	 *
+	 * Note: The same implementation can be used to parse the PKCS #12
+	 * version described in RFC 7292, C:
+	 * pkcs-12PbeParams ::= SEQUENCE {
+	 *     salt        OCTET STRING,
+	 *     iterations  INTEGER
+	 * }
 	 */
 
 	if (asn1_get_next(pos, enc_alg_end - pos, &hdr) < 0 ||
@@ -89,11 +333,11 @@ static int pkcs5_get_params(const u8 *enc_alg, size_t enc_alg_len,
 	pos = hdr.payload;
 	end = hdr.payload + hdr.length;
 
-	/* salt OCTET STRING SIZE(8) */
+	/* salt OCTET STRING SIZE(8) (PKCS #5) or OCTET STRING (PKCS #12) */
 	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
 	    hdr.class != ASN1_CLASS_UNIVERSAL ||
 	    hdr.tag != ASN1_TAG_OCTETSTRING ||
-	    hdr.length != 8) {
+	    hdr.length > sizeof(params->salt)) {
 		wpa_printf(MSG_DEBUG, "PKCS #5: Expected OCTETSTRING SIZE(8) "
 			   "(salt) - found class %d tag 0x%x size %d",
 			   hdr.class, hdr.tag, hdr.length);
@@ -136,6 +380,174 @@ static int pkcs5_get_params(const u8 *enc_alg, size_t enc_alg_len,
 }
 
 
+static struct crypto_cipher *
+pkcs5_crypto_init_pbes2(struct pkcs5_params *params, const char *passwd)
+{
+	u8 key[24];
+
+	if (params->enc_alg != PBES2_ENC_ALG_DES_EDE3_CBC ||
+	    params->iv_len != 8)
+		return NULL;
+
+	wpa_hexdump_ascii_key(MSG_DEBUG, "PKCS #5: PBES2 password for PBKDF2",
+			      passwd, os_strlen(passwd));
+	wpa_hexdump(MSG_DEBUG, "PKCS #5: PBES2 salt for PBKDF2",
+		    params->salt, params->salt_len);
+	wpa_printf(MSG_DEBUG, "PKCS #5: PBES2 PBKDF2 iterations: %u",
+		   params->iter_count);
+	if (pbkdf2_sha1(passwd, params->salt, params->salt_len,
+			params->iter_count, key, sizeof(key)) < 0)
+		return NULL;
+	wpa_hexdump_key(MSG_DEBUG, "PKCS #5: DES EDE3 key", key, sizeof(key));
+	wpa_hexdump(MSG_DEBUG, "PKCS #5: DES IV", params->iv, params->iv_len);
+
+	return crypto_cipher_init(CRYPTO_CIPHER_ALG_3DES, params->iv,
+				  key, sizeof(key));
+}
+
+
+static void add_byte_array_mod(u8 *a, const u8 *b, size_t len)
+{
+	size_t i;
+	unsigned int carry = 0;
+
+	for (i = len - 1; i < len; i--) {
+		carry = carry + a[i] + b[i];
+		a[i] = carry & 0xff;
+		carry >>= 8;
+	}
+}
+
+
+static int pkcs12_key_gen(const u8 *pw, size_t pw_len, const u8 *salt,
+			  size_t salt_len, u8 id, unsigned int iter,
+			  size_t out_len, u8 *out)
+{
+	unsigned int u, v, S_len, P_len, i;
+	u8 *D = NULL, *I = NULL, *B = NULL, *pos;
+	int res = -1;
+
+	/* RFC 7292, B.2 */
+	u = SHA1_MAC_LEN;
+	v = 64;
+
+	/* D = copies of ID */
+	D = os_malloc(v);
+	if (!D)
+		goto done;
+	os_memset(D, id, v);
+
+	/* S = copies of salt; P = copies of password, I = S || P */
+	S_len = v * ((salt_len + v - 1) / v);
+	P_len = v * ((pw_len + v - 1) / v);
+	I = os_malloc(S_len + P_len);
+	if (!I)
+		goto done;
+	pos = I;
+	if (salt_len) {
+		for (i = 0; i < S_len; i++)
+			*pos++ = salt[i % salt_len];
+	}
+	if (pw_len) {
+		for (i = 0; i < P_len; i++)
+			*pos++ = pw[i % pw_len];
+	}
+
+	B = os_malloc(v);
+	if (!B)
+		goto done;
+
+	for (;;) {
+		u8 hash[SHA1_MAC_LEN];
+		const u8 *addr[2];
+		size_t len[2];
+
+		addr[0] = D;
+		len[0] = v;
+		addr[1] = I;
+		len[1] = S_len + P_len;
+		if (sha1_vector(2, addr, len, hash) < 0)
+			goto done;
+
+		addr[0] = hash;
+		len[0] = SHA1_MAC_LEN;
+		for (i = 1; i < iter; i++) {
+			if (sha1_vector(1, addr, len, hash) < 0)
+				goto done;
+		}
+
+		if (out_len <= u) {
+			os_memcpy(out, hash, out_len);
+			res = 0;
+			goto done;
+		}
+
+		os_memcpy(out, hash, u);
+		out += u;
+		out_len -= u;
+
+		/* I_j = (I_j + B + 1) mod 2^(v*8) */
+		/* B = copies of Ai (final hash value) */
+		for (i = 0; i < v; i++)
+			B[i] = hash[i % u];
+		inc_byte_array(B, v);
+		for (i = 0; i < S_len + P_len; i += v)
+			add_byte_array_mod(&I[i], B, v);
+	}
+
+done:
+	os_free(B);
+	os_free(I);
+	os_free(D);
+	return res;
+}
+
+
+#define PKCS12_ID_ENC 1
+#define PKCS12_ID_IV 2
+#define PKCS12_ID_MAC 3
+
+static struct crypto_cipher *
+pkcs12_crypto_init_sha1(struct pkcs5_params *params, const char *passwd)
+{
+	unsigned int i;
+	u8 *pw;
+	size_t pw_len;
+	u8 key[24];
+	u8 iv[8];
+
+	if (params->alg != PKCS5_ALG_SHA1_3DES_CBC)
+		return NULL;
+
+	pw_len = passwd ? os_strlen(passwd) : 0;
+	pw = os_malloc(2 * (pw_len + 1));
+	if (!pw)
+		return NULL;
+	if (pw_len) {
+		for (i = 0; i <= pw_len; i++)
+			WPA_PUT_BE16(&pw[2 * i], passwd[i]);
+		pw_len = 2 * (pw_len + 1);
+	}
+
+	if (pkcs12_key_gen(pw, pw_len, params->salt, params->salt_len,
+			   PKCS12_ID_ENC, params->iter_count,
+			   sizeof(key), key) < 0 ||
+	    pkcs12_key_gen(pw, pw_len, params->salt, params->salt_len,
+			   PKCS12_ID_IV, params->iter_count,
+			   sizeof(iv), iv) < 0) {
+		os_free(pw);
+		return NULL;
+	}
+
+	os_free(pw);
+
+	wpa_hexdump_key(MSG_DEBUG, "PKCS #12: DES key", key, sizeof(key));
+	wpa_hexdump_key(MSG_DEBUG, "PKCS #12: DES IV", iv, sizeof(iv));
+
+	return crypto_cipher_init(CRYPTO_CIPHER_ALG_3DES, iv, key, sizeof(key));
+}
+
+
 static struct crypto_cipher * pkcs5_crypto_init(struct pkcs5_params *params,
 						const char *passwd)
 {
@@ -144,6 +556,12 @@ static struct crypto_cipher * pkcs5_crypto_init(struct pkcs5_params *params,
 	const u8 *addr[2];
 	size_t len[2];
 
+	if (params->alg == PKCS5_ALG_PBES2)
+		return pkcs5_crypto_init_pbes2(params, passwd);
+
+	if (params->alg == PKCS5_ALG_SHA1_3DES_CBC)
+		return pkcs12_crypto_init_sha1(params, passwd);
+
 	if (params->alg != PKCS5_ALG_MD5_DES_CBC)
 		return NULL;
 
diff --git a/src/tls/tlsv1_client.c b/src/tls/tlsv1_client.c
index a6f0587e34c57..9bc0d211f48dd 100644
--- a/src/tls/tlsv1_client.c
+++ b/src/tls/tlsv1_client.c
@@ -1,6 +1,6 @@
 /*
  * TLS v1.0/v1.1/v1.2 client (RFC 2246, RFC 4346, RFC 5246)
- * Copyright (c) 2006-2014, Jouni Malinen <j@w1.fi>
+ * Copyright (c) 2006-2015, Jouni Malinen <j@w1.fi>
  *
  * This software may be distributed under the terms of the BSD license.
  * See README for more details.
@@ -11,6 +11,7 @@
 #include "common.h"
 #include "crypto/sha1.h"
 #include "crypto/tls.h"
+#include "x509v3.h"
 #include "tlsv1_common.h"
 #include "tlsv1_record.h"
 #include "tlsv1_client.h"
@@ -110,7 +111,6 @@ int tls_derive_keys(struct tlsv1_client *conn,
 		pos += conn->rl.iv_size;
 		/* server_write_IV */
 		os_memcpy(conn->rl.read_iv, pos, conn->rl.iv_size);
-		pos += conn->rl.iv_size;
 	} else {
 		/*
 		 * Use IV field to set the mask value for TLS v1.1. A fixed
@@ -494,6 +494,7 @@ void tlsv1_client_deinit(struct tlsv1_client *conn)
 	tlsv1_client_free_dh(conn);
 	tlsv1_cred_free(conn->cred);
 	wpabuf_free(conn->partial_input);
+	x509_certificate_chain_free(conn->server_cert);
 	os_free(conn);
 }
 
@@ -691,18 +692,16 @@ int tlsv1_client_hello_ext(struct tlsv1_client *conn, int ext_type,
 	if (data == NULL || data_len == 0)
 		return 0;
 
-	pos = conn->client_hello_ext = os_malloc(6 + data_len);
+	pos = conn->client_hello_ext = os_malloc(4 + data_len);
 	if (pos == NULL)
 		return -1;
 
-	WPA_PUT_BE16(pos, 4 + data_len);
-	pos += 2;
 	WPA_PUT_BE16(pos, ext_type);
 	pos += 2;
 	WPA_PUT_BE16(pos, data_len);
 	pos += 2;
 	os_memcpy(pos, data, data_len);
-	conn->client_hello_ext_len = 6 + data_len;
+	conn->client_hello_ext_len = 4 + data_len;
 
 	if (ext_type == TLS_EXT_PAC_OPAQUE) {
 		conn->session_ticket_included = 1;
@@ -813,9 +812,14 @@ int tlsv1_client_set_cred(struct tlsv1_client *conn,
 }
 
 
-void tlsv1_client_set_time_checks(struct tlsv1_client *conn, int enabled)
+/**
+ * tlsv1_client_set_flags - Set connection flags
+ * @conn: TLSv1 client connection data from tlsv1_client_init()
+ * @flags: TLS_CONN_* bitfield
+ */
+void tlsv1_client_set_flags(struct tlsv1_client *conn, unsigned int flags)
 {
-	conn->disable_time_checks = !enabled;
+	conn->flags = flags;
 }
 
 
@@ -828,3 +832,38 @@ void tlsv1_client_set_session_ticket_cb(struct tlsv1_client *conn,
 	conn->session_ticket_cb = cb;
 	conn->session_ticket_cb_ctx = ctx;
 }
+
+
+void tlsv1_client_set_cb(struct tlsv1_client *conn,
+			 void (*event_cb)(void *ctx, enum tls_event ev,
+					  union tls_event_data *data),
+			 void *cb_ctx,
+			 int cert_in_cb)
+{
+	conn->event_cb = event_cb;
+	conn->cb_ctx = cb_ctx;
+	conn->cert_in_cb = !!cert_in_cb;
+}
+
+
+int tlsv1_client_get_version(struct tlsv1_client *conn, char *buf,
+			     size_t buflen)
+{
+	if (!conn)
+		return -1;
+	switch (conn->rl.tls_version) {
+	case TLS_VERSION_1:
+		os_strlcpy(buf, "TLSv1", buflen);
+		break;
+	case TLS_VERSION_1_1:
+		os_strlcpy(buf, "TLSv1.1", buflen);
+		break;
+	case TLS_VERSION_1_2:
+		os_strlcpy(buf, "TLSv1.2", buflen);
+		break;
+	default:
+		return -1;
+	}
+
+	return 0;
+}
diff --git a/src/tls/tlsv1_client.h b/src/tls/tlsv1_client.h
index a4e25e969937c..40fa6c7fbdeeb 100644
--- a/src/tls/tlsv1_client.h
+++ b/src/tls/tlsv1_client.h
@@ -41,7 +41,7 @@ int tlsv1_client_get_keyblock_size(struct tlsv1_client *conn);
 int tlsv1_client_set_cipher_list(struct tlsv1_client *conn, u8 *ciphers);
 int tlsv1_client_set_cred(struct tlsv1_client *conn,
 			  struct tlsv1_credentials *cred);
-void tlsv1_client_set_time_checks(struct tlsv1_client *conn, int enabled);
+void tlsv1_client_set_flags(struct tlsv1_client *conn, unsigned int flags);
 
 typedef int (*tlsv1_client_session_ticket_cb)
 (void *ctx, const u8 *ticket, size_t len, const u8 *client_random,
@@ -51,4 +51,12 @@ void tlsv1_client_set_session_ticket_cb(struct tlsv1_client *conn,
 					tlsv1_client_session_ticket_cb cb,
 					void *ctx);
 
+void tlsv1_client_set_cb(struct tlsv1_client *conn,
+			 void (*event_cb)(void *ctx, enum tls_event ev,
+					  union tls_event_data *data),
+			 void *cb_ctx,
+			 int cert_in_cb);
+int tlsv1_client_get_version(struct tlsv1_client *conn, char *buf,
+			     size_t buflen);
+
 #endif /* TLSV1_CLIENT_H */
diff --git a/src/tls/tlsv1_client_i.h b/src/tls/tlsv1_client_i.h
index 55fdcf8d0435c..12ec8df6c3ac1 100644
--- a/src/tls/tlsv1_client_i.h
+++ b/src/tls/tlsv1_client_i.h
@@ -29,11 +29,14 @@ struct tlsv1_client {
 	u8 alert_level;
 	u8 alert_description;
 
+	unsigned int flags; /* TLS_CONN_* bitfield */
+
 	unsigned int certificate_requested:1;
 	unsigned int session_resumed:1;
 	unsigned int session_ticket_included:1;
 	unsigned int use_session_ticket:1;
-	unsigned int disable_time_checks:1;
+	unsigned int cert_in_cb:1;
+	unsigned int ocsp_resp_received:1;
 
 	struct crypto_public_key *server_rsa_key;
 
@@ -64,6 +67,12 @@ struct tlsv1_client {
 	void *session_ticket_cb_ctx;
 
 	struct wpabuf *partial_input;
+
+	void (*event_cb)(void *ctx, enum tls_event ev,
+			 union tls_event_data *data);
+	void *cb_ctx;
+
+	struct x509_certificate *server_cert;
 };
 
 
@@ -81,4 +90,11 @@ int tlsv1_client_process_handshake(struct tlsv1_client *conn, u8 ct,
 				   const u8 *buf, size_t *len,
 				   u8 **out_data, size_t *out_len);
 
+enum tls_ocsp_result {
+	TLS_OCSP_NO_RESPONSE, TLS_OCSP_INVALID, TLS_OCSP_GOOD, TLS_OCSP_REVOKED
+};
+
+enum tls_ocsp_result tls_process_ocsp_response(struct tlsv1_client *conn,
+					       const u8 *resp, size_t len);
+
 #endif /* TLSV1_CLIENT_I_H */
diff --git a/src/tls/tlsv1_client_ocsp.c b/src/tls/tlsv1_client_ocsp.c
new file mode 100644
index 0000000000000..1d7b68ca286ed
--- /dev/null
+++ b/src/tls/tlsv1_client_ocsp.c
@@ -0,0 +1,803 @@
+/*
+ * TLSv1 client - OCSP
+ * Copyright (c) 2015, Jouni Malinen <j@w1.fi>
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ */
+
+#include "includes.h"
+
+#include "common.h"
+#include "crypto/tls.h"
+#include "crypto/sha1.h"
+#include "asn1.h"
+#include "x509v3.h"
+#include "tlsv1_common.h"
+#include "tlsv1_record.h"
+#include "tlsv1_client.h"
+#include "tlsv1_client_i.h"
+
+
+/* RFC 6960, 4.2.1: OCSPResponseStatus ::= ENUMERATED */
+enum ocsp_response_status {
+	OCSP_RESP_STATUS_SUCCESSFUL = 0,
+	OCSP_RESP_STATUS_MALFORMED_REQ = 1,
+	OCSP_RESP_STATUS_INT_ERROR = 2,
+	OCSP_RESP_STATUS_TRY_LATER = 3,
+	/* 4 not used */
+	OCSP_RESP_STATUS_SIG_REQUIRED = 5,
+	OCSP_RESP_STATUS_UNAUTHORIZED = 6,
+};
+
+
+static int is_oid_basic_ocsp_resp(struct asn1_oid *oid)
+{
+	return oid->len == 10 &&
+		oid->oid[0] == 1 /* iso */ &&
+		oid->oid[1] == 3 /* identified-organization */ &&
+		oid->oid[2] == 6 /* dod */ &&
+		oid->oid[3] == 1 /* internet */ &&
+		oid->oid[4] == 5 /* security */ &&
+		oid->oid[5] == 5 /* mechanisms */ &&
+		oid->oid[6] == 7 /* id-pkix */ &&
+		oid->oid[7] == 48 /* id-ad */ &&
+		oid->oid[8] == 1 /* id-pkix-ocsp */ &&
+		oid->oid[9] == 1 /* id-pkix-ocsp-basic */;
+}
+
+
+static int ocsp_responder_id_match(struct x509_certificate *signer,
+				   struct x509_name *name, const u8 *key_hash)
+{
+	if (key_hash) {
+		u8 hash[SHA1_MAC_LEN];
+		const u8 *addr[1] = { signer->public_key };
+		size_t len[1] = { signer->public_key_len };
+
+		if (sha1_vector(1, addr, len, hash) < 0)
+			return 0;
+		return os_memcmp(hash, key_hash, SHA1_MAC_LEN) == 0;
+	}
+
+	return x509_name_compare(&signer->subject, name) == 0;
+}
+
+
+static unsigned int ocsp_hash_data(struct asn1_oid *alg, const u8 *data,
+				   size_t data_len, u8 *hash)
+{
+	const u8 *addr[1] = { data };
+	size_t len[1] = { data_len };
+	char buf[100];
+
+	if (x509_sha1_oid(alg)) {
+		if (sha1_vector(1, addr, len, hash) < 0)
+			return 0;
+		wpa_hexdump(MSG_MSGDUMP, "OCSP: Hash (SHA1)", hash, 20);
+		return 20;
+	}
+
+	if (x509_sha256_oid(alg)) {
+		if (sha256_vector(1, addr, len, hash) < 0)
+			return 0;
+		wpa_hexdump(MSG_MSGDUMP, "OCSP: Hash (SHA256)", hash, 32);
+		return 32;
+	}
+
+	if (x509_sha384_oid(alg)) {
+		if (sha384_vector(1, addr, len, hash) < 0)
+			return 0;
+		wpa_hexdump(MSG_MSGDUMP, "OCSP: Hash (SHA384)", hash, 48);
+		return 48;
+	}
+
+	if (x509_sha512_oid(alg)) {
+		if (sha512_vector(1, addr, len, hash) < 0)
+			return 0;
+		wpa_hexdump(MSG_MSGDUMP, "OCSP: Hash (SHA512)", hash, 64);
+		return 64;
+	}
+
+
+	asn1_oid_to_str(alg, buf, sizeof(buf));
+	wpa_printf(MSG_DEBUG, "OCSP: Could not calculate hash with alg %s",
+		   buf);
+	return 0;
+}
+
+
+static int tls_process_ocsp_single_response(struct tlsv1_client *conn,
+					    struct x509_certificate *cert,
+					    struct x509_certificate *issuer,
+					    const u8 *resp, size_t len,
+					    enum tls_ocsp_result *res)
+{
+	struct asn1_hdr hdr;
+	const u8 *pos, *end;
+	struct x509_algorithm_identifier alg;
+	const u8 *name_hash, *key_hash;
+	size_t name_hash_len, key_hash_len;
+	const u8 *serial_number;
+	size_t serial_number_len;
+	u8 hash[64];
+	unsigned int hash_len;
+	unsigned int cert_status;
+	os_time_t update;
+	struct os_time now;
+
+	wpa_hexdump(MSG_MSGDUMP, "OCSP: SingleResponse", resp, len);
+
+	/*
+	 * SingleResponse ::= SEQUENCE {
+	 *    certID                       CertID,
+	 *    certStatus                   CertStatus,
+	 *    thisUpdate                   GeneralizedTime,
+	 *    nextUpdate         [0]       EXPLICIT GeneralizedTime OPTIONAL,
+	 *    singleExtensions   [1]       EXPLICIT Extensions OPTIONAL }
+	 */
+
+	/* CertID ::= SEQUENCE */
+	if (asn1_get_next(resp, len, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_SEQUENCE) {
+		wpa_printf(MSG_DEBUG,
+			   "OCSP: Expected SEQUENCE (CertID) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+	pos = hdr.payload;
+	end = hdr.payload + hdr.length;
+
+	/*
+	 * CertID ::= SEQUENCE {
+	 *    hashAlgorithm           AlgorithmIdentifier,
+	 *    issuerNameHash          OCTET STRING,
+	 *    issuerKeyHash           OCTET STRING,
+	 *    serialNumber            CertificateSerialNumber }
+	 */
+
+	/* hashAlgorithm  AlgorithmIdentifier */
+	if (x509_parse_algorithm_identifier(pos, end - pos, &alg, &pos))
+		return -1;
+
+	/* issuerNameHash  OCTET STRING */
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_OCTETSTRING) {
+		wpa_printf(MSG_DEBUG,
+			   "OCSP: Expected OCTET STRING (issuerNameHash) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+	name_hash = hdr.payload;
+	name_hash_len = hdr.length;
+	wpa_hexdump(MSG_DEBUG, "OCSP: issuerNameHash",
+		    name_hash, name_hash_len);
+	pos = hdr.payload + hdr.length;
+
+	wpa_hexdump(MSG_DEBUG, "OCSP: Issuer subject DN",
+		    issuer->subject_dn, issuer->subject_dn_len);
+	hash_len = ocsp_hash_data(&alg.oid, issuer->subject_dn,
+				  issuer->subject_dn_len, hash);
+	if (hash_len == 0 || name_hash_len != hash_len ||
+	    os_memcmp(name_hash, hash, hash_len) != 0) {
+		wpa_printf(MSG_DEBUG, "OCSP: issuerNameHash mismatch");
+		wpa_hexdump(MSG_DEBUG, "OCSP: Calculated issuerNameHash",
+			    hash, hash_len);
+		return -1;
+	}
+
+	/* issuerKeyHash  OCTET STRING */
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_OCTETSTRING) {
+		wpa_printf(MSG_DEBUG,
+			   "OCSP: Expected OCTET STRING (issuerKeyHash) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+	key_hash = hdr.payload;
+	key_hash_len = hdr.length;
+	wpa_hexdump(MSG_DEBUG, "OCSP: issuerKeyHash", key_hash, key_hash_len);
+	pos = hdr.payload + hdr.length;
+
+	hash_len = ocsp_hash_data(&alg.oid, issuer->public_key,
+				  issuer->public_key_len, hash);
+	if (hash_len == 0 || key_hash_len != hash_len ||
+	    os_memcmp(key_hash, hash, hash_len) != 0) {
+		wpa_printf(MSG_DEBUG, "OCSP: issuerKeyHash mismatch");
+		wpa_hexdump(MSG_DEBUG, "OCSP: Calculated issuerKeyHash",
+			    hash, hash_len);
+		return -1;
+	}
+
+	/* serialNumber CertificateSerialNumber ::= INTEGER */
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_INTEGER ||
+	    hdr.length < 1 || hdr.length > X509_MAX_SERIAL_NUM_LEN) {
+		wpa_printf(MSG_DEBUG, "OCSP: No INTEGER tag found for serialNumber; class=%d tag=0x%x length=%u",
+			   hdr.class, hdr.tag, hdr.length);
+		return -1;
+	}
+	serial_number = hdr.payload;
+	serial_number_len = hdr.length;
+	while (serial_number_len > 0 && serial_number[0] == 0) {
+		serial_number++;
+		serial_number_len--;
+	}
+	wpa_hexdump(MSG_MSGDUMP, "OCSP: serialNumber", serial_number,
+		    serial_number_len);
+
+	if (serial_number_len != cert->serial_number_len ||
+	    os_memcmp(serial_number, cert->serial_number,
+		      serial_number_len) != 0) {
+		wpa_printf(MSG_DEBUG, "OCSP: serialNumber mismatch");
+		return -1;
+	}
+
+	pos = end;
+	end = resp + len;
+
+	/* certStatus CertStatus ::= CHOICE */
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_CONTEXT_SPECIFIC) {
+		wpa_printf(MSG_DEBUG,
+			   "OCSP: Expected CHOICE (CertStatus) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+	cert_status = hdr.tag;
+	wpa_printf(MSG_DEBUG, "OCSP: certStatus=%u", cert_status);
+	wpa_hexdump(MSG_DEBUG, "OCSP: CertStatus additional data",
+		    hdr.payload, hdr.length);
+	pos = hdr.payload + hdr.length;
+
+	os_get_time(&now);
+	/* thisUpdate  GeneralizedTime */
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_GENERALIZEDTIME ||
+	    x509_parse_time(hdr.payload, hdr.length, hdr.tag, &update) < 0) {
+		wpa_printf(MSG_DEBUG, "OCSP: Failed to parse thisUpdate");
+		return -1;
+	}
+	wpa_printf(MSG_DEBUG, "OCSP: thisUpdate %lu", (unsigned long) update);
+	pos = hdr.payload + hdr.length;
+	if ((unsigned long) now.sec < (unsigned long) update) {
+		wpa_printf(MSG_DEBUG,
+			   "OCSP: thisUpdate time in the future (response not yet valid)");
+		return -1;
+	}
+
+	/* nextUpdate  [0]  EXPLICIT GeneralizedTime OPTIONAL */
+	if (pos < end) {
+		if (asn1_get_next(pos, end - pos, &hdr) < 0)
+			return -1;
+		if (hdr.class == ASN1_CLASS_CONTEXT_SPECIFIC && hdr.tag == 0) {
+			const u8 *next = hdr.payload + hdr.length;
+
+			if (asn1_get_next(hdr.payload, hdr.length, &hdr) < 0 ||
+			    hdr.class != ASN1_CLASS_UNIVERSAL ||
+			    hdr.tag != ASN1_TAG_GENERALIZEDTIME ||
+			    x509_parse_time(hdr.payload, hdr.length, hdr.tag,
+					    &update) < 0) {
+				wpa_printf(MSG_DEBUG,
+					   "OCSP: Failed to parse nextUpdate");
+				return -1;
+			}
+			wpa_printf(MSG_DEBUG, "OCSP: nextUpdate %lu",
+				   (unsigned long) update);
+			pos = next;
+			if ((unsigned long) now.sec > (unsigned long) update) {
+				wpa_printf(MSG_DEBUG, "OCSP: nextUpdate time in the past (response has expired)");
+				return -1;
+			}
+		}
+	}
+
+	/* singleExtensions  [1]  EXPLICIT Extensions OPTIONAL */
+	if (pos < end) {
+		wpa_hexdump(MSG_MSGDUMP, "OCSP: singleExtensions",
+			    pos, end - pos);
+		/* Ignore for now */
+	}
+
+	if (cert_status == 0 /* good */)
+		*res = TLS_OCSP_GOOD;
+	else if (cert_status == 1 /* revoked */)
+		*res = TLS_OCSP_REVOKED;
+	else
+		return -1;
+	return 0;
+}
+
+
+static enum tls_ocsp_result
+tls_process_ocsp_responses(struct tlsv1_client *conn,
+			   struct x509_certificate *cert,
+			   struct x509_certificate *issuer, const u8 *resp,
+			   size_t len)
+{
+	struct asn1_hdr hdr;
+	const u8 *pos, *end;
+	enum tls_ocsp_result res;
+
+	pos = resp;
+	end = resp + len;
+	while (pos < end) {
+		/* SingleResponse ::= SEQUENCE */
+		if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+		    hdr.class != ASN1_CLASS_UNIVERSAL ||
+		    hdr.tag != ASN1_TAG_SEQUENCE) {
+			wpa_printf(MSG_DEBUG,
+				   "OCSP: Expected SEQUENCE (SingleResponse) - found class %d tag 0x%x",
+				   hdr.class, hdr.tag);
+			return TLS_OCSP_INVALID;
+		}
+		if (tls_process_ocsp_single_response(conn, cert, issuer,
+						     hdr.payload, hdr.length,
+						     &res) == 0)
+			return res;
+		pos = hdr.payload + hdr.length;
+	}
+
+	wpa_printf(MSG_DEBUG,
+		   "OCSP: Did not find a response matching the server certificate");
+	return TLS_OCSP_NO_RESPONSE;
+}
+
+
+static enum tls_ocsp_result
+tls_process_basic_ocsp_response(struct tlsv1_client *conn,
+				struct x509_certificate *srv_cert,
+				const u8 *resp, size_t len)
+{
+	struct asn1_hdr hdr;
+	const u8 *pos, *end;
+	const u8 *resp_data, *sign_value, *key_hash = NULL, *responses;
+	const u8 *resp_data_signed;
+	size_t resp_data_len, sign_value_len, responses_len;
+	size_t resp_data_signed_len;
+	struct x509_algorithm_identifier alg;
+	struct x509_certificate *certs = NULL, *last_cert = NULL;
+	struct x509_certificate *issuer, *signer;
+	struct x509_name name; /* used if key_hash == NULL */
+	char buf[100];
+	os_time_t produced_at;
+	enum tls_ocsp_result res;
+
+	wpa_hexdump(MSG_MSGDUMP, "OCSP: BasicOCSPResponse", resp, len);
+
+	os_memset(&name, 0, sizeof(name));
+
+	/*
+	 * RFC 6960, 4.2.1:
+	 * BasicOCSPResponse       ::= SEQUENCE {
+	 *    tbsResponseData      ResponseData,
+	 *    signatureAlgorithm   AlgorithmIdentifier,
+	 *    signature            BIT STRING,
+	 *    certs            [0] EXPLICIT SEQUENCE OF Certificate OPTIONAL }
+	 */
+
+	if (asn1_get_next(resp, len, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_SEQUENCE) {
+		wpa_printf(MSG_DEBUG,
+			   "OCSP: Expected SEQUENCE (BasicOCSPResponse) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return TLS_OCSP_INVALID;
+	}
+	pos = hdr.payload;
+	end = hdr.payload + hdr.length;
+
+	/* ResponseData ::= SEQUENCE */
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_SEQUENCE) {
+		wpa_printf(MSG_DEBUG,
+			   "OCSP: Expected SEQUENCE (ResponseData) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return TLS_OCSP_INVALID;
+	}
+	resp_data = hdr.payload;
+	resp_data_len = hdr.length;
+	resp_data_signed = pos;
+	pos = hdr.payload + hdr.length;
+	resp_data_signed_len = pos - resp_data_signed;
+
+	/* signatureAlgorithm  AlgorithmIdentifier */
+	if (x509_parse_algorithm_identifier(pos, end - pos, &alg, &pos))
+		return TLS_OCSP_INVALID;
+
+	/* signature  BIT STRING */
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_BITSTRING) {
+		wpa_printf(MSG_DEBUG,
+			   "OCSP: Expected BITSTRING (signature) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return TLS_OCSP_INVALID;
+	}
+	if (hdr.length < 1)
+		return TLS_OCSP_INVALID;
+	pos = hdr.payload;
+	if (*pos) {
+		wpa_printf(MSG_DEBUG, "OCSP: BITSTRING - %d unused bits", *pos);
+		/* PKCS #1 v1.5 10.2.1:
+		 * It is an error if the length in bits of the signature S is
+		 * not a multiple of eight.
+		 */
+		return TLS_OCSP_INVALID;
+	}
+	sign_value = pos + 1;
+	sign_value_len = hdr.length - 1;
+	pos += hdr.length;
+	wpa_hexdump(MSG_MSGDUMP, "OCSP: signature", sign_value, sign_value_len);
+
+	/* certs  [0] EXPLICIT SEQUENCE OF Certificate OPTIONAL */
+	if (pos < end) {
+		if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+		    hdr.class != ASN1_CLASS_CONTEXT_SPECIFIC ||
+		    hdr.tag != 0) {
+			wpa_printf(MSG_DEBUG,
+				   "OCSP: Expected [0] EXPLICIT (certs) - found class %d tag 0x%x",
+				   hdr.class, hdr.tag);
+			return TLS_OCSP_INVALID;
+		}
+		wpa_hexdump(MSG_MSGDUMP, "OCSP: certs",
+			    hdr.payload, hdr.length);
+		pos = hdr.payload;
+		end = hdr.payload + hdr.length;
+		while (pos < end) {
+			struct x509_certificate *cert;
+
+			if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+			    hdr.class != ASN1_CLASS_UNIVERSAL ||
+			    hdr.tag != ASN1_TAG_SEQUENCE) {
+				wpa_printf(MSG_DEBUG,
+					   "OCSP: Expected SEQUENCE (Certificate) - found class %d tag 0x%x",
+					   hdr.class, hdr.tag);
+				goto fail;
+			}
+
+			cert = x509_certificate_parse(hdr.payload, hdr.length);
+			if (!cert)
+				goto fail;
+			if (last_cert) {
+				last_cert->next = cert;
+				last_cert = cert;
+			} else {
+				last_cert = certs = cert;
+			}
+			pos = hdr.payload + hdr.length;
+		}
+	}
+
+	/*
+	 * ResponseData ::= SEQUENCE {
+	 *    version              [0] EXPLICIT Version DEFAULT v1,
+	 *    responderID              ResponderID,
+	 *    producedAt               GeneralizedTime,
+	 *    responses                SEQUENCE OF SingleResponse,
+	 *    responseExtensions   [1] EXPLICIT Extensions OPTIONAL }
+	 */
+	pos = resp_data;
+	end = resp_data + resp_data_len;
+	wpa_hexdump(MSG_MSGDUMP, "OCSP: ResponseData", pos, end - pos);
+
+	/*
+	 * version [0] EXPLICIT Version DEFAULT v1
+	 * Version ::= INTEGER { v1(0) }
+	 */
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 &&
+	    hdr.class == ASN1_CLASS_CONTEXT_SPECIFIC &&
+	    hdr.tag == 0) {
+		if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+		    hdr.class != ASN1_CLASS_UNIVERSAL ||
+		    hdr.tag != ASN1_TAG_INTEGER ||
+		    hdr.length != 1) {
+			wpa_printf(MSG_DEBUG,
+				   "OCSP: No INTEGER (len=1) tag found for version field - found class %d tag 0x%x length %d",
+				   hdr.class, hdr.tag, hdr.length);
+			goto fail;
+		}
+		wpa_printf(MSG_DEBUG, "OCSP: ResponseData version %u",
+			   hdr.payload[0]);
+		if (hdr.payload[0] != 0) {
+			wpa_printf(MSG_DEBUG,
+				   "OCSP: Unsupported ResponseData version %u",
+				   hdr.payload[0]);
+			goto no_resp;
+		}
+		pos = hdr.payload + hdr.length;
+	} else {
+		wpa_printf(MSG_DEBUG,
+			   "OCSP: Default ResponseData version (v1)");
+	}
+
+	/*
+	 * ResponderID ::= CHOICE {
+	 *    byName              [1] Name,
+	 *    byKey               [2] KeyHash }
+	 */
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_CONTEXT_SPECIFIC) {
+		wpa_printf(MSG_DEBUG,
+			   "OCSP: Expected CHOICE (ResponderID) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		goto fail;
+	}
+
+	if (hdr.tag == 1) {
+		/* Name */
+		if (x509_parse_name(hdr.payload, hdr.length, &name, &pos) < 0)
+			goto fail;
+		x509_name_string(&name, buf, sizeof(buf));
+		wpa_printf(MSG_DEBUG, "OCSP: ResponderID byName Name: %s", buf);
+	} else if (hdr.tag == 2) {
+		/* KeyHash ::= OCTET STRING */
+		if (asn1_get_next(hdr.payload, hdr.length, &hdr) < 0 ||
+		    hdr.class != ASN1_CLASS_UNIVERSAL ||
+		    hdr.tag != ASN1_TAG_OCTETSTRING) {
+			wpa_printf(MSG_DEBUG,
+				   "OCSP: Expected OCTET STRING (KeyHash) - found class %d tag 0x%x",
+				   hdr.class, hdr.tag);
+			goto fail;
+		}
+		key_hash = hdr.payload;
+		wpa_hexdump(MSG_DEBUG, "OCSP: ResponderID byKey KeyHash",
+			    key_hash, hdr.length);
+		if (hdr.length != SHA1_MAC_LEN) {
+			wpa_printf(MSG_DEBUG,
+				   "OCSP: Unexpected byKey KeyHash length %u - expected %u for SHA-1",
+				   hdr.length, SHA1_MAC_LEN);
+			goto fail;
+		}
+		pos = hdr.payload + hdr.length;
+	} else {
+		wpa_printf(MSG_DEBUG, "OCSP: Unexpected ResponderID CHOICE %u",
+			   hdr.tag);
+		goto fail;
+	}
+
+	/* producedAt  GeneralizedTime */
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_GENERALIZEDTIME ||
+	    x509_parse_time(hdr.payload, hdr.length, hdr.tag,
+			    &produced_at) < 0) {
+		wpa_printf(MSG_DEBUG, "OCSP: Failed to parse producedAt");
+		goto fail;
+	}
+	wpa_printf(MSG_DEBUG, "OCSP: producedAt %lu",
+		   (unsigned long) produced_at);
+	pos = hdr.payload + hdr.length;
+
+	/* responses  SEQUENCE OF SingleResponse */
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_SEQUENCE) {
+		wpa_printf(MSG_DEBUG,
+			   "OCSP: Expected SEQUENCE (responses) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		goto fail;
+	}
+	responses = hdr.payload;
+	responses_len = hdr.length;
+	wpa_hexdump(MSG_MSGDUMP, "OCSP: responses", responses, responses_len);
+	pos = hdr.payload + hdr.length;
+
+	if (pos < end) {
+		/* responseExtensions  [1] EXPLICIT Extensions OPTIONAL */
+		wpa_hexdump(MSG_MSGDUMP, "OCSP: responseExtensions",
+			    pos, end - pos);
+		/* Ignore for now. */
+	}
+
+	if (!srv_cert) {
+		wpa_printf(MSG_DEBUG,
+			   "OCSP: Server certificate not known - cannot check OCSP response");
+		goto no_resp;
+	}
+
+	if (srv_cert->next) {
+		/* Issuer has already been verified in the chain */
+		issuer = srv_cert->next;
+	} else {
+		/* Find issuer from the set of trusted certificates */
+		for (issuer = conn->cred ? conn->cred->trusted_certs : NULL;
+		     issuer; issuer = issuer->next) {
+			if (x509_name_compare(&srv_cert->issuer,
+					      &issuer->subject) == 0)
+				break;
+		}
+	}
+	if (!issuer) {
+		wpa_printf(MSG_DEBUG,
+			   "OCSP: Server certificate issuer not known - cannot check OCSP response");
+		goto no_resp;
+	}
+
+	if (ocsp_responder_id_match(issuer, &name, key_hash)) {
+		wpa_printf(MSG_DEBUG,
+			   "OCSP: Server certificate issuer certificate matches ResponderID");
+		signer = issuer;
+	} else {
+		for (signer = certs; signer; signer = signer->next) {
+			if (!ocsp_responder_id_match(signer, &name, key_hash) ||
+			    x509_name_compare(&srv_cert->issuer,
+					      &issuer->subject) != 0 ||
+			    !(signer->ext_key_usage &
+			      X509_EXT_KEY_USAGE_OCSP) ||
+			    x509_certificate_check_signature(issuer, signer) <
+			    0)
+				continue;
+			wpa_printf(MSG_DEBUG,
+				   "OCSP: An extra certificate from the response matches ResponderID and is trusted as an OCSP signer");
+			break;
+		}
+		if (!signer) {
+			wpa_printf(MSG_DEBUG,
+				   "OCSP: Could not find OCSP signer certificate");
+			goto no_resp;
+		}
+	}
+
+	x509_free_name(&name);
+	os_memset(&name, 0, sizeof(name));
+	x509_certificate_chain_free(certs);
+	certs = NULL;
+
+	if (x509_check_signature(signer, &alg, sign_value, sign_value_len,
+				 resp_data_signed, resp_data_signed_len) < 0) {
+		    wpa_printf(MSG_DEBUG, "OCSP: Invalid signature");
+		    return TLS_OCSP_INVALID;
+	}
+
+	res = tls_process_ocsp_responses(conn, srv_cert, issuer,
+					 responses, responses_len);
+	if (res == TLS_OCSP_REVOKED)
+		srv_cert->ocsp_revoked = 1;
+	else if (res == TLS_OCSP_GOOD)
+		srv_cert->ocsp_good = 1;
+	return res;
+
+no_resp:
+	x509_free_name(&name);
+	x509_certificate_chain_free(certs);
+	return TLS_OCSP_NO_RESPONSE;
+
+fail:
+	x509_free_name(&name);
+	x509_certificate_chain_free(certs);
+	return TLS_OCSP_INVALID;
+}
+
+
+enum tls_ocsp_result tls_process_ocsp_response(struct tlsv1_client *conn,
+					       const u8 *resp, size_t len)
+{
+	struct asn1_hdr hdr;
+	const u8 *pos, *end;
+	u8 resp_status;
+	struct asn1_oid oid;
+	char obuf[80];
+	struct x509_certificate *cert;
+	enum tls_ocsp_result res = TLS_OCSP_NO_RESPONSE;
+	enum tls_ocsp_result res_first = res;
+
+	wpa_hexdump(MSG_MSGDUMP, "TLSv1: OCSPResponse", resp, len);
+
+	/*
+	 * RFC 6960, 4.2.1:
+	 * OCSPResponse ::= SEQUENCE {
+	 *    responseStatus  OCSPResponseStatus,
+	 *    responseBytes   [0] EXPLICIT ResponseBytes OPTIONAL }
+	 */
+
+	if (asn1_get_next(resp, len, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_SEQUENCE) {
+		wpa_printf(MSG_DEBUG,
+			   "OCSP: Expected SEQUENCE (OCSPResponse) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return TLS_OCSP_INVALID;
+	}
+	pos = hdr.payload;
+	end = hdr.payload + hdr.length;
+
+	/* OCSPResponseStatus ::= ENUMERATED */
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_ENUMERATED ||
+	    hdr.length != 1) {
+		wpa_printf(MSG_DEBUG,
+			   "OCSP: Expected ENUMERATED (responseStatus) - found class %d tag 0x%x length %u",
+			   hdr.class, hdr.tag, hdr.length);
+		return TLS_OCSP_INVALID;
+	}
+	resp_status = hdr.payload[0];
+	wpa_printf(MSG_DEBUG, "OCSP: responseStatus %u", resp_status);
+	pos = hdr.payload + hdr.length;
+	if (resp_status != OCSP_RESP_STATUS_SUCCESSFUL) {
+		wpa_printf(MSG_DEBUG, "OCSP: No stapling result");
+		return TLS_OCSP_NO_RESPONSE;
+	}
+
+	/* responseBytes   [0] EXPLICIT ResponseBytes OPTIONAL */
+	if (pos == end)
+		return TLS_OCSP_NO_RESPONSE;
+
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_CONTEXT_SPECIFIC ||
+	    hdr.tag != 0) {
+		wpa_printf(MSG_DEBUG,
+			   "OCSP: Expected [0] EXPLICIT (responseBytes) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return TLS_OCSP_INVALID;
+	}
+
+	/*
+	 * ResponseBytes ::= SEQUENCE {
+	 *     responseType   OBJECT IDENTIFIER,
+	 *     response       OCTET STRING }
+	 */
+
+	if (asn1_get_next(hdr.payload, hdr.length, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_SEQUENCE) {
+		wpa_printf(MSG_DEBUG,
+			   "OCSP: Expected SEQUENCE (ResponseBytes) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return TLS_OCSP_INVALID;
+	}
+	pos = hdr.payload;
+	end = hdr.payload + hdr.length;
+
+	/* responseType   OBJECT IDENTIFIER */
+	if (asn1_get_oid(pos, end - pos, &oid, &pos)) {
+		wpa_printf(MSG_DEBUG,
+			   "OCSP: Failed to parse OID (responseType)");
+		return TLS_OCSP_INVALID;
+	}
+	asn1_oid_to_str(&oid, obuf, sizeof(obuf));
+	wpa_printf(MSG_DEBUG, "OCSP: responseType %s", obuf);
+	if (!is_oid_basic_ocsp_resp(&oid)) {
+		wpa_printf(MSG_DEBUG, "OCSP: Ignore unsupported response type");
+		return TLS_OCSP_NO_RESPONSE;
+	}
+
+	/* response       OCTET STRING */
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_OCTETSTRING) {
+		wpa_printf(MSG_DEBUG,
+			   "OCSP: Expected OCTET STRING (response) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return TLS_OCSP_INVALID;
+	}
+
+	cert = conn->server_cert;
+	while (cert) {
+		if (!cert->ocsp_good && !cert->ocsp_revoked) {
+			char sbuf[128];
+
+			x509_name_string(&cert->subject, sbuf, sizeof(sbuf));
+			wpa_printf(MSG_DEBUG,
+				   "OCSP: Trying to find certificate status for %s",
+				   sbuf);
+
+			res = tls_process_basic_ocsp_response(conn, cert,
+							      hdr.payload,
+							      hdr.length);
+			if (cert == conn->server_cert)
+				res_first = res;
+		}
+		if (res == TLS_OCSP_REVOKED || cert->issuer_trusted)
+			break;
+		cert = cert->next;
+	}
+	return res == TLS_OCSP_REVOKED ? res : res_first;
+}
diff --git a/src/tls/tlsv1_client_read.c b/src/tls/tlsv1_client_read.c
index 9ce96803753a9..244c3cb060821 100644
--- a/src/tls/tlsv1_client_read.c
+++ b/src/tls/tlsv1_client_read.c
@@ -1,6 +1,6 @@
 /*
  * TLSv1 client - read handshake message
- * Copyright (c) 2006-2014, Jouni Malinen <j@w1.fi>
+ * Copyright (c) 2006-2015, Jouni Malinen <j@w1.fi>
  *
  * This software may be distributed under the terms of the BSD license.
  * See README for more details.
@@ -27,6 +27,54 @@ static int tls_process_server_hello_done(struct tlsv1_client *conn, u8 ct,
 					 const u8 *in_data, size_t *in_len);
 
 
+static int tls_version_disabled(struct tlsv1_client *conn, u16 ver)
+{
+	return (((conn->flags & TLS_CONN_DISABLE_TLSv1_0) &&
+		 ver == TLS_VERSION_1) ||
+		((conn->flags & TLS_CONN_DISABLE_TLSv1_1) &&
+		 ver == TLS_VERSION_1_1) ||
+		((conn->flags & TLS_CONN_DISABLE_TLSv1_2) &&
+		 ver == TLS_VERSION_1_2));
+}
+
+
+static int tls_process_server_hello_extensions(struct tlsv1_client *conn,
+					       const u8 *pos, size_t len)
+{
+	const u8 *end = pos + len;
+
+	wpa_hexdump(MSG_MSGDUMP, "TLSv1: ServerHello extensions",
+		    pos, len);
+	while (pos < end) {
+		u16 ext, elen;
+
+		if (end - pos < 4) {
+			wpa_printf(MSG_INFO, "TLSv1: Truncated ServerHello extension header");
+			return -1;
+		}
+
+		ext = WPA_GET_BE16(pos);
+		pos += 2;
+		elen = WPA_GET_BE16(pos);
+		pos += 2;
+
+		if (elen > end - pos) {
+			wpa_printf(MSG_INFO, "TLSv1: Truncated ServerHello extension");
+			return -1;
+		}
+
+		wpa_printf(MSG_DEBUG, "TLSv1: ServerHello ExtensionType %u",
+			   ext);
+		wpa_hexdump(MSG_DEBUG, "TLSv1: ServerHello extension data",
+			    pos, elen);
+
+		pos += elen;
+	}
+
+	return 0;
+}
+
+
 static int tls_process_server_hello(struct tlsv1_client *conn, u8 ct,
 				    const u8 *in_data, size_t *in_len)
 {
@@ -76,7 +124,8 @@ static int tls_process_server_hello(struct tlsv1_client *conn, u8 ct,
 	if (end - pos < 2)
 		goto decode_error;
 	tls_version = WPA_GET_BE16(pos);
-	if (!tls_version_ok(tls_version)) {
+	if (!tls_version_ok(tls_version) ||
+	    tls_version_disabled(conn, tls_version)) {
 		wpa_printf(MSG_DEBUG, "TLSv1: Unexpected protocol version in "
 			   "ServerHello %u.%u", pos[0], pos[1]);
 		tls_alert(conn, TLS_ALERT_LEVEL_FATAL,
@@ -165,8 +214,24 @@ static int tls_process_server_hello(struct tlsv1_client *conn, u8 ct,
 	}
 	pos++;
 
+	if (end - pos >= 2) {
+		u16 ext_len;
+
+		ext_len = WPA_GET_BE16(pos);
+		pos += 2;
+		if (end - pos < ext_len) {
+			wpa_printf(MSG_INFO,
+				   "TLSv1: Invalid ServerHello extension length: %u (left: %u)",
+				   ext_len, (unsigned int) (end - pos));
+			goto decode_error;
+		}
+
+		if (tls_process_server_hello_extensions(conn, pos, ext_len))
+			goto decode_error;
+		pos += ext_len;
+	}
+
 	if (end != pos) {
-		/* TODO: ServerHello extensions */
 		wpa_hexdump(MSG_DEBUG, "TLSv1: Unexpected extra data in the "
 			    "end of ServerHello", pos, end - pos);
 		goto decode_error;
@@ -211,6 +276,73 @@ decode_error:
 }
 
 
+static void tls_peer_cert_event(struct tlsv1_client *conn, int depth,
+				struct x509_certificate *cert)
+{
+	union tls_event_data ev;
+	struct wpabuf *cert_buf = NULL;
+#ifdef CONFIG_SHA256
+	u8 hash[32];
+#endif /* CONFIG_SHA256 */
+	char subject[128];
+
+	if (!conn->event_cb)
+		return;
+
+	os_memset(&ev, 0, sizeof(ev));
+	if (conn->cred->cert_probe || conn->cert_in_cb) {
+		cert_buf = wpabuf_alloc_copy(cert->cert_start,
+					     cert->cert_len);
+		ev.peer_cert.cert = cert_buf;
+	}
+#ifdef CONFIG_SHA256
+	if (cert_buf) {
+		const u8 *addr[1];
+		size_t len[1];
+		addr[0] = wpabuf_head(cert_buf);
+		len[0] = wpabuf_len(cert_buf);
+		if (sha256_vector(1, addr, len, hash) == 0) {
+			ev.peer_cert.hash = hash;
+			ev.peer_cert.hash_len = sizeof(hash);
+		}
+	}
+#endif /* CONFIG_SHA256 */
+
+	ev.peer_cert.depth = depth;
+	x509_name_string(&cert->subject, subject, sizeof(subject));
+	ev.peer_cert.subject = subject;
+
+	conn->event_cb(conn->cb_ctx, TLS_PEER_CERTIFICATE, &ev);
+	wpabuf_free(cert_buf);
+}
+
+
+static void tls_cert_chain_failure_event(struct tlsv1_client *conn, int depth,
+					 struct x509_certificate *cert,
+					 enum tls_fail_reason reason,
+					 const char *reason_txt)
+{
+	struct wpabuf *cert_buf = NULL;
+	union tls_event_data ev;
+	char subject[128];
+
+	if (!conn->event_cb || !cert)
+		return;
+
+	os_memset(&ev, 0, sizeof(ev));
+	ev.cert_fail.depth = depth;
+	x509_name_string(&cert->subject, subject, sizeof(subject));
+	ev.peer_cert.subject = subject;
+	ev.cert_fail.reason = reason;
+	ev.cert_fail.reason_txt = reason_txt;
+	cert_buf = wpabuf_alloc_copy(cert->cert_start,
+				     cert->cert_len);
+	ev.cert_fail.cert = cert_buf;
+	conn->event_cb(conn->cb_ctx, TLS_CERT_CHAIN_FAILURE, &ev);
+	wpabuf_free(cert_buf);
+}
+
+
 static int tls_process_certificate(struct tlsv1_client *conn, u8 ct,
 				   const u8 *in_data, size_t *in_len)
 {
@@ -354,6 +486,8 @@ static int tls_process_certificate(struct tlsv1_client *conn, u8 ct,
 			return -1;
 		}
 
+		tls_peer_cert_event(conn, idx, cert);
+
 		if (last == NULL)
 			chain = cert;
 		else
@@ -364,31 +498,99 @@ static int tls_process_certificate(struct tlsv1_client *conn, u8 ct,
 		pos += cert_len;
 	}
 
-	if (conn->cred &&
-	    x509_certificate_chain_validate(conn->cred->trusted_certs, chain,
-					    &reason, conn->disable_time_checks)
-	    < 0) {
+	if (conn->cred && conn->cred->server_cert_only && chain) {
+		u8 hash[SHA256_MAC_LEN];
+		char buf[128];
+
+		wpa_printf(MSG_DEBUG,
+			   "TLSv1: Validate server certificate hash");
+		x509_name_string(&chain->subject, buf, sizeof(buf));
+		wpa_printf(MSG_DEBUG, "TLSv1: 0: %s", buf);
+		if (sha256_vector(1, &chain->cert_start, &chain->cert_len,
+				  hash) < 0 ||
+		    os_memcmp(conn->cred->srv_cert_hash, hash,
+			      SHA256_MAC_LEN) != 0) {
+			wpa_printf(MSG_DEBUG,
+				   "TLSv1: Server certificate hash mismatch");
+			wpa_hexdump(MSG_MSGDUMP, "TLSv1: SHA256 hash",
+				    hash, SHA256_MAC_LEN);
+			if (conn->event_cb) {
+				union tls_event_data ev;
+
+				os_memset(&ev, 0, sizeof(ev));
+				ev.cert_fail.reason = TLS_FAIL_UNSPECIFIED;
+				ev.cert_fail.reason_txt =
+					"Server certificate mismatch";
+				ev.cert_fail.subject = buf;
+				conn->event_cb(conn->cb_ctx,
+					       TLS_CERT_CHAIN_FAILURE, &ev);
+			}
+			tls_alert(conn, TLS_ALERT_LEVEL_FATAL,
+				  TLS_ALERT_BAD_CERTIFICATE);
+			x509_certificate_chain_free(chain);
+			return -1;
+		}
+	} else if (conn->cred && conn->cred->cert_probe) {
+		wpa_printf(MSG_DEBUG,
+			   "TLSv1: Reject server certificate on probe-only rune");
+		if (conn->event_cb) {
+			union tls_event_data ev;
+			char buf[128];
+
+			os_memset(&ev, 0, sizeof(ev));
+			ev.cert_fail.reason = TLS_FAIL_SERVER_CHAIN_PROBE;
+			ev.cert_fail.reason_txt =
+				"Server certificate chain probe";
+			if (chain) {
+				x509_name_string(&chain->subject, buf,
+						 sizeof(buf));
+				ev.cert_fail.subject = buf;
+			}
+			conn->event_cb(conn->cb_ctx, TLS_CERT_CHAIN_FAILURE,
+				       &ev);
+		}
+		tls_alert(conn, TLS_ALERT_LEVEL_FATAL,
+			  TLS_ALERT_BAD_CERTIFICATE);
+		x509_certificate_chain_free(chain);
+		return -1;
+	} else if (conn->cred && conn->cred->ca_cert_verify &&
+		   x509_certificate_chain_validate(
+			   conn->cred->trusted_certs, chain, &reason,
+			   !!(conn->flags & TLS_CONN_DISABLE_TIME_CHECKS))
+		   < 0) {
 		int tls_reason;
 		wpa_printf(MSG_DEBUG, "TLSv1: Server certificate chain "
 			   "validation failed (reason=%d)", reason);
 		switch (reason) {
 		case X509_VALIDATE_BAD_CERTIFICATE:
 			tls_reason = TLS_ALERT_BAD_CERTIFICATE;
+			tls_cert_chain_failure_event(
+				conn, 0, chain, TLS_FAIL_BAD_CERTIFICATE,
+				"bad certificate");
 			break;
 		case X509_VALIDATE_UNSUPPORTED_CERTIFICATE:
 			tls_reason = TLS_ALERT_UNSUPPORTED_CERTIFICATE;
 			break;
 		case X509_VALIDATE_CERTIFICATE_REVOKED:
 			tls_reason = TLS_ALERT_CERTIFICATE_REVOKED;
+			tls_cert_chain_failure_event(
+				conn, 0, chain, TLS_FAIL_REVOKED,
+				"certificate revoked");
 			break;
 		case X509_VALIDATE_CERTIFICATE_EXPIRED:
 			tls_reason = TLS_ALERT_CERTIFICATE_EXPIRED;
+			tls_cert_chain_failure_event(
+				conn, 0, chain, TLS_FAIL_EXPIRED,
+				"certificate has expired or is not yet valid");
 			break;
 		case X509_VALIDATE_CERTIFICATE_UNKNOWN:
 			tls_reason = TLS_ALERT_CERTIFICATE_UNKNOWN;
 			break;
 		case X509_VALIDATE_UNKNOWN_CA:
 			tls_reason = TLS_ALERT_UNKNOWN_CA;
+			tls_cert_chain_failure_event(
+				conn, 0, chain, TLS_FAIL_UNTRUSTED,
+				"unknown CA");
 			break;
 		default:
 			tls_reason = TLS_ALERT_BAD_CERTIFICATE;
@@ -399,7 +601,25 @@ static int tls_process_certificate(struct tlsv1_client *conn, u8 ct,
 		return -1;
 	}
 
-	x509_certificate_chain_free(chain);
+	if (conn->cred && !conn->cred->server_cert_only && chain &&
+	    (chain->extensions_present & X509_EXT_EXT_KEY_USAGE) &&
+	    !(chain->ext_key_usage &
+	      (X509_EXT_KEY_USAGE_ANY | X509_EXT_KEY_USAGE_SERVER_AUTH))) {
+		tls_cert_chain_failure_event(
+			conn, 0, chain, TLS_FAIL_BAD_CERTIFICATE,
+			"certificate not allowed for server authentication");
+		tls_alert(conn, TLS_ALERT_LEVEL_FATAL,
+			  TLS_ALERT_BAD_CERTIFICATE);
+		x509_certificate_chain_free(chain);
+		return -1;
+	}
+
+	if (conn->flags & TLS_CONN_REQUEST_OCSP) {
+		x509_certificate_chain_free(conn->server_cert);
+		conn->server_cert = chain;
+	} else {
+		x509_certificate_chain_free(chain);
+	}
 
 	*in_len = end - in_data;
 
@@ -507,7 +727,7 @@ static int tlsv1_process_diffie_hellman(struct tlsv1_client *conn,
 	server_params_end = pos;
 
 	if (key_exchange == TLS_KEY_X_DHE_RSA) {
-		u8 hash[MD5_MAC_LEN + SHA1_MAC_LEN];
+		u8 hash[64];
 		int hlen;
 
 		if (conn->rl.tls_version == TLS_VERSION_1_2) {
@@ -524,18 +744,21 @@ static int tlsv1_process_diffie_hellman(struct tlsv1_client *conn,
 			 */
 			if (end - pos < 2)
 				goto fail;
-			if (pos[0] != TLS_HASH_ALG_SHA256 ||
+			if ((pos[0] != TLS_HASH_ALG_SHA256 &&
+			     pos[0] != TLS_HASH_ALG_SHA384 &&
+			     pos[0] != TLS_HASH_ALG_SHA512) ||
 			    pos[1] != TLS_SIGN_ALG_RSA) {
 				wpa_printf(MSG_DEBUG, "TLSv1.2: Unsupported hash(%u)/signature(%u) algorithm",
 					   pos[0], pos[1]);
 				goto fail;
 			}
-			pos += 2;
 
 			hlen = tlsv12_key_x_server_params_hash(
-				conn->rl.tls_version, conn->client_random,
+				conn->rl.tls_version, pos[0],
+				conn->client_random,
 				conn->server_random, server_params,
 				server_params_end - server_params, hash);
+			pos += 2;
 #else /* CONFIG_TLSV12 */
 			goto fail;
 #endif /* CONFIG_TLSV12 */
@@ -567,6 +790,229 @@ fail:
 }
 
 
+static enum tls_ocsp_result
+tls_process_certificate_status_ocsp_response(struct tlsv1_client *conn,
+					     const u8 *pos, size_t len)
+{
+	const u8 *end = pos + len;
+	u32 ocsp_resp_len;
+
+	/* opaque OCSPResponse<1..2^24-1>; */
+	if (end - pos < 3) {
+		wpa_printf(MSG_INFO, "TLSv1: Too short OCSPResponse");
+		tls_alert(conn, TLS_ALERT_LEVEL_FATAL, TLS_ALERT_DECODE_ERROR);
+		return TLS_OCSP_INVALID;
+	}
+	ocsp_resp_len = WPA_GET_BE24(pos);
+	pos += 3;
+	if (end - pos < ocsp_resp_len) {
+		wpa_printf(MSG_INFO, "TLSv1: Truncated OCSPResponse");
+		tls_alert(conn, TLS_ALERT_LEVEL_FATAL, TLS_ALERT_DECODE_ERROR);
+		return TLS_OCSP_INVALID;
+	}
+
+	return tls_process_ocsp_response(conn, pos, ocsp_resp_len);
+}
+
+
+static int tls_process_certificate_status(struct tlsv1_client *conn, u8 ct,
+					   const u8 *in_data, size_t *in_len)
+{
+	const u8 *pos, *end;
+	size_t left, len;
+	u8 type, status_type;
+	enum tls_ocsp_result res;
+	struct x509_certificate *cert;
+	int depth;
+
+	if (ct != TLS_CONTENT_TYPE_HANDSHAKE) {
+		wpa_printf(MSG_DEBUG,
+			   "TLSv1: Expected Handshake; received content type 0x%x",
+			   ct);
+		tls_alert(conn, TLS_ALERT_LEVEL_FATAL,
+			  TLS_ALERT_UNEXPECTED_MESSAGE);
+		return -1;
+	}
+
+	pos = in_data;
+	left = *in_len;
+
+	if (left < 4) {
+		wpa_printf(MSG_DEBUG,
+			   "TLSv1: Too short CertificateStatus (left=%lu)",
+			   (unsigned long) left);
+		tls_alert(conn, TLS_ALERT_LEVEL_FATAL, TLS_ALERT_DECODE_ERROR);
+		return -1;
+	}
+
+	type = *pos++;
+	len = WPA_GET_BE24(pos);
+	pos += 3;
+	left -= 4;
+
+	if (len > left) {
+		wpa_printf(MSG_DEBUG,
+			   "TLSv1: Mismatch in CertificateStatus length (len=%lu != left=%lu)",
+			   (unsigned long) len, (unsigned long) left);
+		tls_alert(conn, TLS_ALERT_LEVEL_FATAL, TLS_ALERT_DECODE_ERROR);
+		return -1;
+	}
+
+	end = pos + len;
+
+	if (type != TLS_HANDSHAKE_TYPE_CERTIFICATE_STATUS) {
+		wpa_printf(MSG_DEBUG,
+			   "TLSv1: Received unexpected handshake message %d (expected CertificateStatus)",
+			   type);
+		tls_alert(conn, TLS_ALERT_LEVEL_FATAL,
+			  TLS_ALERT_UNEXPECTED_MESSAGE);
+		return -1;
+	}
+
+	wpa_printf(MSG_DEBUG, "TLSv1: Received CertificateStatus");
+
+	/*
+	 * struct {
+	 *     CertificateStatusType status_type;
+	 *     select (status_type) {
+	 *         case ocsp: OCSPResponse;
+	 *         case ocsp_multi: OCSPResponseList;
+	 *     } response;
+	 * } CertificateStatus;
+	 */
+	if (end - pos < 1) {
+		wpa_printf(MSG_INFO, "TLSv1: Too short CertificateStatus");
+		tls_alert(conn, TLS_ALERT_LEVEL_FATAL, TLS_ALERT_DECODE_ERROR);
+		return -1;
+	}
+	status_type = *pos++;
+	wpa_printf(MSG_DEBUG, "TLSv1: CertificateStatus status_type %u",
+		   status_type);
+
+	if (status_type == 1 /* ocsp */) {
+		res = tls_process_certificate_status_ocsp_response(
+			conn, pos, end - pos);
+	} else if (status_type == 2 /* ocsp_multi */) {
+		int good = 0, revoked = 0;
+		u32 resp_len;
+
+		res = TLS_OCSP_NO_RESPONSE;
+
+		/*
+		 * opaque OCSPResponse<0..2^24-1>;
+		 *
+		 * struct {
+		 *   OCSPResponse ocsp_response_list<1..2^24-1>;
+		 * } OCSPResponseList;
+		 */
+		if (end - pos < 3) {
+			wpa_printf(MSG_DEBUG,
+				   "TLSv1: Truncated OCSPResponseList");
+			res = TLS_OCSP_INVALID;
+			goto done;
+		}
+		resp_len = WPA_GET_BE24(pos);
+		pos += 3;
+		if (end - pos < resp_len) {
+			wpa_printf(MSG_DEBUG,
+				   "TLSv1: Truncated OCSPResponseList(len=%u)",
+				   resp_len);
+			res = TLS_OCSP_INVALID;
+			goto done;
+		}
+		end = pos + resp_len;
+
+		while (end - pos >= 3) {
+			resp_len = WPA_GET_BE24(pos);
+			pos += 3;
+			if (resp_len > end - pos) {
+				wpa_printf(MSG_DEBUG,
+					   "TLSv1: Truncated OCSPResponse(len=%u; left=%d) in ocsp_multi",
+					   resp_len, (int) (end - pos));
+				res = TLS_OCSP_INVALID;
+				break;
+			}
+			if (!resp_len)
+				continue; /* Skip an empty response */
+			res = tls_process_certificate_status_ocsp_response(
+				conn, pos - 3, resp_len + 3);
+			if (res == TLS_OCSP_REVOKED)
+				revoked++;
+			else if (res == TLS_OCSP_GOOD)
+				good++;
+			pos += resp_len;
+		}
+
+		if (revoked)
+			res = TLS_OCSP_REVOKED;
+		else if (good)
+			res = TLS_OCSP_GOOD;
+	} else {
+		wpa_printf(MSG_DEBUG,
+			   "TLSv1: Ignore unsupported CertificateStatus");
+		goto skip;
+	}
+
+done:
+	if (res == TLS_OCSP_REVOKED) {
+		tls_alert(conn, TLS_ALERT_LEVEL_FATAL,
+			  TLS_ALERT_CERTIFICATE_REVOKED);
+		for (cert = conn->server_cert, depth = 0; cert;
+		     cert = cert->next, depth++) {
+			if (cert->ocsp_revoked) {
+				tls_cert_chain_failure_event(
+					conn, depth, cert, TLS_FAIL_REVOKED,
+					"certificate revoked");
+			}
+		}
+		return -1;
+	}
+
+	if (conn->flags & TLS_CONN_REQUIRE_OCSP_ALL) {
+		/*
+		 * Verify that each certificate on the chain that is not part
+		 * of the trusted certificates has a good status. If not,
+		 * terminate handshake.
+		 */
+		for (cert = conn->server_cert, depth = 0; cert;
+		     cert = cert->next, depth++) {
+			if (!cert->ocsp_good) {
+				tls_alert(conn, TLS_ALERT_LEVEL_FATAL,
+					  TLS_ALERT_BAD_CERTIFICATE_STATUS_RESPONSE);
+				tls_cert_chain_failure_event(
+					conn, depth, cert,
+					TLS_FAIL_UNSPECIFIED,
+					"bad certificate status response");
+				return -1;
+			}
+			if (cert->issuer_trusted)
+				break;
+		}
+	}
+
+	if ((conn->flags & TLS_CONN_REQUIRE_OCSP) && res != TLS_OCSP_GOOD) {
+		tls_alert(conn, TLS_ALERT_LEVEL_FATAL,
+			  res == TLS_OCSP_INVALID ? TLS_ALERT_DECODE_ERROR :
+			  TLS_ALERT_BAD_CERTIFICATE_STATUS_RESPONSE);
+		if (conn->server_cert)
+			tls_cert_chain_failure_event(
+				conn, 0, conn->server_cert,
+				TLS_FAIL_UNSPECIFIED,
+				"bad certificate status response");
+		return -1;
+	}
+
+	conn->ocsp_resp_received = 1;
+
+skip:
+	*in_len = end - in_data;
+
+	conn->state = SERVER_KEY_EXCHANGE;
+
+	return 0;
+}
+
+
 static int tls_process_server_key_exchange(struct tlsv1_client *conn, u8 ct,
 					   const u8 *in_data, size_t *in_len)
 {
@@ -608,6 +1054,10 @@ static int tls_process_server_key_exchange(struct tlsv1_client *conn, u8 ct,
 
 	end = pos + len;
 
+	if ((conn->flags & TLS_CONN_REQUEST_OCSP) &&
+	    type == TLS_HANDSHAKE_TYPE_CERTIFICATE_STATUS)
+		return tls_process_certificate_status(conn, ct, in_data,
+						      in_len);
 	if (type == TLS_HANDSHAKE_TYPE_CERTIFICATE_REQUEST)
 		return tls_process_certificate_request(conn, ct, in_data,
 						       in_len);
@@ -617,7 +1067,9 @@ static int tls_process_server_key_exchange(struct tlsv1_client *conn, u8 ct,
 	if (type != TLS_HANDSHAKE_TYPE_SERVER_KEY_EXCHANGE) {
 		wpa_printf(MSG_DEBUG, "TLSv1: Received unexpected handshake "
 			   "message %d (expected ServerKeyExchange/"
-			   "CertificateRequest/ServerHelloDone)", type);
+			   "CertificateRequest/ServerHelloDone%s)", type,
+			   (conn->flags & TLS_CONN_REQUEST_OCSP) ?
+			   "/CertificateStatus" : "");
 		tls_alert(conn, TLS_ALERT_LEVEL_FATAL,
 			  TLS_ALERT_UNEXPECTED_MESSAGE);
 		return -1;
@@ -771,6 +1223,15 @@ static int tls_process_server_hello_done(struct tlsv1_client *conn, u8 ct,
 
 	wpa_printf(MSG_DEBUG, "TLSv1: Received ServerHelloDone");
 
+	if ((conn->flags & TLS_CONN_REQUIRE_OCSP) &&
+	    !conn->ocsp_resp_received) {
+		wpa_printf(MSG_INFO,
+			   "TLSv1: No OCSP response received - reject handshake");
+		tls_alert(conn, TLS_ALERT_LEVEL_FATAL,
+			  TLS_ALERT_BAD_CERTIFICATE_STATUS_RESPONSE);
+		return -1;
+	}
+
 	*in_len = end - in_data;
 
 	conn->state = CLIENT_KEY_EXCHANGE;
diff --git a/src/tls/tlsv1_client_write.c b/src/tls/tlsv1_client_write.c
index d192f44f40882..04d895e61926a 100644
--- a/src/tls/tlsv1_client_write.c
+++ b/src/tls/tlsv1_client_write.c
@@ -1,6 +1,6 @@
 /*
  * TLSv1 client - write handshake message
- * Copyright (c) 2006-2014, Jouni Malinen <j@w1.fi>
+ * Copyright (c) 2006-2015, Jouni Malinen <j@w1.fi>
  *
  * This software may be distributed under the terms of the BSD license.
  * See README for more details.
@@ -47,8 +47,28 @@ u8 * tls_send_client_hello(struct tlsv1_client *conn, size_t *out_len)
 	u8 *hello, *end, *pos, *hs_length, *hs_start, *rhdr;
 	struct os_time now;
 	size_t len, i;
+	u8 *ext_start;
+	u16 tls_version = TLS_VERSION;
 
-	wpa_printf(MSG_DEBUG, "TLSv1: Send ClientHello");
+	/* Pick the highest locally enabled TLS version */
+#ifdef CONFIG_TLSV12
+	if ((conn->flags & TLS_CONN_DISABLE_TLSv1_2) &&
+	    tls_version == TLS_VERSION_1_2)
+		tls_version = TLS_VERSION_1_1;
+#endif /* CONFIG_TLSV12 */
+#ifdef CONFIG_TLSV11
+	if ((conn->flags & TLS_CONN_DISABLE_TLSv1_1) &&
+	    tls_version == TLS_VERSION_1_1)
+		tls_version = TLS_VERSION_1;
+#endif /* CONFIG_TLSV11 */
+	if ((conn->flags & TLS_CONN_DISABLE_TLSv1_0) &&
+	    tls_version == TLS_VERSION_1) {
+		wpa_printf(MSG_INFO, "TLSv1: No TLS version allowed");
+		return NULL;
+	}
+
+	wpa_printf(MSG_DEBUG, "TLSv1: Send ClientHello (ver %s)",
+		   tls_version_str(tls_version));
 	*out_len = 0;
 
 	os_get_time(&now);
@@ -61,7 +81,7 @@ u8 * tls_send_client_hello(struct tlsv1_client *conn, size_t *out_len)
 	wpa_hexdump(MSG_MSGDUMP, "TLSv1: client_random",
 		    conn->client_random, TLS_RANDOM_LEN);
 
-	len = 100 + conn->num_cipher_suites * 2 + conn->client_hello_ext_len;
+	len = 150 + conn->num_cipher_suites * 2 + conn->client_hello_ext_len;
 	hello = os_malloc(len);
 	if (hello == NULL)
 		return NULL;
@@ -81,7 +101,7 @@ u8 * tls_send_client_hello(struct tlsv1_client *conn, size_t *out_len)
 	pos += 3;
 	/* body - ClientHello */
 	/* ProtocolVersion client_version */
-	WPA_PUT_BE16(pos, TLS_VERSION);
+	WPA_PUT_BE16(pos, tls_version);
 	pos += 2;
 	/* Random random: uint32 gmt_unix_time, opaque random_bytes */
 	os_memcpy(pos, conn->client_random, TLS_RANDOM_LEN);
@@ -101,12 +121,124 @@ u8 * tls_send_client_hello(struct tlsv1_client *conn, size_t *out_len)
 	*pos++ = 1;
 	*pos++ = TLS_COMPRESSION_NULL;
 
+	/* Extension */
+	ext_start = pos;
+	pos += 2;
+
+#ifdef CONFIG_TLSV12
+	if (conn->rl.tls_version >= TLS_VERSION_1_2) {
+		/*
+		 * Add signature_algorithms extension since we support only
+		 * SHA256 (and not the default SHA1) with TLSv1.2.
+		 */
+		/* ExtensionsType extension_type = signature_algorithms(13) */
+		WPA_PUT_BE16(pos, TLS_EXT_SIGNATURE_ALGORITHMS);
+		pos += 2;
+		/* opaque extension_data<0..2^16-1> length */
+		WPA_PUT_BE16(pos, 8);
+		pos += 2;
+		/* supported_signature_algorithms<2..2^16-2> length */
+		WPA_PUT_BE16(pos, 6);
+		pos += 2;
+		/* supported_signature_algorithms */
+		*pos++ = TLS_HASH_ALG_SHA512;
+		*pos++ = TLS_SIGN_ALG_RSA;
+		*pos++ = TLS_HASH_ALG_SHA384;
+		*pos++ = TLS_SIGN_ALG_RSA;
+		*pos++ = TLS_HASH_ALG_SHA256;
+		*pos++ = TLS_SIGN_ALG_RSA;
+	}
+#endif /* CONFIG_TLSV12 */
+
 	if (conn->client_hello_ext) {
 		os_memcpy(pos, conn->client_hello_ext,
 			  conn->client_hello_ext_len);
 		pos += conn->client_hello_ext_len;
 	}
 
+	if (conn->flags & TLS_CONN_REQUEST_OCSP) {
+		wpa_printf(MSG_DEBUG,
+			   "TLSv1: Add status_request extension for OCSP stapling");
+		/* ExtensionsType extension_type = status_request(5) */
+		WPA_PUT_BE16(pos, TLS_EXT_STATUS_REQUEST);
+		pos += 2;
+		/* opaque extension_data<0..2^16-1> length */
+		WPA_PUT_BE16(pos, 5);
+		pos += 2;
+
+		/*
+		 * RFC 6066, 8:
+		 * struct {
+		 *     CertificateStatusType status_type;
+		 *     select (status_type) {
+		 *         case ocsp: OCSPStatusRequest;
+		 *     } request;
+		 * } CertificateStatusRequest;
+		 *
+		 * enum { ocsp(1), (255) } CertificateStatusType;
+		 */
+		*pos++ = 1; /* status_type = ocsp(1) */
+
+		/*
+		 * struct {
+		 *     ResponderID responder_id_list<0..2^16-1>;
+		 *     Extensions  request_extensions;
+		 * } OCSPStatusRequest;
+		 *
+		 * opaque ResponderID<1..2^16-1>;
+		 * opaque Extensions<0..2^16-1>;
+		 */
+		WPA_PUT_BE16(pos, 0); /* responder_id_list(empty) */
+		pos += 2;
+		WPA_PUT_BE16(pos, 0); /* request_extensions(empty) */
+		pos += 2;
+
+		wpa_printf(MSG_DEBUG,
+			   "TLSv1: Add status_request_v2 extension for OCSP stapling");
+		/* ExtensionsType extension_type = status_request_v2(17) */
+		WPA_PUT_BE16(pos, TLS_EXT_STATUS_REQUEST_V2);
+		pos += 2;
+		/* opaque extension_data<0..2^16-1> length */
+		WPA_PUT_BE16(pos, 7);
+		pos += 2;
+
+		/*
+		 * RFC 6961, 2.2:
+		 * struct {
+		 *     CertificateStatusType status_type;
+		 *     uint16 request_length;
+		 *     select (status_type) {
+		 *         case ocsp: OCSPStatusRequest;
+		 *         case ocsp_multi: OCSPStatusRequest;
+		 *     } request;
+		 * } CertificateStatusRequestItemV2;
+		 *
+		 * enum { ocsp(1), ocsp_multi(2), (255) } CertificateStatusType;
+		 *
+		 * struct {
+		 * CertificateStatusRequestItemV2
+		 *     certificate_status_req_list<1..2^16-1>;
+		 * } CertificateStatusRequestListV2;
+		 */
+
+		/* certificate_status_req_list<1..2^16-1> */
+		WPA_PUT_BE16(pos, 5);
+		pos += 2;
+
+		/* CertificateStatusRequestItemV2 */
+		*pos++ = 2; /* status_type = ocsp_multi(2) */
+		/* OCSPStatusRequest as shown above for v1 */
+		WPA_PUT_BE16(pos, 0); /* responder_id_list(empty) */
+		pos += 2;
+		WPA_PUT_BE16(pos, 0); /* request_extensions(empty) */
+		pos += 2;
+	}
+
+	if (pos == ext_start + 2)
+		pos -= 2; /* no extensions */
+	else
+		WPA_PUT_BE16(ext_start, pos - ext_start - 2);
+
 	WPA_PUT_BE24(hs_length, pos - hs_length - 3);
 	tls_verify_hash_add(&conn->verify, hs_start, pos - hs_start);
 
@@ -134,6 +266,11 @@ static int tls_write_client_certificate(struct tlsv1_client *conn,
 	struct x509_certificate *cert;
 
 	pos = *msgpos;
+	if (TLS_RECORD_HEADER_LEN + 1 + 3 + 3 > end - pos) {
+		tls_alert(conn, TLS_ALERT_LEVEL_FATAL,
+			  TLS_ALERT_INTERNAL_ERROR);
+		return -1;
+	}
 
 	wpa_printf(MSG_DEBUG, "TLSv1: Send Certificate");
 	rhdr = pos;
@@ -154,7 +291,7 @@ static int tls_write_client_certificate(struct tlsv1_client *conn,
 	pos += 3;
 	cert = conn->cred ? conn->cred->cert : NULL;
 	while (cert) {
-		if (pos + 3 + cert->cert_len > end) {
+		if (3 + cert->cert_len > (size_t) (end - pos)) {
 			wpa_printf(MSG_DEBUG, "TLSv1: Not enough buffer space "
 				   "for Certificate (cert_len=%lu left=%lu)",
 				   (unsigned long) cert->cert_len,
@@ -265,9 +402,16 @@ static int tlsv1_key_x_dh(struct tlsv1_client *conn, u8 **pos, u8 *end)
 	wpa_hexdump(MSG_DEBUG, "TLSv1: DH Yc (client's public value)",
 		    dh_yc, dh_yc_len);
 
+	if (end - *pos < 2) {
+		tls_alert(conn, TLS_ALERT_LEVEL_FATAL,
+			  TLS_ALERT_INTERNAL_ERROR);
+		os_free(csecret);
+		os_free(dh_yc);
+		return -1;
+	}
 	WPA_PUT_BE16(*pos, dh_yc_len);
 	*pos += 2;
-	if (*pos + dh_yc_len > end) {
+	if (dh_yc_len > (size_t) (end - *pos)) {
 		wpa_printf(MSG_DEBUG, "TLSv1: Not enough room in the "
 			   "message buffer for Yc");
 		tls_alert(conn, TLS_ALERT_LEVEL_FATAL,
@@ -789,6 +933,8 @@ static u8 * tls_send_change_cipher_spec(struct tlsv1_client *conn,
 
 	wpa_printf(MSG_DEBUG, "TLSv1: Session resumption completed "
 		   "successfully");
+	if (!conn->session_resumed && conn->use_session_ticket)
+		conn->session_resumed = 1;
 	conn->state = ESTABLISHED;
 
 	return msg;
diff --git a/src/tls/tlsv1_common.c b/src/tls/tlsv1_common.c
index dabc12a129788..6b28417e499c7 100644
--- a/src/tls/tlsv1_common.c
+++ b/src/tls/tlsv1_common.c
@@ -335,7 +335,7 @@ int tls_prf(u16 ver, const u8 *secret, size_t secret_len, const char *label,
 
 
 #ifdef CONFIG_TLSV12
-int tlsv12_key_x_server_params_hash(u16 tls_version,
+int tlsv12_key_x_server_params_hash(u16 tls_version, u8 hash_alg,
 				    const u8 *client_random,
 				    const u8 *server_random,
 				    const u8 *server_params,
@@ -343,14 +343,30 @@ int tlsv12_key_x_server_params_hash(u16 tls_version,
 {
 	size_t hlen;
 	struct crypto_hash *ctx;
-
-	ctx = crypto_hash_init(CRYPTO_HASH_ALG_SHA256, NULL, 0);
+	enum crypto_hash_alg alg;
+
+	switch (hash_alg) {
+	case TLS_HASH_ALG_SHA256:
+		alg = CRYPTO_HASH_ALG_SHA256;
+		hlen = SHA256_MAC_LEN;
+		break;
+	case TLS_HASH_ALG_SHA384:
+		alg = CRYPTO_HASH_ALG_SHA384;
+		hlen = 48;
+		break;
+	case TLS_HASH_ALG_SHA512:
+		alg = CRYPTO_HASH_ALG_SHA512;
+		hlen = 64;
+		break;
+	default:
+		return -1;
+	}
+	ctx = crypto_hash_init(alg, NULL, 0);
 	if (ctx == NULL)
 		return -1;
 	crypto_hash_update(ctx, client_random, TLS_RANDOM_LEN);
 	crypto_hash_update(ctx, server_random, TLS_RANDOM_LEN);
 	crypto_hash_update(ctx, server_params, server_params_len);
-	hlen = SHA256_MAC_LEN;
 	if (crypto_hash_finish(ctx, hash, &hlen) < 0)
 		return -1;
 
@@ -469,6 +485,21 @@ int tls_verify_signature(u16 tls_version, struct crypto_public_key *pk,
 			wpa_printf(MSG_DEBUG, "TLSv1.2: DigestAlgorithn = SHA-256");
 			decrypted = buf + 19;
 			buflen -= 19;
+		} else if (buflen >= 19 + 48 &&
+		    os_memcmp(buf, "\x30\x41\x30\x0d\x06\x09\x60\x86\x48\x01"
+			      "\x65\x03\x04\x02\x02\x05\x00\x04\x30", 19) == 0)
+		{
+			wpa_printf(MSG_DEBUG, "TLSv1.2: DigestAlgorithn = SHA-384");
+			decrypted = buf + 19;
+			buflen -= 19;
+		} else if (buflen >= 19 + 64 &&
+		    os_memcmp(buf, "\x30\x51\x30\x0d\x06\x09\x60\x86\x48\x01"
+			      "\x65\x03\x04\x02\x03\x05\x00\x04\x40", 19) == 0)
+		{
+			wpa_printf(MSG_DEBUG, "TLSv1.2: DigestAlgorithn = SHA-512");
+			decrypted = buf + 19;
+			buflen -= 19;
+
 		} else {
 			wpa_printf(MSG_DEBUG, "TLSv1.2: Unrecognized DigestInfo");
 			os_free(buf);
diff --git a/src/tls/tlsv1_common.h b/src/tls/tlsv1_common.h
index 26e68af166069..e30b15a030a80 100644
--- a/src/tls/tlsv1_common.h
+++ b/src/tls/tlsv1_common.h
@@ -169,6 +169,8 @@ enum {
 #define TLS_EXT_TRUSTED_CA_KEYS			3 /* RFC 4366 */
 #define TLS_EXT_TRUNCATED_HMAC			4 /* RFC 4366 */
 #define TLS_EXT_STATUS_REQUEST			5 /* RFC 4366 */
+#define TLS_EXT_SIGNATURE_ALGORITHMS		13 /* RFC 5246 */
+#define TLS_EXT_STATUS_REQUEST_V2		17 /* RFC 6961 */
 #define TLS_EXT_SESSION_TICKET			35 /* RFC 4507 */
 
 #define TLS_EXT_PAC_OPAQUE TLS_EXT_SESSION_TICKET /* EAP-FAST terminology */
@@ -257,7 +259,8 @@ int tls_version_ok(u16 ver);
 const char * tls_version_str(u16 ver);
 int tls_prf(u16 ver, const u8 *secret, size_t secret_len, const char *label,
 	    const u8 *seed, size_t seed_len, u8 *out, size_t outlen);
-int tlsv12_key_x_server_params_hash(u16 tls_version, const u8 *client_random,
+int tlsv12_key_x_server_params_hash(u16 tls_version, u8 hash_Alg,
+				    const u8 *client_random,
 				    const u8 *server_random,
 				    const u8 *server_params,
 				    size_t server_params_len, u8 *hash);
diff --git a/src/tls/tlsv1_cred.c b/src/tls/tlsv1_cred.c
index 1ea6827b898ec..52c1ae0143da3 100644
--- a/src/tls/tlsv1_cred.c
+++ b/src/tls/tlsv1_cred.c
@@ -1,6 +1,6 @@
 /*
  * TLSv1 credentials
- * Copyright (c) 2006-2009, Jouni Malinen <j@w1.fi>
+ * Copyright (c) 2006-2015, Jouni Malinen <j@w1.fi>
  *
  * This software may be distributed under the terms of the BSD license.
  * See README for more details.
@@ -11,6 +11,9 @@
 #include "common.h"
 #include "base64.h"
 #include "crypto/crypto.h"
+#include "crypto/sha1.h"
+#include "pkcs5.h"
+#include "pkcs8.h"
 #include "x509v3.h"
 #include "tlsv1_cred.h"
 
@@ -33,6 +36,8 @@ void tlsv1_cred_free(struct tlsv1_credentials *cred)
 	crypto_private_key_free(cred->key);
 	os_free(cred->dh_p);
 	os_free(cred->dh_g);
+	os_free(cred->ocsp_stapling_response);
+	os_free(cred->ocsp_stapling_response_multi);
 	os_free(cred);
 }
 
@@ -190,6 +195,43 @@ int tlsv1_set_ca_cert(struct tlsv1_credentials *cred, const char *cert,
 		      const u8 *cert_blob, size_t cert_blob_len,
 		      const char *path)
 {
+	if (cert && os_strncmp(cert, "hash://", 7) == 0) {
+		const char *pos = cert + 7;
+		if (os_strncmp(pos, "server/sha256/", 14) != 0) {
+			wpa_printf(MSG_DEBUG,
+				   "TLSv1: Unsupported ca_cert hash value '%s'",
+				   cert);
+			return -1;
+		}
+		pos += 14;
+		if (os_strlen(pos) != 32 * 2) {
+			wpa_printf(MSG_DEBUG,
+				   "TLSv1: Unexpected SHA256 hash length in ca_cert '%s'",
+				   cert);
+			return -1;
+		}
+		if (hexstr2bin(pos, cred->srv_cert_hash, 32) < 0) {
+			wpa_printf(MSG_DEBUG,
+				   "TLSv1: Invalid SHA256 hash value in ca_cert '%s'",
+				   cert);
+			return -1;
+		}
+		cred->server_cert_only = 1;
+		cred->ca_cert_verify = 0;
+		wpa_printf(MSG_DEBUG,
+			   "TLSv1: Checking only server certificate match");
+		return 0;
+	}
+
+	if (cert && os_strncmp(cert, "probe://", 8) == 0) {
+		cred->cert_probe = 1;
+		cred->ca_cert_verify = 0;
+		wpa_printf(MSG_DEBUG, "TLSv1: Only probe server certificate");
+		return 0;
+	}
+
+	cred->ca_cert_verify = cert || cert_blob || path;
+
 	if (tlsv1_set_cert_chain(&cred->trusted_certs, cert,
 				 cert_blob, cert_blob_len) < 0)
 		return -1;
@@ -288,6 +330,735 @@ static struct crypto_private_key * tlsv1_set_key_enc_pem(const u8 *key,
 }
 
 
+#ifdef PKCS12_FUNCS
+
+static int oid_is_rsadsi(struct asn1_oid *oid)
+{
+	return oid->len >= 4 &&
+		oid->oid[0] == 1 /* iso */ &&
+		oid->oid[1] == 2 /* member-body */ &&
+		oid->oid[2] == 840 /* us */ &&
+		oid->oid[3] == 113549 /* rsadsi */;
+}
+
+
+static int pkcs12_is_bagtype_oid(struct asn1_oid *oid, unsigned long type)
+{
+	return oid->len == 9 &&
+		oid_is_rsadsi(oid) &&
+		oid->oid[4] == 1 /* pkcs */ &&
+		oid->oid[5] == 12 /* pkcs-12 */ &&
+		oid->oid[6] == 10 &&
+		oid->oid[7] == 1 /* bagtypes */ &&
+		oid->oid[8] == type;
+}
+
+
+static int is_oid_pkcs7(struct asn1_oid *oid)
+{
+	return oid->len == 7 &&
+		oid->oid[0] == 1 /* iso */ &&
+		oid->oid[1] == 2 /* member-body */ &&
+		oid->oid[2] == 840 /* us */ &&
+		oid->oid[3] == 113549 /* rsadsi */ &&
+		oid->oid[4] == 1 /* pkcs */ &&
+		oid->oid[5] == 7 /* pkcs-7 */;
+}
+
+
+static int is_oid_pkcs7_data(struct asn1_oid *oid)
+{
+	return is_oid_pkcs7(oid) && oid->oid[6] == 1 /* data */;
+}
+
+
+static int is_oid_pkcs7_enc_data(struct asn1_oid *oid)
+{
+	return is_oid_pkcs7(oid) && oid->oid[6] == 6 /* encryptedData */;
+}
+
+
+static int is_oid_pkcs9(struct asn1_oid *oid)
+{
+	return oid->len >= 6 &&
+		oid->oid[0] == 1 /* iso */ &&
+		oid->oid[1] == 2 /* member-body */ &&
+		oid->oid[2] == 840 /* us */ &&
+		oid->oid[3] == 113549 /* rsadsi */ &&
+		oid->oid[4] == 1 /* pkcs */ &&
+		oid->oid[5] == 9 /* pkcs-9 */;
+}
+
+
+static int is_oid_pkcs9_friendly_name(struct asn1_oid *oid)
+{
+	return oid->len == 7 && is_oid_pkcs9(oid) &&
+		oid->oid[6] == 20;
+}
+
+
+static int is_oid_pkcs9_local_key_id(struct asn1_oid *oid)
+{
+	return oid->len == 7 && is_oid_pkcs9(oid) &&
+		oid->oid[6] == 21;
+}
+
+
+static int is_oid_pkcs9_x509_cert(struct asn1_oid *oid)
+{
+	return oid->len == 8 && is_oid_pkcs9(oid) &&
+		oid->oid[6] == 22 /* certTypes */ &&
+		oid->oid[7] == 1 /* x509Certificate */;
+}
+
+
+static int pkcs12_keybag(struct tlsv1_credentials *cred,
+			 const u8 *buf, size_t len)
+{
+	/* TODO */
+	return 0;
+}
+
+
+static int pkcs12_pkcs8_keybag(struct tlsv1_credentials *cred,
+			       const u8 *buf, size_t len,
+			       const char *passwd)
+{
+	struct crypto_private_key *key;
+
+	/* PKCS8ShroudedKeyBag ::= EncryptedPrivateKeyInfo */
+	key = pkcs8_enc_key_import(buf, len, passwd);
+	if (!key)
+		return -1;
+
+	wpa_printf(MSG_DEBUG,
+		   "PKCS #12: Successfully decrypted PKCS8ShroudedKeyBag");
+	crypto_private_key_free(cred->key);
+	cred->key = key;
+
+	return 0;
+}
+
+
+static int pkcs12_certbag(struct tlsv1_credentials *cred,
+			  const u8 *buf, size_t len)
+{
+	struct asn1_hdr hdr;
+	struct asn1_oid oid;
+	char obuf[80];
+	const u8 *pos, *end;
+
+	/*
+	 * CertBag ::= SEQUENCE {
+	 *     certId      BAG-TYPE.&id   ({CertTypes}),
+	 *     certValue   [0] EXPLICIT BAG-TYPE.&Type ({CertTypes}{@certId})
+	 * }
+	 */
+
+	if (asn1_get_next(buf, len, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_SEQUENCE) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: Expected SEQUENCE (CertBag) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+
+	pos = hdr.payload;
+	end = hdr.payload + hdr.length;
+
+	if (asn1_get_oid(pos, end - pos, &oid, &pos)) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: Failed to parse OID (certId)");
+		return -1;
+	}
+
+	asn1_oid_to_str(&oid, obuf, sizeof(obuf));
+	wpa_printf(MSG_DEBUG, "PKCS #12: certId %s", obuf);
+
+	if (!is_oid_pkcs9_x509_cert(&oid)) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: Ignored unsupported certificate type (certId %s)",
+			   obuf);
+	}
+
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_CONTEXT_SPECIFIC ||
+	    hdr.tag != 0) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: Expected [0] EXPLICIT (certValue) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+
+	if (asn1_get_next(hdr.payload, hdr.length, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_OCTETSTRING) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: Expected OCTET STRING (x509Certificate) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+
+	wpa_hexdump(MSG_DEBUG, "PKCS #12: x509Certificate",
+		    hdr.payload, hdr.length);
+	if (cred->cert) {
+		struct x509_certificate *cert;
+
+		wpa_printf(MSG_DEBUG, "PKCS #12: Ignore extra certificate");
+		cert = x509_certificate_parse(hdr.payload, hdr.length);
+		if (!cert) {
+			wpa_printf(MSG_DEBUG,
+				   "PKCS #12: Failed to parse x509Certificate");
+			return 0;
+		}
+		x509_certificate_chain_free(cert);
+
+		return 0;
+	}
+	return tlsv1_set_cert(cred, NULL, hdr.payload, hdr.length);
+}
+
+
+static int pkcs12_parse_attr_friendly_name(const u8 *pos, const u8 *end)
+{
+	struct asn1_hdr hdr;
+
+	/*
+	 * RFC 2985, 5.5.1:
+	 * friendlyName ATTRIBUTE ::= {
+	 *         WITH SYNTAX BMPString (SIZE(1..pkcs-9-ub-friendlyName))
+	 *         EQUALITY MATCHING RULE caseIgnoreMatch
+	 *         SINGLE VALUE TRUE
+	 *          ID pkcs-9-at-friendlyName
+	 * }
+	 */
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_BMPSTRING) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: Expected BMPSTRING (friendlyName) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return 0;
+	}
+	wpa_hexdump_ascii(MSG_DEBUG, "PKCS #12: friendlyName",
+			  hdr.payload, hdr.length);
+	return 0;
+}
+
+
+static int pkcs12_parse_attr_local_key_id(const u8 *pos, const u8 *end)
+{
+	struct asn1_hdr hdr;
+
+	/*
+	 * RFC 2985, 5.5.2:
+	 * localKeyId ATTRIBUTE ::= {
+	 *         WITH SYNTAX OCTET STRING
+	 *         EQUALITY MATCHING RULE octetStringMatch
+	 *         SINGLE VALUE TRUE
+	 *         ID pkcs-9-at-localKeyId
+	 * }
+	 */
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_OCTETSTRING) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: Expected OCTET STRING (localKeyID) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+	wpa_hexdump_key(MSG_DEBUG, "PKCS #12: localKeyID",
+			hdr.payload, hdr.length);
+	return 0;
+}
+
+
+static int pkcs12_parse_attr(const u8 *pos, size_t len)
+{
+	const u8 *end = pos + len;
+	struct asn1_hdr hdr;
+	struct asn1_oid a_oid;
+	char obuf[80];
+
+	/*
+	 * PKCS12Attribute ::= SEQUENCE {
+	 * attrId      ATTRIBUTE.&id ({PKCS12AttrSet}),
+	 * attrValues  SET OF ATTRIBUTE.&Type ({PKCS12AttrSet}{@attrId})
+	 * }
+	 */
+
+	if (asn1_get_oid(pos, end - pos, &a_oid, &pos)) {
+		wpa_printf(MSG_DEBUG, "PKCS #12: Failed to parse OID (attrId)");
+		return -1;
+	}
+
+	asn1_oid_to_str(&a_oid, obuf, sizeof(obuf));
+	wpa_printf(MSG_DEBUG, "PKCS #12: attrId %s", obuf);
+
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_SET) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: Expected SET (attrValues) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+	wpa_hexdump_key(MSG_MSGDUMP, "PKCS #12: attrValues",
+			hdr.payload, hdr.length);
+	pos = hdr.payload;
+	end = hdr.payload + hdr.length;
+
+	if (is_oid_pkcs9_friendly_name(&a_oid))
+		return pkcs12_parse_attr_friendly_name(pos, end);
+	if (is_oid_pkcs9_local_key_id(&a_oid))
+		return pkcs12_parse_attr_local_key_id(pos, end);
+
+	wpa_printf(MSG_DEBUG, "PKCS #12: Ignore unknown attribute");
+	return 0;
+}
+
+
+static int pkcs12_safebag(struct tlsv1_credentials *cred,
+			  const u8 *buf, size_t len, const char *passwd)
+{
+	struct asn1_hdr hdr;
+	struct asn1_oid oid;
+	char obuf[80];
+	const u8 *pos = buf, *end = buf + len;
+	const u8 *value;
+	size_t value_len;
+
+	wpa_hexdump_key(MSG_MSGDUMP, "PKCS #12: SafeBag", buf, len);
+
+	/* BAG-TYPE ::= TYPE-IDENTIFIER */
+	if (asn1_get_oid(pos, end - pos, &oid, &pos)) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: Failed to parse OID (BAG-TYPE)");
+		return -1;
+	}
+
+	asn1_oid_to_str(&oid, obuf, sizeof(obuf));
+	wpa_printf(MSG_DEBUG, "PKCS #12: BAG-TYPE %s", obuf);
+
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_CONTEXT_SPECIFIC ||
+	    hdr.tag != 0) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: Expected [0] EXPLICIT (bagValue) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return 0;
+	}
+	value = hdr.payload;
+	value_len = hdr.length;
+	wpa_hexdump_key(MSG_MSGDUMP, "PKCS #12: bagValue", value, value_len);
+	pos = hdr.payload + hdr.length;
+
+	if (pos < end) {
+		/* bagAttributes  SET OF PKCS12Attribute OPTIONAL */
+		if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+		    hdr.class != ASN1_CLASS_UNIVERSAL ||
+		    hdr.tag != ASN1_TAG_SET) {
+			wpa_printf(MSG_DEBUG,
+				   "PKCS #12: Expected SET (bagAttributes) - found class %d tag 0x%x",
+				   hdr.class, hdr.tag);
+			return -1;
+		}
+		wpa_hexdump_key(MSG_MSGDUMP, "PKCS #12: bagAttributes",
+				hdr.payload, hdr.length);
+
+		pos = hdr.payload;
+		end = hdr.payload + hdr.length;
+		while (pos < end) {
+			/* PKCS12Attribute ::= SEQUENCE */
+			if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+			    hdr.class != ASN1_CLASS_UNIVERSAL ||
+			    hdr.tag != ASN1_TAG_SEQUENCE) {
+				wpa_printf(MSG_DEBUG,
+					   "PKCS #12: Expected SEQUENCE (PKCS12Attribute) - found class %d tag 0x%x",
+					   hdr.class, hdr.tag);
+				return -1;
+			}
+			if (pkcs12_parse_attr(hdr.payload, hdr.length) < 0)
+				return -1;
+			pos = hdr.payload + hdr.length;
+		}
+	}
+
+	if (pkcs12_is_bagtype_oid(&oid, 1))
+		return pkcs12_keybag(cred, value, value_len);
+	if (pkcs12_is_bagtype_oid(&oid, 2))
+		return pkcs12_pkcs8_keybag(cred, value, value_len, passwd);
+	if (pkcs12_is_bagtype_oid(&oid, 3))
+		return pkcs12_certbag(cred, value, value_len);
+
+	wpa_printf(MSG_DEBUG, "PKCS #12: Ignore unsupported BAG-TYPE");
+	return 0;
+}
+
+
+static int pkcs12_safecontents(struct tlsv1_credentials *cred,
+			       const u8 *buf, size_t len,
+			       const char *passwd)
+{
+	struct asn1_hdr hdr;
+	const u8 *pos, *end;
+
+	/* SafeContents ::= SEQUENCE OF SafeBag */
+	if (asn1_get_next(buf, len, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_SEQUENCE) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: Expected SEQUENCE (SafeContents) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+	pos = hdr.payload;
+	end = hdr.payload + hdr.length;
+
+	/*
+	 * SafeBag ::= SEQUENCE {
+	 *   bagId          BAG-TYPE.&id ({PKCS12BagSet})
+	 *   bagValue       [0] EXPLICIT BAG-TYPE.&Type({PKCS12BagSet}{@bagId}),
+	 *   bagAttributes  SET OF PKCS12Attribute OPTIONAL
+	 * }
+	 */
+
+	while (pos < end) {
+		if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+		    hdr.class != ASN1_CLASS_UNIVERSAL ||
+		    hdr.tag != ASN1_TAG_SEQUENCE) {
+			wpa_printf(MSG_DEBUG,
+				   "PKCS #12: Expected SEQUENCE (SafeBag) - found class %d tag 0x%x",
+				   hdr.class, hdr.tag);
+			return -1;
+		}
+		if (pkcs12_safebag(cred, hdr.payload, hdr.length, passwd) < 0)
+			return -1;
+		pos = hdr.payload + hdr.length;
+	}
+
+	return 0;
+}
+
+
+static int pkcs12_parse_content_data(struct tlsv1_credentials *cred,
+				     const u8 *pos, const u8 *end,
+				     const char *passwd)
+{
+	struct asn1_hdr hdr;
+
+	/* Data ::= OCTET STRING */
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_OCTETSTRING) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: Expected OCTET STRING (Data) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+
+	wpa_hexdump(MSG_MSGDUMP, "PKCS #12: Data", hdr.payload, hdr.length);
+
+	return pkcs12_safecontents(cred, hdr.payload, hdr.length, passwd);
+}
+
+
+static int pkcs12_parse_content_enc_data(struct tlsv1_credentials *cred,
+					 const u8 *pos, const u8 *end,
+					 const char *passwd)
+{
+	struct asn1_hdr hdr;
+	struct asn1_oid oid;
+	char buf[80];
+	const u8 *enc_alg;
+	u8 *data;
+	size_t enc_alg_len, data_len;
+	int res = -1;
+
+	/*
+	 * EncryptedData ::= SEQUENCE {
+	 *   version Version,
+	 *   encryptedContentInfo EncryptedContentInfo }
+	 */
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_SEQUENCE) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: Expected SEQUENCE (EncryptedData) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return 0;
+	}
+	pos = hdr.payload;
+
+	/* Version ::= INTEGER */
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL || hdr.tag != ASN1_TAG_INTEGER) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: No INTEGER tag found for version; class=%d tag=0x%x",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+	if (hdr.length != 1 || hdr.payload[0] != 0) {
+		wpa_printf(MSG_DEBUG, "PKCS #12: Unrecognized PKCS #7 version");
+		return -1;
+	}
+	pos = hdr.payload + hdr.length;
+
+	wpa_hexdump(MSG_MSGDUMP, "PKCS #12: EncryptedContentInfo",
+		    pos, end - pos);
+
+	/*
+	 * EncryptedContentInfo ::= SEQUENCE {
+	 *   contentType ContentType,
+	 *   contentEncryptionAlgorithm ContentEncryptionAlgorithmIdentifier,
+	 *   encryptedContent [0] IMPLICIT EncryptedContent OPTIONAL }
+	 */
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_SEQUENCE) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: Expected SEQUENCE (EncryptedContentInfo) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+
+	pos = hdr.payload;
+	end = pos + hdr.length;
+
+	/* ContentType ::= OBJECT IDENTIFIER */
+	if (asn1_get_oid(pos, end - pos, &oid, &pos)) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: Could not find OBJECT IDENTIFIER (contentType)");
+		return -1;
+	}
+	asn1_oid_to_str(&oid, buf, sizeof(buf));
+	wpa_printf(MSG_DEBUG, "PKCS #12: EncryptedContentInfo::contentType %s",
+		   buf);
+
+	if (!is_oid_pkcs7_data(&oid)) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: Unsupported EncryptedContentInfo::contentType %s",
+			   buf);
+		return 0;
+	}
+
+	/* ContentEncryptionAlgorithmIdentifier ::= AlgorithmIdentifier */
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_SEQUENCE) {
+		wpa_printf(MSG_DEBUG, "PKCS #12: Expected SEQUENCE (ContentEncryptionAlgorithmIdentifier) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+	enc_alg = hdr.payload;
+	enc_alg_len = hdr.length;
+	pos = hdr.payload + hdr.length;
+
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_CONTEXT_SPECIFIC ||
+	    hdr.tag != 0) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: Expected [0] IMPLICIT (encryptedContent) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+
+	/* EncryptedContent ::= OCTET STRING */
+	data = pkcs5_decrypt(enc_alg, enc_alg_len, hdr.payload, hdr.length,
+			     passwd, &data_len);
+	if (data) {
+		wpa_hexdump_key(MSG_MSGDUMP,
+				"PKCS #12: Decrypted encryptedContent",
+				data, data_len);
+		res = pkcs12_safecontents(cred, data, data_len, passwd);
+		os_free(data);
+	}
+
+	return res;
+}
+
+
+static int pkcs12_parse_content(struct tlsv1_credentials *cred,
+				const u8 *buf, size_t len,
+				const char *passwd)
+{
+	const u8 *pos = buf;
+	const u8 *end = buf + len;
+	struct asn1_oid oid;
+	char txt[80];
+	struct asn1_hdr hdr;
+
+	wpa_hexdump(MSG_MSGDUMP, "PKCS #12: ContentInfo", buf, len);
+
+	if (asn1_get_oid(pos, end - pos, &oid, &pos)) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: Could not find OBJECT IDENTIFIER (contentType)");
+		return 0;
+	}
+
+	asn1_oid_to_str(&oid, txt, sizeof(txt));
+	wpa_printf(MSG_DEBUG, "PKCS #12: contentType %s", txt);
+
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_CONTEXT_SPECIFIC ||
+	    hdr.tag != 0) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: Expected [0] EXPLICIT (content) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return 0;
+	}
+	pos = hdr.payload;
+
+	if (is_oid_pkcs7_data(&oid))
+		return pkcs12_parse_content_data(cred, pos, end, passwd);
+	if (is_oid_pkcs7_enc_data(&oid))
+		return pkcs12_parse_content_enc_data(cred, pos, end, passwd);
+
+	wpa_printf(MSG_DEBUG, "PKCS #12: Ignored unsupported contentType %s",
+		   txt);
+
+	return 0;
+}
+
+
+static int pkcs12_parse(struct tlsv1_credentials *cred,
+			const u8 *key, size_t len, const char *passwd)
+{
+	struct asn1_hdr hdr;
+	const u8 *pos, *end;
+	struct asn1_oid oid;
+	char buf[80];
+
+	/*
+	 * PFX ::= SEQUENCE {
+	 *     version     INTEGER {v3(3)}(v3,...),
+	 *     authSafe    ContentInfo,
+	 *     macData     MacData OPTIONAL
+	 * }
+	 */
+
+	if (asn1_get_next(key, len, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_SEQUENCE) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: Expected SEQUENCE (PFX) - found class %d tag 0x%x; assume PKCS #12 not used",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+
+	pos = hdr.payload;
+	end = pos + hdr.length;
+
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL || hdr.tag != ASN1_TAG_INTEGER) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: No INTEGER tag found for version; class=%d tag=0x%x",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+	if (hdr.length != 1 || hdr.payload[0] != 3) {
+		wpa_printf(MSG_DEBUG, "PKCS #12: Unrecognized version");
+		return -1;
+	}
+	pos = hdr.payload + hdr.length;
+
+	/*
+	 * ContentInfo ::= SEQUENCE {
+	 *   contentType ContentType,
+	 *   content [0] EXPLICIT ANY DEFINED BY contentType OPTIONAL }
+	 */
+
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_SEQUENCE) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: Expected SEQUENCE (authSafe) - found class %d tag 0x%x; assume PKCS #12 not used",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+
+	pos = hdr.payload;
+	end = pos + hdr.length;
+
+	/* ContentType ::= OBJECT IDENTIFIER */
+	if (asn1_get_oid(pos, end - pos, &oid, &pos)) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: Could not find OBJECT IDENTIFIER (contentType); assume PKCS #12 not used");
+		return -1;
+	}
+	asn1_oid_to_str(&oid, buf, sizeof(buf));
+	wpa_printf(MSG_DEBUG, "PKCS #12: contentType %s", buf);
+	if (!is_oid_pkcs7_data(&oid)) {
+		wpa_printf(MSG_DEBUG, "PKCS #12: Unsupported contentType %s",
+			   buf);
+		return -1;
+	}
+
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_CONTEXT_SPECIFIC ||
+	    hdr.tag != 0) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: Expected [0] EXPLICIT (content) - found class %d tag 0x%x; assume PKCS #12 not used",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+
+	pos = hdr.payload;
+
+	/* Data ::= OCTET STRING */
+	if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_OCTETSTRING) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: Expected OCTET STRING (Data) - found class %d tag 0x%x; assume PKCS #12 not used",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+
+	/*
+	 * AuthenticatedSafe ::= SEQUENCE OF ContentInfo
+	 *     -- Data if unencrypted
+	 *     -- EncryptedData if password-encrypted
+	 *     -- EnvelopedData if public key-encrypted
+	 */
+	wpa_hexdump(MSG_MSGDUMP, "PKCS #12: Data content",
+		    hdr.payload, hdr.length);
+
+	if (asn1_get_next(hdr.payload, hdr.length, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_SEQUENCE) {
+		wpa_printf(MSG_DEBUG,
+			   "PKCS #12: Expected SEQUENCE within Data content - found class %d tag 0x%x; assume PKCS #12 not used",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+
+	pos = hdr.payload;
+	end = pos + hdr.length;
+
+	while (end > pos) {
+		if (asn1_get_next(pos, end - pos, &hdr) < 0 ||
+		    hdr.class != ASN1_CLASS_UNIVERSAL ||
+		    hdr.tag != ASN1_TAG_SEQUENCE) {
+			wpa_printf(MSG_DEBUG,
+				   "PKCS #12: Expected SEQUENCE (ContentInfo) - found class %d tag 0x%x; assume PKCS #12 not used",
+				   hdr.class, hdr.tag);
+			return -1;
+		}
+		if (pkcs12_parse_content(cred, hdr.payload, hdr.length,
+					 passwd) < 0)
+			return -1;
+
+		pos = hdr.payload + hdr.length;
+	}
+
+	return 0;
+}
+
+#endif /* PKCS12_FUNCS */
+
+
 static int tlsv1_set_key(struct tlsv1_credentials *cred,
 			 const u8 *key, size_t len, const char *passwd)
 {
@@ -296,6 +1067,10 @@ static int tlsv1_set_key(struct tlsv1_credentials *cred,
 		cred->key = tlsv1_set_key_pem(key, len);
 	if (cred->key == NULL)
 		cred->key = tlsv1_set_key_enc_pem(key, len, passwd);
+#ifdef PKCS12_FUNCS
+	if (!cred->key)
+		pkcs12_parse(cred, key, len, passwd);
+#endif /* PKCS12_FUNCS */
 	if (cred->key == NULL) {
 		wpa_printf(MSG_INFO, "TLSv1: Failed to parse private key");
 		return -1;
diff --git a/src/tls/tlsv1_cred.h b/src/tls/tlsv1_cred.h
index 68fbdc9230084..716e93c39006c 100644
--- a/src/tls/tlsv1_cred.h
+++ b/src/tls/tlsv1_cred.h
@@ -14,11 +14,19 @@ struct tlsv1_credentials {
 	struct x509_certificate *cert;
 	struct crypto_private_key *key;
 
+	unsigned int cert_probe:1;
+	unsigned int ca_cert_verify:1;
+	unsigned int server_cert_only:1;
+	u8 srv_cert_hash[32];
+
 	/* Diffie-Hellman parameters */
 	u8 *dh_p; /* prime */
 	size_t dh_p_len;
 	u8 *dh_g; /* generator */
 	size_t dh_g_len;
+
+	char *ocsp_stapling_response;
+	char *ocsp_stapling_response_multi;
 };
 
 
diff --git a/src/tls/tlsv1_server_i.h b/src/tls/tlsv1_server_i.h
index 96d79b3a8ba25..29c6678772150 100644
--- a/src/tls/tlsv1_server_i.h
+++ b/src/tls/tlsv1_server_i.h
@@ -55,6 +55,9 @@ struct tlsv1_server {
 	void *log_cb_ctx;
 
 	int use_session_ticket;
+	unsigned int status_request:1;
+	unsigned int status_request_v2:1;
+	unsigned int status_request_multi:1;
 
 	u8 *dh_secret;
 	size_t dh_secret_len;
diff --git a/src/tls/tlsv1_server_read.c b/src/tls/tlsv1_server_read.c
index 0f237baff9db6..4aa8a019f3e6e 100644
--- a/src/tls/tlsv1_server_read.c
+++ b/src/tls/tlsv1_server_read.c
@@ -46,6 +46,78 @@ static int testing_cipher_suite_filter(struct tlsv1_server *conn, u16 suite)
 }
 
 
+static void tls_process_status_request_item(struct tlsv1_server *conn,
+					    const u8 *req, size_t req_len)
+{
+	const u8 *pos, *end;
+	u8 status_type;
+
+	pos = req;
+	end = req + req_len;
+
+	/*
+	 * RFC 6961, 2.2:
+	 * struct {
+	 *   CertificateStatusType status_type;
+	 *   uint16 request_length;
+	 *   select (status_type) {
+	 *     case ocsp: OCSPStatusRequest;
+	 *     case ocsp_multi: OCSPStatusRequest;
+	 *   } request;
+	 * } CertificateStatusRequestItemV2;
+	 *
+	 * enum { ocsp(1), ocsp_multi(2), (255) } CertificateStatusType;
+	 */
+
+	if (end - pos < 1)
+		return; /* Truncated data */
+
+	status_type = *pos++;
+	wpa_printf(MSG_DEBUG, "TLSv1: CertificateStatusType %u", status_type);
+	if (status_type != 1 && status_type != 2)
+		return; /* Unsupported status type */
+	/*
+	 * For now, only OCSP stapling is supported, so ignore the specific
+	 * request, if any.
+	 */
+	wpa_hexdump(MSG_DEBUG, "TLSv1: OCSPStatusRequest", pos, end - pos);
+
+	if (status_type == 2)
+		conn->status_request_multi = 1;
+}
+
+
+static void tls_process_status_request_v2(struct tlsv1_server *conn,
+					  const u8 *ext, size_t ext_len)
+{
+	const u8 *pos, *end;
+
+	conn->status_request_v2 = 1;
+
+	pos = ext;
+	end = ext + ext_len;
+
+	/*
+	 * RFC 6961, 2.2:
+	 * struct {
+	 *   CertificateStatusRequestItemV2
+	 *                    certificate_status_req_list<1..2^16-1>;
+	 * } CertificateStatusRequestListV2;
+	 */
+
+	while (end - pos >= 2) {
+		u16 len;
+
+		len = WPA_GET_BE16(pos);
+		pos += 2;
+		if (len > end - pos)
+			break; /* Truncated data */
+		tls_process_status_request_item(conn, pos, len);
+		pos += len;
+	}
+}
+
+
 static int tls_process_client_hello(struct tlsv1_server *conn, u8 ct,
 				    const u8 *in_data, size_t *in_len)
 {
@@ -267,6 +339,11 @@ static int tls_process_client_hello(struct tlsv1_server *conn, u8 ct,
 						  ext_len);
 					conn->session_ticket_len = ext_len;
 				}
+			} else if (ext_type == TLS_EXT_STATUS_REQUEST) {
+				conn->status_request = 1;
+			} else if (ext_type == TLS_EXT_STATUS_REQUEST_V2) {
+				tls_process_status_request_v2(conn, pos,
+							      ext_len);
 			}
 
 			pos += ext_len;
@@ -471,6 +548,15 @@ static int tls_process_certificate(struct tlsv1_server *conn, u8 ct,
 		return -1;
 	}
 
+	if (chain && (chain->extensions_present & X509_EXT_EXT_KEY_USAGE) &&
+	    !(chain->ext_key_usage &
+	      (X509_EXT_KEY_USAGE_ANY | X509_EXT_KEY_USAGE_CLIENT_AUTH))) {
+		tlsv1_server_alert(conn, TLS_ALERT_LEVEL_FATAL,
+				   TLS_ALERT_BAD_CERTIFICATE);
+		x509_certificate_chain_free(chain);
+		return -1;
+	}
+
 	x509_certificate_chain_free(chain);
 
 	*in_len = end - in_data;
diff --git a/src/tls/tlsv1_server_write.c b/src/tls/tlsv1_server_write.c
index 15e6692178ff8..bdc6c11992384 100644
--- a/src/tls/tlsv1_server_write.c
+++ b/src/tls/tlsv1_server_write.c
@@ -42,7 +42,7 @@ static size_t tls_server_cert_chain_der_len(struct tlsv1_server *conn)
 static int tls_write_server_hello(struct tlsv1_server *conn,
 				  u8 **msgpos, u8 *end)
 {
-	u8 *pos, *rhdr, *hs_start, *hs_length;
+	u8 *pos, *rhdr, *hs_start, *hs_length, *ext_start;
 	struct os_time now;
 	size_t rlen;
 
@@ -97,6 +97,32 @@ static int tls_write_server_hello(struct tlsv1_server *conn,
 	/* CompressionMethod compression_method */
 	*pos++ = TLS_COMPRESSION_NULL;
 
+	/* Extension */
+	ext_start = pos;
+	pos += 2;
+
+	if (conn->status_request) {
+		/* Add a status_request extension with empty extension_data */
+		/* ExtensionsType extension_type = status_request(5) */
+		WPA_PUT_BE16(pos, TLS_EXT_STATUS_REQUEST);
+		pos += 2;
+		/* opaque extension_data<0..2^16-1> length */
+		WPA_PUT_BE16(pos, 0);
+		pos += 2;
+	}
+
+	if (conn->status_request_v2) {
+		/*
+		  Add a status_request_v2 extension with empty extension_data
+		*/
+		/* ExtensionsType extension_type = status_request_v2(17) */
+		WPA_PUT_BE16(pos, TLS_EXT_STATUS_REQUEST_V2);
+		pos += 2;
+		/* opaque extension_data<0..2^16-1> length */
+		WPA_PUT_BE16(pos, 0);
+		pos += 2;
+	}
+
 	if (conn->session_ticket && conn->session_ticket_cb) {
 		int res = conn->session_ticket_cb(
 			conn->session_ticket_cb_ctx,
@@ -133,6 +159,11 @@ static int tls_write_server_hello(struct tlsv1_server *conn,
 		 */
 	}
 
+	if (pos == ext_start + 2)
+		pos -= 2; /* no extensions */
+	else
+		WPA_PUT_BE16(ext_start, pos - ext_start - 2);
+
 	WPA_PUT_BE24(hs_length, pos - hs_length - 3);
 	tls_verify_hash_add(&conn->verify, hs_start, pos - hs_start);
 
@@ -168,6 +199,11 @@ static int tls_write_server_certificate(struct tlsv1_server *conn,
 	}
 
 	pos = *msgpos;
+	if (TLS_RECORD_HEADER_LEN + 1 + 3 + 3 > end - pos) {
+		tlsv1_server_alert(conn, TLS_ALERT_LEVEL_FATAL,
+				   TLS_ALERT_INTERNAL_ERROR);
+		return -1;
+	}
 
 	tlsv1_server_log(conn, "Send Certificate");
 	rhdr = pos;
@@ -188,7 +224,7 @@ static int tls_write_server_certificate(struct tlsv1_server *conn,
 	pos += 3;
 	cert = conn->cred->cert;
 	while (cert) {
-		if (pos + 3 + cert->cert_len > end) {
+		if (3 + cert->cert_len > (size_t) (end - pos)) {
 			wpa_printf(MSG_DEBUG, "TLSv1: Not enough buffer space "
 				   "for Certificate (cert_len=%lu left=%lu)",
 				   (unsigned long) cert->cert_len,
@@ -239,6 +275,93 @@ static int tls_write_server_certificate(struct tlsv1_server *conn,
 }
 
 
+static int tls_write_server_certificate_status(struct tlsv1_server *conn,
+					       u8 **msgpos, u8 *end,
+					       int ocsp_multi,
+					       char *ocsp_resp,
+					       size_t ocsp_resp_len)
+{
+	u8 *pos, *rhdr, *hs_start, *hs_length;
+	size_t rlen;
+
+	if (!ocsp_resp) {
+		 /*
+		  * Client did not request certificate status or there is no
+		  * matching response cached.
+		  */
+		return 0;
+	}
+
+	pos = *msgpos;
+	if (TLS_RECORD_HEADER_LEN + 1 + 3 + 1 + 3 + ocsp_resp_len >
+	    (unsigned int) (end - pos)) {
+		tlsv1_server_alert(conn, TLS_ALERT_LEVEL_FATAL,
+				   TLS_ALERT_INTERNAL_ERROR);
+		return -1;
+	}
+
+	tlsv1_server_log(conn, "Send CertificateStatus (multi=%d)", ocsp_multi);
+	rhdr = pos;
+	pos += TLS_RECORD_HEADER_LEN;
+
+	/* opaque fragment[TLSPlaintext.length] */
+
+	/* Handshake */
+	hs_start = pos;
+	/* HandshakeType msg_type */
+	*pos++ = TLS_HANDSHAKE_TYPE_CERTIFICATE_STATUS;
+	/* uint24 length (to be filled) */
+	hs_length = pos;
+	pos += 3;
+
+	/* body - CertificateStatus
+	 *
+	 * struct {
+	 *     CertificateStatusType status_type;
+	 *     select (status_type) {
+	 *         case ocsp: OCSPResponse;
+	 *         case ocsp_multi: OCSPResponseList;
+	 *     } response;
+	 * } CertificateStatus;
+	 *
+	 * opaque OCSPResponse<1..2^24-1>;
+	 *
+	 * struct {
+	 *   OCSPResponse ocsp_response_list<1..2^24-1>;
+	 * } OCSPResponseList;
+	 */
+
+	/* CertificateStatusType status_type */
+	if (ocsp_multi)
+		*pos++ = 2; /* ocsp_multi(2) */
+	else
+		*pos++ = 1; /* ocsp(1) */
+	/* uint24 length of OCSPResponse */
+	WPA_PUT_BE24(pos, ocsp_resp_len);
+	pos += 3;
+	os_memcpy(pos, ocsp_resp, ocsp_resp_len);
+	pos += ocsp_resp_len;
+
+	WPA_PUT_BE24(hs_length, pos - hs_length - 3);
+
+	if (tlsv1_record_send(&conn->rl, TLS_CONTENT_TYPE_HANDSHAKE,
+			      rhdr, end - rhdr, hs_start, pos - hs_start,
+			      &rlen) < 0) {
+		wpa_printf(MSG_DEBUG, "TLSv1: Failed to generate a record");
+		tlsv1_server_alert(conn, TLS_ALERT_LEVEL_FATAL,
+				   TLS_ALERT_INTERNAL_ERROR);
+		return -1;
+	}
+	pos = rhdr + rlen;
+
+	tls_verify_hash_add(&conn->verify, hs_start, pos - hs_start);
+
+	*msgpos = pos;
+
+	return 0;
+}
+
+
 static int tls_write_server_key_exchange(struct tlsv1_server *conn,
 					 u8 **msgpos, u8 *end)
 {
@@ -371,7 +494,7 @@ static int tls_write_server_key_exchange(struct tlsv1_server *conn,
 	/* body - ServerDHParams */
 	server_params = pos;
 	/* dh_p */
-	if (pos + 2 + dh_p_len > end) {
+	if (2 + dh_p_len > (size_t) (end - pos)) {
 		wpa_printf(MSG_DEBUG, "TLSv1: Not enough buffer space for "
 			   "dh_p");
 		tlsv1_server_alert(conn, TLS_ALERT_LEVEL_FATAL,
@@ -385,7 +508,7 @@ static int tls_write_server_key_exchange(struct tlsv1_server *conn,
 	pos += dh_p_len;
 
 	/* dh_g */
-	if (pos + 2 + conn->cred->dh_g_len > end) {
+	if (2 + conn->cred->dh_g_len > (size_t) (end - pos)) {
 		wpa_printf(MSG_DEBUG, "TLSv1: Not enough buffer space for "
 			   "dh_g");
 		tlsv1_server_alert(conn, TLS_ALERT_LEVEL_FATAL,
@@ -399,7 +522,7 @@ static int tls_write_server_key_exchange(struct tlsv1_server *conn,
 	pos += conn->cred->dh_g_len;
 
 	/* dh_Ys */
-	if (pos + 2 + dh_ys_len > end) {
+	if (2 + dh_ys_len > (size_t) (end - pos)) {
 		wpa_printf(MSG_DEBUG, "TLSv1: Not enough buffer space for "
 			   "dh_Ys");
 		tlsv1_server_alert(conn, TLS_ALERT_LEVEL_FATAL,
@@ -443,7 +566,8 @@ static int tls_write_server_key_exchange(struct tlsv1_server *conn,
 		if (conn->rl.tls_version >= TLS_VERSION_1_2) {
 #ifdef CONFIG_TLSV12
 			hlen = tlsv12_key_x_server_params_hash(
-				conn->rl.tls_version, conn->client_random,
+				conn->rl.tls_version, TLS_HASH_ALG_SHA256,
+				conn->client_random,
 				conn->server_random, server_params,
 				pos - server_params, hash + 19);
 
@@ -457,7 +581,7 @@ static int tls_write_server_key_exchange(struct tlsv1_server *conn,
 			 *   SignatureAlgorithm signature;
 			 * } SignatureAndHashAlgorithm;
 			 */
-			if (hlen < 0 || pos + 2 > end) {
+			if (hlen < 0 || end - pos < 2) {
 				tlsv1_server_alert(conn, TLS_ALERT_LEVEL_FATAL,
 						   TLS_ALERT_INTERNAL_ERROR);
 				return -1;
@@ -804,24 +928,46 @@ static u8 * tls_send_server_hello(struct tlsv1_server *conn, size_t *out_len)
 {
 	u8 *msg, *end, *pos;
 	size_t msglen;
+	int ocsp_multi = 0;
+	char *ocsp_resp = NULL;
+	size_t ocsp_resp_len = 0;
 
 	*out_len = 0;
 
-	msglen = 1000 + tls_server_cert_chain_der_len(conn);
+	if (conn->status_request_multi &&
+	    conn->cred->ocsp_stapling_response_multi) {
+		ocsp_resp = os_readfile(
+			conn->cred->ocsp_stapling_response_multi,
+			&ocsp_resp_len);
+		ocsp_multi = 1;
+	} else if ((conn->status_request || conn->status_request_v2) &&
+		   conn->cred->ocsp_stapling_response) {
+		ocsp_resp = os_readfile(conn->cred->ocsp_stapling_response,
+					&ocsp_resp_len);
+	}
+	if (!ocsp_resp)
+		ocsp_resp_len = 0;
+
+	msglen = 1000 + tls_server_cert_chain_der_len(conn) + ocsp_resp_len;
 
 	msg = os_malloc(msglen);
-	if (msg == NULL)
+	if (msg == NULL) {
+		os_free(ocsp_resp);
 		return NULL;
+	}
 
 	pos = msg;
 	end = msg + msglen;
 
 	if (tls_write_server_hello(conn, &pos, end) < 0) {
 		os_free(msg);
+		os_free(ocsp_resp);
 		return NULL;
 	}
 
 	if (conn->use_session_ticket) {
+		os_free(ocsp_resp);
+
 		/* Abbreviated handshake using session ticket; RFC 4507 */
 		if (tls_write_server_change_cipher_spec(conn, &pos, end) < 0 ||
 		    tls_write_server_finished(conn, &pos, end) < 0) {
@@ -838,12 +984,16 @@ static u8 * tls_send_server_hello(struct tlsv1_server *conn, size_t *out_len)
 
 	/* Full handshake */
 	if (tls_write_server_certificate(conn, &pos, end) < 0 ||
+	    tls_write_server_certificate_status(conn, &pos, end, ocsp_multi,
+						ocsp_resp, ocsp_resp_len) < 0 ||
 	    tls_write_server_key_exchange(conn, &pos, end) < 0 ||
 	    tls_write_server_certificate_request(conn, &pos, end) < 0 ||
 	    tls_write_server_hello_done(conn, &pos, end) < 0) {
 		os_free(msg);
+		os_free(ocsp_resp);
 		return NULL;
 	}
+	os_free(ocsp_resp);
 
 	*out_len = pos - msg;
 
diff --git a/src/tls/x509v3.c b/src/tls/x509v3.c
index b51dfcd447320..75f222c4f2495 100644
--- a/src/tls/x509v3.c
+++ b/src/tls/x509v3.c
@@ -1,6 +1,6 @@
 /*
  * X.509v3 certificate parsing and processing (RFC 3280 profile)
- * Copyright (c) 2006-2011, Jouni Malinen <j@w1.fi>
+ * Copyright (c) 2006-2015, Jouni Malinen <j@w1.fi>
  *
  * This software may be distributed under the terms of the BSD license.
  * See README for more details.
@@ -14,7 +14,7 @@
 #include "x509v3.h"
 
 
-static void x509_free_name(struct x509_name *name)
+void x509_free_name(struct x509_name *name)
 {
 	size_t i;
 
@@ -55,6 +55,7 @@ void x509_certificate_free(struct x509_certificate *cert)
 	x509_free_name(&cert->subject);
 	os_free(cert->public_key);
 	os_free(cert->sign_value);
+	os_free(cert->subject_dn);
 	os_free(cert);
 }
 
@@ -177,9 +178,9 @@ int x509_name_compare(struct x509_name *a, struct x509_name *b)
 }
 
 
-static int x509_parse_algorithm_identifier(
-	const u8 *buf, size_t len,
-	struct x509_algorithm_identifier *id, const u8 **next)
+int x509_parse_algorithm_identifier(const u8 *buf, size_t len,
+				    struct x509_algorithm_identifier *id,
+				    const u8 **next)
 {
 	struct asn1_hdr hdr;
 	const u8 *pos, *end;
@@ -199,12 +200,11 @@ static int x509_parse_algorithm_identifier(
 			   hdr.class, hdr.tag);
 		return -1;
 	}
+	if (hdr.length > buf + len - hdr.payload)
+		return -1;
 	pos = hdr.payload;
 	end = pos + hdr.length;
 
-	if (end > buf + len)
-		return -1;
-
 	*next = end;
 
 	if (asn1_get_oid(pos, end - pos, &id->oid, &pos))
@@ -243,7 +243,7 @@ static int x509_parse_public_key(const u8 *buf, size_t len,
 	}
 	pos = hdr.payload;
 
-	if (pos + hdr.length > end)
+	if (hdr.length > end - pos)
 		return -1;
 	end = pos + hdr.length;
 	*next = end;
@@ -289,8 +289,8 @@ static int x509_parse_public_key(const u8 *buf, size_t len,
 }
 
 
-static int x509_parse_name(const u8 *buf, size_t len, struct x509_name *name,
-			   const u8 **next)
+int x509_parse_name(const u8 *buf, size_t len, struct x509_name *name,
+		    const u8 **next)
 {
 	struct asn1_hdr hdr;
 	const u8 *pos, *end, *set_pos, *set_end, *seq_pos, *seq_end;
@@ -319,7 +319,7 @@ static int x509_parse_name(const u8 *buf, size_t len, struct x509_name *name,
 	}
 	pos = hdr.payload;
 
-	if (pos + hdr.length > buf + len)
+	if (hdr.length > buf + len - pos)
 		return -1;
 
 	end = *next = pos + hdr.length;
@@ -537,8 +537,7 @@ done:
 }
 
 
-static int x509_parse_time(const u8 *buf, size_t len, u8 asn1_tag,
-			   os_time_t *val)
+int x509_parse_time(const u8 *buf, size_t len, u8 asn1_tag, os_time_t *val)
 {
 	const char *pos;
 	int year, month, day, hour, min, sec;
@@ -677,7 +676,7 @@ static int x509_parse_validity(const u8 *buf, size_t len,
 	pos = hdr.payload;
 	plen = hdr.length;
 
-	if (pos + plen > buf + len)
+	if (plen > (size_t) (buf + len - pos))
 		return -1;
 
 	*next = pos + plen;
@@ -721,6 +720,15 @@ static int x509_id_ce_oid(struct asn1_oid *oid)
 }
 
 
+static int x509_any_ext_key_usage_oid(struct asn1_oid *oid)
+{
+	return oid->len == 6 &&
+		x509_id_ce_oid(oid) &&
+		oid->oid[3] == 37 /* extKeyUsage */ &&
+		oid->oid[4] == 0 /* anyExtendedKeyUsage */;
+}
+
+
 static int x509_parse_ext_key_usage(struct x509_certificate *cert,
 				    const u8 *pos, size_t len)
 {
@@ -801,7 +809,7 @@ static int x509_parse_ext_basic_constraints(struct x509_certificate *cert,
 		}
 		cert->ca = hdr.payload[0];
 
-		if (hdr.payload + hdr.length == pos + len) {
+		if (hdr.length == pos + len - hdr.payload) {
 			wpa_printf(MSG_DEBUG, "X509: BasicConstraints - cA=%d",
 				   cert->ca);
 			return 0;
@@ -1074,6 +1082,112 @@ static int x509_parse_ext_issuer_alt_name(struct x509_certificate *cert,
 }
 
 
+static int x509_id_pkix_oid(struct asn1_oid *oid)
+{
+	return oid->len >= 7 &&
+		oid->oid[0] == 1 /* iso */ &&
+		oid->oid[1] == 3 /* identified-organization */ &&
+		oid->oid[2] == 6 /* dod */ &&
+		oid->oid[3] == 1 /* internet */ &&
+		oid->oid[4] == 5 /* security */ &&
+		oid->oid[5] == 5 /* mechanisms */ &&
+		oid->oid[6] == 7 /* id-pkix */;
+}
+
+
+static int x509_id_kp_oid(struct asn1_oid *oid)
+{
+	/* id-kp */
+	return oid->len >= 8 &&
+		x509_id_pkix_oid(oid) &&
+		oid->oid[7] == 3 /* id-kp */;
+}
+
+
+static int x509_id_kp_server_auth_oid(struct asn1_oid *oid)
+{
+	/* id-kp */
+	return oid->len == 9 &&
+		x509_id_kp_oid(oid) &&
+		oid->oid[8] == 1 /* id-kp-serverAuth */;
+}
+
+
+static int x509_id_kp_client_auth_oid(struct asn1_oid *oid)
+{
+	/* id-kp */
+	return oid->len == 9 &&
+		x509_id_kp_oid(oid) &&
+		oid->oid[8] == 2 /* id-kp-clientAuth */;
+}
+
+
+static int x509_id_kp_ocsp_oid(struct asn1_oid *oid)
+{
+	/* id-kp */
+	return oid->len == 9 &&
+		x509_id_kp_oid(oid) &&
+		oid->oid[8] == 9 /* id-kp-OCSPSigning */;
+}
+
+
+static int x509_parse_ext_ext_key_usage(struct x509_certificate *cert,
+					const u8 *pos, size_t len)
+{
+	struct asn1_hdr hdr;
+	const u8 *end;
+	struct asn1_oid oid;
+
+	/*
+	 * ExtKeyUsageSyntax ::= SEQUENCE SIZE (1..MAX) OF KeyPurposeId
+	 *
+	 * KeyPurposeId ::= OBJECT IDENTIFIER
+	 */
+
+	if (asn1_get_next(pos, len, &hdr) < 0 ||
+	    hdr.class != ASN1_CLASS_UNIVERSAL ||
+	    hdr.tag != ASN1_TAG_SEQUENCE) {
+		wpa_printf(MSG_DEBUG, "X509: Expected SEQUENCE "
+			   "(ExtKeyUsageSyntax) - found class %d tag 0x%x",
+			   hdr.class, hdr.tag);
+		return -1;
+	}
+	if (hdr.length > pos + len - hdr.payload)
+		return -1;
+	pos = hdr.payload;
+	end = pos + hdr.length;
+
+	wpa_hexdump(MSG_MSGDUMP, "X509: ExtKeyUsageSyntax", pos, end - pos);
+
+	while (pos < end) {
+		char buf[80];
+
+		if (asn1_get_oid(pos, end - pos, &oid, &pos))
+			return -1;
+		if (x509_any_ext_key_usage_oid(&oid)) {
+			os_strlcpy(buf, "anyExtendedKeyUsage", sizeof(buf));
+			cert->ext_key_usage |= X509_EXT_KEY_USAGE_ANY;
+		} else if (x509_id_kp_server_auth_oid(&oid)) {
+			os_strlcpy(buf, "id-kp-serverAuth", sizeof(buf));
+			cert->ext_key_usage |= X509_EXT_KEY_USAGE_SERVER_AUTH;
+		} else if (x509_id_kp_client_auth_oid(&oid)) {
+			os_strlcpy(buf, "id-kp-clientAuth", sizeof(buf));
+			cert->ext_key_usage |= X509_EXT_KEY_USAGE_CLIENT_AUTH;
+		} else if (x509_id_kp_ocsp_oid(&oid)) {
+			os_strlcpy(buf, "id-kp-OCSPSigning", sizeof(buf));
+			cert->ext_key_usage |= X509_EXT_KEY_USAGE_OCSP;
+		} else {
+			asn1_oid_to_str(&oid, buf, sizeof(buf));
+		}
+		wpa_printf(MSG_DEBUG, "ExtKeyUsage KeyPurposeId: %s", buf);
+	}
+
+	cert->extensions_present |= X509_EXT_EXT_KEY_USAGE;
+
+	return 0;
+}
+
+
 static int x509_parse_extension_data(struct x509_certificate *cert,
 				     struct asn1_oid *oid,
 				     const u8 *pos, size_t len)
@@ -1085,7 +1199,6 @@ static int x509_parse_extension_data(struct x509_certificate *cert,
 	 * certificate policies (section 4.2.1.5)
 	 * name constraints (section 4.2.1.11)
 	 * policy constraints (section 4.2.1.12)
-	 * extended key usage (section 4.2.1.13)
 	 * inhibit any-policy (section 4.2.1.15)
 	 */
 	switch (oid->oid[3]) {
@@ -1097,6 +1210,8 @@ static int x509_parse_extension_data(struct x509_certificate *cert,
 		return x509_parse_ext_issuer_alt_name(cert, pos, len);
 	case 19: /* id-ce-basicConstraints */
 		return x509_parse_ext_basic_constraints(cert, pos, len);
+	case 37: /* id-ce-extKeyUsage */
+		return x509_parse_ext_ext_key_usage(cert, pos, len);
 	default:
 		return 1;
 	}
@@ -1224,6 +1339,7 @@ static int x509_parse_tbs_certificate(const u8 *buf, size_t len,
 	size_t left;
 	char sbuf[128];
 	unsigned long value;
+	const u8 *subject_dn;
 
 	/* tbsCertificate TBSCertificate ::= SEQUENCE */
 	if (asn1_get_next(buf, len, &hdr) < 0 ||
@@ -1287,21 +1403,23 @@ static int x509_parse_tbs_certificate(const u8 *buf, size_t len,
 
 	/* serialNumber CertificateSerialNumber ::= INTEGER */
 	if (hdr.class != ASN1_CLASS_UNIVERSAL ||
-	    hdr.tag != ASN1_TAG_INTEGER) {
+	    hdr.tag != ASN1_TAG_INTEGER ||
+	    hdr.length < 1 || hdr.length > X509_MAX_SERIAL_NUM_LEN) {
 		wpa_printf(MSG_DEBUG, "X509: No INTEGER tag found for "
-			   "serialNumber; class=%d tag=0x%x",
-			   hdr.class, hdr.tag);
+			   "serialNumber; class=%d tag=0x%x length=%u",
+			   hdr.class, hdr.tag, hdr.length);
 		return -1;
 	}
 
-	pos = hdr.payload;
-	left = hdr.length;
-	while (left) {
-		cert->serial_number <<= 8;
-		cert->serial_number |= *pos++;
-		left--;
+	pos = hdr.payload + hdr.length;
+	while (hdr.length > 0 && hdr.payload[0] == 0) {
+		hdr.payload++;
+		hdr.length--;
 	}
-	wpa_printf(MSG_MSGDUMP, "X509: serialNumber %lu", cert->serial_number);
+	os_memcpy(cert->serial_number, hdr.payload, hdr.length);
+	cert->serial_number_len = hdr.length;
+	wpa_hexdump(MSG_MSGDUMP, "X509: serialNumber", cert->serial_number,
+		    cert->serial_number_len);
 
 	/* signature AlgorithmIdentifier */
 	if (x509_parse_algorithm_identifier(pos, end - pos, &cert->signature,
@@ -1319,8 +1437,14 @@ static int x509_parse_tbs_certificate(const u8 *buf, size_t len,
 		return -1;
 
 	/* subject Name */
+	subject_dn = pos;
 	if (x509_parse_name(pos, end - pos, &cert->subject, &pos))
 		return -1;
+	cert->subject_dn = os_malloc(pos - subject_dn);
+	if (!cert->subject_dn)
+		return -1;
+	cert->subject_dn_len = pos - subject_dn;
+	os_memcpy(cert->subject_dn, subject_dn, cert->subject_dn_len);
 	x509_name_string(&cert->subject, sbuf, sizeof(sbuf));
 	wpa_printf(MSG_MSGDUMP, "X509: subject %s", sbuf);
 
@@ -1437,7 +1561,7 @@ static int x509_digest_oid(struct asn1_oid *oid)
 }
 
 
-static int x509_sha1_oid(struct asn1_oid *oid)
+int x509_sha1_oid(struct asn1_oid *oid)
 {
 	return oid->len == 6 &&
 		oid->oid[0] == 1 /* iso */ &&
@@ -1449,7 +1573,7 @@ static int x509_sha1_oid(struct asn1_oid *oid)
 }
 
 
-static int x509_sha256_oid(struct asn1_oid *oid)
+static int x509_sha2_oid(struct asn1_oid *oid)
 {
 	return oid->len == 9 &&
 		oid->oid[0] == 2 /* joint-iso-itu-t */ &&
@@ -1459,11 +1583,31 @@ static int x509_sha256_oid(struct asn1_oid *oid)
 		oid->oid[4] == 101 /* gov */ &&
 		oid->oid[5] == 3 /* csor */ &&
 		oid->oid[6] == 4 /* nistAlgorithm */ &&
-		oid->oid[7] == 2 /* hashAlgs */ &&
+		oid->oid[7] == 2 /* hashAlgs */;
+}
+
+
+int x509_sha256_oid(struct asn1_oid *oid)
+{
+	return x509_sha2_oid(oid) &&
 		oid->oid[8] == 1 /* sha256 */;
 }
 
 
+int x509_sha384_oid(struct asn1_oid *oid)
+{
+	return x509_sha2_oid(oid) &&
+		oid->oid[8] == 2 /* sha384 */;
+}
+
+
+int x509_sha512_oid(struct asn1_oid *oid)
+{
+	return x509_sha2_oid(oid) &&
+		oid->oid[8] == 3 /* sha512 */;
+}
+
+
 /**
  * x509_certificate_parse - Parse a X.509 certificate in DER format
  * @buf: Pointer to the X.509 certificate in DER format
@@ -1503,12 +1647,12 @@ struct x509_certificate * x509_certificate_parse(const u8 *buf, size_t len)
 	}
 	pos = hdr.payload;
 
-	if (pos + hdr.length > end) {
+	if (hdr.length > end - pos) {
 		x509_certificate_free(cert);
 		return NULL;
 	}
 
-	if (pos + hdr.length < end) {
+	if (hdr.length < end - pos) {
 		wpa_hexdump(MSG_MSGDUMP, "X509: Ignoring extra data after DER "
 			    "encoded certificate",
 			    pos + hdr.length, end - (pos + hdr.length));
@@ -1582,18 +1726,31 @@ struct x509_certificate * x509_certificate_parse(const u8 *buf, size_t len)
 int x509_certificate_check_signature(struct x509_certificate *issuer,
 				     struct x509_certificate *cert)
 {
+	return x509_check_signature(issuer, &cert->signature,
+				    cert->sign_value, cert->sign_value_len,
+				    cert->tbs_cert_start, cert->tbs_cert_len);
+}
+
+
+int x509_check_signature(struct x509_certificate *issuer,
+			 struct x509_algorithm_identifier *signature,
+			 const u8 *sign_value, size_t sign_value_len,
+			 const u8 *signed_data, size_t signed_data_len)
+{
 	struct crypto_public_key *pk;
 	u8 *data;
 	const u8 *pos, *end, *next, *da_end;
 	size_t data_len;
 	struct asn1_hdr hdr;
 	struct asn1_oid oid;
-	u8 hash[32];
+	u8 hash[64];
 	size_t hash_len;
+	const u8 *addr[1] = { signed_data };
+	size_t len[1] = { signed_data_len };
 
-	if (!x509_pkcs_oid(&cert->signature.oid) ||
-	    cert->signature.oid.len != 7 ||
-	    cert->signature.oid.oid[5] != 1 /* pkcs-1 */) {
+	if (!x509_pkcs_oid(&signature->oid) ||
+	    signature->oid.len != 7 ||
+	    signature->oid.oid[5] != 1 /* pkcs-1 */) {
 		wpa_printf(MSG_DEBUG, "X509: Unrecognized signature "
 			   "algorithm");
 		return -1;
@@ -1604,15 +1761,15 @@ int x509_certificate_check_signature(struct x509_certificate *issuer,
 	if (pk == NULL)
 		return -1;
 
-	data_len = cert->sign_value_len;
+	data_len = sign_value_len;
 	data = os_malloc(data_len);
 	if (data == NULL) {
 		crypto_public_key_free(pk);
 		return -1;
 	}
 
-	if (crypto_public_key_decrypt_pkcs1(pk, cert->sign_value,
-					    cert->sign_value_len, data,
+	if (crypto_public_key_decrypt_pkcs1(pk, sign_value,
+					    sign_value_len, data,
 					    &data_len) < 0) {
 		wpa_printf(MSG_DEBUG, "X509: Failed to decrypt signature");
 		crypto_public_key_free(pk);
@@ -1675,12 +1832,11 @@ int x509_certificate_check_signature(struct x509_certificate *issuer,
 	}
 
 	if (x509_sha1_oid(&oid)) {
-		if (cert->signature.oid.oid[6] !=
-		    5 /* sha-1WithRSAEncryption */) {
+		if (signature->oid.oid[6] != 5 /* sha-1WithRSAEncryption */) {
 			wpa_printf(MSG_DEBUG, "X509: digestAlgorithm SHA1 "
 				   "does not match with certificate "
 				   "signatureAlgorithm (%lu)",
-				   cert->signature.oid.oid[6]);
+				   signature->oid.oid[6]);
 			os_free(data);
 			return -1;
 		}
@@ -1688,12 +1844,36 @@ int x509_certificate_check_signature(struct x509_certificate *issuer,
 	}
 
 	if (x509_sha256_oid(&oid)) {
-		if (cert->signature.oid.oid[6] !=
+		if (signature->oid.oid[6] !=
 		    11 /* sha2561WithRSAEncryption */) {
 			wpa_printf(MSG_DEBUG, "X509: digestAlgorithm SHA256 "
 				   "does not match with certificate "
 				   "signatureAlgorithm (%lu)",
-				   cert->signature.oid.oid[6]);
+				   signature->oid.oid[6]);
+			os_free(data);
+			return -1;
+		}
+		goto skip_digest_oid;
+	}
+
+	if (x509_sha384_oid(&oid)) {
+		if (signature->oid.oid[6] != 12 /* sha384WithRSAEncryption */) {
+			wpa_printf(MSG_DEBUG, "X509: digestAlgorithm SHA384 "
+				   "does not match with certificate "
+				   "signatureAlgorithm (%lu)",
+				   signature->oid.oid[6]);
+			os_free(data);
+			return -1;
+		}
+		goto skip_digest_oid;
+	}
+
+	if (x509_sha512_oid(&oid)) {
+		if (signature->oid.oid[6] != 13 /* sha512WithRSAEncryption */) {
+			wpa_printf(MSG_DEBUG, "X509: digestAlgorithm SHA512 "
+				   "does not match with certificate "
+				   "signatureAlgorithm (%lu)",
+				   signature->oid.oid[6]);
 			os_free(data);
 			return -1;
 		}
@@ -1707,12 +1887,11 @@ int x509_certificate_check_signature(struct x509_certificate *issuer,
 	}
 	switch (oid.oid[5]) {
 	case 5: /* md5 */
-		if (cert->signature.oid.oid[6] != 4 /* md5WithRSAEncryption */)
-		{
+		if (signature->oid.oid[6] != 4 /* md5WithRSAEncryption */) {
 			wpa_printf(MSG_DEBUG, "X509: digestAlgorithm MD5 does "
 				   "not match with certificate "
 				   "signatureAlgorithm (%lu)",
-				   cert->signature.oid.oid[6]);
+				   signature->oid.oid[6]);
 			os_free(data);
 			return -1;
 		}
@@ -1743,34 +1922,41 @@ skip_digest_oid:
 	wpa_hexdump(MSG_MSGDUMP, "X509: Decrypted Digest",
 		    hdr.payload, hdr.length);
 
-	switch (cert->signature.oid.oid[6]) {
+	switch (signature->oid.oid[6]) {
 	case 4: /* md5WithRSAEncryption */
-		md5_vector(1, &cert->tbs_cert_start, &cert->tbs_cert_len,
-			   hash);
+		md5_vector(1, addr, len, hash);
 		hash_len = 16;
 		wpa_hexdump(MSG_MSGDUMP, "X509: Certificate hash (MD5)",
 			    hash, hash_len);
 		break;
 	case 5: /* sha-1WithRSAEncryption */
-		sha1_vector(1, &cert->tbs_cert_start, &cert->tbs_cert_len,
-			    hash);
+		sha1_vector(1, addr, len, hash);
 		hash_len = 20;
 		wpa_hexdump(MSG_MSGDUMP, "X509: Certificate hash (SHA1)",
 			    hash, hash_len);
 		break;
 	case 11: /* sha256WithRSAEncryption */
-		sha256_vector(1, &cert->tbs_cert_start, &cert->tbs_cert_len,
-			      hash);
+		sha256_vector(1, addr, len, hash);
 		hash_len = 32;
 		wpa_hexdump(MSG_MSGDUMP, "X509: Certificate hash (SHA256)",
 			    hash, hash_len);
 		break;
-	case 2: /* md2WithRSAEncryption */
 	case 12: /* sha384WithRSAEncryption */
+		sha384_vector(1, addr, len, hash);
+		hash_len = 48;
+		wpa_hexdump(MSG_MSGDUMP, "X509: Certificate hash (SHA384)",
+			    hash, hash_len);
+		break;
 	case 13: /* sha512WithRSAEncryption */
+		sha512_vector(1, addr, len, hash);
+		hash_len = 64;
+		wpa_hexdump(MSG_MSGDUMP, "X509: Certificate hash (SHA512)",
+			    hash, hash_len);
+		break;
+	case 2: /* md2WithRSAEncryption */
 	default:
 		wpa_printf(MSG_INFO, "X509: Unsupported certificate signature "
-			   "algorithm (%lu)", cert->signature.oid.oid[6]);
+			   "algorithm (%lu)", signature->oid.oid[6]);
 		os_free(data);
 		return -1;
 	}
@@ -1852,6 +2038,7 @@ int x509_certificate_chain_validate(struct x509_certificate *trusted,
 	os_get_time(&now);
 
 	for (cert = chain, idx = 0; cert; cert = cert->next, idx++) {
+		cert->issuer_trusted = 0;
 		x509_name_string(&cert->subject, buf, sizeof(buf)); 
 		wpa_printf(MSG_DEBUG, "X509: %lu: %s", idx, buf);
 
@@ -1937,6 +2124,7 @@ int x509_certificate_chain_validate(struct x509_certificate *trusted,
 
 			wpa_printf(MSG_DEBUG, "X509: Trusted certificate "
 				   "found to complete the chain");
+			cert->issuer_trusted = 1;
 			chain_trusted = 1;
 		}
 	}
diff --git a/src/tls/x509v3.h b/src/tls/x509v3.h
index 91a35baf92b18..7df8e2ab0870c 100644
--- a/src/tls/x509v3.h
+++ b/src/tls/x509v3.h
@@ -45,13 +45,18 @@ struct x509_name {
 	struct asn1_oid rid; /* registeredID */
 };
 
+#define X509_MAX_SERIAL_NUM_LEN 20
+
 struct x509_certificate {
 	struct x509_certificate *next;
 	enum { X509_CERT_V1 = 0, X509_CERT_V2 = 1, X509_CERT_V3 = 2 } version;
-	unsigned long serial_number;
+	u8 serial_number[X509_MAX_SERIAL_NUM_LEN];
+	size_t serial_number_len;
 	struct x509_algorithm_identifier signature;
 	struct x509_name issuer;
 	struct x509_name subject;
+	u8 *subject_dn;
+	size_t subject_dn_len;
 	os_time_t not_before;
 	os_time_t not_after;
 	struct x509_algorithm_identifier public_key_alg;
@@ -68,6 +73,7 @@ struct x509_certificate {
 #define X509_EXT_KEY_USAGE			(1 << 2)
 #define X509_EXT_SUBJECT_ALT_NAME		(1 << 3)
 #define X509_EXT_ISSUER_ALT_NAME		(1 << 4)
+#define X509_EXT_EXT_KEY_USAGE			(1 << 5)
 
 	/* BasicConstraints */
 	int ca; /* cA */
@@ -85,6 +91,13 @@ struct x509_certificate {
 #define X509_KEY_USAGE_ENCIPHER_ONLY		(1 << 7)
 #define X509_KEY_USAGE_DECIPHER_ONLY		(1 << 8)
 
+	/* ExtKeyUsage */
+	unsigned long ext_key_usage;
+#define X509_EXT_KEY_USAGE_ANY			(1 << 0)
+#define X509_EXT_KEY_USAGE_SERVER_AUTH		(1 << 1)
+#define X509_EXT_KEY_USAGE_CLIENT_AUTH		(1 << 2)
+#define X509_EXT_KEY_USAGE_OCSP			(1 << 3)
+
 	/*
 	 * The DER format certificate follows struct x509_certificate. These
 	 * pointers point to that buffer.
@@ -93,6 +106,11 @@ struct x509_certificate {
 	size_t cert_len;
 	const u8 *tbs_cert_start;
 	size_t tbs_cert_len;
+
+	/* Meta data used for certificate validation */
+	unsigned int ocsp_good:1;
+	unsigned int ocsp_revoked:1;
+	unsigned int issuer_trusted:1;
 };
 
 enum {
@@ -106,10 +124,21 @@ enum {
 };
 
 void x509_certificate_free(struct x509_certificate *cert);
+int x509_parse_algorithm_identifier(const u8 *buf, size_t len,
+				    struct x509_algorithm_identifier *id,
+				    const u8 **next);
+int x509_parse_name(const u8 *buf, size_t len, struct x509_name *name,
+		    const u8 **next);
+int x509_parse_time(const u8 *buf, size_t len, u8 asn1_tag, os_time_t *val);
 struct x509_certificate * x509_certificate_parse(const u8 *buf, size_t len);
+void x509_free_name(struct x509_name *name);
 void x509_name_string(struct x509_name *name, char *buf, size_t len);
 int x509_name_compare(struct x509_name *a, struct x509_name *b);
 void x509_certificate_chain_free(struct x509_certificate *cert);
+int x509_check_signature(struct x509_certificate *issuer,
+			 struct x509_algorithm_identifier *signature,
+			 const u8 *sign_value, size_t sign_value_len,
+			 const u8 *signed_data, size_t signed_data_len);
 int x509_certificate_check_signature(struct x509_certificate *issuer,
 				     struct x509_certificate *cert);
 int x509_certificate_chain_validate(struct x509_certificate *trusted,
@@ -120,4 +149,9 @@ x509_certificate_get_subject(struct x509_certificate *chain,
 			     struct x509_name *name);
 int x509_certificate_self_signed(struct x509_certificate *cert);
 
+int x509_sha1_oid(struct asn1_oid *oid);
+int x509_sha256_oid(struct asn1_oid *oid);
+int x509_sha384_oid(struct asn1_oid *oid);
+int x509_sha512_oid(struct asn1_oid *oid);
+
 #endif /* X509V3_H */
diff --git a/src/utils/browser-android.c b/src/utils/browser-android.c
index 9ce1a5cbeae10..71a165269cf6e 100644
--- a/src/utils/browser-android.c
+++ b/src/utils/browser-android.c
@@ -95,7 +95,7 @@ int hs20_web_browser(const char *url)
 
 	if (pid == 0) {
 		/* run the external command in the child process */
-		char *argv[9];
+		char *argv[7];
 
 		argv[0] = "browser-android";
 		argv[1] = "start";
@@ -103,9 +103,7 @@ int hs20_web_browser(const char *url)
 		argv[3] = "android.intent.action.VIEW";
 		argv[4] = "-d";
 		argv[5] = (void *) url;
-		argv[6] = "-n";
-		argv[7] = "com.android.browser/.BrowserActivity";
-		argv[8] = NULL;
+		argv[6] = NULL;
 
 		execv("/system/bin/am", argv);
 		wpa_printf(MSG_ERROR, "execv: %s", strerror(errno));
diff --git a/src/utils/common.c b/src/utils/common.c
index 660e9fc985d69..04a533a05902f 100644
--- a/src/utils/common.c
+++ b/src/utils/common.c
@@ -86,7 +86,7 @@ int hwaddr_masked_aton(const char *txt, u8 *addr, u8 *mask, u8 maskable)
 		return -1;
 
 	/* check for optional mask */
-	if (*r == '\0' || isspace(*r)) {
+	if (*r == '\0' || isspace((unsigned char) *r)) {
 		/* no mask specified, assume default */
 		os_memset(mask, 0xff, ETH_ALEN);
 	} else if (maskable && *r == '/') {
@@ -498,7 +498,7 @@ void printf_encode(char *txt, size_t maxlen, const u8 *data, size_t len)
 			*txt++ = 't';
 			break;
 		default:
-			if (data[i] >= 32 && data[i] <= 127) {
+			if (data[i] >= 32 && data[i] <= 126) {
 				*txt++ = data[i];
 			} else {
 				txt += os_snprintf(txt, end - txt, "\\x%02x",
@@ -697,6 +697,29 @@ int is_hex(const u8 *data, size_t len)
 }
 
 
+int has_ctrl_char(const u8 *data, size_t len)
+{
+	size_t i;
+
+	for (i = 0; i < len; i++) {
+		if (data[i] < 32 || data[i] == 127)
+			return 1;
+	}
+	return 0;
+}
+
+
+int has_newline(const char *str)
+{
+	while (*str) {
+		if (*str == '\n' || *str == '\r')
+			return 1;
+		str++;
+	}
+	return 0;
+}
+
+
 size_t merge_byte_arrays(u8 *res, size_t res_len,
 			 const u8 *src1, size_t src1_len,
 			 const u8 *src2, size_t src2_len)
@@ -978,7 +1001,7 @@ int random_mac_addr_keep_oui(u8 *addr)
  * @delim: a string of delimiters
  * @last: a pointer to a character following the returned token
  *      It has to be set to NULL for the first call and passed for any
- *      futher call.
+ *      further call.
  * Returns: a pointer to token position in str or NULL
  *
  * This function is similar to str_token, but it can be used with both
@@ -1123,3 +1146,57 @@ int is_ctrl_char(char c)
 {
 	return c > 0 && c < 32;
 }
+
+
+/**
+ * ssid_parse - Parse a string that contains SSID in hex or text format
+ * @buf: Input NULL terminated string that contains the SSID
+ * @ssid: Output SSID
+ * Returns: 0 on success, -1 otherwise
+ *
+ * The SSID has to be enclosed in double quotes for the text format or space
+ * or NULL terminated string of hex digits for the hex format. buf can include
+ * additional arguments after the SSID.
+ */
+int ssid_parse(const char *buf, struct wpa_ssid_value *ssid)
+{
+	char *tmp, *res, *end;
+	size_t len;
+
+	ssid->ssid_len = 0;
+
+	tmp = os_strdup(buf);
+	if (!tmp)
+		return -1;
+
+	if (*tmp != '"') {
+		end = os_strchr(tmp, ' ');
+		if (end)
+			*end = '\0';
+	} else {
+		end = os_strchr(tmp + 1, '"');
+		if (!end) {
+			os_free(tmp);
+			return -1;
+		}
+
+		end[1] = '\0';
+	}
+
+	res = wpa_config_parse_string(tmp, &len);
+	if (res && len <= SSID_MAX_LEN) {
+		ssid->ssid_len = len;
+		os_memcpy(ssid->ssid, res, len);
+	}
+
+	os_free(tmp);
+	os_free(res);
+
+	return ssid->ssid_len ? 0 : -1;
+}
+
+
+int str_starts(const char *str, const char *start)
+{
+	return os_strncmp(str, start, os_strlen(start)) == 0;
+}
diff --git a/src/utils/common.h b/src/utils/common.h
index 0b9cc3d882090..77856774d215c 100644
--- a/src/utils/common.h
+++ b/src/utils/common.h
@@ -313,6 +313,9 @@ static inline void WPA_PUT_LE64(u8 *a, u64 val)
 #ifndef ETH_P_ALL
 #define ETH_P_ALL 0x0003
 #endif
+#ifndef ETH_P_IP
+#define ETH_P_IP 0x0800
+#endif
 #ifndef ETH_P_80211_ENCAP
 #define ETH_P_80211_ENCAP 0x890d /* TDLS comes under this category */
 #endif
@@ -416,6 +419,7 @@ void perror(const char *s);
  */
 #ifdef __CHECKER__
 #define __force __attribute__((force))
+#undef __bitwise
 #define __bitwise __attribute__((bitwise))
 #else
 #define __force
@@ -445,6 +449,13 @@ typedef u64 __bitwise le64;
 #endif /* __GNUC__ */
 #endif /* __must_check */
 
+#define SSID_MAX_LEN 32
+
+struct wpa_ssid_value {
+	u8 ssid[SSID_MAX_LEN];
+	size_t ssid_len;
+};
+
 int hwaddr_aton(const char *txt, u8 *addr);
 int hwaddr_masked_aton(const char *txt, u8 *addr, u8 *mask, u8 maskable);
 int hwaddr_compact_aton(const char *txt, u8 *addr);
@@ -461,6 +472,7 @@ int wpa_snprintf_hex_uppercase(char *buf, size_t buf_size, const u8 *data,
 			       size_t len);
 
 int hwaddr_mask_txt(char *buf, size_t len, const u8 *addr, const u8 *mask);
+int ssid_parse(const char *buf, struct wpa_ssid_value *ssid);
 
 #ifdef CONFIG_NATIVE_WINDOWS
 void wpa_unicode2ascii_inplace(TCHAR *str);
@@ -477,6 +489,8 @@ const char * wpa_ssid_txt(const u8 *ssid, size_t ssid_len);
 
 char * wpa_config_parse_string(const char *value, size_t *len);
 int is_hex(const u8 *data, size_t len);
+int has_ctrl_char(const u8 *data, size_t len);
+int has_newline(const char *str);
 size_t merge_byte_arrays(u8 *res, size_t res_len,
 			 const u8 *src1, size_t src1_len,
 			 const u8 *src2, size_t src2_len);
@@ -536,6 +550,8 @@ size_t utf8_unescape(const char *inp, size_t in_size,
 		     char *outp, size_t out_size);
 int is_ctrl_char(char c);
 
+int str_starts(const char *str, const char *start);
+
 
 /*
  * gcc 4.4 ends up generating strict-aliasing warnings about some very common
diff --git a/src/utils/edit_simple.c b/src/utils/edit_simple.c
index 13173cb19361a..2ffd1a2a2b7ea 100644
--- a/src/utils/edit_simple.c
+++ b/src/utils/edit_simple.c
@@ -47,6 +47,12 @@ static void edit_read_char(int sock, void *eloop_ctx, void *sock_ctx)
 		return;
 	}
 
+	if (c == '\b') {
+		if (cmdbuf_pos > 0)
+			cmdbuf_pos--;
+		return;
+	}
+
 	if (c >= 32 && c <= 255) {
 		if (cmdbuf_pos < (int) sizeof(cmdbuf) - 1) {
 			cmdbuf[cmdbuf_pos++] = c;
diff --git a/src/utils/eloop.c b/src/utils/eloop.c
index 8647229b8eb5f..436bc8c993389 100644
--- a/src/utils/eloop.c
+++ b/src/utils/eloop.c
@@ -18,7 +18,12 @@
 #error Do not define both of poll and epoll
 #endif
 
-#if !defined(CONFIG_ELOOP_POLL) && !defined(CONFIG_ELOOP_EPOLL)
+#if defined(CONFIG_ELOOP_POLL) && defined(CONFIG_ELOOP_KQUEUE)
+#error Do not define both of poll and kqueue
+#endif
+
+#if !defined(CONFIG_ELOOP_POLL) && !defined(CONFIG_ELOOP_EPOLL) && \
+    !defined(CONFIG_ELOOP_KQUEUE)
 #define CONFIG_ELOOP_SELECT
 #endif
 
@@ -30,6 +35,10 @@
 #include <sys/epoll.h>
 #endif /* CONFIG_ELOOP_EPOLL */
 
+#ifdef CONFIG_ELOOP_KQUEUE
+#include <sys/event.h>
+#endif /* CONFIG_ELOOP_KQUEUE */
+
 struct eloop_sock {
 	int sock;
 	void *eloop_data;
@@ -75,13 +84,20 @@ struct eloop_data {
 	struct pollfd *pollfds;
 	struct pollfd **pollfds_map;
 #endif /* CONFIG_ELOOP_POLL */
+#if defined(CONFIG_ELOOP_EPOLL) || defined(CONFIG_ELOOP_KQUEUE)
+	int max_fd;
+	struct eloop_sock *fd_table;
+#endif /* CONFIG_ELOOP_EPOLL || CONFIG_ELOOP_KQUEUE */
 #ifdef CONFIG_ELOOP_EPOLL
 	int epollfd;
 	int epoll_max_event_num;
-	int epoll_max_fd;
-	struct eloop_sock *epoll_table;
 	struct epoll_event *epoll_events;
 #endif /* CONFIG_ELOOP_EPOLL */
+#ifdef CONFIG_ELOOP_KQUEUE
+	int kqueuefd;
+	int kqueue_nevents;
+	struct kevent *kqueue_events;
+#endif /* CONFIG_ELOOP_KQUEUE */
 	struct eloop_sock_table readers;
 	struct eloop_sock_table writers;
 	struct eloop_sock_table exceptions;
@@ -149,14 +165,24 @@ int eloop_init(void)
 #ifdef CONFIG_ELOOP_EPOLL
 	eloop.epollfd = epoll_create1(0);
 	if (eloop.epollfd < 0) {
-		wpa_printf(MSG_ERROR, "%s: epoll_create1 failed. %s\n",
+		wpa_printf(MSG_ERROR, "%s: epoll_create1 failed. %s",
+			   __func__, strerror(errno));
+		return -1;
+	}
+#endif /* CONFIG_ELOOP_EPOLL */
+#ifdef CONFIG_ELOOP_KQUEUE
+	eloop.kqueuefd = kqueue();
+	if (eloop.kqueuefd < 0) {
+		wpa_printf(MSG_ERROR, "%s: kqueue failed: %s",
 			   __func__, strerror(errno));
 		return -1;
 	}
+#endif /* CONFIG_ELOOP_KQUEUE */
+#if defined(CONFIG_ELOOP_EPOLL) || defined(CONFIG_ELOOP_KQUEUE)
 	eloop.readers.type = EVENT_TYPE_READ;
 	eloop.writers.type = EVENT_TYPE_WRITE;
 	eloop.exceptions.type = EVENT_TYPE_EXCEPTION;
-#endif /* CONFIG_ELOOP_EPOLL */
+#endif /* CONFIG_ELOOP_EPOLL || CONFIG_ELOOP_KQUEUE */
 #ifdef WPA_TRACE
 	signal(SIGSEGV, eloop_sigsegv_handler);
 #endif /* WPA_TRACE */
@@ -164,15 +190,80 @@ int eloop_init(void)
 }
 
 
+#ifdef CONFIG_ELOOP_EPOLL
+static int eloop_sock_queue(int sock, eloop_event_type type)
+{
+	struct epoll_event ev;
+
+	os_memset(&ev, 0, sizeof(ev));
+	switch (type) {
+	case EVENT_TYPE_READ:
+		ev.events = EPOLLIN;
+		break;
+	case EVENT_TYPE_WRITE:
+		ev.events = EPOLLOUT;
+		break;
+	/*
+	 * Exceptions are always checked when using epoll, but I suppose it's
+	 * possible that someone registered a socket *only* for exception
+	 * handling.
+	 */
+	case EVENT_TYPE_EXCEPTION:
+		ev.events = EPOLLERR | EPOLLHUP;
+		break;
+	}
+	ev.data.fd = sock;
+	if (epoll_ctl(eloop.epollfd, EPOLL_CTL_ADD, sock, &ev) < 0) {
+		wpa_printf(MSG_ERROR, "%s: epoll_ctl(ADD) for fd=%d failed: %s",
+			   __func__, sock, strerror(errno));
+		return -1;
+	}
+	return 0;
+}
+#endif /* CONFIG_ELOOP_EPOLL */
+
+
+#ifdef CONFIG_ELOOP_KQUEUE
+static int eloop_sock_queue(int sock, eloop_event_type type)
+{
+	int filter;
+	struct kevent ke;
+
+	switch (type) {
+	case EVENT_TYPE_READ:
+		filter = EVFILT_READ;
+		break;
+	case EVENT_TYPE_WRITE:
+		filter = EVFILT_WRITE;
+		break;
+	default:
+		filter = 0;
+	}
+	EV_SET(&ke, sock, filter, EV_ADD, 0, 0, 0);
+	if (kevent(eloop.kqueuefd, &ke, 1, NULL, 0, NULL) == -1) {
+		wpa_printf(MSG_ERROR, "%s: kevent(ADD) for fd=%d failed: %s",
+			   __func__, sock, strerror(errno));
+		return -1;
+	}
+	return 0;
+}
+#endif /* CONFIG_ELOOP_KQUEUE */
+
+
 static int eloop_sock_table_add_sock(struct eloop_sock_table *table,
                                      int sock, eloop_sock_handler handler,
                                      void *eloop_data, void *user_data)
 {
 #ifdef CONFIG_ELOOP_EPOLL
+	struct epoll_event *temp_events;
+#endif /* CONFIG_ELOOP_EPOLL */
+#ifdef CONFIG_ELOOP_KQUEUE
+	struct kevent *temp_events;
+#endif /* CONFIG_ELOOP_EPOLL */
+#if defined(CONFIG_ELOOP_EPOLL) || defined(CONFIG_ELOOP_KQUEUE)
 	struct eloop_sock *temp_table;
-	struct epoll_event ev, *temp_events;
 	int next;
-#endif /* CONFIG_ELOOP_EPOLL */
+#endif /* CONFIG_ELOOP_EPOLL || CONFIG_ELOOP_KQUEUE */
 	struct eloop_sock *tmp;
 	int new_max_sock;
 
@@ -208,26 +299,28 @@ static int eloop_sock_table_add_sock(struct eloop_sock_table *table,
 		eloop.pollfds = n;
 	}
 #endif /* CONFIG_ELOOP_POLL */
-#ifdef CONFIG_ELOOP_EPOLL
-	if (new_max_sock >= eloop.epoll_max_fd) {
-		next = eloop.epoll_max_fd == 0 ? 16 : eloop.epoll_max_fd * 2;
-		temp_table = os_realloc_array(eloop.epoll_table, next,
+#if defined(CONFIG_ELOOP_EPOLL) || defined(CONFIG_ELOOP_KQUEUE)
+	if (new_max_sock >= eloop.max_fd) {
+		next = eloop.max_fd == 0 ? 16 : eloop.max_fd * 2;
+		temp_table = os_realloc_array(eloop.fd_table, next,
 					      sizeof(struct eloop_sock));
 		if (temp_table == NULL)
 			return -1;
 
-		eloop.epoll_max_fd = next;
-		eloop.epoll_table = temp_table;
+		eloop.max_fd = next;
+		eloop.fd_table = temp_table;
 	}
+#endif /* CONFIG_ELOOP_EPOLL || CONFIG_ELOOP_KQUEUE */
 
+#ifdef CONFIG_ELOOP_EPOLL
 	if (eloop.count + 1 > eloop.epoll_max_event_num) {
 		next = eloop.epoll_max_event_num == 0 ? 8 :
 			eloop.epoll_max_event_num * 2;
 		temp_events = os_realloc_array(eloop.epoll_events, next,
 					       sizeof(struct epoll_event));
 		if (temp_events == NULL) {
-			wpa_printf(MSG_ERROR, "%s: malloc for epoll failed. "
-				   "%s\n", __func__, strerror(errno));
+			wpa_printf(MSG_ERROR, "%s: malloc for epoll failed: %s",
+				   __func__, strerror(errno));
 			return -1;
 		}
 
@@ -235,6 +328,22 @@ static int eloop_sock_table_add_sock(struct eloop_sock_table *table,
 		eloop.epoll_events = temp_events;
 	}
 #endif /* CONFIG_ELOOP_EPOLL */
+#ifdef CONFIG_ELOOP_KQUEUE
+	if (eloop.count + 1 > eloop.kqueue_nevents) {
+		next = eloop.kqueue_nevents == 0 ? 8 : eloop.kqueue_nevents * 2;
+		temp_events = os_malloc(next * sizeof(*temp_events));
+		if (!temp_events) {
+			wpa_printf(MSG_ERROR,
+				   "%s: malloc for kqueue failed: %s",
+				   __func__, strerror(errno));
+			return -1;
+		}
+
+		os_free(eloop.kqueue_events);
+		eloop.kqueue_events = temp_events;
+		eloop.kqueue_nevents = next;
+	}
+#endif /* CONFIG_ELOOP_KQUEUE */
 
 	eloop_trace_sock_remove_ref(table);
 	tmp = os_realloc_array(table->table, table->count + 1,
@@ -256,33 +365,12 @@ static int eloop_sock_table_add_sock(struct eloop_sock_table *table,
 	table->changed = 1;
 	eloop_trace_sock_add_ref(table);
 
-#ifdef CONFIG_ELOOP_EPOLL
-	os_memset(&ev, 0, sizeof(ev));
-	switch (table->type) {
-	case EVENT_TYPE_READ:
-		ev.events = EPOLLIN;
-		break;
-	case EVENT_TYPE_WRITE:
-		ev.events = EPOLLOUT;
-		break;
-	/*
-	 * Exceptions are always checked when using epoll, but I suppose it's
-	 * possible that someone registered a socket *only* for exception
-	 * handling.
-	 */
-	case EVENT_TYPE_EXCEPTION:
-		ev.events = EPOLLERR | EPOLLHUP;
-		break;
-	}
-	ev.data.fd = sock;
-	if (epoll_ctl(eloop.epollfd, EPOLL_CTL_ADD, sock, &ev) < 0) {
-		wpa_printf(MSG_ERROR, "%s: epoll_ctl(ADD) for fd=%d "
-			   "failed. %s\n", __func__, sock, strerror(errno));
+#if defined(CONFIG_ELOOP_EPOLL) || defined(CONFIG_ELOOP_KQUEUE)
+	if (eloop_sock_queue(sock, table->type) < 0)
 		return -1;
-	}
-	os_memcpy(&eloop.epoll_table[sock], &table->table[table->count - 1],
+	os_memcpy(&eloop.fd_table[sock], &table->table[table->count - 1],
 		  sizeof(struct eloop_sock));
-#endif /* CONFIG_ELOOP_EPOLL */
+#endif /* CONFIG_ELOOP_EPOLL || CONFIG_ELOOP_KQUEUE */
 	return 0;
 }
 
@@ -290,6 +378,9 @@ static int eloop_sock_table_add_sock(struct eloop_sock_table *table,
 static void eloop_sock_table_remove_sock(struct eloop_sock_table *table,
                                          int sock)
 {
+#ifdef CONFIG_ELOOP_KQUEUE
+	struct kevent ke;
+#endif /* CONFIG_ELOOP_KQUEUE */
 	int i;
 
 	if (table == NULL || table->table == NULL || table->count == 0)
@@ -313,12 +404,21 @@ static void eloop_sock_table_remove_sock(struct eloop_sock_table *table,
 	eloop_trace_sock_add_ref(table);
 #ifdef CONFIG_ELOOP_EPOLL
 	if (epoll_ctl(eloop.epollfd, EPOLL_CTL_DEL, sock, NULL) < 0) {
-		wpa_printf(MSG_ERROR, "%s: epoll_ctl(DEL) for fd=%d "
-			   "failed. %s\n", __func__, sock, strerror(errno));
+		wpa_printf(MSG_ERROR, "%s: epoll_ctl(DEL) for fd=%d failed: %s",
+			   __func__, sock, strerror(errno));
 		return;
 	}
-	os_memset(&eloop.epoll_table[sock], 0, sizeof(struct eloop_sock));
+	os_memset(&eloop.fd_table[sock], 0, sizeof(struct eloop_sock));
 #endif /* CONFIG_ELOOP_EPOLL */
+#ifdef CONFIG_ELOOP_KQUEUE
+	EV_SET(&ke, sock, 0, EV_DELETE, 0, 0, 0);
+	if (kevent(eloop.kqueuefd, &ke, 1, NULL, 0, NULL) < 0) {
+		wpa_printf(MSG_ERROR, "%s: kevent(DEL) for fd=%d failed: %s",
+			   __func__, sock, strerror(errno));
+		return;
+	}
+	os_memset(&eloop.fd_table[sock], 0, sizeof(struct eloop_sock));
+#endif /* CONFIG_ELOOP_KQUEUE */
 }
 
 
@@ -511,7 +611,7 @@ static void eloop_sock_table_dispatch(struct epoll_event *events, int nfds)
 	int i;
 
 	for (i = 0; i < nfds; i++) {
-		table = &eloop.epoll_table[events[i].data.fd];
+		table = &eloop.fd_table[events[i].data.fd];
 		if (table->handler == NULL)
 			continue;
 		table->handler(table->sock, table->eloop_data,
@@ -525,6 +625,67 @@ static void eloop_sock_table_dispatch(struct epoll_event *events, int nfds)
 #endif /* CONFIG_ELOOP_EPOLL */
 
 
+#ifdef CONFIG_ELOOP_KQUEUE
+
+static void eloop_sock_table_dispatch(struct kevent *events, int nfds)
+{
+	struct eloop_sock *table;
+	int i;
+
+	for (i = 0; i < nfds; i++) {
+		table = &eloop.fd_table[events[i].ident];
+		if (table->handler == NULL)
+			continue;
+		table->handler(table->sock, table->eloop_data,
+			       table->user_data);
+		if (eloop.readers.changed ||
+		    eloop.writers.changed ||
+		    eloop.exceptions.changed)
+			break;
+	}
+}
+
+
+static int eloop_sock_table_requeue(struct eloop_sock_table *table)
+{
+	int i, r;
+
+	r = 0;
+	for (i = 0; i < table->count && table->table; i++) {
+		if (eloop_sock_queue(table->table[i].sock, table->type) == -1)
+			r = -1;
+	}
+	return r;
+}
+
+#endif /* CONFIG_ELOOP_KQUEUE */
+
+
+int eloop_sock_requeue(void)
+{
+	int r = 0;
+
+#ifdef CONFIG_ELOOP_KQUEUE
+	close(eloop.kqueuefd);
+	eloop.kqueuefd = kqueue();
+	if (eloop.kqueuefd < 0) {
+		wpa_printf(MSG_ERROR, "%s: kqueue failed: %s",
+			   __func__, strerror(errno));
+		return -1;
+	}
+
+	if (eloop_sock_table_requeue(&eloop.readers) < 0)
+		r = -1;
+	if (eloop_sock_table_requeue(&eloop.writers) < 0)
+		r = -1;
+	if (eloop_sock_table_requeue(&eloop.exceptions) < 0)
+		r = -1;
+#endif /* CONFIG_ELOOP_KQUEUE */
+
+	return r;
+}
+
+
 static void eloop_sock_table_destroy(struct eloop_sock_table *table)
 {
 	if (table) {
@@ -905,6 +1066,9 @@ void eloop_run(void)
 #ifdef CONFIG_ELOOP_EPOLL
 	int timeout_ms = -1;
 #endif /* CONFIG_ELOOP_EPOLL */
+#ifdef CONFIG_ELOOP_KQUEUE
+	struct timespec ts;
+#endif /* CONFIG_ELOOP_KQUEUE */
 	int res;
 	struct os_reltime tv, now;
 
@@ -949,6 +1113,10 @@ void eloop_run(void)
 			_tv.tv_sec = tv.sec;
 			_tv.tv_usec = tv.usec;
 #endif /* CONFIG_ELOOP_SELECT */
+#ifdef CONFIG_ELOOP_KQUEUE
+			ts.tv_sec = tv.sec;
+			ts.tv_nsec = tv.usec * 1000L;
+#endif /* CONFIG_ELOOP_KQUEUE */
 		}
 
 #ifdef CONFIG_ELOOP_POLL
@@ -974,6 +1142,15 @@ void eloop_run(void)
 					 eloop.count, timeout_ms);
 		}
 #endif /* CONFIG_ELOOP_EPOLL */
+#ifdef CONFIG_ELOOP_KQUEUE
+		if (eloop.count == 0) {
+			res = 0;
+		} else {
+			res = kevent(eloop.kqueuefd, NULL, 0,
+				     eloop.kqueue_events, eloop.kqueue_nevents,
+				     timeout ? &ts : NULL);
+		}
+#endif /* CONFIG_ELOOP_KQUEUE */
 		if (res < 0 && errno != EINTR && errno != 0) {
 			wpa_printf(MSG_ERROR, "eloop: %s: %s",
 #ifdef CONFIG_ELOOP_POLL
@@ -985,6 +1162,10 @@ void eloop_run(void)
 #ifdef CONFIG_ELOOP_EPOLL
 				   "epoll"
 #endif /* CONFIG_ELOOP_EPOLL */
+#ifdef CONFIG_ELOOP_KQUEUE
+				   "kqueue"
+#endif /* CONFIG_ELOOP_EKQUEUE */
+
 				   , strerror(errno));
 			goto out;
 		}
@@ -995,6 +1176,7 @@ void eloop_run(void)
 
 		eloop_process_pending_signals();
 
+
 		/* check if some registered timeouts have occurred */
 		timeout = dl_list_first(&eloop.timeout, struct eloop_timeout,
 					list);
@@ -1040,6 +1222,9 @@ void eloop_run(void)
 #ifdef CONFIG_ELOOP_EPOLL
 		eloop_sock_table_dispatch(eloop.epoll_events, res);
 #endif /* CONFIG_ELOOP_EPOLL */
+#ifdef CONFIG_ELOOP_KQUEUE
+		eloop_sock_table_dispatch(eloop.kqueue_events, res);
+#endif /* CONFIG_ELOOP_KQUEUE */
 	}
 
 	eloop.terminate = 0;
@@ -1092,11 +1277,17 @@ void eloop_destroy(void)
 	os_free(eloop.pollfds);
 	os_free(eloop.pollfds_map);
 #endif /* CONFIG_ELOOP_POLL */
+#if defined(CONFIG_ELOOP_EPOLL) || defined(CONFIG_ELOOP_KQUEUE)
+	os_free(eloop.fd_table);
+#endif /* CONFIG_ELOOP_EPOLL || CONFIG_ELOOP_KQUEUE */
 #ifdef CONFIG_ELOOP_EPOLL
-	os_free(eloop.epoll_table);
 	os_free(eloop.epoll_events);
 	close(eloop.epollfd);
 #endif /* CONFIG_ELOOP_EPOLL */
+#ifdef CONFIG_ELOOP_KQUEUE
+	os_free(eloop.kqueue_events);
+	close(eloop.kqueuefd);
+#endif /* CONFIG_ELOOP_KQUEUE */
 }
 
 
@@ -1135,6 +1326,17 @@ void eloop_wait_for_read_sock(int sock)
 	FD_SET(sock, &rfds);
 	select(sock + 1, &rfds, NULL, NULL, NULL);
 #endif /* defined(CONFIG_ELOOP_SELECT) || defined(CONFIG_ELOOP_EPOLL) */
+#ifdef CONFIG_ELOOP_KQUEUE
+	int kfd;
+	struct kevent ke1, ke2;
+
+	kfd = kqueue();
+	if (kfd == -1)
+		return;
+	EV_SET(&ke1, sock, EVFILT_READ, EV_ADD | EV_ONESHOT, 0, 0, 0);
+	kevent(kfd, &ke1, 1, &ke2, 1, NULL);
+	close(kfd);
+#endif /* CONFIG_ELOOP_KQUEUE */
 }
 
 #ifdef CONFIG_ELOOP_SELECT
diff --git a/src/utils/eloop.h b/src/utils/eloop.h
index 07b8c0dc33520..97af16f0130aa 100644
--- a/src/utils/eloop.h
+++ b/src/utils/eloop.h
@@ -313,6 +313,14 @@ int eloop_register_signal_reconfig(eloop_signal_handler handler,
 				   void *user_data);
 
 /**
+ * eloop_sock_requeue - Requeue sockets
+ *
+ * Requeue sockets after forking because some implementations require this,
+ * such as epoll and kqueue.
+ */
+int eloop_sock_requeue(void);
+
+/**
  * eloop_run - Start the event loop
  *
  * Start the event loop and continue running as long as there are any
diff --git a/src/utils/eloop_win.c b/src/utils/eloop_win.c
index de47fb21837c2..9c8b12be8ad80 100644
--- a/src/utils/eloop_win.c
+++ b/src/utils/eloop_win.c
@@ -692,3 +692,9 @@ void eloop_wait_for_read_sock(int sock)
 	WSAEventSelect(sock, event, 0);
 	WSACloseEvent(event);
 }
+
+
+int eloop_sock_requeue(void)
+{
+	return 0;
+}
diff --git a/src/utils/ext_password.c b/src/utils/ext_password.c
index 06131197a3113..5615bd72a714d 100644
--- a/src/utils/ext_password.c
+++ b/src/utils/ext_password.c
@@ -16,10 +16,6 @@
 #include "ext_password_i.h"
 
 
-#ifdef CONFIG_EXT_PASSWORD_TEST
-extern struct ext_password_backend ext_password_test;
-#endif /* CONFIG_EXT_PASSWORD_TEST */
-
 static const struct ext_password_backend *backends[] = {
 #ifdef CONFIG_EXT_PASSWORD_TEST
 	&ext_password_test,
diff --git a/src/utils/ext_password_i.h b/src/utils/ext_password_i.h
index 043e7312c62fb..948eaf5421b9e 100644
--- a/src/utils/ext_password_i.h
+++ b/src/utils/ext_password_i.h
@@ -20,4 +20,10 @@ struct ext_password_backend {
 
 struct wpabuf * ext_password_alloc(size_t len);
 
+/* Available ext_password backends */
+
+#ifdef CONFIG_EXT_PASSWORD_TEST
+extern const struct ext_password_backend ext_password_test;
+#endif /* CONFIG_EXT_PASSWORD_TEST */
+
 #endif /* EXT_PASSWORD_I_H */
diff --git a/src/utils/http_curl.c b/src/utils/http_curl.c
index 653eb541ab472..a06aae8d9b9d0 100644
--- a/src/utils/http_curl.c
+++ b/src/utils/http_curl.c
@@ -26,6 +26,9 @@
 #include "common.h"
 #include "xml-utils.h"
 #include "http-utils.h"
+#ifdef EAP_TLS_OPENSSL
+#include "crypto/tls_openssl.h"
+#endif /* EAP_TLS_OPENSSL */
 
 
 struct http_ctx {
@@ -421,6 +424,28 @@ ASN1_SEQUENCE(LogotypeExtn) = {
 
 IMPLEMENT_ASN1_FUNCTIONS(LogotypeExtn);
 
+#ifdef OPENSSL_IS_BORINGSSL
+#define sk_LogotypeInfo_num(st) \
+sk_num(CHECKED_CAST(_STACK *, STACK_OF(LogotypeInfo) *, (st)))
+#define sk_LogotypeInfo_value(st, i) (LogotypeInfo *) \
+sk_value(CHECKED_CAST(_STACK *, const STACK_OF(LogotypeInfo) *, (st)), (i))
+#define sk_LogotypeImage_num(st) \
+sk_num(CHECKED_CAST(_STACK *, STACK_OF(LogotypeImage) *, (st)))
+#define sk_LogotypeImage_value(st, i) (LogotypeImage *) \
+sk_value(CHECKED_CAST(_STACK *, const STACK_OF(LogotypeImage) *, (st)), (i))
+#define sk_LogotypeAudio_num(st) \
+sk_num(CHECKED_CAST(_STACK *, STACK_OF(LogotypeAudio) *, (st)))
+#define sk_LogotypeAudio_value(st, i) (LogotypeAudio *) \
+sk_value(CHECK_CAST(_STACK *, const STACK_OF(LogotypeAudio) *, (st)), (i))
+#define sk_HashAlgAndValue_num(st) \
+sk_num(CHECKED_CAST(_STACK *, STACK_OF(HashAlgAndValue) *, (st)))
+#define sk_HashAlgAndValue_value(st, i) (HashAlgAndValue *) \
+sk_value(CHECKED_CAST(_STACK *, const STACK_OF(HashAlgAndValue) *, (st)), (i))
+#define sk_ASN1_IA5STRING_num(st) \
+sk_num(CHECKED_CAST(_STACK *, STACK_OF(ASN1_IA5STRING) *, (st)))
+#define sk_ASN1_IA5STRING_value(st, i) (ASN1_IA5STRING *) \
+sk_value(CHECKED_CAST(_STACK *, const STACK_OF(ASN1_IA5STRING) *, (st)), (i))
+#else /* OPENSSL_IS_BORINGSSL */
 #define sk_LogotypeInfo_num(st) SKM_sk_num(LogotypeInfo, (st))
 #define sk_LogotypeInfo_value(st, i) SKM_sk_value(LogotypeInfo, (st), (i))
 #define sk_LogotypeImage_num(st) SKM_sk_num(LogotypeImage, (st))
@@ -431,6 +456,7 @@ IMPLEMENT_ASN1_FUNCTIONS(LogotypeExtn);
 #define sk_HashAlgAndValue_value(st, i) SKM_sk_value(HashAlgAndValue, (st), (i))
 #define sk_ASN1_IA5STRING_num(st) SKM_sk_num(ASN1_IA5STRING, (st))
 #define sk_ASN1_IA5STRING_value(st, i) SKM_sk_value(ASN1_IA5STRING, (st), (i))
+#endif /* OPENSSL_IS_BORINGSSL */
 
 
 static void add_logo(struct http_ctx *ctx, struct http_cert *hcert,
@@ -618,13 +644,25 @@ static void i2r_LogotypeImageInfo(LogotypeImageInfo *info, BIO *out, int indent)
 	} else {
 		BIO_printf(out, "%*stype: default (1)\n", indent, "");
 	}
+	val = ASN1_INTEGER_get(info->fileSize);
+	BIO_printf(out, "%*sfileSize: %ld\n", indent, "", val);
 	val = ASN1_INTEGER_get(info->xSize);
 	BIO_printf(out, "%*sxSize: %ld\n", indent, "", val);
 	val = ASN1_INTEGER_get(info->ySize);
 	BIO_printf(out, "%*sySize: %ld\n", indent, "", val);
 	if (info->resolution) {
-		BIO_printf(out, "%*sresolution\n", indent, "");
-		/* TODO */
+		BIO_printf(out, "%*sresolution [%d]\n", indent, "",
+			   info->resolution->type);
+		switch (info->resolution->type) {
+		case 0:
+			val = ASN1_INTEGER_get(info->resolution->d.numBits);
+			BIO_printf(out, "%*snumBits: %ld\n", indent, "", val);
+			break;
+		case 1:
+			val = ASN1_INTEGER_get(info->resolution->d.tableSize);
+			BIO_printf(out, "%*stableSize: %ld\n", indent, "", val);
+			break;
+		}
 	}
 	if (info->language) {
 		BIO_printf(out, "%*slanguage: ", indent, "");
@@ -981,6 +1019,26 @@ static int curl_cb_ssl_verify(int preverify_ok, X509_STORE_CTX *x509_ctx)
 	if (depth == 0 && preverify_ok && validate_server_cert(ctx, cert) < 0)
 		return 0;
 
+#ifdef OPENSSL_IS_BORINGSSL
+	if (depth == 0 && ctx->ocsp != NO_OCSP && preverify_ok) {
+		enum ocsp_result res;
+
+		res = check_ocsp_resp(ssl_ctx, ssl, cert, ctx->peer_issuer,
+				      ctx->peer_issuer_issuer);
+		if (res == OCSP_REVOKED) {
+			preverify_ok = 0;
+			wpa_printf(MSG_INFO, "OCSP: certificate revoked");
+			if (err == X509_V_OK)
+				X509_STORE_CTX_set_error(
+					x509_ctx, X509_V_ERR_CERT_REVOKED);
+		} else if (res != OCSP_GOOD && (ctx->ocsp == MANDATORY_OCSP)) {
+			preverify_ok = 0;
+			wpa_printf(MSG_INFO,
+				   "OCSP: bad certificate status response");
+		}
+	}
+#endif /* OPENSSL_IS_BORINGSSL */
+
 	if (!preverify_ok)
 		ctx->last_err = "TLS validation failed";
 
@@ -1156,6 +1214,7 @@ static int ocsp_resp_cb(SSL *s, void *arg)
 		wpa_printf(MSG_INFO, "OpenSSL: Could not find current server certificate from OCSP response%s",
 			   (ctx->ocsp == MANDATORY_OCSP) ? "" :
 			   " (OCSP not required)");
+		OCSP_CERTID_free(id);
 		OCSP_BASICRESP_free(basic);
 		OCSP_RESPONSE_free(rsp);
 		if (ctx->ocsp == MANDATORY_OCSP)
@@ -1163,6 +1222,7 @@ static int ocsp_resp_cb(SSL *s, void *arg)
 			ctx->last_err = "Could not find current server certificate from OCSP response";
 		return (ctx->ocsp == MANDATORY_OCSP) ? 0 : 1;
 	}
+	OCSP_CERTID_free(id);
 
 	if (!OCSP_check_validity(this_update, next_update, 5 * 60, -1)) {
 		tls_show_errors(__func__, "OpenSSL: OCSP status times invalid");
@@ -1273,6 +1333,16 @@ static CURL * setup_curl_post(struct http_ctx *ctx, const char *address,
 #ifdef EAP_TLS_OPENSSL
 		curl_easy_setopt(curl, CURLOPT_SSL_CTX_FUNCTION, curl_cb_ssl);
 		curl_easy_setopt(curl, CURLOPT_SSL_CTX_DATA, ctx);
+#ifdef OPENSSL_IS_BORINGSSL
+		/* For now, using the CURLOPT_SSL_VERIFYSTATUS option only
+		 * with BoringSSL since the OpenSSL specific callback hack to
+		 * enable OCSP is not available with BoringSSL. The OCSP
+		 * implementation within libcurl is not sufficient for the
+		 * Hotspot 2.0 OSU needs, so cannot use this with OpenSSL.
+		 */
+		if (ctx->ocsp != NO_OCSP)
+			curl_easy_setopt(curl, CURLOPT_SSL_VERIFYSTATUS, 1L);
+#endif /* OPENSSL_IS_BORINGSSL */
 #endif /* EAP_TLS_OPENSSL */
 	} else {
 		curl_easy_setopt(curl, CURLOPT_SSL_VERIFYPEER, 0L);
diff --git a/src/utils/module_tests.h b/src/utils/module_tests.h
new file mode 100644
index 0000000000000..3bfe4ad026cce
--- /dev/null
+++ b/src/utils/module_tests.h
@@ -0,0 +1,20 @@
+/*
+ * Module tests
+ * Copyright (c) 2014-2015, Jouni Malinen <j@w1.fi>
+ *
+ * This software may be distributed under the terms of the BSD license.
+ * See README for more details.
+ */
+
+#ifndef MODULE_TESTS_H
+#define MODULE_TESTS_H
+
+int wpas_module_tests(void);
+int hapd_module_tests(void);
+
+int utils_module_tests(void);
+int wps_module_tests(void);
+int common_module_tests(void);
+int crypto_module_tests(void);
+
+#endif /* MODULE_TESTS_H */
diff --git a/src/utils/os.h b/src/utils/os.h
index 9e496fb659783..e8f0b792738ab 100644
--- a/src/utils/os.h
+++ b/src/utils/os.h
@@ -657,6 +657,10 @@ int os_exec(const char *program, const char *arg, int wait_completion);
 #if defined(WPA_TRACE_BFD) && defined(CONFIG_TESTING_OPTIONS)
 #define TEST_FAIL() testing_test_fail()
 int testing_test_fail(void);
+extern char wpa_trace_fail_func[256];
+extern unsigned int wpa_trace_fail_after;
+extern char wpa_trace_test_fail_func[256];
+extern unsigned int wpa_trace_test_fail_after;
 #else
 #define TEST_FAIL() 0
 #endif
diff --git a/src/utils/os_unix.c b/src/utils/os_unix.c
index ffa2e788b3db8..65c6fa412f207 100644
--- a/src/utils/os_unix.c
+++ b/src/utils/os_unix.c
@@ -372,6 +372,7 @@ void os_program_deinit(void)
 	if (total)
 		wpa_printf(MSG_INFO, "MEMLEAK: total %lu bytes",
 			   (unsigned long) total);
+	wpa_trace_deinit();
 #endif /* WPA_TRACE */
 }
 
@@ -434,27 +435,23 @@ char * os_readfile(const char *name, size_t *len)
 
 int os_file_exists(const char *fname)
 {
-	FILE *f = fopen(fname, "rb");
-	if (f == NULL)
-		return 0;
-	fclose(f);
-	return 1;
+	return access(fname, F_OK) == 0;
 }
 
 
 int os_fdatasync(FILE *stream)
 {
 	if (!fflush(stream)) {
-#ifndef __MACH__
+#ifdef __linux__
 		return fdatasync(fileno(stream));
-#else /* __MACH__ */
+#else /* !__linux__ */
 #ifdef F_FULLFSYNC
 		/* OS X does not implement fdatasync(). */
 		return fcntl(fileno(stream), F_FULLFSYNC);
 #else /* F_FULLFSYNC */
-#error Neither fdatasync nor F_FULLSYNC are defined
+		return fsync(fileno(stream));
 #endif /* F_FULLFSYNC */
-#endif /* __MACH__ */
+#endif /* __linux__ */
 	}
 
 	return -1;
diff --git a/src/utils/pcsc_funcs.c b/src/utils/pcsc_funcs.c
index 6f5ea93962131..383ed3ddfeed5 100644
--- a/src/utils/pcsc_funcs.c
+++ b/src/utils/pcsc_funcs.c
@@ -11,7 +11,11 @@
  */
 
 #include "includes.h"
+#ifdef __APPLE__
+#include <PCSC/winscard.h>
+#else
 #include <winscard.h>
+#endif
 
 #include "common.h"
 #include "pcsc_funcs.h"
@@ -110,7 +114,11 @@ typedef enum { SCARD_GSM_SIM, SCARD_USIM } sim_types;
 struct scard_data {
 	SCARDCONTEXT ctx;
 	SCARDHANDLE card;
+#ifdef __APPLE__
+	uint32_t protocol;
+#else
 	DWORD protocol;
+#endif
 	sim_types sim_type;
 	int pin1_required;
 };
@@ -275,7 +283,7 @@ static int scard_parse_fsp_templ(unsigned char *buf, size_t buf_len,
 	pos++;
 	if (pos >= end)
 		return -1;
-	if ((pos + pos[0]) < end)
+	if (pos[0] < end - pos)
 		end = pos + 1 + pos[0];
 	pos++;
 	wpa_hexdump(MSG_DEBUG, "SCARD: file header FSP template",
@@ -504,7 +512,12 @@ static int scard_get_aid(struct scard_data *scard, unsigned char *aid,
 struct scard_data * scard_init(const char *reader)
 {
 	long ret;
-	unsigned long len, pos;
+#ifdef __APPLE__
+	uint32_t len;
+#else
+	unsigned long len;
+#endif
+	unsigned long pos;
 	struct scard_data *scard;
 #ifdef CONFIG_NATIVE_WINDOWS
 	TCHAR *readers = NULL;
@@ -605,7 +618,7 @@ struct scard_data * scard_init(const char *reader)
 	readers = NULL;
 
 	wpa_printf(MSG_DEBUG, "SCARD: card=0x%x active_protocol=%lu (%s)",
-		   (unsigned int) scard->card, scard->protocol,
+		   (unsigned int) scard->card, (unsigned long) scard->protocol,
 		   scard->protocol == SCARD_PROTOCOL_T0 ? "T0" : "T1");
 
 	ret = SCardBeginTransaction(scard->card);
@@ -764,7 +777,11 @@ static long scard_transmit(struct scard_data *scard,
 			   unsigned char *_recv, size_t *recv_len)
 {
 	long ret;
+#ifdef __APPLE__
+	uint32_t rlen;
+#else
 	unsigned long rlen;
+#endif
 
 	wpa_hexdump_key(MSG_DEBUG, "SCARD: scard_transmit: send",
 			_send, send_len);
@@ -1385,7 +1402,7 @@ int scard_umts_auth(struct scard_data *scard, const unsigned char *_rand,
 		end = buf + len;
 
 		/* RES */
-		if (pos[0] > RES_MAX_LEN || pos + pos[0] > end) {
+		if (pos[0] > RES_MAX_LEN || pos[0] > end - pos) {
 			wpa_printf(MSG_DEBUG, "SCARD: Invalid RES");
 			return -1;
 		}
@@ -1395,7 +1412,7 @@ int scard_umts_auth(struct scard_data *scard, const unsigned char *_rand,
 		wpa_hexdump(MSG_DEBUG, "SCARD: RES", res, *res_len);
 
 		/* CK */
-		if (pos[0] != CK_LEN || pos + CK_LEN > end) {
+		if (pos[0] != CK_LEN || CK_LEN > end - pos) {
 			wpa_printf(MSG_DEBUG, "SCARD: Invalid CK");
 			return -1;
 		}
@@ -1405,7 +1422,7 @@ int scard_umts_auth(struct scard_data *scard, const unsigned char *_rand,
 		wpa_hexdump(MSG_DEBUG, "SCARD: CK", ck, CK_LEN);
 
 		/* IK */
-		if (pos[0] != IK_LEN || pos + IK_LEN > end) {
+		if (pos[0] != IK_LEN || IK_LEN > end - pos) {
 			wpa_printf(MSG_DEBUG, "SCARD: Invalid IK");
 			return -1;
 		}
diff --git a/src/utils/platform.h b/src/utils/platform.h
index 46cfe785e1806..813987eb66064 100644
--- a/src/utils/platform.h
+++ b/src/utils/platform.h
@@ -15,7 +15,7 @@
 								\
 	__ptr->__val;						\
 })
-#define get_unaligned_le16(p)	le16_to_cpu(get_unaligned((uint16_t *)(p)))
-#define get_unaligned_le32(p)	le32_to_cpu(get_unaligned((uint32_t *)(p)))
+#define get_unaligned_le16(p)	le16_to_cpu(get_unaligned((le16 *)(p)))
+#define get_unaligned_le32(p)	le32_to_cpu(get_unaligned((le32 *)(p)))
 
 #endif /* PLATFORM_H */
diff --git a/src/utils/radiotap.c b/src/utils/radiotap.c
index c9a5023355922..71996eb7908f5 100644
--- a/src/utils/radiotap.c
+++ b/src/utils/radiotap.c
@@ -13,8 +13,8 @@
  *
  * See COPYING for more details.
  */
-#include "radiotap_iter.h"
 #include "platform.h"
+#include "radiotap_iter.h"
 
 /* function prototypes and related defs are in radiotap_iter.h */
 
diff --git a/src/utils/radiotap.h b/src/utils/radiotap.h
index 0572e7c963da7..460af23d81246 100644
--- a/src/utils/radiotap.h
+++ b/src/utils/radiotap.h
@@ -65,12 +65,12 @@ struct ieee80211_radiotap_header {
 				 * new fields does not count.
 				 */
 	uint8_t it_pad;
-	uint16_t it_len;	/* length of the whole
+	le16 it_len;		/* length of the whole
 				 * header in bytes, including
 				 * it_version, it_pad,
 				 * it_len, and data fields.
 				 */
-	uint32_t it_present;	/* A bitmap telling which
+	le32 it_present;	/* A bitmap telling which
 				 * fields are present. Set bit 31
 				 * (0x80000000) to extend the
 				 * bitmap by another 32 bits.
diff --git a/src/utils/radiotap_iter.h b/src/utils/radiotap_iter.h
index b768c85baace5..6ea07e3b1b83f 100644
--- a/src/utils/radiotap_iter.h
+++ b/src/utils/radiotap_iter.h
@@ -67,7 +67,7 @@ struct ieee80211_radiotap_iterator {
 	const struct ieee80211_radiotap_namespace *current_namespace;
 
 	unsigned char *_arg, *_next_ns_data;
-	uint32_t *_next_bitmap;
+	le32 *_next_bitmap;
 
 	unsigned char *this_arg;
 #ifdef RADIOTAP_SUPPORT_OVERRIDES
diff --git a/src/utils/trace.c b/src/utils/trace.c
index 8484d277d24b6..d72cf604f8e9b 100644
--- a/src/utils/trace.c
+++ b/src/utils/trace.c
@@ -366,4 +366,13 @@ void wpa_trace_check_ref(const void *addr)
 	}
 }
 
+
+void wpa_trace_deinit(void)
+{
+#ifdef WPA_TRACE_BFD
+	free(syms);
+	syms = NULL;
+#endif /* WPA_TRACE_BFD */
+}
+
 #endif /* WPA_TRACE */
diff --git a/src/utils/trace.h b/src/utils/trace.h
index 43ed86c199786..d1636de077281 100644
--- a/src/utils/trace.h
+++ b/src/utils/trace.h
@@ -66,4 +66,6 @@ void wpa_trace_dump_funcname(const char *title, void *pc);
 
 #endif /* WPA_TRACE_BFD */
 
+void wpa_trace_deinit(void);
+
 #endif /* TRACE_H */
diff --git a/src/utils/utils_module_tests.c b/src/utils/utils_module_tests.c
index 41511b9999a62..abdb79c9879c1 100644
--- a/src/utils/utils_module_tests.c
+++ b/src/utils/utils_module_tests.c
@@ -16,6 +16,7 @@
 #include "utils/base64.h"
 #include "utils/ip_addr.h"
 #include "utils/eloop.h"
+#include "utils/module_tests.h"
 
 
 struct printf_test_data {
diff --git a/src/utils/wpa_debug.c b/src/utils/wpa_debug.c
index 61c0d5ce68c79..f7acf6b9f6984 100644
--- a/src/utils/wpa_debug.c
+++ b/src/utils/wpa_debug.c
@@ -148,7 +148,7 @@ int wpa_debug_open_linux_tracing(void)
 		strtok_r(line, " ", &tmp2);
 		tmp_path = strtok_r(NULL, " ", &tmp2);
 		fstype = strtok_r(NULL, " ", &tmp2);
-		if (strcmp(fstype, "debugfs") == 0) {
+		if (fstype && strcmp(fstype, "debugfs") == 0) {
 			path = tmp_path;
 			break;
 		}
@@ -517,16 +517,18 @@ int wpa_debug_reopen_file(void)
 {
 #ifdef CONFIG_DEBUG_FILE
 	int rv;
-	if (last_path) {
-		char *tmp = os_strdup(last_path);
-		wpa_debug_close_file();
-		rv = wpa_debug_open_file(tmp);
-		os_free(tmp);
-	} else {
-		wpa_printf(MSG_ERROR, "Last-path was not set, cannot "
-			   "re-open log file.");
-		rv = -1;
-	}
+	char *tmp;
+
+	if (!last_path)
+		return 0; /* logfile not used */
+
+	tmp = os_strdup(last_path);
+	if (!tmp)
+		return -1;
+
+	wpa_debug_close_file();
+	rv = wpa_debug_open_file(tmp);
+	os_free(tmp);
 	return rv;
 #else /* CONFIG_DEBUG_FILE */
 	return 0;
diff --git a/src/utils/wpabuf.c b/src/utils/wpabuf.c
index 11e7323619de8..96cb25cc1764b 100644
--- a/src/utils/wpabuf.c
+++ b/src/utils/wpabuf.c
@@ -310,3 +310,33 @@ void wpabuf_printf(struct wpabuf *buf, char *fmt, ...)
 		wpabuf_overflow(buf, res);
 	buf->used += res;
 }
+
+
+/**
+ * wpabuf_parse_bin - Parse a null terminated string of binary data to a wpabuf
+ * @buf: Buffer with null terminated string (hexdump) of binary data
+ * Returns: wpabuf or %NULL on failure
+ *
+ * The string len must be a multiple of two and contain only hexadecimal digits.
+ */
+struct wpabuf * wpabuf_parse_bin(const char *buf)
+{
+	size_t len;
+	struct wpabuf *ret;
+
+	len = os_strlen(buf);
+	if (len & 0x01)
+		return NULL;
+	len /= 2;
+
+	ret = wpabuf_alloc(len);
+	if (ret == NULL)
+		return NULL;
+
+	if (hexstr2bin(buf, wpabuf_put(ret, len), len)) {
+		wpabuf_free(ret);
+		return NULL;
+	}
+
+	return ret;
+}
diff --git a/src/utils/wpabuf.h b/src/utils/wpabuf.h
index c3ef1bae3667a..01da41b324d66 100644
--- a/src/utils/wpabuf.h
+++ b/src/utils/wpabuf.h
@@ -37,6 +37,7 @@ void * wpabuf_put(struct wpabuf *buf, size_t len);
 struct wpabuf * wpabuf_concat(struct wpabuf *a, struct wpabuf *b);
 struct wpabuf * wpabuf_zeropad(struct wpabuf *buf, size_t len);
 void wpabuf_printf(struct wpabuf *buf, char *fmt, ...) PRINTF_FORMAT(2, 3);
+struct wpabuf * wpabuf_parse_bin(const char *buf);
 
 
 /**
@@ -81,7 +82,7 @@ static inline const void * wpabuf_head(const struct wpabuf *buf)
 
 static inline const u8 * wpabuf_head_u8(const struct wpabuf *buf)
 {
-	return wpabuf_head(buf);
+	return (const u8 *) wpabuf_head(buf);
 }
 
 /**
@@ -96,42 +97,42 @@ static inline void * wpabuf_mhead(struct wpabuf *buf)
 
 static inline u8 * wpabuf_mhead_u8(struct wpabuf *buf)
 {
-	return wpabuf_mhead(buf);
+	return (u8 *) wpabuf_mhead(buf);
 }
 
 static inline void wpabuf_put_u8(struct wpabuf *buf, u8 data)
 {
-	u8 *pos = wpabuf_put(buf, 1);
+	u8 *pos = (u8 *) wpabuf_put(buf, 1);
 	*pos = data;
 }
 
 static inline void wpabuf_put_le16(struct wpabuf *buf, u16 data)
 {
-	u8 *pos = wpabuf_put(buf, 2);
+	u8 *pos = (u8 *) wpabuf_put(buf, 2);
 	WPA_PUT_LE16(pos, data);
 }
 
 static inline void wpabuf_put_le32(struct wpabuf *buf, u32 data)
 {
-	u8 *pos = wpabuf_put(buf, 4);
+	u8 *pos = (u8 *) wpabuf_put(buf, 4);
 	WPA_PUT_LE32(pos, data);
 }
 
 static inline void wpabuf_put_be16(struct wpabuf *buf, u16 data)
 {
-	u8 *pos = wpabuf_put(buf, 2);
+	u8 *pos = (u8 *) wpabuf_put(buf, 2);
 	WPA_PUT_BE16(pos, data);
 }
 
 static inline void wpabuf_put_be24(struct wpabuf *buf, u32 data)
 {
-	u8 *pos = wpabuf_put(buf, 3);
+	u8 *pos = (u8 *) wpabuf_put(buf, 3);
 	WPA_PUT_BE24(pos, data);
 }
 
 static inline void wpabuf_put_be32(struct wpabuf *buf, u32 data)
 {
-	u8 *pos = wpabuf_put(buf, 4);
+	u8 *pos = (u8 *) wpabuf_put(buf, 4);
 	WPA_PUT_BE32(pos, data);
 }
 
diff --git a/src/utils/xml_libxml2.c b/src/utils/xml_libxml2.c
index c92839461dad4..7b6d2764b0ed2 100644
--- a/src/utils/xml_libxml2.c
+++ b/src/utils/xml_libxml2.c
@@ -212,6 +212,8 @@ char * xml_node_to_str(struct xml_node_ctx *ctx, xml_node_t *node)
 	xmlDocSetRootElement(doc, n);
 	xmlDocDumpFormatMemory(doc, &buf, &bufsiz, 0);
 	xmlFreeDoc(doc);
+	if (!buf)
+		return NULL;
 	pos = (char *) buf;
 	if (strncmp(pos, "<?xml", 5) == 0) {
 		pos = strchr(pos, '>');
diff --git a/src/wps/wps.c b/src/wps/wps.c
index fbaf85aabab4a..fade6b6905dc8 100644
--- a/src/wps/wps.c
+++ b/src/wps/wps.c
@@ -19,6 +19,10 @@
 int wps_version_number = 0x20;
 int wps_testing_dummy_cred = 0;
 int wps_corrupt_pkhash = 0;
+int wps_force_auth_types_in_use = 0;
+u16 wps_force_auth_types = 0;
+int wps_force_encr_types_in_use = 0;
+u16 wps_force_encr_types = 0;
 #endif /* CONFIG_WPS_TESTING */
 
 
@@ -170,7 +174,7 @@ void wps_deinit(struct wps_data *data)
 	} else if (data->registrar)
 		wps_registrar_unlock_pin(data->wps->registrar, data->uuid_e);
 
-	wpabuf_free(data->dh_privkey);
+	wpabuf_clear_free(data->dh_privkey);
 	wpabuf_free(data->dh_pubkey_e);
 	wpabuf_free(data->dh_pubkey_r);
 	wpabuf_free(data->last_msg);
diff --git a/src/wps/wps.h b/src/wps/wps.h
index 2c91d1678c157..2505d2d9f246d 100644
--- a/src/wps/wps.h
+++ b/src/wps/wps.h
@@ -1,6 +1,6 @@
 /*
  * Wi-Fi Protected Setup
- * Copyright (c) 2007-2013, Jouni Malinen <j@w1.fi>
+ * Copyright (c) 2007-2016, Jouni Malinen <j@w1.fi>
  *
  * This software may be distributed under the terms of the BSD license.
  * See README for more details.
@@ -664,6 +664,16 @@ struct wps_context {
 	u16 encr_types;
 
 	/**
+	 * encr_types_rsn - Enabled encryption types for RSN (WPS_ENCR_*)
+	 */
+	u16 encr_types_rsn;
+
+	/**
+	 * encr_types_wpa - Enabled encryption types for WPA (WPS_ENCR_*)
+	 */
+	u16 encr_types_wpa;
+
+	/**
 	 * auth_types - Authentication types (bit field of WPS_AUTH_*)
 	 */
 	u16 auth_types;
@@ -827,7 +837,7 @@ int wps_build_credential_wrap(struct wpabuf *msg,
 
 unsigned int wps_pin_checksum(unsigned int pin);
 unsigned int wps_pin_valid(unsigned int pin);
-unsigned int wps_generate_pin(void);
+int wps_generate_pin(unsigned int *pin);
 int wps_pin_str_valid(const char *pin);
 void wps_free_pending_msgs(struct upnp_pending_message *msgs);
 
diff --git a/src/wps/wps_attr_build.c b/src/wps/wps_attr_build.c
index b689357a280a6..770f5e90cbde0 100644
--- a/src/wps/wps_attr_build.c
+++ b/src/wps/wps_attr_build.c
@@ -1,6 +1,6 @@
 /*
  * Wi-Fi Protected Setup - attribute building
- * Copyright (c) 2008, Jouni Malinen <j@w1.fi>
+ * Copyright (c) 2008-2016, Jouni Malinen <j@w1.fi>
  *
  * This software may be distributed under the terms of the BSD license.
  * See README for more details.
@@ -20,10 +20,10 @@
 
 int wps_build_public_key(struct wps_data *wps, struct wpabuf *msg)
 {
-	struct wpabuf *pubkey;
+	struct wpabuf *pubkey = NULL;
 
 	wpa_printf(MSG_DEBUG, "WPS:  * Public Key");
-	wpabuf_free(wps->dh_privkey);
+	wpabuf_clear_free(wps->dh_privkey);
 	wps->dh_privkey = NULL;
 	if (wps->dev_pw_id != DEV_PW_DEFAULT && wps->wps->dh_privkey &&
 	    wps->wps->dh_ctx) {
@@ -298,7 +298,16 @@ int wps_build_auth_type_flags(struct wps_data *wps, struct wpabuf *msg)
 	auth_types &= ~WPS_AUTH_WPA;
 	auth_types &= ~WPS_AUTH_WPA2;
 	auth_types &= ~WPS_AUTH_SHARED;
-	wpa_printf(MSG_DEBUG, "WPS:  * Authentication Type Flags");
+#ifdef CONFIG_WPS_TESTING
+	if (wps_force_auth_types_in_use) {
+		wpa_printf(MSG_DEBUG,
+			   "WPS: Testing - replace auth type 0x%x with 0x%x",
+			   auth_types, wps_force_auth_types);
+		auth_types = wps_force_auth_types;
+	}
+#endif /* CONFIG_WPS_TESTING */
+	wpa_printf(MSG_DEBUG, "WPS:  * Authentication Type Flags (0x%x)",
+		   auth_types);
 	wpabuf_put_be16(msg, ATTR_AUTH_TYPE_FLAGS);
 	wpabuf_put_be16(msg, 2);
 	wpabuf_put_be16(msg, auth_types);
@@ -310,7 +319,16 @@ int wps_build_encr_type_flags(struct wps_data *wps, struct wpabuf *msg)
 {
 	u16 encr_types = WPS_ENCR_TYPES;
 	encr_types &= ~WPS_ENCR_WEP;
-	wpa_printf(MSG_DEBUG, "WPS:  * Encryption Type Flags");
+#ifdef CONFIG_WPS_TESTING
+	if (wps_force_encr_types_in_use) {
+		wpa_printf(MSG_DEBUG,
+			   "WPS: Testing - replace encr type 0x%x with 0x%x",
+			   encr_types, wps_force_encr_types);
+		encr_types = wps_force_encr_types;
+	}
+#endif /* CONFIG_WPS_TESTING */
+	wpa_printf(MSG_DEBUG, "WPS:  * Encryption Type Flags (0x%x)",
+		   encr_types);
 	wpabuf_put_be16(msg, ATTR_ENCR_TYPE_FLAGS);
 	wpabuf_put_be16(msg, 2);
 	wpabuf_put_be16(msg, encr_types);
@@ -395,7 +413,8 @@ int wps_build_oob_dev_pw(struct wpabuf *msg, u16 dev_pw_id,
 		   dev_pw_id);
 	addr[0] = wpabuf_head(pubkey);
 	hash_len = wpabuf_len(pubkey);
-	sha256_vector(1, addr, &hash_len, pubkey_hash);
+	if (sha256_vector(1, addr, &hash_len, pubkey_hash) < 0)
+		return -1;
 #ifdef CONFIG_WPS_TESTING
 	if (wps_corrupt_pkhash) {
 		wpa_hexdump(MSG_DEBUG, "WPS: Real Public Key Hash",
diff --git a/src/wps/wps_attr_parse.c b/src/wps/wps_attr_parse.c
index 11a967ba0ef18..756d57e876c55 100644
--- a/src/wps/wps_attr_parse.c
+++ b/src/wps/wps_attr_parse.c
@@ -83,10 +83,10 @@ static int wps_parse_vendor_ext_wfa(struct wps_parse_attr *attr, const u8 *pos,
 	const u8 *end = pos + len;
 	u8 id, elen;
 
-	while (pos + 2 <= end) {
+	while (end - pos >= 2) {
 		id = *pos++;
 		elen = *pos++;
-		if (pos + elen > end)
+		if (elen > end - pos)
 			break;
 		if (wps_set_vendor_ext_wfa_subelem(attr, id, elen, pos) < 0)
 			return -1;
diff --git a/src/wps/wps_attr_process.c b/src/wps/wps_attr_process.c
index eadb22fe2e78b..e8c4579309ab3 100644
--- a/src/wps/wps_attr_process.c
+++ b/src/wps/wps_attr_process.c
@@ -229,6 +229,16 @@ static int wps_workaround_cred_key(struct wps_credential *cred)
 		cred->key_len--;
 #endif /* CONFIG_WPS_STRICT */
 	}
+
+
+	if (cred->auth_type & (WPS_AUTH_WPAPSK | WPS_AUTH_WPA2PSK) &&
+	    (cred->key_len < 8 || has_ctrl_char(cred->key, cred->key_len))) {
+		wpa_printf(MSG_INFO, "WPS: Reject credential with invalid WPA/WPA2-Personal passphrase");
+		wpa_hexdump_ascii_key(MSG_INFO, "WPS: Network Key",
+				      cred->key, cred->key_len);
+		return -1;
+	}
+
 	return 0;
 }
 
diff --git a/src/wps/wps_common.c b/src/wps/wps_common.c
index 88f85fe83f057..2e3472177de9e 100644
--- a/src/wps/wps_common.c
+++ b/src/wps/wps_common.c
@@ -90,7 +90,7 @@ int wps_derive_keys(struct wps_data *wps)
 	}
 
 	/* Own DH private key is not needed anymore */
-	wpabuf_free(wps->dh_privkey);
+	wpabuf_clear_free(wps->dh_privkey);
 	wps->dh_privkey = NULL;
 
 	wpa_hexdump_buf_key(MSG_DEBUG, "WPS: DH shared key", dh_shared);
@@ -100,7 +100,7 @@ int wps_derive_keys(struct wps_data *wps)
 	len[0] = wpabuf_len(dh_shared);
 	sha256_vector(1, addr, len, dhkey);
 	wpa_hexdump_key(MSG_DEBUG, "WPS: DHKey", dhkey, sizeof(dhkey));
-	wpabuf_free(dh_shared);
+	wpabuf_clear_free(dh_shared);
 
 	/* KDK = HMAC-SHA-256_DHKey(N1 || EnrolleeMAC || N2) */
 	addr[0] = wps->nonce_e;
@@ -129,23 +129,26 @@ int wps_derive_keys(struct wps_data *wps)
 }
 
 
-void wps_derive_psk(struct wps_data *wps, const u8 *dev_passwd,
-		    size_t dev_passwd_len)
+int wps_derive_psk(struct wps_data *wps, const u8 *dev_passwd,
+		   size_t dev_passwd_len)
 {
 	u8 hash[SHA256_MAC_LEN];
 
-	hmac_sha256(wps->authkey, WPS_AUTHKEY_LEN, dev_passwd,
-		    (dev_passwd_len + 1) / 2, hash);
+	if (hmac_sha256(wps->authkey, WPS_AUTHKEY_LEN, dev_passwd,
+			(dev_passwd_len + 1) / 2, hash) < 0)
+		return -1;
 	os_memcpy(wps->psk1, hash, WPS_PSK_LEN);
-	hmac_sha256(wps->authkey, WPS_AUTHKEY_LEN,
-		    dev_passwd + (dev_passwd_len + 1) / 2,
-		    dev_passwd_len / 2, hash);
+	if (hmac_sha256(wps->authkey, WPS_AUTHKEY_LEN,
+			dev_passwd + (dev_passwd_len + 1) / 2,
+			dev_passwd_len / 2, hash) < 0)
+		return -1;
 	os_memcpy(wps->psk2, hash, WPS_PSK_LEN);
 
 	wpa_hexdump_ascii_key(MSG_DEBUG, "WPS: Device Password",
 			      dev_passwd, dev_passwd_len);
 	wpa_hexdump_key(MSG_DEBUG, "WPS: PSK1", wps->psk1, WPS_PSK_LEN);
 	wpa_hexdump_key(MSG_DEBUG, "WPS: PSK2", wps->psk2, WPS_PSK_LEN);
+	return 0;
 }
 
 
@@ -173,7 +176,7 @@ struct wpabuf * wps_decrypt_encr_settings(struct wps_data *wps, const u8 *encr,
 	wpabuf_put_data(decrypted, encr + block_size, encr_len - block_size);
 	if (aes_128_cbc_decrypt(wps->keywrapkey, encr, wpabuf_mhead(decrypted),
 				wpabuf_len(decrypted))) {
-		wpabuf_free(decrypted);
+		wpabuf_clear_free(decrypted);
 		return NULL;
 	}
 
@@ -184,14 +187,14 @@ struct wpabuf * wps_decrypt_encr_settings(struct wps_data *wps, const u8 *encr,
 	pad = *pos;
 	if (pad > wpabuf_len(decrypted)) {
 		wpa_printf(MSG_DEBUG, "WPS: Invalid PKCS#5 v2.0 pad value");
-		wpabuf_free(decrypted);
+		wpabuf_clear_free(decrypted);
 		return NULL;
 	}
 	for (i = 0; i < pad; i++) {
 		if (*pos-- != pad) {
 			wpa_printf(MSG_DEBUG, "WPS: Invalid PKCS#5 v2.0 pad "
 				   "string");
-			wpabuf_free(decrypted);
+			wpabuf_clear_free(decrypted);
 			return NULL;
 		}
 	}
@@ -235,20 +238,18 @@ unsigned int wps_pin_valid(unsigned int pin)
  * wps_generate_pin - Generate a random PIN
  * Returns: Eight digit PIN (i.e., including the checksum digit)
  */
-unsigned int wps_generate_pin(void)
+int wps_generate_pin(unsigned int *pin)
 {
 	unsigned int val;
 
 	/* Generate seven random digits for the PIN */
-	if (random_get_bytes((unsigned char *) &val, sizeof(val)) < 0) {
-		struct os_time now;
-		os_get_time(&now);
-		val = os_random() ^ now.sec ^ now.usec;
-	}
+	if (random_get_bytes((unsigned char *) &val, sizeof(val)) < 0)
+		return -1;
 	val %= 10000000;
 
 	/* Append checksum digit */
-	return val * 10 + wps_pin_checksum(val);
+	*pin = val * 10 + wps_pin_checksum(val);
+	return 0;
 }
 
 
@@ -375,7 +376,7 @@ struct wpabuf * wps_get_oob_cred(struct wps_context *wps, int rf_band,
 	    wps_build_mac_addr(plain, wps->dev.mac_addr) ||
 	    wps_build_wfa_ext(plain, 0, NULL, 0)) {
 		os_free(data.new_psk);
-		wpabuf_free(plain);
+		wpabuf_clear_free(plain);
 		return NULL;
 	}
 
@@ -423,7 +424,7 @@ struct wpabuf * wps_build_nfc_pw_token(u16 dev_pw_id,
 	    wps_build_wfa_ext(data, 0, NULL, 0)) {
 		wpa_printf(MSG_ERROR, "WPS: Failed to build NFC password "
 			   "token");
-		wpabuf_free(data);
+		wpabuf_clear_free(data);
 		return NULL;
 	}
 
@@ -660,7 +661,7 @@ int wps_nfc_gen_dh(struct wpabuf **pubkey, struct wpabuf **privkey)
 
 	wpabuf_free(*pubkey);
 	*pubkey = pub;
-	wpabuf_free(*privkey);
+	wpabuf_clear_free(*privkey);
 	*privkey = priv;
 
 	return 0;
@@ -691,7 +692,7 @@ struct wpabuf * wps_nfc_token_gen(int ndef, int *id, struct wpabuf **pubkey,
 	}
 
 	*id = 0x10 + val % 0xfff0;
-	wpabuf_free(*dev_pw);
+	wpabuf_clear_free(*dev_pw);
 	*dev_pw = pw;
 
 	return wps_nfc_token_build(ndef, *id, *pubkey, *dev_pw);
diff --git a/src/wps/wps_defs.h b/src/wps/wps_defs.h
index a23b979d2e3c7..301864da433d0 100644
--- a/src/wps/wps_defs.h
+++ b/src/wps/wps_defs.h
@@ -14,6 +14,10 @@
 extern int wps_version_number;
 extern int wps_testing_dummy_cred;
 extern int wps_corrupt_pkhash;
+extern int wps_force_auth_types_in_use;
+extern u16 wps_force_auth_types;
+extern int wps_force_encr_types_in_use;
+extern u16 wps_force_encr_types;
 #define WPS_VERSION wps_version_number
 
 #else /* CONFIG_WPS_TESTING */
diff --git a/src/wps/wps_enrollee.c b/src/wps/wps_enrollee.c
index 9321b721abd75..417507740d7aa 100644
--- a/src/wps/wps_enrollee.c
+++ b/src/wps/wps_enrollee.c
@@ -173,7 +173,8 @@ static struct wpabuf * wps_build_m3(struct wps_data *wps)
 		wpa_printf(MSG_DEBUG, "WPS: No Device Password available");
 		return NULL;
 	}
-	wps_derive_psk(wps, wps->dev_password, wps->dev_password_len);
+	if (wps_derive_psk(wps, wps->dev_password, wps->dev_password_len) < 0)
+		return NULL;
 
 	if (wps->wps->ap && random_pool_ready() != 1) {
 		wpa_printf(MSG_INFO,
@@ -224,11 +225,11 @@ static struct wpabuf * wps_build_m5(struct wps_data *wps)
 	    wps_build_encr_settings(wps, msg, plain) ||
 	    wps_build_wfa_ext(msg, 0, NULL, 0) ||
 	    wps_build_authenticator(wps, msg)) {
-		wpabuf_free(plain);
+		wpabuf_clear_free(plain);
 		wpabuf_free(msg);
 		return NULL;
 	}
-	wpabuf_free(plain);
+	wpabuf_clear_free(plain);
 
 	wps->state = RECV_M6;
 	return msg;
@@ -394,11 +395,11 @@ static struct wpabuf * wps_build_m7(struct wps_data *wps)
 	    wps_build_encr_settings(wps, msg, plain) ||
 	    wps_build_wfa_ext(msg, 0, NULL, 0) ||
 	    wps_build_authenticator(wps, msg)) {
-		wpabuf_free(plain);
+		wpabuf_clear_free(plain);
 		wpabuf_free(msg);
 		return NULL;
 	}
-	wpabuf_free(plain);
+	wpabuf_clear_free(plain);
 
 	if (wps->wps->ap && wps->wps->registrar) {
 		/*
@@ -1007,11 +1008,11 @@ static enum wps_process_res wps_process_m2(struct wps_data *wps,
 					      eattr.key_wrap_auth) ||
 		    wps_process_creds(wps, eattr.cred, eattr.cred_len,
 				      eattr.num_cred, attr->version2 != NULL)) {
-			wpabuf_free(decrypted);
+			wpabuf_clear_free(decrypted);
 			wps->state = SEND_WSC_NACK;
 			return WPS_CONTINUE;
 		}
-		wpabuf_free(decrypted);
+		wpabuf_clear_free(decrypted);
 
 		wps->state = WPS_MSG_DONE;
 		return WPS_CONTINUE;
@@ -1112,7 +1113,7 @@ static enum wps_process_res wps_process_m4(struct wps_data *wps,
 	}
 
 	if (wps_validate_m4_encr(decrypted, attr->version2 != NULL) < 0) {
-		wpabuf_free(decrypted);
+		wpabuf_clear_free(decrypted);
 		wps->state = SEND_WSC_NACK;
 		return WPS_CONTINUE;
 	}
@@ -1122,11 +1123,11 @@ static enum wps_process_res wps_process_m4(struct wps_data *wps,
 	if (wps_parse_msg(decrypted, &eattr) < 0 ||
 	    wps_process_key_wrap_auth(wps, decrypted, eattr.key_wrap_auth) ||
 	    wps_process_r_snonce1(wps, eattr.r_snonce1)) {
-		wpabuf_free(decrypted);
+		wpabuf_clear_free(decrypted);
 		wps->state = SEND_WSC_NACK;
 		return WPS_CONTINUE;
 	}
-	wpabuf_free(decrypted);
+	wpabuf_clear_free(decrypted);
 
 	wps->state = SEND_M5;
 	return WPS_CONTINUE;
@@ -1165,7 +1166,7 @@ static enum wps_process_res wps_process_m6(struct wps_data *wps,
 	}
 
 	if (wps_validate_m6_encr(decrypted, attr->version2 != NULL) < 0) {
-		wpabuf_free(decrypted);
+		wpabuf_clear_free(decrypted);
 		wps->state = SEND_WSC_NACK;
 		return WPS_CONTINUE;
 	}
@@ -1175,11 +1176,11 @@ static enum wps_process_res wps_process_m6(struct wps_data *wps,
 	if (wps_parse_msg(decrypted, &eattr) < 0 ||
 	    wps_process_key_wrap_auth(wps, decrypted, eattr.key_wrap_auth) ||
 	    wps_process_r_snonce2(wps, eattr.r_snonce2)) {
-		wpabuf_free(decrypted);
+		wpabuf_clear_free(decrypted);
 		wps->state = SEND_WSC_NACK;
 		return WPS_CONTINUE;
 	}
-	wpabuf_free(decrypted);
+	wpabuf_clear_free(decrypted);
 
 	if (wps->wps->ap)
 		wps->wps->event_cb(wps->wps->cb_ctx, WPS_EV_AP_PIN_SUCCESS,
@@ -1236,7 +1237,7 @@ static enum wps_process_res wps_process_m8(struct wps_data *wps,
 
 	if (wps_validate_m8_encr(decrypted, wps->wps->ap,
 				 attr->version2 != NULL) < 0) {
-		wpabuf_free(decrypted);
+		wpabuf_clear_free(decrypted);
 		wps->state = SEND_WSC_NACK;
 		return WPS_CONTINUE;
 	}
@@ -1249,11 +1250,11 @@ static enum wps_process_res wps_process_m8(struct wps_data *wps,
 			      eattr.num_cred, attr->version2 != NULL) ||
 	    wps_process_ap_settings_e(wps, &eattr, decrypted,
 				      attr->version2 != NULL)) {
-		wpabuf_free(decrypted);
+		wpabuf_clear_free(decrypted);
 		wps->state = SEND_WSC_NACK;
 		return WPS_CONTINUE;
 	}
-	wpabuf_free(decrypted);
+	wpabuf_clear_free(decrypted);
 
 	wps->state = WPS_MSG_DONE;
 	return WPS_CONTINUE;
diff --git a/src/wps/wps_i.h b/src/wps/wps_i.h
index f7154f8734bbd..fe0c60bd120bf 100644
--- a/src/wps/wps_i.h
+++ b/src/wps/wps_i.h
@@ -132,8 +132,8 @@ struct wps_data {
 void wps_kdf(const u8 *key, const u8 *label_prefix, size_t label_prefix_len,
 	     const char *label, u8 *res, size_t res_len);
 int wps_derive_keys(struct wps_data *wps);
-void wps_derive_psk(struct wps_data *wps, const u8 *dev_passwd,
-		    size_t dev_passwd_len);
+int wps_derive_psk(struct wps_data *wps, const u8 *dev_passwd,
+		   size_t dev_passwd_len);
 struct wpabuf * wps_decrypt_encr_settings(struct wps_data *wps, const u8 *encr,
 					  size_t encr_len);
 void wps_fail_event(struct wps_context *wps, enum wps_msg_type msg,
diff --git a/src/wps/wps_module_tests.c b/src/wps/wps_module_tests.c
index 350630768be4b..23bed4b36e011 100644
--- a/src/wps/wps_module_tests.c
+++ b/src/wps/wps_module_tests.c
@@ -9,6 +9,7 @@
 #include "utils/includes.h"
 
 #include "utils/common.h"
+#include "utils/module_tests.h"
 #include "wps_attr_parse.h"
 
 struct wps_attr_parse_test {
@@ -17,7 +18,7 @@ struct wps_attr_parse_test {
 	int extra;
 };
 
-const struct wps_attr_parse_test wps_attr_parse_test_cases[] = {
+static const struct wps_attr_parse_test wps_attr_parse_test_cases[] = {
 	/* Empty message */
 	{ "", 0, 0 },
 	/* Truncated attribute header */
diff --git a/src/wps/wps_registrar.c b/src/wps/wps_registrar.c
index 4ca3a42d4c738..fac8bd837f2fd 100644
--- a/src/wps/wps_registrar.c
+++ b/src/wps/wps_registrar.c
@@ -1,6 +1,6 @@
 /*
  * Wi-Fi Protected Setup - Registrar
- * Copyright (c) 2008-2013, Jouni Malinen <j@w1.fi>
+ * Copyright (c) 2008-2016, Jouni Malinen <j@w1.fi>
  *
  * This software may be distributed under the terms of the BSD license.
  * See README for more details.
@@ -703,7 +703,7 @@ void wps_registrar_deinit(struct wps_registrar *reg)
 	eloop_cancel_timeout(wps_registrar_pbc_timeout, reg, NULL);
 	eloop_cancel_timeout(wps_registrar_set_selected_timeout, reg, NULL);
 	wps_registrar_flush(reg);
-	wpabuf_free(reg->extra_cred);
+	wpabuf_clear_free(reg->extra_cred);
 	os_free(reg);
 }
 
@@ -1577,13 +1577,13 @@ int wps_build_credential_wrap(struct wpabuf *msg,
 	if (wbuf == NULL)
 		return -1;
 	if (wps_build_credential(wbuf, cred)) {
-		wpabuf_free(wbuf);
+		wpabuf_clear_free(wbuf);
 		return -1;
 	}
 	wpabuf_put_be16(msg, ATTR_CRED);
 	wpabuf_put_be16(msg, wpabuf_len(wbuf));
 	wpabuf_put_buf(msg, wbuf);
-	wpabuf_free(wbuf);
+	wpabuf_clear_free(wbuf);
 	return 0;
 }
 
@@ -1606,6 +1606,9 @@ int wps_build_cred(struct wps_data *wps, struct wpabuf *msg)
 	wps->cred.ssid_len = wps->wps->ssid_len;
 
 	/* Select the best authentication and encryption type */
+	wpa_printf(MSG_DEBUG,
+		   "WPS: Own auth types 0x%x - masked Enrollee auth types 0x%x",
+		   wps->wps->auth_types, wps->auth_type);
 	if (wps->auth_type & WPS_AUTH_WPA2PSK)
 		wps->auth_type = WPS_AUTH_WPA2PSK;
 	else if (wps->auth_type & WPS_AUTH_WPAPSK)
@@ -1619,6 +1622,14 @@ int wps_build_cred(struct wps_data *wps, struct wpabuf *msg)
 	}
 	wps->cred.auth_type = wps->auth_type;
 
+	wpa_printf(MSG_DEBUG,
+		   "WPS: Own encr types 0x%x (rsn: 0x%x, wpa: 0x%x) - masked Enrollee encr types 0x%x",
+		   wps->wps->encr_types, wps->wps->encr_types_rsn,
+		   wps->wps->encr_types_wpa, wps->encr_type);
+	if (wps->wps->ap && wps->auth_type == WPS_AUTH_WPA2PSK)
+		wps->encr_type &= wps->wps->encr_types_rsn;
+	else if (wps->wps->ap && wps->auth_type == WPS_AUTH_WPAPSK)
+		wps->encr_type &= wps->wps->encr_types_wpa;
 	if (wps->auth_type == WPS_AUTH_WPA2PSK ||
 	    wps->auth_type == WPS_AUTH_WPAPSK) {
 		if (wps->encr_type & WPS_ENCR_AES)
@@ -1740,14 +1751,14 @@ use_provided:
 		return -1;
 
 	if (wps_build_credential(cred, &wps->cred)) {
-		wpabuf_free(cred);
+		wpabuf_clear_free(cred);
 		return -1;
 	}
 
 	wpabuf_put_be16(msg, ATTR_CRED);
 	wpabuf_put_be16(msg, wpabuf_len(cred));
 	wpabuf_put_buf(msg, cred);
-	wpabuf_free(cred);
+	wpabuf_clear_free(cred);
 
 skip_cred_build:
 	if (wps->wps->registrar->extra_cred) {
@@ -1785,7 +1796,7 @@ static struct wpabuf * wps_build_ap_cred(struct wps_data *wps)
 	}
 
 	if (wps_build_ap_settings(wps, plain)) {
-		wpabuf_free(plain);
+		wpabuf_clear_free(plain);
 		wpabuf_free(msg);
 		return NULL;
 	}
@@ -1793,7 +1804,7 @@ static struct wpabuf * wps_build_ap_cred(struct wps_data *wps)
 	wpabuf_put_be16(msg, ATTR_CRED);
 	wpabuf_put_be16(msg, wpabuf_len(plain));
 	wpabuf_put_buf(msg, plain);
-	wpabuf_free(plain);
+	wpabuf_clear_free(plain);
 
 	return msg;
 }
@@ -1853,10 +1864,10 @@ static struct wpabuf * wps_build_m2(struct wps_data *wps)
 		    wps_build_key_wrap_auth(wps, plain) ||
 		    wps_build_encr_settings(wps, msg, plain)) {
 			wpabuf_free(msg);
-			wpabuf_free(plain);
+			wpabuf_clear_free(plain);
 			return NULL;
 		}
-		wpabuf_free(plain);
+		wpabuf_clear_free(plain);
 		config_in_m2 = 1;
 	}
 #endif /* CONFIG_WPS_NFC */
@@ -1917,7 +1928,8 @@ static struct wpabuf * wps_build_m4(struct wps_data *wps)
 
 	wpa_printf(MSG_DEBUG, "WPS: Building Message M4");
 
-	wps_derive_psk(wps, wps->dev_password, wps->dev_password_len);
+	if (wps_derive_psk(wps, wps->dev_password, wps->dev_password_len) < 0)
+		return NULL;
 
 	plain = wpabuf_alloc(200);
 	if (plain == NULL)
@@ -1938,11 +1950,11 @@ static struct wpabuf * wps_build_m4(struct wps_data *wps)
 	    wps_build_encr_settings(wps, msg, plain) ||
 	    wps_build_wfa_ext(msg, 0, NULL, 0) ||
 	    wps_build_authenticator(wps, msg)) {
-		wpabuf_free(plain);
+		wpabuf_clear_free(plain);
 		wpabuf_free(msg);
 		return NULL;
 	}
-	wpabuf_free(plain);
+	wpabuf_clear_free(plain);
 
 	wps->state = RECV_M5;
 	return msg;
@@ -1973,11 +1985,11 @@ static struct wpabuf * wps_build_m6(struct wps_data *wps)
 	    wps_build_encr_settings(wps, msg, plain) ||
 	    wps_build_wfa_ext(msg, 0, NULL, 0) ||
 	    wps_build_authenticator(wps, msg)) {
-		wpabuf_free(plain);
+		wpabuf_clear_free(plain);
 		wpabuf_free(msg);
 		return NULL;
 	}
-	wpabuf_free(plain);
+	wpabuf_clear_free(plain);
 
 	wps->wps_pin_revealed = 1;
 	wps->state = RECV_M7;
@@ -2010,11 +2022,11 @@ static struct wpabuf * wps_build_m8(struct wps_data *wps)
 	    wps_build_encr_settings(wps, msg, plain) ||
 	    wps_build_wfa_ext(msg, 0, NULL, 0) ||
 	    wps_build_authenticator(wps, msg)) {
-		wpabuf_free(plain);
-		wpabuf_free(msg);
+		wpabuf_clear_free(plain);
+		wpabuf_clear_free(msg);
 		return NULL;
 	}
-	wpabuf_free(plain);
+	wpabuf_clear_free(plain);
 
 	wps->state = RECV_DONE;
 	return msg;
@@ -2343,6 +2355,23 @@ static int wps_process_auth_type_flags(struct wps_data *wps, const u8 *auth)
 
 	wpa_printf(MSG_DEBUG, "WPS: Enrollee Authentication Type flags 0x%x",
 		   auth_types);
+#ifdef WPS_WORKAROUNDS
+	/*
+	 * Some deployed implementations seem to advertise incorrect information
+	 * in this attribute. A value of 0x1b (WPA2 + WPA + WPAPSK + OPEN, but
+	 * no WPA2PSK) has been reported to be used. Add WPA2PSK to the list to
+	 * avoid issues with building Credentials that do not use the strongest
+	 * actually supported authentication option (that device does support
+	 * WPA2PSK even when it does not claim it here).
+	 */
+	if ((auth_types &
+	     (WPS_AUTH_WPA2 | WPS_AUTH_WPA2PSK | WPS_AUTH_WPAPSK)) ==
+	    (WPS_AUTH_WPA2 | WPS_AUTH_WPAPSK)) {
+		wpa_printf(MSG_DEBUG,
+			   "WPS: Workaround - assume Enrollee supports WPA2PSK based on claimed WPA2 support");
+		auth_types |= WPS_AUTH_WPA2PSK;
+	}
+#endif /* WPS_WORKAROUNDS */
 	wps->auth_type = wps->wps->auth_types & auth_types;
 	if (wps->auth_type == 0) {
 		wpa_printf(MSG_DEBUG, "WPS: No match in supported "
@@ -2757,7 +2786,7 @@ static enum wps_process_res wps_process_m5(struct wps_data *wps,
 	}
 
 	if (wps_validate_m5_encr(decrypted, attr->version2 != NULL) < 0) {
-		wpabuf_free(decrypted);
+		wpabuf_clear_free(decrypted);
 		wps->state = SEND_WSC_NACK;
 		return WPS_CONTINUE;
 	}
@@ -2767,11 +2796,11 @@ static enum wps_process_res wps_process_m5(struct wps_data *wps,
 	if (wps_parse_msg(decrypted, &eattr) < 0 ||
 	    wps_process_key_wrap_auth(wps, decrypted, eattr.key_wrap_auth) ||
 	    wps_process_e_snonce1(wps, eattr.e_snonce1)) {
-		wpabuf_free(decrypted);
+		wpabuf_clear_free(decrypted);
 		wps->state = SEND_WSC_NACK;
 		return WPS_CONTINUE;
 	}
-	wpabuf_free(decrypted);
+	wpabuf_clear_free(decrypted);
 
 	wps->state = SEND_M6;
 	return WPS_CONTINUE;
@@ -2909,7 +2938,7 @@ static enum wps_process_res wps_process_m7(struct wps_data *wps,
 
 	if (wps_validate_m7_encr(decrypted, wps->wps->ap || wps->er,
 				 attr->version2 != NULL) < 0) {
-		wpabuf_free(decrypted);
+		wpabuf_clear_free(decrypted);
 		wps->state = SEND_WSC_NACK;
 		return WPS_CONTINUE;
 	}
@@ -2920,12 +2949,12 @@ static enum wps_process_res wps_process_m7(struct wps_data *wps,
 	    wps_process_key_wrap_auth(wps, decrypted, eattr.key_wrap_auth) ||
 	    wps_process_e_snonce2(wps, eattr.e_snonce2) ||
 	    wps_process_ap_settings_r(wps, &eattr)) {
-		wpabuf_free(decrypted);
+		wpabuf_clear_free(decrypted);
 		wps->state = SEND_WSC_NACK;
 		return WPS_CONTINUE;
 	}
 
-	wpabuf_free(decrypted);
+	wpabuf_clear_free(decrypted);
 
 	wps->state = SEND_M8;
 	return WPS_CONTINUE;
diff --git a/src/wps/wps_upnp.c b/src/wps/wps_upnp.c
index 44318e0942520..0c458c6adef9d 100644
--- a/src/wps/wps_upnp.c
+++ b/src/wps/wps_upnp.c
@@ -1082,6 +1082,7 @@ upnp_wps_get_iface(struct upnp_wps_device_sm *sm, void *priv)
 void upnp_wps_device_deinit(struct upnp_wps_device_sm *sm, void *priv)
 {
 	struct upnp_wps_device_interface *iface;
+	struct upnp_wps_peer *peer;
 
 	if (!sm)
 		return;
@@ -1102,8 +1103,13 @@ void upnp_wps_device_deinit(struct upnp_wps_device_sm *sm, void *priv)
 					    iface->wps->registrar);
 	dl_list_del(&iface->list);
 
-	if (iface->peer.wps)
-		wps_deinit(iface->peer.wps);
+	while ((peer = dl_list_first(&iface->peers, struct upnp_wps_peer,
+				     list))) {
+		if (peer->wps)
+			wps_deinit(peer->wps);
+		dl_list_del(&peer->list);
+		os_free(peer);
+	}
 	os_free(iface->ctx->ap_pin);
 	os_free(iface->ctx);
 	os_free(iface);
@@ -1141,6 +1147,7 @@ upnp_wps_device_init(struct upnp_wps_device_ctx *ctx, struct wps_context *wps,
 	}
 	wpa_printf(MSG_DEBUG, "WPS UPnP: Init interface instance %p", iface);
 
+	dl_list_init(&iface->peers);
 	iface->ctx = ctx;
 	iface->wps = wps;
 	iface->priv = priv;
diff --git a/src/wps/wps_upnp.h b/src/wps/wps_upnp.h
index 87b7ab14160b7..b6f6df5ec5192 100644
--- a/src/wps/wps_upnp.h
+++ b/src/wps/wps_upnp.h
@@ -11,11 +11,14 @@
 #ifndef WPS_UPNP_H
 #define WPS_UPNP_H
 
+#include "utils/list.h"
+
 struct upnp_wps_device_sm;
 struct wps_context;
 struct wps_data;
 
 struct upnp_wps_peer {
+	struct dl_list list;
 	struct wps_data *wps;
 };
 
diff --git a/src/wps/wps_upnp_i.h b/src/wps/wps_upnp_i.h
index f289fe685ac78..6a7c627253e30 100644
--- a/src/wps/wps_upnp_i.h
+++ b/src/wps/wps_upnp_i.h
@@ -109,8 +109,7 @@ struct upnp_wps_device_interface {
 	struct wps_context *wps;
 	void *priv;
 
-	/* FIX: maintain separate structures for each UPnP peer */
-	struct upnp_wps_peer peer;
+	struct dl_list peers; /* active UPnP peer sessions */
 };
 
 /*
diff --git a/src/wps/wps_upnp_ssdp.c b/src/wps/wps_upnp_ssdp.c
index 968fc03f92e7c..a685ce4c3c0fa 100644
--- a/src/wps/wps_upnp_ssdp.c
+++ b/src/wps/wps_upnp_ssdp.c
@@ -100,12 +100,6 @@ static int line_length(const char *l)
 }
 
 
-static int str_starts(const char *str, const char *start)
-{
-	return os_strncmp(str, start, os_strlen(start)) == 0;
-}
-
-
 /***************************************************************************
  * Advertisements.
  * These are multicast to the world to tell them we are here.
diff --git a/src/wps/wps_upnp_web.c b/src/wps/wps_upnp_web.c
index d5b0b5b26e9d5..7548e8432a68f 100644
--- a/src/wps/wps_upnp_web.c
+++ b/src/wps/wps_upnp_web.c
@@ -300,7 +300,8 @@ static void http_put_empty(struct wpabuf *buf, enum http_reply_code code)
  * would appear to be required (given that we will be closing it!).
  */
 static void web_connection_parse_get(struct upnp_wps_device_sm *sm,
-				     struct http_request *hreq, char *filename)
+				     struct http_request *hreq,
+				     const char *filename)
 {
 	struct wpabuf *buf; /* output buffer, allocated */
 	char *put_length_here;
@@ -409,6 +410,15 @@ send_buf:
 }
 
 
+static void wps_upnp_peer_del(struct upnp_wps_peer *peer)
+{
+	dl_list_del(&peer->list);
+	if (peer->wps)
+		wps_deinit(peer->wps);
+	os_free(peer);
+}
+
+
 static enum http_reply_code
 web_process_get_device_info(struct upnp_wps_device_sm *sm,
 			    struct wpabuf **reply, const char **replyname)
@@ -426,7 +436,9 @@ web_process_get_device_info(struct upnp_wps_device_sm *sm,
 	if (!iface || iface->ctx->ap_pin == NULL)
 		return HTTP_INTERNAL_SERVER_ERROR;
 
-	peer = &iface->peer;
+	peer = os_zalloc(sizeof(*peer));
+	if (!peer)
+		return HTTP_INTERNAL_SERVER_ERROR;
 
 	/*
 	 * Request for DeviceInfo, i.e., M1 TLVs. This is a start of WPS
@@ -436,9 +448,6 @@ web_process_get_device_info(struct upnp_wps_device_sm *sm,
 	 * registration.
 	 */
 
-	if (peer->wps)
-		wps_deinit(peer->wps);
-
 	os_memset(&cfg, 0, sizeof(cfg));
 	cfg.wps = iface->wps;
 	cfg.pin = (u8 *) iface->ctx->ap_pin;
@@ -455,8 +464,22 @@ web_process_get_device_info(struct upnp_wps_device_sm *sm,
 		*reply = NULL;
 	if (*reply == NULL) {
 		wpa_printf(MSG_INFO, "WPS UPnP: Failed to get DeviceInfo");
+		os_free(peer);
 		return HTTP_INTERNAL_SERVER_ERROR;
 	}
+
+	if (dl_list_len(&iface->peers) > 3) {
+		struct upnp_wps_peer *old;
+
+		old = dl_list_first(&iface->peers, struct upnp_wps_peer, list);
+		if (old) {
+			wpa_printf(MSG_DEBUG, "WPS UPnP: Drop oldest active session");
+			wps_upnp_peer_del(old);
+		}
+	}
+	dl_list_add_tail(&iface->peers, &peer->list);
+	/* TODO: Could schedule a timeout to free the entry */
+
 	*replyname = name;
 	return HTTP_OK;
 }
@@ -472,6 +495,8 @@ web_process_put_message(struct upnp_wps_device_sm *sm, char *data,
 	enum wps_process_res res;
 	enum wsc_op_code op_code;
 	struct upnp_wps_device_interface *iface;
+	struct wps_parse_attr attr;
+	struct upnp_wps_peer *tmp, *peer;
 
 	iface = dl_list_first(&sm->interfaces,
 			      struct upnp_wps_device_interface, list);
@@ -487,11 +512,56 @@ web_process_put_message(struct upnp_wps_device_sm *sm, char *data,
 	msg = xml_get_base64_item(data, "NewInMessage", &ret);
 	if (msg == NULL)
 		return ret;
-	res = wps_process_msg(iface->peer.wps, WSC_UPnP, msg);
-	if (res == WPS_FAILURE)
+
+	if (wps_parse_msg(msg, &attr)) {
+		wpa_printf(MSG_DEBUG,
+			   "WPS UPnP: Could not parse PutMessage - NewInMessage");
+		wpabuf_free(msg);
+		return HTTP_BAD_REQUEST;
+	}
+
+	/* Find a matching active peer session */
+	peer = NULL;
+	dl_list_for_each(tmp, &iface->peers, struct upnp_wps_peer, list) {
+		if (!tmp->wps)
+			continue;
+		if (attr.enrollee_nonce &&
+		    os_memcmp(tmp->wps->nonce_e, attr.enrollee_nonce,
+			      WPS_NONCE_LEN) != 0)
+			continue; /* Enrollee nonce mismatch */
+		if (attr.msg_type &&
+		    *attr.msg_type != WPS_M2 &&
+		    *attr.msg_type != WPS_M2D &&
+		    attr.registrar_nonce &&
+		    os_memcmp(tmp->wps->nonce_r, attr.registrar_nonce,
+			      WPS_NONCE_LEN) != 0)
+			continue; /* Registrar nonce mismatch */
+		peer = tmp;
+		break;
+	}
+	if (!peer) {
+		/*
+		  Try to use the first entry in case message could work with
+		 * it. The actual handler function will reject this, if needed.
+		 * This maintains older behavior where only a single peer entry
+		 * was supported.
+		 */
+		peer = dl_list_first(&iface->peers, struct upnp_wps_peer, list);
+	}
+	if (!peer || !peer->wps) {
+		wpa_printf(MSG_DEBUG, "WPS UPnP: No active peer entry found");
+		wpabuf_free(msg);
+		return HTTP_BAD_REQUEST;
+	}
+
+	res = wps_process_msg(peer->wps, WSC_UPnP, msg);
+	if (res == WPS_FAILURE) {
 		*reply = NULL;
-	else
-		*reply = wps_get_msg(iface->peer.wps, &op_code);
+		wpa_printf(MSG_DEBUG, "WPS UPnP: Drop active peer session");
+		wps_upnp_peer_del(peer);
+	} else {
+		*reply = wps_get_msg(peer->wps, &op_code);
+	}
 	wpabuf_free(msg);
 	if (*reply == NULL)
 		return HTTP_INTERNAL_SERVER_ERROR;