summaryrefslogtreecommitdiff
path: root/lib/Sema/SemaExpr.cpp
diff options
context:
space:
mode:
Diffstat (limited to 'lib/Sema/SemaExpr.cpp')
-rw-r--r--lib/Sema/SemaExpr.cpp976
1 files changed, 647 insertions, 329 deletions
diff --git a/lib/Sema/SemaExpr.cpp b/lib/Sema/SemaExpr.cpp
index bf4abfcb74604..76330f5cdbddb 100644
--- a/lib/Sema/SemaExpr.cpp
+++ b/lib/Sema/SemaExpr.cpp
@@ -12,13 +12,9 @@
//===----------------------------------------------------------------------===//
#include "clang/Sema/SemaInternal.h"
-#include "clang/Sema/DelayedDiagnostic.h"
-#include "clang/Sema/Initialization.h"
-#include "clang/Sema/Lookup.h"
-#include "clang/Sema/ScopeInfo.h"
-#include "clang/Sema/AnalysisBasedWarnings.h"
-#include "clang/AST/ASTContext.h"
+#include "TreeTransform.h"
#include "clang/AST/ASTConsumer.h"
+#include "clang/AST/ASTContext.h"
#include "clang/AST/ASTMutationListener.h"
#include "clang/AST/CXXInheritance.h"
#include "clang/AST/DeclObjC.h"
@@ -34,14 +30,17 @@
#include "clang/Basic/TargetInfo.h"
#include "clang/Lex/LiteralSupport.h"
#include "clang/Lex/Preprocessor.h"
+#include "clang/Sema/AnalysisBasedWarnings.h"
#include "clang/Sema/DeclSpec.h"
+#include "clang/Sema/DelayedDiagnostic.h"
#include "clang/Sema/Designator.h"
+#include "clang/Sema/Initialization.h"
+#include "clang/Sema/Lookup.h"
+#include "clang/Sema/ParsedTemplate.h"
#include "clang/Sema/Scope.h"
#include "clang/Sema/ScopeInfo.h"
-#include "clang/Sema/ParsedTemplate.h"
#include "clang/Sema/SemaFixItUtils.h"
#include "clang/Sema/Template.h"
-#include "TreeTransform.h"
using namespace clang;
using namespace sema;
@@ -163,7 +162,7 @@ static bool hasAnyExplicitStorageClass(const FunctionDecl *D) {
for (FunctionDecl::redecl_iterator I = D->redecls_begin(),
E = D->redecls_end();
I != E; ++I) {
- if (I->getStorageClassAsWritten() != SC_None)
+ if (I->getStorageClass() != SC_None)
return true;
}
return false;
@@ -215,19 +214,24 @@ static void diagnoseUseOfInternalDeclInInlineFunction(Sema &S,
: diag::warn_internal_in_extern_inline)
<< /*IsVar=*/!UsedFn << D;
- // Suggest "static" on the inline function, if possible.
- if (!hasAnyExplicitStorageClass(Current)) {
- const FunctionDecl *FirstDecl = Current->getCanonicalDecl();
- SourceLocation DeclBegin = FirstDecl->getSourceRange().getBegin();
- S.Diag(DeclBegin, diag::note_convert_inline_to_static)
- << Current << FixItHint::CreateInsertion(DeclBegin, "static ");
- }
+ S.MaybeSuggestAddingStaticToDecl(Current);
S.Diag(D->getCanonicalDecl()->getLocation(),
diag::note_internal_decl_declared_here)
<< D;
}
+void Sema::MaybeSuggestAddingStaticToDecl(const FunctionDecl *Cur) {
+ const FunctionDecl *First = Cur->getFirstDeclaration();
+
+ // Suggest "static" on the function, if possible.
+ if (!hasAnyExplicitStorageClass(First)) {
+ SourceLocation DeclBegin = First->getSourceRange().getBegin();
+ Diag(DeclBegin, diag::note_convert_inline_to_static)
+ << Cur << FixItHint::CreateInsertion(DeclBegin, "static ");
+ }
+}
+
/// \brief Determine whether the use of this declaration is valid, and
/// emit any corresponding diagnostics.
///
@@ -288,12 +292,6 @@ bool Sema::DiagnoseUseOfDecl(NamedDecl *D, SourceLocation Loc,
/// diagnostic complaining about the given function being deleted or
/// unavailable.
std::string Sema::getDeletedOrUnavailableSuffix(const FunctionDecl *FD) {
- // FIXME: C++0x implicitly-deleted special member functions could be
- // detected here so that we could improve diagnostics to say, e.g.,
- // "base class 'A' had a deleted copy constructor".
- if (FD->isDeleted())
- return std::string();
-
std::string Message;
if (FD->getAvailability(&Message))
return ": " + Message;
@@ -457,6 +455,62 @@ static void CheckForNullPointerDereference(Sema &S, Expr *E) {
}
}
+static void DiagnoseDirectIsaAccess(Sema &S, const ObjCIvarRefExpr *OIRE,
+ SourceLocation AssignLoc,
+ const Expr* RHS) {
+ const ObjCIvarDecl *IV = OIRE->getDecl();
+ if (!IV)
+ return;
+
+ DeclarationName MemberName = IV->getDeclName();
+ IdentifierInfo *Member = MemberName.getAsIdentifierInfo();
+ if (!Member || !Member->isStr("isa"))
+ return;
+
+ const Expr *Base = OIRE->getBase();
+ QualType BaseType = Base->getType();
+ if (OIRE->isArrow())
+ BaseType = BaseType->getPointeeType();
+ if (const ObjCObjectType *OTy = BaseType->getAs<ObjCObjectType>())
+ if (ObjCInterfaceDecl *IDecl = OTy->getInterface()) {
+ ObjCInterfaceDecl *ClassDeclared = 0;
+ ObjCIvarDecl *IV = IDecl->lookupInstanceVariable(Member, ClassDeclared);
+ if (!ClassDeclared->getSuperClass()
+ && (*ClassDeclared->ivar_begin()) == IV) {
+ if (RHS) {
+ NamedDecl *ObjectSetClass =
+ S.LookupSingleName(S.TUScope,
+ &S.Context.Idents.get("object_setClass"),
+ SourceLocation(), S.LookupOrdinaryName);
+ if (ObjectSetClass) {
+ SourceLocation RHSLocEnd = S.PP.getLocForEndOfToken(RHS->getLocEnd());
+ S.Diag(OIRE->getExprLoc(), diag::warn_objc_isa_assign) <<
+ FixItHint::CreateInsertion(OIRE->getLocStart(), "object_setClass(") <<
+ FixItHint::CreateReplacement(SourceRange(OIRE->getOpLoc(),
+ AssignLoc), ",") <<
+ FixItHint::CreateInsertion(RHSLocEnd, ")");
+ }
+ else
+ S.Diag(OIRE->getLocation(), diag::warn_objc_isa_assign);
+ } else {
+ NamedDecl *ObjectGetClass =
+ S.LookupSingleName(S.TUScope,
+ &S.Context.Idents.get("object_getClass"),
+ SourceLocation(), S.LookupOrdinaryName);
+ if (ObjectGetClass)
+ S.Diag(OIRE->getExprLoc(), diag::warn_objc_isa_use) <<
+ FixItHint::CreateInsertion(OIRE->getLocStart(), "object_getClass(") <<
+ FixItHint::CreateReplacement(
+ SourceRange(OIRE->getOpLoc(),
+ OIRE->getLocEnd()), ")");
+ else
+ S.Diag(OIRE->getLocation(), diag::warn_objc_isa_use);
+ }
+ S.Diag(IV->getLocation(), diag::note_ivar_decl);
+ }
+ }
+}
+
ExprResult Sema::DefaultLvalueConversion(Expr *E) {
// Handle any placeholder expressions which made it here.
if (E->getType()->isPlaceholderType()) {
@@ -489,8 +543,31 @@ ExprResult Sema::DefaultLvalueConversion(Expr *E) {
if (T->isVoidType())
return Owned(E);
- CheckForNullPointerDereference(*this, E);
+ // OpenCL usually rejects direct accesses to values of 'half' type.
+ if (getLangOpts().OpenCL && !getOpenCLOptions().cl_khr_fp16 &&
+ T->isHalfType()) {
+ Diag(E->getExprLoc(), diag::err_opencl_half_load_store)
+ << 0 << T;
+ return ExprError();
+ }
+ CheckForNullPointerDereference(*this, E);
+ if (const ObjCIsaExpr *OISA = dyn_cast<ObjCIsaExpr>(E->IgnoreParenCasts())) {
+ NamedDecl *ObjectGetClass = LookupSingleName(TUScope,
+ &Context.Idents.get("object_getClass"),
+ SourceLocation(), LookupOrdinaryName);
+ if (ObjectGetClass)
+ Diag(E->getExprLoc(), diag::warn_objc_isa_use) <<
+ FixItHint::CreateInsertion(OISA->getLocStart(), "object_getClass(") <<
+ FixItHint::CreateReplacement(
+ SourceRange(OISA->getOpLoc(), OISA->getIsaMemberLoc()), ")");
+ else
+ Diag(E->getExprLoc(), diag::warn_objc_isa_use);
+ }
+ else if (const ObjCIvarRefExpr *OIRE =
+ dyn_cast<ObjCIvarRefExpr>(E->IgnoreParenCasts()))
+ DiagnoseDirectIsaAccess(*this, OIRE, SourceLocation(), /* Expr*/0);
+
// C++ [conv.lval]p1:
// [...] If T is a non-class type, the type of the prvalue is the
// cv-unqualified version of T. Otherwise, the type of the
@@ -504,6 +581,12 @@ ExprResult Sema::DefaultLvalueConversion(Expr *E) {
T = T.getUnqualifiedType();
UpdateMarkingForLValueToRValue(E);
+
+ // Loading a __weak object implicitly retains the value, so we need a cleanup to
+ // balance that.
+ if (getLangOpts().ObjCAutoRefCount &&
+ E->getType().getObjCLifetime() == Qualifiers::OCL_Weak)
+ ExprNeedsCleanups = true;
ExprResult Res = Owned(ImplicitCastExpr::Create(Context, T, CK_LValueToRValue,
E, 0, VK_RValue));
@@ -540,15 +623,14 @@ ExprResult Sema::UsualUnaryConversions(Expr *E) {
// First, convert to an r-value.
ExprResult Res = DefaultFunctionArrayLvalueConversion(E);
if (Res.isInvalid())
- return Owned(E);
+ return ExprError();
E = Res.take();
QualType Ty = E->getType();
assert(!Ty.isNull() && "UsualUnaryConversions - missing type");
- // Half FP is a bit different: it's a storage-only type, meaning that any
- // "use" of it should be promoted to float.
- if (Ty->isHalfType())
+ // Half FP have to be promoted to float unless it is natively supported
+ if (Ty->isHalfType() && !getLangOpts().NativeHalfType)
return ImpCastExprToType(Res.take(), Context.FloatTy, CK_FloatingCast);
// Try to perform integral promotions if the object has a theoretically
@@ -583,19 +665,23 @@ ExprResult Sema::UsualUnaryConversions(Expr *E) {
}
/// DefaultArgumentPromotion (C99 6.5.2.2p6). Used for function calls that
-/// do not have a prototype. Arguments that have type float are promoted to
-/// double. All other argument types are converted by UsualUnaryConversions().
+/// do not have a prototype. Arguments that have type float or __fp16
+/// are promoted to double. All other argument types are converted by
+/// UsualUnaryConversions().
ExprResult Sema::DefaultArgumentPromotion(Expr *E) {
QualType Ty = E->getType();
assert(!Ty.isNull() && "DefaultArgumentPromotion - missing type");
ExprResult Res = UsualUnaryConversions(E);
if (Res.isInvalid())
- return Owned(E);
+ return ExprError();
E = Res.take();
- // If this is a 'float' (CVR qualified or typedef) promote to double.
- if (Ty->isSpecificBuiltinType(BuiltinType::Float))
+ // If this is a 'float' or '__fp16' (CVR qualified or typedef) promote to
+ // double.
+ const BuiltinType *BTy = Ty->getAs<BuiltinType>();
+ if (BTy && (BTy->getKind() == BuiltinType::Half ||
+ BTy->getKind() == BuiltinType::Float))
E = ImpCastExprToType(E, Context.DoubleTy, CK_FloatingCast).take();
// C++ performs lvalue-to-rvalue conversion as a default argument
@@ -635,16 +721,16 @@ Sema::VarArgKind Sema::isValidVarArgType(const QualType &Ty) {
if (Ty.isCXX98PODType(Context))
return VAK_Valid;
- // C++0x [expr.call]p7:
- // Passing a potentially-evaluated argument of class type (Clause 9)
+ // C++11 [expr.call]p7:
+ // Passing a potentially-evaluated argument of class type (Clause 9)
// having a non-trivial copy constructor, a non-trivial move constructor,
- // or a non-trivial destructor, with no corresponding parameter,
+ // or a non-trivial destructor, with no corresponding parameter,
// is conditionally-supported with implementation-defined semantics.
- if (getLangOpts().CPlusPlus0x && !Ty->isDependentType())
+ if (getLangOpts().CPlusPlus11 && !Ty->isDependentType())
if (CXXRecordDecl *Record = Ty->getAsCXXRecordDecl())
- if (Record->hasTrivialCopyConstructor() &&
- Record->hasTrivialMoveConstructor() &&
- Record->hasTrivialDestructor())
+ if (!Record->hasNonTrivialCopyConstructor() &&
+ !Record->hasNonTrivialMoveConstructor() &&
+ !Record->hasNonTrivialDestructor())
return VAK_ValidInCXX11;
if (getLangOpts().ObjCAutoRefCount && Ty->isObjCLifetimeType())
@@ -673,7 +759,7 @@ bool Sema::variadicArgumentPODCheck(const Expr *E, VariadicCallType CT) {
return DiagRuntimeBehavior(E->getLocStart(), 0,
PDiag(diag::warn_cannot_pass_non_pod_arg_to_vararg)
- << getLangOpts().CPlusPlus0x << Ty << CT);
+ << getLangOpts().CPlusPlus11 << Ty << CT);
}
}
// c++ rules are enforced elsewhere.
@@ -938,54 +1024,24 @@ static QualType handleFloatConversion(Sema &S, ExprResult &LHS,
/*convertFloat=*/!IsCompAssign);
}
-/// \brief Handle conversions with GCC complex int extension. Helper function
-/// of UsualArithmeticConversions()
-// FIXME: if the operands are (int, _Complex long), we currently
-// don't promote the complex. Also, signedness?
-static QualType handleComplexIntConversion(Sema &S, ExprResult &LHS,
- ExprResult &RHS, QualType LHSType,
- QualType RHSType,
- bool IsCompAssign) {
- const ComplexType *LHSComplexInt = LHSType->getAsComplexIntegerType();
- const ComplexType *RHSComplexInt = RHSType->getAsComplexIntegerType();
+typedef ExprResult PerformCastFn(Sema &S, Expr *operand, QualType toType);
- if (LHSComplexInt && RHSComplexInt) {
- int order = S.Context.getIntegerTypeOrder(LHSComplexInt->getElementType(),
- RHSComplexInt->getElementType());
- assert(order && "inequal types with equal element ordering");
- if (order > 0) {
- // _Complex int -> _Complex long
- RHS = S.ImpCastExprToType(RHS.take(), LHSType, CK_IntegralComplexCast);
- return LHSType;
- }
-
- if (!IsCompAssign)
- LHS = S.ImpCastExprToType(LHS.take(), RHSType, CK_IntegralComplexCast);
- return RHSType;
- }
-
- if (LHSComplexInt) {
- // int -> _Complex int
- // FIXME: This needs to take integer ranks into account
- RHS = S.ImpCastExprToType(RHS.take(), LHSComplexInt->getElementType(),
- CK_IntegralCast);
- RHS = S.ImpCastExprToType(RHS.take(), LHSType, CK_IntegralRealToComplex);
- return LHSType;
- }
+namespace {
+/// These helper callbacks are placed in an anonymous namespace to
+/// permit their use as function template parameters.
+ExprResult doIntegralCast(Sema &S, Expr *op, QualType toType) {
+ return S.ImpCastExprToType(op, toType, CK_IntegralCast);
+}
- assert(RHSComplexInt);
- // int -> _Complex int
- // FIXME: This needs to take integer ranks into account
- if (!IsCompAssign) {
- LHS = S.ImpCastExprToType(LHS.take(), RHSComplexInt->getElementType(),
- CK_IntegralCast);
- LHS = S.ImpCastExprToType(LHS.take(), RHSType, CK_IntegralRealToComplex);
- }
- return RHSType;
+ExprResult doComplexIntegralCast(Sema &S, Expr *op, QualType toType) {
+ return S.ImpCastExprToType(op, S.Context.getComplexType(toType),
+ CK_IntegralComplexCast);
+}
}
/// \brief Handle integer arithmetic conversions. Helper function of
/// UsualArithmeticConversions()
+template <PerformCastFn doLHSCast, PerformCastFn doRHSCast>
static QualType handleIntegerConversion(Sema &S, ExprResult &LHS,
ExprResult &RHS, QualType LHSType,
QualType RHSType, bool IsCompAssign) {
@@ -996,29 +1052,29 @@ static QualType handleIntegerConversion(Sema &S, ExprResult &LHS,
if (LHSSigned == RHSSigned) {
// Same signedness; use the higher-ranked type
if (order >= 0) {
- RHS = S.ImpCastExprToType(RHS.take(), LHSType, CK_IntegralCast);
+ RHS = (*doRHSCast)(S, RHS.take(), LHSType);
return LHSType;
} else if (!IsCompAssign)
- LHS = S.ImpCastExprToType(LHS.take(), RHSType, CK_IntegralCast);
+ LHS = (*doLHSCast)(S, LHS.take(), RHSType);
return RHSType;
} else if (order != (LHSSigned ? 1 : -1)) {
// The unsigned type has greater than or equal rank to the
// signed type, so use the unsigned type
if (RHSSigned) {
- RHS = S.ImpCastExprToType(RHS.take(), LHSType, CK_IntegralCast);
+ RHS = (*doRHSCast)(S, RHS.take(), LHSType);
return LHSType;
} else if (!IsCompAssign)
- LHS = S.ImpCastExprToType(LHS.take(), RHSType, CK_IntegralCast);
+ LHS = (*doLHSCast)(S, LHS.take(), RHSType);
return RHSType;
} else if (S.Context.getIntWidth(LHSType) != S.Context.getIntWidth(RHSType)) {
// The two types are different widths; if we are here, that
// means the signed type is larger than the unsigned type, so
// use the signed type.
if (LHSSigned) {
- RHS = S.ImpCastExprToType(RHS.take(), LHSType, CK_IntegralCast);
+ RHS = (*doRHSCast)(S, RHS.take(), LHSType);
return LHSType;
} else if (!IsCompAssign)
- LHS = S.ImpCastExprToType(LHS.take(), RHSType, CK_IntegralCast);
+ LHS = (*doLHSCast)(S, LHS.take(), RHSType);
return RHSType;
} else {
// The signed type is higher-ranked than the unsigned type,
@@ -1027,19 +1083,62 @@ static QualType handleIntegerConversion(Sema &S, ExprResult &LHS,
// to the signed type.
QualType result =
S.Context.getCorrespondingUnsignedType(LHSSigned ? LHSType : RHSType);
- RHS = S.ImpCastExprToType(RHS.take(), result, CK_IntegralCast);
+ RHS = (*doRHSCast)(S, RHS.take(), result);
if (!IsCompAssign)
- LHS = S.ImpCastExprToType(LHS.take(), result, CK_IntegralCast);
+ LHS = (*doLHSCast)(S, LHS.take(), result);
return result;
}
}
+/// \brief Handle conversions with GCC complex int extension. Helper function
+/// of UsualArithmeticConversions()
+static QualType handleComplexIntConversion(Sema &S, ExprResult &LHS,
+ ExprResult &RHS, QualType LHSType,
+ QualType RHSType,
+ bool IsCompAssign) {
+ const ComplexType *LHSComplexInt = LHSType->getAsComplexIntegerType();
+ const ComplexType *RHSComplexInt = RHSType->getAsComplexIntegerType();
+
+ if (LHSComplexInt && RHSComplexInt) {
+ QualType LHSEltType = LHSComplexInt->getElementType();
+ QualType RHSEltType = RHSComplexInt->getElementType();
+ QualType ScalarType =
+ handleIntegerConversion<doComplexIntegralCast, doComplexIntegralCast>
+ (S, LHS, RHS, LHSEltType, RHSEltType, IsCompAssign);
+
+ return S.Context.getComplexType(ScalarType);
+ }
+
+ if (LHSComplexInt) {
+ QualType LHSEltType = LHSComplexInt->getElementType();
+ QualType ScalarType =
+ handleIntegerConversion<doComplexIntegralCast, doIntegralCast>
+ (S, LHS, RHS, LHSEltType, RHSType, IsCompAssign);
+ QualType ComplexType = S.Context.getComplexType(ScalarType);
+ RHS = S.ImpCastExprToType(RHS.take(), ComplexType,
+ CK_IntegralRealToComplex);
+
+ return ComplexType;
+ }
+
+ assert(RHSComplexInt);
+
+ QualType RHSEltType = RHSComplexInt->getElementType();
+ QualType ScalarType =
+ handleIntegerConversion<doIntegralCast, doComplexIntegralCast>
+ (S, LHS, RHS, LHSType, RHSEltType, IsCompAssign);
+ QualType ComplexType = S.Context.getComplexType(ScalarType);
+
+ if (!IsCompAssign)
+ LHS = S.ImpCastExprToType(LHS.take(), ComplexType,
+ CK_IntegralRealToComplex);
+ return ComplexType;
+}
+
/// UsualArithmeticConversions - Performs various conversions that are common to
/// binary operators (C99 6.3.1.8). If both operands aren't arithmetic, this
/// routine returns the first non-arithmetic type found. The client is
/// responsible for emitting appropriate error diagnostics.
-/// FIXME: verify the conversion rules for "complex int" are consistent with
-/// GCC.
QualType Sema::UsualArithmeticConversions(ExprResult &LHS, ExprResult &RHS,
bool IsCompAssign) {
if (!IsCompAssign) {
@@ -1104,10 +1203,11 @@ QualType Sema::UsualArithmeticConversions(ExprResult &LHS, ExprResult &RHS,
IsCompAssign);
// Finally, we have two differing integer types.
- return handleIntegerConversion(*this, LHS, RHS, LHSType, RHSType,
- IsCompAssign);
+ return handleIntegerConversion<doIntegralCast, doIntegralCast>
+ (*this, LHS, RHS, LHSType, RHSType, IsCompAssign);
}
+
//===----------------------------------------------------------------------===//
// Semantic Analysis for various Expression Types
//===----------------------------------------------------------------------===//
@@ -1149,6 +1249,12 @@ Sema::CreateGenericSelectionExpr(SourceLocation KeyLoc,
TypeSourceInfo **Types,
Expr **Exprs,
unsigned NumAssocs) {
+ if (ControllingExpr->getType()->isPlaceholderType()) {
+ ExprResult result = CheckPlaceholderExpr(ControllingExpr);
+ if (result.isInvalid()) return ExprError();
+ ControllingExpr = result.take();
+ }
+
bool TypeErrorFound = false,
IsResultDependent = ControllingExpr->isTypeDependent(),
ContainsUnexpandedParameterPack
@@ -1401,7 +1507,7 @@ Sema::BuildDeclRefExpr(ValueDecl *D, QualType Ty, ExprValueKind VK,
ExprResult
Sema::BuildDeclRefExpr(ValueDecl *D, QualType Ty, ExprValueKind VK,
const DeclarationNameInfo &NameInfo,
- const CXXScopeSpec *SS) {
+ const CXXScopeSpec *SS, NamedDecl *FoundD) {
if (getLangOpts().CUDA)
if (const FunctionDecl *Caller = dyn_cast<FunctionDecl>(CurContext))
if (const FunctionDecl *Callee = dyn_cast<FunctionDecl>(D)) {
@@ -1425,7 +1531,7 @@ Sema::BuildDeclRefExpr(ValueDecl *D, QualType Ty, ExprValueKind VK,
: NestedNameSpecifierLoc(),
SourceLocation(),
D, refersToEnclosingScope,
- NameInfo, Ty, VK);
+ NameInfo, Ty, VK, FoundD);
MarkDeclRefReferenced(E);
@@ -1533,9 +1639,10 @@ bool Sema::DiagnoseEmptyLookup(Scope *S, CXXScopeSpec &SS, LookupResult &R,
UnresolvedLookupExpr *ULE = cast<UnresolvedLookupExpr>(
CallsUndergoingInstantiation.back()->getCallee());
-
CXXMethodDecl *DepMethod;
- if (CurMethod->getTemplatedKind() ==
+ if (CurMethod->isDependentContext())
+ DepMethod = CurMethod;
+ else if (CurMethod->getTemplatedKind() ==
FunctionDecl::TK_FunctionTemplateSpecialization)
DepMethod = cast<CXXMethodDecl>(CurMethod->getPrimaryTemplate()->
getInstantiatedFromMemberTemplate()->getTemplatedDecl());
@@ -1642,9 +1749,13 @@ bool Sema::DiagnoseEmptyLookup(Scope *S, CXXScopeSpec &SS, LookupResult &R,
<< SS.getRange()
<< FixItHint::CreateReplacement(Corrected.getCorrectionRange(),
CorrectedStr);
- if (ND)
- Diag(ND->getLocation(), diag::note_previous_decl)
- << CorrectedQuotedStr;
+
+ unsigned diag = isa<ImplicitParamDecl>(ND)
+ ? diag::note_implicit_param_decl
+ : diag::note_previous_decl;
+
+ Diag(ND->getLocation(), diag)
+ << CorrectedQuotedStr;
// Tell the callee to try to recover.
return false;
@@ -1946,6 +2057,10 @@ Sema::LookupInObjCMethod(LookupResult &Lookup, Scope *S,
IdentifierInfo *II, bool AllowBuiltinCreation) {
SourceLocation Loc = Lookup.getNameLoc();
ObjCMethodDecl *CurMethod = getCurMethodDecl();
+
+ // Check for error condition which is already reported.
+ if (!CurMethod)
+ return ExprError();
// There are two cases to handle here. 1) scoped lookup could have failed,
// in which case we should look for an ivar. 2) scoped lookup could have
@@ -2009,14 +2124,15 @@ Sema::LookupInObjCMethod(LookupResult &Lookup, Scope *S,
if (SelfExpr.isInvalid())
return ExprError();
- MarkAnyDeclReferenced(Loc, IV);
+ MarkAnyDeclReferenced(Loc, IV, true);
ObjCMethodFamily MF = CurMethod->getMethodFamily();
- if (MF != OMF_init && MF != OMF_dealloc && MF != OMF_finalize)
+ if (MF != OMF_init && MF != OMF_dealloc && MF != OMF_finalize &&
+ !IvarBacksCurrentMethodAccessor(IFace, CurMethod, IV))
Diag(Loc, diag::warn_direct_ivar_access) << IV->getDeclName();
ObjCIvarRefExpr *Result = new (Context) ObjCIvarRefExpr(IV, IV->getType(),
- Loc,
+ Loc, IV->getLocation(),
SelfExpr.take(),
true, true);
@@ -2321,8 +2437,8 @@ Sema::BuildDeclarationNameExpr(const CXXScopeSpec &SS,
// If this is a single, fully-resolved result and we don't need ADL,
// just build an ordinary singleton decl ref.
if (!NeedsADL && R.isSingleResult() && !R.getAsSingle<FunctionTemplateDecl>())
- return BuildDeclarationNameExpr(SS, R.getLookupNameInfo(),
- R.getFoundDecl());
+ return BuildDeclarationNameExpr(SS, R.getLookupNameInfo(), R.getFoundDecl(),
+ R.getRepresentativeDecl());
// We only need to check the declaration if there's exactly one
// result, because in the overloaded case the results can only be
@@ -2350,7 +2466,7 @@ Sema::BuildDeclarationNameExpr(const CXXScopeSpec &SS,
ExprResult
Sema::BuildDeclarationNameExpr(const CXXScopeSpec &SS,
const DeclarationNameInfo &NameInfo,
- NamedDecl *D) {
+ NamedDecl *D, NamedDecl *FoundD) {
assert(D && "Cannot refer to a NULL declaration");
assert(!isa<FunctionTemplateDecl>(D) &&
"Cannot refer unambiguously to a function template");
@@ -2546,7 +2662,7 @@ Sema::BuildDeclarationNameExpr(const CXXScopeSpec &SS,
break;
}
- return BuildDeclRefExpr(VD, type, valueKind, NameInfo, &SS);
+ return BuildDeclRefExpr(VD, type, valueKind, NameInfo, &SS, FoundD);
}
}
@@ -2565,8 +2681,14 @@ ExprResult Sema::ActOnPredefinedExpr(SourceLocation Loc, tok::TokenKind Kind) {
// string.
Decl *currentDecl = getCurFunctionOrMethodDecl();
- if (!currentDecl && getCurBlock())
- currentDecl = getCurBlock()->TheDecl;
+ // Blocks and lambdas can occur at global scope. Don't emit a warning.
+ if (!currentDecl) {
+ if (const BlockScopeInfo *BSI = getCurBlock())
+ currentDecl = BSI->TheDecl;
+ else if (const LambdaScopeInfo *LSI = getCurLambda())
+ currentDecl = LSI->CallOperator;
+ }
+
if (!currentDecl) {
Diag(Loc, diag::ext_predef_outside_function);
currentDecl = Context.getTranslationUnitDecl();
@@ -2764,7 +2886,7 @@ ExprResult Sema::ActOnNumericConstant(const Token &Tok, Scope *UDLScope) {
SourceLocation TokLoc = Tok.getLocation();
unsigned Length = Literal.getUDSuffixOffset();
QualType StrTy = Context.getConstantArrayType(
- Context.CharTy, llvm::APInt(32, Length + 1),
+ Context.CharTy.withConst(), llvm::APInt(32, Length + 1),
ArrayType::Normal, 0);
Expr *Lit = StringLiteral::Create(
Context, StringRef(TokSpelling.data(), Length), StringLiteral::Ascii,
@@ -2825,7 +2947,7 @@ ExprResult Sema::ActOnNumericConstant(const Token &Tok, Scope *UDLScope) {
if (!getLangOpts().C99 && Literal.isLongLong) {
if (getLangOpts().CPlusPlus)
Diag(Tok.getLocation(),
- getLangOpts().CPlusPlus0x ?
+ getLangOpts().CPlusPlus11 ?
diag::warn_cxx98_compat_longlong : diag::ext_cxx11_longlong);
else
Diag(Tok.getLocation(), diag::ext_c99_longlong);
@@ -2835,7 +2957,10 @@ ExprResult Sema::ActOnNumericConstant(const Token &Tok, Scope *UDLScope) {
unsigned MaxWidth = Context.getTargetInfo().getIntMaxTWidth();
// The microsoft literal suffix extensions support 128-bit literals, which
// may be wider than [u]intmax_t.
- if (Literal.isMicrosoftInteger && MaxWidth < 128)
+ // FIXME: Actually, they don't. We seem to have accidentally invented the
+ // i128 suffix.
+ if (Literal.isMicrosoftInteger && MaxWidth < 128 &&
+ PP.getTargetInfo().hasInt128Type())
MaxWidth = 128;
llvm::APInt ResultVal(MaxWidth, 0);
@@ -2905,7 +3030,8 @@ ExprResult Sema::ActOnNumericConstant(const Token &Tok, Scope *UDLScope) {
// If it doesn't fit in unsigned long long, and we're using Microsoft
// extensions, then its a 128-bit integer literal.
- if (Ty.isNull() && Literal.isMicrosoftInteger) {
+ if (Ty.isNull() && Literal.isMicrosoftInteger &&
+ PP.getTargetInfo().hasInt128Type()) {
if (Literal.isUnsigned)
Ty = Context.UnsignedInt128Ty;
else
@@ -2963,16 +3089,17 @@ static bool CheckExtensionTraitOperandType(Sema &S, QualType T,
SourceRange ArgRange,
UnaryExprOrTypeTrait TraitKind) {
// C99 6.5.3.4p1:
- if (T->isFunctionType()) {
- // alignof(function) is allowed as an extension.
- if (TraitKind == UETT_SizeOf)
- S.Diag(Loc, diag::ext_sizeof_function_type) << ArgRange;
+ if (T->isFunctionType() &&
+ (TraitKind == UETT_SizeOf || TraitKind == UETT_AlignOf)) {
+ // sizeof(function)/alignof(function) is allowed as an extension.
+ S.Diag(Loc, diag::ext_sizeof_alignof_function_type)
+ << TraitKind << ArgRange;
return false;
}
// Allow sizeof(void)/alignof(void) as an extension.
if (T->isVoidType()) {
- S.Diag(Loc, diag::ext_sizeof_void_type) << TraitKind << ArgRange;
+ S.Diag(Loc, diag::ext_sizeof_alignof_void_type) << TraitKind << ArgRange;
return false;
}
@@ -2995,6 +3122,24 @@ static bool CheckObjCTraitOperandConstraints(Sema &S, QualType T,
return false;
}
+/// \brief Check whether E is a pointer from a decayed array type (the decayed
+/// pointer type is equal to T) and emit a warning if it is.
+static void warnOnSizeofOnArrayDecay(Sema &S, SourceLocation Loc, QualType T,
+ Expr *E) {
+ // Don't warn if the operation changed the type.
+ if (T != E->getType())
+ return;
+
+ // Now look for array decays.
+ ImplicitCastExpr *ICE = dyn_cast<ImplicitCastExpr>(E);
+ if (!ICE || ICE->getCastKind() != CK_ArrayToPointerDecay)
+ return;
+
+ S.Diag(Loc, diag::warn_sizeof_array_decay) << ICE->getSourceRange()
+ << ICE->getType()
+ << ICE->getSubExpr()->getType();
+}
+
/// \brief Check the constrains on expression operands to unary type expression
/// and type traits.
///
@@ -3048,6 +3193,16 @@ bool Sema::CheckUnaryExprOrTypeTraitOperand(Expr *E,
}
}
}
+
+ // Warn on "sizeof(array op x)" and "sizeof(x op array)", where the array
+ // decays into a pointer and returns an unintended result. This is most
+ // likely a typo for "sizeof(array) op x".
+ if (BinaryOperator *BO = dyn_cast<BinaryOperator>(E->IgnoreParens())) {
+ warnOnSizeofOnArrayDecay(*this, BO->getOperatorLoc(), BO->getType(),
+ BO->getLHS());
+ warnOnSizeofOnArrayDecay(*this, BO->getOperatorLoc(), BO->getType(),
+ BO->getRHS());
+ }
}
return false;
@@ -3189,7 +3344,7 @@ Sema::CreateUnaryExprOrTypeTraitExpr(Expr *E, SourceLocation OpLoc,
return ExprError();
if (ExprKind == UETT_SizeOf && E->getType()->isVariableArrayType()) {
- PE = TranformToPotentiallyEvaluated(E);
+ PE = TransformToPotentiallyEvaluated(E);
if (PE.isInvalid()) return ExprError();
E = PE.take();
}
@@ -3292,33 +3447,56 @@ static bool checkArithmeticOnObjCPointer(Sema &S,
}
ExprResult
-Sema::ActOnArraySubscriptExpr(Scope *S, Expr *Base, SourceLocation LLoc,
- Expr *Idx, SourceLocation RLoc) {
+Sema::ActOnArraySubscriptExpr(Scope *S, Expr *base, SourceLocation lbLoc,
+ Expr *idx, SourceLocation rbLoc) {
// Since this might be a postfix expression, get rid of ParenListExprs.
- ExprResult Result = MaybeConvertParenListExprToParenExpr(S, Base);
- if (Result.isInvalid()) return ExprError();
- Base = Result.take();
+ if (isa<ParenListExpr>(base)) {
+ ExprResult result = MaybeConvertParenListExprToParenExpr(S, base);
+ if (result.isInvalid()) return ExprError();
+ base = result.take();
+ }
- Expr *LHSExp = Base, *RHSExp = Idx;
+ // Handle any non-overload placeholder types in the base and index
+ // expressions. We can't handle overloads here because the other
+ // operand might be an overloadable type, in which case the overload
+ // resolution for the operator overload should get the first crack
+ // at the overload.
+ if (base->getType()->isNonOverloadPlaceholderType()) {
+ ExprResult result = CheckPlaceholderExpr(base);
+ if (result.isInvalid()) return ExprError();
+ base = result.take();
+ }
+ if (idx->getType()->isNonOverloadPlaceholderType()) {
+ ExprResult result = CheckPlaceholderExpr(idx);
+ if (result.isInvalid()) return ExprError();
+ idx = result.take();
+ }
+ // Build an unanalyzed expression if either operand is type-dependent.
if (getLangOpts().CPlusPlus &&
- (LHSExp->isTypeDependent() || RHSExp->isTypeDependent())) {
- return Owned(new (Context) ArraySubscriptExpr(LHSExp, RHSExp,
+ (base->isTypeDependent() || idx->isTypeDependent())) {
+ return Owned(new (Context) ArraySubscriptExpr(base, idx,
Context.DependentTy,
VK_LValue, OK_Ordinary,
- RLoc));
+ rbLoc));
}
+ // Use C++ overloaded-operator rules if either operand has record
+ // type. The spec says to do this if either type is *overloadable*,
+ // but enum types can't declare subscript operators or conversion
+ // operators, so there's nothing interesting for overload resolution
+ // to do if there aren't any record types involved.
+ //
+ // ObjC pointers have their own subscripting logic that is not tied
+ // to overload resolution and so should not take this path.
if (getLangOpts().CPlusPlus &&
- (LHSExp->getType()->isRecordType() ||
- LHSExp->getType()->isEnumeralType() ||
- RHSExp->getType()->isRecordType() ||
- RHSExp->getType()->isEnumeralType()) &&
- !LHSExp->getType()->isObjCObjectPointerType()) {
- return CreateOverloadedArraySubscriptExpr(LLoc, RLoc, Base, Idx);
+ (base->getType()->isRecordType() ||
+ (!base->getType()->isObjCObjectPointerType() &&
+ idx->getType()->isRecordType()))) {
+ return CreateOverloadedArraySubscriptExpr(lbLoc, rbLoc, base, idx);
}
- return CreateBuiltinArraySubscriptExpr(Base, LLoc, Idx, RLoc);
+ return CreateBuiltinArraySubscriptExpr(base, lbLoc, idx, rbLoc);
}
ExprResult
@@ -3525,7 +3703,7 @@ ExprResult Sema::BuildCXXDefaultArgExpr(SourceLocation CallLoc,
return ExprError();
Expr *Arg = Result.takeAs<Expr>();
- CheckImplicitConversions(Arg, Param->getOuterLocStart());
+ CheckCompletedExpr(Arg, Param->getOuterLocStart());
// Build the default argument expression.
return Owned(CXXDefaultArgExpr::Create(Context, CallLoc, Param, Arg));
}
@@ -3687,7 +3865,8 @@ bool Sema::GatherArgumentsForCall(SourceLocation CallLoc,
Expr **Args, unsigned NumArgs,
SmallVector<Expr *, 8> &AllArgs,
VariadicCallType CallType,
- bool AllowExplicit) {
+ bool AllowExplicit,
+ bool IsListInitialization) {
unsigned NumArgsInProto = Proto->getNumArgs();
unsigned NumArgsToCheck = NumArgs;
bool Invalid = false;
@@ -3720,20 +3899,21 @@ bool Sema::GatherArgumentsForCall(SourceLocation CallLoc,
(!Param || !Param->hasAttr<CFConsumedAttr>()))
Arg = stripARCUnbridgedCast(Arg);
- InitializedEntity Entity =
- Param? InitializedEntity::InitializeParameter(Context, Param)
- : InitializedEntity::InitializeParameter(Context, ProtoArgType,
- Proto->isArgConsumed(i));
+ InitializedEntity Entity = Param ?
+ InitializedEntity::InitializeParameter(Context, Param, ProtoArgType)
+ : InitializedEntity::InitializeParameter(Context, ProtoArgType,
+ Proto->isArgConsumed(i));
ExprResult ArgE = PerformCopyInitialization(Entity,
SourceLocation(),
Owned(Arg),
- /*TopLevelOfInitList=*/false,
+ IsListInitialization,
AllowExplicit);
if (ArgE.isInvalid())
return true;
Arg = ArgE.takeAs<Expr>();
} else {
+ assert(FDecl && "can't use default arguments without a known callee");
Param = FDecl->getParamDecl(i);
ExprResult ArgExpr =
@@ -3762,11 +3942,8 @@ bool Sema::GatherArgumentsForCall(SourceLocation CallLoc,
if (Proto->getResultType() == Context.UnknownAnyTy &&
FDecl && FDecl->isExternC()) {
for (unsigned i = ArgIx; i != NumArgs; ++i) {
- ExprResult arg;
- if (isa<ExplicitCastExpr>(Args[i]->IgnoreParens()))
- arg = DefaultFunctionArrayLvalueConversion(Args[i]);
- else
- arg = DefaultVariadicArgumentPromotion(Args[i], CallType, FDecl);
+ QualType paramType; // ignored
+ ExprResult arg = checkUnknownAnyArg(CallLoc, Args[i], paramType);
Invalid |= arg.isInvalid();
AllArgs.push_back(arg.take());
}
@@ -3790,9 +3967,9 @@ bool Sema::GatherArgumentsForCall(SourceLocation CallLoc,
static void DiagnoseCalleeStaticArrayParam(Sema &S, ParmVarDecl *PVD) {
TypeLoc TL = PVD->getTypeSourceInfo()->getTypeLoc();
- if (ArrayTypeLoc *ATL = dyn_cast<ArrayTypeLoc>(&TL))
+ if (ArrayTypeLoc ATL = TL.getAs<ArrayTypeLoc>())
S.Diag(PVD->getLocation(), diag::note_callee_static_array)
- << ATL->getLocalSourceRange();
+ << ATL.getLocalSourceRange();
}
/// CheckStaticArrayArgument - If the given argument corresponds to a static
@@ -4593,10 +4770,15 @@ ExprResult Sema::BuildVectorLiteral(SourceLocation LParenLoc,
Expr **exprs;
unsigned numExprs;
Expr *subExpr;
+ SourceLocation LiteralLParenLoc, LiteralRParenLoc;
if (ParenListExpr *PE = dyn_cast<ParenListExpr>(E)) {
+ LiteralLParenLoc = PE->getLParenLoc();
+ LiteralRParenLoc = PE->getRParenLoc();
exprs = PE->getExprs();
numExprs = PE->getNumExprs();
- } else {
+ } else { // isa<ParenExpr> by assertion at function entrance
+ LiteralLParenLoc = cast<ParenExpr>(E)->getLParen();
+ LiteralRParenLoc = cast<ParenExpr>(E)->getRParen();
subExpr = cast<ParenExpr>(E)->getSubExpr();
exprs = &subExpr;
numExprs = 1;
@@ -4653,8 +4835,8 @@ ExprResult Sema::BuildVectorLiteral(SourceLocation LParenLoc,
}
// FIXME: This means that pretty-printing the final AST will produce curly
// braces instead of the original commas.
- InitListExpr *initE = new (Context) InitListExpr(Context, LParenLoc,
- initExprs, RParenLoc);
+ InitListExpr *initE = new (Context) InitListExpr(Context, LiteralLParenLoc,
+ initExprs, LiteralRParenLoc);
initE->setType(Ty);
return BuildCompoundLiteralExpr(LParenLoc, TInfo, RParenLoc, initE);
}
@@ -4681,7 +4863,6 @@ Sema::MaybeConvertParenListExprToParenExpr(Scope *S, Expr *OrigExpr) {
ExprResult Sema::ActOnParenListExpr(SourceLocation L,
SourceLocation R,
MultiExprArg Val) {
- assert(Val.data() != 0 && "ActOnParenOrParenListExpr() missing expr list");
Expr *expr = new (Context) ParenListExpr(Context, L, Val, R);
return Owned(expr);
}
@@ -4720,7 +4901,7 @@ bool Sema::DiagnoseConditionalForNull(Expr *LHSExpr, Expr *RHSExpr,
return false;
}
- int DiagType = (NullKind == Expr::NPCK_CXX0X_nullptr);
+ int DiagType = (NullKind == Expr::NPCK_CXX11_nullptr);
Diag(QuestionLoc, diag::err_typecheck_cond_incompatible_operands_null)
<< NonPointerExpr->getType() << DiagType
<< NonPointerExpr->getSourceRange();
@@ -4734,7 +4915,7 @@ static bool checkCondition(Sema &S, Expr *Cond) {
// C99 6.5.15p2
if (CondTy->isScalarType()) return false;
- // OpenCL: Sec 6.3.i says the condition is allowed to be a vector or scalar.
+ // OpenCL v1.1 s6.3.i says the condition is allowed to be a vector or scalar.
if (S.getLangOpts().OpenCL && CondTy->isVectorType())
return false;
@@ -4995,9 +5176,9 @@ QualType Sema::CheckConditionalOperands(ExprResult &Cond, ExprResult &LHS,
if (LHSTy->isVectorType() || RHSTy->isVectorType())
return CheckVectorOperands(LHS, RHS, QuestionLoc, /*isCompAssign*/false);
- // OpenCL: If the condition is a vector, and both operands are scalar,
+ // If the condition is a vector, and both operands are scalar,
// attempt to implicity convert them to the vector type to act like the
- // built in select.
+ // built in select. (OpenCL v1.1 s6.3.i)
if (getLangOpts().OpenCL && CondTy->isVectorType())
if (checkConditionalConvertScalarsToVectors(*this, LHS, RHS, CondTy))
return QualType();
@@ -5264,7 +5445,8 @@ static bool IsArithmeticBinaryExpr(Expr *E, BinaryOperatorKind *Opcode,
// Make sure this is really a binary operator that is safe to pass into
// BinaryOperator::getOverloadedOpcode(), e.g. it's not a subscript op.
OverloadedOperatorKind OO = Call->getOperator();
- if (OO < OO_Plus || OO > OO_Arrow)
+ if (OO < OO_Plus || OO > OO_Arrow ||
+ OO == OO_PlusPlus || OO == OO_MinusMinus)
return false;
BinaryOperatorKind OpKind = BinaryOperator::getOverloadedOpcode(OO);
@@ -5625,7 +5807,6 @@ Sema::CheckAssignmentConstraints(QualType LHSType, ExprResult &RHS,
LHSType = Context.getCanonicalType(LHSType).getUnqualifiedType();
RHSType = Context.getCanonicalType(RHSType).getUnqualifiedType();
-
// Common case: no conversion required.
if (LHSType == RHSType) {
Kind = CK_NoOp;
@@ -6570,6 +6751,11 @@ static bool isScopedEnumerationType(QualType T) {
static void DiagnoseBadShiftValues(Sema& S, ExprResult &LHS, ExprResult &RHS,
SourceLocation Loc, unsigned Opc,
QualType LHSType) {
+ // OpenCL 6.3j: shift values are effectively % word size of LHS (more defined),
+ // so skip remaining warnings as we don't want to modify values within Sema.
+ if (S.getLangOpts().OpenCL)
+ return;
+
llvm::APSInt Right;
// Check right/shifter operand
if (RHS.get()->isValueDependent() ||
@@ -6689,10 +6875,10 @@ static bool IsWithinTemplateSpecialization(Decl *D) {
}
/// If two different enums are compared, raise a warning.
-static void checkEnumComparison(Sema &S, SourceLocation Loc, ExprResult &LHS,
- ExprResult &RHS) {
- QualType LHSStrippedType = LHS.get()->IgnoreParenImpCasts()->getType();
- QualType RHSStrippedType = RHS.get()->IgnoreParenImpCasts()->getType();
+static void checkEnumComparison(Sema &S, SourceLocation Loc, Expr *LHS,
+ Expr *RHS) {
+ QualType LHSStrippedType = LHS->IgnoreParenImpCasts()->getType();
+ QualType RHSStrippedType = RHS->IgnoreParenImpCasts()->getType();
const EnumType *LHSEnumType = LHSStrippedType->getAs<EnumType>();
if (!LHSEnumType)
@@ -6712,7 +6898,7 @@ static void checkEnumComparison(Sema &S, SourceLocation Loc, ExprResult &LHS,
S.Diag(Loc, diag::warn_comparison_of_mixed_enum_types)
<< LHSStrippedType << RHSStrippedType
- << LHS.get()->getSourceRange() << RHS.get()->getSourceRange();
+ << LHS->getSourceRange() << RHS->getSourceRange();
}
/// \brief Diagnose bad pointer comparisons.
@@ -6796,18 +6982,18 @@ static bool isObjCObjectLiteral(ExprResult &E) {
}
static bool hasIsEqualMethod(Sema &S, const Expr *LHS, const Expr *RHS) {
- // Get the LHS object's interface type.
- QualType Type = LHS->getType();
- QualType InterfaceType;
- if (const ObjCObjectPointerType *PTy = Type->getAs<ObjCObjectPointerType>()) {
- InterfaceType = PTy->getPointeeType();
- if (const ObjCObjectType *iQFaceTy =
- InterfaceType->getAsObjCQualifiedInterfaceType())
- InterfaceType = iQFaceTy->getBaseType();
- } else {
- // If this is not actually an Objective-C object, bail out.
+ const ObjCObjectPointerType *Type =
+ LHS->getType()->getAs<ObjCObjectPointerType>();
+
+ // If this is not actually an Objective-C object, bail out.
+ if (!Type)
return false;
- }
+
+ // Get the LHS object's interface type.
+ QualType InterfaceType = Type->getPointeeType();
+ if (const ObjCObjectType *iQFaceTy =
+ InterfaceType->getAsObjCQualifiedInterfaceType())
+ InterfaceType = iQFaceTy->getBaseType();
// If the RHS isn't an Objective-C object, bail out.
if (!RHS->getType()->isObjCObjectPointerType())
@@ -6826,8 +7012,7 @@ static bool hasIsEqualMethod(Sema &S, const Expr *LHS, const Expr *RHS) {
/*warn=*/false);
} else {
// Check protocols.
- Method = S.LookupMethodInQualifiedType(IsEqualSel,
- cast<ObjCObjectPointerType>(Type),
+ Method = S.LookupMethodInQualifiedType(IsEqualSel, Type,
/*instance=*/true);
}
}
@@ -6846,6 +7031,48 @@ static bool hasIsEqualMethod(Sema &S, const Expr *LHS, const Expr *RHS) {
return true;
}
+Sema::ObjCLiteralKind Sema::CheckLiteralKind(Expr *FromE) {
+ FromE = FromE->IgnoreParenImpCasts();
+ switch (FromE->getStmtClass()) {
+ default:
+ break;
+ case Stmt::ObjCStringLiteralClass:
+ // "string literal"
+ return LK_String;
+ case Stmt::ObjCArrayLiteralClass:
+ // "array literal"
+ return LK_Array;
+ case Stmt::ObjCDictionaryLiteralClass:
+ // "dictionary literal"
+ return LK_Dictionary;
+ case Stmt::BlockExprClass:
+ return LK_Block;
+ case Stmt::ObjCBoxedExprClass: {
+ Expr *Inner = cast<ObjCBoxedExpr>(FromE)->getSubExpr()->IgnoreParens();
+ switch (Inner->getStmtClass()) {
+ case Stmt::IntegerLiteralClass:
+ case Stmt::FloatingLiteralClass:
+ case Stmt::CharacterLiteralClass:
+ case Stmt::ObjCBoolLiteralExprClass:
+ case Stmt::CXXBoolLiteralExprClass:
+ // "numeric literal"
+ return LK_Numeric;
+ case Stmt::ImplicitCastExprClass: {
+ CastKind CK = cast<CastExpr>(Inner)->getCastKind();
+ // Boolean literals can be represented by implicit casts.
+ if (CK == CK_IntegralToBoolean || CK == CK_IntegralCast)
+ return LK_Numeric;
+ break;
+ }
+ default:
+ break;
+ }
+ return LK_Boxed;
+ }
+ }
+ return LK_None;
+}
+
static void diagnoseObjCLiteralComparison(Sema &S, SourceLocation Loc,
ExprResult &LHS, ExprResult &RHS,
BinaryOperator::Opcode Opc){
@@ -6866,61 +7093,15 @@ static void diagnoseObjCLiteralComparison(Sema &S, SourceLocation Loc,
return;
// This should be kept in sync with warn_objc_literal_comparison.
- // LK_String should always be last, since it has its own warning flag.
- enum {
- LK_Array,
- LK_Dictionary,
- LK_Numeric,
- LK_Boxed,
- LK_String
- } LiteralKind;
-
- Literal = Literal->IgnoreParenImpCasts();
- switch (Literal->getStmtClass()) {
- case Stmt::ObjCStringLiteralClass:
- // "string literal"
- LiteralKind = LK_String;
- break;
- case Stmt::ObjCArrayLiteralClass:
- // "array literal"
- LiteralKind = LK_Array;
- break;
- case Stmt::ObjCDictionaryLiteralClass:
- // "dictionary literal"
- LiteralKind = LK_Dictionary;
- break;
- case Stmt::ObjCBoxedExprClass: {
- Expr *Inner = cast<ObjCBoxedExpr>(Literal)->getSubExpr();
- switch (Inner->getStmtClass()) {
- case Stmt::IntegerLiteralClass:
- case Stmt::FloatingLiteralClass:
- case Stmt::CharacterLiteralClass:
- case Stmt::ObjCBoolLiteralExprClass:
- case Stmt::CXXBoolLiteralExprClass:
- // "numeric literal"
- LiteralKind = LK_Numeric;
- break;
- case Stmt::ImplicitCastExprClass: {
- CastKind CK = cast<CastExpr>(Inner)->getCastKind();
- // Boolean literals can be represented by implicit casts.
- if (CK == CK_IntegralToBoolean || CK == CK_IntegralCast) {
- LiteralKind = LK_Numeric;
- break;
- }
- // FALLTHROUGH
- }
- default:
- // "boxed expression"
- LiteralKind = LK_Boxed;
- break;
- }
- break;
- }
- default:
+ // LK_String should always be after the other literals, since it has its own
+ // warning flag.
+ Sema::ObjCLiteralKind LiteralKind = S.CheckLiteralKind(Literal);
+ assert(LiteralKind != Sema::LK_Block);
+ if (LiteralKind == Sema::LK_None) {
llvm_unreachable("Unknown Objective-C object literal kind");
}
- if (LiteralKind == LK_String)
+ if (LiteralKind == Sema::LK_String)
S.Diag(Loc, diag::warn_objc_string_literal_comparison)
<< Literal->getSourceRange();
else
@@ -6931,11 +7112,12 @@ static void diagnoseObjCLiteralComparison(Sema &S, SourceLocation Loc,
hasIsEqualMethod(S, LHS.get(), RHS.get())) {
SourceLocation Start = LHS.get()->getLocStart();
SourceLocation End = S.PP.getLocForEndOfToken(RHS.get()->getLocEnd());
- SourceRange OpRange(Loc, S.PP.getLocForEndOfToken(Loc));
+ CharSourceRange OpRange =
+ CharSourceRange::getCharRange(Loc, S.PP.getLocForEndOfToken(Loc));
S.Diag(Loc, diag::note_objc_literal_comparison_isequal)
<< FixItHint::CreateInsertion(Start, Opc == BO_EQ ? "[" : "![")
- << FixItHint::CreateReplacement(OpRange, "isEqual:")
+ << FixItHint::CreateReplacement(OpRange, " isEqual:")
<< FixItHint::CreateInsertion(End, "]");
}
}
@@ -6959,7 +7141,7 @@ QualType Sema::CheckCompareOperands(ExprResult &LHS, ExprResult &RHS,
Expr *LHSStripped = LHS.get()->IgnoreParenImpCasts();
Expr *RHSStripped = RHS.get()->IgnoreParenImpCasts();
- checkEnumComparison(*this, Loc, LHS, RHS);
+ checkEnumComparison(*this, Loc, LHS.get(), RHS.get());
if (!LHSType->hasFloatingRepresentation() &&
!(LHSType->isBlockPointerType() && IsRelational) &&
@@ -7109,7 +7291,7 @@ QualType Sema::CheckCompareOperands(ExprResult &LHS, ExprResult &RHS,
if ((LCanPointeeTy->isFunctionType() || RCanPointeeTy->isFunctionType())
&& !LHSIsNull && !RHSIsNull) {
diagnoseFunctionPointerToVoidComparison(
- *this, Loc, LHS, RHS, /*isError*/ isSFINAEContext());
+ *this, Loc, LHS, RHS, /*isError*/ (bool)isSFINAEContext());
if (isSFINAEContext())
return QualType();
@@ -7396,7 +7578,10 @@ QualType Sema::CheckVectorLogicalOperands(ExprResult &LHS, ExprResult &RHS,
// Ensure that either both operands are of the same vector type, or
// one operand is of a vector type and the other is of its element type.
QualType vType = CheckVectorOperands(LHS, RHS, Loc, false);
- if (vType.isNull() || vType->isFloatingType())
+ if (vType.isNull())
+ return InvalidOperands(Loc, LHS, RHS);
+ if (getLangOpts().OpenCL && getLangOpts().OpenCLVersion < 120 &&
+ vType->hasFloatingRepresentation())
return InvalidOperands(Loc, LHS, RHS);
return GetSignedVectorType(LHS.get()->getType());
@@ -7472,8 +7657,17 @@ inline QualType Sema::CheckLogicalOperands( // C99 6.5.[13,14]
RHS.get()->getLocEnd()));
}
}
-
+
if (!Context.getLangOpts().CPlusPlus) {
+ // OpenCL v1.1 s6.3.g: The logical operators and (&&), or (||) do
+ // not operate on the built-in scalar and vector float types.
+ if (Context.getLangOpts().OpenCL &&
+ Context.getLangOpts().OpenCLVersion < 120) {
+ if (LHS.get()->getType()->isFloatingType() ||
+ RHS.get()->getType()->isFloatingType())
+ return InvalidOperands(Loc, LHS, RHS);
+ }
+
LHS = UsualUnaryConversions(LHS.take());
if (LHS.isInvalid())
return QualType();
@@ -7999,7 +8193,9 @@ static QualType CheckAddressOfOperand(Sema &S, ExprResult &OrigOp,
if (const BuiltinType *PTy = OrigOp.get()->getType()->getAsPlaceholderType()){
if (PTy->getKind() == BuiltinType::Overload) {
if (!isa<OverloadExpr>(OrigOp.get()->IgnoreParens())) {
- S.Diag(OpLoc, diag::err_typecheck_invalid_lvalue_addrof)
+ assert(cast<UnaryOperator>(OrigOp.get()->IgnoreParens())->getOpcode()
+ == UO_AddrOf);
+ S.Diag(OpLoc, diag::err_typecheck_invalid_lvalue_addrof_addrof_function)
<< OrigOp.get()->getSourceRange();
return QualType();
}
@@ -8043,10 +8239,10 @@ static QualType CheckAddressOfOperand(Sema &S, ExprResult &OrigOp,
Expr::LValueClassification lval = op->ClassifyLValue(S.Context);
unsigned AddressOfError = AO_No_Error;
- if (lval == Expr::LV_ClassTemporary) {
- bool sfinae = S.isSFINAEContext();
- S.Diag(OpLoc, sfinae ? diag::err_typecheck_addrof_class_temporary
- : diag::ext_typecheck_addrof_class_temporary)
+ if (lval == Expr::LV_ClassTemporary || lval == Expr::LV_ArrayTemporary) {
+ bool sfinae = (bool)S.isSFINAEContext();
+ S.Diag(OpLoc, S.isSFINAEContext() ? diag::err_typecheck_addrof_temporary
+ : diag::ext_typecheck_addrof_temporary)
<< op->getType() << op->getSourceRange();
if (sfinae)
return QualType();
@@ -8094,9 +8290,8 @@ static QualType CheckAddressOfOperand(Sema &S, ExprResult &OrigOp,
if (isa<PseudoObjectExpr>(op)) {
AddressOfError = AO_Property_Expansion;
} else {
- // FIXME: emit more specific diag...
S.Diag(OpLoc, diag::err_typecheck_invalid_lvalue_addrof)
- << op->getSourceRange();
+ << op->getType() << op->getSourceRange();
return QualType();
}
}
@@ -8312,7 +8507,7 @@ static void DiagnoseSelfAssignment(Sema &S, Expr *LHSExpr, Expr *RHSExpr,
ExprResult Sema::CreateBuiltinBinOp(SourceLocation OpLoc,
BinaryOperatorKind Opc,
Expr *LHSExpr, Expr *RHSExpr) {
- if (getLangOpts().CPlusPlus0x && isa<InitListExpr>(RHSExpr)) {
+ if (getLangOpts().CPlusPlus11 && isa<InitListExpr>(RHSExpr)) {
// The syntax only allows initializer lists on the RHS of assignment,
// so we don't need to worry about accepting invalid code for
// non-assignment operators.
@@ -8445,6 +8640,24 @@ ExprResult Sema::CreateBuiltinBinOp(SourceLocation OpLoc,
CheckArrayAccess(LHS.get());
CheckArrayAccess(RHS.get());
+ if (const ObjCIsaExpr *OISA = dyn_cast<ObjCIsaExpr>(LHS.get()->IgnoreParenCasts())) {
+ NamedDecl *ObjectSetClass = LookupSingleName(TUScope,
+ &Context.Idents.get("object_setClass"),
+ SourceLocation(), LookupOrdinaryName);
+ if (ObjectSetClass && isa<ObjCIsaExpr>(LHS.get())) {
+ SourceLocation RHSLocEnd = PP.getLocForEndOfToken(RHS.get()->getLocEnd());
+ Diag(LHS.get()->getExprLoc(), diag::warn_objc_isa_assign) <<
+ FixItHint::CreateInsertion(LHS.get()->getLocStart(), "object_setClass(") <<
+ FixItHint::CreateReplacement(SourceRange(OISA->getOpLoc(), OpLoc), ",") <<
+ FixItHint::CreateInsertion(RHSLocEnd, ")");
+ }
+ else
+ Diag(LHS.get()->getExprLoc(), diag::warn_objc_isa_assign);
+ }
+ else if (const ObjCIvarRefExpr *OIRE =
+ dyn_cast<ObjCIvarRefExpr>(LHS.get()->IgnoreParenCasts()))
+ DiagnoseDirectIsaAccess(*this, OIRE, OpLoc, RHS.get());
+
if (CompResultTy.isNull())
return Owned(new (Context) BinaryOperator(LHS.take(), RHS.take(), Opc,
ResultTy, VK, OK, OpLoc,
@@ -8467,46 +8680,38 @@ ExprResult Sema::CreateBuiltinBinOp(SourceLocation OpLoc,
static void DiagnoseBitwisePrecedence(Sema &Self, BinaryOperatorKind Opc,
SourceLocation OpLoc, Expr *LHSExpr,
Expr *RHSExpr) {
- typedef BinaryOperator BinOp;
- BinOp::Opcode LHSopc = static_cast<BinOp::Opcode>(-1),
- RHSopc = static_cast<BinOp::Opcode>(-1);
- if (BinOp *BO = dyn_cast<BinOp>(LHSExpr))
- LHSopc = BO->getOpcode();
- if (BinOp *BO = dyn_cast<BinOp>(RHSExpr))
- RHSopc = BO->getOpcode();
-
- // Subs are not binary operators.
- if (LHSopc == -1 && RHSopc == -1)
+ BinaryOperator *LHSBO = dyn_cast<BinaryOperator>(LHSExpr);
+ BinaryOperator *RHSBO = dyn_cast<BinaryOperator>(RHSExpr);
+
+ // Check that one of the sides is a comparison operator.
+ bool isLeftComp = LHSBO && LHSBO->isComparisonOp();
+ bool isRightComp = RHSBO && RHSBO->isComparisonOp();
+ if (!isLeftComp && !isRightComp)
return;
// Bitwise operations are sometimes used as eager logical ops.
// Don't diagnose this.
- if ((BinOp::isComparisonOp(LHSopc) || BinOp::isBitwiseOp(LHSopc)) &&
- (BinOp::isComparisonOp(RHSopc) || BinOp::isBitwiseOp(RHSopc)))
+ bool isLeftBitwise = LHSBO && LHSBO->isBitwiseOp();
+ bool isRightBitwise = RHSBO && RHSBO->isBitwiseOp();
+ if ((isLeftComp || isLeftBitwise) && (isRightComp || isRightBitwise))
return;
- bool isLeftComp = BinOp::isComparisonOp(LHSopc);
- bool isRightComp = BinOp::isComparisonOp(RHSopc);
- if (!isLeftComp && !isRightComp) return;
-
SourceRange DiagRange = isLeftComp ? SourceRange(LHSExpr->getLocStart(),
OpLoc)
: SourceRange(OpLoc, RHSExpr->getLocEnd());
- StringRef OpStr = isLeftComp ? BinOp::getOpcodeStr(LHSopc)
- : BinOp::getOpcodeStr(RHSopc);
+ StringRef OpStr = isLeftComp ? LHSBO->getOpcodeStr() : RHSBO->getOpcodeStr();
SourceRange ParensRange = isLeftComp ?
- SourceRange(cast<BinOp>(LHSExpr)->getRHS()->getLocStart(),
- RHSExpr->getLocEnd())
- : SourceRange(LHSExpr->getLocStart(),
- cast<BinOp>(RHSExpr)->getLHS()->getLocStart());
+ SourceRange(LHSBO->getRHS()->getLocStart(), RHSExpr->getLocEnd())
+ : SourceRange(LHSExpr->getLocStart(), RHSBO->getLHS()->getLocStart());
Self.Diag(OpLoc, diag::warn_precedence_bitwise_rel)
- << DiagRange << BinOp::getOpcodeStr(Opc) << OpStr;
+ << DiagRange << BinaryOperator::getOpcodeStr(Opc) << OpStr;
SuggestParentheses(Self, OpLoc,
Self.PDiag(diag::note_precedence_silence) << OpStr,
(isLeftComp ? LHSExpr : RHSExpr)->getSourceRange());
SuggestParentheses(Self, OpLoc,
- Self.PDiag(diag::note_precedence_bitwise_first) << BinOp::getOpcodeStr(Opc),
+ Self.PDiag(diag::note_precedence_bitwise_first)
+ << BinaryOperator::getOpcodeStr(Opc),
ParensRange);
}
@@ -8806,7 +9011,8 @@ ExprResult Sema::CreateBuiltinUnaryOp(SourceLocation OpLoc,
case UO_Not: // bitwise complement
Input = UsualUnaryConversions(Input.take());
- if (Input.isInvalid()) return ExprError();
+ if (Input.isInvalid())
+ return ExprError();
resultType = Input.get()->getType();
if (resultType->isDependentType())
break;
@@ -8814,12 +9020,22 @@ ExprResult Sema::CreateBuiltinUnaryOp(SourceLocation OpLoc,
if (resultType->isComplexType() || resultType->isComplexIntegerType())
// C99 does not support '~' for complex conjugation.
Diag(OpLoc, diag::ext_integer_complement_complex)
- << resultType << Input.get()->getSourceRange();
+ << resultType << Input.get()->getSourceRange();
else if (resultType->hasIntegerRepresentation())
break;
- else {
+ else if (resultType->isExtVectorType()) {
+ if (Context.getLangOpts().OpenCL) {
+ // OpenCL v1.1 s6.3.f: The bitwise operator not (~) does not operate
+ // on vector float types.
+ QualType T = resultType->getAs<ExtVectorType>()->getElementType();
+ if (!T->isIntegerType())
+ return ExprError(Diag(OpLoc, diag::err_typecheck_unary_expr)
+ << resultType << Input.get()->getSourceRange());
+ }
+ break;
+ } else {
return ExprError(Diag(OpLoc, diag::err_typecheck_unary_expr)
- << resultType << Input.get()->getSourceRange());
+ << resultType << Input.get()->getSourceRange());
}
break;
@@ -8830,7 +9046,7 @@ ExprResult Sema::CreateBuiltinUnaryOp(SourceLocation OpLoc,
resultType = Input.get()->getType();
// Though we still have to promote half FP to float...
- if (resultType->isHalfType()) {
+ if (resultType->isHalfType() && !Context.getLangOpts().NativeHalfType) {
Input = ImpCastExprToType(Input.take(), Context.FloatTy, CK_FloatingCast).take();
resultType = Context.FloatTy;
}
@@ -8844,8 +9060,24 @@ ExprResult Sema::CreateBuiltinUnaryOp(SourceLocation OpLoc,
// operand contextually converted to bool.
Input = ImpCastExprToType(Input.take(), Context.BoolTy,
ScalarTypeToBooleanCastKind(resultType));
+ } else if (Context.getLangOpts().OpenCL &&
+ Context.getLangOpts().OpenCLVersion < 120) {
+ // OpenCL v1.1 6.3.h: The logical operator not (!) does not
+ // operate on scalar float types.
+ if (!resultType->isIntegerType())
+ return ExprError(Diag(OpLoc, diag::err_typecheck_unary_expr)
+ << resultType << Input.get()->getSourceRange());
}
} else if (resultType->isExtVectorType()) {
+ if (Context.getLangOpts().OpenCL &&
+ Context.getLangOpts().OpenCLVersion < 120) {
+ // OpenCL v1.1 6.3.h: The logical operator not (!) does not
+ // operate on vector float types.
+ QualType T = resultType->getAs<ExtVectorType>()->getElementType();
+ if (!T->isIntegerType())
+ return ExprError(Diag(OpLoc, diag::err_typecheck_unary_expr)
+ << resultType << Input.get()->getSourceRange());
+ }
// Vector logical not returns the signed variant of the operand type.
resultType = GetSignedVectorType(resultType);
break;
@@ -9210,9 +9442,9 @@ ExprResult Sema::BuildBuiltinOffsetOf(SourceLocation BuiltinLoc,
// If type is not a standard-layout class (Clause 9), the results are
// undefined.
if (CXXRecordDecl *CRD = dyn_cast<CXXRecordDecl>(RD)) {
- bool IsSafe = LangOpts.CPlusPlus0x? CRD->isStandardLayout() : CRD->isPOD();
+ bool IsSafe = LangOpts.CPlusPlus11? CRD->isStandardLayout() : CRD->isPOD();
unsigned DiagID =
- LangOpts.CPlusPlus0x? diag::warn_offsetof_non_standardlayout_type
+ LangOpts.CPlusPlus11? diag::warn_offsetof_non_standardlayout_type
: diag::warn_offsetof_non_pod_type;
if (!IsSafe && !DidWarnAboutNonPOD &&
@@ -9379,8 +9611,7 @@ void Sema::ActOnBlockArguments(SourceLocation CaretLoc, Declarator &ParamInfo,
FunctionProtoType::ExtProtoInfo EPI;
EPI.HasTrailingReturn = false;
EPI.TypeQuals |= DeclSpec::TQ_const;
- T = Context.getFunctionType(Context.DependentTy, /*Args=*/0, /*NumArgs=*/0,
- EPI);
+ T = Context.getFunctionType(Context.DependentTy, ArrayRef<QualType>(), EPI);
Sig = Context.getTrivialTypeSourceInfo(T);
}
@@ -9394,8 +9625,7 @@ void Sema::ActOnBlockArguments(SourceLocation CaretLoc, Declarator &ParamInfo,
FunctionProtoTypeLoc ExplicitSignature;
TypeLoc tmp = Sig->getTypeLoc().IgnoreParens();
- if (isa<FunctionProtoTypeLoc>(tmp)) {
- ExplicitSignature = cast<FunctionProtoTypeLoc>(tmp);
+ if ((ExplicitSignature = tmp.getAs<FunctionProtoTypeLoc>())) {
// Check whether that explicit signature was synthesized by
// GetTypeForDeclarator. If so, don't save that as part of the
@@ -9560,7 +9790,7 @@ ExprResult Sema::ActOnBlockStmtExpr(SourceLocation CaretLoc,
if (isa<FunctionNoProtoType>(FTy)) {
FunctionProtoType::ExtProtoInfo EPI;
EPI.ExtInfo = Ext;
- BlockTy = Context.getFunctionType(RetTy, 0, 0, EPI);
+ BlockTy = Context.getFunctionType(RetTy, ArrayRef<QualType>(), EPI);
// Otherwise, if we don't need to change anything about the function type,
// preserve its sugar structure.
@@ -9574,17 +9804,18 @@ ExprResult Sema::ActOnBlockStmtExpr(SourceLocation CaretLoc,
FunctionProtoType::ExtProtoInfo EPI = FPT->getExtProtoInfo();
EPI.TypeQuals = 0; // FIXME: silently?
EPI.ExtInfo = Ext;
- BlockTy = Context.getFunctionType(RetTy,
- FPT->arg_type_begin(),
- FPT->getNumArgs(),
- EPI);
+ BlockTy =
+ Context.getFunctionType(RetTy,
+ ArrayRef<QualType>(FPT->arg_type_begin(),
+ FPT->getNumArgs()),
+ EPI);
}
// If we don't have a function type, just build one from nothing.
} else {
FunctionProtoType::ExtProtoInfo EPI;
EPI.ExtInfo = FunctionType::ExtInfo().withNoReturn(NoReturn);
- BlockTy = Context.getFunctionType(RetTy, 0, 0, EPI);
+ BlockTy = Context.getFunctionType(RetTy, ArrayRef<QualType>(), EPI);
}
DiagnoseUnusedParameters(BSI->TheDecl->param_begin(),
@@ -9715,11 +9946,11 @@ ExprResult Sema::BuildVAArgExpr(SourceLocation BuiltinLoc,
if (TInfo->getType()->isSpecificBuiltinType(BuiltinType::Float))
PromoteType = Context.DoubleTy;
if (!PromoteType.isNull())
- Diag(TInfo->getTypeLoc().getBeginLoc(),
- diag::warn_second_parameter_to_va_arg_never_compatible)
- << TInfo->getType()
- << PromoteType
- << TInfo->getTypeLoc().getSourceRange();
+ DiagRuntimeBehavior(TInfo->getTypeLoc().getBeginLoc(), E,
+ PDiag(diag::warn_second_parameter_to_va_arg_never_compatible)
+ << TInfo->getType()
+ << PromoteType
+ << TInfo->getTypeLoc().getSourceRange());
}
QualType T = TInfo->getType().getNonLValueExprType(Context);
@@ -9932,6 +10163,9 @@ bool Sema::DiagnoseAssignmentResult(AssignConvertType ConvTy,
if (CheckInferredResultType)
EmitRelatedResultTypeNote(SrcExpr);
+
+ if (Action == AA_Returning && ConvTy == IncompatiblePointer)
+ EmitRelatedResultTypeNoteForReturn(DstType);
if (Complained)
*Complained = true;
@@ -9980,7 +10214,7 @@ Sema::VerifyIntegerConstantExpression(Expr *E, llvm::APSInt *Result,
bool AllowFold) {
SourceLocation DiagLoc = E->getLocStart();
- if (getLangOpts().CPlusPlus0x) {
+ if (getLangOpts().CPlusPlus11) {
// C++11 [expr.const]p5:
// If an expression of literal class type is used in a context where an
// integral constant expression is required, then that class type shall
@@ -10107,14 +10341,14 @@ Sema::VerifyIntegerConstantExpression(Expr *E, llvm::APSInt *Result,
// Circumvent ICE checking in C++11 to avoid evaluating the expression twice
// in the non-ICE case.
- if (!getLangOpts().CPlusPlus0x && E->isIntegerConstantExpr(Context)) {
+ if (!getLangOpts().CPlusPlus11 && E->isIntegerConstantExpr(Context)) {
if (Result)
*Result = E->EvaluateKnownConstInt(Context);
return Owned(E);
}
Expr::EvalResult EvalResult;
- llvm::SmallVector<PartialDiagnosticAt, 8> Notes;
+ SmallVector<PartialDiagnosticAt, 8> Notes;
EvalResult.Diag = &Notes;
// Try to evaluate the expression, and produce diagnostics explaining why it's
@@ -10125,7 +10359,7 @@ Sema::VerifyIntegerConstantExpression(Expr *E, llvm::APSInt *Result,
// In C++11, we can rely on diagnostics being produced for any expression
// which is not a constant expression. If no diagnostics were produced, then
// this is a constant expression.
- if (Folded && getLangOpts().CPlusPlus0x && Notes.empty()) {
+ if (Folded && getLangOpts().CPlusPlus11 && Notes.empty()) {
if (Result)
*Result = EvalResult.Val.getInt();
return Owned(E);
@@ -10211,7 +10445,7 @@ namespace {
};
}
-ExprResult Sema::TranformToPotentiallyEvaluated(Expr *E) {
+ExprResult Sema::TransformToPotentiallyEvaluated(Expr *E) {
assert(ExprEvalContexts.back().Context == Unevaluated &&
"Should only transform unevaluated expressions");
ExprEvalContexts.back().Context =
@@ -10302,7 +10536,7 @@ void Sema::DiscardCleanupsInEvaluationContext() {
ExprResult Sema::HandleExprEvaluationContextForTypeof(Expr *E) {
if (!E->getType()->isVariablyModifiedType())
return E;
- return TranformToPotentiallyEvaluated(E);
+ return TransformToPotentiallyEvaluated(E);
}
static bool IsPotentiallyEvaluatedContext(Sema &SemaRef) {
@@ -10395,6 +10629,9 @@ void Sema::MarkFunctionReferenced(SourceLocation Loc, FunctionDecl *Func) {
if (!Constructor->isUsed(false))
DefineImplicitMoveConstructor(Loc, Constructor);
}
+ } else if (Constructor->getInheritedConstructor()) {
+ if (!Constructor->isUsed(false))
+ DefineInheritingConstructor(Loc, Constructor);
}
MarkVTableUsed(Loc, Constructor->getParent());
@@ -10488,13 +10725,26 @@ void Sema::MarkFunctionReferenced(SourceLocation Loc, FunctionDecl *Func) {
}
// Keep track of used but undefined functions.
- if (!Func->isPure() && !Func->hasBody() &&
- Func->getLinkage() != ExternalLinkage) {
- SourceLocation &old = UndefinedInternals[Func->getCanonicalDecl()];
- if (old.isInvalid()) old = Loc;
+ if (!Func->isDefined()) {
+ if (mightHaveNonExternalLinkage(Func))
+ UndefinedButUsed.insert(std::make_pair(Func->getCanonicalDecl(), Loc));
+ else if (Func->getMostRecentDecl()->isInlined() &&
+ (LangOpts.CPlusPlus || !LangOpts.GNUInline) &&
+ !Func->getMostRecentDecl()->hasAttr<GNUInlineAttr>())
+ UndefinedButUsed.insert(std::make_pair(Func->getCanonicalDecl(), Loc));
+ }
+
+ // Normally the must current decl is marked used while processing the use and
+ // any subsequent decls are marked used by decl merging. This fails with
+ // template instantiation since marking can happen at the end of the file
+ // and, because of the two phase lookup, this function is called with at
+ // decl in the middle of a decl chain. We loop to maintain the invariant
+ // that once a decl is used, all decls after it are also used.
+ for (FunctionDecl *F = Func->getMostRecentDecl();; F = F->getPreviousDecl()) {
+ F->setUsed(true);
+ if (F == Func)
+ break;
}
-
- Func->setUsed(true);
}
static void
@@ -10572,7 +10822,7 @@ static ExprResult captureInLambda(Sema &S, LambdaScopeInfo *LSI,
// Introduce a new evaluation context for the initialization, so
// that temporaries introduced as part of the capture are retained
// to be re-"exported" from the lambda expression itself.
- S.PushExpressionEvaluationContext(Sema::PotentiallyEvaluated);
+ EnterExpressionEvaluationContext scope(S, Sema::PotentiallyEvaluated);
// C++ [expr.prim.labda]p12:
// An entity captured by a lambda-expression is odr-used (3.2) in
@@ -10604,7 +10854,7 @@ static ExprResult captureInLambda(Sema &S, LambdaScopeInfo *LSI,
= VarDecl::Create(S.Context, S.CurContext, Loc, Loc,
IterationVarName, SizeType,
S.Context.getTrivialTypeSourceInfo(SizeType, Loc),
- SC_None, SC_None);
+ SC_None);
IndexVariables.push_back(IterationVar);
LSI->ArrayIndexVars.push_back(IterationVar);
@@ -10623,7 +10873,6 @@ static ExprResult captureInLambda(Sema &S, LambdaScopeInfo *LSI,
if (Subscript.isInvalid()) {
S.CleanupVarDeclMarking();
S.DiscardCleanupsInEvaluationContext();
- S.PopExpressionEvaluationContext();
return ExprError();
}
@@ -10659,7 +10908,6 @@ static ExprResult captureInLambda(Sema &S, LambdaScopeInfo *LSI,
// Exit the expression evaluation context used for the capture.
S.CleanupVarDeclMarking();
S.DiscardCleanupsInEvaluationContext();
- S.PopExpressionEvaluationContext();
return Result;
}
@@ -10748,7 +10996,22 @@ bool Sema::tryCaptureVariable(VarDecl *Var, SourceLocation Loc,
}
return true;
}
-
+ // Prohibit structs with flexible array members too.
+ // We cannot capture what is in the tail end of the struct.
+ if (const RecordType *VTTy = Var->getType()->getAs<RecordType>()) {
+ if (VTTy->getDecl()->hasFlexibleArrayMember()) {
+ if (BuildAndDiagnose) {
+ if (IsBlock)
+ Diag(Loc, diag::err_ref_flexarray_type);
+ else
+ Diag(Loc, diag::err_lambda_capture_flexarray_type)
+ << Var->getDeclName();
+ Diag(Var->getLocation(), diag::note_previous_decl)
+ << Var->getDeclName();
+ }
+ return true;
+ }
+ }
// Lambdas are not allowed to capture __block variables; they don't
// support the expected semantics.
if (IsLambda && HasBlocksAttr) {
@@ -10830,13 +11093,18 @@ bool Sema::tryCaptureVariable(VarDecl *Var, SourceLocation Loc,
// actually requires the destructor.
if (isa<ParmVarDecl>(Var))
FinalizeVarWithDestructor(Var, Record);
-
+
+ // Enter a new evaluation context to insulate the copy
+ // full-expression.
+ EnterExpressionEvaluationContext scope(*this, PotentiallyEvaluated);
+
// According to the blocks spec, the capture of a variable from
// the stack requires a const copy constructor. This is not true
// of the copy/move done to move a __block variable to the heap.
- Expr *DeclRef = new (Context) DeclRefExpr(Var, false,
+ Expr *DeclRef = new (Context) DeclRefExpr(Var, Nested,
DeclRefType.withConst(),
VK_LValue, Loc);
+
ExprResult Result
= PerformCopyInitialization(
InitializedEntity::InitializeBlock(Var->getLocation(),
@@ -10921,7 +11189,7 @@ bool Sema::tryCaptureVariable(VarDecl *Var, SourceLocation Loc,
if (BuildAndDiagnose) {
ExprResult Result = captureInLambda(*this, LSI, Var, CaptureType,
DeclRefType, Loc,
- I == N-1);
+ Nested);
if (!Result.isInvalid())
CopyExpr = Result.take();
}
@@ -10978,7 +11246,7 @@ static void MarkVarDeclODRUsed(Sema &SemaRef, VarDecl *Var,
if (Var->hasDefinition(SemaRef.Context) == VarDecl::DeclarationOnly &&
Var->getLinkage() != ExternalLinkage &&
!(Var->isStaticDataMember() && Var->hasInit())) {
- SourceLocation &old = SemaRef.UndefinedInternals[Var->getCanonicalDecl()];
+ SourceLocation &old = SemaRef.UndefinedButUsed[Var->getCanonicalDecl()];
if (old.isInvalid()) old = Loc;
}
@@ -11090,13 +11358,13 @@ void Sema::MarkVariableReferenced(SourceLocation Loc, VarDecl *Var) {
}
static void MarkExprReferenced(Sema &SemaRef, SourceLocation Loc,
- Decl *D, Expr *E) {
+ Decl *D, Expr *E, bool OdrUse) {
if (VarDecl *Var = dyn_cast<VarDecl>(D)) {
DoMarkVarDeclReferenced(SemaRef, Loc, Var, E);
return;
}
- SemaRef.MarkAnyDeclReferenced(Loc, D);
+ SemaRef.MarkAnyDeclReferenced(Loc, D, OdrUse);
// If this is a call to a method via a cast, also mark the method in the
// derived class used in case codegen can devirtualize the call.
@@ -11111,32 +11379,58 @@ static void MarkExprReferenced(Sema &SemaRef, SourceLocation Loc,
if (!MostDerivedClassDecl)
return;
CXXMethodDecl *DM = MD->getCorrespondingMethodInClass(MostDerivedClassDecl);
- if (!DM)
+ if (!DM || DM->isPure())
return;
- SemaRef.MarkAnyDeclReferenced(Loc, DM);
+ SemaRef.MarkAnyDeclReferenced(Loc, DM, OdrUse);
}
/// \brief Perform reference-marking and odr-use handling for a DeclRefExpr.
void Sema::MarkDeclRefReferenced(DeclRefExpr *E) {
- MarkExprReferenced(*this, E->getLocation(), E->getDecl(), E);
+ // TODO: update this with DR# once a defect report is filed.
+ // C++11 defect. The address of a pure member should not be an ODR use, even
+ // if it's a qualified reference.
+ bool OdrUse = true;
+ if (CXXMethodDecl *Method = dyn_cast<CXXMethodDecl>(E->getDecl()))
+ if (Method->isVirtual())
+ OdrUse = false;
+ MarkExprReferenced(*this, E->getLocation(), E->getDecl(), E, OdrUse);
}
/// \brief Perform reference-marking and odr-use handling for a MemberExpr.
void Sema::MarkMemberReferenced(MemberExpr *E) {
- MarkExprReferenced(*this, E->getMemberLoc(), E->getMemberDecl(), E);
+ // C++11 [basic.def.odr]p2:
+ // A non-overloaded function whose name appears as a potentially-evaluated
+ // expression or a member of a set of candidate functions, if selected by
+ // overload resolution when referred to from a potentially-evaluated
+ // expression, is odr-used, unless it is a pure virtual function and its
+ // name is not explicitly qualified.
+ bool OdrUse = true;
+ if (!E->hasQualifier()) {
+ if (CXXMethodDecl *Method = dyn_cast<CXXMethodDecl>(E->getMemberDecl()))
+ if (Method->isPure())
+ OdrUse = false;
+ }
+ SourceLocation Loc = E->getMemberLoc().isValid() ?
+ E->getMemberLoc() : E->getLocStart();
+ MarkExprReferenced(*this, Loc, E->getMemberDecl(), E, OdrUse);
}
/// \brief Perform marking for a reference to an arbitrary declaration. It
/// marks the declaration referenced, and performs odr-use checking for functions
/// and variables. This method should not be used when building an normal
/// expression which refers to a variable.
-void Sema::MarkAnyDeclReferenced(SourceLocation Loc, Decl *D) {
- if (VarDecl *VD = dyn_cast<VarDecl>(D))
- MarkVariableReferenced(Loc, VD);
- else if (FunctionDecl *FD = dyn_cast<FunctionDecl>(D))
- MarkFunctionReferenced(Loc, FD);
- else
- D->setReferenced();
+void Sema::MarkAnyDeclReferenced(SourceLocation Loc, Decl *D, bool OdrUse) {
+ if (OdrUse) {
+ if (VarDecl *VD = dyn_cast<VarDecl>(D)) {
+ MarkVariableReferenced(Loc, VD);
+ return;
+ }
+ if (FunctionDecl *FD = dyn_cast<FunctionDecl>(D)) {
+ MarkFunctionReferenced(Loc, FD);
+ return;
+ }
+ }
+ D->setReferenced();
}
namespace {
@@ -11161,7 +11455,7 @@ bool MarkReferencedDecls::TraverseTemplateArgument(
const TemplateArgument &Arg) {
if (Arg.getKind() == TemplateArgument::Declaration) {
if (Decl *D = Arg.getAsDecl())
- S.MarkAnyDeclReferenced(Loc, D);
+ S.MarkAnyDeclReferenced(Loc, D, true);
}
return Inherited::TraverseTemplateArgument(Arg);
@@ -11685,10 +11979,11 @@ ExprResult RebuildUnknownAnyExpr::VisitCallExpr(CallExpr *E) {
// Rebuild the function type, replacing the result type with DestType.
if (const FunctionProtoType *Proto = dyn_cast<FunctionProtoType>(FnType))
- DestType = S.Context.getFunctionType(DestType,
- Proto->arg_type_begin(),
- Proto->getNumArgs(),
- Proto->getExtProtoInfo());
+ DestType =
+ S.Context.getFunctionType(DestType,
+ ArrayRef<QualType>(Proto->arg_type_begin(),
+ Proto->getNumArgs()),
+ Proto->getExtProtoInfo());
else
DestType = S.Context.getFunctionNoProtoType(DestType,
FnType->getExtInfo());
@@ -11850,6 +12145,29 @@ ExprResult Sema::forceUnknownAnyToType(Expr *E, QualType ToType) {
return RebuildUnknownAnyExpr(*this, ToType).Visit(E);
}
+ExprResult Sema::checkUnknownAnyArg(SourceLocation callLoc,
+ Expr *arg, QualType &paramType) {
+ // If the syntactic form of the argument is not an explicit cast of
+ // any sort, just do default argument promotion.
+ ExplicitCastExpr *castArg = dyn_cast<ExplicitCastExpr>(arg->IgnoreParens());
+ if (!castArg) {
+ ExprResult result = DefaultArgumentPromotion(arg);
+ if (result.isInvalid()) return ExprError();
+ paramType = result.get()->getType();
+ return result;
+ }
+
+ // Otherwise, use the type that was written in the explicit cast.
+ assert(!arg->hasPlaceholderType());
+ paramType = castArg->getTypeAsWritten();
+
+ // Copy-initialize a parameter of that type.
+ InitializedEntity entity =
+ InitializedEntity::InitializeParameter(Context, paramType,
+ /*consumed*/ false);
+ return PerformCopyInitialization(entity, callLoc, Owned(arg));
+}
+
static ExprResult diagnoseUnknownAnyExpr(Sema &S, Expr *E) {
Expr *orig = E;
unsigned diagID = diag::err_uncasted_use_of_unknown_any;