diff options
author | Dimitry Andric <dim@FreeBSD.org> | 2011-02-26 22:09:03 +0000 |
---|---|---|
committer | Dimitry Andric <dim@FreeBSD.org> | 2011-02-26 22:09:03 +0000 |
commit | c3b054d250cdca485c71845089c316e10610ebad (patch) | |
tree | abae0246ec9156cc1a7cbb947b2b0dfe95fa3189 /lib/AST | |
parent | bca07a4524feb4edec581062d631a13116320a24 (diff) |
Diffstat (limited to 'lib/AST')
-rw-r--r-- | lib/AST/ASTContext.cpp | 106 | ||||
-rw-r--r-- | lib/AST/ASTImporter.cpp | 48 | ||||
-rw-r--r-- | lib/AST/Decl.cpp | 73 | ||||
-rw-r--r-- | lib/AST/DeclBase.cpp | 16 | ||||
-rw-r--r-- | lib/AST/DeclCXX.cpp | 32 | ||||
-rw-r--r-- | lib/AST/DeclPrinter.cpp | 6 | ||||
-rw-r--r-- | lib/AST/Expr.cpp | 13 | ||||
-rw-r--r-- | lib/AST/ExprCXX.cpp | 42 | ||||
-rw-r--r-- | lib/AST/ExprConstant.cpp | 2 | ||||
-rw-r--r-- | lib/AST/ItaniumMangle.cpp | 10 | ||||
-rw-r--r-- | lib/AST/NestedNameSpecifier.cpp | 182 | ||||
-rw-r--r-- | lib/AST/RecordLayoutBuilder.cpp | 93 | ||||
-rw-r--r-- | lib/AST/Stmt.cpp | 4 | ||||
-rw-r--r-- | lib/AST/StmtDumper.cpp | 4 | ||||
-rw-r--r-- | lib/AST/TemplateBase.cpp | 18 |
15 files changed, 397 insertions, 252 deletions
diff --git a/lib/AST/ASTContext.cpp b/lib/AST/ASTContext.cpp index 945dfb87f297..9c2455034d68 100644 --- a/lib/AST/ASTContext.cpp +++ b/lib/AST/ASTContext.cpp @@ -205,7 +205,7 @@ ASTContext::ASTContext(const LangOptions& LOpts, SourceManager &SM, DeclarationNames(*this), ExternalSource(0), Listener(0), PrintingPolicy(LOpts), LastSDM(0, 0), - UniqueBlockByRefTypeID(0), UniqueBlockParmTypeID(0) { + UniqueBlockByRefTypeID(0) { ObjCIdRedefinitionType = QualType(); ObjCClassRedefinitionType = QualType(); ObjCSelRedefinitionType = QualType(); @@ -874,7 +874,7 @@ ASTContext::getTypeInfo(const Type *T) const { case Type::Auto: { const AutoType *A = cast<AutoType>(T); assert(A->isDeduced() && "Cannot request the size of a dependent type"); - return getTypeInfo(cast<AutoType>(T)->getDeducedType().getTypePtr()); + return getTypeInfo(A->getDeducedType().getTypePtr()); } case Type::Paren: @@ -2683,12 +2683,22 @@ QualType ASTContext::getDecltypeType(Expr *e) const { return QualType(dt, 0); } -/// getAutoType - Unlike many "get<Type>" functions, we don't unique -/// AutoType AST's. +/// getAutoType - We only unique auto types after they've been deduced. QualType ASTContext::getAutoType(QualType DeducedType) const { - AutoType *at = new (*this, TypeAlignment) AutoType(DeducedType); - Types.push_back(at); - return QualType(at, 0); + void *InsertPos = 0; + if (!DeducedType.isNull()) { + // Look in the folding set for an existing type. + llvm::FoldingSetNodeID ID; + AutoType::Profile(ID, DeducedType); + if (AutoType *AT = AutoTypes.FindNodeOrInsertPos(ID, InsertPos)) + return QualType(AT, 0); + } + + AutoType *AT = new (*this, TypeAlignment) AutoType(DeducedType); + Types.push_back(AT); + if (InsertPos) + AutoTypes.InsertNode(AT, InsertPos); + return QualType(AT, 0); } /// getTagDeclType - Return the unique reference to the type for the @@ -2971,7 +2981,15 @@ ASTContext::getCanonicalNestedNameSpecifier(NestedNameSpecifier *NNS) const { case NestedNameSpecifier::Namespace: // A namespace is canonical; build a nested-name-specifier with // this namespace and no prefix. - return NestedNameSpecifier::Create(*this, 0, NNS->getAsNamespace()); + return NestedNameSpecifier::Create(*this, 0, + NNS->getAsNamespace()->getOriginalNamespace()); + + case NestedNameSpecifier::NamespaceAlias: + // A namespace is canonical; build a nested-name-specifier with + // this namespace and no prefix. + return NestedNameSpecifier::Create(*this, 0, + NNS->getAsNamespaceAlias()->getNamespace() + ->getOriginalNamespace()); case NestedNameSpecifier::TypeSpec: case NestedNameSpecifier::TypeSpecWithTemplate: { @@ -3609,78 +3627,6 @@ ASTContext::BuildByRefType(llvm::StringRef DeclName, QualType Ty) const { return getPointerType(getTagDeclType(T)); } - -QualType ASTContext::getBlockParmType( - bool BlockHasCopyDispose, - llvm::SmallVectorImpl<const Expr *> &Layout) const { - - // FIXME: Move up - llvm::SmallString<36> Name; - llvm::raw_svector_ostream(Name) << "__block_literal_" - << ++UniqueBlockParmTypeID; - RecordDecl *T; - T = CreateRecordDecl(*this, TTK_Struct, TUDecl, SourceLocation(), - &Idents.get(Name.str())); - T->startDefinition(); - QualType FieldTypes[] = { - getPointerType(VoidPtrTy), - IntTy, - IntTy, - getPointerType(VoidPtrTy), - (BlockHasCopyDispose ? - getPointerType(getBlockDescriptorExtendedType()) : - getPointerType(getBlockDescriptorType())) - }; - - const char *FieldNames[] = { - "__isa", - "__flags", - "__reserved", - "__FuncPtr", - "__descriptor" - }; - - for (size_t i = 0; i < 5; ++i) { - FieldDecl *Field = FieldDecl::Create(*this, T, SourceLocation(), - &Idents.get(FieldNames[i]), - FieldTypes[i], /*TInfo=*/0, - /*BitWidth=*/0, /*Mutable=*/false); - Field->setAccess(AS_public); - T->addDecl(Field); - } - - for (unsigned i = 0; i < Layout.size(); ++i) { - const Expr *E = Layout[i]; - - QualType FieldType = E->getType(); - IdentifierInfo *FieldName = 0; - if (isa<CXXThisExpr>(E)) { - FieldName = &Idents.get("this"); - } else if (const BlockDeclRefExpr *BDRE = dyn_cast<BlockDeclRefExpr>(E)) { - const ValueDecl *D = BDRE->getDecl(); - FieldName = D->getIdentifier(); - if (BDRE->isByRef()) - FieldType = BuildByRefType(D->getName(), FieldType); - } else { - // Padding. - assert(isa<ConstantArrayType>(FieldType) && - isa<DeclRefExpr>(E) && - !cast<DeclRefExpr>(E)->getDecl()->getDeclName() && - "doesn't match characteristics of padding decl"); - } - - FieldDecl *Field = FieldDecl::Create(*this, T, SourceLocation(), - FieldName, FieldType, /*TInfo=*/0, - /*BitWidth=*/0, /*Mutable=*/false); - Field->setAccess(AS_public); - T->addDecl(Field); - } - - T->completeDefinition(); - - return getPointerType(getTagDeclType(T)); -} - void ASTContext::setObjCFastEnumerationStateType(QualType T) { const RecordType *Rec = T->getAs<RecordType>(); assert(Rec && "Invalid ObjCFAstEnumerationStateType"); diff --git a/lib/AST/ASTImporter.cpp b/lib/AST/ASTImporter.cpp index 65c0a3bb619f..21f10fb7ad99 100644 --- a/lib/AST/ASTImporter.cpp +++ b/lib/AST/ASTImporter.cpp @@ -2097,11 +2097,7 @@ Decl *ASTNodeImporter::VisitEnumDecl(EnumDecl *D) { D->isScoped(), D->isScopedUsingClassTag(), D->isFixed()); // Import the qualifier, if any. - if (D->getQualifier()) { - NestedNameSpecifier *NNS = Importer.Import(D->getQualifier()); - SourceRange NNSRange = Importer.Import(D->getQualifierRange()); - D2->setQualifierInfo(NNS, NNSRange); - } + D2->setQualifierInfo(Importer.Import(D->getQualifierLoc())); D2->setAccess(D->getAccess()); D2->setLexicalDeclContext(LexicalDC); Importer.Imported(D, D2); @@ -2225,12 +2221,8 @@ Decl *ASTNodeImporter::VisitRecordDecl(RecordDecl *D) { Name.getAsIdentifierInfo(), Importer.Import(D->getTagKeywordLoc())); } - // Import the qualifier, if any. - if (D->getQualifier()) { - NestedNameSpecifier *NNS = Importer.Import(D->getQualifier()); - SourceRange NNSRange = Importer.Import(D->getQualifierRange()); - D2->setQualifierInfo(NNS, NNSRange); - } + + D2->setQualifierInfo(Importer.Import(D->getQualifierLoc())); D2->setLexicalDeclContext(LexicalDC); LexicalDC->addDecl(D2); } @@ -2408,11 +2400,7 @@ Decl *ASTNodeImporter::VisitFunctionDecl(FunctionDecl *D) { } // Import the qualifier, if any. - if (D->getQualifier()) { - NestedNameSpecifier *NNS = Importer.Import(D->getQualifier()); - SourceRange NNSRange = Importer.Import(D->getQualifierRange()); - ToFunction->setQualifierInfo(NNS, NNSRange); - } + ToFunction->setQualifierInfo(Importer.Import(D->getQualifierLoc())); ToFunction->setAccess(D->getAccess()); ToFunction->setLexicalDeclContext(LexicalDC); ToFunction->setVirtualAsWritten(D->isVirtualAsWritten()); @@ -2666,12 +2654,7 @@ Decl *ASTNodeImporter::VisitVarDecl(VarDecl *D) { Name.getAsIdentifierInfo(), T, TInfo, D->getStorageClass(), D->getStorageClassAsWritten()); - // Import the qualifier, if any. - if (D->getQualifier()) { - NestedNameSpecifier *NNS = Importer.Import(D->getQualifier()); - SourceRange NNSRange = Importer.Import(D->getQualifierRange()); - ToVar->setQualifierInfo(NNS, NNSRange); - } + ToVar->setQualifierInfo(Importer.Import(D->getQualifierLoc())); ToVar->setAccess(D->getAccess()); ToVar->setLexicalDeclContext(LexicalDC); Importer.Imported(D, ToVar); @@ -3591,14 +3574,7 @@ Decl *ASTNodeImporter::VisitClassTemplateDecl(ClassTemplateDecl *D) { Name.getAsIdentifierInfo(), Importer.Import(DTemplated->getTagKeywordLoc())); D2Templated->setAccess(DTemplated->getAccess()); - - - // Import the qualifier, if any. - if (DTemplated->getQualifier()) { - NestedNameSpecifier *NNS = Importer.Import(DTemplated->getQualifier()); - SourceRange NNSRange = Importer.Import(DTemplated->getQualifierRange()); - D2Templated->setQualifierInfo(NNS, NNSRange); - } + D2Templated->setQualifierInfo(Importer.Import(DTemplated->getQualifierLoc())); D2Templated->setLexicalDeclContext(LexicalDC); // Create the class template declaration itself. @@ -3703,12 +3679,7 @@ Decl *ASTNodeImporter::VisitClassTemplateSpecializationDecl( ClassTemplate->AddSpecialization(D2, InsertPos); // Import the qualifier, if any. - if (D->getQualifier()) { - NestedNameSpecifier *NNS = Importer.Import(D->getQualifier()); - SourceRange NNSRange = Importer.Import(D->getQualifierRange()); - D2->setQualifierInfo(NNS, NNSRange); - } - + D2->setQualifierInfo(Importer.Import(D->getQualifierLoc())); // Add the specialization to this context. D2->setLexicalDeclContext(LexicalDC); @@ -4067,6 +4038,11 @@ NestedNameSpecifier *ASTImporter::Import(NestedNameSpecifier *FromNNS) { return 0; } +NestedNameSpecifierLoc ASTImporter::Import(NestedNameSpecifierLoc FromNNS) { + // FIXME: Implement! + return NestedNameSpecifierLoc(); +} + TemplateName ASTImporter::Import(TemplateName From) { switch (From.getKind()) { case TemplateName::Template: diff --git a/lib/AST/Decl.cpp b/lib/AST/Decl.cpp index 56db8c7e330b..73fe117b1e4e 100644 --- a/lib/AST/Decl.cpp +++ b/lib/AST/Decl.cpp @@ -266,8 +266,12 @@ static LinkageInfo getLVForNamespaceScopeDecl(const NamedDecl *D, LVFlags F) { return LinkageInfo::internal(); } - if (D->isInAnonymousNamespace()) - return LinkageInfo::uniqueExternal(); + if (D->isInAnonymousNamespace()) { + const VarDecl *Var = dyn_cast<VarDecl>(D); + const FunctionDecl *Func = dyn_cast<FunctionDecl>(D); + if ((!Var || !Var->isExternC()) && (!Func || !Func->isExternC())) + return LinkageInfo::uniqueExternal(); + } // Set up the defaults. @@ -704,7 +708,7 @@ static LinkageInfo getLVForDecl(const NamedDecl *D, LVFlags Flags) { // external linkage. if (D->getLexicalDeclContext()->isFunctionOrMethod()) { if (const FunctionDecl *Function = dyn_cast<FunctionDecl>(D)) { - if (Function->isInAnonymousNamespace()) + if (Function->isInAnonymousNamespace() && !Function->isExternC()) return LinkageInfo::uniqueExternal(); LinkageInfo LV; @@ -725,7 +729,7 @@ static LinkageInfo getLVForDecl(const NamedDecl *D, LVFlags Flags) { if (const VarDecl *Var = dyn_cast<VarDecl>(D)) if (Var->getStorageClass() == SC_Extern || Var->getStorageClass() == SC_PrivateExtern) { - if (Var->isInAnonymousNamespace()) + if (Var->isInAnonymousNamespace() && !Var->isExternC()) return LinkageInfo::uniqueExternal(); LinkageInfo LV; @@ -837,8 +841,10 @@ bool NamedDecl::declarationReplaces(NamedDecl *OldD) const { // UsingDirectiveDecl's are not really NamedDecl's, and all have same name. // We want to keep it, unless it nominates same namespace. if (getKind() == Decl::UsingDirective) { - return cast<UsingDirectiveDecl>(this)->getNominatedNamespace() == - cast<UsingDirectiveDecl>(OldD)->getNominatedNamespace(); + return cast<UsingDirectiveDecl>(this)->getNominatedNamespace() + ->getOriginalNamespace() == + cast<UsingDirectiveDecl>(OldD)->getNominatedNamespace() + ->getOriginalNamespace(); } if (const FunctionDecl *FD = dyn_cast<FunctionDecl>(this)) @@ -864,9 +870,13 @@ bool NamedDecl::declarationReplaces(NamedDecl *OldD) const { return cast<UsingShadowDecl>(this)->getTargetDecl() == cast<UsingShadowDecl>(OldD)->getTargetDecl(); - if (isa<UsingDecl>(this) && isa<UsingDecl>(OldD)) - return cast<UsingDecl>(this)->getTargetNestedNameDecl() == - cast<UsingDecl>(OldD)->getTargetNestedNameDecl(); + if (isa<UsingDecl>(this) && isa<UsingDecl>(OldD)) { + ASTContext &Context = getASTContext(); + return Context.getCanonicalNestedNameSpecifier( + cast<UsingDecl>(this)->getQualifier()) == + Context.getCanonicalNestedNameSpecifier( + cast<UsingDecl>(OldD)->getQualifier()); + } // For non-function declarations, if the declarations are of the // same kind then this must be a redeclaration, or semantic analysis @@ -927,9 +937,8 @@ SourceLocation DeclaratorDecl::getTypeSpecStartLoc() const { return SourceLocation(); } -void DeclaratorDecl::setQualifierInfo(NestedNameSpecifier *Qualifier, - SourceRange QualifierRange) { - if (Qualifier) { +void DeclaratorDecl::setQualifierInfo(NestedNameSpecifierLoc QualifierLoc) { + if (QualifierLoc) { // Make sure the extended decl info is allocated. if (!hasExtInfo()) { // Save (non-extended) type source info pointer. @@ -940,12 +949,10 @@ void DeclaratorDecl::setQualifierInfo(NestedNameSpecifier *Qualifier, getExtInfo()->TInfo = savedTInfo; } // Set qualifier info. - getExtInfo()->NNS = Qualifier; - getExtInfo()->NNSRange = QualifierRange; + getExtInfo()->QualifierLoc = QualifierLoc; } else { // Here Qualifier == 0, i.e., we are removing the qualifier (if any). - assert(QualifierRange.isInvalid()); if (hasExtInfo()) { // Save type source info pointer. TypeSourceInfo *savedTInfo = getExtInfo()->TInfo; @@ -967,7 +974,7 @@ QualifierInfo::setTemplateParameterListsInfo(ASTContext &Context, TemplateParameterList **TPLists) { assert((NumTPLists == 0 || TPLists != 0) && "Empty array of template parameters with positive size!"); - assert((NumTPLists == 0 || NNS) && + assert((NumTPLists == 0 || QualifierLoc) && "Nonempty array of template parameters with no qualifier!"); // Free previous template parameters (if any). @@ -1037,8 +1044,11 @@ bool VarDecl::isExternC() const { getStorageClass() != SC_Static) || (getDeclContext()->isFunctionOrMethod() && hasExternalStorage()); - for (const DeclContext *DC = getDeclContext(); !DC->isTranslationUnit(); - DC = DC->getParent()) { + const DeclContext *DC = getDeclContext(); + if (DC->isFunctionOrMethod()) + return false; + + for (; !DC->isTranslationUnit(); DC = DC->getParent()) { if (const LinkageSpecDecl *Linkage = dyn_cast<LinkageSpecDecl>(DC)) { if (Linkage->getLanguage() == LinkageSpecDecl::lang_c) return getStorageClass() != SC_Static; @@ -1046,8 +1056,6 @@ bool VarDecl::isExternC() const { break; } - if (DC->isFunctionOrMethod()) - return false; } return false; @@ -1363,8 +1371,11 @@ bool FunctionDecl::isExternC() const { if (!Context.getLangOptions().CPlusPlus) return getStorageClass() != SC_Static && !getAttr<OverloadableAttr>(); - for (const DeclContext *DC = getDeclContext(); !DC->isTranslationUnit(); - DC = DC->getParent()) { + const DeclContext *DC = getDeclContext(); + if (DC->isRecord()) + return false; + + for (; !DC->isTranslationUnit(); DC = DC->getParent()) { if (const LinkageSpecDecl *Linkage = dyn_cast<LinkageSpecDecl>(DC)) { if (Linkage->getLanguage() == LinkageSpecDecl::lang_c) return getStorageClass() != SC_Static && @@ -1372,9 +1383,6 @@ bool FunctionDecl::isExternC() const { break; } - - if (DC->isRecord()) - break; } return isMain(); @@ -2018,19 +2026,16 @@ TagDecl* TagDecl::getDefinition() const { return 0; } -void TagDecl::setQualifierInfo(NestedNameSpecifier *Qualifier, - SourceRange QualifierRange) { - if (Qualifier) { +void TagDecl::setQualifierInfo(NestedNameSpecifierLoc QualifierLoc) { + if (QualifierLoc) { // Make sure the extended qualifier info is allocated. if (!hasExtInfo()) TypedefDeclOrQualifier = new (getASTContext()) ExtInfo; // Set qualifier info. - getExtInfo()->NNS = Qualifier; - getExtInfo()->NNSRange = QualifierRange; + getExtInfo()->QualifierLoc = QualifierLoc; } else { // Here Qualifier == 0, i.e., we are removing the qualifier (if any). - assert(QualifierRange.isInvalid()); if (hasExtInfo()) { getASTContext().Deallocate(getExtInfo()); TypedefDeclOrQualifier = (TypedefDecl*) 0; @@ -2211,8 +2216,10 @@ NamespaceDecl *NamespaceDecl::getNextNamespace() { } ImplicitParamDecl *ImplicitParamDecl::Create(ASTContext &C, DeclContext *DC, - SourceLocation L, IdentifierInfo *Id, QualType T) { - return new (C) ImplicitParamDecl(ImplicitParam, DC, L, Id, T); + SourceLocation loc, + IdentifierInfo *name, + QualType type) { + return new (C) ImplicitParamDecl(DC, loc, name, type); } FunctionDecl *FunctionDecl::Create(ASTContext &C, DeclContext *DC, diff --git a/lib/AST/DeclBase.cpp b/lib/AST/DeclBase.cpp index be379d522dd4..81df00d6c7e8 100644 --- a/lib/AST/DeclBase.cpp +++ b/lib/AST/DeclBase.cpp @@ -465,6 +465,22 @@ void Decl::CheckAccessDeclContext() const { #endif } +DeclContext *Decl::getNonClosureContext() { + DeclContext *DC = getDeclContext(); + + // This is basically "while (DC->isClosure()) DC = DC->getParent();" + // except that it's significantly more efficient to cast to a known + // decl type and call getDeclContext() than to call getParent(). + do { + if (isa<BlockDecl>(DC)) { + DC = cast<BlockDecl>(DC)->getDeclContext(); + continue; + } + } while (false); + + assert(!DC->isClosure()); + return DC; +} //===----------------------------------------------------------------------===// // DeclContext Implementation diff --git a/lib/AST/DeclCXX.cpp b/lib/AST/DeclCXX.cpp index fba73f59d563..46768c12d879 100644 --- a/lib/AST/DeclCXX.cpp +++ b/lib/AST/DeclCXX.cpp @@ -1267,15 +1267,14 @@ LinkageSpecDecl *LinkageSpecDecl::Create(ASTContext &C, UsingDirectiveDecl *UsingDirectiveDecl::Create(ASTContext &C, DeclContext *DC, SourceLocation L, SourceLocation NamespaceLoc, - SourceRange QualifierRange, - NestedNameSpecifier *Qualifier, + NestedNameSpecifierLoc QualifierLoc, SourceLocation IdentLoc, NamedDecl *Used, DeclContext *CommonAncestor) { if (NamespaceDecl *NS = dyn_cast_or_null<NamespaceDecl>(Used)) Used = NS->getOriginalNamespace(); - return new (C) UsingDirectiveDecl(DC, L, NamespaceLoc, QualifierRange, - Qualifier, IdentLoc, Used, CommonAncestor); + return new (C) UsingDirectiveDecl(DC, L, NamespaceLoc, QualifierLoc, + IdentLoc, Used, CommonAncestor); } NamespaceDecl *UsingDirectiveDecl::getNominatedNamespace() { @@ -1289,14 +1288,13 @@ NamespaceAliasDecl *NamespaceAliasDecl::Create(ASTContext &C, DeclContext *DC, SourceLocation UsingLoc, SourceLocation AliasLoc, IdentifierInfo *Alias, - SourceRange QualifierRange, - NestedNameSpecifier *Qualifier, + NestedNameSpecifierLoc QualifierLoc, SourceLocation IdentLoc, NamedDecl *Namespace) { if (NamespaceDecl *NS = dyn_cast_or_null<NamespaceDecl>(Namespace)) Namespace = NS->getOriginalNamespace(); - return new (C) NamespaceAliasDecl(DC, UsingLoc, AliasLoc, Alias, QualifierRange, - Qualifier, IdentLoc, Namespace); + return new (C) NamespaceAliasDecl(DC, UsingLoc, AliasLoc, Alias, + QualifierLoc, IdentLoc, Namespace); } UsingDecl *UsingShadowDecl::getUsingDecl() const { @@ -1337,35 +1335,31 @@ void UsingDecl::removeShadowDecl(UsingShadowDecl *S) { S->UsingOrNextShadow = this; } -UsingDecl *UsingDecl::Create(ASTContext &C, DeclContext *DC, - SourceRange NNR, SourceLocation UL, - NestedNameSpecifier* TargetNNS, +UsingDecl *UsingDecl::Create(ASTContext &C, DeclContext *DC, SourceLocation UL, + NestedNameSpecifierLoc QualifierLoc, const DeclarationNameInfo &NameInfo, bool IsTypeNameArg) { - return new (C) UsingDecl(DC, NNR, UL, TargetNNS, NameInfo, IsTypeNameArg); + return new (C) UsingDecl(DC, UL, QualifierLoc, NameInfo, IsTypeNameArg); } UnresolvedUsingValueDecl * UnresolvedUsingValueDecl::Create(ASTContext &C, DeclContext *DC, SourceLocation UsingLoc, - SourceRange TargetNNR, - NestedNameSpecifier *TargetNNS, + NestedNameSpecifierLoc QualifierLoc, const DeclarationNameInfo &NameInfo) { return new (C) UnresolvedUsingValueDecl(DC, C.DependentTy, UsingLoc, - TargetNNR, TargetNNS, NameInfo); + QualifierLoc, NameInfo); } UnresolvedUsingTypenameDecl * UnresolvedUsingTypenameDecl::Create(ASTContext &C, DeclContext *DC, SourceLocation UsingLoc, SourceLocation TypenameLoc, - SourceRange TargetNNR, - NestedNameSpecifier *TargetNNS, + NestedNameSpecifierLoc QualifierLoc, SourceLocation TargetNameLoc, DeclarationName TargetName) { return new (C) UnresolvedUsingTypenameDecl(DC, UsingLoc, TypenameLoc, - TargetNNR, TargetNNS, - TargetNameLoc, + QualifierLoc, TargetNameLoc, TargetName.getAsIdentifierInfo()); } diff --git a/lib/AST/DeclPrinter.cpp b/lib/AST/DeclPrinter.cpp index 77b42574709f..c6ae128e42b5 100644 --- a/lib/AST/DeclPrinter.cpp +++ b/lib/AST/DeclPrinter.cpp @@ -918,20 +918,20 @@ void DeclPrinter::VisitObjCPropertyImplDecl(ObjCPropertyImplDecl *PID) { void DeclPrinter::VisitUsingDecl(UsingDecl *D) { Out << "using "; - D->getTargetNestedNameDecl()->print(Out, Policy); + D->getQualifier()->print(Out, Policy); Out << D; } void DeclPrinter::VisitUnresolvedUsingTypenameDecl(UnresolvedUsingTypenameDecl *D) { Out << "using typename "; - D->getTargetNestedNameSpecifier()->print(Out, Policy); + D->getQualifier()->print(Out, Policy); Out << D->getDeclName(); } void DeclPrinter::VisitUnresolvedUsingValueDecl(UnresolvedUsingValueDecl *D) { Out << "using "; - D->getTargetNestedNameSpecifier()->print(Out, Policy); + D->getQualifier()->print(Out, Policy); Out << D->getDeclName(); } diff --git a/lib/AST/Expr.cpp b/lib/AST/Expr.cpp index 391b26ab48ea..1c1061b5a229 100644 --- a/lib/AST/Expr.cpp +++ b/lib/AST/Expr.cpp @@ -836,6 +836,19 @@ QualType CallExpr::getCallReturnType() const { return FnType->getResultType(); } +SourceRange CallExpr::getSourceRange() const { + if (isa<CXXOperatorCallExpr>(this)) + return cast<CXXOperatorCallExpr>(this)->getSourceRange(); + + SourceLocation begin = getCallee()->getLocStart(); + if (begin.isInvalid() && getNumArgs() > 0) + begin = getArg(0)->getLocStart(); + SourceLocation end = getRParenLoc(); + if (end.isInvalid() && getNumArgs() > 0) + end = getArg(getNumArgs() - 1)->getLocEnd(); + return SourceRange(begin, end); +} + OffsetOfExpr *OffsetOfExpr::Create(ASTContext &C, QualType type, SourceLocation OperatorLoc, TypeSourceInfo *tsi, diff --git a/lib/AST/ExprCXX.cpp b/lib/AST/ExprCXX.cpp index 28ff9fb57afc..4f4a6b4944d9 100644 --- a/lib/AST/ExprCXX.cpp +++ b/lib/AST/ExprCXX.cpp @@ -128,10 +128,10 @@ PseudoDestructorTypeStorage::PseudoDestructorTypeStorage(TypeSourceInfo *Info) } CXXPseudoDestructorExpr::CXXPseudoDestructorExpr(ASTContext &Context, - Expr *Base, bool isArrow, SourceLocation OperatorLoc, - NestedNameSpecifier *Qualifier, SourceRange QualifierRange, - TypeSourceInfo *ScopeType, SourceLocation ColonColonLoc, - SourceLocation TildeLoc, PseudoDestructorTypeStorage DestroyedType) + Expr *Base, bool isArrow, SourceLocation OperatorLoc, + NestedNameSpecifierLoc QualifierLoc, TypeSourceInfo *ScopeType, + SourceLocation ColonColonLoc, SourceLocation TildeLoc, + PseudoDestructorTypeStorage DestroyedType) : Expr(CXXPseudoDestructorExprClass, Context.getPointerType(Context.getFunctionType(Context.VoidTy, 0, 0, FunctionProtoType::ExtProtoInfo())), @@ -142,15 +142,16 @@ CXXPseudoDestructorExpr::CXXPseudoDestructorExpr(ASTContext &Context, /*isValueDependent=*/Base->isValueDependent(), // ContainsUnexpandedParameterPack (Base->containsUnexpandedParameterPack() || - (Qualifier && Qualifier->containsUnexpandedParameterPack()) || + (QualifierLoc && + QualifierLoc.getNestedNameSpecifier() + ->containsUnexpandedParameterPack()) || (ScopeType && ScopeType->getType()->containsUnexpandedParameterPack()) || (DestroyedType.getTypeSourceInfo() && DestroyedType.getTypeSourceInfo()->getType() ->containsUnexpandedParameterPack()))), Base(static_cast<Stmt *>(Base)), IsArrow(isArrow), - OperatorLoc(OperatorLoc), Qualifier(Qualifier), - QualifierRange(QualifierRange), + OperatorLoc(OperatorLoc), QualifierLoc(QualifierLoc), ScopeType(ScopeType), ColonColonLoc(ColonColonLoc), TildeLoc(TildeLoc), DestroyedType(DestroyedType) { } @@ -282,15 +283,16 @@ CXXRecordDecl *OverloadExpr::getNamingClass() const { // DependentScopeDeclRefExpr DependentScopeDeclRefExpr::DependentScopeDeclRefExpr(QualType T, - NestedNameSpecifier *Qualifier, - SourceRange QualifierRange, + NestedNameSpecifierLoc QualifierLoc, const DeclarationNameInfo &NameInfo, const TemplateArgumentListInfo *Args) : Expr(DependentScopeDeclRefExprClass, T, VK_LValue, OK_Ordinary, true, true, (NameInfo.containsUnexpandedParameterPack() || - (Qualifier && Qualifier->containsUnexpandedParameterPack()))), - NameInfo(NameInfo), QualifierRange(QualifierRange), Qualifier(Qualifier), + (QualifierLoc && + QualifierLoc.getNestedNameSpecifier() + ->containsUnexpandedParameterPack()))), + QualifierLoc(QualifierLoc), NameInfo(NameInfo), HasExplicitTemplateArgs(Args != 0) { if (Args) { @@ -306,16 +308,14 @@ DependentScopeDeclRefExpr::DependentScopeDeclRefExpr(QualType T, DependentScopeDeclRefExpr * DependentScopeDeclRefExpr::Create(ASTContext &C, - NestedNameSpecifier *Qualifier, - SourceRange QualifierRange, + NestedNameSpecifierLoc QualifierLoc, const DeclarationNameInfo &NameInfo, const TemplateArgumentListInfo *Args) { std::size_t size = sizeof(DependentScopeDeclRefExpr); if (Args) size += ExplicitTemplateArgumentList::sizeFor(*Args); void *Mem = C.Allocate(size); - return new (Mem) DependentScopeDeclRefExpr(C.DependentTy, - Qualifier, QualifierRange, + return new (Mem) DependentScopeDeclRefExpr(C.DependentTy, QualifierLoc, NameInfo, Args); } @@ -328,13 +328,16 @@ DependentScopeDeclRefExpr::CreateEmpty(ASTContext &C, size += ExplicitTemplateArgumentList::sizeFor(NumTemplateArgs); void *Mem = C.Allocate(size); DependentScopeDeclRefExpr *E - = new (Mem) DependentScopeDeclRefExpr(QualType(), 0, SourceRange(), + = new (Mem) DependentScopeDeclRefExpr(QualType(), NestedNameSpecifierLoc(), DeclarationNameInfo(), 0); E->HasExplicitTemplateArgs = HasExplicitTemplateArgs; return E; } SourceRange CXXConstructExpr::getSourceRange() const { + if (isa<CXXTemporaryObjectExpr>(this)) + return cast<CXXTemporaryObjectExpr>(this)->getSourceRange(); + if (ParenRange.isValid()) return SourceRange(Loc, ParenRange.getEnd()); @@ -397,13 +400,6 @@ CXXRecordDecl *CXXMemberCallExpr::getRecordDecl() { return ThisArg->getType()->getAsCXXRecordDecl(); } -SourceRange CXXMemberCallExpr::getSourceRange() const { - SourceLocation LocStart = getCallee()->getLocStart(); - if (LocStart.isInvalid() && getNumArgs() > 0) - LocStart = getArg(0)->getLocStart(); - return SourceRange(LocStart, getRParenLoc()); -} - //===----------------------------------------------------------------------===// // Named casts diff --git a/lib/AST/ExprConstant.cpp b/lib/AST/ExprConstant.cpp index 656bb99df98e..3a5eb66ea18f 100644 --- a/lib/AST/ExprConstant.cpp +++ b/lib/AST/ExprConstant.cpp @@ -2926,7 +2926,7 @@ static ICEDiag CheckICE(const Expr* E, ASTContext &Ctx) { Exp->getOpcode() == BO_Rem) { // Evaluate gives an error for undefined Div/Rem, so make sure // we don't evaluate one. - if (LHSResult.Val != 2 && RHSResult.Val != 2) { + if (LHSResult.Val == 0 && RHSResult.Val == 0) { llvm::APSInt REval = Exp->getRHS()->EvaluateAsInt(Ctx); if (REval == 0) return ICEDiag(1, E->getLocStart()); diff --git a/lib/AST/ItaniumMangle.cpp b/lib/AST/ItaniumMangle.cpp index d66c374cbec0..939ca7a924aa 100644 --- a/lib/AST/ItaniumMangle.cpp +++ b/lib/AST/ItaniumMangle.cpp @@ -606,6 +606,9 @@ void CXXNameMangler::mangleUnresolvedScope(NestedNameSpecifier *Qualifier) { case NestedNameSpecifier::Namespace: mangleName(Qualifier->getAsNamespace()); break; + case NestedNameSpecifier::NamespaceAlias: + mangleName(Qualifier->getAsNamespaceAlias()->getNamespace()); + break; case NestedNameSpecifier::TypeSpec: case NestedNameSpecifier::TypeSpecWithTemplate: { const Type *QTy = Qualifier->getAsType(); @@ -1647,8 +1650,11 @@ void CXXNameMangler::mangleType(const DecltypeType *T) { void CXXNameMangler::mangleType(const AutoType *T) { QualType D = T->getDeducedType(); - assert(!D.isNull() && "can't mangle undeduced auto type"); - mangleType(D); + // <builtin-type> ::= Da # dependent auto + if (D.isNull()) + Out << "Da"; + else + mangleType(D); } void CXXNameMangler::mangleIntegerLiteral(QualType T, diff --git a/lib/AST/NestedNameSpecifier.cpp b/lib/AST/NestedNameSpecifier.cpp index 650321d76ee5..6f1ec058d74e 100644 --- a/lib/AST/NestedNameSpecifier.cpp +++ b/lib/AST/NestedNameSpecifier.cpp @@ -14,8 +14,10 @@ #include "clang/AST/NestedNameSpecifier.h" #include "clang/AST/ASTContext.h" #include "clang/AST/Decl.h" +#include "clang/AST/DeclCXX.h" #include "clang/AST/PrettyPrinter.h" #include "clang/AST/Type.h" +#include "clang/AST/TypeLoc.h" #include "llvm/Support/raw_ostream.h" #include <cassert> @@ -46,7 +48,7 @@ NestedNameSpecifier::Create(const ASTContext &Context, NestedNameSpecifier Mockup; Mockup.Prefix.setPointer(Prefix); - Mockup.Prefix.setInt(Identifier); + Mockup.Prefix.setInt(StoredIdentifier); Mockup.Specifier = II; return FindOrInsert(Context, Mockup); } @@ -60,19 +62,34 @@ NestedNameSpecifier::Create(const ASTContext &Context, "Broken nested name specifier"); NestedNameSpecifier Mockup; Mockup.Prefix.setPointer(Prefix); - Mockup.Prefix.setInt(Namespace); + Mockup.Prefix.setInt(StoredNamespaceOrAlias); Mockup.Specifier = NS; return FindOrInsert(Context, Mockup); } NestedNameSpecifier * NestedNameSpecifier::Create(const ASTContext &Context, + NestedNameSpecifier *Prefix, + NamespaceAliasDecl *Alias) { + assert(Alias && "Namespace alias cannot be NULL"); + assert((!Prefix || + (Prefix->getAsType() == 0 && Prefix->getAsIdentifier() == 0)) && + "Broken nested name specifier"); + NestedNameSpecifier Mockup; + Mockup.Prefix.setPointer(Prefix); + Mockup.Prefix.setInt(StoredNamespaceOrAlias); + Mockup.Specifier = Alias; + return FindOrInsert(Context, Mockup); +} + +NestedNameSpecifier * +NestedNameSpecifier::Create(const ASTContext &Context, NestedNameSpecifier *Prefix, bool Template, const Type *T) { assert(T && "Type cannot be NULL"); NestedNameSpecifier Mockup; Mockup.Prefix.setPointer(Prefix); - Mockup.Prefix.setInt(Template? TypeSpecWithTemplate : TypeSpec); + Mockup.Prefix.setInt(Template? StoredTypeSpecWithTemplate : StoredTypeSpec); Mockup.Specifier = const_cast<Type*>(T); return FindOrInsert(Context, Mockup); } @@ -82,7 +99,7 @@ NestedNameSpecifier::Create(const ASTContext &Context, IdentifierInfo *II) { assert(II && "Identifier cannot be NULL"); NestedNameSpecifier Mockup; Mockup.Prefix.setPointer(0); - Mockup.Prefix.setInt(Identifier); + Mockup.Prefix.setInt(StoredIdentifier); Mockup.Specifier = II; return FindOrInsert(Context, Mockup); } @@ -94,6 +111,47 @@ NestedNameSpecifier::GlobalSpecifier(const ASTContext &Context) { return Context.GlobalNestedNameSpecifier; } +NestedNameSpecifier::SpecifierKind NestedNameSpecifier::getKind() const { + if (Specifier == 0) + return Global; + + switch (Prefix.getInt()) { + case StoredIdentifier: + return Identifier; + + case StoredNamespaceOrAlias: + return isa<NamespaceDecl>(static_cast<NamedDecl *>(Specifier))? Namespace + : NamespaceAlias; + + case StoredTypeSpec: + return TypeSpec; + + case StoredTypeSpecWithTemplate: + return TypeSpecWithTemplate; + } + + return Global; +} + +/// \brief Retrieve the namespace stored in this nested name +/// specifier. +NamespaceDecl *NestedNameSpecifier::getAsNamespace() const { + if (Prefix.getInt() == StoredNamespaceOrAlias) + return dyn_cast<NamespaceDecl>(static_cast<NamedDecl *>(Specifier)); + + return 0; +} + +/// \brief Retrieve the namespace alias stored in this nested name +/// specifier. +NamespaceAliasDecl *NestedNameSpecifier::getAsNamespaceAlias() const { + if (Prefix.getInt() == StoredNamespaceOrAlias) + return dyn_cast<NamespaceAliasDecl>(static_cast<NamedDecl *>(Specifier)); + + return 0; +} + + /// \brief Whether this nested name specifier refers to a dependent /// type or not. bool NestedNameSpecifier::isDependent() const { @@ -103,6 +161,7 @@ bool NestedNameSpecifier::isDependent() const { return true; case Namespace: + case NamespaceAlias: case Global: return false; @@ -121,6 +180,7 @@ bool NestedNameSpecifier::containsUnexpandedParameterPack() const { return getPrefix() && getPrefix()->containsUnexpandedParameterPack(); case Namespace: + case NamespaceAlias: case Global: return false; @@ -147,7 +207,11 @@ NestedNameSpecifier::print(llvm::raw_ostream &OS, break; case Namespace: - OS << getAsNamespace()->getIdentifier()->getName(); + OS << getAsNamespace()->getName(); + break; + + case NamespaceAlias: + OS << getAsNamespaceAlias()->getName(); break; case Global: @@ -199,3 +263,111 @@ NestedNameSpecifier::print(llvm::raw_ostream &OS, void NestedNameSpecifier::dump(const LangOptions &LO) { print(llvm::errs(), PrintingPolicy(LO)); } + +unsigned +NestedNameSpecifierLoc::getLocalDataLength(NestedNameSpecifier *Qualifier) { + assert(Qualifier && "Expected a non-NULL qualifier"); + + // Location of the trailing '::'. + unsigned Length = sizeof(unsigned); + + switch (Qualifier->getKind()) { + case NestedNameSpecifier::Global: + // Nothing more to add. + break; + + case NestedNameSpecifier::Identifier: + case NestedNameSpecifier::Namespace: + case NestedNameSpecifier::NamespaceAlias: + // The location of the identifier or namespace name. + Length += sizeof(unsigned); + break; + + case NestedNameSpecifier::TypeSpecWithTemplate: + case NestedNameSpecifier::TypeSpec: + // The "void*" that points at the TypeLoc data. + // Note: the 'template' keyword is part of the TypeLoc. + Length += sizeof(void *); + break; + } + + return Length; +} + +unsigned +NestedNameSpecifierLoc::getDataLength(NestedNameSpecifier *Qualifier) { + unsigned Length = 0; + for (; Qualifier; Qualifier = Qualifier->getPrefix()) + Length += getLocalDataLength(Qualifier); + return Length; +} + +namespace { + /// \brief Load a (possibly unaligned) source location from a given address + /// and offset. + SourceLocation LoadSourceLocation(void *Data, unsigned Offset) { + unsigned Raw; + memcpy(&Raw, static_cast<char *>(Data) + Offset, sizeof(unsigned)); + return SourceLocation::getFromRawEncoding(Raw); + } + + /// \brief Load a (possibly unaligned) pointer from a given address and + /// offset. + void *LoadPointer(void *Data, unsigned Offset) { + void *Result; + memcpy(&Result, static_cast<char *>(Data) + Offset, sizeof(void*)); + return Result; + } +} + +SourceRange NestedNameSpecifierLoc::getSourceRange() const { + if (!Qualifier) + return SourceRange(); + + NestedNameSpecifierLoc First = *this; + while (NestedNameSpecifierLoc Prefix = First.getPrefix()) + First = Prefix; + + return SourceRange(First.getLocalSourceRange().getBegin(), + getLocalSourceRange().getEnd()); +} + +SourceRange NestedNameSpecifierLoc::getLocalSourceRange() const { + if (!Qualifier) + return SourceRange(); + + unsigned Offset = getDataLength(Qualifier->getPrefix()); + switch (Qualifier->getKind()) { + case NestedNameSpecifier::Global: + return LoadSourceLocation(Data, Offset); + + case NestedNameSpecifier::Identifier: + case NestedNameSpecifier::Namespace: + case NestedNameSpecifier::NamespaceAlias: + return SourceRange(LoadSourceLocation(Data, Offset), + LoadSourceLocation(Data, Offset + sizeof(unsigned))); + + case NestedNameSpecifier::TypeSpecWithTemplate: + case NestedNameSpecifier::TypeSpec: { + // The "void*" that points at the TypeLoc data. + // Note: the 'template' keyword is part of the TypeLoc. + void *TypeData = LoadPointer(Data, Offset); + TypeLoc TL(Qualifier->getAsType(), TypeData); + return SourceRange(TL.getBeginLoc(), + LoadSourceLocation(Data, Offset + sizeof(void*))); + } + } + + return SourceRange(); +} + +TypeLoc NestedNameSpecifierLoc::getTypeLoc() const { + assert((Qualifier->getKind() == NestedNameSpecifier::TypeSpec || + Qualifier->getKind() == NestedNameSpecifier::TypeSpecWithTemplate) && + "Nested-name-specifier location is not a type"); + + // The "void*" that points at the TypeLoc data. + unsigned Offset = getDataLength(Qualifier->getPrefix()); + void *TypeData = LoadPointer(Data, Offset); + return TypeLoc(Qualifier->getAsType(), TypeData); +} diff --git a/lib/AST/RecordLayoutBuilder.cpp b/lib/AST/RecordLayoutBuilder.cpp index cf14eba1405d..4ed031f97499 100644 --- a/lib/AST/RecordLayoutBuilder.cpp +++ b/lib/AST/RecordLayoutBuilder.cpp @@ -698,6 +698,25 @@ protected: DiagnosticBuilder Diag(SourceLocation Loc, unsigned DiagID); + CharUnits getSize() const { + assert(Size % Context.getCharWidth() == 0); + return Context.toCharUnitsFromBits(Size); + } + uint64_t getSizeInBits() const { return Size; } + + void setSize(CharUnits NewSize) { Size = Context.toBits(NewSize); } + void setSize(uint64_t NewSize) { Size = NewSize; } + + CharUnits getDataSize() const { + assert(DataSize % Context.getCharWidth() == 0); + return Context.toCharUnitsFromBits(DataSize); + } + uint64_t getDataSizeInBits() const { return DataSize; } + + void setDataSize(CharUnits NewSize) { DataSize = Context.toBits(NewSize); } + void setDataSize(uint64_t NewSize) { DataSize = NewSize; } + + RecordLayoutBuilder(const RecordLayoutBuilder&); // DO NOT IMPLEMENT void operator=(const RecordLayoutBuilder&); // DO NOT IMPLEMENT public: @@ -796,8 +815,8 @@ void RecordLayoutBuilder::DeterminePrimaryBase(const CXXRecordDecl *RD) { assert(DataSize == 0 && "Vtable pointer must be at offset zero!"); // Update the size. - Size += GetVirtualPointersSize(RD); - DataSize = Size; + setSize(getSizeInBits() + GetVirtualPointersSize(RD)); + setDataSize(getSizeInBits()); CharUnits UnpackedBaseAlign = Context.toCharUnitsFromBits(Context.Target.getPointerAlign(0)); @@ -1090,7 +1109,7 @@ CharUnits RecordLayoutBuilder::LayoutBase(const BaseSubobjectInfo *Base) { if (Base->Class->isEmpty() && EmptySubobjects->CanPlaceBaseAtOffset(Base, CharUnits::Zero())) { uint64_t RecordSizeInBits = Context.toBits(Layout.getSize()); - Size = std::max(Size, RecordSizeInBits); + setSize(std::max(getSizeInBits(), RecordSizeInBits)); return CharUnits::Zero(); } @@ -1106,7 +1125,7 @@ CharUnits RecordLayoutBuilder::LayoutBase(const BaseSubobjectInfo *Base) { // Round up the current record size to the base's alignment boundary. uint64_t Offset = - llvm::RoundUpToAlignment(DataSize, Context.toBits(BaseAlign)); + llvm::RoundUpToAlignment(getDataSizeInBits(), Context.toBits(BaseAlign)); // Try to place the base. while (!EmptySubobjects->CanPlaceBaseAtOffset(Base, @@ -1115,11 +1134,12 @@ CharUnits RecordLayoutBuilder::LayoutBase(const BaseSubobjectInfo *Base) { if (!Base->Class->isEmpty()) { // Update the data size. - DataSize = Offset + Context.toBits(Layout.getNonVirtualSize()); + setDataSize(Offset + Context.toBits(Layout.getNonVirtualSize())); - Size = std::max(Size, DataSize); + setSize(std::max(getSizeInBits(), getDataSizeInBits())); } else - Size = std::max(Size, Offset + Context.toBits(Layout.getSize())); + setSize(std::max(getSizeInBits(), + Offset + Context.toBits(Layout.getSize()))); // Remember max struct/class alignment. UpdateAlignment(BaseAlign, UnpackedBaseAlign); @@ -1167,7 +1187,8 @@ void RecordLayoutBuilder::Layout(const CXXRecordDecl *RD) { LayoutFields(RD); - NonVirtualSize = Context.toCharUnitsFromBits(Size); + // FIXME: Size isn't always an exact multiple of the char width. Round up? + NonVirtualSize = Context.toCharUnitsFromBits(getSizeInBits()); NonVirtualAlignment = Alignment; // Lay out the virtual bases and add the primary virtual base offsets. @@ -1211,8 +1232,8 @@ void RecordLayoutBuilder::Layout(const ObjCInterfaceDecl *D) { // We start laying out ivars not at the end of the superclass // structure, but at the next byte following the last field. - Size = Context.toBits(SL.getDataSize()); - DataSize = Size; + setSize(SL.getDataSize()); + setDataSize(getSizeInBits()); } InitializeLayout(D); @@ -1270,20 +1291,20 @@ void RecordLayoutBuilder::LayoutWideBitField(uint64_t FieldSize, UnfilledBitsInLastByte = 0; uint64_t FieldOffset; - uint64_t UnpaddedFieldOffset = DataSize - UnfilledBitsInLastByte; + uint64_t UnpaddedFieldOffset = getDataSizeInBits() - UnfilledBitsInLastByte; if (IsUnion) { - DataSize = std::max(DataSize, FieldSize); + setDataSize(std::max(getDataSizeInBits(), FieldSize)); FieldOffset = 0; } else { // The bitfield is allocated starting at the next offset aligned appropriately // for T', with length n bits. - FieldOffset = llvm::RoundUpToAlignment(DataSize, TypeAlign); + FieldOffset = llvm::RoundUpToAlignment(getDataSizeInBits(), TypeAlign); uint64_t NewSizeInBits = FieldOffset + FieldSize; - DataSize = llvm::RoundUpToAlignment(NewSizeInBits, 8); - UnfilledBitsInLastByte = DataSize - NewSizeInBits; + setDataSize(llvm::RoundUpToAlignment(NewSizeInBits, 8)); + UnfilledBitsInLastByte = getDataSizeInBits() - NewSizeInBits; } // Place this field at the current location. @@ -1293,7 +1314,7 @@ void RecordLayoutBuilder::LayoutWideBitField(uint64_t FieldSize, TypeAlign, FieldPacked, D); // Update the size. - Size = std::max(Size, DataSize); + setSize(std::max(getSizeInBits(), getDataSizeInBits())); // Remember max struct/class alignment. UpdateAlignment(Context.toCharUnitsFromBits(TypeAlign)); @@ -1301,7 +1322,7 @@ void RecordLayoutBuilder::LayoutWideBitField(uint64_t FieldSize, void RecordLayoutBuilder::LayoutBitField(const FieldDecl *D) { bool FieldPacked = Packed || D->hasAttr<PackedAttr>(); - uint64_t UnpaddedFieldOffset = DataSize - UnfilledBitsInLastByte; + uint64_t UnpaddedFieldOffset = getDataSizeInBits() - UnfilledBitsInLastByte; uint64_t FieldOffset = IsUnion ? 0 : UnpaddedFieldOffset; uint64_t FieldSize = D->getBitWidth()->EvaluateAsInt(Context).getZExtValue(); @@ -1355,16 +1376,16 @@ void RecordLayoutBuilder::LayoutBitField(const FieldDecl *D) { // Update DataSize to include the last byte containing (part of) the bitfield. if (IsUnion) { // FIXME: I think FieldSize should be TypeSize here. - DataSize = std::max(DataSize, FieldSize); + setDataSize(std::max(getDataSizeInBits(), FieldSize)); } else { uint64_t NewSizeInBits = FieldOffset + FieldSize; - DataSize = llvm::RoundUpToAlignment(NewSizeInBits, 8); - UnfilledBitsInLastByte = DataSize - NewSizeInBits; + setDataSize(llvm::RoundUpToAlignment(NewSizeInBits, 8)); + UnfilledBitsInLastByte = getDataSizeInBits() - NewSizeInBits; } // Update the size. - Size = std::max(Size, DataSize); + setSize(std::max(getSizeInBits(), getDataSizeInBits())); // Remember max struct/class alignment. UpdateAlignment(Context.toCharUnitsFromBits(FieldAlign), @@ -1377,14 +1398,14 @@ void RecordLayoutBuilder::LayoutField(const FieldDecl *D) { return; } - uint64_t UnpaddedFieldOffset = DataSize - UnfilledBitsInLastByte; + uint64_t UnpaddedFieldOffset = getDataSizeInBits() - UnfilledBitsInLastByte; // Reset the unfilled bits. UnfilledBitsInLastByte = 0; bool FieldPacked = Packed || D->hasAttr<PackedAttr>(); CharUnits FieldOffset = - IsUnion ? CharUnits::Zero() : Context.toCharUnitsFromBits(DataSize); + IsUnion ? CharUnits::Zero() : getDataSize(); CharUnits FieldSize; CharUnits FieldAlign; @@ -1464,12 +1485,12 @@ void RecordLayoutBuilder::LayoutField(const FieldDecl *D) { // Reserve space for this field. uint64_t FieldSizeInBits = Context.toBits(FieldSize); if (IsUnion) - Size = std::max(Size, FieldSizeInBits); + setSize(std::max(getSizeInBits(), FieldSizeInBits)); else - Size = Context.toBits(FieldOffset) + FieldSizeInBits; + setSize(Context.toBits(FieldOffset) + FieldSizeInBits); // Update the data size. - DataSize = Size; + setDataSize(getSizeInBits()); // Remember max struct/class alignment. UpdateAlignment(FieldAlign, UnpackedFieldAlign); @@ -1477,29 +1498,30 @@ void RecordLayoutBuilder::LayoutField(const FieldDecl *D) { void RecordLayoutBuilder::FinishLayout(const NamedDecl *D) { // In C++, records cannot be of size 0. - if (Context.getLangOptions().CPlusPlus && Size == 0) { + if (Context.getLangOptions().CPlusPlus && getSizeInBits() == 0) { if (const CXXRecordDecl *RD = dyn_cast<CXXRecordDecl>(D)) { // Compatibility with gcc requires a class (pod or non-pod) // which is not empty but of size 0; such as having fields of // array of zero-length, remains of Size 0 if (RD->isEmpty()) - Size = 8; + setSize(8); } else - Size = 8; + setSize(8); } // Finally, round the size of the record up to the alignment of the // record itself. - uint64_t UnpaddedSize = Size - UnfilledBitsInLastByte; + uint64_t UnpaddedSize = getSizeInBits() - UnfilledBitsInLastByte; uint64_t UnpackedSize = - llvm::RoundUpToAlignment(Size, Context.toBits(UnpackedAlignment)); - Size = llvm::RoundUpToAlignment(Size, Context.toBits(Alignment)); + llvm::RoundUpToAlignment(getSizeInBits(), + Context.toBits(UnpackedAlignment)); + setSize(llvm::RoundUpToAlignment(getSizeInBits(), Context.toBits(Alignment))); unsigned CharBitNum = Context.Target.getCharWidth(); if (const RecordDecl *RD = dyn_cast<RecordDecl>(D)) { // Warn if padding was introduced to the struct/class/union. - if (Size > UnpaddedSize) { - unsigned PadSize = Size - UnpaddedSize; + if (getSizeInBits() > UnpaddedSize) { + unsigned PadSize = getSizeInBits() - UnpaddedSize; bool InBits = true; if (PadSize % CharBitNum == 0) { PadSize = PadSize / CharBitNum; @@ -1513,7 +1535,8 @@ void RecordLayoutBuilder::FinishLayout(const NamedDecl *D) { // Warn if we packed it unnecessarily. If the alignment is 1 byte don't // bother since there won't be alignment issues. - if (Packed && UnpackedAlignment > CharUnits::One() && Size == UnpackedSize) + if (Packed && UnpackedAlignment > CharUnits::One() && + getSizeInBits() == UnpackedSize) Diag(D->getLocation(), diag::warn_unnecessary_packed) << Context.getTypeDeclType(RD); } diff --git a/lib/AST/Stmt.cpp b/lib/AST/Stmt.cpp index 7e73f02e67e7..8a80275aa165 100644 --- a/lib/AST/Stmt.cpp +++ b/lib/AST/Stmt.cpp @@ -218,6 +218,10 @@ unsigned AsmStmt::getNumPlusOperands() const { Expr *AsmStmt::getInputExpr(unsigned i) { return cast<Expr>(Exprs[i + NumOutputs]); } +void AsmStmt::setInputExpr(unsigned i, Expr *E) { + Exprs[i + NumOutputs] = E; +} + /// getInputConstraint - Return the specified input constraint. Unlike output /// constraints, these can be empty. diff --git a/lib/AST/StmtDumper.cpp b/lib/AST/StmtDumper.cpp index 846bd4ce1441..5c7dbb3ed990 100644 --- a/lib/AST/StmtDumper.cpp +++ b/lib/AST/StmtDumper.cpp @@ -279,8 +279,8 @@ void StmtDumper::DumpDeclarator(Decl *D) { // print using decl (e.g. "using std::string;") const char *tn = UD->isTypeName() ? "typename " : ""; OS << '"' << UD->getDeclKindName() << tn; - UD->getTargetNestedNameDecl()->print(OS, - PrintingPolicy(UD->getASTContext().getLangOptions())); + UD->getQualifier()->print(OS, + PrintingPolicy(UD->getASTContext().getLangOptions())); OS << ";\""; } else if (LabelDecl *LD = dyn_cast<LabelDecl>(D)) { OS << "label " << LD->getNameAsString(); diff --git a/lib/AST/TemplateBase.cpp b/lib/AST/TemplateBase.cpp index 5ab5f4644c88..1764f4ab1f03 100644 --- a/lib/AST/TemplateBase.cpp +++ b/lib/AST/TemplateBase.cpp @@ -24,8 +24,6 @@ #include "llvm/ADT/FoldingSet.h" #include <algorithm> #include <cctype> -#include <iomanip> -#include <sstream> using namespace clang; @@ -42,17 +40,11 @@ static void printIntegral(const TemplateArgument &TemplArg, if (T->isBooleanType()) { Out << (Val->getBoolValue() ? "true" : "false"); } else if (T->isCharType()) { - char Ch = Val->getSExtValue(); - if (std::isprint(Ch)) { - Out << "'"; - if (Ch == '\'' || Ch == '\\') - Out << '\\'; - Out << Ch << "'"; - } else { - std::ostringstream Str; - Str << std::setw(2) << std::setfill('0') << std::hex << (int)Ch; - Out << "'\\x" << Str.str() << "'"; - } + const unsigned char Ch = Val->getZExtValue(); + const std::string Str(1, Ch); + Out << ((Ch == '\'') ? "'\\" : "'"); + Out.write_escaped(Str, /*UseHexEscapes=*/ true); + Out << "'"; } else { Out << Val->toString(10); } |